diff options
author | nkozlovskiy <nmk@ydb.tech> | 2023-09-29 12:24:06 +0300 |
---|---|---|
committer | nkozlovskiy <nmk@ydb.tech> | 2023-09-29 12:41:34 +0300 |
commit | e0e3e1717e3d33762ce61950504f9637a6e669ed (patch) | |
tree | bca3ff6939b10ed60c3d5c12439963a1146b9711 /contrib/tools/python/src/Lib/lib-tk | |
parent | 38f2c5852db84c7b4d83adfcb009eb61541d1ccd (diff) | |
download | ydb-e0e3e1717e3d33762ce61950504f9637a6e669ed.tar.gz |
add ydb deps
Diffstat (limited to 'contrib/tools/python/src/Lib/lib-tk')
34 files changed, 19915 insertions, 0 deletions
diff --git a/contrib/tools/python/src/Lib/lib-tk/Canvas.py b/contrib/tools/python/src/Lib/lib-tk/Canvas.py new file mode 100644 index 0000000000..34464ab979 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/Canvas.py @@ -0,0 +1,194 @@ +# This module exports classes for the various canvas item types + +# NOTE: This module was an experiment and is now obsolete. +# It's best to use the Tkinter.Canvas class directly. + +from warnings import warnpy3k +warnpy3k("the Canvas module has been removed in Python 3.0", stacklevel=2) +del warnpy3k + +from Tkinter import Canvas, _cnfmerge, _flatten + + +class CanvasItem: + def __init__(self, canvas, itemType, *args, **kw): + self.canvas = canvas + self.id = canvas._create(itemType, args, kw) + if not hasattr(canvas, 'items'): + canvas.items = {} + canvas.items[self.id] = self + def __str__(self): + return str(self.id) + def __repr__(self): + return '<%s, id=%d>' % (self.__class__.__name__, self.id) + def delete(self): + del self.canvas.items[self.id] + self.canvas.delete(self.id) + def __getitem__(self, key): + v = self.canvas.tk.split(self.canvas.tk.call( + self.canvas._w, 'itemconfigure', + self.id, '-' + key)) + return v[4] + cget = __getitem__ + def __setitem__(self, key, value): + self.canvas.itemconfig(self.id, {key: value}) + def keys(self): + if not hasattr(self, '_keys'): + self._keys = map(lambda x, tk=self.canvas.tk: + tk.splitlist(x)[0][1:], + self.canvas.tk.splitlist( + self.canvas._do( + 'itemconfigure', + (self.id,)))) + return self._keys + def has_key(self, key): + return key in self.keys() + def __contains__(self, key): + return key in self.keys() + def addtag(self, tag, option='withtag'): + self.canvas.addtag(tag, option, self.id) + def bbox(self): + x1, y1, x2, y2 = self.canvas.bbox(self.id) + return (x1, y1), (x2, y2) + def bind(self, sequence=None, command=None, add=None): + return self.canvas.tag_bind(self.id, sequence, command, add) + def unbind(self, sequence, funcid=None): + self.canvas.tag_unbind(self.id, sequence, funcid) + def config(self, cnf={}, **kw): + return self.canvas.itemconfig(self.id, _cnfmerge((cnf, kw))) + def coords(self, pts = ()): + flat = () + for x, y in pts: flat = flat + (x, y) + return self.canvas.coords(self.id, *flat) + def dchars(self, first, last=None): + self.canvas.dchars(self.id, first, last) + def dtag(self, ttd): + self.canvas.dtag(self.id, ttd) + def focus(self): + self.canvas.focus(self.id) + def gettags(self): + return self.canvas.gettags(self.id) + def icursor(self, index): + self.canvas.icursor(self.id, index) + def index(self, index): + return self.canvas.index(self.id, index) + def insert(self, beforethis, string): + self.canvas.insert(self.id, beforethis, string) + def lower(self, belowthis=None): + self.canvas.tag_lower(self.id, belowthis) + def move(self, xamount, yamount): + self.canvas.move(self.id, xamount, yamount) + def tkraise(self, abovethis=None): + self.canvas.tag_raise(self.id, abovethis) + raise_ = tkraise # BW compat + def scale(self, xorigin, yorigin, xscale, yscale): + self.canvas.scale(self.id, xorigin, yorigin, xscale, yscale) + def type(self): + return self.canvas.type(self.id) + +class Arc(CanvasItem): + def __init__(self, canvas, *args, **kw): + CanvasItem.__init__(self, canvas, 'arc', *args, **kw) + +class Bitmap(CanvasItem): + def __init__(self, canvas, *args, **kw): + CanvasItem.__init__(self, canvas, 'bitmap', *args, **kw) + +class ImageItem(CanvasItem): + def __init__(self, canvas, *args, **kw): + CanvasItem.__init__(self, canvas, 'image', *args, **kw) + +class Line(CanvasItem): + def __init__(self, canvas, *args, **kw): + CanvasItem.__init__(self, canvas, 'line', *args, **kw) + +class Oval(CanvasItem): + def __init__(self, canvas, *args, **kw): + CanvasItem.__init__(self, canvas, 'oval', *args, **kw) + +class Polygon(CanvasItem): + def __init__(self, canvas, *args, **kw): + CanvasItem.__init__(self, canvas, 'polygon', *args, **kw) + +class Rectangle(CanvasItem): + def __init__(self, canvas, *args, **kw): + CanvasItem.__init__(self, canvas, 'rectangle', *args, **kw) + +# XXX "Text" is taken by the Text widget... +class CanvasText(CanvasItem): + def __init__(self, canvas, *args, **kw): + CanvasItem.__init__(self, canvas, 'text', *args, **kw) + +class Window(CanvasItem): + def __init__(self, canvas, *args, **kw): + CanvasItem.__init__(self, canvas, 'window', *args, **kw) + +class Group: + def __init__(self, canvas, tag=None): + if not tag: + tag = 'Group%d' % id(self) + self.tag = self.id = tag + self.canvas = canvas + self.canvas.dtag(self.tag) + def str(self): + return self.tag + __str__ = str + def _do(self, cmd, *args): + return self.canvas._do(cmd, (self.tag,) + _flatten(args)) + def addtag_above(self, tagOrId): + self._do('addtag', 'above', tagOrId) + def addtag_all(self): + self._do('addtag', 'all') + def addtag_below(self, tagOrId): + self._do('addtag', 'below', tagOrId) + def addtag_closest(self, x, y, halo=None, start=None): + self._do('addtag', 'closest', x, y, halo, start) + def addtag_enclosed(self, x1, y1, x2, y2): + self._do('addtag', 'enclosed', x1, y1, x2, y2) + def addtag_overlapping(self, x1, y1, x2, y2): + self._do('addtag', 'overlapping', x1, y1, x2, y2) + def addtag_withtag(self, tagOrId): + self._do('addtag', 'withtag', tagOrId) + def bbox(self): + return self.canvas._getints(self._do('bbox')) + def bind(self, sequence=None, command=None, add=None): + return self.canvas.tag_bind(self.id, sequence, command, add) + def unbind(self, sequence, funcid=None): + self.canvas.tag_unbind(self.id, sequence, funcid) + def coords(self, *pts): + return self._do('coords', pts) + def dchars(self, first, last=None): + self._do('dchars', first, last) + def delete(self): + self._do('delete') + def dtag(self, tagToDelete=None): + self._do('dtag', tagToDelete) + def focus(self): + self._do('focus') + def gettags(self): + return self.canvas.tk.splitlist(self._do('gettags', self.tag)) + def icursor(self, index): + return self._do('icursor', index) + def index(self, index): + return self.canvas.tk.getint(self._do('index', index)) + def insert(self, beforeThis, string): + self._do('insert', beforeThis, string) + def config(self, cnf={}, **kw): + return self.canvas.itemconfigure(self.tag, _cnfmerge((cnf,kw))) + def lower(self, belowThis=None): + self._do('lower', belowThis) + def move(self, xAmount, yAmount): + self._do('move', xAmount, yAmount) + def tkraise(self, aboveThis=None): + self._do('raise', aboveThis) + lift = tkraise + def scale(self, xOrigin, yOrigin, xScale, yScale): + self._do('scale', xOrigin, yOrigin, xScale, yScale) + def select_adjust(self, index): + self.canvas._do('select', ('adjust', self.tag, index)) + def select_from(self, index): + self.canvas._do('select', ('from', self.tag, index)) + def select_to(self, index): + self.canvas._do('select', ('to', self.tag, index)) + def type(self): + return self._do('type') diff --git a/contrib/tools/python/src/Lib/lib-tk/Dialog.py b/contrib/tools/python/src/Lib/lib-tk/Dialog.py new file mode 100644 index 0000000000..2d089593ba --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/Dialog.py @@ -0,0 +1,49 @@ +# dialog.py -- Tkinter interface to the tk_dialog script. + +from Tkinter import * +from Tkinter import _cnfmerge + +if TkVersion <= 3.6: + DIALOG_ICON = 'warning' +else: + DIALOG_ICON = 'questhead' + + +class Dialog(Widget): + def __init__(self, master=None, cnf={}, **kw): + cnf = _cnfmerge((cnf, kw)) + self.widgetName = '__dialog__' + Widget._setup(self, master, cnf) + self.num = self.tk.getint( + self.tk.call( + 'tk_dialog', self._w, + cnf['title'], cnf['text'], + cnf['bitmap'], cnf['default'], + *cnf['strings'])) + try: Widget.destroy(self) + except TclError: pass + def destroy(self): pass + +def _test(): + d = Dialog(None, {'title': 'File Modified', + 'text': + 'File "Python.h" has been modified' + ' since the last time it was saved.' + ' Do you want to save it before' + ' exiting the application.', + 'bitmap': DIALOG_ICON, + 'default': 0, + 'strings': ('Save File', + 'Discard Changes', + 'Return to Editor')}) + print d.num + + +if __name__ == '__main__': + t = Button(None, {'text': 'Test', + 'command': _test, + Pack: {}}) + q = Button(None, {'text': 'Quit', + 'command': t.quit, + Pack: {}}) + t.mainloop() diff --git a/contrib/tools/python/src/Lib/lib-tk/FileDialog.py b/contrib/tools/python/src/Lib/lib-tk/FileDialog.py new file mode 100644 index 0000000000..06ce2b9229 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/FileDialog.py @@ -0,0 +1,274 @@ +"""File selection dialog classes. + +Classes: + +- FileDialog +- LoadFileDialog +- SaveFileDialog + +""" + +from Tkinter import * +from Dialog import Dialog + +import os +import fnmatch + + +dialogstates = {} + + +class FileDialog: + + """Standard file selection dialog -- no checks on selected file. + + Usage: + + d = FileDialog(master) + fname = d.go(dir_or_file, pattern, default, key) + if fname is None: ...canceled... + else: ...open file... + + All arguments to go() are optional. + + The 'key' argument specifies a key in the global dictionary + 'dialogstates', which keeps track of the values for the directory + and pattern arguments, overriding the values passed in (it does + not keep track of the default argument!). If no key is specified, + the dialog keeps no memory of previous state. Note that memory is + kept even when the dialog is canceled. (All this emulates the + behavior of the Macintosh file selection dialogs.) + + """ + + title = "File Selection Dialog" + + def __init__(self, master, title=None): + if title is None: title = self.title + self.master = master + self.directory = None + + self.top = Toplevel(master) + self.top.title(title) + self.top.iconname(title) + + self.botframe = Frame(self.top) + self.botframe.pack(side=BOTTOM, fill=X) + + self.selection = Entry(self.top) + self.selection.pack(side=BOTTOM, fill=X) + self.selection.bind('<Return>', self.ok_event) + + self.filter = Entry(self.top) + self.filter.pack(side=TOP, fill=X) + self.filter.bind('<Return>', self.filter_command) + + self.midframe = Frame(self.top) + self.midframe.pack(expand=YES, fill=BOTH) + + self.filesbar = Scrollbar(self.midframe) + self.filesbar.pack(side=RIGHT, fill=Y) + self.files = Listbox(self.midframe, exportselection=0, + yscrollcommand=(self.filesbar, 'set')) + self.files.pack(side=RIGHT, expand=YES, fill=BOTH) + btags = self.files.bindtags() + self.files.bindtags(btags[1:] + btags[:1]) + self.files.bind('<ButtonRelease-1>', self.files_select_event) + self.files.bind('<Double-ButtonRelease-1>', self.files_double_event) + self.filesbar.config(command=(self.files, 'yview')) + + self.dirsbar = Scrollbar(self.midframe) + self.dirsbar.pack(side=LEFT, fill=Y) + self.dirs = Listbox(self.midframe, exportselection=0, + yscrollcommand=(self.dirsbar, 'set')) + self.dirs.pack(side=LEFT, expand=YES, fill=BOTH) + self.dirsbar.config(command=(self.dirs, 'yview')) + btags = self.dirs.bindtags() + self.dirs.bindtags(btags[1:] + btags[:1]) + self.dirs.bind('<ButtonRelease-1>', self.dirs_select_event) + self.dirs.bind('<Double-ButtonRelease-1>', self.dirs_double_event) + + self.ok_button = Button(self.botframe, + text="OK", + command=self.ok_command) + self.ok_button.pack(side=LEFT) + self.filter_button = Button(self.botframe, + text="Filter", + command=self.filter_command) + self.filter_button.pack(side=LEFT, expand=YES) + self.cancel_button = Button(self.botframe, + text="Cancel", + command=self.cancel_command) + self.cancel_button.pack(side=RIGHT) + + self.top.protocol('WM_DELETE_WINDOW', self.cancel_command) + # XXX Are the following okay for a general audience? + self.top.bind('<Alt-w>', self.cancel_command) + self.top.bind('<Alt-W>', self.cancel_command) + + def go(self, dir_or_file=os.curdir, pattern="*", default="", key=None): + if key and key in dialogstates: + self.directory, pattern = dialogstates[key] + else: + dir_or_file = os.path.expanduser(dir_or_file) + if os.path.isdir(dir_or_file): + self.directory = dir_or_file + else: + self.directory, default = os.path.split(dir_or_file) + self.set_filter(self.directory, pattern) + self.set_selection(default) + self.filter_command() + self.selection.focus_set() + self.top.wait_visibility() # window needs to be visible for the grab + self.top.grab_set() + self.how = None + self.master.mainloop() # Exited by self.quit(how) + if key: + directory, pattern = self.get_filter() + if self.how: + directory = os.path.dirname(self.how) + dialogstates[key] = directory, pattern + self.top.destroy() + return self.how + + def quit(self, how=None): + self.how = how + self.master.quit() # Exit mainloop() + + def dirs_double_event(self, event): + self.filter_command() + + def dirs_select_event(self, event): + dir, pat = self.get_filter() + subdir = self.dirs.get('active') + dir = os.path.normpath(os.path.join(self.directory, subdir)) + self.set_filter(dir, pat) + + def files_double_event(self, event): + self.ok_command() + + def files_select_event(self, event): + file = self.files.get('active') + self.set_selection(file) + + def ok_event(self, event): + self.ok_command() + + def ok_command(self): + self.quit(self.get_selection()) + + def filter_command(self, event=None): + dir, pat = self.get_filter() + try: + names = os.listdir(dir) + except os.error: + self.master.bell() + return + self.directory = dir + self.set_filter(dir, pat) + names.sort() + subdirs = [os.pardir] + matchingfiles = [] + for name in names: + fullname = os.path.join(dir, name) + if os.path.isdir(fullname): + subdirs.append(name) + elif fnmatch.fnmatch(name, pat): + matchingfiles.append(name) + self.dirs.delete(0, END) + for name in subdirs: + self.dirs.insert(END, name) + self.files.delete(0, END) + for name in matchingfiles: + self.files.insert(END, name) + head, tail = os.path.split(self.get_selection()) + if tail == os.curdir: tail = '' + self.set_selection(tail) + + def get_filter(self): + filter = self.filter.get() + filter = os.path.expanduser(filter) + if filter[-1:] == os.sep or os.path.isdir(filter): + filter = os.path.join(filter, "*") + return os.path.split(filter) + + def get_selection(self): + file = self.selection.get() + file = os.path.expanduser(file) + return file + + def cancel_command(self, event=None): + self.quit() + + def set_filter(self, dir, pat): + if not os.path.isabs(dir): + try: + pwd = os.getcwd() + except os.error: + pwd = None + if pwd: + dir = os.path.join(pwd, dir) + dir = os.path.normpath(dir) + self.filter.delete(0, END) + self.filter.insert(END, os.path.join(dir or os.curdir, pat or "*")) + + def set_selection(self, file): + self.selection.delete(0, END) + self.selection.insert(END, os.path.join(self.directory, file)) + + +class LoadFileDialog(FileDialog): + + """File selection dialog which checks that the file exists.""" + + title = "Load File Selection Dialog" + + def ok_command(self): + file = self.get_selection() + if not os.path.isfile(file): + self.master.bell() + else: + self.quit(file) + + +class SaveFileDialog(FileDialog): + + """File selection dialog which checks that the file may be created.""" + + title = "Save File Selection Dialog" + + def ok_command(self): + file = self.get_selection() + if os.path.exists(file): + if os.path.isdir(file): + self.master.bell() + return + d = Dialog(self.top, + title="Overwrite Existing File Question", + text="Overwrite existing file %r?" % (file,), + bitmap='questhead', + default=1, + strings=("Yes", "Cancel")) + if d.num != 0: + return + else: + head, tail = os.path.split(file) + if not os.path.isdir(head): + self.master.bell() + return + self.quit(file) + + +def test(): + """Simple test program.""" + root = Tk() + root.withdraw() + fd = LoadFileDialog(root) + loadfile = fd.go(key="test") + fd = SaveFileDialog(root) + savefile = fd.go(key="test") + print loadfile, savefile + + +if __name__ == '__main__': + test() diff --git a/contrib/tools/python/src/Lib/lib-tk/FixTk.py b/contrib/tools/python/src/Lib/lib-tk/FixTk.py new file mode 100644 index 0000000000..8af27b5826 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/FixTk.py @@ -0,0 +1,81 @@ +import sys, os + +# Delay import _tkinter until we have set TCL_LIBRARY, +# so that Tcl_FindExecutable has a chance to locate its +# encoding directory. + +# Unfortunately, we cannot know the TCL_LIBRARY directory +# if we don't know the tcl version, which we cannot find out +# without import Tcl. Fortunately, Tcl will itself look in +# <TCL_LIBRARY>\..\tcl<TCL_VERSION>, so anything close to +# the real Tcl library will do. + +# Expand symbolic links on Vista +try: + import ctypes + ctypes.windll.kernel32.GetFinalPathNameByHandleW +except (ImportError, AttributeError): + def convert_path(s): + return s +else: + def convert_path(s): + assert isinstance(s, str) # sys.prefix contains only bytes + udir = s.decode("mbcs") + hdir = ctypes.windll.kernel32.\ + CreateFileW(udir, 0x80, # FILE_READ_ATTRIBUTES + 1, # FILE_SHARE_READ + None, 3, # OPEN_EXISTING + 0x02000000, # FILE_FLAG_BACKUP_SEMANTICS + None) + if hdir == -1: + # Cannot open directory, give up + return s + buf = ctypes.create_unicode_buffer(u"", 32768) + res = ctypes.windll.kernel32.\ + GetFinalPathNameByHandleW(hdir, buf, len(buf), + 0) # VOLUME_NAME_DOS + ctypes.windll.kernel32.CloseHandle(hdir) + if res == 0: + # Conversion failed (e.g. network location) + return s + s = buf[:res].encode("mbcs") + # Ignore leading \\?\ + if s.startswith("\\\\?\\"): + s = s[4:] + if s.startswith("UNC"): + s = "\\" + s[3:] + return s + +prefix = os.path.join(sys.prefix,"tcl") +if not os.path.exists(prefix): + # devdir/externals/tcltk/lib + tcltk = 'tcltk' + if sys.maxsize > 2**31 - 1: + tcltk = 'tcltk64' + prefix = os.path.join(sys.prefix, "externals", tcltk, "lib") + prefix = os.path.abspath(prefix) +# if this does not exist, no further search is needed +if os.path.exists(prefix): + prefix = convert_path(prefix) + if "TCL_LIBRARY" not in os.environ: + for name in os.listdir(prefix): + if name.startswith("tcl"): + tcldir = os.path.join(prefix,name) + if os.path.isdir(tcldir): + os.environ["TCL_LIBRARY"] = tcldir + # Compute TK_LIBRARY, knowing that it has the same version + # as Tcl + import _tkinter + ver = str(_tkinter.TCL_VERSION) + if "TK_LIBRARY" not in os.environ: + v = os.path.join(prefix, 'tk'+ver) + if os.path.exists(os.path.join(v, "tclIndex")): + os.environ['TK_LIBRARY'] = v + # We don't know the Tix version, so we must search the entire + # directory + if "TIX_LIBRARY" not in os.environ: + for name in os.listdir(prefix): + if name.startswith("tix"): + tixdir = os.path.join(prefix,name) + if os.path.isdir(tixdir): + os.environ["TIX_LIBRARY"] = tixdir diff --git a/contrib/tools/python/src/Lib/lib-tk/ScrolledText.py b/contrib/tools/python/src/Lib/lib-tk/ScrolledText.py new file mode 100644 index 0000000000..a1ef79ca74 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/ScrolledText.py @@ -0,0 +1,55 @@ +"""A ScrolledText widget feels like a text widget but also has a +vertical scroll bar on its right. (Later, options may be added to +add a horizontal bar as well, to make the bars disappear +automatically when not needed, to move them to the other side of the +window, etc.) + +Configuration options are passed to the Text widget. +A Frame widget is inserted between the master and the text, to hold +the Scrollbar widget. +Most methods calls are inherited from the Text widget; Pack, Grid and +Place methods are redirected to the Frame widget however. +""" + +__all__ = ['ScrolledText'] + +from Tkinter import Frame, Text, Scrollbar, Pack, Grid, Place +from Tkconstants import RIGHT, LEFT, Y, BOTH + +class ScrolledText(Text): + def __init__(self, master=None, **kw): + self.frame = Frame(master) + self.vbar = Scrollbar(self.frame) + self.vbar.pack(side=RIGHT, fill=Y) + + kw.update({'yscrollcommand': self.vbar.set}) + Text.__init__(self, self.frame, **kw) + self.pack(side=LEFT, fill=BOTH, expand=True) + self.vbar['command'] = self.yview + + # Copy geometry methods of self.frame without overriding Text + # methods -- hack! + text_meths = vars(Text).keys() + methods = vars(Pack).keys() + vars(Grid).keys() + vars(Place).keys() + methods = set(methods).difference(text_meths) + + for m in methods: + if m[0] != '_' and m != 'config' and m != 'configure': + setattr(self, m, getattr(self.frame, m)) + + def __str__(self): + return str(self.frame) + + +def example(): + import __main__ + from Tkconstants import END + + stext = ScrolledText(bg='white', height=10) + stext.insert(END, __main__.__doc__) + stext.pack(fill=BOTH, side=LEFT, expand=True) + stext.focus_set() + stext.mainloop() + +if __name__ == "__main__": + example() diff --git a/contrib/tools/python/src/Lib/lib-tk/SimpleDialog.py b/contrib/tools/python/src/Lib/lib-tk/SimpleDialog.py new file mode 100644 index 0000000000..cb08318dbd --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/SimpleDialog.py @@ -0,0 +1,112 @@ +"""A simple but flexible modal dialog box.""" + + +from Tkinter import * + + +class SimpleDialog: + + def __init__(self, master, + text='', buttons=[], default=None, cancel=None, + title=None, class_=None): + if class_: + self.root = Toplevel(master, class_=class_) + else: + self.root = Toplevel(master) + if title: + self.root.title(title) + self.root.iconname(title) + self.message = Message(self.root, text=text, aspect=400) + self.message.pack(expand=1, fill=BOTH) + self.frame = Frame(self.root) + self.frame.pack() + self.num = default + self.cancel = cancel + self.default = default + self.root.bind('<Return>', self.return_event) + for num in range(len(buttons)): + s = buttons[num] + b = Button(self.frame, text=s, + command=(lambda self=self, num=num: self.done(num))) + if num == default: + b.config(relief=RIDGE, borderwidth=8) + b.pack(side=LEFT, fill=BOTH, expand=1) + self.root.protocol('WM_DELETE_WINDOW', self.wm_delete_window) + self._set_transient(master) + + def _set_transient(self, master, relx=0.5, rely=0.3): + widget = self.root + widget.withdraw() # Remain invisible while we figure out the geometry + widget.transient(master) + widget.update_idletasks() # Actualize geometry information + if master.winfo_ismapped(): + m_width = master.winfo_width() + m_height = master.winfo_height() + m_x = master.winfo_rootx() + m_y = master.winfo_rooty() + else: + m_width = master.winfo_screenwidth() + m_height = master.winfo_screenheight() + m_x = m_y = 0 + w_width = widget.winfo_reqwidth() + w_height = widget.winfo_reqheight() + x = m_x + (m_width - w_width) * relx + y = m_y + (m_height - w_height) * rely + if x+w_width > master.winfo_screenwidth(): + x = master.winfo_screenwidth() - w_width + elif x < 0: + x = 0 + if y+w_height > master.winfo_screenheight(): + y = master.winfo_screenheight() - w_height + elif y < 0: + y = 0 + widget.geometry("+%d+%d" % (x, y)) + widget.deiconify() # Become visible at the desired location + + def go(self): + self.root.wait_visibility() + self.root.grab_set() + self.root.mainloop() + self.root.destroy() + return self.num + + def return_event(self, event): + if self.default is None: + self.root.bell() + else: + self.done(self.default) + + def wm_delete_window(self): + if self.cancel is None: + self.root.bell() + else: + self.done(self.cancel) + + def done(self, num): + self.num = num + self.root.quit() + + +if __name__ == '__main__': + + def test(): + root = Tk() + def doit(root=root): + d = SimpleDialog(root, + text="This is a test dialog. " + "Would this have been an actual dialog, " + "the buttons below would have been glowing " + "in soft pink light.\n" + "Do you believe this?", + buttons=["Yes", "No", "Cancel"], + default=0, + cancel=2, + title="Test Dialog") + print d.go() + t = Button(root, text='Test', command=doit) + t.pack() + q = Button(root, text='Quit', command=t.quit) + q.pack() + t.mainloop() + + test() diff --git a/contrib/tools/python/src/Lib/lib-tk/Tix.py b/contrib/tools/python/src/Lib/lib-tk/Tix.py new file mode 100644 index 0000000000..d0f8fe750c --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/Tix.py @@ -0,0 +1,1950 @@ +# Tix.py -- Tix widget wrappers. +# +# For Tix, see http://tix.sourceforge.net +# +# - Sudhir Shenoy (sshenoy@gol.com), Dec. 1995. +# based on an idea of Jean-Marc Lugrin (lugrin@ms.com) +# +# NOTE: In order to minimize changes to Tkinter.py, some of the code here +# (TixWidget.__init__) has been taken from Tkinter (Widget.__init__) +# and will break if there are major changes in Tkinter. +# +# The Tix widgets are represented by a class hierarchy in python with proper +# inheritance of base classes. +# +# As a result after creating a 'w = StdButtonBox', I can write +# w.ok['text'] = 'Who Cares' +# or w.ok['bg'] = w['bg'] +# or even w.ok.invoke() +# etc. +# +# Compare the demo tixwidgets.py to the original Tcl program and you will +# appreciate the advantages. +# + +import os +import Tkinter +from Tkinter import * +from Tkinter import _flatten, _cnfmerge + +# WARNING - TkVersion is a limited precision floating point number +if TkVersion < 3.999: + raise ImportError, "This version of Tix.py requires Tk 4.0 or higher" + +import _tkinter # If this fails your Python may not be configured for Tk + +# Some more constants (for consistency with Tkinter) +WINDOW = 'window' +TEXT = 'text' +STATUS = 'status' +IMMEDIATE = 'immediate' +IMAGE = 'image' +IMAGETEXT = 'imagetext' +BALLOON = 'balloon' +AUTO = 'auto' +ACROSSTOP = 'acrosstop' + +# A few useful constants for the Grid widget +ASCII = 'ascii' +CELL = 'cell' +COLUMN = 'column' +DECREASING = 'decreasing' +INCREASING = 'increasing' +INTEGER = 'integer' +MAIN = 'main' +MAX = 'max' +REAL = 'real' +ROW = 'row' +S_REGION = 's-region' +X_REGION = 'x-region' +Y_REGION = 'y-region' + +# Some constants used by Tkinter dooneevent() +TCL_DONT_WAIT = 1 << 1 +TCL_WINDOW_EVENTS = 1 << 2 +TCL_FILE_EVENTS = 1 << 3 +TCL_TIMER_EVENTS = 1 << 4 +TCL_IDLE_EVENTS = 1 << 5 +TCL_ALL_EVENTS = 0 + +# BEWARE - this is implemented by copying some code from the Widget class +# in Tkinter (to override Widget initialization) and is therefore +# liable to break. + +# Could probably add this to Tkinter.Misc +class tixCommand: + """The tix commands provide access to miscellaneous elements + of Tix's internal state and the Tix application context. + Most of the information manipulated by these commands pertains + to the application as a whole, or to a screen or + display, rather than to a particular window. + + This is a mixin class, assumed to be mixed to Tkinter.Tk + that supports the self.tk.call method. + """ + + def tix_addbitmapdir(self, directory): + """Tix maintains a list of directories under which + the tix_getimage and tix_getbitmap commands will + search for image files. The standard bitmap directory + is $TIX_LIBRARY/bitmaps. The addbitmapdir command + adds directory into this list. By using this + command, the image files of an applications can + also be located using the tix_getimage or tix_getbitmap + command. + """ + return self.tk.call('tix', 'addbitmapdir', directory) + + def tix_cget(self, option): + """Returns the current value of the configuration + option given by option. Option may be any of the + options described in the CONFIGURATION OPTIONS section. + """ + return self.tk.call('tix', 'cget', option) + + def tix_configure(self, cnf=None, **kw): + """Query or modify the configuration options of the Tix application + context. If no option is specified, returns a dictionary all of the + available options. If option is specified with no value, then the + command returns a list describing the one named option (this list + will be identical to the corresponding sublist of the value + returned if no option is specified). If one or more option-value + pairs are specified, then the command modifies the given option(s) + to have the given value(s); in this case the command returns an + empty string. Option may be any of the configuration options. + """ + # Copied from Tkinter.py + if kw: + cnf = _cnfmerge((cnf, kw)) + elif cnf: + cnf = _cnfmerge(cnf) + if cnf is None: + return self._getconfigure('tix', 'configure') + if isinstance(cnf, StringType): + return self._getconfigure1('tix', 'configure', '-'+cnf) + return self.tk.call(('tix', 'configure') + self._options(cnf)) + + def tix_filedialog(self, dlgclass=None): + """Returns the file selection dialog that may be shared among + different calls from this application. This command will create a + file selection dialog widget when it is called the first time. This + dialog will be returned by all subsequent calls to tix_filedialog. + An optional dlgclass parameter can be passed to specified what type + of file selection dialog widget is desired. Possible options are + tix FileSelectDialog or tixExFileSelectDialog. + """ + if dlgclass is not None: + return self.tk.call('tix', 'filedialog', dlgclass) + else: + return self.tk.call('tix', 'filedialog') + + def tix_getbitmap(self, name): + """Locates a bitmap file of the name name.xpm or name in one of the + bitmap directories (see the tix_addbitmapdir command above). By + using tix_getbitmap, you can avoid hard coding the pathnames of the + bitmap files in your application. When successful, it returns the + complete pathname of the bitmap file, prefixed with the character + '@'. The returned value can be used to configure the -bitmap + option of the TK and Tix widgets. + """ + return self.tk.call('tix', 'getbitmap', name) + + def tix_getimage(self, name): + """Locates an image file of the name name.xpm, name.xbm or name.ppm + in one of the bitmap directories (see the addbitmapdir command + above). If more than one file with the same name (but different + extensions) exist, then the image type is chosen according to the + depth of the X display: xbm images are chosen on monochrome + displays and color images are chosen on color displays. By using + tix_ getimage, you can avoid hard coding the pathnames of the + image files in your application. When successful, this command + returns the name of the newly created image, which can be used to + configure the -image option of the Tk and Tix widgets. + """ + return self.tk.call('tix', 'getimage', name) + + def tix_option_get(self, name): + """Gets the options maintained by the Tix + scheme mechanism. Available options include: + + active_bg active_fg bg + bold_font dark1_bg dark1_fg + dark2_bg dark2_fg disabled_fg + fg fixed_font font + inactive_bg inactive_fg input1_bg + input2_bg italic_font light1_bg + light1_fg light2_bg light2_fg + menu_font output1_bg output2_bg + select_bg select_fg selector + """ + # could use self.tk.globalgetvar('tixOption', name) + return self.tk.call('tix', 'option', 'get', name) + + def tix_resetoptions(self, newScheme, newFontSet, newScmPrio=None): + """Resets the scheme and fontset of the Tix application to + newScheme and newFontSet, respectively. This affects only those + widgets created after this call. Therefore, it is best to call the + resetoptions command before the creation of any widgets in a Tix + application. + + The optional parameter newScmPrio can be given to reset the + priority level of the Tk options set by the Tix schemes. + + Because of the way Tk handles the X option database, after Tix has + been has imported and inited, it is not possible to reset the color + schemes and font sets using the tix config command. Instead, the + tix_resetoptions command must be used. + """ + if newScmPrio is not None: + return self.tk.call('tix', 'resetoptions', newScheme, newFontSet, newScmPrio) + else: + return self.tk.call('tix', 'resetoptions', newScheme, newFontSet) + +class Tk(Tkinter.Tk, tixCommand): + """Toplevel widget of Tix which represents mostly the main window + of an application. It has an associated Tcl interpreter.""" + def __init__(self, screenName=None, baseName=None, className='Tix'): + Tkinter.Tk.__init__(self, screenName, baseName, className) + tixlib = os.environ.get('TIX_LIBRARY') + self.tk.eval('global auto_path; lappend auto_path [file dir [info nameof]]') + if tixlib is not None: + self.tk.eval('global auto_path; lappend auto_path {%s}' % tixlib) + self.tk.eval('global tcl_pkgPath; lappend tcl_pkgPath {%s}' % tixlib) + # Load Tix - this should work dynamically or statically + # If it's static, tcl/tix8.1/pkgIndex.tcl should have + # 'load {} Tix' + # If it's dynamic under Unix, tcl/tix8.1/pkgIndex.tcl should have + # 'load libtix8.1.8.3.so Tix' + self.tk.eval('package require Tix') + + def destroy(self): + # For safety, remove the delete_window binding before destroy + self.protocol("WM_DELETE_WINDOW", "") + Tkinter.Tk.destroy(self) + +# The Tix 'tixForm' geometry manager +class Form: + """The Tix Form geometry manager + + Widgets can be arranged by specifying attachments to other widgets. + See Tix documentation for complete details""" + + def config(self, cnf={}, **kw): + self.tk.call('tixForm', self._w, *self._options(cnf, kw)) + + form = config + + def __setitem__(self, key, value): + Form.form(self, {key: value}) + + def check(self): + return self.tk.call('tixForm', 'check', self._w) + + def forget(self): + self.tk.call('tixForm', 'forget', self._w) + + def grid(self, xsize=0, ysize=0): + if (not xsize) and (not ysize): + x = self.tk.call('tixForm', 'grid', self._w) + y = self.tk.splitlist(x) + z = () + for x in y: + z = z + (self.tk.getint(x),) + return z + return self.tk.call('tixForm', 'grid', self._w, xsize, ysize) + + def info(self, option=None): + if not option: + return self.tk.call('tixForm', 'info', self._w) + if option[0] != '-': + option = '-' + option + return self.tk.call('tixForm', 'info', self._w, option) + + def slaves(self): + return map(self._nametowidget, + self.tk.splitlist( + self.tk.call( + 'tixForm', 'slaves', self._w))) + + + +Tkinter.Widget.__bases__ = Tkinter.Widget.__bases__ + (Form,) + +class TixWidget(Tkinter.Widget): + """A TixWidget class is used to package all (or most) Tix widgets. + + Widget initialization is extended in two ways: + 1) It is possible to give a list of options which must be part of + the creation command (so called Tix 'static' options). These cannot be + given as a 'config' command later. + 2) It is possible to give the name of an existing TK widget. These are + child widgets created automatically by a Tix mega-widget. The Tk call + to create these widgets is therefore bypassed in TixWidget.__init__ + + Both options are for use by subclasses only. + """ + def __init__ (self, master=None, widgetName=None, + static_options=None, cnf={}, kw={}): + # Merge keywords and dictionary arguments + if kw: + cnf = _cnfmerge((cnf, kw)) + else: + cnf = _cnfmerge(cnf) + + # Move static options into extra. static_options must be + # a list of keywords (or None). + extra=() + + # 'options' is always a static option + if static_options: + static_options.append('options') + else: + static_options = ['options'] + + for k,v in cnf.items()[:]: + if k in static_options: + extra = extra + ('-' + k, v) + del cnf[k] + + self.widgetName = widgetName + Widget._setup(self, master, cnf) + + # If widgetName is None, this is a dummy creation call where the + # corresponding Tk widget has already been created by Tix + if widgetName: + self.tk.call(widgetName, self._w, *extra) + + # Non-static options - to be done via a 'config' command + if cnf: + Widget.config(self, cnf) + + # Dictionary to hold subwidget names for easier access. We can't + # use the children list because the public Tix names may not be the + # same as the pathname component + self.subwidget_list = {} + + # We set up an attribute access function so that it is possible to + # do w.ok['text'] = 'Hello' rather than w.subwidget('ok')['text'] = 'Hello' + # when w is a StdButtonBox. + # We can even do w.ok.invoke() because w.ok is subclassed from the + # Button class if you go through the proper constructors + def __getattr__(self, name): + if name in self.subwidget_list: + return self.subwidget_list[name] + raise AttributeError, name + + def set_silent(self, value): + """Set a variable without calling its action routine""" + self.tk.call('tixSetSilent', self._w, value) + + def subwidget(self, name): + """Return the named subwidget (which must have been created by + the sub-class).""" + n = self._subwidget_name(name) + if not n: + raise TclError, "Subwidget " + name + " not child of " + self._name + # Remove header of name and leading dot + n = n[len(self._w)+1:] + return self._nametowidget(n) + + def subwidgets_all(self): + """Return all subwidgets.""" + names = self._subwidget_names() + if not names: + return [] + retlist = [] + for name in names: + name = name[len(self._w)+1:] + try: + retlist.append(self._nametowidget(name)) + except: + # some of the widgets are unknown e.g. border in LabelFrame + pass + return retlist + + def _subwidget_name(self,name): + """Get a subwidget name (returns a String, not a Widget !)""" + try: + return self.tk.call(self._w, 'subwidget', name) + except TclError: + return None + + def _subwidget_names(self): + """Return the name of all subwidgets.""" + try: + x = self.tk.call(self._w, 'subwidgets', '-all') + return self.tk.splitlist(x) + except TclError: + return None + + def config_all(self, option, value): + """Set configuration options for all subwidgets (and self).""" + if option == '': + return + elif not isinstance(option, StringType): + option = repr(option) + if not isinstance(value, StringType): + value = repr(value) + names = self._subwidget_names() + for name in names: + self.tk.call(name, 'configure', '-' + option, value) + # These are missing from Tkinter + def image_create(self, imgtype, cnf={}, master=None, **kw): + if not master: + master = Tkinter._default_root + if not master: + raise RuntimeError, 'Too early to create image' + if kw and cnf: cnf = _cnfmerge((cnf, kw)) + elif kw: cnf = kw + options = () + for k, v in cnf.items(): + if hasattr(v, '__call__'): + v = self._register(v) + options = options + ('-'+k, v) + return master.tk.call(('image', 'create', imgtype,) + options) + def image_delete(self, imgname): + try: + self.tk.call('image', 'delete', imgname) + except TclError: + # May happen if the root was destroyed + pass + +# Subwidgets are child widgets created automatically by mega-widgets. +# In python, we have to create these subwidgets manually to mirror their +# existence in Tk/Tix. +class TixSubWidget(TixWidget): + """Subwidget class. + + This is used to mirror child widgets automatically created + by Tix/Tk as part of a mega-widget in Python (which is not informed + of this)""" + + def __init__(self, master, name, + destroy_physically=1, check_intermediate=1): + if check_intermediate: + path = master._subwidget_name(name) + try: + path = path[len(master._w)+1:] + plist = path.split('.') + except: + plist = [] + + if not check_intermediate: + # immediate descendant + TixWidget.__init__(self, master, None, None, {'name' : name}) + else: + # Ensure that the intermediate widgets exist + parent = master + for i in range(len(plist) - 1): + n = '.'.join(plist[:i+1]) + try: + w = master._nametowidget(n) + parent = w + except KeyError: + # Create the intermediate widget + parent = TixSubWidget(parent, plist[i], + destroy_physically=0, + check_intermediate=0) + # The Tk widget name is in plist, not in name + if plist: + name = plist[-1] + TixWidget.__init__(self, parent, None, None, {'name' : name}) + self.destroy_physically = destroy_physically + + def destroy(self): + # For some widgets e.g., a NoteBook, when we call destructors, + # we must be careful not to destroy the frame widget since this + # also destroys the parent NoteBook thus leading to an exception + # in Tkinter when it finally calls Tcl to destroy the NoteBook + for c in self.children.values(): c.destroy() + if self._name in self.master.children: + del self.master.children[self._name] + if self._name in self.master.subwidget_list: + del self.master.subwidget_list[self._name] + if self.destroy_physically: + # This is bypassed only for a few widgets + self.tk.call('destroy', self._w) + + +# Useful class to create a display style - later shared by many items. +# Contributed by Steffen Kremser +class DisplayStyle: + """DisplayStyle - handle configuration options shared by + (multiple) Display Items""" + + def __init__(self, itemtype, cnf={}, **kw): + if 'refwindow' in kw: + master = kw['refwindow'] + elif 'refwindow' in cnf: + master = cnf['refwindow'] + else: + master = Tkinter._default_root + if not master: + raise RuntimeError("Too early to create display style: no root window") + self.tk = master.tk + self.stylename = self.tk.call('tixDisplayStyle', itemtype, + *self._options(cnf,kw) ) + + def __str__(self): + return self.stylename + + def _options(self, cnf, kw): + if kw and cnf: + cnf = _cnfmerge((cnf, kw)) + elif kw: + cnf = kw + opts = () + for k, v in cnf.items(): + opts = opts + ('-'+k, v) + return opts + + def delete(self): + self.tk.call(self.stylename, 'delete') + + def __setitem__(self,key,value): + self.tk.call(self.stylename, 'configure', '-%s'%key, value) + + def config(self, cnf={}, **kw): + return self._getconfigure( + self.stylename, 'configure', *self._options(cnf,kw)) + + def __getitem__(self,key): + return self.tk.call(self.stylename, 'cget', '-%s'%key) + + +###################################################### +### The Tix Widget classes - in alphabetical order ### +###################################################### + +class Balloon(TixWidget): + """Balloon help widget. + + Subwidget Class + --------- ----- + label Label + message Message""" + + # FIXME: It should inherit -superclass tixShell + def __init__(self, master=None, cnf={}, **kw): + # static seem to be -installcolormap -initwait -statusbar -cursor + static = ['options', 'installcolormap', 'initwait', 'statusbar', + 'cursor'] + TixWidget.__init__(self, master, 'tixBalloon', static, cnf, kw) + self.subwidget_list['label'] = _dummyLabel(self, 'label', + destroy_physically=0) + self.subwidget_list['message'] = _dummyLabel(self, 'message', + destroy_physically=0) + + def bind_widget(self, widget, cnf={}, **kw): + """Bind balloon widget to another. + One balloon widget may be bound to several widgets at the same time""" + self.tk.call(self._w, 'bind', widget._w, *self._options(cnf, kw)) + + def unbind_widget(self, widget): + self.tk.call(self._w, 'unbind', widget._w) + +class ButtonBox(TixWidget): + """ButtonBox - A container for pushbuttons. + Subwidgets are the buttons added with the add method. + """ + def __init__(self, master=None, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixButtonBox', + ['orientation', 'options'], cnf, kw) + + def add(self, name, cnf={}, **kw): + """Add a button with given name to box.""" + + btn = self.tk.call(self._w, 'add', name, *self._options(cnf, kw)) + self.subwidget_list[name] = _dummyButton(self, name) + return btn + + def invoke(self, name): + if name in self.subwidget_list: + self.tk.call(self._w, 'invoke', name) + +class ComboBox(TixWidget): + """ComboBox - an Entry field with a dropdown menu. The user can select a + choice by either typing in the entry subwidget or selecting from the + listbox subwidget. + + Subwidget Class + --------- ----- + entry Entry + arrow Button + slistbox ScrolledListBox + tick Button + cross Button : present if created with the fancy option""" + + # FIXME: It should inherit -superclass tixLabelWidget + def __init__ (self, master=None, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixComboBox', + ['editable', 'dropdown', 'fancy', 'options'], + cnf, kw) + self.subwidget_list['label'] = _dummyLabel(self, 'label') + self.subwidget_list['entry'] = _dummyEntry(self, 'entry') + self.subwidget_list['arrow'] = _dummyButton(self, 'arrow') + self.subwidget_list['slistbox'] = _dummyScrolledListBox(self, + 'slistbox') + try: + self.subwidget_list['tick'] = _dummyButton(self, 'tick') + self.subwidget_list['cross'] = _dummyButton(self, 'cross') + except TypeError: + # unavailable when -fancy not specified + pass + + # align + + def add_history(self, str): + self.tk.call(self._w, 'addhistory', str) + + def append_history(self, str): + self.tk.call(self._w, 'appendhistory', str) + + def insert(self, index, str): + self.tk.call(self._w, 'insert', index, str) + + def pick(self, index): + self.tk.call(self._w, 'pick', index) + +class Control(TixWidget): + """Control - An entry field with value change arrows. The user can + adjust the value by pressing the two arrow buttons or by entering + the value directly into the entry. The new value will be checked + against the user-defined upper and lower limits. + + Subwidget Class + --------- ----- + incr Button + decr Button + entry Entry + label Label""" + + # FIXME: It should inherit -superclass tixLabelWidget + def __init__ (self, master=None, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixControl', ['options'], cnf, kw) + self.subwidget_list['incr'] = _dummyButton(self, 'incr') + self.subwidget_list['decr'] = _dummyButton(self, 'decr') + self.subwidget_list['label'] = _dummyLabel(self, 'label') + self.subwidget_list['entry'] = _dummyEntry(self, 'entry') + + def decrement(self): + self.tk.call(self._w, 'decr') + + def increment(self): + self.tk.call(self._w, 'incr') + + def invoke(self): + self.tk.call(self._w, 'invoke') + + def update(self): + self.tk.call(self._w, 'update') + +class DirList(TixWidget): + """DirList - displays a list view of a directory, its previous + directories and its sub-directories. The user can choose one of + the directories displayed in the list or change to another directory. + + Subwidget Class + --------- ----- + hlist HList + hsb Scrollbar + vsb Scrollbar""" + + # FIXME: It should inherit -superclass tixScrolledHList + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixDirList', ['options'], cnf, kw) + self.subwidget_list['hlist'] = _dummyHList(self, 'hlist') + self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb') + self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb') + + def chdir(self, dir): + self.tk.call(self._w, 'chdir', dir) + +class DirTree(TixWidget): + """DirTree - Directory Listing in a hierarchical view. + Displays a tree view of a directory, its previous directories and its + sub-directories. The user can choose one of the directories displayed + in the list or change to another directory. + + Subwidget Class + --------- ----- + hlist HList + hsb Scrollbar + vsb Scrollbar""" + + # FIXME: It should inherit -superclass tixScrolledHList + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixDirTree', ['options'], cnf, kw) + self.subwidget_list['hlist'] = _dummyHList(self, 'hlist') + self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb') + self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb') + + def chdir(self, dir): + self.tk.call(self._w, 'chdir', dir) + +class DirSelectBox(TixWidget): + """DirSelectBox - Motif style file select box. + It is generally used for + the user to choose a file. FileSelectBox stores the files mostly + recently selected into a ComboBox widget so that they can be quickly + selected again. + + Subwidget Class + --------- ----- + selection ComboBox + filter ComboBox + dirlist ScrolledListBox + filelist ScrolledListBox""" + + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixDirSelectBox', ['options'], cnf, kw) + self.subwidget_list['dirlist'] = _dummyDirList(self, 'dirlist') + self.subwidget_list['dircbx'] = _dummyFileComboBox(self, 'dircbx') + +class ExFileSelectBox(TixWidget): + """ExFileSelectBox - MS Windows style file select box. + It provides a convenient method for the user to select files. + + Subwidget Class + --------- ----- + cancel Button + ok Button + hidden Checkbutton + types ComboBox + dir ComboBox + file ComboBox + dirlist ScrolledListBox + filelist ScrolledListBox""" + + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixExFileSelectBox', ['options'], cnf, kw) + self.subwidget_list['cancel'] = _dummyButton(self, 'cancel') + self.subwidget_list['ok'] = _dummyButton(self, 'ok') + self.subwidget_list['hidden'] = _dummyCheckbutton(self, 'hidden') + self.subwidget_list['types'] = _dummyComboBox(self, 'types') + self.subwidget_list['dir'] = _dummyComboBox(self, 'dir') + self.subwidget_list['dirlist'] = _dummyDirList(self, 'dirlist') + self.subwidget_list['file'] = _dummyComboBox(self, 'file') + self.subwidget_list['filelist'] = _dummyScrolledListBox(self, 'filelist') + + def filter(self): + self.tk.call(self._w, 'filter') + + def invoke(self): + self.tk.call(self._w, 'invoke') + + +# Should inherit from a Dialog class +class DirSelectDialog(TixWidget): + """The DirSelectDialog widget presents the directories in the file + system in a dialog window. The user can use this dialog window to + navigate through the file system to select the desired directory. + + Subwidgets Class + ---------- ----- + dirbox DirSelectDialog""" + + # FIXME: It should inherit -superclass tixDialogShell + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixDirSelectDialog', + ['options'], cnf, kw) + self.subwidget_list['dirbox'] = _dummyDirSelectBox(self, 'dirbox') + # cancel and ok buttons are missing + + def popup(self): + self.tk.call(self._w, 'popup') + + def popdown(self): + self.tk.call(self._w, 'popdown') + + +# Should inherit from a Dialog class +class ExFileSelectDialog(TixWidget): + """ExFileSelectDialog - MS Windows style file select dialog. + It provides a convenient method for the user to select files. + + Subwidgets Class + ---------- ----- + fsbox ExFileSelectBox""" + + # FIXME: It should inherit -superclass tixDialogShell + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixExFileSelectDialog', + ['options'], cnf, kw) + self.subwidget_list['fsbox'] = _dummyExFileSelectBox(self, 'fsbox') + + def popup(self): + self.tk.call(self._w, 'popup') + + def popdown(self): + self.tk.call(self._w, 'popdown') + +class FileSelectBox(TixWidget): + """ExFileSelectBox - Motif style file select box. + It is generally used for + the user to choose a file. FileSelectBox stores the files mostly + recently selected into a ComboBox widget so that they can be quickly + selected again. + + Subwidget Class + --------- ----- + selection ComboBox + filter ComboBox + dirlist ScrolledListBox + filelist ScrolledListBox""" + + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixFileSelectBox', ['options'], cnf, kw) + self.subwidget_list['dirlist'] = _dummyScrolledListBox(self, 'dirlist') + self.subwidget_list['filelist'] = _dummyScrolledListBox(self, 'filelist') + self.subwidget_list['filter'] = _dummyComboBox(self, 'filter') + self.subwidget_list['selection'] = _dummyComboBox(self, 'selection') + + def apply_filter(self): # name of subwidget is same as command + self.tk.call(self._w, 'filter') + + def invoke(self): + self.tk.call(self._w, 'invoke') + +# Should inherit from a Dialog class +class FileSelectDialog(TixWidget): + """FileSelectDialog - Motif style file select dialog. + + Subwidgets Class + ---------- ----- + btns StdButtonBox + fsbox FileSelectBox""" + + # FIXME: It should inherit -superclass tixStdDialogShell + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixFileSelectDialog', + ['options'], cnf, kw) + self.subwidget_list['btns'] = _dummyStdButtonBox(self, 'btns') + self.subwidget_list['fsbox'] = _dummyFileSelectBox(self, 'fsbox') + + def popup(self): + self.tk.call(self._w, 'popup') + + def popdown(self): + self.tk.call(self._w, 'popdown') + +class FileEntry(TixWidget): + """FileEntry - Entry field with button that invokes a FileSelectDialog. + The user can type in the filename manually. Alternatively, the user can + press the button widget that sits next to the entry, which will bring + up a file selection dialog. + + Subwidgets Class + ---------- ----- + button Button + entry Entry""" + + # FIXME: It should inherit -superclass tixLabelWidget + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixFileEntry', + ['dialogtype', 'options'], cnf, kw) + self.subwidget_list['button'] = _dummyButton(self, 'button') + self.subwidget_list['entry'] = _dummyEntry(self, 'entry') + + def invoke(self): + self.tk.call(self._w, 'invoke') + + def file_dialog(self): + # FIXME: return python object + pass + +class HList(TixWidget, XView, YView): + """HList - Hierarchy display widget can be used to display any data + that have a hierarchical structure, for example, file system directory + trees. The list entries are indented and connected by branch lines + according to their places in the hierarchy. + + Subwidgets - None""" + + def __init__ (self,master=None,cnf={}, **kw): + TixWidget.__init__(self, master, 'tixHList', + ['columns', 'options'], cnf, kw) + + def add(self, entry, cnf={}, **kw): + return self.tk.call(self._w, 'add', entry, *self._options(cnf, kw)) + + def add_child(self, parent=None, cnf={}, **kw): + if not parent: + parent = '' + return self.tk.call( + self._w, 'addchild', parent, *self._options(cnf, kw)) + + def anchor_set(self, entry): + self.tk.call(self._w, 'anchor', 'set', entry) + + def anchor_clear(self): + self.tk.call(self._w, 'anchor', 'clear') + + def column_width(self, col=0, width=None, chars=None): + if not chars: + return self.tk.call(self._w, 'column', 'width', col, width) + else: + return self.tk.call(self._w, 'column', 'width', col, + '-char', chars) + + def delete_all(self): + self.tk.call(self._w, 'delete', 'all') + + def delete_entry(self, entry): + self.tk.call(self._w, 'delete', 'entry', entry) + + def delete_offsprings(self, entry): + self.tk.call(self._w, 'delete', 'offsprings', entry) + + def delete_siblings(self, entry): + self.tk.call(self._w, 'delete', 'siblings', entry) + + def dragsite_set(self, index): + self.tk.call(self._w, 'dragsite', 'set', index) + + def dragsite_clear(self): + self.tk.call(self._w, 'dragsite', 'clear') + + def dropsite_set(self, index): + self.tk.call(self._w, 'dropsite', 'set', index) + + def dropsite_clear(self): + self.tk.call(self._w, 'dropsite', 'clear') + + def header_create(self, col, cnf={}, **kw): + self.tk.call(self._w, 'header', 'create', col, *self._options(cnf, kw)) + + def header_configure(self, col, cnf={}, **kw): + if cnf is None: + return self._getconfigure(self._w, 'header', 'configure', col) + self.tk.call(self._w, 'header', 'configure', col, + *self._options(cnf, kw)) + + def header_cget(self, col, opt): + return self.tk.call(self._w, 'header', 'cget', col, opt) + + def header_exists(self, col): + # A workaround to Tix library bug (issue #25464). + # The documented command is "exists", but only erroneous "exist" is + # accepted. + return self.tk.getboolean(self.tk.call(self._w, 'header', 'exist', col)) + header_exist = header_exists + + def header_delete(self, col): + self.tk.call(self._w, 'header', 'delete', col) + + def header_size(self, col): + return self.tk.call(self._w, 'header', 'size', col) + + def hide_entry(self, entry): + self.tk.call(self._w, 'hide', 'entry', entry) + + def indicator_create(self, entry, cnf={}, **kw): + self.tk.call( + self._w, 'indicator', 'create', entry, *self._options(cnf, kw)) + + def indicator_configure(self, entry, cnf={}, **kw): + if cnf is None: + return self._getconfigure( + self._w, 'indicator', 'configure', entry) + self.tk.call( + self._w, 'indicator', 'configure', entry, *self._options(cnf, kw)) + + def indicator_cget(self, entry, opt): + return self.tk.call(self._w, 'indicator', 'cget', entry, opt) + + def indicator_exists(self, entry): + return self.tk.call (self._w, 'indicator', 'exists', entry) + + def indicator_delete(self, entry): + self.tk.call(self._w, 'indicator', 'delete', entry) + + def indicator_size(self, entry): + return self.tk.call(self._w, 'indicator', 'size', entry) + + def info_anchor(self): + return self.tk.call(self._w, 'info', 'anchor') + + def info_bbox(self, entry): + return self._getints( + self.tk.call(self._w, 'info', 'bbox', entry)) or None + + def info_children(self, entry=None): + c = self.tk.call(self._w, 'info', 'children', entry) + return self.tk.splitlist(c) + + def info_data(self, entry): + return self.tk.call(self._w, 'info', 'data', entry) + + def info_dragsite(self): + return self.tk.call(self._w, 'info', 'dragsite') + + def info_dropsite(self): + return self.tk.call(self._w, 'info', 'dropsite') + + def info_exists(self, entry): + return self.tk.call(self._w, 'info', 'exists', entry) + + def info_hidden(self, entry): + return self.tk.call(self._w, 'info', 'hidden', entry) + + def info_next(self, entry): + return self.tk.call(self._w, 'info', 'next', entry) + + def info_parent(self, entry): + return self.tk.call(self._w, 'info', 'parent', entry) + + def info_prev(self, entry): + return self.tk.call(self._w, 'info', 'prev', entry) + + def info_selection(self): + c = self.tk.call(self._w, 'info', 'selection') + return self.tk.splitlist(c) + + def item_cget(self, entry, col, opt): + return self.tk.call(self._w, 'item', 'cget', entry, col, opt) + + def item_configure(self, entry, col, cnf={}, **kw): + if cnf is None: + return self._getconfigure(self._w, 'item', 'configure', entry, col) + self.tk.call(self._w, 'item', 'configure', entry, col, + *self._options(cnf, kw)) + + def item_create(self, entry, col, cnf={}, **kw): + self.tk.call( + self._w, 'item', 'create', entry, col, *self._options(cnf, kw)) + + def item_exists(self, entry, col): + return self.tk.call(self._w, 'item', 'exists', entry, col) + + def item_delete(self, entry, col): + self.tk.call(self._w, 'item', 'delete', entry, col) + + def entrycget(self, entry, opt): + return self.tk.call(self._w, 'entrycget', entry, opt) + + def entryconfigure(self, entry, cnf={}, **kw): + if cnf is None: + return self._getconfigure(self._w, 'entryconfigure', entry) + self.tk.call(self._w, 'entryconfigure', entry, + *self._options(cnf, kw)) + + def nearest(self, y): + return self.tk.call(self._w, 'nearest', y) + + def see(self, entry): + self.tk.call(self._w, 'see', entry) + + def selection_clear(self, cnf={}, **kw): + self.tk.call(self._w, 'selection', 'clear', *self._options(cnf, kw)) + + def selection_includes(self, entry): + return self.tk.call(self._w, 'selection', 'includes', entry) + + def selection_set(self, first, last=None): + self.tk.call(self._w, 'selection', 'set', first, last) + + def show_entry(self, entry): + return self.tk.call(self._w, 'show', 'entry', entry) + +class InputOnly(TixWidget): + """InputOnly - Invisible widget. Unix only. + + Subwidgets - None""" + + def __init__ (self,master=None,cnf={}, **kw): + TixWidget.__init__(self, master, 'tixInputOnly', None, cnf, kw) + +class LabelEntry(TixWidget): + """LabelEntry - Entry field with label. Packages an entry widget + and a label into one mega widget. It can be used to simplify the creation + of ``entry-form'' type of interface. + + Subwidgets Class + ---------- ----- + label Label + entry Entry""" + + def __init__ (self,master=None,cnf={}, **kw): + TixWidget.__init__(self, master, 'tixLabelEntry', + ['labelside','options'], cnf, kw) + self.subwidget_list['label'] = _dummyLabel(self, 'label') + self.subwidget_list['entry'] = _dummyEntry(self, 'entry') + +class LabelFrame(TixWidget): + """LabelFrame - Labelled Frame container. Packages a frame widget + and a label into one mega widget. To create widgets inside a + LabelFrame widget, one creates the new widgets relative to the + frame subwidget and manage them inside the frame subwidget. + + Subwidgets Class + ---------- ----- + label Label + frame Frame""" + + def __init__ (self,master=None,cnf={}, **kw): + TixWidget.__init__(self, master, 'tixLabelFrame', + ['labelside','options'], cnf, kw) + self.subwidget_list['label'] = _dummyLabel(self, 'label') + self.subwidget_list['frame'] = _dummyFrame(self, 'frame') + + +class ListNoteBook(TixWidget): + """A ListNoteBook widget is very similar to the TixNoteBook widget: + it can be used to display many windows in a limited space using a + notebook metaphor. The notebook is divided into a stack of pages + (windows). At one time only one of these pages can be shown. + The user can navigate through these pages by + choosing the name of the desired page in the hlist subwidget.""" + + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixListNoteBook', ['options'], cnf, kw) + # Is this necessary? It's not an exposed subwidget in Tix. + self.subwidget_list['pane'] = _dummyPanedWindow(self, 'pane', + destroy_physically=0) + self.subwidget_list['hlist'] = _dummyHList(self, 'hlist') + self.subwidget_list['shlist'] = _dummyScrolledHList(self, 'shlist') + + def add(self, name, cnf={}, **kw): + self.tk.call(self._w, 'add', name, *self._options(cnf, kw)) + self.subwidget_list[name] = TixSubWidget(self, name) + return self.subwidget_list[name] + + def page(self, name): + return self.subwidget(name) + + def pages(self): + # Can't call subwidgets_all directly because we don't want .nbframe + names = self.tk.split(self.tk.call(self._w, 'pages')) + ret = [] + for x in names: + ret.append(self.subwidget(x)) + return ret + + def raise_page(self, name): # raise is a python keyword + self.tk.call(self._w, 'raise', name) + +class Meter(TixWidget): + """The Meter widget can be used to show the progress of a background + job which may take a long time to execute. + """ + + def __init__(self, master=None, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixMeter', + ['options'], cnf, kw) + +class NoteBook(TixWidget): + """NoteBook - Multi-page container widget (tabbed notebook metaphor). + + Subwidgets Class + ---------- ----- + nbframe NoteBookFrame + <pages> page widgets added dynamically with the add method""" + + def __init__ (self,master=None,cnf={}, **kw): + TixWidget.__init__(self,master,'tixNoteBook', ['options'], cnf, kw) + self.subwidget_list['nbframe'] = TixSubWidget(self, 'nbframe', + destroy_physically=0) + + def add(self, name, cnf={}, **kw): + self.tk.call(self._w, 'add', name, *self._options(cnf, kw)) + self.subwidget_list[name] = TixSubWidget(self, name) + return self.subwidget_list[name] + + def delete(self, name): + self.tk.call(self._w, 'delete', name) + self.subwidget_list[name].destroy() + del self.subwidget_list[name] + + def page(self, name): + return self.subwidget(name) + + def pages(self): + # Can't call subwidgets_all directly because we don't want .nbframe + names = self.tk.split(self.tk.call(self._w, 'pages')) + ret = [] + for x in names: + ret.append(self.subwidget(x)) + return ret + + def raise_page(self, name): # raise is a python keyword + self.tk.call(self._w, 'raise', name) + + def raised(self): + return self.tk.call(self._w, 'raised') + +class NoteBookFrame(TixWidget): + # FIXME: This is dangerous to expose to be called on its own. + pass + +class OptionMenu(TixWidget): + """OptionMenu - creates a menu button of options. + + Subwidget Class + --------- ----- + menubutton Menubutton + menu Menu""" + + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixOptionMenu', + ['labelside', 'options'], cnf, kw) + self.subwidget_list['menubutton'] = _dummyMenubutton(self, 'menubutton') + self.subwidget_list['menu'] = _dummyMenu(self, 'menu') + + def add_command(self, name, cnf={}, **kw): + self.tk.call(self._w, 'add', 'command', name, *self._options(cnf, kw)) + + def add_separator(self, name, cnf={}, **kw): + self.tk.call(self._w, 'add', 'separator', name, *self._options(cnf, kw)) + + def delete(self, name): + self.tk.call(self._w, 'delete', name) + + def disable(self, name): + self.tk.call(self._w, 'disable', name) + + def enable(self, name): + self.tk.call(self._w, 'enable', name) + +class PanedWindow(TixWidget): + """PanedWindow - Multi-pane container widget + allows the user to interactively manipulate the sizes of several + panes. The panes can be arranged either vertically or horizontally.The + user changes the sizes of the panes by dragging the resize handle + between two panes. + + Subwidgets Class + ---------- ----- + <panes> g/p widgets added dynamically with the add method.""" + + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixPanedWindow', ['orientation', 'options'], cnf, kw) + + # add delete forget panecget paneconfigure panes setsize + def add(self, name, cnf={}, **kw): + self.tk.call(self._w, 'add', name, *self._options(cnf, kw)) + self.subwidget_list[name] = TixSubWidget(self, name, + check_intermediate=0) + return self.subwidget_list[name] + + def delete(self, name): + self.tk.call(self._w, 'delete', name) + self.subwidget_list[name].destroy() + del self.subwidget_list[name] + + def forget(self, name): + self.tk.call(self._w, 'forget', name) + + def panecget(self, entry, opt): + return self.tk.call(self._w, 'panecget', entry, opt) + + def paneconfigure(self, entry, cnf={}, **kw): + if cnf is None: + return self._getconfigure(self._w, 'paneconfigure', entry) + self.tk.call(self._w, 'paneconfigure', entry, *self._options(cnf, kw)) + + def panes(self): + names = self.tk.splitlist(self.tk.call(self._w, 'panes')) + return [self.subwidget(x) for x in names] + +class PopupMenu(TixWidget): + """PopupMenu widget can be used as a replacement of the tk_popup command. + The advantage of the Tix PopupMenu widget is it requires less application + code to manipulate. + + + Subwidgets Class + ---------- ----- + menubutton Menubutton + menu Menu""" + + # FIXME: It should inherit -superclass tixShell + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixPopupMenu', ['options'], cnf, kw) + self.subwidget_list['menubutton'] = _dummyMenubutton(self, 'menubutton') + self.subwidget_list['menu'] = _dummyMenu(self, 'menu') + + def bind_widget(self, widget): + self.tk.call(self._w, 'bind', widget._w) + + def unbind_widget(self, widget): + self.tk.call(self._w, 'unbind', widget._w) + + def post_widget(self, widget, x, y): + self.tk.call(self._w, 'post', widget._w, x, y) + +class ResizeHandle(TixWidget): + """Internal widget to draw resize handles on Scrolled widgets.""" + def __init__(self, master, cnf={}, **kw): + # There seems to be a Tix bug rejecting the configure method + # Let's try making the flags -static + flags = ['options', 'command', 'cursorfg', 'cursorbg', + 'handlesize', 'hintcolor', 'hintwidth', + 'x', 'y'] + # In fact, x y height width are configurable + TixWidget.__init__(self, master, 'tixResizeHandle', + flags, cnf, kw) + + def attach_widget(self, widget): + self.tk.call(self._w, 'attachwidget', widget._w) + + def detach_widget(self, widget): + self.tk.call(self._w, 'detachwidget', widget._w) + + def hide(self, widget): + self.tk.call(self._w, 'hide', widget._w) + + def show(self, widget): + self.tk.call(self._w, 'show', widget._w) + +class ScrolledHList(TixWidget): + """ScrolledHList - HList with automatic scrollbars.""" + + # FIXME: It should inherit -superclass tixScrolledWidget + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixScrolledHList', ['options'], + cnf, kw) + self.subwidget_list['hlist'] = _dummyHList(self, 'hlist') + self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb') + self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb') + +class ScrolledListBox(TixWidget): + """ScrolledListBox - Listbox with automatic scrollbars.""" + + # FIXME: It should inherit -superclass tixScrolledWidget + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixScrolledListBox', ['options'], cnf, kw) + self.subwidget_list['listbox'] = _dummyListbox(self, 'listbox') + self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb') + self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb') + +class ScrolledText(TixWidget): + """ScrolledText - Text with automatic scrollbars.""" + + # FIXME: It should inherit -superclass tixScrolledWidget + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixScrolledText', ['options'], cnf, kw) + self.subwidget_list['text'] = _dummyText(self, 'text') + self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb') + self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb') + +class ScrolledTList(TixWidget): + """ScrolledTList - TList with automatic scrollbars.""" + + # FIXME: It should inherit -superclass tixScrolledWidget + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixScrolledTList', ['options'], + cnf, kw) + self.subwidget_list['tlist'] = _dummyTList(self, 'tlist') + self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb') + self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb') + +class ScrolledWindow(TixWidget): + """ScrolledWindow - Window with automatic scrollbars.""" + + # FIXME: It should inherit -superclass tixScrolledWidget + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixScrolledWindow', ['options'], cnf, kw) + self.subwidget_list['window'] = _dummyFrame(self, 'window') + self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb') + self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb') + +class Select(TixWidget): + """Select - Container of button subwidgets. It can be used to provide + radio-box or check-box style of selection options for the user. + + Subwidgets are buttons added dynamically using the add method.""" + + # FIXME: It should inherit -superclass tixLabelWidget + def __init__(self, master, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixSelect', + ['allowzero', 'radio', 'orientation', 'labelside', + 'options'], + cnf, kw) + self.subwidget_list['label'] = _dummyLabel(self, 'label') + + def add(self, name, cnf={}, **kw): + self.tk.call(self._w, 'add', name, *self._options(cnf, kw)) + self.subwidget_list[name] = _dummyButton(self, name) + return self.subwidget_list[name] + + def invoke(self, name): + self.tk.call(self._w, 'invoke', name) + +class Shell(TixWidget): + """Toplevel window. + + Subwidgets - None""" + + def __init__ (self,master=None,cnf={}, **kw): + TixWidget.__init__(self, master, 'tixShell', ['options', 'title'], cnf, kw) + +class DialogShell(TixWidget): + """Toplevel window, with popup popdown and center methods. + It tells the window manager that it is a dialog window and should be + treated specially. The exact treatment depends on the treatment of + the window manager. + + Subwidgets - None""" + + # FIXME: It should inherit from Shell + def __init__ (self,master=None,cnf={}, **kw): + TixWidget.__init__(self, master, + 'tixDialogShell', + ['options', 'title', 'mapped', + 'minheight', 'minwidth', + 'parent', 'transient'], cnf, kw) + + def popdown(self): + self.tk.call(self._w, 'popdown') + + def popup(self): + self.tk.call(self._w, 'popup') + + def center(self): + self.tk.call(self._w, 'center') + +class StdButtonBox(TixWidget): + """StdButtonBox - Standard Button Box (OK, Apply, Cancel and Help) """ + + def __init__(self, master=None, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixStdButtonBox', + ['orientation', 'options'], cnf, kw) + self.subwidget_list['ok'] = _dummyButton(self, 'ok') + self.subwidget_list['apply'] = _dummyButton(self, 'apply') + self.subwidget_list['cancel'] = _dummyButton(self, 'cancel') + self.subwidget_list['help'] = _dummyButton(self, 'help') + + def invoke(self, name): + if name in self.subwidget_list: + self.tk.call(self._w, 'invoke', name) + +class TList(TixWidget, XView, YView): + """TList - Hierarchy display widget which can be + used to display data in a tabular format. The list entries of a TList + widget are similar to the entries in the Tk listbox widget. The main + differences are (1) the TList widget can display the list entries in a + two dimensional format and (2) you can use graphical images as well as + multiple colors and fonts for the list entries. + + Subwidgets - None""" + + def __init__ (self,master=None,cnf={}, **kw): + TixWidget.__init__(self, master, 'tixTList', ['options'], cnf, kw) + + def active_set(self, index): + self.tk.call(self._w, 'active', 'set', index) + + def active_clear(self): + self.tk.call(self._w, 'active', 'clear') + + def anchor_set(self, index): + self.tk.call(self._w, 'anchor', 'set', index) + + def anchor_clear(self): + self.tk.call(self._w, 'anchor', 'clear') + + def delete(self, from_, to=None): + self.tk.call(self._w, 'delete', from_, to) + + def dragsite_set(self, index): + self.tk.call(self._w, 'dragsite', 'set', index) + + def dragsite_clear(self): + self.tk.call(self._w, 'dragsite', 'clear') + + def dropsite_set(self, index): + self.tk.call(self._w, 'dropsite', 'set', index) + + def dropsite_clear(self): + self.tk.call(self._w, 'dropsite', 'clear') + + def insert(self, index, cnf={}, **kw): + self.tk.call(self._w, 'insert', index, *self._options(cnf, kw)) + + def info_active(self): + return self.tk.call(self._w, 'info', 'active') + + def info_anchor(self): + return self.tk.call(self._w, 'info', 'anchor') + + def info_down(self, index): + return self.tk.call(self._w, 'info', 'down', index) + + def info_left(self, index): + return self.tk.call(self._w, 'info', 'left', index) + + def info_right(self, index): + return self.tk.call(self._w, 'info', 'right', index) + + def info_selection(self): + c = self.tk.call(self._w, 'info', 'selection') + return self.tk.splitlist(c) + + def info_size(self): + return self.tk.call(self._w, 'info', 'size') + + def info_up(self, index): + return self.tk.call(self._w, 'info', 'up', index) + + def nearest(self, x, y): + return self.tk.call(self._w, 'nearest', x, y) + + def see(self, index): + self.tk.call(self._w, 'see', index) + + def selection_clear(self, cnf={}, **kw): + self.tk.call(self._w, 'selection', 'clear', *self._options(cnf, kw)) + + def selection_includes(self, index): + return self.tk.call(self._w, 'selection', 'includes', index) + + def selection_set(self, first, last=None): + self.tk.call(self._w, 'selection', 'set', first, last) + +class Tree(TixWidget): + """Tree - The tixTree widget can be used to display hierarchical + data in a tree form. The user can adjust + the view of the tree by opening or closing parts of the tree.""" + + # FIXME: It should inherit -superclass tixScrolledWidget + def __init__(self, master=None, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixTree', + ['options'], cnf, kw) + self.subwidget_list['hlist'] = _dummyHList(self, 'hlist') + self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb') + self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb') + + def autosetmode(self): + '''This command calls the setmode method for all the entries in this + Tree widget: if an entry has no child entries, its mode is set to + none. Otherwise, if the entry has any hidden child entries, its mode is + set to open; otherwise its mode is set to close.''' + self.tk.call(self._w, 'autosetmode') + + def close(self, entrypath): + '''Close the entry given by entryPath if its mode is close.''' + self.tk.call(self._w, 'close', entrypath) + + def getmode(self, entrypath): + '''Returns the current mode of the entry given by entryPath.''' + return self.tk.call(self._w, 'getmode', entrypath) + + def open(self, entrypath): + '''Open the entry given by entryPath if its mode is open.''' + self.tk.call(self._w, 'open', entrypath) + + def setmode(self, entrypath, mode='none'): + '''This command is used to indicate whether the entry given by + entryPath has children entries and whether the children are visible. mode + must be one of open, close or none. If mode is set to open, a (+) + indicator is drawn next to the entry. If mode is set to close, a (-) + indicator is drawn next to the entry. If mode is set to none, no + indicators will be drawn for this entry. The default mode is none. The + open mode indicates the entry has hidden children and this entry can be + opened by the user. The close mode indicates that all the children of the + entry are now visible and the entry can be closed by the user.''' + self.tk.call(self._w, 'setmode', entrypath, mode) + + +# Could try subclassing Tree for CheckList - would need another arg to init +class CheckList(TixWidget): + """The CheckList widget + displays a list of items to be selected by the user. CheckList acts + similarly to the Tk checkbutton or radiobutton widgets, except it is + capable of handling many more items than checkbuttons or radiobuttons. + """ + # FIXME: It should inherit -superclass tixTree + def __init__(self, master=None, cnf={}, **kw): + TixWidget.__init__(self, master, 'tixCheckList', + ['options', 'radio'], cnf, kw) + self.subwidget_list['hlist'] = _dummyHList(self, 'hlist') + self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb') + self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb') + + def autosetmode(self): + '''This command calls the setmode method for all the entries in this + Tree widget: if an entry has no child entries, its mode is set to + none. Otherwise, if the entry has any hidden child entries, its mode is + set to open; otherwise its mode is set to close.''' + self.tk.call(self._w, 'autosetmode') + + def close(self, entrypath): + '''Close the entry given by entryPath if its mode is close.''' + self.tk.call(self._w, 'close', entrypath) + + def getmode(self, entrypath): + '''Returns the current mode of the entry given by entryPath.''' + return self.tk.call(self._w, 'getmode', entrypath) + + def open(self, entrypath): + '''Open the entry given by entryPath if its mode is open.''' + self.tk.call(self._w, 'open', entrypath) + + def getselection(self, mode='on'): + '''Returns a list of items whose status matches status. If status is + not specified, the list of items in the "on" status will be returned. + Mode can be on, off, default''' + c = self.tk.split(self.tk.call(self._w, 'getselection', mode)) + return self.tk.splitlist(c) + + def getstatus(self, entrypath): + '''Returns the current status of entryPath.''' + return self.tk.call(self._w, 'getstatus', entrypath) + + def setstatus(self, entrypath, mode='on'): + '''Sets the status of entryPath to be status. A bitmap will be + displayed next to the entry its status is on, off or default.''' + self.tk.call(self._w, 'setstatus', entrypath, mode) + + +########################################################################### +### The subclassing below is used to instantiate the subwidgets in each ### +### mega widget. This allows us to access their methods directly. ### +########################################################################### + +class _dummyButton(Button, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + +class _dummyCheckbutton(Checkbutton, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + +class _dummyEntry(Entry, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + +class _dummyFrame(Frame, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + +class _dummyLabel(Label, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + +class _dummyListbox(Listbox, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + +class _dummyMenu(Menu, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + +class _dummyMenubutton(Menubutton, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + +class _dummyScrollbar(Scrollbar, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + +class _dummyText(Text, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + +class _dummyScrolledListBox(ScrolledListBox, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + self.subwidget_list['listbox'] = _dummyListbox(self, 'listbox') + self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb') + self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb') + +class _dummyHList(HList, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + +class _dummyScrolledHList(ScrolledHList, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + self.subwidget_list['hlist'] = _dummyHList(self, 'hlist') + self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb') + self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb') + +class _dummyTList(TList, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + +class _dummyComboBox(ComboBox, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, ['fancy',destroy_physically]) + self.subwidget_list['label'] = _dummyLabel(self, 'label') + self.subwidget_list['entry'] = _dummyEntry(self, 'entry') + self.subwidget_list['arrow'] = _dummyButton(self, 'arrow') + + self.subwidget_list['slistbox'] = _dummyScrolledListBox(self, + 'slistbox') + try: + self.subwidget_list['tick'] = _dummyButton(self, 'tick') + #cross Button : present if created with the fancy option + self.subwidget_list['cross'] = _dummyButton(self, 'cross') + except TypeError: + # unavailable when -fancy not specified + pass + +class _dummyDirList(DirList, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + self.subwidget_list['hlist'] = _dummyHList(self, 'hlist') + self.subwidget_list['vsb'] = _dummyScrollbar(self, 'vsb') + self.subwidget_list['hsb'] = _dummyScrollbar(self, 'hsb') + +class _dummyDirSelectBox(DirSelectBox, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + self.subwidget_list['dirlist'] = _dummyDirList(self, 'dirlist') + self.subwidget_list['dircbx'] = _dummyFileComboBox(self, 'dircbx') + +class _dummyExFileSelectBox(ExFileSelectBox, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + self.subwidget_list['cancel'] = _dummyButton(self, 'cancel') + self.subwidget_list['ok'] = _dummyButton(self, 'ok') + self.subwidget_list['hidden'] = _dummyCheckbutton(self, 'hidden') + self.subwidget_list['types'] = _dummyComboBox(self, 'types') + self.subwidget_list['dir'] = _dummyComboBox(self, 'dir') + self.subwidget_list['dirlist'] = _dummyScrolledListBox(self, 'dirlist') + self.subwidget_list['file'] = _dummyComboBox(self, 'file') + self.subwidget_list['filelist'] = _dummyScrolledListBox(self, 'filelist') + +class _dummyFileSelectBox(FileSelectBox, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + self.subwidget_list['dirlist'] = _dummyScrolledListBox(self, 'dirlist') + self.subwidget_list['filelist'] = _dummyScrolledListBox(self, 'filelist') + self.subwidget_list['filter'] = _dummyComboBox(self, 'filter') + self.subwidget_list['selection'] = _dummyComboBox(self, 'selection') + +class _dummyFileComboBox(ComboBox, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + self.subwidget_list['dircbx'] = _dummyComboBox(self, 'dircbx') + +class _dummyStdButtonBox(StdButtonBox, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + self.subwidget_list['ok'] = _dummyButton(self, 'ok') + self.subwidget_list['apply'] = _dummyButton(self, 'apply') + self.subwidget_list['cancel'] = _dummyButton(self, 'cancel') + self.subwidget_list['help'] = _dummyButton(self, 'help') + +class _dummyNoteBookFrame(NoteBookFrame, TixSubWidget): + def __init__(self, master, name, destroy_physically=0): + TixSubWidget.__init__(self, master, name, destroy_physically) + +class _dummyPanedWindow(PanedWindow, TixSubWidget): + def __init__(self, master, name, destroy_physically=1): + TixSubWidget.__init__(self, master, name, destroy_physically) + +######################## +### Utility Routines ### +######################## + +#mike Should tixDestroy be exposed as a wrapper? - but not for widgets. + +def OptionName(widget): + '''Returns the qualified path name for the widget. Normally used to set + default options for subwidgets. See tixwidgets.py''' + return widget.tk.call('tixOptionName', widget._w) + +# Called with a dictionary argument of the form +# {'*.c':'C source files', '*.txt':'Text Files', '*':'All files'} +# returns a string which can be used to configure the fsbox file types +# in an ExFileSelectBox. i.e., +# '{{*} {* - All files}} {{*.c} {*.c - C source files}} {{*.txt} {*.txt - Text Files}}' +def FileTypeList(dict): + s = '' + for type in dict.keys(): + s = s + '{{' + type + '} {' + type + ' - ' + dict[type] + '}} ' + return s + +# Still to be done: +# tixIconView +class CObjView(TixWidget): + """This file implements the Canvas Object View widget. This is a base + class of IconView. It implements automatic placement/adjustment of the + scrollbars according to the canvas objects inside the canvas subwidget. + The scrollbars are adjusted so that the canvas is just large enough + to see all the objects. + """ + # FIXME: It should inherit -superclass tixScrolledWidget + pass + + +class Grid(TixWidget, XView, YView): + '''The Tix Grid command creates a new window and makes it into a + tixGrid widget. Additional options, may be specified on the command + line or in the option database to configure aspects such as its cursor + and relief. + + A Grid widget displays its contents in a two dimensional grid of cells. + Each cell may contain one Tix display item, which may be in text, + graphics or other formats. See the DisplayStyle class for more information + about Tix display items. Individual cells, or groups of cells, can be + formatted with a wide range of attributes, such as its color, relief and + border. + + Subwidgets - None''' + # valid specific resources as of Tk 8.4 + # editdonecmd, editnotifycmd, floatingcols, floatingrows, formatcmd, + # highlightbackground, highlightcolor, leftmargin, itemtype, selectmode, + # selectunit, topmargin, + def __init__(self, master=None, cnf={}, **kw): + static= [] + self.cnf= cnf + TixWidget.__init__(self, master, 'tixGrid', static, cnf, kw) + + # valid options as of Tk 8.4 + # anchor, bdtype, cget, configure, delete, dragsite, dropsite, entrycget, + # edit, entryconfigure, format, geometryinfo, info, index, move, nearest, + # selection, set, size, unset, xview, yview + def anchor_clear(self): + """Removes the selection anchor.""" + self.tk.call(self, 'anchor', 'clear') + + def anchor_get(self): + "Get the (x,y) coordinate of the current anchor cell" + return self._getints(self.tk.call(self, 'anchor', 'get')) + + def anchor_set(self, x, y): + """Set the selection anchor to the cell at (x, y).""" + self.tk.call(self, 'anchor', 'set', x, y) + + def delete_row(self, from_, to=None): + """Delete rows between from_ and to inclusive. + If to is not provided, delete only row at from_""" + if to is None: + self.tk.call(self, 'delete', 'row', from_) + else: + self.tk.call(self, 'delete', 'row', from_, to) + + def delete_column(self, from_, to=None): + """Delete columns between from_ and to inclusive. + If to is not provided, delete only column at from_""" + if to is None: + self.tk.call(self, 'delete', 'column', from_) + else: + self.tk.call(self, 'delete', 'column', from_, to) + + def edit_apply(self): + """If any cell is being edited, de-highlight the cell and applies + the changes.""" + self.tk.call(self, 'edit', 'apply') + + def edit_set(self, x, y): + """Highlights the cell at (x, y) for editing, if the -editnotify + command returns True for this cell.""" + self.tk.call(self, 'edit', 'set', x, y) + + def entrycget(self, x, y, option): + "Get the option value for cell at (x,y)" + if option and option[0] != '-': + option = '-' + option + return self.tk.call(self, 'entrycget', x, y, option) + + def entryconfigure(self, x, y, cnf=None, **kw): + return self._configure(('entryconfigure', x, y), cnf, kw) + + # def format + # def index + + def info_exists(self, x, y): + "Return True if display item exists at (x,y)" + return self._getboolean(self.tk.call(self, 'info', 'exists', x, y)) + + def info_bbox(self, x, y): + # This seems to always return '', at least for 'text' displayitems + return self.tk.call(self, 'info', 'bbox', x, y) + + def move_column(self, from_, to, offset): + """Moves the range of columns from position FROM through TO by + the distance indicated by OFFSET. For example, move_column(2, 4, 1) + moves the columns 2,3,4 to columns 3,4,5.""" + self.tk.call(self, 'move', 'column', from_, to, offset) + + def move_row(self, from_, to, offset): + """Moves the range of rows from position FROM through TO by + the distance indicated by OFFSET. + For example, move_row(2, 4, 1) moves the rows 2,3,4 to rows 3,4,5.""" + self.tk.call(self, 'move', 'row', from_, to, offset) + + def nearest(self, x, y): + "Return coordinate of cell nearest pixel coordinate (x,y)" + return self._getints(self.tk.call(self, 'nearest', x, y)) + + # def selection adjust + # def selection clear + # def selection includes + # def selection set + # def selection toggle + + def set(self, x, y, itemtype=None, **kw): + args= self._options(self.cnf, kw) + if itemtype is not None: + args= ('-itemtype', itemtype) + args + self.tk.call(self, 'set', x, y, *args) + + def size_column(self, index, **kw): + """Queries or sets the size of the column given by + INDEX. INDEX may be any non-negative + integer that gives the position of a given column. + INDEX can also be the string "default"; in this case, this command + queries or sets the default size of all columns. + When no option-value pair is given, this command returns a tuple + containing the current size setting of the given column. When + option-value pairs are given, the corresponding options of the + size setting of the given column are changed. Options may be one + of the follwing: + pad0 pixels + Specifies the paddings to the left of a column. + pad1 pixels + Specifies the paddings to the right of a column. + size val + Specifies the width of a column. Val may be: + "auto" -- the width of the column is set to the + width of the widest cell in the column; + a valid Tk screen distance unit; + or a real number following by the word chars + (e.g. 3.4chars) that sets the width of the column to the + given number of characters.""" + return self.tk.split(self.tk.call(self._w, 'size', 'column', index, + *self._options({}, kw))) + + def size_row(self, index, **kw): + """Queries or sets the size of the row given by + INDEX. INDEX may be any non-negative + integer that gives the position of a given row . + INDEX can also be the string "default"; in this case, this command + queries or sets the default size of all rows. + When no option-value pair is given, this command returns a list con- + taining the current size setting of the given row . When option-value + pairs are given, the corresponding options of the size setting of the + given row are changed. Options may be one of the follwing: + pad0 pixels + Specifies the paddings to the top of a row. + pad1 pixels + Specifies the paddings to the bottom of a row. + size val + Specifies the height of a row. Val may be: + "auto" -- the height of the row is set to the + height of the highest cell in the row; + a valid Tk screen distance unit; + or a real number following by the word chars + (e.g. 3.4chars) that sets the height of the row to the + given number of characters.""" + return self.tk.split(self.tk.call( + self, 'size', 'row', index, *self._options({}, kw))) + + def unset(self, x, y): + """Clears the cell at (x, y) by removing its display item.""" + self.tk.call(self._w, 'unset', x, y) + + +class ScrolledGrid(Grid): + '''Scrolled Grid widgets''' + + # FIXME: It should inherit -superclass tixScrolledWidget + def __init__(self, master=None, cnf={}, **kw): + static= [] + self.cnf= cnf + TixWidget.__init__(self, master, 'tixScrolledGrid', static, cnf, kw) diff --git a/contrib/tools/python/src/Lib/lib-tk/Tkconstants.py b/contrib/tools/python/src/Lib/lib-tk/Tkconstants.py new file mode 100644 index 0000000000..63eee33d24 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/Tkconstants.py @@ -0,0 +1,110 @@ +# Symbolic constants for Tk + +# Booleans +NO=FALSE=OFF=0 +YES=TRUE=ON=1 + +# -anchor and -sticky +N='n' +S='s' +W='w' +E='e' +NW='nw' +SW='sw' +NE='ne' +SE='se' +NS='ns' +EW='ew' +NSEW='nsew' +CENTER='center' + +# -fill +NONE='none' +X='x' +Y='y' +BOTH='both' + +# -side +LEFT='left' +TOP='top' +RIGHT='right' +BOTTOM='bottom' + +# -relief +RAISED='raised' +SUNKEN='sunken' +FLAT='flat' +RIDGE='ridge' +GROOVE='groove' +SOLID = 'solid' + +# -orient +HORIZONTAL='horizontal' +VERTICAL='vertical' + +# -tabs +NUMERIC='numeric' + +# -wrap +CHAR='char' +WORD='word' + +# -align +BASELINE='baseline' + +# -bordermode +INSIDE='inside' +OUTSIDE='outside' + +# Special tags, marks and insert positions +SEL='sel' +SEL_FIRST='sel.first' +SEL_LAST='sel.last' +END='end' +INSERT='insert' +CURRENT='current' +ANCHOR='anchor' +ALL='all' # e.g. Canvas.delete(ALL) + +# Text widget and button states +NORMAL='normal' +DISABLED='disabled' +ACTIVE='active' +# Canvas state +HIDDEN='hidden' + +# Menu item types +CASCADE='cascade' +CHECKBUTTON='checkbutton' +COMMAND='command' +RADIOBUTTON='radiobutton' +SEPARATOR='separator' + +# Selection modes for list boxes +SINGLE='single' +BROWSE='browse' +MULTIPLE='multiple' +EXTENDED='extended' + +# Activestyle for list boxes +# NONE='none' is also valid +DOTBOX='dotbox' +UNDERLINE='underline' + +# Various canvas styles +PIESLICE='pieslice' +CHORD='chord' +ARC='arc' +FIRST='first' +LAST='last' +BUTT='butt' +PROJECTING='projecting' +ROUND='round' +BEVEL='bevel' +MITER='miter' + +# Arguments to xview/yview +MOVETO='moveto' +SCROLL='scroll' +UNITS='units' +PAGES='pages' diff --git a/contrib/tools/python/src/Lib/lib-tk/Tkdnd.py b/contrib/tools/python/src/Lib/lib-tk/Tkdnd.py new file mode 100644 index 0000000000..1b09f91cfd --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/Tkdnd.py @@ -0,0 +1,321 @@ +"""Drag-and-drop support for Tkinter. + +This is very preliminary. I currently only support dnd *within* one +application, between different windows (or within the same window). + +I am trying to make this as generic as possible -- not dependent on +the use of a particular widget or icon type, etc. I also hope that +this will work with Pmw. + +To enable an object to be dragged, you must create an event binding +for it that starts the drag-and-drop process. Typically, you should +bind <ButtonPress> to a callback function that you write. The function +should call Tkdnd.dnd_start(source, event), where 'source' is the +object to be dragged, and 'event' is the event that invoked the call +(the argument to your callback function). Even though this is a class +instantiation, the returned instance should not be stored -- it will +be kept alive automatically for the duration of the drag-and-drop. + +When a drag-and-drop is already in process for the Tk interpreter, the +call is *ignored*; this normally averts starting multiple simultaneous +dnd processes, e.g. because different button callbacks all +dnd_start(). + +The object is *not* necessarily a widget -- it can be any +application-specific object that is meaningful to potential +drag-and-drop targets. + +Potential drag-and-drop targets are discovered as follows. Whenever +the mouse moves, and at the start and end of a drag-and-drop move, the +Tk widget directly under the mouse is inspected. This is the target +widget (not to be confused with the target object, yet to be +determined). If there is no target widget, there is no dnd target +object. If there is a target widget, and it has an attribute +dnd_accept, this should be a function (or any callable object). The +function is called as dnd_accept(source, event), where 'source' is the +object being dragged (the object passed to dnd_start() above), and +'event' is the most recent event object (generally a <Motion> event; +it can also be <ButtonPress> or <ButtonRelease>). If the dnd_accept() +function returns something other than None, this is the new dnd target +object. If dnd_accept() returns None, or if the target widget has no +dnd_accept attribute, the target widget's parent is considered as the +target widget, and the search for a target object is repeated from +there. If necessary, the search is repeated all the way up to the +root widget. If none of the target widgets can produce a target +object, there is no target object (the target object is None). + +The target object thus produced, if any, is called the new target +object. It is compared with the old target object (or None, if there +was no old target widget). There are several cases ('source' is the +source object, and 'event' is the most recent event object): + +- Both the old and new target objects are None. Nothing happens. + +- The old and new target objects are the same object. Its method +dnd_motion(source, event) is called. + +- The old target object was None, and the new target object is not +None. The new target object's method dnd_enter(source, event) is +called. + +- The new target object is None, and the old target object is not +None. The old target object's method dnd_leave(source, event) is +called. + +- The old and new target objects differ and neither is None. The old +target object's method dnd_leave(source, event), and then the new +target object's method dnd_enter(source, event) is called. + +Once this is done, the new target object replaces the old one, and the +Tk mainloop proceeds. The return value of the methods mentioned above +is ignored; if they raise an exception, the normal exception handling +mechanisms take over. + +The drag-and-drop processes can end in two ways: a final target object +is selected, or no final target object is selected. When a final +target object is selected, it will always have been notified of the +potential drop by a call to its dnd_enter() method, as described +above, and possibly one or more calls to its dnd_motion() method; its +dnd_leave() method has not been called since the last call to +dnd_enter(). The target is notified of the drop by a call to its +method dnd_commit(source, event). + +If no final target object is selected, and there was an old target +object, its dnd_leave(source, event) method is called to complete the +dnd sequence. + +Finally, the source object is notified that the drag-and-drop process +is over, by a call to source.dnd_end(target, event), specifying either +the selected target object, or None if no target object was selected. +The source object can use this to implement the commit action; this is +sometimes simpler than to do it in the target's dnd_commit(). The +target's dnd_commit() method could then simply be aliased to +dnd_leave(). + +At any time during a dnd sequence, the application can cancel the +sequence by calling the cancel() method on the object returned by +dnd_start(). This will call dnd_leave() if a target is currently +active; it will never call dnd_commit(). + +""" + + +import Tkinter + + +# The factory function + +def dnd_start(source, event): + h = DndHandler(source, event) + if h.root: + return h + else: + return None + + +# The class that does the work + +class DndHandler: + + root = None + + def __init__(self, source, event): + if event.num > 5: + return + root = event.widget._root() + try: + root.__dnd + return # Don't start recursive dnd + except AttributeError: + root.__dnd = self + self.root = root + self.source = source + self.target = None + self.initial_button = button = event.num + self.initial_widget = widget = event.widget + self.release_pattern = "<B%d-ButtonRelease-%d>" % (button, button) + self.save_cursor = widget['cursor'] or "" + widget.bind(self.release_pattern, self.on_release) + widget.bind("<Motion>", self.on_motion) + widget['cursor'] = "hand2" + + def __del__(self): + root = self.root + self.root = None + if root: + try: + del root.__dnd + except AttributeError: + pass + + def on_motion(self, event): + x, y = event.x_root, event.y_root + target_widget = self.initial_widget.winfo_containing(x, y) + source = self.source + new_target = None + while target_widget: + try: + attr = target_widget.dnd_accept + except AttributeError: + pass + else: + new_target = attr(source, event) + if new_target: + break + target_widget = target_widget.master + old_target = self.target + if old_target is new_target: + if old_target: + old_target.dnd_motion(source, event) + else: + if old_target: + self.target = None + old_target.dnd_leave(source, event) + if new_target: + new_target.dnd_enter(source, event) + self.target = new_target + + def on_release(self, event): + self.finish(event, 1) + + def cancel(self, event=None): + self.finish(event, 0) + + def finish(self, event, commit=0): + target = self.target + source = self.source + widget = self.initial_widget + root = self.root + try: + del root.__dnd + self.initial_widget.unbind(self.release_pattern) + self.initial_widget.unbind("<Motion>") + widget['cursor'] = self.save_cursor + self.target = self.source = self.initial_widget = self.root = None + if target: + if commit: + target.dnd_commit(source, event) + else: + target.dnd_leave(source, event) + finally: + source.dnd_end(target, event) + + + +# ---------------------------------------------------------------------- +# The rest is here for testing and demonstration purposes only! + +class Icon: + + def __init__(self, name): + self.name = name + self.canvas = self.label = self.id = None + + def attach(self, canvas, x=10, y=10): + if canvas is self.canvas: + self.canvas.coords(self.id, x, y) + return + if self.canvas: + self.detach() + if not canvas: + return + label = Tkinter.Label(canvas, text=self.name, + borderwidth=2, relief="raised") + id = canvas.create_window(x, y, window=label, anchor="nw") + self.canvas = canvas + self.label = label + self.id = id + label.bind("<ButtonPress>", self.press) + + def detach(self): + canvas = self.canvas + if not canvas: + return + id = self.id + label = self.label + self.canvas = self.label = self.id = None + canvas.delete(id) + label.destroy() + + def press(self, event): + if dnd_start(self, event): + # where the pointer is relative to the label widget: + self.x_off = event.x + self.y_off = event.y + # where the widget is relative to the canvas: + self.x_orig, self.y_orig = self.canvas.coords(self.id) + + def move(self, event): + x, y = self.where(self.canvas, event) + self.canvas.coords(self.id, x, y) + + def putback(self): + self.canvas.coords(self.id, self.x_orig, self.y_orig) + + def where(self, canvas, event): + # where the corner of the canvas is relative to the screen: + x_org = canvas.winfo_rootx() + y_org = canvas.winfo_rooty() + # where the pointer is relative to the canvas widget: + x = event.x_root - x_org + y = event.y_root - y_org + # compensate for initial pointer offset + return x - self.x_off, y - self.y_off + + def dnd_end(self, target, event): + pass + +class Tester: + + def __init__(self, root): + self.top = Tkinter.Toplevel(root) + self.canvas = Tkinter.Canvas(self.top, width=100, height=100) + self.canvas.pack(fill="both", expand=1) + self.canvas.dnd_accept = self.dnd_accept + + def dnd_accept(self, source, event): + return self + + def dnd_enter(self, source, event): + self.canvas.focus_set() # Show highlight border + x, y = source.where(self.canvas, event) + x1, y1, x2, y2 = source.canvas.bbox(source.id) + dx, dy = x2-x1, y2-y1 + self.dndid = self.canvas.create_rectangle(x, y, x+dx, y+dy) + self.dnd_motion(source, event) + + def dnd_motion(self, source, event): + x, y = source.where(self.canvas, event) + x1, y1, x2, y2 = self.canvas.bbox(self.dndid) + self.canvas.move(self.dndid, x-x1, y-y1) + + def dnd_leave(self, source, event): + self.top.focus_set() # Hide highlight border + self.canvas.delete(self.dndid) + self.dndid = None + + def dnd_commit(self, source, event): + self.dnd_leave(source, event) + x, y = source.where(self.canvas, event) + source.attach(self.canvas, x, y) + +def test(): + root = Tkinter.Tk() + root.geometry("+1+1") + Tkinter.Button(command=root.quit, text="Quit").pack() + t1 = Tester(root) + t1.top.geometry("+1+60") + t2 = Tester(root) + t2.top.geometry("+120+60") + t3 = Tester(root) + t3.top.geometry("+240+60") + i1 = Icon("ICON1") + i2 = Icon("ICON2") + i3 = Icon("ICON3") + i1.attach(t1.canvas) + i2.attach(t2.canvas) + i3.attach(t3.canvas) + root.mainloop() + +if __name__ == '__main__': + test() diff --git a/contrib/tools/python/src/Lib/lib-tk/Tkinter.py b/contrib/tools/python/src/Lib/lib-tk/Tkinter.py new file mode 100644 index 0000000000..6c02955928 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/Tkinter.py @@ -0,0 +1,3867 @@ +"""Wrapper functions for Tcl/Tk. + +Tkinter provides classes which allow the display, positioning and +control of widgets. Toplevel widgets are Tk and Toplevel. Other +widgets are Frame, Label, Entry, Text, Canvas, Button, Radiobutton, +Checkbutton, Scale, Listbox, Scrollbar, OptionMenu, Spinbox +LabelFrame and PanedWindow. + +Properties of the widgets are specified with keyword arguments. +Keyword arguments have the same name as the corresponding resource +under Tk. + +Widgets are positioned with one of the geometry managers Place, Pack +or Grid. These managers can be called with methods place, pack, grid +available in every Widget. + +Actions are bound to events by resources (e.g. keyword argument +command) or with the method bind. + +Example (Hello, World): +import Tkinter +from Tkconstants import * +tk = Tkinter.Tk() +frame = Tkinter.Frame(tk, relief=RIDGE, borderwidth=2) +frame.pack(fill=BOTH,expand=1) +label = Tkinter.Label(frame, text="Hello, World") +label.pack(fill=X, expand=1) +button = Tkinter.Button(frame,text="Exit",command=tk.destroy) +button.pack(side=BOTTOM) +tk.mainloop() +""" + +__version__ = "$Revision: 81008 $" + +import sys +if sys.platform == "win32": + # Attempt to configure Tcl/Tk without requiring PATH + import FixTk +import _tkinter # If this fails your Python may not be configured for Tk +tkinter = _tkinter # b/w compat for export +TclError = _tkinter.TclError +from types import * +from Tkconstants import * +import re + +wantobjects = 1 + +TkVersion = float(_tkinter.TK_VERSION) +TclVersion = float(_tkinter.TCL_VERSION) + +READABLE = _tkinter.READABLE +WRITABLE = _tkinter.WRITABLE +EXCEPTION = _tkinter.EXCEPTION + +# These are not always defined, e.g. not on Win32 with Tk 8.0 :-( +try: _tkinter.createfilehandler +except AttributeError: _tkinter.createfilehandler = None +try: _tkinter.deletefilehandler +except AttributeError: _tkinter.deletefilehandler = None + + +_magic_re = re.compile(r'([\\{}])') +_space_re = re.compile(r'([\s])') + +def _join(value): + """Internal function.""" + return ' '.join(map(_stringify, value)) + +def _stringify(value): + """Internal function.""" + if isinstance(value, (list, tuple)): + if len(value) == 1: + value = _stringify(value[0]) + if _magic_re.search(value): + value = '{%s}' % value + else: + value = '{%s}' % _join(value) + else: + if isinstance(value, str): + value = unicode(value, 'utf-8') + elif not isinstance(value, unicode): + value = str(value) + if not value: + value = '{}' + elif _magic_re.search(value): + # add '\' before special characters and spaces + value = _magic_re.sub(r'\\\1', value) + value = value.replace('\n', r'\n') + value = _space_re.sub(r'\\\1', value) + if value[0] == '"': + value = '\\' + value + elif value[0] == '"' or _space_re.search(value): + value = '{%s}' % value + return value + +def _flatten(tuple): + """Internal function.""" + res = () + for item in tuple: + if type(item) in (TupleType, ListType): + res = res + _flatten(item) + elif item is not None: + res = res + (item,) + return res + +try: _flatten = _tkinter._flatten +except AttributeError: pass + +def _cnfmerge(cnfs): + """Internal function.""" + if type(cnfs) is DictionaryType: + return cnfs + elif type(cnfs) in (NoneType, StringType): + return cnfs + else: + cnf = {} + for c in _flatten(cnfs): + try: + cnf.update(c) + except (AttributeError, TypeError), msg: + print "_cnfmerge: fallback due to:", msg + for k, v in c.items(): + cnf[k] = v + return cnf + +try: _cnfmerge = _tkinter._cnfmerge +except AttributeError: pass + +def _splitdict(tk, v, cut_minus=True, conv=None): + """Return a properly formatted dict built from Tcl list pairs. + + If cut_minus is True, the supposed '-' prefix will be removed from + keys. If conv is specified, it is used to convert values. + + Tcl list is expected to contain an even number of elements. + """ + t = tk.splitlist(v) + if len(t) % 2: + raise RuntimeError('Tcl list representing a dict is expected ' + 'to contain an even number of elements') + it = iter(t) + dict = {} + for key, value in zip(it, it): + key = str(key) + if cut_minus and key[0] == '-': + key = key[1:] + if conv: + value = conv(value) + dict[key] = value + return dict + +class Event: + """Container for the properties of an event. + + Instances of this type are generated if one of the following events occurs: + + KeyPress, KeyRelease - for keyboard events + ButtonPress, ButtonRelease, Motion, Enter, Leave, MouseWheel - for mouse events + Visibility, Unmap, Map, Expose, FocusIn, FocusOut, Circulate, + Colormap, Gravity, Reparent, Property, Destroy, Activate, + Deactivate - for window events. + + If a callback function for one of these events is registered + using bind, bind_all, bind_class, or tag_bind, the callback is + called with an Event as first argument. It will have the + following attributes (in braces are the event types for which + the attribute is valid): + + serial - serial number of event + num - mouse button pressed (ButtonPress, ButtonRelease) + focus - whether the window has the focus (Enter, Leave) + height - height of the exposed window (Configure, Expose) + width - width of the exposed window (Configure, Expose) + keycode - keycode of the pressed key (KeyPress, KeyRelease) + state - state of the event as a number (ButtonPress, ButtonRelease, + Enter, KeyPress, KeyRelease, + Leave, Motion) + state - state as a string (Visibility) + time - when the event occurred + x - x-position of the mouse + y - y-position of the mouse + x_root - x-position of the mouse on the screen + (ButtonPress, ButtonRelease, KeyPress, KeyRelease, Motion) + y_root - y-position of the mouse on the screen + (ButtonPress, ButtonRelease, KeyPress, KeyRelease, Motion) + char - pressed character (KeyPress, KeyRelease) + send_event - see X/Windows documentation + keysym - keysym of the event as a string (KeyPress, KeyRelease) + keysym_num - keysym of the event as a number (KeyPress, KeyRelease) + type - type of the event as a number + widget - widget in which the event occurred + delta - delta of wheel movement (MouseWheel) + """ + pass + +_support_default_root = 1 +_default_root = None + +def NoDefaultRoot(): + """Inhibit setting of default root window. + + Call this function to inhibit that the first instance of + Tk is used for windows without an explicit parent window. + """ + global _support_default_root + _support_default_root = 0 + global _default_root + _default_root = None + del _default_root + +def _tkerror(err): + """Internal function.""" + pass + +def _exit(code=0): + """Internal function. Calling it will raise the exception SystemExit.""" + try: + code = int(code) + except ValueError: + pass + raise SystemExit, code + +_varnum = 0 +class Variable: + """Class to define value holders for e.g. buttons. + + Subclasses StringVar, IntVar, DoubleVar, BooleanVar are specializations + that constrain the type of the value returned from get().""" + _default = "" + _tclCommands = None + def __init__(self, master=None, value=None, name=None): + """Construct a variable + + MASTER can be given as master widget. + VALUE is an optional value (defaults to "") + NAME is an optional Tcl name (defaults to PY_VARnum). + + If NAME matches an existing variable and VALUE is omitted + then the existing value is retained. + """ + global _varnum + if not master: + master = _default_root + self._root = master._root() + self._tk = master.tk + if name: + self._name = name + else: + self._name = 'PY_VAR' + repr(_varnum) + _varnum += 1 + if value is not None: + self.set(value) + elif not self._tk.getboolean(self._tk.call("info", "exists", self._name)): + self.set(self._default) + def __del__(self): + """Unset the variable in Tcl.""" + if self._tk is None: + return + if self._tk.getboolean(self._tk.call("info", "exists", self._name)): + self._tk.globalunsetvar(self._name) + if self._tclCommands is not None: + for name in self._tclCommands: + #print '- Tkinter: deleted command', name + self._tk.deletecommand(name) + self._tclCommands = None + def __str__(self): + """Return the name of the variable in Tcl.""" + return self._name + def set(self, value): + """Set the variable to VALUE.""" + return self._tk.globalsetvar(self._name, value) + def get(self): + """Return value of variable.""" + return self._tk.globalgetvar(self._name) + def trace_variable(self, mode, callback): + """Define a trace callback for the variable. + + MODE is one of "r", "w", "u" for read, write, undefine. + CALLBACK must be a function which is called when + the variable is read, written or undefined. + + Return the name of the callback. + """ + f = CallWrapper(callback, None, self._root).__call__ + cbname = repr(id(f)) + try: + callback = callback.im_func + except AttributeError: + pass + try: + cbname = cbname + callback.__name__ + except AttributeError: + pass + self._tk.createcommand(cbname, f) + if self._tclCommands is None: + self._tclCommands = [] + self._tclCommands.append(cbname) + self._tk.call("trace", "variable", self._name, mode, cbname) + return cbname + trace = trace_variable + def trace_vdelete(self, mode, cbname): + """Delete the trace callback for a variable. + + MODE is one of "r", "w", "u" for read, write, undefine. + CBNAME is the name of the callback returned from trace_variable or trace. + """ + self._tk.call("trace", "vdelete", self._name, mode, cbname) + cbname = self._tk.splitlist(cbname)[0] + for m, ca in self.trace_vinfo(): + if self._tk.splitlist(ca)[0] == cbname: + break + else: + self._tk.deletecommand(cbname) + try: + self._tclCommands.remove(cbname) + except ValueError: + pass + def trace_vinfo(self): + """Return all trace callback information.""" + return map(self._tk.splitlist, self._tk.splitlist( + self._tk.call("trace", "vinfo", self._name))) + def __eq__(self, other): + """Comparison for equality (==). + + Note: if the Variable's master matters to behavior + also compare self._master == other._master + """ + return self.__class__.__name__ == other.__class__.__name__ \ + and self._name == other._name + +class StringVar(Variable): + """Value holder for strings variables.""" + _default = "" + def __init__(self, master=None, value=None, name=None): + """Construct a string variable. + + MASTER can be given as master widget. + VALUE is an optional value (defaults to "") + NAME is an optional Tcl name (defaults to PY_VARnum). + + If NAME matches an existing variable and VALUE is omitted + then the existing value is retained. + """ + Variable.__init__(self, master, value, name) + + def get(self): + """Return value of variable as string.""" + value = self._tk.globalgetvar(self._name) + if isinstance(value, basestring): + return value + return str(value) + +class IntVar(Variable): + """Value holder for integer variables.""" + _default = 0 + def __init__(self, master=None, value=None, name=None): + """Construct an integer variable. + + MASTER can be given as master widget. + VALUE is an optional value (defaults to 0) + NAME is an optional Tcl name (defaults to PY_VARnum). + + If NAME matches an existing variable and VALUE is omitted + then the existing value is retained. + """ + Variable.__init__(self, master, value, name) + + def set(self, value): + """Set the variable to value, converting booleans to integers.""" + if isinstance(value, bool): + value = int(value) + return Variable.set(self, value) + + def get(self): + """Return the value of the variable as an integer.""" + return getint(self._tk.globalgetvar(self._name)) + +class DoubleVar(Variable): + """Value holder for float variables.""" + _default = 0.0 + def __init__(self, master=None, value=None, name=None): + """Construct a float variable. + + MASTER can be given as master widget. + VALUE is an optional value (defaults to 0.0) + NAME is an optional Tcl name (defaults to PY_VARnum). + + If NAME matches an existing variable and VALUE is omitted + then the existing value is retained. + """ + Variable.__init__(self, master, value, name) + + def get(self): + """Return the value of the variable as a float.""" + return getdouble(self._tk.globalgetvar(self._name)) + +class BooleanVar(Variable): + """Value holder for boolean variables.""" + _default = False + def __init__(self, master=None, value=None, name=None): + """Construct a boolean variable. + + MASTER can be given as master widget. + VALUE is an optional value (defaults to False) + NAME is an optional Tcl name (defaults to PY_VARnum). + + If NAME matches an existing variable and VALUE is omitted + then the existing value is retained. + """ + Variable.__init__(self, master, value, name) + + def set(self, value): + """Set the variable to VALUE.""" + return self._tk.globalsetvar(self._name, self._tk.getboolean(value)) + + def get(self): + """Return the value of the variable as a bool.""" + return self._tk.getboolean(self._tk.globalgetvar(self._name)) + +def mainloop(n=0): + """Run the main loop of Tcl.""" + _default_root.tk.mainloop(n) + +getint = int + +getdouble = float + +def getboolean(s): + """Convert true and false to integer values 1 and 0.""" + return _default_root.tk.getboolean(s) + +# Methods defined on both toplevel and interior widgets +class Misc: + """Internal class. + + Base class which defines methods common for interior widgets.""" + + # XXX font command? + _tclCommands = None + def destroy(self): + """Internal function. + + Delete all Tcl commands created for + this widget in the Tcl interpreter.""" + if self._tclCommands is not None: + for name in self._tclCommands: + #print '- Tkinter: deleted command', name + self.tk.deletecommand(name) + self._tclCommands = None + def deletecommand(self, name): + """Internal function. + + Delete the Tcl command provided in NAME.""" + #print '- Tkinter: deleted command', name + self.tk.deletecommand(name) + try: + self._tclCommands.remove(name) + except ValueError: + pass + def tk_strictMotif(self, boolean=None): + """Set Tcl internal variable, whether the look and feel + should adhere to Motif. + + A parameter of 1 means adhere to Motif (e.g. no color + change if mouse passes over slider). + Returns the set value.""" + return self.tk.getboolean(self.tk.call( + 'set', 'tk_strictMotif', boolean)) + def tk_bisque(self): + """Change the color scheme to light brown as used in Tk 3.6 and before.""" + self.tk.call('tk_bisque') + def tk_setPalette(self, *args, **kw): + """Set a new color scheme for all widget elements. + + A single color as argument will cause that all colors of Tk + widget elements are derived from this. + Alternatively several keyword parameters and its associated + colors can be given. The following keywords are valid: + activeBackground, foreground, selectColor, + activeForeground, highlightBackground, selectBackground, + background, highlightColor, selectForeground, + disabledForeground, insertBackground, troughColor.""" + self.tk.call(('tk_setPalette',) + + _flatten(args) + _flatten(kw.items())) + def tk_menuBar(self, *args): + """Do not use. Needed in Tk 3.6 and earlier.""" + # obsolete since Tk 4.0 + import warnings + warnings.warn('tk_menuBar() does nothing and will be removed in 3.6', + DeprecationWarning, stacklevel=2) + def wait_variable(self, name='PY_VAR'): + """Wait until the variable is modified. + + A parameter of type IntVar, StringVar, DoubleVar or + BooleanVar must be given.""" + self.tk.call('tkwait', 'variable', name) + waitvar = wait_variable # XXX b/w compat + def wait_window(self, window=None): + """Wait until a WIDGET is destroyed. + + If no parameter is given self is used.""" + if window is None: + window = self + self.tk.call('tkwait', 'window', window._w) + def wait_visibility(self, window=None): + """Wait until the visibility of a WIDGET changes + (e.g. it appears). + + If no parameter is given self is used.""" + if window is None: + window = self + self.tk.call('tkwait', 'visibility', window._w) + def setvar(self, name='PY_VAR', value='1'): + """Set Tcl variable NAME to VALUE.""" + self.tk.setvar(name, value) + def getvar(self, name='PY_VAR'): + """Return value of Tcl variable NAME.""" + return self.tk.getvar(name) + getint = int + getdouble = float + def getboolean(self, s): + """Return a boolean value for Tcl boolean values true and false given as parameter.""" + return self.tk.getboolean(s) + def focus_set(self): + """Direct input focus to this widget. + + If the application currently does not have the focus + this widget will get the focus if the application gets + the focus through the window manager.""" + self.tk.call('focus', self._w) + focus = focus_set # XXX b/w compat? + def focus_force(self): + """Direct input focus to this widget even if the + application does not have the focus. Use with + caution!""" + self.tk.call('focus', '-force', self._w) + def focus_get(self): + """Return the widget which has currently the focus in the + application. + + Use focus_displayof to allow working with several + displays. Return None if application does not have + the focus.""" + name = self.tk.call('focus') + if name == 'none' or not name: return None + return self._nametowidget(name) + def focus_displayof(self): + """Return the widget which has currently the focus on the + display where this widget is located. + + Return None if the application does not have the focus.""" + name = self.tk.call('focus', '-displayof', self._w) + if name == 'none' or not name: return None + return self._nametowidget(name) + def focus_lastfor(self): + """Return the widget which would have the focus if top level + for this widget gets the focus from the window manager.""" + name = self.tk.call('focus', '-lastfor', self._w) + if name == 'none' or not name: return None + return self._nametowidget(name) + def tk_focusFollowsMouse(self): + """The widget under mouse will get automatically focus. Can not + be disabled easily.""" + self.tk.call('tk_focusFollowsMouse') + def tk_focusNext(self): + """Return the next widget in the focus order which follows + widget which has currently the focus. + + The focus order first goes to the next child, then to + the children of the child recursively and then to the + next sibling which is higher in the stacking order. A + widget is omitted if it has the takefocus resource set + to 0.""" + name = self.tk.call('tk_focusNext', self._w) + if not name: return None + return self._nametowidget(name) + def tk_focusPrev(self): + """Return previous widget in the focus order. See tk_focusNext for details.""" + name = self.tk.call('tk_focusPrev', self._w) + if not name: return None + return self._nametowidget(name) + def after(self, ms, func=None, *args): + """Call function once after given time. + + MS specifies the time in milliseconds. FUNC gives the + function which shall be called. Additional parameters + are given as parameters to the function call. Return + identifier to cancel scheduling with after_cancel.""" + if not func: + # I'd rather use time.sleep(ms*0.001) + self.tk.call('after', ms) + return None + else: + def callit(): + try: + func(*args) + finally: + try: + self.deletecommand(name) + except TclError: + pass + callit.__name__ = func.__name__ + name = self._register(callit) + return self.tk.call('after', ms, name) + def after_idle(self, func, *args): + """Call FUNC once if the Tcl main loop has no event to + process. + + Return an identifier to cancel the scheduling with + after_cancel.""" + return self.after('idle', func, *args) + def after_cancel(self, id): + """Cancel scheduling of function identified with ID. + + Identifier returned by after or after_idle must be + given as first parameter. + """ + if not id: + raise ValueError('id must be a valid identifier returned from ' + 'after or after_idle') + try: + data = self.tk.call('after', 'info', id) + script = self.tk.splitlist(data)[0] + self.deletecommand(script) + except TclError: + pass + self.tk.call('after', 'cancel', id) + def bell(self, displayof=0): + """Ring a display's bell.""" + self.tk.call(('bell',) + self._displayof(displayof)) + + # Clipboard handling: + def clipboard_get(self, **kw): + """Retrieve data from the clipboard on window's display. + + The window keyword defaults to the root window of the Tkinter + application. + + The type keyword specifies the form in which the data is + to be returned and should be an atom name such as STRING + or FILE_NAME. Type defaults to STRING, except on X11, where the default + is to try UTF8_STRING and fall back to STRING. + + This command is equivalent to: + + selection_get(CLIPBOARD) + """ + if 'type' not in kw and self._windowingsystem == 'x11': + try: + kw['type'] = 'UTF8_STRING' + return self.tk.call(('clipboard', 'get') + self._options(kw)) + except TclError: + del kw['type'] + return self.tk.call(('clipboard', 'get') + self._options(kw)) + + def clipboard_clear(self, **kw): + """Clear the data in the Tk clipboard. + + A widget specified for the optional displayof keyword + argument specifies the target display.""" + if 'displayof' not in kw: kw['displayof'] = self._w + self.tk.call(('clipboard', 'clear') + self._options(kw)) + def clipboard_append(self, string, **kw): + """Append STRING to the Tk clipboard. + + A widget specified at the optional displayof keyword + argument specifies the target display. The clipboard + can be retrieved with selection_get.""" + if 'displayof' not in kw: kw['displayof'] = self._w + self.tk.call(('clipboard', 'append') + self._options(kw) + + ('--', string)) + # XXX grab current w/o window argument + def grab_current(self): + """Return widget which has currently the grab in this application + or None.""" + name = self.tk.call('grab', 'current', self._w) + if not name: return None + return self._nametowidget(name) + def grab_release(self): + """Release grab for this widget if currently set.""" + self.tk.call('grab', 'release', self._w) + def grab_set(self): + """Set grab for this widget. + + A grab directs all events to this and descendant + widgets in the application.""" + self.tk.call('grab', 'set', self._w) + def grab_set_global(self): + """Set global grab for this widget. + + A global grab directs all events to this and + descendant widgets on the display. Use with caution - + other applications do not get events anymore.""" + self.tk.call('grab', 'set', '-global', self._w) + def grab_status(self): + """Return None, "local" or "global" if this widget has + no, a local or a global grab.""" + status = self.tk.call('grab', 'status', self._w) + if status == 'none': status = None + return status + def option_add(self, pattern, value, priority = None): + """Set a VALUE (second parameter) for an option + PATTERN (first parameter). + + An optional third parameter gives the numeric priority + (defaults to 80).""" + self.tk.call('option', 'add', pattern, value, priority) + def option_clear(self): + """Clear the option database. + + It will be reloaded if option_add is called.""" + self.tk.call('option', 'clear') + def option_get(self, name, className): + """Return the value for an option NAME for this widget + with CLASSNAME. + + Values with higher priority override lower values.""" + return self.tk.call('option', 'get', self._w, name, className) + def option_readfile(self, fileName, priority = None): + """Read file FILENAME into the option database. + + An optional second parameter gives the numeric + priority.""" + self.tk.call('option', 'readfile', fileName, priority) + def selection_clear(self, **kw): + """Clear the current X selection.""" + if 'displayof' not in kw: kw['displayof'] = self._w + self.tk.call(('selection', 'clear') + self._options(kw)) + def selection_get(self, **kw): + """Return the contents of the current X selection. + + A keyword parameter selection specifies the name of + the selection and defaults to PRIMARY. A keyword + parameter displayof specifies a widget on the display + to use. A keyword parameter type specifies the form of data to be + fetched, defaulting to STRING except on X11, where UTF8_STRING is tried + before STRING.""" + if 'displayof' not in kw: kw['displayof'] = self._w + if 'type' not in kw and self._windowingsystem == 'x11': + try: + kw['type'] = 'UTF8_STRING' + return self.tk.call(('selection', 'get') + self._options(kw)) + except TclError: + del kw['type'] + return self.tk.call(('selection', 'get') + self._options(kw)) + def selection_handle(self, command, **kw): + """Specify a function COMMAND to call if the X + selection owned by this widget is queried by another + application. + + This function must return the contents of the + selection. The function will be called with the + arguments OFFSET and LENGTH which allows the chunking + of very long selections. The following keyword + parameters can be provided: + selection - name of the selection (default PRIMARY), + type - type of the selection (e.g. STRING, FILE_NAME).""" + name = self._register(command) + self.tk.call(('selection', 'handle') + self._options(kw) + + (self._w, name)) + def selection_own(self, **kw): + """Become owner of X selection. + + A keyword parameter selection specifies the name of + the selection (default PRIMARY).""" + self.tk.call(('selection', 'own') + + self._options(kw) + (self._w,)) + def selection_own_get(self, **kw): + """Return owner of X selection. + + The following keyword parameter can + be provided: + selection - name of the selection (default PRIMARY), + type - type of the selection (e.g. STRING, FILE_NAME).""" + if 'displayof' not in kw: kw['displayof'] = self._w + name = self.tk.call(('selection', 'own') + self._options(kw)) + if not name: return None + return self._nametowidget(name) + def send(self, interp, cmd, *args): + """Send Tcl command CMD to different interpreter INTERP to be executed.""" + return self.tk.call(('send', interp, cmd) + args) + def lower(self, belowThis=None): + """Lower this widget in the stacking order.""" + self.tk.call('lower', self._w, belowThis) + def tkraise(self, aboveThis=None): + """Raise this widget in the stacking order.""" + self.tk.call('raise', self._w, aboveThis) + lift = tkraise + def colormodel(self, value=None): + """Useless. Not implemented in Tk.""" + return self.tk.call('tk', 'colormodel', self._w, value) + def winfo_atom(self, name, displayof=0): + """Return integer which represents atom NAME.""" + args = ('winfo', 'atom') + self._displayof(displayof) + (name,) + return getint(self.tk.call(args)) + def winfo_atomname(self, id, displayof=0): + """Return name of atom with identifier ID.""" + args = ('winfo', 'atomname') \ + + self._displayof(displayof) + (id,) + return self.tk.call(args) + def winfo_cells(self): + """Return number of cells in the colormap for this widget.""" + return getint( + self.tk.call('winfo', 'cells', self._w)) + def winfo_children(self): + """Return a list of all widgets which are children of this widget.""" + result = [] + for child in self.tk.splitlist( + self.tk.call('winfo', 'children', self._w)): + try: + # Tcl sometimes returns extra windows, e.g. for + # menus; those need to be skipped + result.append(self._nametowidget(child)) + except KeyError: + pass + return result + + def winfo_class(self): + """Return window class name of this widget.""" + return self.tk.call('winfo', 'class', self._w) + def winfo_colormapfull(self): + """Return true if at the last color request the colormap was full.""" + return self.tk.getboolean( + self.tk.call('winfo', 'colormapfull', self._w)) + def winfo_containing(self, rootX, rootY, displayof=0): + """Return the widget which is at the root coordinates ROOTX, ROOTY.""" + args = ('winfo', 'containing') \ + + self._displayof(displayof) + (rootX, rootY) + name = self.tk.call(args) + if not name: return None + return self._nametowidget(name) + def winfo_depth(self): + """Return the number of bits per pixel.""" + return getint(self.tk.call('winfo', 'depth', self._w)) + def winfo_exists(self): + """Return true if this widget exists.""" + return getint( + self.tk.call('winfo', 'exists', self._w)) + def winfo_fpixels(self, number): + """Return the number of pixels for the given distance NUMBER + (e.g. "3c") as float.""" + return getdouble(self.tk.call( + 'winfo', 'fpixels', self._w, number)) + def winfo_geometry(self): + """Return geometry string for this widget in the form "widthxheight+X+Y".""" + return self.tk.call('winfo', 'geometry', self._w) + def winfo_height(self): + """Return height of this widget.""" + return getint( + self.tk.call('winfo', 'height', self._w)) + def winfo_id(self): + """Return identifier ID for this widget.""" + return int(self.tk.call('winfo', 'id', self._w), 0) + def winfo_interps(self, displayof=0): + """Return the name of all Tcl interpreters for this display.""" + args = ('winfo', 'interps') + self._displayof(displayof) + return self.tk.splitlist(self.tk.call(args)) + def winfo_ismapped(self): + """Return true if this widget is mapped.""" + return getint( + self.tk.call('winfo', 'ismapped', self._w)) + def winfo_manager(self): + """Return the window manager name for this widget.""" + return self.tk.call('winfo', 'manager', self._w) + def winfo_name(self): + """Return the name of this widget.""" + return self.tk.call('winfo', 'name', self._w) + def winfo_parent(self): + """Return the name of the parent of this widget.""" + return self.tk.call('winfo', 'parent', self._w) + def winfo_pathname(self, id, displayof=0): + """Return the pathname of the widget given by ID.""" + args = ('winfo', 'pathname') \ + + self._displayof(displayof) + (id,) + return self.tk.call(args) + def winfo_pixels(self, number): + """Rounded integer value of winfo_fpixels.""" + return getint( + self.tk.call('winfo', 'pixels', self._w, number)) + def winfo_pointerx(self): + """Return the x coordinate of the pointer on the root window.""" + return getint( + self.tk.call('winfo', 'pointerx', self._w)) + def winfo_pointerxy(self): + """Return a tuple of x and y coordinates of the pointer on the root window.""" + return self._getints( + self.tk.call('winfo', 'pointerxy', self._w)) + def winfo_pointery(self): + """Return the y coordinate of the pointer on the root window.""" + return getint( + self.tk.call('winfo', 'pointery', self._w)) + def winfo_reqheight(self): + """Return requested height of this widget.""" + return getint( + self.tk.call('winfo', 'reqheight', self._w)) + def winfo_reqwidth(self): + """Return requested width of this widget.""" + return getint( + self.tk.call('winfo', 'reqwidth', self._w)) + def winfo_rgb(self, color): + """Return tuple of decimal values for red, green, blue for + COLOR in this widget.""" + return self._getints( + self.tk.call('winfo', 'rgb', self._w, color)) + def winfo_rootx(self): + """Return x coordinate of upper left corner of this widget on the + root window.""" + return getint( + self.tk.call('winfo', 'rootx', self._w)) + def winfo_rooty(self): + """Return y coordinate of upper left corner of this widget on the + root window.""" + return getint( + self.tk.call('winfo', 'rooty', self._w)) + def winfo_screen(self): + """Return the screen name of this widget.""" + return self.tk.call('winfo', 'screen', self._w) + def winfo_screencells(self): + """Return the number of the cells in the colormap of the screen + of this widget.""" + return getint( + self.tk.call('winfo', 'screencells', self._w)) + def winfo_screendepth(self): + """Return the number of bits per pixel of the root window of the + screen of this widget.""" + return getint( + self.tk.call('winfo', 'screendepth', self._w)) + def winfo_screenheight(self): + """Return the number of pixels of the height of the screen of this widget + in pixel.""" + return getint( + self.tk.call('winfo', 'screenheight', self._w)) + def winfo_screenmmheight(self): + """Return the number of pixels of the height of the screen of + this widget in mm.""" + return getint( + self.tk.call('winfo', 'screenmmheight', self._w)) + def winfo_screenmmwidth(self): + """Return the number of pixels of the width of the screen of + this widget in mm.""" + return getint( + self.tk.call('winfo', 'screenmmwidth', self._w)) + def winfo_screenvisual(self): + """Return one of the strings directcolor, grayscale, pseudocolor, + staticcolor, staticgray, or truecolor for the default + colormodel of this screen.""" + return self.tk.call('winfo', 'screenvisual', self._w) + def winfo_screenwidth(self): + """Return the number of pixels of the width of the screen of + this widget in pixel.""" + return getint( + self.tk.call('winfo', 'screenwidth', self._w)) + def winfo_server(self): + """Return information of the X-Server of the screen of this widget in + the form "XmajorRminor vendor vendorVersion".""" + return self.tk.call('winfo', 'server', self._w) + def winfo_toplevel(self): + """Return the toplevel widget of this widget.""" + return self._nametowidget(self.tk.call( + 'winfo', 'toplevel', self._w)) + def winfo_viewable(self): + """Return true if the widget and all its higher ancestors are mapped.""" + return getint( + self.tk.call('winfo', 'viewable', self._w)) + def winfo_visual(self): + """Return one of the strings directcolor, grayscale, pseudocolor, + staticcolor, staticgray, or truecolor for the + colormodel of this widget.""" + return self.tk.call('winfo', 'visual', self._w) + def winfo_visualid(self): + """Return the X identifier for the visual for this widget.""" + return self.tk.call('winfo', 'visualid', self._w) + def winfo_visualsavailable(self, includeids=0): + """Return a list of all visuals available for the screen + of this widget. + + Each item in the list consists of a visual name (see winfo_visual), a + depth and if INCLUDEIDS=1 is given also the X identifier.""" + data = self.tk.split( + self.tk.call('winfo', 'visualsavailable', self._w, + includeids and 'includeids' or None)) + if type(data) is StringType: + data = [self.tk.split(data)] + return map(self.__winfo_parseitem, data) + def __winfo_parseitem(self, t): + """Internal function.""" + return t[:1] + tuple(map(self.__winfo_getint, t[1:])) + def __winfo_getint(self, x): + """Internal function.""" + return int(x, 0) + def winfo_vrootheight(self): + """Return the height of the virtual root window associated with this + widget in pixels. If there is no virtual root window return the + height of the screen.""" + return getint( + self.tk.call('winfo', 'vrootheight', self._w)) + def winfo_vrootwidth(self): + """Return the width of the virtual root window associated with this + widget in pixel. If there is no virtual root window return the + width of the screen.""" + return getint( + self.tk.call('winfo', 'vrootwidth', self._w)) + def winfo_vrootx(self): + """Return the x offset of the virtual root relative to the root + window of the screen of this widget.""" + return getint( + self.tk.call('winfo', 'vrootx', self._w)) + def winfo_vrooty(self): + """Return the y offset of the virtual root relative to the root + window of the screen of this widget.""" + return getint( + self.tk.call('winfo', 'vrooty', self._w)) + def winfo_width(self): + """Return the width of this widget.""" + return getint( + self.tk.call('winfo', 'width', self._w)) + def winfo_x(self): + """Return the x coordinate of the upper left corner of this widget + in the parent.""" + return getint( + self.tk.call('winfo', 'x', self._w)) + def winfo_y(self): + """Return the y coordinate of the upper left corner of this widget + in the parent.""" + return getint( + self.tk.call('winfo', 'y', self._w)) + def update(self): + """Enter event loop until all pending events have been processed by Tcl.""" + self.tk.call('update') + def update_idletasks(self): + """Enter event loop until all idle callbacks have been called. This + will update the display of windows but not process events caused by + the user.""" + self.tk.call('update', 'idletasks') + def bindtags(self, tagList=None): + """Set or get the list of bindtags for this widget. + + With no argument return the list of all bindtags associated with + this widget. With a list of strings as argument the bindtags are + set to this list. The bindtags determine in which order events are + processed (see bind).""" + if tagList is None: + return self.tk.splitlist( + self.tk.call('bindtags', self._w)) + else: + self.tk.call('bindtags', self._w, tagList) + def _bind(self, what, sequence, func, add, needcleanup=1): + """Internal function.""" + if type(func) is StringType: + self.tk.call(what + (sequence, func)) + elif func: + funcid = self._register(func, self._substitute, + needcleanup) + cmd = ('%sif {"[%s %s]" == "break"} break\n' + % + (add and '+' or '', + funcid, self._subst_format_str)) + self.tk.call(what + (sequence, cmd)) + return funcid + elif sequence: + return self.tk.call(what + (sequence,)) + else: + return self.tk.splitlist(self.tk.call(what)) + def bind(self, sequence=None, func=None, add=None): + """Bind to this widget at event SEQUENCE a call to function FUNC. + + SEQUENCE is a string of concatenated event + patterns. An event pattern is of the form + <MODIFIER-MODIFIER-TYPE-DETAIL> where MODIFIER is one + of Control, Mod2, M2, Shift, Mod3, M3, Lock, Mod4, M4, + Button1, B1, Mod5, M5 Button2, B2, Meta, M, Button3, + B3, Alt, Button4, B4, Double, Button5, B5 Triple, + Mod1, M1. TYPE is one of Activate, Enter, Map, + ButtonPress, Button, Expose, Motion, ButtonRelease + FocusIn, MouseWheel, Circulate, FocusOut, Property, + Colormap, Gravity Reparent, Configure, KeyPress, Key, + Unmap, Deactivate, KeyRelease Visibility, Destroy, + Leave and DETAIL is the button number for ButtonPress, + ButtonRelease and DETAIL is the Keysym for KeyPress and + KeyRelease. Examples are + <Control-Button-1> for pressing Control and mouse button 1 or + <Alt-A> for pressing A and the Alt key (KeyPress can be omitted). + An event pattern can also be a virtual event of the form + <<AString>> where AString can be arbitrary. This + event can be generated by event_generate. + If events are concatenated they must appear shortly + after each other. + + FUNC will be called if the event sequence occurs with an + instance of Event as argument. If the return value of FUNC is + "break" no further bound function is invoked. + + An additional boolean parameter ADD specifies whether FUNC will + be called additionally to the other bound function or whether + it will replace the previous function. + + Bind will return an identifier to allow deletion of the bound function with + unbind without memory leak. + + If FUNC or SEQUENCE is omitted the bound function or list + of bound events are returned.""" + + return self._bind(('bind', self._w), sequence, func, add) + def unbind(self, sequence, funcid=None): + """Unbind for this widget for event SEQUENCE the + function identified with FUNCID.""" + self.tk.call('bind', self._w, sequence, '') + if funcid: + self.deletecommand(funcid) + def bind_all(self, sequence=None, func=None, add=None): + """Bind to all widgets at an event SEQUENCE a call to function FUNC. + An additional boolean parameter ADD specifies whether FUNC will + be called additionally to the other bound function or whether + it will replace the previous function. See bind for the return value.""" + return self._bind(('bind', 'all'), sequence, func, add, 0) + def unbind_all(self, sequence): + """Unbind for all widgets for event SEQUENCE all functions.""" + self.tk.call('bind', 'all' , sequence, '') + def bind_class(self, className, sequence=None, func=None, add=None): + + """Bind to widgets with bindtag CLASSNAME at event + SEQUENCE a call of function FUNC. An additional + boolean parameter ADD specifies whether FUNC will be + called additionally to the other bound function or + whether it will replace the previous function. See bind for + the return value.""" + + return self._bind(('bind', className), sequence, func, add, 0) + def unbind_class(self, className, sequence): + """Unbind for all widgets with bindtag CLASSNAME for event SEQUENCE + all functions.""" + self.tk.call('bind', className , sequence, '') + def mainloop(self, n=0): + """Call the mainloop of Tk.""" + self.tk.mainloop(n) + def quit(self): + """Quit the Tcl interpreter. All widgets will be destroyed.""" + self.tk.quit() + def _getints(self, string): + """Internal function.""" + if string: + return tuple(map(getint, self.tk.splitlist(string))) + def _getdoubles(self, string): + """Internal function.""" + if string: + return tuple(map(getdouble, self.tk.splitlist(string))) + def _getboolean(self, string): + """Internal function.""" + if string: + return self.tk.getboolean(string) + def _displayof(self, displayof): + """Internal function.""" + if displayof: + return ('-displayof', displayof) + if displayof is None: + return ('-displayof', self._w) + return () + @property + def _windowingsystem(self): + """Internal function.""" + try: + return self._root()._windowingsystem_cached + except AttributeError: + ws = self._root()._windowingsystem_cached = \ + self.tk.call('tk', 'windowingsystem') + return ws + def _options(self, cnf, kw = None): + """Internal function.""" + if kw: + cnf = _cnfmerge((cnf, kw)) + else: + cnf = _cnfmerge(cnf) + res = () + for k, v in cnf.items(): + if v is not None: + if k[-1] == '_': k = k[:-1] + if hasattr(v, '__call__'): + v = self._register(v) + elif isinstance(v, (tuple, list)): + nv = [] + for item in v: + if not isinstance(item, (basestring, int, long)): + break + elif isinstance(item, (int, long)): + nv.append('%d' % item) + else: + # format it to proper Tcl code if it contains space + nv.append(_stringify(item)) + else: + v = ' '.join(nv) + res = res + ('-'+k, v) + return res + def nametowidget(self, name): + """Return the Tkinter instance of a widget identified by + its Tcl name NAME.""" + name = str(name).split('.') + w = self + + if not name[0]: + w = w._root() + name = name[1:] + + for n in name: + if not n: + break + w = w.children[n] + + return w + _nametowidget = nametowidget + def _register(self, func, subst=None, needcleanup=1): + """Return a newly created Tcl function. If this + function is called, the Python function FUNC will + be executed. An optional function SUBST can + be given which will be executed before FUNC.""" + f = CallWrapper(func, subst, self).__call__ + name = repr(id(f)) + try: + func = func.im_func + except AttributeError: + pass + try: + name = name + func.__name__ + except AttributeError: + pass + self.tk.createcommand(name, f) + if needcleanup: + if self._tclCommands is None: + self._tclCommands = [] + self._tclCommands.append(name) + return name + register = _register + def _root(self): + """Internal function.""" + w = self + while w.master: w = w.master + return w + _subst_format = ('%#', '%b', '%f', '%h', '%k', + '%s', '%t', '%w', '%x', '%y', + '%A', '%E', '%K', '%N', '%W', '%T', '%X', '%Y', '%D') + _subst_format_str = " ".join(_subst_format) + def _substitute(self, *args): + """Internal function.""" + if len(args) != len(self._subst_format): return args + getboolean = self.tk.getboolean + + getint = int + def getint_event(s): + """Tk changed behavior in 8.4.2, returning "??" rather more often.""" + try: + return int(s) + except ValueError: + return s + + nsign, b, f, h, k, s, t, w, x, y, A, E, K, N, W, T, X, Y, D = args + # Missing: (a, c, d, m, o, v, B, R) + e = Event() + # serial field: valid for all events + # number of button: ButtonPress and ButtonRelease events only + # height field: Configure, ConfigureRequest, Create, + # ResizeRequest, and Expose events only + # keycode field: KeyPress and KeyRelease events only + # time field: "valid for events that contain a time field" + # width field: Configure, ConfigureRequest, Create, ResizeRequest, + # and Expose events only + # x field: "valid for events that contain an x field" + # y field: "valid for events that contain a y field" + # keysym as decimal: KeyPress and KeyRelease events only + # x_root, y_root fields: ButtonPress, ButtonRelease, KeyPress, + # KeyRelease, and Motion events + e.serial = getint(nsign) + e.num = getint_event(b) + try: e.focus = getboolean(f) + except TclError: pass + e.height = getint_event(h) + e.keycode = getint_event(k) + e.state = getint_event(s) + e.time = getint_event(t) + e.width = getint_event(w) + e.x = getint_event(x) + e.y = getint_event(y) + e.char = A + try: e.send_event = getboolean(E) + except TclError: pass + e.keysym = K + e.keysym_num = getint_event(N) + e.type = T + try: + e.widget = self._nametowidget(W) + except KeyError: + e.widget = W + e.x_root = getint_event(X) + e.y_root = getint_event(Y) + try: + e.delta = getint(D) + except ValueError: + e.delta = 0 + return (e,) + def _report_exception(self): + """Internal function.""" + import sys + exc, val, tb = sys.exc_type, sys.exc_value, sys.exc_traceback + root = self._root() + root.report_callback_exception(exc, val, tb) + + def _getconfigure(self, *args): + """Call Tcl configure command and return the result as a dict.""" + cnf = {} + for x in self.tk.splitlist(self.tk.call(*args)): + x = self.tk.splitlist(x) + cnf[x[0][1:]] = (x[0][1:],) + x[1:] + return cnf + + def _getconfigure1(self, *args): + x = self.tk.splitlist(self.tk.call(*args)) + return (x[0][1:],) + x[1:] + + def _configure(self, cmd, cnf, kw): + """Internal function.""" + if kw: + cnf = _cnfmerge((cnf, kw)) + elif cnf: + cnf = _cnfmerge(cnf) + if cnf is None: + return self._getconfigure(_flatten((self._w, cmd))) + if type(cnf) is StringType: + return self._getconfigure1(_flatten((self._w, cmd, '-'+cnf))) + self.tk.call(_flatten((self._w, cmd)) + self._options(cnf)) + # These used to be defined in Widget: + def configure(self, cnf=None, **kw): + """Configure resources of a widget. + + The values for resources are specified as keyword + arguments. To get an overview about + the allowed keyword arguments call the method keys. + """ + return self._configure('configure', cnf, kw) + config = configure + def cget(self, key): + """Return the resource value for a KEY given as string.""" + return self.tk.call(self._w, 'cget', '-' + key) + __getitem__ = cget + def __setitem__(self, key, value): + self.configure({key: value}) + def __contains__(self, key): + raise TypeError("Tkinter objects don't support 'in' tests.") + def keys(self): + """Return a list of all resource names of this widget.""" + splitlist = self.tk.splitlist + return [splitlist(x)[0][1:] for x in + splitlist(self.tk.call(self._w, 'configure'))] + def __str__(self): + """Return the window path name of this widget.""" + return self._w + # Pack methods that apply to the master + _noarg_ = ['_noarg_'] + def pack_propagate(self, flag=_noarg_): + """Set or get the status for propagation of geometry information. + + A boolean argument specifies whether the geometry information + of the slaves will determine the size of this widget. If no argument + is given the current setting will be returned. + """ + if flag is Misc._noarg_: + return self._getboolean(self.tk.call( + 'pack', 'propagate', self._w)) + else: + self.tk.call('pack', 'propagate', self._w, flag) + propagate = pack_propagate + def pack_slaves(self): + """Return a list of all slaves of this widget + in its packing order.""" + return map(self._nametowidget, + self.tk.splitlist( + self.tk.call('pack', 'slaves', self._w))) + slaves = pack_slaves + # Place method that applies to the master + def place_slaves(self): + """Return a list of all slaves of this widget + in its packing order.""" + return map(self._nametowidget, + self.tk.splitlist( + self.tk.call( + 'place', 'slaves', self._w))) + # Grid methods that apply to the master + def grid_bbox(self, column=None, row=None, col2=None, row2=None): + """Return a tuple of integer coordinates for the bounding + box of this widget controlled by the geometry manager grid. + + If COLUMN, ROW is given the bounding box applies from + the cell with row and column 0 to the specified + cell. If COL2 and ROW2 are given the bounding box + starts at that cell. + + The returned integers specify the offset of the upper left + corner in the master widget and the width and height. + """ + args = ('grid', 'bbox', self._w) + if column is not None and row is not None: + args = args + (column, row) + if col2 is not None and row2 is not None: + args = args + (col2, row2) + return self._getints(self.tk.call(*args)) or None + + bbox = grid_bbox + + def _gridconvvalue(self, value): + if isinstance(value, (str, _tkinter.Tcl_Obj)): + try: + svalue = str(value) + if not svalue: + return None + elif '.' in svalue: + return getdouble(svalue) + else: + return getint(svalue) + except ValueError: + pass + return value + + def _grid_configure(self, command, index, cnf, kw): + """Internal function.""" + if type(cnf) is StringType and not kw: + if cnf[-1:] == '_': + cnf = cnf[:-1] + if cnf[:1] != '-': + cnf = '-'+cnf + options = (cnf,) + else: + options = self._options(cnf, kw) + if not options: + return _splitdict( + self.tk, + self.tk.call('grid', command, self._w, index), + conv=self._gridconvvalue) + res = self.tk.call( + ('grid', command, self._w, index) + + options) + if len(options) == 1: + return self._gridconvvalue(res) + + def grid_columnconfigure(self, index, cnf={}, **kw): + """Configure column INDEX of a grid. + + Valid resources are minsize (minimum size of the column), + weight (how much does additional space propagate to this column) + and pad (how much space to let additionally).""" + return self._grid_configure('columnconfigure', index, cnf, kw) + columnconfigure = grid_columnconfigure + def grid_location(self, x, y): + """Return a tuple of column and row which identify the cell + at which the pixel at position X and Y inside the master + widget is located.""" + return self._getints( + self.tk.call( + 'grid', 'location', self._w, x, y)) or None + def grid_propagate(self, flag=_noarg_): + """Set or get the status for propagation of geometry information. + + A boolean argument specifies whether the geometry information + of the slaves will determine the size of this widget. If no argument + is given, the current setting will be returned. + """ + if flag is Misc._noarg_: + return self._getboolean(self.tk.call( + 'grid', 'propagate', self._w)) + else: + self.tk.call('grid', 'propagate', self._w, flag) + def grid_rowconfigure(self, index, cnf={}, **kw): + """Configure row INDEX of a grid. + + Valid resources are minsize (minimum size of the row), + weight (how much does additional space propagate to this row) + and pad (how much space to let additionally).""" + return self._grid_configure('rowconfigure', index, cnf, kw) + rowconfigure = grid_rowconfigure + def grid_size(self): + """Return a tuple of the number of column and rows in the grid.""" + return self._getints( + self.tk.call('grid', 'size', self._w)) or None + size = grid_size + def grid_slaves(self, row=None, column=None): + """Return a list of all slaves of this widget + in its packing order.""" + args = () + if row is not None: + args = args + ('-row', row) + if column is not None: + args = args + ('-column', column) + return map(self._nametowidget, + self.tk.splitlist(self.tk.call( + ('grid', 'slaves', self._w) + args))) + + # Support for the "event" command, new in Tk 4.2. + # By Case Roole. + + def event_add(self, virtual, *sequences): + """Bind a virtual event VIRTUAL (of the form <<Name>>) + to an event SEQUENCE such that the virtual event is triggered + whenever SEQUENCE occurs.""" + args = ('event', 'add', virtual) + sequences + self.tk.call(args) + + def event_delete(self, virtual, *sequences): + """Unbind a virtual event VIRTUAL from SEQUENCE.""" + args = ('event', 'delete', virtual) + sequences + self.tk.call(args) + + def event_generate(self, sequence, **kw): + """Generate an event SEQUENCE. Additional + keyword arguments specify parameter of the event + (e.g. x, y, rootx, rooty).""" + args = ('event', 'generate', self._w, sequence) + for k, v in kw.items(): + args = args + ('-%s' % k, str(v)) + self.tk.call(args) + + def event_info(self, virtual=None): + """Return a list of all virtual events or the information + about the SEQUENCE bound to the virtual event VIRTUAL.""" + return self.tk.splitlist( + self.tk.call('event', 'info', virtual)) + + # Image related commands + + def image_names(self): + """Return a list of all existing image names.""" + return self.tk.splitlist(self.tk.call('image', 'names')) + + def image_types(self): + """Return a list of all available image types (e.g. photo bitmap).""" + return self.tk.splitlist(self.tk.call('image', 'types')) + + +class CallWrapper: + """Internal class. Stores function to call when some user + defined Tcl function is called e.g. after an event occurred.""" + def __init__(self, func, subst, widget): + """Store FUNC, SUBST and WIDGET as members.""" + self.func = func + self.subst = subst + self.widget = widget + def __call__(self, *args): + """Apply first function SUBST to arguments, than FUNC.""" + try: + if self.subst: + args = self.subst(*args) + return self.func(*args) + except SystemExit, msg: + raise SystemExit, msg + except: + self.widget._report_exception() + + +class XView: + """Mix-in class for querying and changing the horizontal position + of a widget's window.""" + + def xview(self, *args): + """Query and change the horizontal position of the view.""" + res = self.tk.call(self._w, 'xview', *args) + if not args: + return self._getdoubles(res) + + def xview_moveto(self, fraction): + """Adjusts the view in the window so that FRACTION of the + total width of the canvas is off-screen to the left.""" + self.tk.call(self._w, 'xview', 'moveto', fraction) + + def xview_scroll(self, number, what): + """Shift the x-view according to NUMBER which is measured in "units" + or "pages" (WHAT).""" + self.tk.call(self._w, 'xview', 'scroll', number, what) + + +class YView: + """Mix-in class for querying and changing the vertical position + of a widget's window.""" + + def yview(self, *args): + """Query and change the vertical position of the view.""" + res = self.tk.call(self._w, 'yview', *args) + if not args: + return self._getdoubles(res) + + def yview_moveto(self, fraction): + """Adjusts the view in the window so that FRACTION of the + total height of the canvas is off-screen to the top.""" + self.tk.call(self._w, 'yview', 'moveto', fraction) + + def yview_scroll(self, number, what): + """Shift the y-view according to NUMBER which is measured in + "units" or "pages" (WHAT).""" + self.tk.call(self._w, 'yview', 'scroll', number, what) + + +class Wm: + """Provides functions for the communication with the window manager.""" + + def wm_aspect(self, + minNumer=None, minDenom=None, + maxNumer=None, maxDenom=None): + """Instruct the window manager to set the aspect ratio (width/height) + of this widget to be between MINNUMER/MINDENOM and MAXNUMER/MAXDENOM. Return a tuple + of the actual values if no argument is given.""" + return self._getints( + self.tk.call('wm', 'aspect', self._w, + minNumer, minDenom, + maxNumer, maxDenom)) + aspect = wm_aspect + + def wm_attributes(self, *args): + """This subcommand returns or sets platform specific attributes + + The first form returns a list of the platform specific flags and + their values. The second form returns the value for the specific + option. The third form sets one or more of the values. The values + are as follows: + + On Windows, -disabled gets or sets whether the window is in a + disabled state. -toolwindow gets or sets the style of the window + to toolwindow (as defined in the MSDN). -topmost gets or sets + whether this is a topmost window (displays above all other + windows). + + On Macintosh, XXXXX + + On Unix, there are currently no special attribute values. + """ + args = ('wm', 'attributes', self._w) + args + return self.tk.call(args) + attributes=wm_attributes + + def wm_client(self, name=None): + """Store NAME in WM_CLIENT_MACHINE property of this widget. Return + current value.""" + return self.tk.call('wm', 'client', self._w, name) + client = wm_client + def wm_colormapwindows(self, *wlist): + """Store list of window names (WLIST) into WM_COLORMAPWINDOWS property + of this widget. This list contains windows whose colormaps differ from their + parents. Return current list of widgets if WLIST is empty.""" + if len(wlist) > 1: + wlist = (wlist,) # Tk needs a list of windows here + args = ('wm', 'colormapwindows', self._w) + wlist + if wlist: + self.tk.call(args) + else: + return map(self._nametowidget, self.tk.splitlist(self.tk.call(args))) + colormapwindows = wm_colormapwindows + def wm_command(self, value=None): + """Store VALUE in WM_COMMAND property. It is the command + which shall be used to invoke the application. Return current + command if VALUE is None.""" + return self.tk.call('wm', 'command', self._w, value) + command = wm_command + def wm_deiconify(self): + """Deiconify this widget. If it was never mapped it will not be mapped. + On Windows it will raise this widget and give it the focus.""" + return self.tk.call('wm', 'deiconify', self._w) + deiconify = wm_deiconify + def wm_focusmodel(self, model=None): + """Set focus model to MODEL. "active" means that this widget will claim + the focus itself, "passive" means that the window manager shall give + the focus. Return current focus model if MODEL is None.""" + return self.tk.call('wm', 'focusmodel', self._w, model) + focusmodel = wm_focusmodel + def wm_frame(self): + """Return identifier for decorative frame of this widget if present.""" + return self.tk.call('wm', 'frame', self._w) + frame = wm_frame + def wm_geometry(self, newGeometry=None): + """Set geometry to NEWGEOMETRY of the form =widthxheight+x+y. Return + current value if None is given.""" + return self.tk.call('wm', 'geometry', self._w, newGeometry) + geometry = wm_geometry + def wm_grid(self, + baseWidth=None, baseHeight=None, + widthInc=None, heightInc=None): + """Instruct the window manager that this widget shall only be + resized on grid boundaries. WIDTHINC and HEIGHTINC are the width and + height of a grid unit in pixels. BASEWIDTH and BASEHEIGHT are the + number of grid units requested in Tk_GeometryRequest.""" + return self._getints(self.tk.call( + 'wm', 'grid', self._w, + baseWidth, baseHeight, widthInc, heightInc)) + grid = wm_grid + def wm_group(self, pathName=None): + """Set the group leader widgets for related widgets to PATHNAME. Return + the group leader of this widget if None is given.""" + return self.tk.call('wm', 'group', self._w, pathName) + group = wm_group + def wm_iconbitmap(self, bitmap=None, default=None): + """Set bitmap for the iconified widget to BITMAP. Return + the bitmap if None is given. + + Under Windows, the DEFAULT parameter can be used to set the icon + for the widget and any descendents that don't have an icon set + explicitly. DEFAULT can be the relative path to a .ico file + (example: root.iconbitmap(default='myicon.ico') ). See Tk + documentation for more information.""" + if default: + return self.tk.call('wm', 'iconbitmap', self._w, '-default', default) + else: + return self.tk.call('wm', 'iconbitmap', self._w, bitmap) + iconbitmap = wm_iconbitmap + def wm_iconify(self): + """Display widget as icon.""" + return self.tk.call('wm', 'iconify', self._w) + iconify = wm_iconify + def wm_iconmask(self, bitmap=None): + """Set mask for the icon bitmap of this widget. Return the + mask if None is given.""" + return self.tk.call('wm', 'iconmask', self._w, bitmap) + iconmask = wm_iconmask + def wm_iconname(self, newName=None): + """Set the name of the icon for this widget. Return the name if + None is given.""" + return self.tk.call('wm', 'iconname', self._w, newName) + iconname = wm_iconname + def wm_iconposition(self, x=None, y=None): + """Set the position of the icon of this widget to X and Y. Return + a tuple of the current values of X and X if None is given.""" + return self._getints(self.tk.call( + 'wm', 'iconposition', self._w, x, y)) + iconposition = wm_iconposition + def wm_iconwindow(self, pathName=None): + """Set widget PATHNAME to be displayed instead of icon. Return the current + value if None is given.""" + return self.tk.call('wm', 'iconwindow', self._w, pathName) + iconwindow = wm_iconwindow + def wm_maxsize(self, width=None, height=None): + """Set max WIDTH and HEIGHT for this widget. If the window is gridded + the values are given in grid units. Return the current values if None + is given.""" + return self._getints(self.tk.call( + 'wm', 'maxsize', self._w, width, height)) + maxsize = wm_maxsize + def wm_minsize(self, width=None, height=None): + """Set min WIDTH and HEIGHT for this widget. If the window is gridded + the values are given in grid units. Return the current values if None + is given.""" + return self._getints(self.tk.call( + 'wm', 'minsize', self._w, width, height)) + minsize = wm_minsize + def wm_overrideredirect(self, boolean=None): + """Instruct the window manager to ignore this widget + if BOOLEAN is given with 1. Return the current value if None + is given.""" + return self._getboolean(self.tk.call( + 'wm', 'overrideredirect', self._w, boolean)) + overrideredirect = wm_overrideredirect + def wm_positionfrom(self, who=None): + """Instruct the window manager that the position of this widget shall + be defined by the user if WHO is "user", and by its own policy if WHO is + "program".""" + return self.tk.call('wm', 'positionfrom', self._w, who) + positionfrom = wm_positionfrom + def wm_protocol(self, name=None, func=None): + """Bind function FUNC to command NAME for this widget. + Return the function bound to NAME if None is given. NAME could be + e.g. "WM_SAVE_YOURSELF" or "WM_DELETE_WINDOW".""" + if hasattr(func, '__call__'): + command = self._register(func) + else: + command = func + return self.tk.call( + 'wm', 'protocol', self._w, name, command) + protocol = wm_protocol + def wm_resizable(self, width=None, height=None): + """Instruct the window manager whether this width can be resized + in WIDTH or HEIGHT. Both values are boolean values.""" + return self.tk.call('wm', 'resizable', self._w, width, height) + resizable = wm_resizable + def wm_sizefrom(self, who=None): + """Instruct the window manager that the size of this widget shall + be defined by the user if WHO is "user", and by its own policy if WHO is + "program".""" + return self.tk.call('wm', 'sizefrom', self._w, who) + sizefrom = wm_sizefrom + def wm_state(self, newstate=None): + """Query or set the state of this widget as one of normal, icon, + iconic (see wm_iconwindow), withdrawn, or zoomed (Windows only).""" + return self.tk.call('wm', 'state', self._w, newstate) + state = wm_state + def wm_title(self, string=None): + """Set the title of this widget.""" + return self.tk.call('wm', 'title', self._w, string) + title = wm_title + def wm_transient(self, master=None): + """Instruct the window manager that this widget is transient + with regard to widget MASTER.""" + return self.tk.call('wm', 'transient', self._w, master) + transient = wm_transient + def wm_withdraw(self): + """Withdraw this widget from the screen such that it is unmapped + and forgotten by the window manager. Re-draw it with wm_deiconify.""" + return self.tk.call('wm', 'withdraw', self._w) + withdraw = wm_withdraw + + +class Tk(Misc, Wm): + """Toplevel widget of Tk which represents mostly the main window + of an application. It has an associated Tcl interpreter.""" + _w = '.' + def __init__(self, screenName=None, baseName=None, className='Tk', + useTk=1, sync=0, use=None): + """Return a new Toplevel widget on screen SCREENNAME. A new Tcl interpreter will + be created. BASENAME will be used for the identification of the profile file (see + readprofile). + It is constructed from sys.argv[0] without extensions if None is given. CLASSNAME + is the name of the widget class.""" + self.master = None + self.children = {} + self._tkloaded = 0 + # to avoid recursions in the getattr code in case of failure, we + # ensure that self.tk is always _something_. + self.tk = None + if baseName is None: + import os + baseName = os.path.basename(sys.argv[0]) + baseName, ext = os.path.splitext(baseName) + if ext not in ('.py', '.pyc', '.pyo'): + baseName = baseName + ext + interactive = 0 + self.tk = _tkinter.create(screenName, baseName, className, interactive, wantobjects, useTk, sync, use) + if useTk: + self._loadtk() + if not sys.flags.ignore_environment: + # Issue #16248: Honor the -E flag to avoid code injection. + self.readprofile(baseName, className) + def loadtk(self): + if not self._tkloaded: + self.tk.loadtk() + self._loadtk() + def _loadtk(self): + self._tkloaded = 1 + global _default_root + # Version sanity checks + tk_version = self.tk.getvar('tk_version') + if tk_version != _tkinter.TK_VERSION: + raise RuntimeError, \ + "tk.h version (%s) doesn't match libtk.a version (%s)" \ + % (_tkinter.TK_VERSION, tk_version) + # Under unknown circumstances, tcl_version gets coerced to float + tcl_version = str(self.tk.getvar('tcl_version')) + if tcl_version != _tkinter.TCL_VERSION: + raise RuntimeError, \ + "tcl.h version (%s) doesn't match libtcl.a version (%s)" \ + % (_tkinter.TCL_VERSION, tcl_version) + if TkVersion < 4.0: + raise RuntimeError, \ + "Tk 4.0 or higher is required; found Tk %s" \ + % str(TkVersion) + # Create and register the tkerror and exit commands + # We need to inline parts of _register here, _ register + # would register differently-named commands. + if self._tclCommands is None: + self._tclCommands = [] + self.tk.createcommand('tkerror', _tkerror) + self.tk.createcommand('exit', _exit) + self._tclCommands.append('tkerror') + self._tclCommands.append('exit') + if _support_default_root and not _default_root: + _default_root = self + self.protocol("WM_DELETE_WINDOW", self.destroy) + def destroy(self): + """Destroy this and all descendants widgets. This will + end the application of this Tcl interpreter.""" + for c in self.children.values(): c.destroy() + self.tk.call('destroy', self._w) + Misc.destroy(self) + global _default_root + if _support_default_root and _default_root is self: + _default_root = None + def readprofile(self, baseName, className): + """Internal function. It reads BASENAME.tcl and CLASSNAME.tcl into + the Tcl Interpreter and calls execfile on BASENAME.py and CLASSNAME.py if + such a file exists in the home directory.""" + import os + if 'HOME' in os.environ: home = os.environ['HOME'] + else: home = os.curdir + class_tcl = os.path.join(home, '.%s.tcl' % className) + class_py = os.path.join(home, '.%s.py' % className) + base_tcl = os.path.join(home, '.%s.tcl' % baseName) + base_py = os.path.join(home, '.%s.py' % baseName) + dir = {'self': self} + exec 'from Tkinter import *' in dir + if os.path.isfile(class_tcl): + self.tk.call('source', class_tcl) + if os.path.isfile(class_py): + execfile(class_py, dir) + if os.path.isfile(base_tcl): + self.tk.call('source', base_tcl) + if os.path.isfile(base_py): + execfile(base_py, dir) + def report_callback_exception(self, exc, val, tb): + """Report callback exception on sys.stderr. + + Applications may want to override this internal function, and + should when sys.stderr is None.""" + import traceback, sys + print >>sys.stderr, "Exception in Tkinter callback" + sys.last_type = exc + sys.last_value = val + sys.last_traceback = tb + traceback.print_exception(exc, val, tb) + def __getattr__(self, attr): + "Delegate attribute access to the interpreter object" + return getattr(self.tk, attr) + +# Ideally, the classes Pack, Place and Grid disappear, the +# pack/place/grid methods are defined on the Widget class, and +# everybody uses w.pack_whatever(...) instead of Pack.whatever(w, +# ...), with pack(), place() and grid() being short for +# pack_configure(), place_configure() and grid_columnconfigure(), and +# forget() being short for pack_forget(). As a practical matter, I'm +# afraid that there is too much code out there that may be using the +# Pack, Place or Grid class, so I leave them intact -- but only as +# backwards compatibility features. Also note that those methods that +# take a master as argument (e.g. pack_propagate) have been moved to +# the Misc class (which now incorporates all methods common between +# toplevel and interior widgets). Again, for compatibility, these are +# copied into the Pack, Place or Grid class. + + +def Tcl(screenName=None, baseName=None, className='Tk', useTk=0): + return Tk(screenName, baseName, className, useTk) + +class Pack: + """Geometry manager Pack. + + Base class to use the methods pack_* in every widget.""" + def pack_configure(self, cnf={}, **kw): + """Pack a widget in the parent widget. Use as options: + after=widget - pack it after you have packed widget + anchor=NSEW (or subset) - position widget according to + given direction + before=widget - pack it before you will pack widget + expand=bool - expand widget if parent size grows + fill=NONE or X or Y or BOTH - fill widget if widget grows + in=master - use master to contain this widget + in_=master - see 'in' option description + ipadx=amount - add internal padding in x direction + ipady=amount - add internal padding in y direction + padx=amount - add padding in x direction + pady=amount - add padding in y direction + side=TOP or BOTTOM or LEFT or RIGHT - where to add this widget. + """ + self.tk.call( + ('pack', 'configure', self._w) + + self._options(cnf, kw)) + pack = configure = config = pack_configure + def pack_forget(self): + """Unmap this widget and do not use it for the packing order.""" + self.tk.call('pack', 'forget', self._w) + forget = pack_forget + def pack_info(self): + """Return information about the packing options + for this widget.""" + d = _splitdict(self.tk, self.tk.call('pack', 'info', self._w)) + if 'in' in d: + d['in'] = self.nametowidget(d['in']) + return d + info = pack_info + propagate = pack_propagate = Misc.pack_propagate + slaves = pack_slaves = Misc.pack_slaves + +class Place: + """Geometry manager Place. + + Base class to use the methods place_* in every widget.""" + def place_configure(self, cnf={}, **kw): + """Place a widget in the parent widget. Use as options: + in=master - master relative to which the widget is placed + in_=master - see 'in' option description + x=amount - locate anchor of this widget at position x of master + y=amount - locate anchor of this widget at position y of master + relx=amount - locate anchor of this widget between 0.0 and 1.0 + relative to width of master (1.0 is right edge) + rely=amount - locate anchor of this widget between 0.0 and 1.0 + relative to height of master (1.0 is bottom edge) + anchor=NSEW (or subset) - position anchor according to given direction + width=amount - width of this widget in pixel + height=amount - height of this widget in pixel + relwidth=amount - width of this widget between 0.0 and 1.0 + relative to width of master (1.0 is the same width + as the master) + relheight=amount - height of this widget between 0.0 and 1.0 + relative to height of master (1.0 is the same + height as the master) + bordermode="inside" or "outside" - whether to take border width of + master widget into account + """ + self.tk.call( + ('place', 'configure', self._w) + + self._options(cnf, kw)) + place = configure = config = place_configure + def place_forget(self): + """Unmap this widget.""" + self.tk.call('place', 'forget', self._w) + forget = place_forget + def place_info(self): + """Return information about the placing options + for this widget.""" + d = _splitdict(self.tk, self.tk.call('place', 'info', self._w)) + if 'in' in d: + d['in'] = self.nametowidget(d['in']) + return d + info = place_info + slaves = place_slaves = Misc.place_slaves + +class Grid: + """Geometry manager Grid. + + Base class to use the methods grid_* in every widget.""" + # Thanks to Masazumi Yoshikawa (yosikawa@isi.edu) + def grid_configure(self, cnf={}, **kw): + """Position a widget in the parent widget in a grid. Use as options: + column=number - use cell identified with given column (starting with 0) + columnspan=number - this widget will span several columns + in=master - use master to contain this widget + in_=master - see 'in' option description + ipadx=amount - add internal padding in x direction + ipady=amount - add internal padding in y direction + padx=amount - add padding in x direction + pady=amount - add padding in y direction + row=number - use cell identified with given row (starting with 0) + rowspan=number - this widget will span several rows + sticky=NSEW - if cell is larger on which sides will this + widget stick to the cell boundary + """ + self.tk.call( + ('grid', 'configure', self._w) + + self._options(cnf, kw)) + grid = configure = config = grid_configure + bbox = grid_bbox = Misc.grid_bbox + columnconfigure = grid_columnconfigure = Misc.grid_columnconfigure + def grid_forget(self): + """Unmap this widget.""" + self.tk.call('grid', 'forget', self._w) + forget = grid_forget + def grid_remove(self): + """Unmap this widget but remember the grid options.""" + self.tk.call('grid', 'remove', self._w) + def grid_info(self): + """Return information about the options + for positioning this widget in a grid.""" + d = _splitdict(self.tk, self.tk.call('grid', 'info', self._w)) + if 'in' in d: + d['in'] = self.nametowidget(d['in']) + return d + info = grid_info + location = grid_location = Misc.grid_location + propagate = grid_propagate = Misc.grid_propagate + rowconfigure = grid_rowconfigure = Misc.grid_rowconfigure + size = grid_size = Misc.grid_size + slaves = grid_slaves = Misc.grid_slaves + +class BaseWidget(Misc): + """Internal class.""" + def _setup(self, master, cnf): + """Internal function. Sets up information about children.""" + if _support_default_root: + global _default_root + if not master: + if not _default_root: + _default_root = Tk() + master = _default_root + self.master = master + self.tk = master.tk + name = None + if 'name' in cnf: + name = cnf['name'] + del cnf['name'] + if not name: + name = repr(id(self)) + self._name = name + if master._w=='.': + self._w = '.' + name + else: + self._w = master._w + '.' + name + self.children = {} + if self._name in self.master.children: + self.master.children[self._name].destroy() + self.master.children[self._name] = self + def __init__(self, master, widgetName, cnf={}, kw={}, extra=()): + """Construct a widget with the parent widget MASTER, a name WIDGETNAME + and appropriate options.""" + if kw: + cnf = _cnfmerge((cnf, kw)) + self.widgetName = widgetName + BaseWidget._setup(self, master, cnf) + if self._tclCommands is None: + self._tclCommands = [] + classes = [] + for k in cnf.keys(): + if type(k) is ClassType: + classes.append((k, cnf[k])) + del cnf[k] + self.tk.call( + (widgetName, self._w) + extra + self._options(cnf)) + for k, v in classes: + k.configure(self, v) + def destroy(self): + """Destroy this and all descendants widgets.""" + for c in self.children.values(): c.destroy() + self.tk.call('destroy', self._w) + if self._name in self.master.children: + del self.master.children[self._name] + Misc.destroy(self) + def _do(self, name, args=()): + # XXX Obsolete -- better use self.tk.call directly! + return self.tk.call((self._w, name) + args) + +class Widget(BaseWidget, Pack, Place, Grid): + """Internal class. + + Base class for a widget which can be positioned with the geometry managers + Pack, Place or Grid.""" + pass + +class Toplevel(BaseWidget, Wm): + """Toplevel widget, e.g. for dialogs.""" + def __init__(self, master=None, cnf={}, **kw): + """Construct a toplevel widget with the parent MASTER. + + Valid resource names: background, bd, bg, borderwidth, class, + colormap, container, cursor, height, highlightbackground, + highlightcolor, highlightthickness, menu, relief, screen, takefocus, + use, visual, width.""" + if kw: + cnf = _cnfmerge((cnf, kw)) + extra = () + for wmkey in ['screen', 'class_', 'class', 'visual', + 'colormap']: + if wmkey in cnf: + val = cnf[wmkey] + # TBD: a hack needed because some keys + # are not valid as keyword arguments + if wmkey[-1] == '_': opt = '-'+wmkey[:-1] + else: opt = '-'+wmkey + extra = extra + (opt, val) + del cnf[wmkey] + BaseWidget.__init__(self, master, 'toplevel', cnf, {}, extra) + root = self._root() + self.iconname(root.iconname()) + self.title(root.title()) + self.protocol("WM_DELETE_WINDOW", self.destroy) + +class Button(Widget): + """Button widget.""" + def __init__(self, master=None, cnf={}, **kw): + """Construct a button widget with the parent MASTER. + + STANDARD OPTIONS + + activebackground, activeforeground, anchor, + background, bitmap, borderwidth, cursor, + disabledforeground, font, foreground + highlightbackground, highlightcolor, + highlightthickness, image, justify, + padx, pady, relief, repeatdelay, + repeatinterval, takefocus, text, + textvariable, underline, wraplength + + WIDGET-SPECIFIC OPTIONS + + command, compound, default, height, + overrelief, state, width + """ + Widget.__init__(self, master, 'button', cnf, kw) + + def tkButtonEnter(self, *dummy): + self.tk.call('tkButtonEnter', self._w) + + def tkButtonLeave(self, *dummy): + self.tk.call('tkButtonLeave', self._w) + + def tkButtonDown(self, *dummy): + self.tk.call('tkButtonDown', self._w) + + def tkButtonUp(self, *dummy): + self.tk.call('tkButtonUp', self._w) + + def tkButtonInvoke(self, *dummy): + self.tk.call('tkButtonInvoke', self._w) + + def flash(self): + """Flash the button. + + This is accomplished by redisplaying + the button several times, alternating between active and + normal colors. At the end of the flash the button is left + in the same normal/active state as when the command was + invoked. This command is ignored if the button's state is + disabled. + """ + self.tk.call(self._w, 'flash') + + def invoke(self): + """Invoke the command associated with the button. + + The return value is the return value from the command, + or an empty string if there is no command associated with + the button. This command is ignored if the button's state + is disabled. + """ + return self.tk.call(self._w, 'invoke') + +# Indices: +# XXX I don't like these -- take them away +def AtEnd(): + return 'end' +def AtInsert(*args): + s = 'insert' + for a in args: + if a: s = s + (' ' + a) + return s +def AtSelFirst(): + return 'sel.first' +def AtSelLast(): + return 'sel.last' +def At(x, y=None): + if y is None: + return '@%r' % (x,) + else: + return '@%r,%r' % (x, y) + +class Canvas(Widget, XView, YView): + """Canvas widget to display graphical elements like lines or text.""" + def __init__(self, master=None, cnf={}, **kw): + """Construct a canvas widget with the parent MASTER. + + Valid resource names: background, bd, bg, borderwidth, closeenough, + confine, cursor, height, highlightbackground, highlightcolor, + highlightthickness, insertbackground, insertborderwidth, + insertofftime, insertontime, insertwidth, offset, relief, + scrollregion, selectbackground, selectborderwidth, selectforeground, + state, takefocus, width, xscrollcommand, xscrollincrement, + yscrollcommand, yscrollincrement.""" + Widget.__init__(self, master, 'canvas', cnf, kw) + def addtag(self, *args): + """Internal function.""" + self.tk.call((self._w, 'addtag') + args) + def addtag_above(self, newtag, tagOrId): + """Add tag NEWTAG to all items above TAGORID.""" + self.addtag(newtag, 'above', tagOrId) + def addtag_all(self, newtag): + """Add tag NEWTAG to all items.""" + self.addtag(newtag, 'all') + def addtag_below(self, newtag, tagOrId): + """Add tag NEWTAG to all items below TAGORID.""" + self.addtag(newtag, 'below', tagOrId) + def addtag_closest(self, newtag, x, y, halo=None, start=None): + """Add tag NEWTAG to item which is closest to pixel at X, Y. + If several match take the top-most. + All items closer than HALO are considered overlapping (all are + closests). If START is specified the next below this tag is taken.""" + self.addtag(newtag, 'closest', x, y, halo, start) + def addtag_enclosed(self, newtag, x1, y1, x2, y2): + """Add tag NEWTAG to all items in the rectangle defined + by X1,Y1,X2,Y2.""" + self.addtag(newtag, 'enclosed', x1, y1, x2, y2) + def addtag_overlapping(self, newtag, x1, y1, x2, y2): + """Add tag NEWTAG to all items which overlap the rectangle + defined by X1,Y1,X2,Y2.""" + self.addtag(newtag, 'overlapping', x1, y1, x2, y2) + def addtag_withtag(self, newtag, tagOrId): + """Add tag NEWTAG to all items with TAGORID.""" + self.addtag(newtag, 'withtag', tagOrId) + def bbox(self, *args): + """Return a tuple of X1,Y1,X2,Y2 coordinates for a rectangle + which encloses all items with tags specified as arguments.""" + return self._getints( + self.tk.call((self._w, 'bbox') + args)) or None + def tag_unbind(self, tagOrId, sequence, funcid=None): + """Unbind for all items with TAGORID for event SEQUENCE the + function identified with FUNCID.""" + self.tk.call(self._w, 'bind', tagOrId, sequence, '') + if funcid: + self.deletecommand(funcid) + def tag_bind(self, tagOrId, sequence=None, func=None, add=None): + """Bind to all items with TAGORID at event SEQUENCE a call to function FUNC. + + An additional boolean parameter ADD specifies whether FUNC will be + called additionally to the other bound function or whether it will + replace the previous function. See bind for the return value.""" + return self._bind((self._w, 'bind', tagOrId), + sequence, func, add) + def canvasx(self, screenx, gridspacing=None): + """Return the canvas x coordinate of pixel position SCREENX rounded + to nearest multiple of GRIDSPACING units.""" + return getdouble(self.tk.call( + self._w, 'canvasx', screenx, gridspacing)) + def canvasy(self, screeny, gridspacing=None): + """Return the canvas y coordinate of pixel position SCREENY rounded + to nearest multiple of GRIDSPACING units.""" + return getdouble(self.tk.call( + self._w, 'canvasy', screeny, gridspacing)) + def coords(self, *args): + """Return a list of coordinates for the item given in ARGS.""" + # XXX Should use _flatten on args + return map(getdouble, + self.tk.splitlist( + self.tk.call((self._w, 'coords') + args))) + def _create(self, itemType, args, kw): # Args: (val, val, ..., cnf={}) + """Internal function.""" + args = _flatten(args) + cnf = args[-1] + if type(cnf) in (DictionaryType, TupleType): + args = args[:-1] + else: + cnf = {} + return getint(self.tk.call( + self._w, 'create', itemType, + *(args + self._options(cnf, kw)))) + def create_arc(self, *args, **kw): + """Create arc shaped region with coordinates x1,y1,x2,y2.""" + return self._create('arc', args, kw) + def create_bitmap(self, *args, **kw): + """Create bitmap with coordinates x1,y1.""" + return self._create('bitmap', args, kw) + def create_image(self, *args, **kw): + """Create image item with coordinates x1,y1.""" + return self._create('image', args, kw) + def create_line(self, *args, **kw): + """Create line with coordinates x1,y1,...,xn,yn.""" + return self._create('line', args, kw) + def create_oval(self, *args, **kw): + """Create oval with coordinates x1,y1,x2,y2.""" + return self._create('oval', args, kw) + def create_polygon(self, *args, **kw): + """Create polygon with coordinates x1,y1,...,xn,yn.""" + return self._create('polygon', args, kw) + def create_rectangle(self, *args, **kw): + """Create rectangle with coordinates x1,y1,x2,y2.""" + return self._create('rectangle', args, kw) + def create_text(self, *args, **kw): + """Create text with coordinates x1,y1.""" + return self._create('text', args, kw) + def create_window(self, *args, **kw): + """Create window with coordinates x1,y1,x2,y2.""" + return self._create('window', args, kw) + def dchars(self, *args): + """Delete characters of text items identified by tag or id in ARGS (possibly + several times) from FIRST to LAST character (including).""" + self.tk.call((self._w, 'dchars') + args) + def delete(self, *args): + """Delete items identified by all tag or ids contained in ARGS.""" + self.tk.call((self._w, 'delete') + args) + def dtag(self, *args): + """Delete tag or id given as last arguments in ARGS from items + identified by first argument in ARGS.""" + self.tk.call((self._w, 'dtag') + args) + def find(self, *args): + """Internal function.""" + return self._getints( + self.tk.call((self._w, 'find') + args)) or () + def find_above(self, tagOrId): + """Return items above TAGORID.""" + return self.find('above', tagOrId) + def find_all(self): + """Return all items.""" + return self.find('all') + def find_below(self, tagOrId): + """Return all items below TAGORID.""" + return self.find('below', tagOrId) + def find_closest(self, x, y, halo=None, start=None): + """Return item which is closest to pixel at X, Y. + If several match take the top-most. + All items closer than HALO are considered overlapping (all are + closest). If START is specified the next below this tag is taken.""" + return self.find('closest', x, y, halo, start) + def find_enclosed(self, x1, y1, x2, y2): + """Return all items in rectangle defined + by X1,Y1,X2,Y2.""" + return self.find('enclosed', x1, y1, x2, y2) + def find_overlapping(self, x1, y1, x2, y2): + """Return all items which overlap the rectangle + defined by X1,Y1,X2,Y2.""" + return self.find('overlapping', x1, y1, x2, y2) + def find_withtag(self, tagOrId): + """Return all items with TAGORID.""" + return self.find('withtag', tagOrId) + def focus(self, *args): + """Set focus to the first item specified in ARGS.""" + return self.tk.call((self._w, 'focus') + args) + def gettags(self, *args): + """Return tags associated with the first item specified in ARGS.""" + return self.tk.splitlist( + self.tk.call((self._w, 'gettags') + args)) + def icursor(self, *args): + """Set cursor at position POS in the item identified by TAGORID. + In ARGS TAGORID must be first.""" + self.tk.call((self._w, 'icursor') + args) + def index(self, *args): + """Return position of cursor as integer in item specified in ARGS.""" + return getint(self.tk.call((self._w, 'index') + args)) + def insert(self, *args): + """Insert TEXT in item TAGORID at position POS. ARGS must + be TAGORID POS TEXT.""" + self.tk.call((self._w, 'insert') + args) + def itemcget(self, tagOrId, option): + """Return the resource value for an OPTION for item TAGORID.""" + return self.tk.call( + (self._w, 'itemcget') + (tagOrId, '-'+option)) + def itemconfigure(self, tagOrId, cnf=None, **kw): + """Configure resources of an item TAGORID. + + The values for resources are specified as keyword + arguments. To get an overview about + the allowed keyword arguments call the method without arguments. + """ + return self._configure(('itemconfigure', tagOrId), cnf, kw) + itemconfig = itemconfigure + # lower, tkraise/lift hide Misc.lower, Misc.tkraise/lift, + # so the preferred name for them is tag_lower, tag_raise + # (similar to tag_bind, and similar to the Text widget); + # unfortunately can't delete the old ones yet (maybe in 1.6) + def tag_lower(self, *args): + """Lower an item TAGORID given in ARGS + (optional below another item).""" + self.tk.call((self._w, 'lower') + args) + lower = tag_lower + def move(self, *args): + """Move an item TAGORID given in ARGS.""" + self.tk.call((self._w, 'move') + args) + def postscript(self, cnf={}, **kw): + """Print the contents of the canvas to a postscript + file. Valid options: colormap, colormode, file, fontmap, + height, pageanchor, pageheight, pagewidth, pagex, pagey, + rotate, width, x, y.""" + return self.tk.call((self._w, 'postscript') + + self._options(cnf, kw)) + def tag_raise(self, *args): + """Raise an item TAGORID given in ARGS + (optional above another item).""" + self.tk.call((self._w, 'raise') + args) + lift = tkraise = tag_raise + def scale(self, *args): + """Scale item TAGORID with XORIGIN, YORIGIN, XSCALE, YSCALE.""" + self.tk.call((self._w, 'scale') + args) + def scan_mark(self, x, y): + """Remember the current X, Y coordinates.""" + self.tk.call(self._w, 'scan', 'mark', x, y) + def scan_dragto(self, x, y, gain=10): + """Adjust the view of the canvas to GAIN times the + difference between X and Y and the coordinates given in + scan_mark.""" + self.tk.call(self._w, 'scan', 'dragto', x, y, gain) + def select_adjust(self, tagOrId, index): + """Adjust the end of the selection near the cursor of an item TAGORID to index.""" + self.tk.call(self._w, 'select', 'adjust', tagOrId, index) + def select_clear(self): + """Clear the selection if it is in this widget.""" + self.tk.call(self._w, 'select', 'clear') + def select_from(self, tagOrId, index): + """Set the fixed end of a selection in item TAGORID to INDEX.""" + self.tk.call(self._w, 'select', 'from', tagOrId, index) + def select_item(self): + """Return the item which has the selection.""" + return self.tk.call(self._w, 'select', 'item') or None + def select_to(self, tagOrId, index): + """Set the variable end of a selection in item TAGORID to INDEX.""" + self.tk.call(self._w, 'select', 'to', tagOrId, index) + def type(self, tagOrId): + """Return the type of the item TAGORID.""" + return self.tk.call(self._w, 'type', tagOrId) or None + +class Checkbutton(Widget): + """Checkbutton widget which is either in on- or off-state.""" + def __init__(self, master=None, cnf={}, **kw): + """Construct a checkbutton widget with the parent MASTER. + + Valid resource names: activebackground, activeforeground, anchor, + background, bd, bg, bitmap, borderwidth, command, cursor, + disabledforeground, fg, font, foreground, height, + highlightbackground, highlightcolor, highlightthickness, image, + indicatoron, justify, offvalue, onvalue, padx, pady, relief, + selectcolor, selectimage, state, takefocus, text, textvariable, + underline, variable, width, wraplength.""" + Widget.__init__(self, master, 'checkbutton', cnf, kw) + def deselect(self): + """Put the button in off-state.""" + self.tk.call(self._w, 'deselect') + def flash(self): + """Flash the button.""" + self.tk.call(self._w, 'flash') + def invoke(self): + """Toggle the button and invoke a command if given as resource.""" + return self.tk.call(self._w, 'invoke') + def select(self): + """Put the button in on-state.""" + self.tk.call(self._w, 'select') + def toggle(self): + """Toggle the button.""" + self.tk.call(self._w, 'toggle') + +class Entry(Widget, XView): + """Entry widget which allows displaying simple text.""" + def __init__(self, master=None, cnf={}, **kw): + """Construct an entry widget with the parent MASTER. + + Valid resource names: background, bd, bg, borderwidth, cursor, + exportselection, fg, font, foreground, highlightbackground, + highlightcolor, highlightthickness, insertbackground, + insertborderwidth, insertofftime, insertontime, insertwidth, + invalidcommand, invcmd, justify, relief, selectbackground, + selectborderwidth, selectforeground, show, state, takefocus, + textvariable, validate, validatecommand, vcmd, width, + xscrollcommand.""" + Widget.__init__(self, master, 'entry', cnf, kw) + def delete(self, first, last=None): + """Delete text from FIRST to LAST (not included).""" + self.tk.call(self._w, 'delete', first, last) + def get(self): + """Return the text.""" + return self.tk.call(self._w, 'get') + def icursor(self, index): + """Insert cursor at INDEX.""" + self.tk.call(self._w, 'icursor', index) + def index(self, index): + """Return position of cursor.""" + return getint(self.tk.call( + self._w, 'index', index)) + def insert(self, index, string): + """Insert STRING at INDEX.""" + self.tk.call(self._w, 'insert', index, string) + def scan_mark(self, x): + """Remember the current X, Y coordinates.""" + self.tk.call(self._w, 'scan', 'mark', x) + def scan_dragto(self, x): + """Adjust the view of the canvas to 10 times the + difference between X and Y and the coordinates given in + scan_mark.""" + self.tk.call(self._w, 'scan', 'dragto', x) + def selection_adjust(self, index): + """Adjust the end of the selection near the cursor to INDEX.""" + self.tk.call(self._w, 'selection', 'adjust', index) + select_adjust = selection_adjust + def selection_clear(self): + """Clear the selection if it is in this widget.""" + self.tk.call(self._w, 'selection', 'clear') + select_clear = selection_clear + def selection_from(self, index): + """Set the fixed end of a selection to INDEX.""" + self.tk.call(self._w, 'selection', 'from', index) + select_from = selection_from + def selection_present(self): + """Return True if there are characters selected in the entry, False + otherwise.""" + return self.tk.getboolean( + self.tk.call(self._w, 'selection', 'present')) + select_present = selection_present + def selection_range(self, start, end): + """Set the selection from START to END (not included).""" + self.tk.call(self._w, 'selection', 'range', start, end) + select_range = selection_range + def selection_to(self, index): + """Set the variable end of a selection to INDEX.""" + self.tk.call(self._w, 'selection', 'to', index) + select_to = selection_to + +class Frame(Widget): + """Frame widget which may contain other widgets and can have a 3D border.""" + def __init__(self, master=None, cnf={}, **kw): + """Construct a frame widget with the parent MASTER. + + Valid resource names: background, bd, bg, borderwidth, class, + colormap, container, cursor, height, highlightbackground, + highlightcolor, highlightthickness, relief, takefocus, visual, width.""" + cnf = _cnfmerge((cnf, kw)) + extra = () + if 'class_' in cnf: + extra = ('-class', cnf['class_']) + del cnf['class_'] + elif 'class' in cnf: + extra = ('-class', cnf['class']) + del cnf['class'] + Widget.__init__(self, master, 'frame', cnf, {}, extra) + +class Label(Widget): + """Label widget which can display text and bitmaps.""" + def __init__(self, master=None, cnf={}, **kw): + """Construct a label widget with the parent MASTER. + + STANDARD OPTIONS + + activebackground, activeforeground, anchor, + background, bitmap, borderwidth, cursor, + disabledforeground, font, foreground, + highlightbackground, highlightcolor, + highlightthickness, image, justify, + padx, pady, relief, takefocus, text, + textvariable, underline, wraplength + + WIDGET-SPECIFIC OPTIONS + + height, state, width + + """ + Widget.__init__(self, master, 'label', cnf, kw) + +class Listbox(Widget, XView, YView): + """Listbox widget which can display a list of strings.""" + def __init__(self, master=None, cnf={}, **kw): + """Construct a listbox widget with the parent MASTER. + + Valid resource names: background, bd, bg, borderwidth, cursor, + exportselection, fg, font, foreground, height, highlightbackground, + highlightcolor, highlightthickness, relief, selectbackground, + selectborderwidth, selectforeground, selectmode, setgrid, takefocus, + width, xscrollcommand, yscrollcommand, listvariable.""" + Widget.__init__(self, master, 'listbox', cnf, kw) + def activate(self, index): + """Activate item identified by INDEX.""" + self.tk.call(self._w, 'activate', index) + def bbox(self, index): + """Return a tuple of X1,Y1,X2,Y2 coordinates for a rectangle + which encloses the item identified by the given index.""" + return self._getints(self.tk.call(self._w, 'bbox', index)) or None + def curselection(self): + """Return the indices of currently selected item.""" + return self._getints(self.tk.call(self._w, 'curselection')) or () + def delete(self, first, last=None): + """Delete items from FIRST to LAST (included).""" + self.tk.call(self._w, 'delete', first, last) + def get(self, first, last=None): + """Get list of items from FIRST to LAST (included).""" + if last is not None: + return self.tk.splitlist(self.tk.call( + self._w, 'get', first, last)) + else: + return self.tk.call(self._w, 'get', first) + def index(self, index): + """Return index of item identified with INDEX.""" + i = self.tk.call(self._w, 'index', index) + if i == 'none': return None + return getint(i) + def insert(self, index, *elements): + """Insert ELEMENTS at INDEX.""" + self.tk.call((self._w, 'insert', index) + elements) + def nearest(self, y): + """Get index of item which is nearest to y coordinate Y.""" + return getint(self.tk.call( + self._w, 'nearest', y)) + def scan_mark(self, x, y): + """Remember the current X, Y coordinates.""" + self.tk.call(self._w, 'scan', 'mark', x, y) + def scan_dragto(self, x, y): + """Adjust the view of the listbox to 10 times the + difference between X and Y and the coordinates given in + scan_mark.""" + self.tk.call(self._w, 'scan', 'dragto', x, y) + def see(self, index): + """Scroll such that INDEX is visible.""" + self.tk.call(self._w, 'see', index) + def selection_anchor(self, index): + """Set the fixed end oft the selection to INDEX.""" + self.tk.call(self._w, 'selection', 'anchor', index) + select_anchor = selection_anchor + def selection_clear(self, first, last=None): + """Clear the selection from FIRST to LAST (included).""" + self.tk.call(self._w, + 'selection', 'clear', first, last) + select_clear = selection_clear + def selection_includes(self, index): + """Return 1 if INDEX is part of the selection.""" + return self.tk.getboolean(self.tk.call( + self._w, 'selection', 'includes', index)) + select_includes = selection_includes + def selection_set(self, first, last=None): + """Set the selection from FIRST to LAST (included) without + changing the currently selected elements.""" + self.tk.call(self._w, 'selection', 'set', first, last) + select_set = selection_set + def size(self): + """Return the number of elements in the listbox.""" + return getint(self.tk.call(self._w, 'size')) + def itemcget(self, index, option): + """Return the resource value for an ITEM and an OPTION.""" + return self.tk.call( + (self._w, 'itemcget') + (index, '-'+option)) + def itemconfigure(self, index, cnf=None, **kw): + """Configure resources of an ITEM. + + The values for resources are specified as keyword arguments. + To get an overview about the allowed keyword arguments + call the method without arguments. + Valid resource names: background, bg, foreground, fg, + selectbackground, selectforeground.""" + return self._configure(('itemconfigure', index), cnf, kw) + itemconfig = itemconfigure + +class Menu(Widget): + """Menu widget which allows displaying menu bars, pull-down menus and pop-up menus.""" + def __init__(self, master=None, cnf={}, **kw): + """Construct menu widget with the parent MASTER. + + Valid resource names: activebackground, activeborderwidth, + activeforeground, background, bd, bg, borderwidth, cursor, + disabledforeground, fg, font, foreground, postcommand, relief, + selectcolor, takefocus, tearoff, tearoffcommand, title, type.""" + Widget.__init__(self, master, 'menu', cnf, kw) + def tk_bindForTraversal(self): + # obsolete since Tk 4.0 + import warnings + warnings.warn('tk_bindForTraversal() does nothing and ' + 'will be removed in 3.6', + DeprecationWarning, stacklevel=2) + def tk_mbPost(self): + self.tk.call('tk_mbPost', self._w) + def tk_mbUnpost(self): + self.tk.call('tk_mbUnpost') + def tk_traverseToMenu(self, char): + self.tk.call('tk_traverseToMenu', self._w, char) + def tk_traverseWithinMenu(self, char): + self.tk.call('tk_traverseWithinMenu', self._w, char) + def tk_getMenuButtons(self): + return self.tk.call('tk_getMenuButtons', self._w) + def tk_nextMenu(self, count): + self.tk.call('tk_nextMenu', count) + def tk_nextMenuEntry(self, count): + self.tk.call('tk_nextMenuEntry', count) + def tk_invokeMenu(self): + self.tk.call('tk_invokeMenu', self._w) + def tk_firstMenu(self): + self.tk.call('tk_firstMenu', self._w) + def tk_mbButtonDown(self): + self.tk.call('tk_mbButtonDown', self._w) + def tk_popup(self, x, y, entry=""): + """Post the menu at position X,Y with entry ENTRY.""" + self.tk.call('tk_popup', self._w, x, y, entry) + def activate(self, index): + """Activate entry at INDEX.""" + self.tk.call(self._w, 'activate', index) + def add(self, itemType, cnf={}, **kw): + """Internal function.""" + self.tk.call((self._w, 'add', itemType) + + self._options(cnf, kw)) + def add_cascade(self, cnf={}, **kw): + """Add hierarchical menu item.""" + self.add('cascade', cnf or kw) + def add_checkbutton(self, cnf={}, **kw): + """Add checkbutton menu item.""" + self.add('checkbutton', cnf or kw) + def add_command(self, cnf={}, **kw): + """Add command menu item.""" + self.add('command', cnf or kw) + def add_radiobutton(self, cnf={}, **kw): + """Addd radio menu item.""" + self.add('radiobutton', cnf or kw) + def add_separator(self, cnf={}, **kw): + """Add separator.""" + self.add('separator', cnf or kw) + def insert(self, index, itemType, cnf={}, **kw): + """Internal function.""" + self.tk.call((self._w, 'insert', index, itemType) + + self._options(cnf, kw)) + def insert_cascade(self, index, cnf={}, **kw): + """Add hierarchical menu item at INDEX.""" + self.insert(index, 'cascade', cnf or kw) + def insert_checkbutton(self, index, cnf={}, **kw): + """Add checkbutton menu item at INDEX.""" + self.insert(index, 'checkbutton', cnf or kw) + def insert_command(self, index, cnf={}, **kw): + """Add command menu item at INDEX.""" + self.insert(index, 'command', cnf or kw) + def insert_radiobutton(self, index, cnf={}, **kw): + """Addd radio menu item at INDEX.""" + self.insert(index, 'radiobutton', cnf or kw) + def insert_separator(self, index, cnf={}, **kw): + """Add separator at INDEX.""" + self.insert(index, 'separator', cnf or kw) + def delete(self, index1, index2=None): + """Delete menu items between INDEX1 and INDEX2 (included).""" + if index2 is None: + index2 = index1 + + num_index1, num_index2 = self.index(index1), self.index(index2) + if (num_index1 is None) or (num_index2 is None): + num_index1, num_index2 = 0, -1 + + for i in range(num_index1, num_index2 + 1): + if 'command' in self.entryconfig(i): + c = str(self.entrycget(i, 'command')) + if c: + self.deletecommand(c) + self.tk.call(self._w, 'delete', index1, index2) + def entrycget(self, index, option): + """Return the resource value of a menu item for OPTION at INDEX.""" + return self.tk.call(self._w, 'entrycget', index, '-' + option) + def entryconfigure(self, index, cnf=None, **kw): + """Configure a menu item at INDEX.""" + return self._configure(('entryconfigure', index), cnf, kw) + entryconfig = entryconfigure + def index(self, index): + """Return the index of a menu item identified by INDEX.""" + i = self.tk.call(self._w, 'index', index) + if i == 'none': return None + return getint(i) + def invoke(self, index): + """Invoke a menu item identified by INDEX and execute + the associated command.""" + return self.tk.call(self._w, 'invoke', index) + def post(self, x, y): + """Display a menu at position X,Y.""" + self.tk.call(self._w, 'post', x, y) + def type(self, index): + """Return the type of the menu item at INDEX.""" + return self.tk.call(self._w, 'type', index) + def unpost(self): + """Unmap a menu.""" + self.tk.call(self._w, 'unpost') + def yposition(self, index): + """Return the y-position of the topmost pixel of the menu item at INDEX.""" + return getint(self.tk.call( + self._w, 'yposition', index)) + +class Menubutton(Widget): + """Menubutton widget, obsolete since Tk8.0.""" + def __init__(self, master=None, cnf={}, **kw): + Widget.__init__(self, master, 'menubutton', cnf, kw) + +class Message(Widget): + """Message widget to display multiline text. Obsolete since Label does it too.""" + def __init__(self, master=None, cnf={}, **kw): + Widget.__init__(self, master, 'message', cnf, kw) + +class Radiobutton(Widget): + """Radiobutton widget which shows only one of several buttons in on-state.""" + def __init__(self, master=None, cnf={}, **kw): + """Construct a radiobutton widget with the parent MASTER. + + Valid resource names: activebackground, activeforeground, anchor, + background, bd, bg, bitmap, borderwidth, command, cursor, + disabledforeground, fg, font, foreground, height, + highlightbackground, highlightcolor, highlightthickness, image, + indicatoron, justify, padx, pady, relief, selectcolor, selectimage, + state, takefocus, text, textvariable, underline, value, variable, + width, wraplength.""" + Widget.__init__(self, master, 'radiobutton', cnf, kw) + def deselect(self): + """Put the button in off-state.""" + + self.tk.call(self._w, 'deselect') + def flash(self): + """Flash the button.""" + self.tk.call(self._w, 'flash') + def invoke(self): + """Toggle the button and invoke a command if given as resource.""" + return self.tk.call(self._w, 'invoke') + def select(self): + """Put the button in on-state.""" + self.tk.call(self._w, 'select') + +class Scale(Widget): + """Scale widget which can display a numerical scale.""" + def __init__(self, master=None, cnf={}, **kw): + """Construct a scale widget with the parent MASTER. + + Valid resource names: activebackground, background, bigincrement, bd, + bg, borderwidth, command, cursor, digits, fg, font, foreground, from, + highlightbackground, highlightcolor, highlightthickness, label, + length, orient, relief, repeatdelay, repeatinterval, resolution, + showvalue, sliderlength, sliderrelief, state, takefocus, + tickinterval, to, troughcolor, variable, width.""" + Widget.__init__(self, master, 'scale', cnf, kw) + def get(self): + """Get the current value as integer or float.""" + value = self.tk.call(self._w, 'get') + try: + return getint(value) + except ValueError: + return getdouble(value) + def set(self, value): + """Set the value to VALUE.""" + self.tk.call(self._w, 'set', value) + def coords(self, value=None): + """Return a tuple (X,Y) of the point along the centerline of the + trough that corresponds to VALUE or the current value if None is + given.""" + + return self._getints(self.tk.call(self._w, 'coords', value)) + def identify(self, x, y): + """Return where the point X,Y lies. Valid return values are "slider", + "though1" and "though2".""" + return self.tk.call(self._w, 'identify', x, y) + +class Scrollbar(Widget): + """Scrollbar widget which displays a slider at a certain position.""" + def __init__(self, master=None, cnf={}, **kw): + """Construct a scrollbar widget with the parent MASTER. + + Valid resource names: activebackground, activerelief, + background, bd, bg, borderwidth, command, cursor, + elementborderwidth, highlightbackground, + highlightcolor, highlightthickness, jump, orient, + relief, repeatdelay, repeatinterval, takefocus, + troughcolor, width.""" + Widget.__init__(self, master, 'scrollbar', cnf, kw) + def activate(self, index): + """Display the element at INDEX with activebackground and activerelief. + INDEX can be "arrow1","slider" or "arrow2".""" + self.tk.call(self._w, 'activate', index) + def delta(self, deltax, deltay): + """Return the fractional change of the scrollbar setting if it + would be moved by DELTAX or DELTAY pixels.""" + return getdouble( + self.tk.call(self._w, 'delta', deltax, deltay)) + def fraction(self, x, y): + """Return the fractional value which corresponds to a slider + position of X,Y.""" + return getdouble(self.tk.call(self._w, 'fraction', x, y)) + def identify(self, x, y): + """Return the element under position X,Y as one of + "arrow1","slider","arrow2" or "".""" + return self.tk.call(self._w, 'identify', x, y) + def get(self): + """Return the current fractional values (upper and lower end) + of the slider position.""" + return self._getdoubles(self.tk.call(self._w, 'get')) + def set(self, *args): + """Set the fractional values of the slider position (upper and + lower ends as value between 0 and 1).""" + self.tk.call((self._w, 'set') + args) + + + +class Text(Widget, XView, YView): + """Text widget which can display text in various forms.""" + def __init__(self, master=None, cnf={}, **kw): + """Construct a text widget with the parent MASTER. + + STANDARD OPTIONS + + background, borderwidth, cursor, + exportselection, font, foreground, + highlightbackground, highlightcolor, + highlightthickness, insertbackground, + insertborderwidth, insertofftime, + insertontime, insertwidth, padx, pady, + relief, selectbackground, + selectborderwidth, selectforeground, + setgrid, takefocus, + xscrollcommand, yscrollcommand, + + WIDGET-SPECIFIC OPTIONS + + autoseparators, height, maxundo, + spacing1, spacing2, spacing3, + state, tabs, undo, width, wrap, + + """ + Widget.__init__(self, master, 'text', cnf, kw) + def bbox(self, *args): + """Return a tuple of (x,y,width,height) which gives the bounding + box of the visible part of the character at the index in ARGS.""" + return self._getints( + self.tk.call((self._w, 'bbox') + args)) or None + def tk_textSelectTo(self, index): + self.tk.call('tk_textSelectTo', self._w, index) + def tk_textBackspace(self): + self.tk.call('tk_textBackspace', self._w) + def tk_textIndexCloser(self, a, b, c): + self.tk.call('tk_textIndexCloser', self._w, a, b, c) + def tk_textResetAnchor(self, index): + self.tk.call('tk_textResetAnchor', self._w, index) + def compare(self, index1, op, index2): + """Return whether between index INDEX1 and index INDEX2 the + relation OP is satisfied. OP is one of <, <=, ==, >=, >, or !=.""" + return self.tk.getboolean(self.tk.call( + self._w, 'compare', index1, op, index2)) + def debug(self, boolean=None): + """Turn on the internal consistency checks of the B-Tree inside the text + widget according to BOOLEAN.""" + if boolean is None: + return self.tk.getboolean(self.tk.call(self._w, 'debug')) + self.tk.call(self._w, 'debug', boolean) + def delete(self, index1, index2=None): + """Delete the characters between INDEX1 and INDEX2 (not included).""" + self.tk.call(self._w, 'delete', index1, index2) + def dlineinfo(self, index): + """Return tuple (x,y,width,height,baseline) giving the bounding box + and baseline position of the visible part of the line containing + the character at INDEX.""" + return self._getints(self.tk.call(self._w, 'dlineinfo', index)) + def dump(self, index1, index2=None, command=None, **kw): + """Return the contents of the widget between index1 and index2. + + The type of contents returned in filtered based on the keyword + parameters; if 'all', 'image', 'mark', 'tag', 'text', or 'window' are + given and true, then the corresponding items are returned. The result + is a list of triples of the form (key, value, index). If none of the + keywords are true then 'all' is used by default. + + If the 'command' argument is given, it is called once for each element + of the list of triples, with the values of each triple serving as the + arguments to the function. In this case the list is not returned.""" + args = [] + func_name = None + result = None + if not command: + # Never call the dump command without the -command flag, since the + # output could involve Tcl quoting and would be a pain to parse + # right. Instead just set the command to build a list of triples + # as if we had done the parsing. + result = [] + def append_triple(key, value, index, result=result): + result.append((key, value, index)) + command = append_triple + try: + if not isinstance(command, str): + func_name = command = self._register(command) + args += ["-command", command] + for key in kw: + if kw[key]: args.append("-" + key) + args.append(index1) + if index2: + args.append(index2) + self.tk.call(self._w, "dump", *args) + return result + finally: + if func_name: + self.deletecommand(func_name) + + ## new in tk8.4 + def edit(self, *args): + """Internal method + + This method controls the undo mechanism and + the modified flag. The exact behavior of the + command depends on the option argument that + follows the edit argument. The following forms + of the command are currently supported: + + edit_modified, edit_redo, edit_reset, edit_separator + and edit_undo + + """ + return self.tk.call(self._w, 'edit', *args) + + def edit_modified(self, arg=None): + """Get or Set the modified flag + + If arg is not specified, returns the modified + flag of the widget. The insert, delete, edit undo and + edit redo commands or the user can set or clear the + modified flag. If boolean is specified, sets the + modified flag of the widget to arg. + """ + return self.edit("modified", arg) + + def edit_redo(self): + """Redo the last undone edit + + When the undo option is true, reapplies the last + undone edits provided no other edits were done since + then. Generates an error when the redo stack is empty. + Does nothing when the undo option is false. + """ + return self.edit("redo") + + def edit_reset(self): + """Clears the undo and redo stacks + """ + return self.edit("reset") + + def edit_separator(self): + """Inserts a separator (boundary) on the undo stack. + + Does nothing when the undo option is false + """ + return self.edit("separator") + + def edit_undo(self): + """Undoes the last edit action + + If the undo option is true. An edit action is defined + as all the insert and delete commands that are recorded + on the undo stack in between two separators. Generates + an error when the undo stack is empty. Does nothing + when the undo option is false + """ + return self.edit("undo") + + def get(self, index1, index2=None): + """Return the text from INDEX1 to INDEX2 (not included).""" + return self.tk.call(self._w, 'get', index1, index2) + # (Image commands are new in 8.0) + def image_cget(self, index, option): + """Return the value of OPTION of an embedded image at INDEX.""" + if option[:1] != "-": + option = "-" + option + if option[-1:] == "_": + option = option[:-1] + return self.tk.call(self._w, "image", "cget", index, option) + def image_configure(self, index, cnf=None, **kw): + """Configure an embedded image at INDEX.""" + return self._configure(('image', 'configure', index), cnf, kw) + def image_create(self, index, cnf={}, **kw): + """Create an embedded image at INDEX.""" + return self.tk.call( + self._w, "image", "create", index, + *self._options(cnf, kw)) + def image_names(self): + """Return all names of embedded images in this widget.""" + return self.tk.call(self._w, "image", "names") + def index(self, index): + """Return the index in the form line.char for INDEX.""" + return str(self.tk.call(self._w, 'index', index)) + def insert(self, index, chars, *args): + """Insert CHARS before the characters at INDEX. An additional + tag can be given in ARGS. Additional CHARS and tags can follow in ARGS.""" + self.tk.call((self._w, 'insert', index, chars) + args) + def mark_gravity(self, markName, direction=None): + """Change the gravity of a mark MARKNAME to DIRECTION (LEFT or RIGHT). + Return the current value if None is given for DIRECTION.""" + return self.tk.call( + (self._w, 'mark', 'gravity', markName, direction)) + def mark_names(self): + """Return all mark names.""" + return self.tk.splitlist(self.tk.call( + self._w, 'mark', 'names')) + def mark_set(self, markName, index): + """Set mark MARKNAME before the character at INDEX.""" + self.tk.call(self._w, 'mark', 'set', markName, index) + def mark_unset(self, *markNames): + """Delete all marks in MARKNAMES.""" + self.tk.call((self._w, 'mark', 'unset') + markNames) + def mark_next(self, index): + """Return the name of the next mark after INDEX.""" + return self.tk.call(self._w, 'mark', 'next', index) or None + def mark_previous(self, index): + """Return the name of the previous mark before INDEX.""" + return self.tk.call(self._w, 'mark', 'previous', index) or None + def scan_mark(self, x, y): + """Remember the current X, Y coordinates.""" + self.tk.call(self._w, 'scan', 'mark', x, y) + def scan_dragto(self, x, y): + """Adjust the view of the text to 10 times the + difference between X and Y and the coordinates given in + scan_mark.""" + self.tk.call(self._w, 'scan', 'dragto', x, y) + def search(self, pattern, index, stopindex=None, + forwards=None, backwards=None, exact=None, + regexp=None, nocase=None, count=None, elide=None): + """Search PATTERN beginning from INDEX until STOPINDEX. + Return the index of the first character of a match or an + empty string.""" + args = [self._w, 'search'] + if forwards: args.append('-forwards') + if backwards: args.append('-backwards') + if exact: args.append('-exact') + if regexp: args.append('-regexp') + if nocase: args.append('-nocase') + if elide: args.append('-elide') + if count: args.append('-count'); args.append(count) + if pattern and pattern[0] == '-': args.append('--') + args.append(pattern) + args.append(index) + if stopindex: args.append(stopindex) + return str(self.tk.call(tuple(args))) + def see(self, index): + """Scroll such that the character at INDEX is visible.""" + self.tk.call(self._w, 'see', index) + def tag_add(self, tagName, index1, *args): + """Add tag TAGNAME to all characters between INDEX1 and index2 in ARGS. + Additional pairs of indices may follow in ARGS.""" + self.tk.call( + (self._w, 'tag', 'add', tagName, index1) + args) + def tag_unbind(self, tagName, sequence, funcid=None): + """Unbind for all characters with TAGNAME for event SEQUENCE the + function identified with FUNCID.""" + self.tk.call(self._w, 'tag', 'bind', tagName, sequence, '') + if funcid: + self.deletecommand(funcid) + def tag_bind(self, tagName, sequence, func, add=None): + """Bind to all characters with TAGNAME at event SEQUENCE a call to function FUNC. + + An additional boolean parameter ADD specifies whether FUNC will be + called additionally to the other bound function or whether it will + replace the previous function. See bind for the return value.""" + return self._bind((self._w, 'tag', 'bind', tagName), + sequence, func, add) + def tag_cget(self, tagName, option): + """Return the value of OPTION for tag TAGNAME.""" + if option[:1] != '-': + option = '-' + option + if option[-1:] == '_': + option = option[:-1] + return self.tk.call(self._w, 'tag', 'cget', tagName, option) + def tag_configure(self, tagName, cnf=None, **kw): + """Configure a tag TAGNAME.""" + return self._configure(('tag', 'configure', tagName), cnf, kw) + tag_config = tag_configure + def tag_delete(self, *tagNames): + """Delete all tags in TAGNAMES.""" + self.tk.call((self._w, 'tag', 'delete') + tagNames) + def tag_lower(self, tagName, belowThis=None): + """Change the priority of tag TAGNAME such that it is lower + than the priority of BELOWTHIS.""" + self.tk.call(self._w, 'tag', 'lower', tagName, belowThis) + def tag_names(self, index=None): + """Return a list of all tag names.""" + return self.tk.splitlist( + self.tk.call(self._w, 'tag', 'names', index)) + def tag_nextrange(self, tagName, index1, index2=None): + """Return a list of start and end index for the first sequence of + characters between INDEX1 and INDEX2 which all have tag TAGNAME. + The text is searched forward from INDEX1.""" + return self.tk.splitlist(self.tk.call( + self._w, 'tag', 'nextrange', tagName, index1, index2)) + def tag_prevrange(self, tagName, index1, index2=None): + """Return a list of start and end index for the first sequence of + characters between INDEX1 and INDEX2 which all have tag TAGNAME. + The text is searched backwards from INDEX1.""" + return self.tk.splitlist(self.tk.call( + self._w, 'tag', 'prevrange', tagName, index1, index2)) + def tag_raise(self, tagName, aboveThis=None): + """Change the priority of tag TAGNAME such that it is higher + than the priority of ABOVETHIS.""" + self.tk.call( + self._w, 'tag', 'raise', tagName, aboveThis) + def tag_ranges(self, tagName): + """Return a list of ranges of text which have tag TAGNAME.""" + return self.tk.splitlist(self.tk.call( + self._w, 'tag', 'ranges', tagName)) + def tag_remove(self, tagName, index1, index2=None): + """Remove tag TAGNAME from all characters between INDEX1 and INDEX2.""" + self.tk.call( + self._w, 'tag', 'remove', tagName, index1, index2) + def window_cget(self, index, option): + """Return the value of OPTION of an embedded window at INDEX.""" + if option[:1] != '-': + option = '-' + option + if option[-1:] == '_': + option = option[:-1] + return self.tk.call(self._w, 'window', 'cget', index, option) + def window_configure(self, index, cnf=None, **kw): + """Configure an embedded window at INDEX.""" + return self._configure(('window', 'configure', index), cnf, kw) + window_config = window_configure + def window_create(self, index, cnf={}, **kw): + """Create a window at INDEX.""" + self.tk.call( + (self._w, 'window', 'create', index) + + self._options(cnf, kw)) + def window_names(self): + """Return all names of embedded windows in this widget.""" + return self.tk.splitlist( + self.tk.call(self._w, 'window', 'names')) + def yview_pickplace(self, *what): + """Obsolete function, use see.""" + self.tk.call((self._w, 'yview', '-pickplace') + what) + + +class _setit: + """Internal class. It wraps the command in the widget OptionMenu.""" + def __init__(self, var, value, callback=None): + self.__value = value + self.__var = var + self.__callback = callback + def __call__(self, *args): + self.__var.set(self.__value) + if self.__callback: + self.__callback(self.__value, *args) + +class OptionMenu(Menubutton): + """OptionMenu which allows the user to select a value from a menu.""" + def __init__(self, master, variable, value, *values, **kwargs): + """Construct an optionmenu widget with the parent MASTER, with + the resource textvariable set to VARIABLE, the initially selected + value VALUE, the other menu values VALUES and an additional + keyword argument command.""" + kw = {"borderwidth": 2, "textvariable": variable, + "indicatoron": 1, "relief": RAISED, "anchor": "c", + "highlightthickness": 2} + Widget.__init__(self, master, "menubutton", kw) + self.widgetName = 'tk_optionMenu' + menu = self.__menu = Menu(self, name="menu", tearoff=0) + self.menuname = menu._w + # 'command' is the only supported keyword + callback = kwargs.get('command') + if 'command' in kwargs: + del kwargs['command'] + if kwargs: + raise TclError, 'unknown option -'+kwargs.keys()[0] + menu.add_command(label=value, + command=_setit(variable, value, callback)) + for v in values: + menu.add_command(label=v, + command=_setit(variable, v, callback)) + self["menu"] = menu + + def __getitem__(self, name): + if name == 'menu': + return self.__menu + return Widget.__getitem__(self, name) + + def destroy(self): + """Destroy this widget and the associated menu.""" + Menubutton.destroy(self) + self.__menu = None + +class Image: + """Base class for images.""" + _last_id = 0 + def __init__(self, imgtype, name=None, cnf={}, master=None, **kw): + self.name = None + if not master: + master = _default_root + if not master: + raise RuntimeError, 'Too early to create image' + self.tk = getattr(master, 'tk', master) + if not name: + Image._last_id += 1 + name = "pyimage%r" % (Image._last_id,) # tk itself would use image<x> + # The following is needed for systems where id(x) + # can return a negative number, such as Linux/m68k: + if name[0] == '-': name = '_' + name[1:] + if kw and cnf: cnf = _cnfmerge((cnf, kw)) + elif kw: cnf = kw + options = () + for k, v in cnf.items(): + if hasattr(v, '__call__'): + v = self._register(v) + elif k in ('data', 'maskdata'): + v = self.tk._createbytearray(v) + options = options + ('-'+k, v) + self.tk.call(('image', 'create', imgtype, name,) + options) + self.name = name + def __str__(self): return self.name + def __del__(self): + if self.name: + try: + self.tk.call('image', 'delete', self.name) + except TclError: + # May happen if the root was destroyed + pass + def __setitem__(self, key, value): + self.tk.call(self.name, 'configure', '-'+key, value) + def __getitem__(self, key): + return self.tk.call(self.name, 'configure', '-'+key) + def configure(self, **kw): + """Configure the image.""" + res = () + for k, v in _cnfmerge(kw).items(): + if v is not None: + if k[-1] == '_': k = k[:-1] + if hasattr(v, '__call__'): + v = self._register(v) + elif k in ('data', 'maskdata'): + v = self.tk._createbytearray(v) + res = res + ('-'+k, v) + self.tk.call((self.name, 'config') + res) + config = configure + def height(self): + """Return the height of the image.""" + return getint( + self.tk.call('image', 'height', self.name)) + def type(self): + """Return the type of the image, e.g. "photo" or "bitmap".""" + return self.tk.call('image', 'type', self.name) + def width(self): + """Return the width of the image.""" + return getint( + self.tk.call('image', 'width', self.name)) + +class PhotoImage(Image): + """Widget which can display images in PGM, PPM, GIF, PNG format.""" + def __init__(self, name=None, cnf={}, master=None, **kw): + """Create an image with NAME. + + Valid resource names: data, format, file, gamma, height, palette, + width.""" + Image.__init__(self, 'photo', name, cnf, master, **kw) + def blank(self): + """Display a transparent image.""" + self.tk.call(self.name, 'blank') + def cget(self, option): + """Return the value of OPTION.""" + return self.tk.call(self.name, 'cget', '-' + option) + # XXX config + def __getitem__(self, key): + return self.tk.call(self.name, 'cget', '-' + key) + # XXX copy -from, -to, ...? + def copy(self): + """Return a new PhotoImage with the same image as this widget.""" + destImage = PhotoImage(master=self.tk) + self.tk.call(destImage, 'copy', self.name) + return destImage + def zoom(self, x, y=''): + """Return a new PhotoImage with the same image as this widget + but zoom it with a factor of x in the X direction and y in the Y + direction. If y is not given, the default value is the same as x. + """ + destImage = PhotoImage(master=self.tk) + if y=='': y=x + self.tk.call(destImage, 'copy', self.name, '-zoom',x,y) + return destImage + def subsample(self, x, y=''): + """Return a new PhotoImage based on the same image as this widget + but use only every Xth or Yth pixel. If y is not given, the + default value is the same as x. + """ + destImage = PhotoImage(master=self.tk) + if y=='': y=x + self.tk.call(destImage, 'copy', self.name, '-subsample',x,y) + return destImage + def get(self, x, y): + """Return the color (red, green, blue) of the pixel at X,Y.""" + return self.tk.call(self.name, 'get', x, y) + def put(self, data, to=None): + """Put row formatted colors to image starting from + position TO, e.g. image.put("{red green} {blue yellow}", to=(4,6))""" + args = (self.name, 'put', data) + if to: + if to[0] == '-to': + to = to[1:] + args = args + ('-to',) + tuple(to) + self.tk.call(args) + # XXX read + def write(self, filename, format=None, from_coords=None): + """Write image to file FILENAME in FORMAT starting from + position FROM_COORDS.""" + args = (self.name, 'write', filename) + if format: + args = args + ('-format', format) + if from_coords: + args = args + ('-from',) + tuple(from_coords) + self.tk.call(args) + +class BitmapImage(Image): + """Widget which can display images in XBM format.""" + def __init__(self, name=None, cnf={}, master=None, **kw): + """Create a bitmap with NAME. + + Valid resource names: background, data, file, foreground, maskdata, maskfile.""" + Image.__init__(self, 'bitmap', name, cnf, master, **kw) + +def image_names(): + return _default_root.tk.splitlist(_default_root.tk.call('image', 'names')) + +def image_types(): + return _default_root.tk.splitlist(_default_root.tk.call('image', 'types')) + + +class Spinbox(Widget, XView): + """spinbox widget.""" + def __init__(self, master=None, cnf={}, **kw): + """Construct a spinbox widget with the parent MASTER. + + STANDARD OPTIONS + + activebackground, background, borderwidth, + cursor, exportselection, font, foreground, + highlightbackground, highlightcolor, + highlightthickness, insertbackground, + insertborderwidth, insertofftime, + insertontime, insertwidth, justify, relief, + repeatdelay, repeatinterval, + selectbackground, selectborderwidth + selectforeground, takefocus, textvariable + xscrollcommand. + + WIDGET-SPECIFIC OPTIONS + + buttonbackground, buttoncursor, + buttondownrelief, buttonuprelief, + command, disabledbackground, + disabledforeground, format, from, + invalidcommand, increment, + readonlybackground, state, to, + validate, validatecommand values, + width, wrap, + """ + Widget.__init__(self, master, 'spinbox', cnf, kw) + + def bbox(self, index): + """Return a tuple of X1,Y1,X2,Y2 coordinates for a + rectangle which encloses the character given by index. + + The first two elements of the list give the x and y + coordinates of the upper-left corner of the screen + area covered by the character (in pixels relative + to the widget) and the last two elements give the + width and height of the character, in pixels. The + bounding box may refer to a region outside the + visible area of the window. + """ + return self._getints(self.tk.call(self._w, 'bbox', index)) or None + + def delete(self, first, last=None): + """Delete one or more elements of the spinbox. + + First is the index of the first character to delete, + and last is the index of the character just after + the last one to delete. If last isn't specified it + defaults to first+1, i.e. a single character is + deleted. This command returns an empty string. + """ + return self.tk.call(self._w, 'delete', first, last) + + def get(self): + """Returns the spinbox's string""" + return self.tk.call(self._w, 'get') + + def icursor(self, index): + """Alter the position of the insertion cursor. + + The insertion cursor will be displayed just before + the character given by index. Returns an empty string + """ + return self.tk.call(self._w, 'icursor', index) + + def identify(self, x, y): + """Returns the name of the widget at position x, y + + Return value is one of: none, buttondown, buttonup, entry + """ + return self.tk.call(self._w, 'identify', x, y) + + def index(self, index): + """Returns the numerical index corresponding to index + """ + return self.tk.call(self._w, 'index', index) + + def insert(self, index, s): + """Insert string s at index + + Returns an empty string. + """ + return self.tk.call(self._w, 'insert', index, s) + + def invoke(self, element): + """Causes the specified element to be invoked + + The element could be buttondown or buttonup + triggering the action associated with it. + """ + return self.tk.call(self._w, 'invoke', element) + + def scan(self, *args): + """Internal function.""" + return self._getints( + self.tk.call((self._w, 'scan') + args)) or () + + def scan_mark(self, x): + """Records x and the current view in the spinbox window; + + used in conjunction with later scan dragto commands. + Typically this command is associated with a mouse button + press in the widget. It returns an empty string. + """ + return self.scan("mark", x) + + def scan_dragto(self, x): + """Compute the difference between the given x argument + and the x argument to the last scan mark command + + It then adjusts the view left or right by 10 times the + difference in x-coordinates. This command is typically + associated with mouse motion events in the widget, to + produce the effect of dragging the spinbox at high speed + through the window. The return value is an empty string. + """ + return self.scan("dragto", x) + + def selection(self, *args): + """Internal function.""" + return self._getints( + self.tk.call((self._w, 'selection') + args)) or () + + def selection_adjust(self, index): + """Locate the end of the selection nearest to the character + given by index, + + Then adjust that end of the selection to be at index + (i.e including but not going beyond index). The other + end of the selection is made the anchor point for future + select to commands. If the selection isn't currently in + the spinbox, then a new selection is created to include + the characters between index and the most recent selection + anchor point, inclusive. + """ + return self.selection("adjust", index) + + def selection_clear(self): + """Clear the selection + + If the selection isn't in this widget then the + command has no effect. + """ + return self.selection("clear") + + def selection_element(self, element=None): + """Sets or gets the currently selected element. + + If a spinbutton element is specified, it will be + displayed depressed. + """ + return self.tk.call(self._w, 'selection', 'element', element) + +########################################################################### + +class LabelFrame(Widget): + """labelframe widget.""" + def __init__(self, master=None, cnf={}, **kw): + """Construct a labelframe widget with the parent MASTER. + + STANDARD OPTIONS + + borderwidth, cursor, font, foreground, + highlightbackground, highlightcolor, + highlightthickness, padx, pady, relief, + takefocus, text + + WIDGET-SPECIFIC OPTIONS + + background, class, colormap, container, + height, labelanchor, labelwidget, + visual, width + """ + Widget.__init__(self, master, 'labelframe', cnf, kw) + +######################################################################## + +class PanedWindow(Widget): + """panedwindow widget.""" + def __init__(self, master=None, cnf={}, **kw): + """Construct a panedwindow widget with the parent MASTER. + + STANDARD OPTIONS + + background, borderwidth, cursor, height, + orient, relief, width + + WIDGET-SPECIFIC OPTIONS + + handlepad, handlesize, opaqueresize, + sashcursor, sashpad, sashrelief, + sashwidth, showhandle, + """ + Widget.__init__(self, master, 'panedwindow', cnf, kw) + + def add(self, child, **kw): + """Add a child widget to the panedwindow in a new pane. + + The child argument is the name of the child widget + followed by pairs of arguments that specify how to + manage the windows. The possible options and values + are the ones accepted by the paneconfigure method. + """ + self.tk.call((self._w, 'add', child) + self._options(kw)) + + def remove(self, child): + """Remove the pane containing child from the panedwindow + + All geometry management options for child will be forgotten. + """ + self.tk.call(self._w, 'forget', child) + forget=remove + + def identify(self, x, y): + """Identify the panedwindow component at point x, y + + If the point is over a sash or a sash handle, the result + is a two element list containing the index of the sash or + handle, and a word indicating whether it is over a sash + or a handle, such as {0 sash} or {2 handle}. If the point + is over any other part of the panedwindow, the result is + an empty list. + """ + return self.tk.call(self._w, 'identify', x, y) + + def proxy(self, *args): + """Internal function.""" + return self._getints( + self.tk.call((self._w, 'proxy') + args)) or () + + def proxy_coord(self): + """Return the x and y pair of the most recent proxy location + """ + return self.proxy("coord") + + def proxy_forget(self): + """Remove the proxy from the display. + """ + return self.proxy("forget") + + def proxy_place(self, x, y): + """Place the proxy at the given x and y coordinates. + """ + return self.proxy("place", x, y) + + def sash(self, *args): + """Internal function.""" + return self._getints( + self.tk.call((self._w, 'sash') + args)) or () + + def sash_coord(self, index): + """Return the current x and y pair for the sash given by index. + + Index must be an integer between 0 and 1 less than the + number of panes in the panedwindow. The coordinates given are + those of the top left corner of the region containing the sash. + pathName sash dragto index x y This command computes the + difference between the given coordinates and the coordinates + given to the last sash coord command for the given sash. It then + moves that sash the computed difference. The return value is the + empty string. + """ + return self.sash("coord", index) + + def sash_mark(self, index): + """Records x and y for the sash given by index; + + Used in conjunction with later dragto commands to move the sash. + """ + return self.sash("mark", index) + + def sash_place(self, index, x, y): + """Place the sash given by index at the given coordinates + """ + return self.sash("place", index, x, y) + + def panecget(self, child, option): + """Query a management option for window. + + Option may be any value allowed by the paneconfigure subcommand + """ + return self.tk.call( + (self._w, 'panecget') + (child, '-'+option)) + + def paneconfigure(self, tagOrId, cnf=None, **kw): + """Query or modify the management options for window. + + If no option is specified, returns a list describing all + of the available options for pathName. If option is + specified with no value, then the command returns a list + describing the one named option (this list will be identical + to the corresponding sublist of the value returned if no + option is specified). If one or more option-value pairs are + specified, then the command modifies the given widget + option(s) to have the given value(s); in this case the + command returns an empty string. The following options + are supported: + + after window + Insert the window after the window specified. window + should be the name of a window already managed by pathName. + before window + Insert the window before the window specified. window + should be the name of a window already managed by pathName. + height size + Specify a height for the window. The height will be the + outer dimension of the window including its border, if + any. If size is an empty string, or if -height is not + specified, then the height requested internally by the + window will be used initially; the height may later be + adjusted by the movement of sashes in the panedwindow. + Size may be any value accepted by Tk_GetPixels. + minsize n + Specifies that the size of the window cannot be made + less than n. This constraint only affects the size of + the widget in the paned dimension -- the x dimension + for horizontal panedwindows, the y dimension for + vertical panedwindows. May be any value accepted by + Tk_GetPixels. + padx n + Specifies a non-negative value indicating how much + extra space to leave on each side of the window in + the X-direction. The value may have any of the forms + accepted by Tk_GetPixels. + pady n + Specifies a non-negative value indicating how much + extra space to leave on each side of the window in + the Y-direction. The value may have any of the forms + accepted by Tk_GetPixels. + sticky style + If a window's pane is larger than the requested + dimensions of the window, this option may be used + to position (or stretch) the window within its pane. + Style is a string that contains zero or more of the + characters n, s, e or w. The string can optionally + contains spaces or commas, but they are ignored. Each + letter refers to a side (north, south, east, or west) + that the window will "stick" to. If both n and s + (or e and w) are specified, the window will be + stretched to fill the entire height (or width) of + its cavity. + width size + Specify a width for the window. The width will be + the outer dimension of the window including its + border, if any. If size is an empty string, or + if -width is not specified, then the width requested + internally by the window will be used initially; the + width may later be adjusted by the movement of sashes + in the panedwindow. Size may be any value accepted by + Tk_GetPixels. + + """ + if cnf is None and not kw: + return self._getconfigure(self._w, 'paneconfigure', tagOrId) + if type(cnf) == StringType and not kw: + return self._getconfigure1( + self._w, 'paneconfigure', tagOrId, '-'+cnf) + self.tk.call((self._w, 'paneconfigure', tagOrId) + + self._options(cnf, kw)) + paneconfig = paneconfigure + + def panes(self): + """Returns an ordered list of the child panes.""" + return self.tk.splitlist(self.tk.call(self._w, 'panes')) + +###################################################################### +# Extensions: + +class Studbutton(Button): + def __init__(self, master=None, cnf={}, **kw): + Widget.__init__(self, master, 'studbutton', cnf, kw) + self.bind('<Any-Enter>', self.tkButtonEnter) + self.bind('<Any-Leave>', self.tkButtonLeave) + self.bind('<1>', self.tkButtonDown) + self.bind('<ButtonRelease-1>', self.tkButtonUp) + +class Tributton(Button): + def __init__(self, master=None, cnf={}, **kw): + Widget.__init__(self, master, 'tributton', cnf, kw) + self.bind('<Any-Enter>', self.tkButtonEnter) + self.bind('<Any-Leave>', self.tkButtonLeave) + self.bind('<1>', self.tkButtonDown) + self.bind('<ButtonRelease-1>', self.tkButtonUp) + self['fg'] = self['bg'] + self['activebackground'] = self['bg'] + +###################################################################### +# Test: + +def _test(): + root = Tk() + text = "This is Tcl/Tk version %s" % TclVersion + if TclVersion >= 8.1: + try: + text = text + unicode("\nThis should be a cedilla: \347", + "iso-8859-1") + except NameError: + pass # no unicode support + label = Label(root, text=text) + label.pack() + test = Button(root, text="Click me!", + command=lambda root=root: root.test.configure( + text="[%s]" % root.test['text'])) + test.pack() + root.test = test + quit = Button(root, text="QUIT", command=root.destroy) + quit.pack() + # The following three commands are needed so the window pops + # up on top on Windows... + root.iconify() + root.update() + root.deiconify() + root.mainloop() + +if __name__ == '__main__': + _test() diff --git a/contrib/tools/python/src/Lib/lib-tk/test/runtktests.py b/contrib/tools/python/src/Lib/lib-tk/test/runtktests.py new file mode 100644 index 0000000000..d4b18931ec --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/test/runtktests.py @@ -0,0 +1,70 @@ +""" +Use this module to get and run all tk tests. + +Tkinter tests should live in a package inside the directory where this file +lives, like test_tkinter. +Extensions also should live in packages following the same rule as above. +""" + +import os +import sys +import unittest +import importlib +import test.test_support + +this_dir_path = os.path.abspath(os.path.dirname(__file__)) + +def is_package(path): + for name in os.listdir(path): + if name in ('__init__.py', '__init__.pyc', '__init.pyo'): + return True + return False + +def get_tests_modules(basepath=this_dir_path, gui=True, packages=None): + """This will import and yield modules whose names start with test_ + and are inside packages found in the path starting at basepath. + + If packages is specified it should contain package names that want + their tests collected. + """ + py_ext = '.py' + + for dirpath, dirnames, filenames in os.walk(basepath): + for dirname in list(dirnames): + if dirname[0] == '.': + dirnames.remove(dirname) + + if is_package(dirpath) and filenames: + pkg_name = dirpath[len(basepath) + len(os.sep):].replace('/', '.') + if packages and pkg_name not in packages: + continue + + filenames = filter( + lambda x: x.startswith('test_') and x.endswith(py_ext), + filenames) + + for name in filenames: + try: + yield importlib.import_module( + ".%s" % name[:-len(py_ext)], pkg_name) + except test.test_support.ResourceDenied: + if gui: + raise + +def get_tests(text=True, gui=True, packages=None): + """Yield all the tests in the modules found by get_tests_modules. + + If nogui is True, only tests that do not require a GUI will be + returned.""" + attrs = [] + if text: + attrs.append('tests_nogui') + if gui: + attrs.append('tests_gui') + for module in get_tests_modules(gui=gui, packages=packages): + for attr in attrs: + for test in getattr(module, attr, ()): + yield test + +if __name__ == "__main__": + test.test_support.run_unittest(*get_tests()) diff --git a/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/__init__.py b/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/__init__.py new file mode 100644 index 0000000000..e69de29bb2 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/__init__.py diff --git a/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_font.py b/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_font.py new file mode 100644 index 0000000000..830c5a691a --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_font.py @@ -0,0 +1,107 @@ +import unittest +import Tkinter as tkinter +import tkFont as font +from test.test_support import requires, run_unittest, gc_collect +from test_ttk.support import AbstractTkTest + +requires('gui') + +fontname = "TkDefaultFont" + +class FontTest(AbstractTkTest, unittest.TestCase): + + @classmethod + def setUpClass(cls): + AbstractTkTest.setUpClass.__func__(cls) + try: + cls.font = font.Font(root=cls.root, name=fontname, exists=True) + except tkinter.TclError: + cls.font = font.Font(root=cls.root, name=fontname, exists=False) + + def test_configure(self): + options = self.font.configure() + self.assertGreaterEqual(set(options), + {'family', 'size', 'weight', 'slant', 'underline', 'overstrike'}) + for key in options: + self.assertEqual(self.font.cget(key), options[key]) + self.assertEqual(self.font[key], options[key]) + for key in 'family', 'weight', 'slant': + self.assertIsInstance(options[key], str) + self.assertIsInstance(self.font.cget(key), str) + self.assertIsInstance(self.font[key], str) + sizetype = int if self.wantobjects else str + for key in 'size', 'underline', 'overstrike': + self.assertIsInstance(options[key], sizetype) + self.assertIsInstance(self.font.cget(key), sizetype) + self.assertIsInstance(self.font[key], sizetype) + + def test_unicode_family(self): + family = u'MS \u30b4\u30b7\u30c3\u30af' + try: + f = font.Font(root=self.root, family=family, exists=True) + except tkinter.TclError: + f = font.Font(root=self.root, family=family, exists=False) + self.assertEqual(f.cget('family'), family) + del f + gc_collect() + + def test_actual(self): + options = self.font.actual() + self.assertGreaterEqual(set(options), + {'family', 'size', 'weight', 'slant', 'underline', 'overstrike'}) + for key in options: + self.assertEqual(self.font.actual(key), options[key]) + for key in 'family', 'weight', 'slant': + self.assertIsInstance(options[key], str) + self.assertIsInstance(self.font.actual(key), str) + sizetype = int if self.wantobjects else str + for key in 'size', 'underline', 'overstrike': + self.assertIsInstance(options[key], sizetype) + self.assertIsInstance(self.font.actual(key), sizetype) + + def test_name(self): + self.assertEqual(self.font.name, fontname) + self.assertEqual(str(self.font), fontname) + + def test_eq(self): + font1 = font.Font(root=self.root, name=fontname, exists=True) + font2 = font.Font(root=self.root, name=fontname, exists=True) + self.assertIsNot(font1, font2) + self.assertEqual(font1, font2) + self.assertNotEqual(font1, font1.copy()) + self.assertNotEqual(font1, 0) + self.assertNotIn(font1, [0]) + + def test_measure(self): + self.assertIsInstance(self.font.measure('abc'), int) + + def test_metrics(self): + metrics = self.font.metrics() + self.assertGreaterEqual(set(metrics), + {'ascent', 'descent', 'linespace', 'fixed'}) + for key in metrics: + self.assertEqual(self.font.metrics(key), metrics[key]) + self.assertIsInstance(metrics[key], int) + self.assertIsInstance(self.font.metrics(key), int) + + def test_families(self): + families = font.families(self.root) + self.assertIsInstance(families, tuple) + self.assertTrue(families) + for family in families: + self.assertIsInstance(family, (str, unicode)) + self.assertTrue(family) + + def test_names(self): + names = font.names(self.root) + self.assertIsInstance(names, tuple) + self.assertTrue(names) + for name in names: + self.assertIsInstance(name, (str, unicode)) + self.assertTrue(name) + self.assertIn(fontname, names) + +tests_gui = (FontTest, ) + +if __name__ == "__main__": + run_unittest(*tests_gui) diff --git a/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_geometry_managers.py b/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_geometry_managers.py new file mode 100644 index 0000000000..941fb31b7e --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_geometry_managers.py @@ -0,0 +1,893 @@ +import unittest +import re +import Tkinter as tkinter +from Tkinter import TclError +from test.test_support import requires, run_unittest + +from test_ttk.support import pixels_conv, tcl_version, requires_tcl +from widget_tests import AbstractWidgetTest, int_round + +requires('gui') + + +class PackTest(AbstractWidgetTest, unittest.TestCase): + + test_keys = None + + def create2(self): + pack = tkinter.Toplevel(self.root, name='pack') + pack.wm_geometry('300x200+0+0') + pack.wm_minsize(1, 1) + a = tkinter.Frame(pack, name='a', width=20, height=40, bg='red') + b = tkinter.Frame(pack, name='b', width=50, height=30, bg='blue') + c = tkinter.Frame(pack, name='c', width=80, height=80, bg='green') + d = tkinter.Frame(pack, name='d', width=40, height=30, bg='yellow') + return pack, a, b, c, d + + def test_pack_configure_after(self): + pack, a, b, c, d = self.create2() + with self.assertRaisesRegexp(TclError, 'window "%s" isn\'t packed' % b): + a.pack_configure(after=b) + with self.assertRaisesRegexp(TclError, 'bad window path name ".foo"'): + a.pack_configure(after='.foo') + a.pack_configure(side='top') + b.pack_configure(side='top') + c.pack_configure(side='top') + d.pack_configure(side='top') + self.assertEqual(pack.pack_slaves(), [a, b, c, d]) + a.pack_configure(after=b) + self.assertEqual(pack.pack_slaves(), [b, a, c, d]) + a.pack_configure(after=a) + self.assertEqual(pack.pack_slaves(), [b, a, c, d]) + + def test_pack_configure_anchor(self): + pack, a, b, c, d = self.create2() + def check(anchor, geom): + a.pack_configure(side='top', ipadx=5, padx=10, ipady=15, pady=20, + expand=True, anchor=anchor) + self.root.update() + self.assertEqual(a.winfo_geometry(), geom) + check('n', '30x70+135+20') + check('ne', '30x70+260+20') + check('e', '30x70+260+65') + check('se', '30x70+260+110') + check('s', '30x70+135+110') + check('sw', '30x70+10+110') + check('w', '30x70+10+65') + check('nw', '30x70+10+20') + check('center', '30x70+135+65') + + def test_pack_configure_before(self): + pack, a, b, c, d = self.create2() + with self.assertRaisesRegexp(TclError, 'window "%s" isn\'t packed' % b): + a.pack_configure(before=b) + with self.assertRaisesRegexp(TclError, 'bad window path name ".foo"'): + a.pack_configure(before='.foo') + a.pack_configure(side='top') + b.pack_configure(side='top') + c.pack_configure(side='top') + d.pack_configure(side='top') + self.assertEqual(pack.pack_slaves(), [a, b, c, d]) + a.pack_configure(before=d) + self.assertEqual(pack.pack_slaves(), [b, c, a, d]) + a.pack_configure(before=a) + self.assertEqual(pack.pack_slaves(), [b, c, a, d]) + + def test_pack_configure_expand(self): + pack, a, b, c, d = self.create2() + def check(*geoms): + self.root.update() + self.assertEqual(a.winfo_geometry(), geoms[0]) + self.assertEqual(b.winfo_geometry(), geoms[1]) + self.assertEqual(c.winfo_geometry(), geoms[2]) + self.assertEqual(d.winfo_geometry(), geoms[3]) + a.pack_configure(side='left') + b.pack_configure(side='top') + c.pack_configure(side='right') + d.pack_configure(side='bottom') + check('20x40+0+80', '50x30+135+0', '80x80+220+75', '40x30+100+170') + a.pack_configure(side='left', expand='yes') + b.pack_configure(side='top', expand='on') + c.pack_configure(side='right', expand=True) + d.pack_configure(side='bottom', expand=1) + check('20x40+40+80', '50x30+175+35', '80x80+180+110', '40x30+100+135') + a.pack_configure(side='left', expand='yes', fill='both') + b.pack_configure(side='top', expand='on', fill='both') + c.pack_configure(side='right', expand=True, fill='both') + d.pack_configure(side='bottom', expand=1, fill='both') + check('100x200+0+0', '200x100+100+0', '160x100+140+100', '40x100+100+100') + + def test_pack_configure_in(self): + pack, a, b, c, d = self.create2() + a.pack_configure(side='top') + b.pack_configure(side='top') + c.pack_configure(side='top') + d.pack_configure(side='top') + a.pack_configure(in_=pack) + self.assertEqual(pack.pack_slaves(), [b, c, d, a]) + a.pack_configure(in_=c) + self.assertEqual(pack.pack_slaves(), [b, c, d]) + self.assertEqual(c.pack_slaves(), [a]) + with self.assertRaisesRegexp(TclError, + 'can\'t pack %s inside itself' % (a,)): + a.pack_configure(in_=a) + with self.assertRaisesRegexp(TclError, 'bad window path name ".foo"'): + a.pack_configure(in_='.foo') + + def test_pack_configure_padx_ipadx_fill(self): + pack, a, b, c, d = self.create2() + def check(geom1, geom2, **kwargs): + a.pack_forget() + b.pack_forget() + a.pack_configure(**kwargs) + b.pack_configure(expand=True, fill='both') + self.root.update() + self.assertEqual(a.winfo_geometry(), geom1) + self.assertEqual(b.winfo_geometry(), geom2) + check('20x40+260+80', '240x200+0+0', side='right', padx=20) + check('20x40+250+80', '240x200+0+0', side='right', padx=(10, 30)) + check('60x40+240+80', '240x200+0+0', side='right', ipadx=20) + check('30x40+260+80', '250x200+0+0', side='right', ipadx=5, padx=10) + check('20x40+260+80', '240x200+0+0', side='right', padx=20, fill='x') + check('20x40+249+80', '240x200+0+0', + side='right', padx=(9, 31), fill='x') + check('60x40+240+80', '240x200+0+0', side='right', ipadx=20, fill='x') + check('30x40+260+80', '250x200+0+0', + side='right', ipadx=5, padx=10, fill='x') + check('30x40+255+80', '250x200+0+0', + side='right', ipadx=5, padx=(5, 15), fill='x') + check('20x40+140+0', '300x160+0+40', side='top', padx=20) + check('20x40+120+0', '300x160+0+40', side='top', padx=(0, 40)) + check('60x40+120+0', '300x160+0+40', side='top', ipadx=20) + check('30x40+135+0', '300x160+0+40', side='top', ipadx=5, padx=10) + check('30x40+130+0', '300x160+0+40', side='top', ipadx=5, padx=(5, 15)) + check('260x40+20+0', '300x160+0+40', side='top', padx=20, fill='x') + check('260x40+25+0', '300x160+0+40', + side='top', padx=(25, 15), fill='x') + check('300x40+0+0', '300x160+0+40', side='top', ipadx=20, fill='x') + check('280x40+10+0', '300x160+0+40', + side='top', ipadx=5, padx=10, fill='x') + check('280x40+5+0', '300x160+0+40', + side='top', ipadx=5, padx=(5, 15), fill='x') + a.pack_configure(padx='1c') + self.assertEqual(a.pack_info()['padx'], + self._str(pack.winfo_pixels('1c'))) + a.pack_configure(ipadx='1c') + self.assertEqual(a.pack_info()['ipadx'], + self._str(pack.winfo_pixels('1c'))) + + def test_pack_configure_pady_ipady_fill(self): + pack, a, b, c, d = self.create2() + def check(geom1, geom2, **kwargs): + a.pack_forget() + b.pack_forget() + a.pack_configure(**kwargs) + b.pack_configure(expand=True, fill='both') + self.root.update() + self.assertEqual(a.winfo_geometry(), geom1) + self.assertEqual(b.winfo_geometry(), geom2) + check('20x40+280+80', '280x200+0+0', side='right', pady=20) + check('20x40+280+70', '280x200+0+0', side='right', pady=(10, 30)) + check('20x80+280+60', '280x200+0+0', side='right', ipady=20) + check('20x50+280+75', '280x200+0+0', side='right', ipady=5, pady=10) + check('20x40+280+80', '280x200+0+0', side='right', pady=20, fill='x') + check('20x40+280+69', '280x200+0+0', + side='right', pady=(9, 31), fill='x') + check('20x80+280+60', '280x200+0+0', side='right', ipady=20, fill='x') + check('20x50+280+75', '280x200+0+0', + side='right', ipady=5, pady=10, fill='x') + check('20x50+280+70', '280x200+0+0', + side='right', ipady=5, pady=(5, 15), fill='x') + check('20x40+140+20', '300x120+0+80', side='top', pady=20) + check('20x40+140+0', '300x120+0+80', side='top', pady=(0, 40)) + check('20x80+140+0', '300x120+0+80', side='top', ipady=20) + check('20x50+140+10', '300x130+0+70', side='top', ipady=5, pady=10) + check('20x50+140+5', '300x130+0+70', side='top', ipady=5, pady=(5, 15)) + check('300x40+0+20', '300x120+0+80', side='top', pady=20, fill='x') + check('300x40+0+25', '300x120+0+80', + side='top', pady=(25, 15), fill='x') + check('300x80+0+0', '300x120+0+80', side='top', ipady=20, fill='x') + check('300x50+0+10', '300x130+0+70', + side='top', ipady=5, pady=10, fill='x') + check('300x50+0+5', '300x130+0+70', + side='top', ipady=5, pady=(5, 15), fill='x') + a.pack_configure(pady='1c') + self.assertEqual(a.pack_info()['pady'], + self._str(pack.winfo_pixels('1c'))) + a.pack_configure(ipady='1c') + self.assertEqual(a.pack_info()['ipady'], + self._str(pack.winfo_pixels('1c'))) + + def test_pack_configure_side(self): + pack, a, b, c, d = self.create2() + def check(side, geom1, geom2): + a.pack_configure(side=side) + self.assertEqual(a.pack_info()['side'], side) + b.pack_configure(expand=True, fill='both') + self.root.update() + self.assertEqual(a.winfo_geometry(), geom1) + self.assertEqual(b.winfo_geometry(), geom2) + check('top', '20x40+140+0', '300x160+0+40') + check('bottom', '20x40+140+160', '300x160+0+0') + check('left', '20x40+0+80', '280x200+20+0') + check('right', '20x40+280+80', '280x200+0+0') + + def test_pack_forget(self): + pack, a, b, c, d = self.create2() + a.pack_configure() + b.pack_configure() + c.pack_configure() + self.assertEqual(pack.pack_slaves(), [a, b, c]) + b.pack_forget() + self.assertEqual(pack.pack_slaves(), [a, c]) + b.pack_forget() + self.assertEqual(pack.pack_slaves(), [a, c]) + d.pack_forget() + + def test_pack_info(self): + pack, a, b, c, d = self.create2() + with self.assertRaisesRegexp(TclError, 'window "%s" isn\'t packed' % a): + a.pack_info() + a.pack_configure() + b.pack_configure(side='right', in_=a, anchor='s', expand=True, fill='x', + ipadx=5, padx=10, ipady=2, pady=(5, 15)) + info = a.pack_info() + self.assertIsInstance(info, dict) + self.assertEqual(info['anchor'], 'center') + self.assertEqual(info['expand'], self._str(0)) + self.assertEqual(info['fill'], 'none') + self.assertEqual(info['in'], pack) + self.assertEqual(info['ipadx'], self._str(0)) + self.assertEqual(info['ipady'], self._str(0)) + self.assertEqual(info['padx'], self._str(0)) + self.assertEqual(info['pady'], self._str(0)) + self.assertEqual(info['side'], 'top') + info = b.pack_info() + self.assertIsInstance(info, dict) + self.assertEqual(info['anchor'], 's') + self.assertEqual(info['expand'], self._str(1)) + self.assertEqual(info['fill'], 'x') + self.assertEqual(info['in'], a) + self.assertEqual(info['ipadx'], self._str(5)) + self.assertEqual(info['ipady'], self._str(2)) + self.assertEqual(info['padx'], self._str(10)) + self.assertEqual(info['pady'], self._str((5, 15))) + self.assertEqual(info['side'], 'right') + + def test_pack_propagate(self): + pack, a, b, c, d = self.create2() + pack.configure(width=300, height=200) + a.pack_configure() + pack.pack_propagate(False) + self.root.update() + self.assertEqual(pack.winfo_reqwidth(), 300) + self.assertEqual(pack.winfo_reqheight(), 200) + pack.pack_propagate(True) + self.root.update() + self.assertEqual(pack.winfo_reqwidth(), 20) + self.assertEqual(pack.winfo_reqheight(), 40) + + def test_pack_slaves(self): + pack, a, b, c, d = self.create2() + self.assertEqual(pack.pack_slaves(), []) + a.pack_configure() + self.assertEqual(pack.pack_slaves(), [a]) + b.pack_configure() + self.assertEqual(pack.pack_slaves(), [a, b]) + + +class PlaceTest(AbstractWidgetTest, unittest.TestCase): + + test_keys = None + + def create2(self): + t = tkinter.Toplevel(self.root, width=300, height=200, bd=0) + t.wm_geometry('300x200+0+0') + f = tkinter.Frame(t, width=154, height=84, bd=2, relief='raised') + f.place_configure(x=48, y=38) + f2 = tkinter.Frame(t, width=30, height=60, bd=2, relief='raised') + self.root.update() + return t, f, f2 + + def test_place_configure_in(self): + t, f, f2 = self.create2() + self.assertEqual(f2.winfo_manager(), '') + with self.assertRaisesRegexp(TclError, "can't place %s relative to " + "itself" % re.escape(str(f2))): + f2.place_configure(in_=f2) + if tcl_version >= (8, 5): + self.assertEqual(f2.winfo_manager(), '') + with self.assertRaisesRegexp(TclError, 'bad window path name'): + f2.place_configure(in_='spam') + f2.place_configure(in_=f) + self.assertEqual(f2.winfo_manager(), 'place') + + def test_place_configure_x(self): + t, f, f2 = self.create2() + f2.place_configure(in_=f) + self.assertEqual(f2.place_info()['x'], '0') + self.root.update() + self.assertEqual(f2.winfo_x(), 50) + f2.place_configure(x=100) + self.assertEqual(f2.place_info()['x'], '100') + self.root.update() + self.assertEqual(f2.winfo_x(), 150) + f2.place_configure(x=-10, relx=1) + self.assertEqual(f2.place_info()['x'], '-10') + self.root.update() + self.assertEqual(f2.winfo_x(), 190) + with self.assertRaisesRegexp(TclError, 'bad screen distance "spam"'): + f2.place_configure(in_=f, x='spam') + + def test_place_configure_y(self): + t, f, f2 = self.create2() + f2.place_configure(in_=f) + self.assertEqual(f2.place_info()['y'], '0') + self.root.update() + self.assertEqual(f2.winfo_y(), 40) + f2.place_configure(y=50) + self.assertEqual(f2.place_info()['y'], '50') + self.root.update() + self.assertEqual(f2.winfo_y(), 90) + f2.place_configure(y=-10, rely=1) + self.assertEqual(f2.place_info()['y'], '-10') + self.root.update() + self.assertEqual(f2.winfo_y(), 110) + with self.assertRaisesRegexp(TclError, 'bad screen distance "spam"'): + f2.place_configure(in_=f, y='spam') + + def test_place_configure_relx(self): + t, f, f2 = self.create2() + f2.place_configure(in_=f) + self.assertEqual(f2.place_info()['relx'], '0') + self.root.update() + self.assertEqual(f2.winfo_x(), 50) + f2.place_configure(relx=0.5) + self.assertEqual(f2.place_info()['relx'], '0.5') + self.root.update() + self.assertEqual(f2.winfo_x(), 125) + f2.place_configure(relx=1) + self.assertEqual(f2.place_info()['relx'], '1') + self.root.update() + self.assertEqual(f2.winfo_x(), 200) + with self.assertRaisesRegexp(TclError, 'expected floating-point number ' + 'but got "spam"'): + f2.place_configure(in_=f, relx='spam') + + def test_place_configure_rely(self): + t, f, f2 = self.create2() + f2.place_configure(in_=f) + self.assertEqual(f2.place_info()['rely'], '0') + self.root.update() + self.assertEqual(f2.winfo_y(), 40) + f2.place_configure(rely=0.5) + self.assertEqual(f2.place_info()['rely'], '0.5') + self.root.update() + self.assertEqual(f2.winfo_y(), 80) + f2.place_configure(rely=1) + self.assertEqual(f2.place_info()['rely'], '1') + self.root.update() + self.assertEqual(f2.winfo_y(), 120) + with self.assertRaisesRegexp(TclError, 'expected floating-point number ' + 'but got "spam"'): + f2.place_configure(in_=f, rely='spam') + + def test_place_configure_anchor(self): + f = tkinter.Frame(self.root) + with self.assertRaisesRegexp(TclError, 'bad anchor "j"'): + f.place_configure(anchor='j') + with self.assertRaisesRegexp(TclError, 'ambiguous anchor ""'): + f.place_configure(anchor='') + for value in 'n', 'ne', 'e', 'se', 's', 'sw', 'w', 'nw', 'center': + f.place_configure(anchor=value) + self.assertEqual(f.place_info()['anchor'], value) + + def test_place_configure_width(self): + t, f, f2 = self.create2() + f2.place_configure(in_=f, width=120) + self.root.update() + self.assertEqual(f2.winfo_width(), 120) + f2.place_configure(width='') + self.root.update() + self.assertEqual(f2.winfo_width(), 30) + with self.assertRaisesRegexp(TclError, 'bad screen distance "abcd"'): + f2.place_configure(width='abcd') + + def test_place_configure_height(self): + t, f, f2 = self.create2() + f2.place_configure(in_=f, height=120) + self.root.update() + self.assertEqual(f2.winfo_height(), 120) + f2.place_configure(height='') + self.root.update() + self.assertEqual(f2.winfo_height(), 60) + with self.assertRaisesRegexp(TclError, 'bad screen distance "abcd"'): + f2.place_configure(height='abcd') + + def test_place_configure_relwidth(self): + t, f, f2 = self.create2() + f2.place_configure(in_=f, relwidth=0.5) + self.root.update() + self.assertEqual(f2.winfo_width(), 75) + f2.place_configure(relwidth='') + self.root.update() + self.assertEqual(f2.winfo_width(), 30) + with self.assertRaisesRegexp(TclError, 'expected floating-point number ' + 'but got "abcd"'): + f2.place_configure(relwidth='abcd') + + def test_place_configure_relheight(self): + t, f, f2 = self.create2() + f2.place_configure(in_=f, relheight=0.5) + self.root.update() + self.assertEqual(f2.winfo_height(), 40) + f2.place_configure(relheight='') + self.root.update() + self.assertEqual(f2.winfo_height(), 60) + with self.assertRaisesRegexp(TclError, 'expected floating-point number ' + 'but got "abcd"'): + f2.place_configure(relheight='abcd') + + def test_place_configure_bordermode(self): + f = tkinter.Frame(self.root) + with self.assertRaisesRegexp(TclError, 'bad bordermode "j"'): + f.place_configure(bordermode='j') + with self.assertRaisesRegexp(TclError, 'ambiguous bordermode ""'): + f.place_configure(bordermode='') + for value in 'inside', 'outside', 'ignore': + f.place_configure(bordermode=value) + self.assertEqual(f.place_info()['bordermode'], value) + + def test_place_forget(self): + foo = tkinter.Frame(self.root) + foo.place_configure(width=50, height=50) + self.root.update() + foo.place_forget() + self.root.update() + self.assertFalse(foo.winfo_ismapped()) + with self.assertRaises(TypeError): + foo.place_forget(0) + + def test_place_info(self): + t, f, f2 = self.create2() + f2.place_configure(in_=f, x=1, y=2, width=3, height=4, + relx=0.1, rely=0.2, relwidth=0.3, relheight=0.4, + anchor='se', bordermode='outside') + info = f2.place_info() + self.assertIsInstance(info, dict) + self.assertEqual(info['x'], '1') + self.assertEqual(info['y'], '2') + self.assertEqual(info['width'], '3') + self.assertEqual(info['height'], '4') + self.assertEqual(info['relx'], '0.1') + self.assertEqual(info['rely'], '0.2') + self.assertEqual(info['relwidth'], '0.3') + self.assertEqual(info['relheight'], '0.4') + self.assertEqual(info['anchor'], 'se') + self.assertEqual(info['bordermode'], 'outside') + self.assertEqual(info['x'], '1') + self.assertEqual(info['x'], '1') + with self.assertRaises(TypeError): + f2.place_info(0) + + def test_place_slaves(self): + foo = tkinter.Frame(self.root) + bar = tkinter.Frame(self.root) + self.assertEqual(foo.place_slaves(), []) + bar.place_configure(in_=foo) + self.assertEqual(foo.place_slaves(), [bar]) + with self.assertRaises(TypeError): + foo.place_slaves(0) + + +class GridTest(AbstractWidgetTest, unittest.TestCase): + + test_keys = None + + def tearDown(self): + cols, rows = self.root.grid_size() + for i in range(cols + 1): + self.root.grid_columnconfigure(i, weight=0, minsize=0, pad=0, uniform='') + for i in range(rows + 1): + self.root.grid_rowconfigure(i, weight=0, minsize=0, pad=0, uniform='') + self.root.grid_propagate(1) + super(GridTest, self).tearDown() + + def test_grid_configure(self): + b = tkinter.Button(self.root) + self.assertEqual(b.grid_info(), {}) + b.grid_configure() + self.assertEqual(b.grid_info()['in'], self.root) + self.assertEqual(b.grid_info()['column'], self._str(0)) + self.assertEqual(b.grid_info()['row'], self._str(0)) + b.grid_configure({'column': 1}, row=2) + self.assertEqual(b.grid_info()['column'], self._str(1)) + self.assertEqual(b.grid_info()['row'], self._str(2)) + + def test_grid_configure_column(self): + b = tkinter.Button(self.root) + with self.assertRaisesRegexp(TclError, 'bad column value "-1": ' + 'must be a non-negative integer'): + b.grid_configure(column=-1) + b.grid_configure(column=2) + self.assertEqual(b.grid_info()['column'], self._str(2)) + + def test_grid_configure_columnspan(self): + b = tkinter.Button(self.root) + with self.assertRaisesRegexp(TclError, 'bad columnspan value "0": ' + 'must be a positive integer'): + b.grid_configure(columnspan=0) + b.grid_configure(columnspan=2) + self.assertEqual(b.grid_info()['columnspan'], self._str(2)) + + def test_grid_configure_in(self): + f = tkinter.Frame(self.root) + b = tkinter.Button(self.root) + self.assertEqual(b.grid_info(), {}) + b.grid_configure() + self.assertEqual(b.grid_info()['in'], self.root) + b.grid_configure(in_=f) + self.assertEqual(b.grid_info()['in'], f) + b.grid_configure({'in': self.root}) + self.assertEqual(b.grid_info()['in'], self.root) + + def test_grid_configure_ipadx(self): + b = tkinter.Button(self.root) + with self.assertRaisesRegexp(TclError, 'bad ipadx value "-1": ' + 'must be positive screen distance'): + b.grid_configure(ipadx=-1) + b.grid_configure(ipadx=1) + self.assertEqual(b.grid_info()['ipadx'], self._str(1)) + b.grid_configure(ipadx='.5c') + self.assertEqual(b.grid_info()['ipadx'], + self._str(int_round(pixels_conv('.5c') * self.scaling))) + + def test_grid_configure_ipady(self): + b = tkinter.Button(self.root) + with self.assertRaisesRegexp(TclError, 'bad ipady value "-1": ' + 'must be positive screen distance'): + b.grid_configure(ipady=-1) + b.grid_configure(ipady=1) + self.assertEqual(b.grid_info()['ipady'], self._str(1)) + b.grid_configure(ipady='.5c') + self.assertEqual(b.grid_info()['ipady'], + self._str(int_round(pixels_conv('.5c') * self.scaling))) + + def test_grid_configure_padx(self): + b = tkinter.Button(self.root) + with self.assertRaisesRegexp(TclError, 'bad pad value "-1": ' + 'must be positive screen distance'): + b.grid_configure(padx=-1) + b.grid_configure(padx=1) + self.assertEqual(b.grid_info()['padx'], self._str(1)) + b.grid_configure(padx=(10, 5)) + self.assertEqual(b.grid_info()['padx'], self._str((10, 5))) + b.grid_configure(padx='.5c') + self.assertEqual(b.grid_info()['padx'], + self._str(int_round(pixels_conv('.5c') * self.scaling))) + + def test_grid_configure_pady(self): + b = tkinter.Button(self.root) + with self.assertRaisesRegexp(TclError, 'bad pad value "-1": ' + 'must be positive screen distance'): + b.grid_configure(pady=-1) + b.grid_configure(pady=1) + self.assertEqual(b.grid_info()['pady'], self._str(1)) + b.grid_configure(pady=(10, 5)) + self.assertEqual(b.grid_info()['pady'], self._str((10, 5))) + b.grid_configure(pady='.5c') + self.assertEqual(b.grid_info()['pady'], + self._str(int_round(pixels_conv('.5c') * self.scaling))) + + def test_grid_configure_row(self): + b = tkinter.Button(self.root) + with self.assertRaisesRegexp(TclError, 'bad (row|grid) value "-1": ' + 'must be a non-negative integer'): + b.grid_configure(row=-1) + b.grid_configure(row=2) + self.assertEqual(b.grid_info()['row'], self._str(2)) + + def test_grid_configure_rownspan(self): + b = tkinter.Button(self.root) + with self.assertRaisesRegexp(TclError, 'bad rowspan value "0": ' + 'must be a positive integer'): + b.grid_configure(rowspan=0) + b.grid_configure(rowspan=2) + self.assertEqual(b.grid_info()['rowspan'], self._str(2)) + + def test_grid_configure_sticky(self): + f = tkinter.Frame(self.root, bg='red') + with self.assertRaisesRegexp(TclError, 'bad stickyness value "glue"'): + f.grid_configure(sticky='glue') + f.grid_configure(sticky='ne') + self.assertEqual(f.grid_info()['sticky'], 'ne') + f.grid_configure(sticky='n,s,e,w') + self.assertEqual(f.grid_info()['sticky'], 'nesw') + + def test_grid_columnconfigure(self): + with self.assertRaises(TypeError): + self.root.grid_columnconfigure() + self.assertEqual(self.root.grid_columnconfigure(0), + {'minsize': 0, 'pad': 0, 'uniform': None, 'weight': 0}) + with self.assertRaisesRegexp(TclError, 'bad option "-foo"'): + self.root.grid_columnconfigure(0, 'foo') + self.root.grid_columnconfigure((0, 3), weight=2) + with self.assertRaisesRegexp(TclError, + 'must specify a single element on retrieval'): + self.root.grid_columnconfigure((0, 3)) + b = tkinter.Button(self.root) + b.grid_configure(column=0, row=0) + if tcl_version >= (8, 5): + self.root.grid_columnconfigure('all', weight=3) + with self.assertRaisesRegexp(TclError, 'expected integer but got "all"'): + self.root.grid_columnconfigure('all') + self.assertEqual(self.root.grid_columnconfigure(0, 'weight'), 3) + self.assertEqual(self.root.grid_columnconfigure(3, 'weight'), 2) + self.assertEqual(self.root.grid_columnconfigure(265, 'weight'), 0) + if tcl_version >= (8, 5): + self.root.grid_columnconfigure(b, weight=4) + self.assertEqual(self.root.grid_columnconfigure(0, 'weight'), 4) + + def test_grid_columnconfigure_minsize(self): + with self.assertRaisesRegexp(TclError, 'bad screen distance "foo"'): + self.root.grid_columnconfigure(0, minsize='foo') + self.root.grid_columnconfigure(0, minsize=10) + self.assertEqual(self.root.grid_columnconfigure(0, 'minsize'), 10) + self.assertEqual(self.root.grid_columnconfigure(0)['minsize'], 10) + + def test_grid_columnconfigure_weight(self): + with self.assertRaisesRegexp(TclError, 'expected integer but got "bad"'): + self.root.grid_columnconfigure(0, weight='bad') + with self.assertRaisesRegexp(TclError, 'invalid arg "-weight": ' + 'should be non-negative'): + self.root.grid_columnconfigure(0, weight=-3) + self.root.grid_columnconfigure(0, weight=3) + self.assertEqual(self.root.grid_columnconfigure(0, 'weight'), 3) + self.assertEqual(self.root.grid_columnconfigure(0)['weight'], 3) + + def test_grid_columnconfigure_pad(self): + with self.assertRaisesRegexp(TclError, 'bad screen distance "foo"'): + self.root.grid_columnconfigure(0, pad='foo') + with self.assertRaisesRegexp(TclError, 'invalid arg "-pad": ' + 'should be non-negative'): + self.root.grid_columnconfigure(0, pad=-3) + self.root.grid_columnconfigure(0, pad=3) + self.assertEqual(self.root.grid_columnconfigure(0, 'pad'), 3) + self.assertEqual(self.root.grid_columnconfigure(0)['pad'], 3) + + def test_grid_columnconfigure_uniform(self): + self.root.grid_columnconfigure(0, uniform='foo') + self.assertEqual(self.root.grid_columnconfigure(0, 'uniform'), 'foo') + self.assertEqual(self.root.grid_columnconfigure(0)['uniform'], 'foo') + + def test_grid_rowconfigure(self): + with self.assertRaises(TypeError): + self.root.grid_rowconfigure() + self.assertEqual(self.root.grid_rowconfigure(0), + {'minsize': 0, 'pad': 0, 'uniform': None, 'weight': 0}) + with self.assertRaisesRegexp(TclError, 'bad option "-foo"'): + self.root.grid_rowconfigure(0, 'foo') + self.root.grid_rowconfigure((0, 3), weight=2) + with self.assertRaisesRegexp(TclError, + 'must specify a single element on retrieval'): + self.root.grid_rowconfigure((0, 3)) + b = tkinter.Button(self.root) + b.grid_configure(column=0, row=0) + if tcl_version >= (8, 5): + self.root.grid_rowconfigure('all', weight=3) + with self.assertRaisesRegexp(TclError, 'expected integer but got "all"'): + self.root.grid_rowconfigure('all') + self.assertEqual(self.root.grid_rowconfigure(0, 'weight'), 3) + self.assertEqual(self.root.grid_rowconfigure(3, 'weight'), 2) + self.assertEqual(self.root.grid_rowconfigure(265, 'weight'), 0) + if tcl_version >= (8, 5): + self.root.grid_rowconfigure(b, weight=4) + self.assertEqual(self.root.grid_rowconfigure(0, 'weight'), 4) + + def test_grid_rowconfigure_minsize(self): + with self.assertRaisesRegexp(TclError, 'bad screen distance "foo"'): + self.root.grid_rowconfigure(0, minsize='foo') + self.root.grid_rowconfigure(0, minsize=10) + self.assertEqual(self.root.grid_rowconfigure(0, 'minsize'), 10) + self.assertEqual(self.root.grid_rowconfigure(0)['minsize'], 10) + + def test_grid_rowconfigure_weight(self): + with self.assertRaisesRegexp(TclError, 'expected integer but got "bad"'): + self.root.grid_rowconfigure(0, weight='bad') + with self.assertRaisesRegexp(TclError, 'invalid arg "-weight": ' + 'should be non-negative'): + self.root.grid_rowconfigure(0, weight=-3) + self.root.grid_rowconfigure(0, weight=3) + self.assertEqual(self.root.grid_rowconfigure(0, 'weight'), 3) + self.assertEqual(self.root.grid_rowconfigure(0)['weight'], 3) + + def test_grid_rowconfigure_pad(self): + with self.assertRaisesRegexp(TclError, 'bad screen distance "foo"'): + self.root.grid_rowconfigure(0, pad='foo') + with self.assertRaisesRegexp(TclError, 'invalid arg "-pad": ' + 'should be non-negative'): + self.root.grid_rowconfigure(0, pad=-3) + self.root.grid_rowconfigure(0, pad=3) + self.assertEqual(self.root.grid_rowconfigure(0, 'pad'), 3) + self.assertEqual(self.root.grid_rowconfigure(0)['pad'], 3) + + def test_grid_rowconfigure_uniform(self): + self.root.grid_rowconfigure(0, uniform='foo') + self.assertEqual(self.root.grid_rowconfigure(0, 'uniform'), 'foo') + self.assertEqual(self.root.grid_rowconfigure(0)['uniform'], 'foo') + + def test_grid_forget(self): + b = tkinter.Button(self.root) + c = tkinter.Button(self.root) + b.grid_configure(row=2, column=2, rowspan=2, columnspan=2, + padx=3, pady=4, sticky='ns') + self.assertEqual(self.root.grid_slaves(), [b]) + b.grid_forget() + c.grid_forget() + self.assertEqual(self.root.grid_slaves(), []) + self.assertEqual(b.grid_info(), {}) + b.grid_configure(row=0, column=0) + info = b.grid_info() + self.assertEqual(info['row'], self._str(0)) + self.assertEqual(info['column'], self._str(0)) + self.assertEqual(info['rowspan'], self._str(1)) + self.assertEqual(info['columnspan'], self._str(1)) + self.assertEqual(info['padx'], self._str(0)) + self.assertEqual(info['pady'], self._str(0)) + self.assertEqual(info['sticky'], '') + + def test_grid_remove(self): + b = tkinter.Button(self.root) + c = tkinter.Button(self.root) + b.grid_configure(row=2, column=2, rowspan=2, columnspan=2, + padx=3, pady=4, sticky='ns') + self.assertEqual(self.root.grid_slaves(), [b]) + b.grid_remove() + c.grid_remove() + self.assertEqual(self.root.grid_slaves(), []) + self.assertEqual(b.grid_info(), {}) + b.grid_configure(row=0, column=0) + info = b.grid_info() + self.assertEqual(info['row'], self._str(0)) + self.assertEqual(info['column'], self._str(0)) + self.assertEqual(info['rowspan'], self._str(2)) + self.assertEqual(info['columnspan'], self._str(2)) + self.assertEqual(info['padx'], self._str(3)) + self.assertEqual(info['pady'], self._str(4)) + self.assertEqual(info['sticky'], 'ns') + + def test_grid_info(self): + b = tkinter.Button(self.root) + self.assertEqual(b.grid_info(), {}) + b.grid_configure(row=2, column=2, rowspan=2, columnspan=2, + padx=3, pady=4, sticky='ns') + info = b.grid_info() + self.assertIsInstance(info, dict) + self.assertEqual(info['in'], self.root) + self.assertEqual(info['row'], self._str(2)) + self.assertEqual(info['column'], self._str(2)) + self.assertEqual(info['rowspan'], self._str(2)) + self.assertEqual(info['columnspan'], self._str(2)) + self.assertEqual(info['padx'], self._str(3)) + self.assertEqual(info['pady'], self._str(4)) + self.assertEqual(info['sticky'], 'ns') + + def test_grid_bbox(self): + self.assertEqual(self.root.grid_bbox(), (0, 0, 0, 0)) + self.assertEqual(self.root.grid_bbox(0, 0), (0, 0, 0, 0)) + self.assertEqual(self.root.grid_bbox(0, 0, 1, 1), (0, 0, 0, 0)) + with self.assertRaisesRegexp(TclError, 'expected integer but got "x"'): + self.root.grid_bbox('x', 0) + with self.assertRaisesRegexp(TclError, 'expected integer but got "x"'): + self.root.grid_bbox(0, 'x') + with self.assertRaisesRegexp(TclError, 'expected integer but got "x"'): + self.root.grid_bbox(0, 0, 'x', 0) + with self.assertRaisesRegexp(TclError, 'expected integer but got "x"'): + self.root.grid_bbox(0, 0, 0, 'x') + with self.assertRaises(TypeError): + self.root.grid_bbox(0, 0, 0, 0, 0) + t = self.root + # de-maximize + t.wm_geometry('1x1+0+0') + t.wm_geometry('') + f1 = tkinter.Frame(t, width=75, height=75, bg='red') + f2 = tkinter.Frame(t, width=90, height=90, bg='blue') + f1.grid_configure(row=0, column=0) + f2.grid_configure(row=1, column=1) + self.root.update() + self.assertEqual(t.grid_bbox(), (0, 0, 165, 165)) + self.assertEqual(t.grid_bbox(0, 0), (0, 0, 75, 75)) + self.assertEqual(t.grid_bbox(0, 0, 1, 1), (0, 0, 165, 165)) + self.assertEqual(t.grid_bbox(1, 1), (75, 75, 90, 90)) + self.assertEqual(t.grid_bbox(10, 10, 0, 0), (0, 0, 165, 165)) + self.assertEqual(t.grid_bbox(-2, -2, -1, -1), (0, 0, 0, 0)) + self.assertEqual(t.grid_bbox(10, 10, 12, 12), (165, 165, 0, 0)) + + def test_grid_location(self): + with self.assertRaises(TypeError): + self.root.grid_location() + with self.assertRaises(TypeError): + self.root.grid_location(0) + with self.assertRaises(TypeError): + self.root.grid_location(0, 0, 0) + with self.assertRaisesRegexp(TclError, 'bad screen distance "x"'): + self.root.grid_location('x', 'y') + with self.assertRaisesRegexp(TclError, 'bad screen distance "y"'): + self.root.grid_location('1c', 'y') + t = self.root + # de-maximize + t.wm_geometry('1x1+0+0') + t.wm_geometry('') + f = tkinter.Frame(t, width=200, height=100, + highlightthickness=0, bg='red') + self.assertEqual(f.grid_location(10, 10), (-1, -1)) + f.grid_configure() + self.root.update() + self.assertEqual(t.grid_location(-10, -10), (-1, -1)) + self.assertEqual(t.grid_location(-10, 0), (-1, 0)) + self.assertEqual(t.grid_location(-1, 0), (-1, 0)) + self.assertEqual(t.grid_location(0, -10), (0, -1)) + self.assertEqual(t.grid_location(0, -1), (0, -1)) + self.assertEqual(t.grid_location(0, 0), (0, 0)) + self.assertEqual(t.grid_location(200, 0), (0, 0)) + self.assertEqual(t.grid_location(201, 0), (1, 0)) + self.assertEqual(t.grid_location(0, 100), (0, 0)) + self.assertEqual(t.grid_location(0, 101), (0, 1)) + self.assertEqual(t.grid_location(201, 101), (1, 1)) + + def test_grid_propagate(self): + self.assertEqual(self.root.grid_propagate(), True) + with self.assertRaises(TypeError): + self.root.grid_propagate(False, False) + self.root.grid_propagate(False) + self.assertFalse(self.root.grid_propagate()) + f = tkinter.Frame(self.root, width=100, height=100, bg='red') + f.grid_configure(row=0, column=0) + self.root.update() + self.assertEqual(f.winfo_width(), 100) + self.assertEqual(f.winfo_height(), 100) + f.grid_propagate(False) + g = tkinter.Frame(self.root, width=75, height=85, bg='green') + g.grid_configure(in_=f, row=0, column=0) + self.root.update() + self.assertEqual(f.winfo_width(), 100) + self.assertEqual(f.winfo_height(), 100) + f.grid_propagate(True) + self.root.update() + self.assertEqual(f.winfo_width(), 75) + self.assertEqual(f.winfo_height(), 85) + + def test_grid_size(self): + with self.assertRaises(TypeError): + self.root.grid_size(0) + self.assertEqual(self.root.grid_size(), (0, 0)) + f = tkinter.Scale(self.root) + f.grid_configure(row=0, column=0) + self.assertEqual(self.root.grid_size(), (1, 1)) + f.grid_configure(row=4, column=5) + self.assertEqual(self.root.grid_size(), (6, 5)) + + def test_grid_slaves(self): + self.assertEqual(self.root.grid_slaves(), []) + a = tkinter.Label(self.root) + a.grid_configure(row=0, column=1) + b = tkinter.Label(self.root) + b.grid_configure(row=1, column=0) + c = tkinter.Label(self.root) + c.grid_configure(row=1, column=1) + d = tkinter.Label(self.root) + d.grid_configure(row=1, column=1) + self.assertEqual(self.root.grid_slaves(), [d, c, b, a]) + self.assertEqual(self.root.grid_slaves(row=0), [a]) + self.assertEqual(self.root.grid_slaves(row=1), [d, c, b]) + self.assertEqual(self.root.grid_slaves(column=0), [b]) + self.assertEqual(self.root.grid_slaves(column=1), [d, c, a]) + self.assertEqual(self.root.grid_slaves(row=1, column=1), [d, c]) + + +tests_gui = ( + PackTest, PlaceTest, GridTest, +) + +if __name__ == '__main__': + run_unittest(*tests_gui) diff --git a/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_images.py b/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_images.py new file mode 100644 index 0000000000..b9f977375f --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_images.py @@ -0,0 +1,328 @@ +import unittest +import Tkinter as tkinter +import ttk +import test.test_support as support +from test_ttk.support import AbstractTkTest, requires_tcl + +support.requires('gui') + + +class MiscTest(AbstractTkTest, unittest.TestCase): + + def test_image_types(self): + image_types = self.root.image_types() + self.assertIsInstance(image_types, tuple) + self.assertIn('photo', image_types) + self.assertIn('bitmap', image_types) + + def test_image_names(self): + image_names = self.root.image_names() + self.assertIsInstance(image_names, tuple) + + +class BitmapImageTest(AbstractTkTest, unittest.TestCase): + + @classmethod + def setUpClass(cls): + AbstractTkTest.setUpClass.__func__(cls) + cls.testfile = support.findfile('python.xbm', subdir='imghdrdata') + + def test_create_from_file(self): + image = tkinter.BitmapImage('::img::test', master=self.root, + foreground='yellow', background='blue', + file=self.testfile) + self.assertEqual(str(image), '::img::test') + self.assertEqual(image.type(), 'bitmap') + self.assertEqual(image.width(), 16) + self.assertEqual(image.height(), 16) + self.assertIn('::img::test', self.root.image_names()) + del image + self.assertNotIn('::img::test', self.root.image_names()) + + def test_create_from_data(self): + with open(self.testfile, 'rb') as f: + data = f.read() + image = tkinter.BitmapImage('::img::test', master=self.root, + foreground='yellow', background='blue', + data=data) + self.assertEqual(str(image), '::img::test') + self.assertEqual(image.type(), 'bitmap') + self.assertEqual(image.width(), 16) + self.assertEqual(image.height(), 16) + self.assertIn('::img::test', self.root.image_names()) + del image + self.assertNotIn('::img::test', self.root.image_names()) + + def assertEqualStrList(self, actual, expected): + self.assertIsInstance(actual, str) + self.assertEqual(self.root.splitlist(actual), expected) + + def test_configure_data(self): + image = tkinter.BitmapImage('::img::test', master=self.root) + self.assertEqual(image['data'], '-data {} {} {} {}') + with open(self.testfile, 'rb') as f: + data = f.read() + image.configure(data=data) + self.assertEqualStrList(image['data'], + ('-data', '', '', '', data)) + self.assertEqual(image.width(), 16) + self.assertEqual(image.height(), 16) + + self.assertEqual(image['maskdata'], '-maskdata {} {} {} {}') + image.configure(maskdata=data) + self.assertEqualStrList(image['maskdata'], + ('-maskdata', '', '', '', data)) + + def test_configure_file(self): + image = tkinter.BitmapImage('::img::test', master=self.root) + self.assertEqual(image['file'], '-file {} {} {} {}') + image.configure(file=self.testfile) + self.assertEqualStrList(image['file'], + ('-file', '', '', '',self.testfile)) + self.assertEqual(image.width(), 16) + self.assertEqual(image.height(), 16) + + self.assertEqual(image['maskfile'], '-maskfile {} {} {} {}') + image.configure(maskfile=self.testfile) + self.assertEqualStrList(image['maskfile'], + ('-maskfile', '', '', '', self.testfile)) + + def test_configure_background(self): + image = tkinter.BitmapImage('::img::test', master=self.root) + self.assertEqual(image['background'], '-background {} {} {} {}') + image.configure(background='blue') + self.assertEqual(image['background'], '-background {} {} {} blue') + + def test_configure_foreground(self): + image = tkinter.BitmapImage('::img::test', master=self.root) + self.assertEqual(image['foreground'], + '-foreground {} {} #000000 #000000') + image.configure(foreground='yellow') + self.assertEqual(image['foreground'], + '-foreground {} {} #000000 yellow') + + +class PhotoImageTest(AbstractTkTest, unittest.TestCase): + + @classmethod + def setUpClass(cls): + AbstractTkTest.setUpClass.__func__(cls) + cls.testfile = support.findfile('python.gif', subdir='imghdrdata') + + def create(self): + return tkinter.PhotoImage('::img::test', master=self.root, + file=self.testfile) + + def colorlist(self, *args): + if tkinter.TkVersion >= 8.6 and self.wantobjects: + return args + else: + return tkinter._join(args) + + def check_create_from_file(self, ext): + testfile = support.findfile('python.' + ext, subdir='imghdrdata') + image = tkinter.PhotoImage('::img::test', master=self.root, + file=testfile) + self.assertEqual(str(image), '::img::test') + self.assertEqual(image.type(), 'photo') + self.assertEqual(image.width(), 16) + self.assertEqual(image.height(), 16) + self.assertEqual(image['data'], '') + self.assertEqual(image['file'], testfile) + self.assertIn('::img::test', self.root.image_names()) + del image + self.assertNotIn('::img::test', self.root.image_names()) + + def check_create_from_data(self, ext): + testfile = support.findfile('python.' + ext, subdir='imghdrdata') + with open(testfile, 'rb') as f: + data = f.read() + image = tkinter.PhotoImage('::img::test', master=self.root, + data=data) + self.assertEqual(str(image), '::img::test') + self.assertEqual(image.type(), 'photo') + self.assertEqual(image.width(), 16) + self.assertEqual(image.height(), 16) + self.assertEqual(image['data'], data if self.wantobjects + else data.decode('latin1')) + self.assertEqual(image['file'], '') + self.assertIn('::img::test', self.root.image_names()) + del image + self.assertNotIn('::img::test', self.root.image_names()) + + def test_create_from_ppm_file(self): + self.check_create_from_file('ppm') + + def test_create_from_ppm_data(self): + self.check_create_from_data('ppm') + + def test_create_from_pgm_file(self): + self.check_create_from_file('pgm') + + def test_create_from_pgm_data(self): + self.check_create_from_data('pgm') + + def test_create_from_gif_file(self): + self.check_create_from_file('gif') + + def test_create_from_gif_data(self): + self.check_create_from_data('gif') + + @requires_tcl(8, 6) + def test_create_from_png_file(self): + self.check_create_from_file('png') + + @requires_tcl(8, 6) + def test_create_from_png_data(self): + self.check_create_from_data('png') + + def test_configure_data(self): + image = tkinter.PhotoImage('::img::test', master=self.root) + self.assertEqual(image['data'], '') + with open(self.testfile, 'rb') as f: + data = f.read() + image.configure(data=data) + self.assertEqual(image['data'], data if self.wantobjects + else data.decode('latin1')) + self.assertEqual(image.width(), 16) + self.assertEqual(image.height(), 16) + + def test_configure_format(self): + image = tkinter.PhotoImage('::img::test', master=self.root) + self.assertEqual(image['format'], '') + image.configure(file=self.testfile, format='gif') + self.assertEqual(image['format'], ('gif',) if self.wantobjects + else 'gif') + self.assertEqual(image.width(), 16) + self.assertEqual(image.height(), 16) + + def test_configure_file(self): + image = tkinter.PhotoImage('::img::test', master=self.root) + self.assertEqual(image['file'], '') + image.configure(file=self.testfile) + self.assertEqual(image['file'], self.testfile) + self.assertEqual(image.width(), 16) + self.assertEqual(image.height(), 16) + + def test_configure_gamma(self): + image = tkinter.PhotoImage('::img::test', master=self.root) + self.assertEqual(image['gamma'], '1.0') + image.configure(gamma=2.0) + self.assertEqual(image['gamma'], '2.0') + + def test_configure_width_height(self): + image = tkinter.PhotoImage('::img::test', master=self.root) + self.assertEqual(image['width'], '0') + self.assertEqual(image['height'], '0') + image.configure(width=20) + image.configure(height=10) + self.assertEqual(image['width'], '20') + self.assertEqual(image['height'], '10') + self.assertEqual(image.width(), 20) + self.assertEqual(image.height(), 10) + + def test_configure_palette(self): + image = tkinter.PhotoImage('::img::test', master=self.root) + self.assertEqual(image['palette'], '') + image.configure(palette=256) + self.assertEqual(image['palette'], '256') + image.configure(palette='3/4/2') + self.assertEqual(image['palette'], '3/4/2') + + def test_blank(self): + image = self.create() + image.blank() + self.assertEqual(image.width(), 16) + self.assertEqual(image.height(), 16) + self.assertEqual(image.get(4, 6), self.colorlist(0, 0, 0)) + + def test_copy(self): + image = self.create() + image2 = image.copy() + self.assertEqual(image2.width(), 16) + self.assertEqual(image2.height(), 16) + self.assertEqual(image.get(4, 6), image.get(4, 6)) + + def test_subsample(self): + image = self.create() + image2 = image.subsample(2, 3) + self.assertEqual(image2.width(), 8) + self.assertEqual(image2.height(), 6) + self.assertEqual(image2.get(2, 2), image.get(4, 6)) + + image2 = image.subsample(2) + self.assertEqual(image2.width(), 8) + self.assertEqual(image2.height(), 8) + self.assertEqual(image2.get(2, 3), image.get(4, 6)) + + def test_zoom(self): + image = self.create() + image2 = image.zoom(2, 3) + self.assertEqual(image2.width(), 32) + self.assertEqual(image2.height(), 48) + self.assertEqual(image2.get(8, 18), image.get(4, 6)) + self.assertEqual(image2.get(9, 20), image.get(4, 6)) + + image2 = image.zoom(2) + self.assertEqual(image2.width(), 32) + self.assertEqual(image2.height(), 32) + self.assertEqual(image2.get(8, 12), image.get(4, 6)) + self.assertEqual(image2.get(9, 13), image.get(4, 6)) + + def test_put(self): + image = self.create() + image.put('{red green} {blue yellow}', to=(4, 6)) + self.assertEqual(image.get(4, 6), self.colorlist(255, 0, 0)) + self.assertEqual(image.get(5, 6), + self.colorlist(0, 128 if tkinter.TkVersion >= 8.6 + else 255, 0)) + self.assertEqual(image.get(4, 7), self.colorlist(0, 0, 255)) + self.assertEqual(image.get(5, 7), self.colorlist(255, 255, 0)) + + image.put((('#f00', '#00ff00'), ('#000000fff', '#ffffffff0000'))) + self.assertEqual(image.get(0, 0), self.colorlist(255, 0, 0)) + self.assertEqual(image.get(1, 0), self.colorlist(0, 255, 0)) + self.assertEqual(image.get(0, 1), self.colorlist(0, 0, 255)) + self.assertEqual(image.get(1, 1), self.colorlist(255, 255, 0)) + + def test_get(self): + image = self.create() + self.assertEqual(image.get(4, 6), self.colorlist(62, 116, 162)) + self.assertEqual(image.get(0, 0), self.colorlist(0, 0, 0)) + self.assertEqual(image.get(15, 15), self.colorlist(0, 0, 0)) + self.assertRaises(tkinter.TclError, image.get, -1, 0) + self.assertRaises(tkinter.TclError, image.get, 0, -1) + self.assertRaises(tkinter.TclError, image.get, 16, 15) + self.assertRaises(tkinter.TclError, image.get, 15, 16) + + def test_write(self): + image = self.create() + self.addCleanup(support.unlink, support.TESTFN) + + image.write(support.TESTFN) + image2 = tkinter.PhotoImage('::img::test2', master=self.root, + format='ppm', + file=support.TESTFN) + self.assertEqual(str(image2), '::img::test2') + self.assertEqual(image2.type(), 'photo') + self.assertEqual(image2.width(), 16) + self.assertEqual(image2.height(), 16) + self.assertEqual(image2.get(0, 0), image.get(0, 0)) + self.assertEqual(image2.get(15, 8), image.get(15, 8)) + + image.write(support.TESTFN, format='gif', from_coords=(4, 6, 6, 9)) + image3 = tkinter.PhotoImage('::img::test3', master=self.root, + format='gif', + file=support.TESTFN) + self.assertEqual(str(image3), '::img::test3') + self.assertEqual(image3.type(), 'photo') + self.assertEqual(image3.width(), 2) + self.assertEqual(image3.height(), 3) + self.assertEqual(image3.get(0, 0), image.get(4, 6)) + self.assertEqual(image3.get(1, 2), image.get(5, 8)) + + +tests_gui = (MiscTest, BitmapImageTest, PhotoImageTest,) + +if __name__ == "__main__": + support.run_unittest(*tests_gui) diff --git a/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_loadtk.py b/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_loadtk.py new file mode 100644 index 0000000000..32c640de1d --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_loadtk.py @@ -0,0 +1,45 @@ +import os +import sys +import unittest +from test import test_support +from Tkinter import Tcl, TclError + +test_support.requires('gui') + +class TkLoadTest(unittest.TestCase): + + @unittest.skipIf('DISPLAY' not in os.environ, 'No $DISPLAY set.') + def testLoadTk(self): + tcl = Tcl() + self.assertRaises(TclError,tcl.winfo_geometry) + tcl.loadtk() + self.assertEqual('1x1+0+0', tcl.winfo_geometry()) + tcl.destroy() + + def testLoadTkFailure(self): + old_display = None + if sys.platform.startswith(('win', 'darwin', 'cygwin')): + # no failure possible on windows? + + # XXX Maybe on tk older than 8.4.13 it would be possible, + # see tkinter.h. + return + with test_support.EnvironmentVarGuard() as env: + if 'DISPLAY' in os.environ: + del env['DISPLAY'] + # on some platforms, deleting environment variables + # doesn't actually carry through to the process level + # because they don't support unsetenv + # If that's the case, abort. + display = os.popen('echo $DISPLAY').read().strip() + if display: + return + + tcl = Tcl() + self.assertRaises(TclError, tcl.winfo_geometry) + self.assertRaises(TclError, tcl.loadtk) + +tests_gui = (TkLoadTest, ) + +if __name__ == "__main__": + test_support.run_unittest(*tests_gui) diff --git a/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_text.py b/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_text.py new file mode 100644 index 0000000000..a439b6c4f0 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_text.py @@ -0,0 +1,47 @@ +import unittest +import Tkinter as tkinter +from test.test_support import requires, run_unittest +from test_ttk.support import AbstractTkTest + +requires('gui') + +class TextTest(AbstractTkTest, unittest.TestCase): + + def setUp(self): + super(TextTest, self).setUp() + self.text = tkinter.Text(self.root) + + def test_debug(self): + text = self.text + olddebug = text.debug() + try: + text.debug(0) + self.assertEqual(text.debug(), 0) + text.debug(1) + self.assertEqual(text.debug(), 1) + finally: + text.debug(olddebug) + self.assertEqual(text.debug(), olddebug) + + def test_search(self): + text = self.text + + # pattern and index are obligatory arguments. + self.assertRaises(tkinter.TclError, text.search, None, '1.0') + self.assertRaises(tkinter.TclError, text.search, 'a', None) + self.assertRaises(tkinter.TclError, text.search, None, None) + + # Invalid text index. + self.assertRaises(tkinter.TclError, text.search, '', 0) + + # Check if we are getting the indices as strings -- you are likely + # to get Tcl_Obj under Tk 8.5 if Tkinter doesn't convert it. + text.insert('1.0', 'hi-test') + self.assertEqual(text.search('-test', '1.0', 'end'), '1.2') + self.assertEqual(text.search('test', '1.0', 'end'), '1.3') + + +tests_gui = (TextTest, ) + +if __name__ == "__main__": + run_unittest(*tests_gui) diff --git a/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_variables.py b/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_variables.py new file mode 100644 index 0000000000..11f9414948 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_variables.py @@ -0,0 +1,257 @@ +import unittest +import gc +from Tkinter import (Variable, StringVar, IntVar, DoubleVar, BooleanVar, Tcl, + TclError) + + +class TestBase(unittest.TestCase): + + def setUp(self): + self.root = Tcl() + + def tearDown(self): + del self.root + + +class TestVariable(TestBase): + + def info_exists(self, *args): + return self.root.getboolean(self.root.call("info", "exists", *args)) + + def test_default(self): + v = Variable(self.root) + self.assertEqual("", v.get()) + self.assertRegexpMatches(str(v), r"^PY_VAR(\d+)$") + + def test_name_and_value(self): + v = Variable(self.root, "sample string", "varname") + self.assertEqual("sample string", v.get()) + self.assertEqual("varname", str(v)) + + def test___del__(self): + self.assertFalse(self.info_exists("varname")) + v = Variable(self.root, "sample string", "varname") + self.assertTrue(self.info_exists("varname")) + del v + self.assertFalse(self.info_exists("varname")) + + def test_dont_unset_not_existing(self): + self.assertFalse(self.info_exists("varname")) + v1 = Variable(self.root, name="name") + v2 = Variable(self.root, name="name") + del v1 + self.assertFalse(self.info_exists("name")) + # shouldn't raise exception + del v2 + self.assertFalse(self.info_exists("name")) + + def test___eq__(self): + # values doesn't matter, only class and name are checked + v1 = Variable(self.root, name="abc") + v2 = Variable(self.root, name="abc") + self.assertEqual(v1, v2) + + v3 = Variable(self.root, name="abc") + v4 = StringVar(self.root, name="abc") + self.assertNotEqual(v3, v4) + + def test_invalid_name(self): + with self.assertRaises(TypeError): + Variable(self.root, name=123) + + def test_null_in_name(self): + with self.assertRaises(ValueError): + Variable(self.root, name='var\x00name') + with self.assertRaises(ValueError): + self.root.globalsetvar('var\x00name', "value") + with self.assertRaises(ValueError): + self.root.setvar('var\x00name', "value") + + def test_trace(self): + v = Variable(self.root) + vname = str(v) + trace = [] + def read_tracer(*args): + trace.append(('read',) + args) + def write_tracer(*args): + trace.append(('write',) + args) + cb1 = v.trace_variable('r', read_tracer) + cb2 = v.trace_variable('wu', write_tracer) + self.assertEqual(sorted(v.trace_vinfo()), [('r', cb1), ('wu', cb2)]) + self.assertEqual(trace, []) + + v.set('spam') + self.assertEqual(trace, [('write', vname, '', 'w')]) + + trace = [] + v.get() + self.assertEqual(trace, [('read', vname, '', 'r')]) + + trace = [] + info = sorted(v.trace_vinfo()) + v.trace_vdelete('w', cb1) # Wrong mode + self.assertEqual(sorted(v.trace_vinfo()), info) + with self.assertRaises(TclError): + v.trace_vdelete('r', 'spam') # Wrong command name + self.assertEqual(sorted(v.trace_vinfo()), info) + v.trace_vdelete('r', (cb1, 43)) # Wrong arguments + self.assertEqual(sorted(v.trace_vinfo()), info) + v.get() + self.assertEqual(trace, [('read', vname, '', 'r')]) + + trace = [] + v.trace_vdelete('r', cb1) + self.assertEqual(v.trace_vinfo(), [('wu', cb2)]) + v.get() + self.assertEqual(trace, []) + + trace = [] + del write_tracer + gc.collect() + v.set('eggs') + self.assertEqual(trace, [('write', vname, '', 'w')]) + + #trace = [] + #del v + #gc.collect() + #self.assertEqual(trace, [('write', vname, '', 'u')]) + + +class TestStringVar(TestBase): + + def test_default(self): + v = StringVar(self.root) + self.assertEqual("", v.get()) + + def test_get(self): + v = StringVar(self.root, "abc", "name") + self.assertEqual("abc", v.get()) + self.root.globalsetvar("name", "value") + self.assertEqual("value", v.get()) + + def test_get_null(self): + v = StringVar(self.root, "abc\x00def", "name") + self.assertEqual("abc\x00def", v.get()) + self.root.globalsetvar("name", "val\x00ue") + self.assertEqual("val\x00ue", v.get()) + + +class TestIntVar(TestBase): + + def test_default(self): + v = IntVar(self.root) + self.assertEqual(0, v.get()) + + def test_get(self): + v = IntVar(self.root, 123, "name") + self.assertEqual(123, v.get()) + self.root.globalsetvar("name", "345") + self.assertEqual(345, v.get()) + + def test_invalid_value(self): + v = IntVar(self.root, name="name") + self.root.globalsetvar("name", "value") + with self.assertRaises(ValueError): + v.get() + self.root.globalsetvar("name", "345.0") + with self.assertRaises(ValueError): + v.get() + + +class TestDoubleVar(TestBase): + + def test_default(self): + v = DoubleVar(self.root) + self.assertEqual(0.0, v.get()) + + def test_get(self): + v = DoubleVar(self.root, 1.23, "name") + self.assertAlmostEqual(1.23, v.get()) + self.root.globalsetvar("name", "3.45") + self.assertAlmostEqual(3.45, v.get()) + + def test_get_from_int(self): + v = DoubleVar(self.root, 1.23, "name") + self.assertAlmostEqual(1.23, v.get()) + self.root.globalsetvar("name", "3.45") + self.assertAlmostEqual(3.45, v.get()) + self.root.globalsetvar("name", "456") + self.assertAlmostEqual(456, v.get()) + + def test_invalid_value(self): + v = DoubleVar(self.root, name="name") + self.root.globalsetvar("name", "value") + with self.assertRaises(ValueError): + v.get() + + +class TestBooleanVar(TestBase): + + def test_default(self): + v = BooleanVar(self.root) + self.assertIs(v.get(), False) + + def test_get(self): + v = BooleanVar(self.root, True, "name") + self.assertIs(v.get(), True) + self.root.globalsetvar("name", "0") + self.assertIs(v.get(), False) + self.root.globalsetvar("name", 42 if self.root.wantobjects() else 1) + self.assertIs(v.get(), True) + self.root.globalsetvar("name", 0) + self.assertIs(v.get(), False) + self.root.globalsetvar("name", 42L if self.root.wantobjects() else 1L) + self.assertIs(v.get(), True) + self.root.globalsetvar("name", 0L) + self.assertIs(v.get(), False) + self.root.globalsetvar("name", "on") + self.assertIs(v.get(), True) + self.root.globalsetvar("name", u"0") + self.assertIs(v.get(), False) + self.root.globalsetvar("name", u"on") + self.assertIs(v.get(), True) + + def test_set(self): + true = 1 if self.root.wantobjects() else "1" + false = 0 if self.root.wantobjects() else "0" + v = BooleanVar(self.root, name="name") + v.set(True) + self.assertEqual(self.root.globalgetvar("name"), true) + v.set("0") + self.assertEqual(self.root.globalgetvar("name"), false) + v.set(42) + self.assertEqual(self.root.globalgetvar("name"), true) + v.set(0) + self.assertEqual(self.root.globalgetvar("name"), false) + v.set(42L) + self.assertEqual(self.root.globalgetvar("name"), true) + v.set(0L) + self.assertEqual(self.root.globalgetvar("name"), false) + v.set("on") + self.assertEqual(self.root.globalgetvar("name"), true) + v.set(u"0") + self.assertEqual(self.root.globalgetvar("name"), false) + v.set(u"on") + self.assertEqual(self.root.globalgetvar("name"), true) + + def test_invalid_value_domain(self): + false = 0 if self.root.wantobjects() else "0" + v = BooleanVar(self.root, name="name") + with self.assertRaises(TclError): + v.set("value") + self.assertEqual(self.root.globalgetvar("name"), false) + self.root.globalsetvar("name", "value") + with self.assertRaises(TclError): + v.get() + self.root.globalsetvar("name", "1.0") + with self.assertRaises(TclError): + v.get() + + +tests_gui = (TestVariable, TestStringVar, TestIntVar, + TestDoubleVar, TestBooleanVar) + + +if __name__ == "__main__": + from test.support import run_unittest + run_unittest(*tests_gui) diff --git a/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_widgets.py b/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_widgets.py new file mode 100644 index 0000000000..4b196ac5d5 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/test/test_tkinter/test_widgets.py @@ -0,0 +1,1229 @@ +import unittest +import Tkinter as tkinter +from Tkinter import TclError +import os +import sys +from test.test_support import requires, run_unittest + +from test_ttk.support import (tcl_version, requires_tcl, get_tk_patchlevel, + widget_eq) +from widget_tests import ( + add_standard_options, noconv, noconv_meth, int_round, pixels_round, + AbstractWidgetTest, StandardOptionsTests, + IntegerSizeTests, PixelSizeTests, + setUpModule) + +requires('gui') + + +class AbstractToplevelTest(AbstractWidgetTest, PixelSizeTests): + _conv_pad_pixels = noconv_meth + + def test_class(self): + widget = self.create() + self.assertEqual(widget['class'], + widget.__class__.__name__.title()) + self.checkInvalidParam(widget, 'class', 'Foo', + errmsg="can't modify -class option after widget is created") + widget2 = self.create(class_='Foo') + self.assertEqual(widget2['class'], 'Foo') + + def test_colormap(self): + widget = self.create() + self.assertEqual(widget['colormap'], '') + self.checkInvalidParam(widget, 'colormap', 'new', + errmsg="can't modify -colormap option after widget is created") + widget2 = self.create(colormap='new') + self.assertEqual(widget2['colormap'], 'new') + + def test_container(self): + widget = self.create() + self.assertEqual(widget['container'], 0 if self.wantobjects else '0') + self.checkInvalidParam(widget, 'container', 1, + errmsg="can't modify -container option after widget is created") + widget2 = self.create(container=True) + self.assertEqual(widget2['container'], 1 if self.wantobjects else '1') + + def test_visual(self): + widget = self.create() + self.assertEqual(widget['visual'], '') + self.checkInvalidParam(widget, 'visual', 'default', + errmsg="can't modify -visual option after widget is created") + widget2 = self.create(visual='default') + self.assertEqual(widget2['visual'], 'default') + + +@add_standard_options(StandardOptionsTests) +class ToplevelTest(AbstractToplevelTest, unittest.TestCase): + OPTIONS = ( + 'background', 'borderwidth', + 'class', 'colormap', 'container', 'cursor', 'height', + 'highlightbackground', 'highlightcolor', 'highlightthickness', + 'menu', 'padx', 'pady', 'relief', 'screen', + 'takefocus', 'use', 'visual', 'width', + ) + + def create(self, **kwargs): + return tkinter.Toplevel(self.root, **kwargs) + + def test_menu(self): + widget = self.create() + menu = tkinter.Menu(self.root) + self.checkParam(widget, 'menu', menu, eq=widget_eq) + self.checkParam(widget, 'menu', '') + + def test_screen(self): + widget = self.create() + self.assertEqual(widget['screen'], '') + try: + display = os.environ['DISPLAY'] + except KeyError: + self.skipTest('No $DISPLAY set.') + self.checkInvalidParam(widget, 'screen', display, + errmsg="can't modify -screen option after widget is created") + widget2 = self.create(screen=display) + self.assertEqual(widget2['screen'], display) + + def test_use(self): + widget = self.create() + self.assertEqual(widget['use'], '') + parent = self.create(container=True) + # hex() adds the 'L' suffix for longs + wid = '%#x' % parent.winfo_id() + widget2 = self.create(use=wid) + self.assertEqual(widget2['use'], wid) + + +@add_standard_options(StandardOptionsTests) +class FrameTest(AbstractToplevelTest, unittest.TestCase): + OPTIONS = ( + 'background', 'borderwidth', + 'class', 'colormap', 'container', 'cursor', 'height', + 'highlightbackground', 'highlightcolor', 'highlightthickness', + 'padx', 'pady', 'relief', 'takefocus', 'visual', 'width', + ) + + def create(self, **kwargs): + return tkinter.Frame(self.root, **kwargs) + + +@add_standard_options(StandardOptionsTests) +class LabelFrameTest(AbstractToplevelTest, unittest.TestCase): + OPTIONS = ( + 'background', 'borderwidth', + 'class', 'colormap', 'container', 'cursor', + 'font', 'foreground', 'height', + 'highlightbackground', 'highlightcolor', 'highlightthickness', + 'labelanchor', 'labelwidget', 'padx', 'pady', 'relief', + 'takefocus', 'text', 'visual', 'width', + ) + + def create(self, **kwargs): + return tkinter.LabelFrame(self.root, **kwargs) + + def test_labelanchor(self): + widget = self.create() + self.checkEnumParam(widget, 'labelanchor', + 'e', 'en', 'es', 'n', 'ne', 'nw', + 's', 'se', 'sw', 'w', 'wn', 'ws') + self.checkInvalidParam(widget, 'labelanchor', 'center') + + def test_labelwidget(self): + widget = self.create() + label = tkinter.Label(self.root, text='Mupp', name='foo') + self.checkParam(widget, 'labelwidget', label, expected='.foo') + label.destroy() + + +class AbstractLabelTest(AbstractWidgetTest, IntegerSizeTests): + _conv_pixels = noconv_meth + + def test_highlightthickness(self): + widget = self.create() + self.checkPixelsParam(widget, 'highlightthickness', + 0, 1.3, 2.6, 6, -2, '10p') + + +@add_standard_options(StandardOptionsTests) +class LabelTest(AbstractLabelTest, unittest.TestCase): + OPTIONS = ( + 'activebackground', 'activeforeground', 'anchor', + 'background', 'bitmap', 'borderwidth', 'compound', 'cursor', + 'disabledforeground', 'font', 'foreground', 'height', + 'highlightbackground', 'highlightcolor', 'highlightthickness', + 'image', 'justify', 'padx', 'pady', 'relief', 'state', + 'takefocus', 'text', 'textvariable', + 'underline', 'width', 'wraplength', + ) + + def create(self, **kwargs): + return tkinter.Label(self.root, **kwargs) + + +@add_standard_options(StandardOptionsTests) +class ButtonTest(AbstractLabelTest, unittest.TestCase): + OPTIONS = ( + 'activebackground', 'activeforeground', 'anchor', + 'background', 'bitmap', 'borderwidth', + 'command', 'compound', 'cursor', 'default', + 'disabledforeground', 'font', 'foreground', 'height', + 'highlightbackground', 'highlightcolor', 'highlightthickness', + 'image', 'justify', 'overrelief', 'padx', 'pady', 'relief', + 'repeatdelay', 'repeatinterval', + 'state', 'takefocus', 'text', 'textvariable', + 'underline', 'width', 'wraplength') + + def create(self, **kwargs): + return tkinter.Button(self.root, **kwargs) + + def test_default(self): + widget = self.create() + self.checkEnumParam(widget, 'default', 'active', 'disabled', 'normal') + + +@add_standard_options(StandardOptionsTests) +class CheckbuttonTest(AbstractLabelTest, unittest.TestCase): + OPTIONS = ( + 'activebackground', 'activeforeground', 'anchor', + 'background', 'bitmap', 'borderwidth', + 'command', 'compound', 'cursor', + 'disabledforeground', 'font', 'foreground', 'height', + 'highlightbackground', 'highlightcolor', 'highlightthickness', + 'image', 'indicatoron', 'justify', + 'offrelief', 'offvalue', 'onvalue', 'overrelief', + 'padx', 'pady', 'relief', 'selectcolor', 'selectimage', 'state', + 'takefocus', 'text', 'textvariable', + 'tristateimage', 'tristatevalue', + 'underline', 'variable', 'width', 'wraplength', + ) + + def create(self, **kwargs): + return tkinter.Checkbutton(self.root, **kwargs) + + + def test_offvalue(self): + widget = self.create() + self.checkParams(widget, 'offvalue', 1, 2.3, '', 'any string') + + def test_onvalue(self): + widget = self.create() + self.checkParams(widget, 'onvalue', 1, 2.3, '', 'any string') + + +@add_standard_options(StandardOptionsTests) +class RadiobuttonTest(AbstractLabelTest, unittest.TestCase): + OPTIONS = ( + 'activebackground', 'activeforeground', 'anchor', + 'background', 'bitmap', 'borderwidth', + 'command', 'compound', 'cursor', + 'disabledforeground', 'font', 'foreground', 'height', + 'highlightbackground', 'highlightcolor', 'highlightthickness', + 'image', 'indicatoron', 'justify', 'offrelief', 'overrelief', + 'padx', 'pady', 'relief', 'selectcolor', 'selectimage', 'state', + 'takefocus', 'text', 'textvariable', + 'tristateimage', 'tristatevalue', + 'underline', 'value', 'variable', 'width', 'wraplength', + ) + + def create(self, **kwargs): + return tkinter.Radiobutton(self.root, **kwargs) + + def test_value(self): + widget = self.create() + self.checkParams(widget, 'value', 1, 2.3, '', 'any string') + + +@add_standard_options(StandardOptionsTests) +class MenubuttonTest(AbstractLabelTest, unittest.TestCase): + OPTIONS = ( + 'activebackground', 'activeforeground', 'anchor', + 'background', 'bitmap', 'borderwidth', + 'compound', 'cursor', 'direction', + 'disabledforeground', 'font', 'foreground', 'height', + 'highlightbackground', 'highlightcolor', 'highlightthickness', + 'image', 'indicatoron', 'justify', 'menu', + 'padx', 'pady', 'relief', 'state', + 'takefocus', 'text', 'textvariable', + 'underline', 'width', 'wraplength', + ) + _conv_pixels = staticmethod(pixels_round) + + def create(self, **kwargs): + return tkinter.Menubutton(self.root, **kwargs) + + def test_direction(self): + widget = self.create() + self.checkEnumParam(widget, 'direction', + 'above', 'below', 'flush', 'left', 'right') + + def test_height(self): + widget = self.create() + self.checkIntegerParam(widget, 'height', 100, -100, 0, conv=str) + + test_highlightthickness = StandardOptionsTests.test_highlightthickness.im_func + + @unittest.skipIf(sys.platform == 'darwin', + 'crashes with Cocoa Tk (issue19733)') + def test_image(self): + widget = self.create() + image = tkinter.PhotoImage(master=self.root, name='image1') + self.checkParam(widget, 'image', image, conv=str) + errmsg = 'image "spam" doesn\'t exist' + with self.assertRaises(tkinter.TclError) as cm: + widget['image'] = 'spam' + if errmsg is not None: + self.assertEqual(str(cm.exception), errmsg) + with self.assertRaises(tkinter.TclError) as cm: + widget.configure({'image': 'spam'}) + if errmsg is not None: + self.assertEqual(str(cm.exception), errmsg) + + def test_menu(self): + widget = self.create() + menu = tkinter.Menu(widget, name='menu') + self.checkParam(widget, 'menu', menu, eq=widget_eq) + menu.destroy() + + def test_padx(self): + widget = self.create() + self.checkPixelsParam(widget, 'padx', 3, 4.4, 5.6, '12m') + self.checkParam(widget, 'padx', -2, expected=0) + + def test_pady(self): + widget = self.create() + self.checkPixelsParam(widget, 'pady', 3, 4.4, 5.6, '12m') + self.checkParam(widget, 'pady', -2, expected=0) + + def test_width(self): + widget = self.create() + self.checkIntegerParam(widget, 'width', 402, -402, 0, conv=str) + + +class OptionMenuTest(MenubuttonTest, unittest.TestCase): + + def create(self, default='b', values=('a', 'b', 'c'), **kwargs): + return tkinter.OptionMenu(self.root, None, default, *values, **kwargs) + + +@add_standard_options(IntegerSizeTests, StandardOptionsTests) +class EntryTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'background', 'borderwidth', 'cursor', + 'disabledbackground', 'disabledforeground', + 'exportselection', 'font', 'foreground', + 'highlightbackground', 'highlightcolor', 'highlightthickness', + 'insertbackground', 'insertborderwidth', + 'insertofftime', 'insertontime', 'insertwidth', + 'invalidcommand', 'justify', 'readonlybackground', 'relief', + 'selectbackground', 'selectborderwidth', 'selectforeground', + 'show', 'state', 'takefocus', 'textvariable', + 'validate', 'validatecommand', 'width', 'xscrollcommand', + ) + + def create(self, **kwargs): + return tkinter.Entry(self.root, **kwargs) + + def test_disabledbackground(self): + widget = self.create() + self.checkColorParam(widget, 'disabledbackground') + + def test_insertborderwidth(self): + widget = self.create(insertwidth=100) + self.checkPixelsParam(widget, 'insertborderwidth', + 0, 1.3, 2.6, 6, -2, '10p') + # insertborderwidth is bounded above by a half of insertwidth. + self.checkParam(widget, 'insertborderwidth', 60, expected=100//2) + + def test_insertwidth(self): + widget = self.create() + self.checkPixelsParam(widget, 'insertwidth', 1.3, 3.6, '10p') + self.checkParam(widget, 'insertwidth', 0.1, expected=2) + self.checkParam(widget, 'insertwidth', -2, expected=2) + if pixels_round(0.9) <= 0: + self.checkParam(widget, 'insertwidth', 0.9, expected=2) + else: + self.checkParam(widget, 'insertwidth', 0.9, expected=1) + + def test_invalidcommand(self): + widget = self.create() + self.checkCommandParam(widget, 'invalidcommand') + self.checkCommandParam(widget, 'invcmd') + + def test_readonlybackground(self): + widget = self.create() + self.checkColorParam(widget, 'readonlybackground') + + def test_show(self): + widget = self.create() + self.checkParam(widget, 'show', '*') + self.checkParam(widget, 'show', '') + self.checkParam(widget, 'show', ' ') + + def test_state(self): + widget = self.create() + self.checkEnumParam(widget, 'state', + 'disabled', 'normal', 'readonly') + + def test_validate(self): + widget = self.create() + self.checkEnumParam(widget, 'validate', + 'all', 'key', 'focus', 'focusin', 'focusout', 'none') + + def test_validatecommand(self): + widget = self.create() + self.checkCommandParam(widget, 'validatecommand') + self.checkCommandParam(widget, 'vcmd') + + +@add_standard_options(StandardOptionsTests) +class SpinboxTest(EntryTest, unittest.TestCase): + OPTIONS = ( + 'activebackground', 'background', 'borderwidth', + 'buttonbackground', 'buttoncursor', 'buttondownrelief', 'buttonuprelief', + 'command', 'cursor', 'disabledbackground', 'disabledforeground', + 'exportselection', 'font', 'foreground', 'format', 'from', + 'highlightbackground', 'highlightcolor', 'highlightthickness', + 'increment', + 'insertbackground', 'insertborderwidth', + 'insertofftime', 'insertontime', 'insertwidth', + 'invalidcommand', 'justify', 'relief', 'readonlybackground', + 'repeatdelay', 'repeatinterval', + 'selectbackground', 'selectborderwidth', 'selectforeground', + 'state', 'takefocus', 'textvariable', 'to', + 'validate', 'validatecommand', 'values', + 'width', 'wrap', 'xscrollcommand', + ) + + def create(self, **kwargs): + return tkinter.Spinbox(self.root, **kwargs) + + test_show = None + + def test_buttonbackground(self): + widget = self.create() + self.checkColorParam(widget, 'buttonbackground') + + def test_buttoncursor(self): + widget = self.create() + self.checkCursorParam(widget, 'buttoncursor') + + def test_buttondownrelief(self): + widget = self.create() + self.checkReliefParam(widget, 'buttondownrelief') + + def test_buttonuprelief(self): + widget = self.create() + self.checkReliefParam(widget, 'buttonuprelief') + + def test_format(self): + widget = self.create() + self.checkParam(widget, 'format', '%2f') + self.checkParam(widget, 'format', '%2.2f') + self.checkParam(widget, 'format', '%.2f') + self.checkParam(widget, 'format', '%2.f') + self.checkInvalidParam(widget, 'format', '%2e-1f') + self.checkInvalidParam(widget, 'format', '2.2') + self.checkInvalidParam(widget, 'format', '%2.-2f') + self.checkParam(widget, 'format', '%-2.02f') + self.checkParam(widget, 'format', '% 2.02f') + self.checkParam(widget, 'format', '% -2.200f') + self.checkParam(widget, 'format', '%09.200f') + self.checkInvalidParam(widget, 'format', '%d') + + def test_from(self): + widget = self.create() + self.checkParam(widget, 'to', 100.0) + self.checkFloatParam(widget, 'from', -10, 10.2, 11.7) + self.checkInvalidParam(widget, 'from', 200, + errmsg='-to value must be greater than -from value') + + def test_increment(self): + widget = self.create() + self.checkFloatParam(widget, 'increment', -1, 1, 10.2, 12.8, 0) + + def test_to(self): + widget = self.create() + self.checkParam(widget, 'from', -100.0) + self.checkFloatParam(widget, 'to', -10, 10.2, 11.7) + self.checkInvalidParam(widget, 'to', -200, + errmsg='-to value must be greater than -from value') + + def test_values(self): + # XXX + widget = self.create() + self.assertEqual(widget['values'], '') + self.checkParam(widget, 'values', 'mon tue wed thur') + self.checkParam(widget, 'values', ('mon', 'tue', 'wed', 'thur'), + expected='mon tue wed thur') + self.checkParam(widget, 'values', (42, 3.14, '', 'any string'), + expected='42 3.14 {} {any string}') + self.checkParam(widget, 'values', '') + + def test_wrap(self): + widget = self.create() + self.checkBooleanParam(widget, 'wrap') + + def test_bbox(self): + widget = self.create() + self.assertIsBoundingBox(widget.bbox(0)) + self.assertRaises(tkinter.TclError, widget.bbox, 'noindex') + self.assertRaises(tkinter.TclError, widget.bbox, None) + self.assertRaises(TypeError, widget.bbox) + self.assertRaises(TypeError, widget.bbox, 0, 1) + + def test_selection_element(self): + widget = self.create() + self.assertEqual(widget.selection_element(), "none") + widget.selection_element("buttonup") + self.assertEqual(widget.selection_element(), "buttonup") + widget.selection_element("buttondown") + self.assertEqual(widget.selection_element(), "buttondown") + + +@add_standard_options(StandardOptionsTests) +class TextTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'autoseparators', 'background', 'blockcursor', 'borderwidth', + 'cursor', 'endline', 'exportselection', + 'font', 'foreground', 'height', + 'highlightbackground', 'highlightcolor', 'highlightthickness', + 'inactiveselectbackground', 'insertbackground', 'insertborderwidth', + 'insertofftime', 'insertontime', 'insertunfocussed', 'insertwidth', + 'maxundo', 'padx', 'pady', 'relief', + 'selectbackground', 'selectborderwidth', 'selectforeground', + 'setgrid', 'spacing1', 'spacing2', 'spacing3', 'startline', 'state', + 'tabs', 'tabstyle', 'takefocus', 'undo', 'width', 'wrap', + 'xscrollcommand', 'yscrollcommand', + ) + if tcl_version < (8, 5): + _stringify = True + + def create(self, **kwargs): + return tkinter.Text(self.root, **kwargs) + + def test_autoseparators(self): + widget = self.create() + self.checkBooleanParam(widget, 'autoseparators') + + @requires_tcl(8, 5) + def test_blockcursor(self): + widget = self.create() + self.checkBooleanParam(widget, 'blockcursor') + + @requires_tcl(8, 5) + def test_endline(self): + widget = self.create() + text = '\n'.join('Line %d' for i in range(100)) + widget.insert('end', text) + self.checkParam(widget, 'endline', 200, expected='') + self.checkParam(widget, 'endline', -10, expected='') + self.checkInvalidParam(widget, 'endline', 'spam', + errmsg='expected integer but got "spam"') + self.checkParam(widget, 'endline', 50) + self.checkParam(widget, 'startline', 15) + self.checkInvalidParam(widget, 'endline', 10, + errmsg='-startline must be less than or equal to -endline') + + def test_height(self): + widget = self.create() + self.checkPixelsParam(widget, 'height', 100, 101.2, 102.6, '3c') + self.checkParam(widget, 'height', -100, expected=1) + self.checkParam(widget, 'height', 0, expected=1) + + def test_maxundo(self): + widget = self.create() + self.checkIntegerParam(widget, 'maxundo', 0, 5, -1) + + @requires_tcl(8, 5) + def test_inactiveselectbackground(self): + widget = self.create() + self.checkColorParam(widget, 'inactiveselectbackground') + + @requires_tcl(8, 6) + def test_insertunfocussed(self): + widget = self.create() + self.checkEnumParam(widget, 'insertunfocussed', + 'hollow', 'none', 'solid') + + def test_selectborderwidth(self): + widget = self.create() + self.checkPixelsParam(widget, 'selectborderwidth', + 1.3, 2.6, -2, '10p', conv=noconv, + keep_orig=tcl_version >= (8, 5)) + + def test_spacing1(self): + widget = self.create() + self.checkPixelsParam(widget, 'spacing1', 20, 21.4, 22.6, '0.5c') + self.checkParam(widget, 'spacing1', -5, expected=0) + + def test_spacing2(self): + widget = self.create() + self.checkPixelsParam(widget, 'spacing2', 5, 6.4, 7.6, '0.1c') + self.checkParam(widget, 'spacing2', -1, expected=0) + + def test_spacing3(self): + widget = self.create() + self.checkPixelsParam(widget, 'spacing3', 20, 21.4, 22.6, '0.5c') + self.checkParam(widget, 'spacing3', -10, expected=0) + + @requires_tcl(8, 5) + def test_startline(self): + widget = self.create() + text = '\n'.join('Line %d' for i in range(100)) + widget.insert('end', text) + self.checkParam(widget, 'startline', 200, expected='') + self.checkParam(widget, 'startline', -10, expected='') + self.checkInvalidParam(widget, 'startline', 'spam', + errmsg='expected integer but got "spam"') + self.checkParam(widget, 'startline', 10) + self.checkParam(widget, 'endline', 50) + self.checkInvalidParam(widget, 'startline', 70, + errmsg='-startline must be less than or equal to -endline') + + def test_state(self): + widget = self.create() + if tcl_version < (8, 5): + self.checkParams(widget, 'state', 'disabled', 'normal') + else: + self.checkEnumParam(widget, 'state', 'disabled', 'normal') + + def test_tabs(self): + widget = self.create() + if get_tk_patchlevel() < (8, 5, 11): + self.checkParam(widget, 'tabs', (10.2, 20.7, '1i', '2i'), + expected=('10.2', '20.7', '1i', '2i')) + else: + self.checkParam(widget, 'tabs', (10.2, 20.7, '1i', '2i')) + self.checkParam(widget, 'tabs', '10.2 20.7 1i 2i', + expected=('10.2', '20.7', '1i', '2i')) + self.checkParam(widget, 'tabs', '2c left 4c 6c center', + expected=('2c', 'left', '4c', '6c', 'center')) + self.checkInvalidParam(widget, 'tabs', 'spam', + errmsg='bad screen distance "spam"', + keep_orig=tcl_version >= (8, 5)) + + @requires_tcl(8, 5) + def test_tabstyle(self): + widget = self.create() + self.checkEnumParam(widget, 'tabstyle', 'tabular', 'wordprocessor') + + def test_undo(self): + widget = self.create() + self.checkBooleanParam(widget, 'undo') + + def test_width(self): + widget = self.create() + self.checkIntegerParam(widget, 'width', 402) + self.checkParam(widget, 'width', -402, expected=1) + self.checkParam(widget, 'width', 0, expected=1) + + def test_wrap(self): + widget = self.create() + if tcl_version < (8, 5): + self.checkParams(widget, 'wrap', 'char', 'none', 'word') + else: + self.checkEnumParam(widget, 'wrap', 'char', 'none', 'word') + + def test_bbox(self): + widget = self.create() + self.assertIsBoundingBox(widget.bbox('1.1')) + self.assertIsNone(widget.bbox('end')) + self.assertRaises(tkinter.TclError, widget.bbox, 'noindex') + self.assertRaises(tkinter.TclError, widget.bbox, None) + self.assertRaises(tkinter.TclError, widget.bbox) + self.assertRaises(tkinter.TclError, widget.bbox, '1.1', 'end') + + +@add_standard_options(PixelSizeTests, StandardOptionsTests) +class CanvasTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'background', 'borderwidth', + 'closeenough', 'confine', 'cursor', 'height', + 'highlightbackground', 'highlightcolor', 'highlightthickness', + 'insertbackground', 'insertborderwidth', + 'insertofftime', 'insertontime', 'insertwidth', + 'offset', 'relief', 'scrollregion', + 'selectbackground', 'selectborderwidth', 'selectforeground', + 'state', 'takefocus', + 'xscrollcommand', 'xscrollincrement', + 'yscrollcommand', 'yscrollincrement', 'width', + ) + + _conv_pixels = staticmethod(int_round) + _stringify = True + + def create(self, **kwargs): + return tkinter.Canvas(self.root, **kwargs) + + def test_closeenough(self): + widget = self.create() + self.checkFloatParam(widget, 'closeenough', 24, 2.4, 3.6, -3, + conv=float) + + def test_confine(self): + widget = self.create() + self.checkBooleanParam(widget, 'confine') + + def test_offset(self): + widget = self.create() + self.assertEqual(widget['offset'], '0,0') + self.checkParams(widget, 'offset', + 'n', 'ne', 'e', 'se', 's', 'sw', 'w', 'nw', 'center') + self.checkParam(widget, 'offset', '10,20') + self.checkParam(widget, 'offset', '#5,6') + self.checkInvalidParam(widget, 'offset', 'spam') + + def test_scrollregion(self): + widget = self.create() + self.checkParam(widget, 'scrollregion', '0 0 200 150') + self.checkParam(widget, 'scrollregion', (0, 0, 200, 150), + expected='0 0 200 150') + self.checkParam(widget, 'scrollregion', '') + self.checkInvalidParam(widget, 'scrollregion', 'spam', + errmsg='bad scrollRegion "spam"') + self.checkInvalidParam(widget, 'scrollregion', (0, 0, 200, 'spam')) + self.checkInvalidParam(widget, 'scrollregion', (0, 0, 200)) + self.checkInvalidParam(widget, 'scrollregion', (0, 0, 200, 150, 0)) + + def test_state(self): + widget = self.create() + self.checkEnumParam(widget, 'state', 'disabled', 'normal', + errmsg='bad state value "{}": must be normal or disabled') + + def test_xscrollincrement(self): + widget = self.create() + self.checkPixelsParam(widget, 'xscrollincrement', + 40, 0, 41.2, 43.6, -40, '0.5i') + + def test_yscrollincrement(self): + widget = self.create() + self.checkPixelsParam(widget, 'yscrollincrement', + 10, 0, 11.2, 13.6, -10, '0.1i') + + +@add_standard_options(IntegerSizeTests, StandardOptionsTests) +class ListboxTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'activestyle', 'background', 'borderwidth', 'cursor', + 'disabledforeground', 'exportselection', + 'font', 'foreground', 'height', + 'highlightbackground', 'highlightcolor', 'highlightthickness', + 'justify', 'listvariable', 'relief', + 'selectbackground', 'selectborderwidth', 'selectforeground', + 'selectmode', 'setgrid', 'state', + 'takefocus', 'width', 'xscrollcommand', 'yscrollcommand', + ) + + def create(self, **kwargs): + return tkinter.Listbox(self.root, **kwargs) + + def test_activestyle(self): + widget = self.create() + self.checkEnumParam(widget, 'activestyle', + 'dotbox', 'none', 'underline') + + test_justify = requires_tcl(8, 6, 5)(StandardOptionsTests.test_justify.im_func) + + def test_listvariable(self): + widget = self.create() + var = tkinter.DoubleVar(self.root) + self.checkVariableParam(widget, 'listvariable', var) + + def test_selectmode(self): + widget = self.create() + self.checkParam(widget, 'selectmode', 'single') + self.checkParam(widget, 'selectmode', 'browse') + self.checkParam(widget, 'selectmode', 'multiple') + self.checkParam(widget, 'selectmode', 'extended') + + def test_state(self): + widget = self.create() + self.checkEnumParam(widget, 'state', 'disabled', 'normal') + + def test_itemconfigure(self): + widget = self.create() + with self.assertRaisesRegexp(TclError, 'item number "0" out of range'): + widget.itemconfigure(0) + colors = 'red orange yellow green blue white violet'.split() + widget.insert('end', *colors) + for i, color in enumerate(colors): + widget.itemconfigure(i, background=color) + with self.assertRaises(TypeError): + widget.itemconfigure() + with self.assertRaisesRegexp(TclError, 'bad listbox index "red"'): + widget.itemconfigure('red') + self.assertEqual(widget.itemconfigure(0, 'background'), + ('background', 'background', 'Background', '', 'red')) + self.assertEqual(widget.itemconfigure('end', 'background'), + ('background', 'background', 'Background', '', 'violet')) + self.assertEqual(widget.itemconfigure('@0,0', 'background'), + ('background', 'background', 'Background', '', 'red')) + + d = widget.itemconfigure(0) + self.assertIsInstance(d, dict) + for k, v in d.items(): + self.assertIn(len(v), (2, 5)) + if len(v) == 5: + self.assertEqual(v, widget.itemconfigure(0, k)) + self.assertEqual(v[4], widget.itemcget(0, k)) + + def check_itemconfigure(self, name, value): + widget = self.create() + widget.insert('end', 'a', 'b', 'c', 'd') + widget.itemconfigure(0, **{name: value}) + self.assertEqual(widget.itemconfigure(0, name)[4], value) + self.assertEqual(widget.itemcget(0, name), value) + with self.assertRaisesRegexp(TclError, 'unknown color name "spam"'): + widget.itemconfigure(0, **{name: 'spam'}) + + def test_itemconfigure_background(self): + self.check_itemconfigure('background', '#ff0000') + + def test_itemconfigure_bg(self): + self.check_itemconfigure('bg', '#ff0000') + + def test_itemconfigure_fg(self): + self.check_itemconfigure('fg', '#110022') + + def test_itemconfigure_foreground(self): + self.check_itemconfigure('foreground', '#110022') + + def test_itemconfigure_selectbackground(self): + self.check_itemconfigure('selectbackground', '#110022') + + def test_itemconfigure_selectforeground(self): + self.check_itemconfigure('selectforeground', '#654321') + + def test_box(self): + lb = self.create() + lb.insert(0, *('el%d' % i for i in range(8))) + lb.pack() + self.assertIsBoundingBox(lb.bbox(0)) + self.assertIsNone(lb.bbox(-1)) + self.assertIsNone(lb.bbox(10)) + self.assertRaises(TclError, lb.bbox, 'noindex') + self.assertRaises(TclError, lb.bbox, None) + self.assertRaises(TypeError, lb.bbox) + self.assertRaises(TypeError, lb.bbox, 0, 1) + + def test_curselection(self): + lb = self.create() + lb.insert(0, *('el%d' % i for i in range(8))) + lb.selection_clear(0, tkinter.END) + lb.selection_set(2, 4) + lb.selection_set(6) + self.assertEqual(lb.curselection(), (2, 3, 4, 6)) + self.assertRaises(TypeError, lb.curselection, 0) + + def test_get(self): + lb = self.create() + lb.insert(0, *('el%d' % i for i in range(8))) + self.assertEqual(lb.get(0), 'el0') + self.assertEqual(lb.get(3), 'el3') + self.assertEqual(lb.get('end'), 'el7') + self.assertEqual(lb.get(8), '') + self.assertEqual(lb.get(-1), '') + self.assertEqual(lb.get(3, 5), ('el3', 'el4', 'el5')) + self.assertEqual(lb.get(5, 'end'), ('el5', 'el6', 'el7')) + self.assertEqual(lb.get(5, 0), ()) + self.assertEqual(lb.get(0, 0), ('el0',)) + self.assertRaises(TclError, lb.get, 'noindex') + self.assertRaises(TclError, lb.get, None) + self.assertRaises(TypeError, lb.get) + self.assertRaises(TclError, lb.get, 'end', 'noindex') + self.assertRaises(TypeError, lb.get, 1, 2, 3) + self.assertRaises(TclError, lb.get, 2.4) + + +@add_standard_options(PixelSizeTests, StandardOptionsTests) +class ScaleTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'activebackground', 'background', 'bigincrement', 'borderwidth', + 'command', 'cursor', 'digits', 'font', 'foreground', 'from', + 'highlightbackground', 'highlightcolor', 'highlightthickness', + 'label', 'length', 'orient', 'relief', + 'repeatdelay', 'repeatinterval', + 'resolution', 'showvalue', 'sliderlength', 'sliderrelief', 'state', + 'takefocus', 'tickinterval', 'to', 'troughcolor', 'variable', 'width', + ) + default_orient = 'vertical' + + def create(self, **kwargs): + return tkinter.Scale(self.root, **kwargs) + + def test_bigincrement(self): + widget = self.create() + self.checkFloatParam(widget, 'bigincrement', 12.4, 23.6, -5) + + def test_digits(self): + widget = self.create() + self.checkIntegerParam(widget, 'digits', 5, 0) + + def test_from(self): + widget = self.create() + self.checkFloatParam(widget, 'from', 100, 14.9, 15.1, conv=round) + + def test_label(self): + widget = self.create() + self.checkParam(widget, 'label', 'any string') + self.checkParam(widget, 'label', '') + + def test_length(self): + widget = self.create() + self.checkPixelsParam(widget, 'length', 130, 131.2, 135.6, '5i') + + def test_resolution(self): + widget = self.create() + self.checkFloatParam(widget, 'resolution', 4.2, 0, 6.7, -2) + + def test_showvalue(self): + widget = self.create() + self.checkBooleanParam(widget, 'showvalue') + + def test_sliderlength(self): + widget = self.create() + self.checkPixelsParam(widget, 'sliderlength', + 10, 11.2, 15.6, -3, '3m') + + def test_sliderrelief(self): + widget = self.create() + self.checkReliefParam(widget, 'sliderrelief') + + def test_tickinterval(self): + widget = self.create() + self.checkFloatParam(widget, 'tickinterval', 1, 4.3, 7.6, 0, + conv=round) + self.checkParam(widget, 'tickinterval', -2, expected=2, + conv=round) + + def test_to(self): + widget = self.create() + self.checkFloatParam(widget, 'to', 300, 14.9, 15.1, -10, + conv=round) + + +@add_standard_options(PixelSizeTests, StandardOptionsTests) +class ScrollbarTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'activebackground', 'activerelief', + 'background', 'borderwidth', + 'command', 'cursor', 'elementborderwidth', + 'highlightbackground', 'highlightcolor', 'highlightthickness', + 'jump', 'orient', 'relief', + 'repeatdelay', 'repeatinterval', + 'takefocus', 'troughcolor', 'width', + ) + _conv_pixels = staticmethod(int_round) + _stringify = True + default_orient = 'vertical' + + def create(self, **kwargs): + return tkinter.Scrollbar(self.root, **kwargs) + + def test_activerelief(self): + widget = self.create() + self.checkReliefParam(widget, 'activerelief') + + def test_elementborderwidth(self): + widget = self.create() + self.checkPixelsParam(widget, 'elementborderwidth', 4.3, 5.6, -2, '1m') + + def test_orient(self): + widget = self.create() + self.checkEnumParam(widget, 'orient', 'vertical', 'horizontal', + errmsg='bad orientation "{}": must be vertical or horizontal') + + def test_activate(self): + sb = self.create() + for e in ('arrow1', 'slider', 'arrow2'): + sb.activate(e) + sb.activate('') + self.assertRaises(TypeError, sb.activate) + self.assertRaises(TypeError, sb.activate, 'arrow1', 'arrow2') + + def test_set(self): + sb = self.create() + sb.set(0.2, 0.4) + self.assertEqual(sb.get(), (0.2, 0.4)) + self.assertRaises(TclError, sb.set, 'abc', 'def') + self.assertRaises(TclError, sb.set, 0.6, 'def') + self.assertRaises(TclError, sb.set, 0.6, None) + self.assertRaises(TclError, sb.set, 0.6) + self.assertRaises(TclError, sb.set, 0.6, 0.7, 0.8) + + +@add_standard_options(StandardOptionsTests) +class PanedWindowTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'background', 'borderwidth', 'cursor', + 'handlepad', 'handlesize', 'height', + 'opaqueresize', 'orient', + 'proxybackground', 'proxyborderwidth', 'proxyrelief', + 'relief', + 'sashcursor', 'sashpad', 'sashrelief', 'sashwidth', + 'showhandle', 'width', + ) + default_orient = 'horizontal' + + def create(self, **kwargs): + return tkinter.PanedWindow(self.root, **kwargs) + + def test_handlepad(self): + widget = self.create() + self.checkPixelsParam(widget, 'handlepad', 5, 6.4, 7.6, -3, '1m') + + def test_handlesize(self): + widget = self.create() + self.checkPixelsParam(widget, 'handlesize', 8, 9.4, 10.6, -3, '2m', + conv=noconv) + + def test_height(self): + widget = self.create() + self.checkPixelsParam(widget, 'height', 100, 101.2, 102.6, -100, 0, '1i', + conv=noconv) + + def test_opaqueresize(self): + widget = self.create() + self.checkBooleanParam(widget, 'opaqueresize') + + @requires_tcl(8, 6, 5) + def test_proxybackground(self): + widget = self.create() + self.checkColorParam(widget, 'proxybackground') + + @requires_tcl(8, 6, 5) + def test_proxyborderwidth(self): + widget = self.create() + self.checkPixelsParam(widget, 'proxyborderwidth', + 0, 1.3, 2.9, 6, -2, '10p', + conv=noconv) + + @requires_tcl(8, 6, 5) + def test_proxyrelief(self): + widget = self.create() + self.checkReliefParam(widget, 'proxyrelief') + + def test_sashcursor(self): + widget = self.create() + self.checkCursorParam(widget, 'sashcursor') + + def test_sashpad(self): + widget = self.create() + self.checkPixelsParam(widget, 'sashpad', 8, 1.3, 2.6, -2, '2m') + + def test_sashrelief(self): + widget = self.create() + self.checkReliefParam(widget, 'sashrelief') + + def test_sashwidth(self): + widget = self.create() + self.checkPixelsParam(widget, 'sashwidth', 10, 11.1, 15.6, -3, '1m', + conv=noconv) + + def test_showhandle(self): + widget = self.create() + self.checkBooleanParam(widget, 'showhandle') + + def test_width(self): + widget = self.create() + self.checkPixelsParam(widget, 'width', 402, 403.4, 404.6, -402, 0, '5i', + conv=noconv) + + def create2(self): + p = self.create() + b = tkinter.Button(p) + c = tkinter.Button(p) + p.add(b) + p.add(c) + return p, b, c + + def test_paneconfigure(self): + p, b, c = self.create2() + self.assertRaises(TypeError, p.paneconfigure) + d = p.paneconfigure(b) + self.assertIsInstance(d, dict) + for k, v in d.items(): + self.assertEqual(len(v), 5) + self.assertEqual(v, p.paneconfigure(b, k)) + self.assertEqual(v[4], p.panecget(b, k)) + + def check_paneconfigure(self, p, b, name, value, expected, stringify=False): + conv = lambda x: x + if not self.wantobjects or stringify: + expected = str(expected) + if self.wantobjects and stringify: + conv = str + p.paneconfigure(b, **{name: value}) + self.assertEqual(conv(p.paneconfigure(b, name)[4]), expected) + self.assertEqual(conv(p.panecget(b, name)), expected) + + def check_paneconfigure_bad(self, p, b, name, msg): + with self.assertRaisesRegexp(TclError, msg): + p.paneconfigure(b, **{name: 'badValue'}) + + def test_paneconfigure_after(self): + p, b, c = self.create2() + self.check_paneconfigure(p, b, 'after', c, str(c)) + self.check_paneconfigure_bad(p, b, 'after', + 'bad window path name "badValue"') + + def test_paneconfigure_before(self): + p, b, c = self.create2() + self.check_paneconfigure(p, b, 'before', c, str(c)) + self.check_paneconfigure_bad(p, b, 'before', + 'bad window path name "badValue"') + + def test_paneconfigure_height(self): + p, b, c = self.create2() + self.check_paneconfigure(p, b, 'height', 10, 10, + stringify=get_tk_patchlevel() < (8, 5, 11)) + self.check_paneconfigure_bad(p, b, 'height', + 'bad screen distance "badValue"') + + @requires_tcl(8, 5) + def test_paneconfigure_hide(self): + p, b, c = self.create2() + self.check_paneconfigure(p, b, 'hide', False, 0) + self.check_paneconfigure_bad(p, b, 'hide', + 'expected boolean value but got "badValue"') + + def test_paneconfigure_minsize(self): + p, b, c = self.create2() + self.check_paneconfigure(p, b, 'minsize', 10, 10) + self.check_paneconfigure_bad(p, b, 'minsize', + 'bad screen distance "badValue"') + + def test_paneconfigure_padx(self): + p, b, c = self.create2() + self.check_paneconfigure(p, b, 'padx', 1.3, 1) + self.check_paneconfigure_bad(p, b, 'padx', + 'bad screen distance "badValue"') + + def test_paneconfigure_pady(self): + p, b, c = self.create2() + self.check_paneconfigure(p, b, 'pady', 1.3, 1) + self.check_paneconfigure_bad(p, b, 'pady', + 'bad screen distance "badValue"') + + def test_paneconfigure_sticky(self): + p, b, c = self.create2() + self.check_paneconfigure(p, b, 'sticky', 'nsew', 'nesw') + self.check_paneconfigure_bad(p, b, 'sticky', + 'bad stickyness value "badValue": must ' + 'be a string containing zero or more of ' + 'n, e, s, and w') + + @requires_tcl(8, 5) + def test_paneconfigure_stretch(self): + p, b, c = self.create2() + self.check_paneconfigure(p, b, 'stretch', 'alw', 'always') + self.check_paneconfigure_bad(p, b, 'stretch', + 'bad stretch "badValue": must be ' + 'always, first, last, middle, or never') + + def test_paneconfigure_width(self): + p, b, c = self.create2() + self.check_paneconfigure(p, b, 'width', 10, 10, + stringify=get_tk_patchlevel() < (8, 5, 11)) + self.check_paneconfigure_bad(p, b, 'width', + 'bad screen distance "badValue"') + + +@add_standard_options(StandardOptionsTests) +class MenuTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'activebackground', 'activeborderwidth', 'activeforeground', + 'background', 'borderwidth', 'cursor', + 'disabledforeground', 'font', 'foreground', + 'postcommand', 'relief', 'selectcolor', 'takefocus', + 'tearoff', 'tearoffcommand', 'title', 'type', + ) + _conv_pixels = noconv_meth + + def create(self, **kwargs): + return tkinter.Menu(self.root, **kwargs) + + def test_postcommand(self): + widget = self.create() + self.checkCommandParam(widget, 'postcommand') + + def test_tearoff(self): + widget = self.create() + self.checkBooleanParam(widget, 'tearoff') + + def test_tearoffcommand(self): + widget = self.create() + self.checkCommandParam(widget, 'tearoffcommand') + + def test_title(self): + widget = self.create() + self.checkParam(widget, 'title', 'any string') + + def test_type(self): + widget = self.create() + self.checkEnumParam(widget, 'type', + 'normal', 'tearoff', 'menubar') + + def test_entryconfigure(self): + m1 = self.create() + m1.add_command(label='test') + self.assertRaises(TypeError, m1.entryconfigure) + with self.assertRaisesRegexp(TclError, 'bad menu entry index "foo"'): + m1.entryconfigure('foo') + d = m1.entryconfigure(1) + self.assertIsInstance(d, dict) + for k, v in d.items(): + self.assertIsInstance(k, str) + self.assertIsInstance(v, tuple) + self.assertEqual(len(v), 5) + self.assertEqual(v[0], k) + self.assertEqual(m1.entrycget(1, k), v[4]) + m1.destroy() + + def test_entryconfigure_label(self): + m1 = self.create() + m1.add_command(label='test') + self.assertEqual(m1.entrycget(1, 'label'), 'test') + m1.entryconfigure(1, label='changed') + self.assertEqual(m1.entrycget(1, 'label'), 'changed') + + def test_entryconfigure_variable(self): + m1 = self.create() + v1 = tkinter.BooleanVar(self.root) + v2 = tkinter.BooleanVar(self.root) + m1.add_checkbutton(variable=v1, onvalue=True, offvalue=False, + label='Nonsense') + self.assertEqual(str(m1.entrycget(1, 'variable')), str(v1)) + m1.entryconfigure(1, variable=v2) + self.assertEqual(str(m1.entrycget(1, 'variable')), str(v2)) + + +@add_standard_options(PixelSizeTests, StandardOptionsTests) +class MessageTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'anchor', 'aspect', 'background', 'borderwidth', + 'cursor', 'font', 'foreground', + 'highlightbackground', 'highlightcolor', 'highlightthickness', + 'justify', 'padx', 'pady', 'relief', + 'takefocus', 'text', 'textvariable', 'width', + ) + _conv_pad_pixels = noconv_meth + + def create(self, **kwargs): + return tkinter.Message(self.root, **kwargs) + + def test_aspect(self): + widget = self.create() + self.checkIntegerParam(widget, 'aspect', 250, 0, -300) + + +tests_gui = [ + ButtonTest, CanvasTest, CheckbuttonTest, EntryTest, + FrameTest, LabelFrameTest,LabelTest, ListboxTest, + MenubuttonTest, MenuTest, MessageTest, OptionMenuTest, + PanedWindowTest, RadiobuttonTest, ScaleTest, ScrollbarTest, + SpinboxTest, TextTest, ToplevelTest, +] + +if __name__ == '__main__': + run_unittest(*tests_gui) diff --git a/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/__init__.py b/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/__init__.py new file mode 100644 index 0000000000..e69de29bb2 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/__init__.py diff --git a/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/support.py b/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/support.py new file mode 100644 index 0000000000..a86e0ea851 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/support.py @@ -0,0 +1,117 @@ +import functools +import re +import unittest +import Tkinter as tkinter + +class AbstractTkTest: + + @classmethod + def setUpClass(cls): + cls._old_support_default_root = tkinter._support_default_root + destroy_default_root() + tkinter.NoDefaultRoot() + cls.root = tkinter.Tk() + cls.wantobjects = cls.root.wantobjects() + # De-maximize main window. + # Some window managers can maximize new windows. + cls.root.wm_state('normal') + try: + cls.root.wm_attributes('-zoomed', False) + except tkinter.TclError: + pass + + @classmethod + def tearDownClass(cls): + cls.root.update_idletasks() + cls.root.destroy() + del cls.root + tkinter._default_root = None + tkinter._support_default_root = cls._old_support_default_root + + def setUp(self): + self.root.deiconify() + + def tearDown(self): + for w in self.root.winfo_children(): + w.destroy() + self.root.withdraw() + +def destroy_default_root(): + if getattr(tkinter, '_default_root', None): + tkinter._default_root.update_idletasks() + tkinter._default_root.destroy() + tkinter._default_root = None + +def simulate_mouse_click(widget, x, y): + """Generate proper events to click at the x, y position (tries to act + like an X server).""" + widget.event_generate('<Enter>', x=0, y=0) + widget.event_generate('<Motion>', x=x, y=y) + widget.event_generate('<ButtonPress-1>', x=x, y=y) + widget.event_generate('<ButtonRelease-1>', x=x, y=y) + + +import _tkinter +tcl_version = tuple(map(int, _tkinter.TCL_VERSION.split('.'))) + +def requires_tcl(*version): + if len(version) <= 2: + return unittest.skipUnless(tcl_version >= version, + 'requires Tcl version >= ' + '.'.join(map(str, version))) + + def deco(test): + @functools.wraps(test) + def newtest(self): + if get_tk_patchlevel() < version: + self.skipTest('requires Tcl version >= ' + + '.'.join(map(str, version))) + test(self) + return newtest + return deco + +_tk_patchlevel = None +def get_tk_patchlevel(): + global _tk_patchlevel + if _tk_patchlevel is None: + tcl = tkinter.Tcl() + patchlevel = tcl.call('info', 'patchlevel') + m = re.match(r'(\d+)\.(\d+)([ab.])(\d+)$', patchlevel) + major, minor, releaselevel, serial = m.groups() + major, minor, serial = int(major), int(minor), int(serial) + releaselevel = {'a': 'alpha', 'b': 'beta', '.': 'final'}[releaselevel] + if releaselevel == 'final': + _tk_patchlevel = major, minor, serial, releaselevel, 0 + else: + _tk_patchlevel = major, minor, 0, releaselevel, serial + return _tk_patchlevel + +units = { + 'c': 72 / 2.54, # centimeters + 'i': 72, # inches + 'm': 72 / 25.4, # millimeters + 'p': 1, # points +} + +def pixels_conv(value): + return float(value[:-1]) * units[value[-1:]] + +def tcl_obj_eq(actual, expected): + if actual == expected: + return True + if isinstance(actual, _tkinter.Tcl_Obj): + if isinstance(expected, str): + return str(actual) == expected + if isinstance(actual, tuple): + if isinstance(expected, tuple): + return (len(actual) == len(expected) and + all(tcl_obj_eq(act, exp) + for act, exp in zip(actual, expected))) + return False + +def widget_eq(actual, expected): + if actual == expected: + return True + if isinstance(actual, (str, tkinter.Widget)): + if isinstance(expected, (str, tkinter.Widget)): + return str(actual) == str(expected) + return False diff --git a/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/test_extensions.py b/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/test_extensions.py new file mode 100644 index 0000000000..70b2f9c6b1 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/test_extensions.py @@ -0,0 +1,316 @@ +import sys +import unittest +import Tkinter as tkinter +import ttk +from test.test_support import requires, run_unittest, swap_attr +from test_ttk.support import AbstractTkTest, destroy_default_root + +requires('gui') + +class LabeledScaleTest(AbstractTkTest, unittest.TestCase): + + def tearDown(self): + self.root.update_idletasks() + super(LabeledScaleTest, self).tearDown() + + def test_widget_destroy(self): + # automatically created variable + x = ttk.LabeledScale(self.root) + var = x._variable._name + x.destroy() + self.assertRaises(tkinter.TclError, x.tk.globalgetvar, var) + + # manually created variable + myvar = tkinter.DoubleVar(self.root) + name = myvar._name + x = ttk.LabeledScale(self.root, variable=myvar) + x.destroy() + if self.wantobjects: + self.assertEqual(x.tk.globalgetvar(name), myvar.get()) + else: + self.assertEqual(float(x.tk.globalgetvar(name)), myvar.get()) + del myvar + self.assertRaises(tkinter.TclError, x.tk.globalgetvar, name) + + # checking that the tracing callback is properly removed + myvar = tkinter.IntVar(self.root) + # LabeledScale will start tracing myvar + x = ttk.LabeledScale(self.root, variable=myvar) + x.destroy() + # Unless the tracing callback was removed, creating a new + # LabeledScale with the same var will cause an error now. This + # happens because the variable will be set to (possibly) a new + # value which causes the tracing callback to be called and then + # it tries calling instance attributes not yet defined. + ttk.LabeledScale(self.root, variable=myvar) + if hasattr(sys, 'last_type'): + self.assertNotEqual(sys.last_type, tkinter.TclError) + + + def test_initialization_no_master(self): + # no master passing + with swap_attr(tkinter, '_default_root', None), \ + swap_attr(tkinter, '_support_default_root', True): + try: + x = ttk.LabeledScale() + self.assertIsNotNone(tkinter._default_root) + self.assertEqual(x.master, tkinter._default_root) + self.assertEqual(x.tk, tkinter._default_root.tk) + x.destroy() + finally: + destroy_default_root() + + def test_initialization(self): + # master passing + master = tkinter.Frame(self.root) + x = ttk.LabeledScale(master) + self.assertEqual(x.master, master) + x.destroy() + + # variable initialization/passing + passed_expected = (('0', 0), (0, 0), (10, 10), + (-1, -1), (sys.maxint + 1, sys.maxint + 1)) + if self.wantobjects: + passed_expected += ((2.5, 2),) + for pair in passed_expected: + x = ttk.LabeledScale(self.root, from_=pair[0]) + self.assertEqual(x.value, pair[1]) + x.destroy() + x = ttk.LabeledScale(self.root, from_='2.5') + self.assertRaises(ValueError, x._variable.get) + x.destroy() + x = ttk.LabeledScale(self.root, from_=None) + self.assertRaises(ValueError, x._variable.get) + x.destroy() + # variable should have its default value set to the from_ value + myvar = tkinter.DoubleVar(self.root, value=20) + x = ttk.LabeledScale(self.root, variable=myvar) + self.assertEqual(x.value, 0) + x.destroy() + # check that it is really using a DoubleVar + x = ttk.LabeledScale(self.root, variable=myvar, from_=0.5) + self.assertEqual(x.value, 0.5) + self.assertEqual(x._variable._name, myvar._name) + x.destroy() + + # widget positionment + def check_positions(scale, scale_pos, label, label_pos): + self.assertEqual(scale.pack_info()['side'], scale_pos) + self.assertEqual(label.place_info()['anchor'], label_pos) + x = ttk.LabeledScale(self.root, compound='top') + check_positions(x.scale, 'bottom', x.label, 'n') + x.destroy() + x = ttk.LabeledScale(self.root, compound='bottom') + check_positions(x.scale, 'top', x.label, 's') + x.destroy() + # invert default positions + x = ttk.LabeledScale(self.root, compound='unknown') + check_positions(x.scale, 'top', x.label, 's') + x.destroy() + x = ttk.LabeledScale(self.root) # take default positions + check_positions(x.scale, 'bottom', x.label, 'n') + x.destroy() + + # extra, and invalid, kwargs + self.assertRaises(tkinter.TclError, ttk.LabeledScale, master, a='b') + + + def test_horizontal_range(self): + lscale = ttk.LabeledScale(self.root, from_=0, to=10) + lscale.pack() + lscale.wait_visibility() + lscale.update() + + linfo_1 = lscale.label.place_info() + prev_xcoord = lscale.scale.coords()[0] + self.assertEqual(prev_xcoord, int(linfo_1['x'])) + # change range to: from -5 to 5. This should change the x coord of + # the scale widget, since 0 is at the middle of the new + # range. + lscale.scale.configure(from_=-5, to=5) + # The following update is needed since the test doesn't use mainloop, + # at the same time this shouldn't affect test outcome + lscale.update() + curr_xcoord = lscale.scale.coords()[0] + self.assertNotEqual(prev_xcoord, curr_xcoord) + # the label widget should have been repositioned too + linfo_2 = lscale.label.place_info() + self.assertEqual(lscale.label['text'], 0 if self.wantobjects else '0') + self.assertEqual(curr_xcoord, int(linfo_2['x'])) + # change the range back + lscale.scale.configure(from_=0, to=10) + self.assertNotEqual(prev_xcoord, curr_xcoord) + self.assertEqual(prev_xcoord, int(linfo_1['x'])) + + lscale.destroy() + + + def test_variable_change(self): + x = ttk.LabeledScale(self.root) + x.pack() + x.wait_visibility() + x.update() + + curr_xcoord = x.scale.coords()[0] + newval = x.value + 1 + x.value = newval + # The following update is needed since the test doesn't use mainloop, + # at the same time this shouldn't affect test outcome + x.update() + self.assertEqual(x.label['text'], + newval if self.wantobjects else str(newval)) + self.assertGreater(x.scale.coords()[0], curr_xcoord) + self.assertEqual(x.scale.coords()[0], + int(x.label.place_info()['x'])) + + # value outside range + if self.wantobjects: + conv = lambda x: x + else: + conv = int + x.value = conv(x.scale['to']) + 1 # no changes shouldn't happen + x.update() + self.assertEqual(conv(x.label['text']), newval) + self.assertEqual(x.scale.coords()[0], + int(x.label.place_info()['x'])) + + x.destroy() + + + def test_resize(self): + x = ttk.LabeledScale(self.root) + x.pack(expand=True, fill='both') + x.wait_visibility() + x.update() + + width, height = x.master.winfo_width(), x.master.winfo_height() + width_new, height_new = width * 2, height * 2 + + x.value = 3 + x.update() + x.master.wm_geometry("%dx%d" % (width_new, height_new)) + self.assertEqual(int(x.label.place_info()['x']), + x.scale.coords()[0]) + + # Reset geometry + x.master.wm_geometry("%dx%d" % (width, height)) + x.destroy() + + +class OptionMenuTest(AbstractTkTest, unittest.TestCase): + + def setUp(self): + super(OptionMenuTest, self).setUp() + self.textvar = tkinter.StringVar(self.root) + + def tearDown(self): + del self.textvar + super(OptionMenuTest, self).tearDown() + + + def test_widget_destroy(self): + var = tkinter.StringVar(self.root) + optmenu = ttk.OptionMenu(self.root, var) + name = var._name + optmenu.update_idletasks() + optmenu.destroy() + self.assertEqual(optmenu.tk.globalgetvar(name), var.get()) + del var + self.assertRaises(tkinter.TclError, optmenu.tk.globalgetvar, name) + + + def test_initialization(self): + self.assertRaises(tkinter.TclError, + ttk.OptionMenu, self.root, self.textvar, invalid='thing') + + optmenu = ttk.OptionMenu(self.root, self.textvar, 'b', 'a', 'b') + self.assertEqual(optmenu._variable.get(), 'b') + + self.assertTrue(optmenu['menu']) + self.assertTrue(optmenu['textvariable']) + + optmenu.destroy() + + + def test_menu(self): + items = ('a', 'b', 'c') + default = 'a' + optmenu = ttk.OptionMenu(self.root, self.textvar, default, *items) + found_default = False + for i in range(len(items)): + value = optmenu['menu'].entrycget(i, 'value') + self.assertEqual(value, items[i]) + if value == default: + found_default = True + self.assertTrue(found_default) + optmenu.destroy() + + # default shouldn't be in menu if it is not part of values + default = 'd' + optmenu = ttk.OptionMenu(self.root, self.textvar, default, *items) + curr = None + i = 0 + while True: + last, curr = curr, optmenu['menu'].entryconfigure(i, 'value') + if last == curr: + # no more menu entries + break + self.assertNotEqual(curr, default) + i += 1 + self.assertEqual(i, len(items)) + + # check that variable is updated correctly + optmenu.pack() + optmenu.wait_visibility() + optmenu['menu'].invoke(0) + self.assertEqual(optmenu._variable.get(), items[0]) + + # changing to an invalid index shouldn't change the variable + self.assertRaises(tkinter.TclError, optmenu['menu'].invoke, -1) + self.assertEqual(optmenu._variable.get(), items[0]) + + optmenu.destroy() + + # specifying a callback + success = [] + def cb_test(item): + self.assertEqual(item, items[1]) + success.append(True) + optmenu = ttk.OptionMenu(self.root, self.textvar, 'a', command=cb_test, + *items) + optmenu['menu'].invoke(1) + if not success: + self.fail("Menu callback not invoked") + + optmenu.destroy() + + def test_unique_radiobuttons(self): + # check that radiobuttons are unique across instances (bpo25684) + items = ('a', 'b', 'c') + default = 'a' + optmenu = ttk.OptionMenu(self.root, self.textvar, default, *items) + textvar2 = tkinter.StringVar(self.root) + optmenu2 = ttk.OptionMenu(self.root, textvar2, default, *items) + optmenu.pack() + optmenu.wait_visibility() + optmenu2.pack() + optmenu2.wait_visibility() + optmenu['menu'].invoke(1) + optmenu2['menu'].invoke(2) + optmenu_stringvar_name = optmenu['menu'].entrycget(0, 'variable') + optmenu2_stringvar_name = optmenu2['menu'].entrycget(0, 'variable') + self.assertNotEqual(optmenu_stringvar_name, + optmenu2_stringvar_name) + self.assertEqual(self.root.tk.globalgetvar(optmenu_stringvar_name), + items[1]) + self.assertEqual(self.root.tk.globalgetvar(optmenu2_stringvar_name), + items[2]) + + optmenu.destroy() + optmenu2.destroy() + + +tests_gui = (LabeledScaleTest, OptionMenuTest) + +if __name__ == "__main__": + run_unittest(*tests_gui) diff --git a/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/test_functions.py b/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/test_functions.py new file mode 100644 index 0000000000..ea3f81c220 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/test_functions.py @@ -0,0 +1,466 @@ +# -*- encoding: utf-8 -*- +import sys +import unittest +import ttk + +class MockTkApp: + + def splitlist(self, arg): + if isinstance(arg, tuple): + return arg + return arg.split(':') + + def wantobjects(self): + return True + + +class MockTclObj(object): + typename = 'test' + + def __init__(self, val): + self.val = val + + def __str__(self): + return unicode(self.val) + + +class MockStateSpec(object): + typename = 'StateSpec' + + def __init__(self, *args): + self.val = args + + def __str__(self): + return ' '.join(self.val) + + +class InternalFunctionsTest(unittest.TestCase): + + def test_format_optdict(self): + def check_against(fmt_opts, result): + for i in range(0, len(fmt_opts), 2): + self.assertEqual(result.pop(fmt_opts[i]), fmt_opts[i + 1]) + if result: + self.fail("result still got elements: %s" % result) + + # passing an empty dict should return an empty object (tuple here) + self.assertFalse(ttk._format_optdict({})) + + # check list formatting + check_against( + ttk._format_optdict({'fg': 'blue', 'padding': [1, 2, 3, 4]}), + {'-fg': 'blue', '-padding': '1 2 3 4'}) + + # check tuple formatting (same as list) + check_against( + ttk._format_optdict({'test': (1, 2, '', 0)}), + {'-test': '1 2 {} 0'}) + + # check untouched values + check_against( + ttk._format_optdict({'test': {'left': 'as is'}}), + {'-test': {'left': 'as is'}}) + + # check script formatting + check_against( + ttk._format_optdict( + {'test': [1, -1, '', '2m', 0], 'test2': 3, + 'test3': '', 'test4': 'abc def', + 'test5': '"abc"', 'test6': '{}', + 'test7': '} -spam {'}, script=True), + {'-test': '{1 -1 {} 2m 0}', '-test2': '3', + '-test3': '{}', '-test4': '{abc def}', + '-test5': '{"abc"}', '-test6': r'\{\}', + '-test7': r'\}\ -spam\ \{'}) + + opts = {u'αβγ': True, u'á': False} + orig_opts = opts.copy() + # check if giving unicode keys is fine + check_against(ttk._format_optdict(opts), {u'-αβγ': True, u'-á': False}) + # opts should remain unchanged + self.assertEqual(opts, orig_opts) + + # passing values with spaces inside a tuple/list + check_against( + ttk._format_optdict( + {'option': ('one two', 'three')}), + {'-option': '{one two} three'}) + check_against( + ttk._format_optdict( + {'option': ('one\ttwo', 'three')}), + {'-option': '{one\ttwo} three'}) + + # passing empty strings inside a tuple/list + check_against( + ttk._format_optdict( + {'option': ('', 'one')}), + {'-option': '{} one'}) + + # passing values with braces inside a tuple/list + check_against( + ttk._format_optdict( + {'option': ('one} {two', 'three')}), + {'-option': r'one\}\ \{two three'}) + + # passing quoted strings inside a tuple/list + check_against( + ttk._format_optdict( + {'option': ('"one"', 'two')}), + {'-option': '{"one"} two'}) + check_against( + ttk._format_optdict( + {'option': ('{one}', 'two')}), + {'-option': r'\{one\} two'}) + + # ignore an option + amount_opts = len(ttk._format_optdict(opts, ignore=(u'á'))) // 2 + self.assertEqual(amount_opts, len(opts) - 1) + + # ignore non-existing options + amount_opts = len(ttk._format_optdict(opts, ignore=(u'á', 'b'))) // 2 + self.assertEqual(amount_opts, len(opts) - 1) + + # ignore every option + self.assertFalse(ttk._format_optdict(opts, ignore=opts.keys())) + + + def test_format_mapdict(self): + opts = {'a': [('b', 'c', 'val'), ('d', 'otherval'), ('', 'single')]} + result = ttk._format_mapdict(opts) + self.assertEqual(len(result), len(opts.keys()) * 2) + self.assertEqual(result, ('-a', '{b c} val d otherval {} single')) + self.assertEqual(ttk._format_mapdict(opts, script=True), + ('-a', '{{b c} val d otherval {} single}')) + + self.assertEqual(ttk._format_mapdict({2: []}), ('-2', '')) + + opts = {u'üñÃćódè': [(u'á', u'vãl')]} + result = ttk._format_mapdict(opts) + self.assertEqual(result, (u'-üñÃćódè', u'á vãl')) + + # empty states + valid = {'opt': [('', u'', 'hi')]} + self.assertEqual(ttk._format_mapdict(valid), ('-opt', '{ } hi')) + + # when passing multiple states, they all must be strings + invalid = {'opt': [(1, 2, 'valid val')]} + self.assertRaises(TypeError, ttk._format_mapdict, invalid) + invalid = {'opt': [([1], '2', 'valid val')]} + self.assertRaises(TypeError, ttk._format_mapdict, invalid) + # but when passing a single state, it can be anything + valid = {'opt': [[1, 'value']]} + self.assertEqual(ttk._format_mapdict(valid), ('-opt', '1 value')) + # special attention to single states which evalute to False + for stateval in (None, 0, False, '', set()): # just some samples + valid = {'opt': [(stateval, 'value')]} + self.assertEqual(ttk._format_mapdict(valid), + ('-opt', '{} value')) + + # values must be iterable + opts = {'a': None} + self.assertRaises(TypeError, ttk._format_mapdict, opts) + + # items in the value must have size >= 2 + self.assertRaises(IndexError, ttk._format_mapdict, + {'a': [('invalid', )]}) + + + def test_format_elemcreate(self): + self.assertTrue(ttk._format_elemcreate(None), (None, ())) + + ## Testing type = image + # image type expects at least an image name, so this should raise + # IndexError since it tries to access the index 0 of an empty tuple + self.assertRaises(IndexError, ttk._format_elemcreate, 'image') + + # don't format returned values as a tcl script + # minimum acceptable for image type + self.assertEqual(ttk._format_elemcreate('image', False, 'test'), + ("test ", ())) + # specifying a state spec + self.assertEqual(ttk._format_elemcreate('image', False, 'test', + ('', 'a')), ("test {} a", ())) + # state spec with multiple states + self.assertEqual(ttk._format_elemcreate('image', False, 'test', + ('a', 'b', 'c')), ("test {a b} c", ())) + # state spec and options + res = ttk._format_elemcreate('image', False, 'test', + ('a', 'b'), a='x', b='y') + self.assertEqual(res[0], "test a b") + self.assertEqual(set(res[1]), {"-a", "x", "-b", "y"}) + # format returned values as a tcl script + # state spec with multiple states and an option with a multivalue + self.assertEqual(ttk._format_elemcreate('image', True, 'test', + ('a', 'b', 'c', 'd'), x=[2, 3]), ("{test {a b c} d}", "-x {2 3}")) + + ## Testing type = vsapi + # vsapi type expects at least a class name and a part_id, so this + # should raise a ValueError since it tries to get two elements from + # an empty tuple + self.assertRaises(ValueError, ttk._format_elemcreate, 'vsapi') + + # don't format returned values as a tcl script + # minimum acceptable for vsapi + self.assertEqual(ttk._format_elemcreate('vsapi', False, 'a', 'b'), + ("a b ", ())) + # now with a state spec with multiple states + self.assertEqual(ttk._format_elemcreate('vsapi', False, 'a', 'b', + ('a', 'b', 'c')), ("a b {a b} c", ())) + # state spec and option + self.assertEqual(ttk._format_elemcreate('vsapi', False, 'a', 'b', + ('a', 'b'), opt='x'), ("a b a b", ("-opt", "x"))) + # format returned values as a tcl script + # state spec with a multivalue and an option + self.assertEqual(ttk._format_elemcreate('vsapi', True, 'a', 'b', + ('a', 'b', [1, 2]), opt='x'), ("{a b {a b} {1 2}}", "-opt x")) + + # Testing type = from + # from type expects at least a type name + self.assertRaises(IndexError, ttk._format_elemcreate, 'from') + + self.assertEqual(ttk._format_elemcreate('from', False, 'a'), + ('a', ())) + self.assertEqual(ttk._format_elemcreate('from', False, 'a', 'b'), + ('a', ('b', ))) + self.assertEqual(ttk._format_elemcreate('from', True, 'a', 'b'), + ('{a}', 'b')) + + + def test_format_layoutlist(self): + def sample(indent=0, indent_size=2): + return ttk._format_layoutlist( + [('a', {'other': [1, 2, 3], 'children': + [('b', {'children': + [('c', {'children': + [('d', {'nice': 'opt'})], 'something': (1, 2) + })] + })] + })], indent=indent, indent_size=indent_size)[0] + + def sample_expected(indent=0, indent_size=2): + spaces = lambda amount=0: ' ' * (amount + indent) + return ( + "%sa -other {1 2 3} -children {\n" + "%sb -children {\n" + "%sc -something {1 2} -children {\n" + "%sd -nice opt\n" + "%s}\n" + "%s}\n" + "%s}" % (spaces(), spaces(indent_size), + spaces(2 * indent_size), spaces(3 * indent_size), + spaces(2 * indent_size), spaces(indent_size), spaces())) + + # empty layout + self.assertEqual(ttk._format_layoutlist([])[0], '') + + # smallest (after an empty one) acceptable layout + smallest = ttk._format_layoutlist([('a', None)], indent=0) + self.assertEqual(smallest, + ttk._format_layoutlist([('a', '')], indent=0)) + self.assertEqual(smallest[0], 'a') + + # testing indentation levels + self.assertEqual(sample(), sample_expected()) + for i in range(4): + self.assertEqual(sample(i), sample_expected(i)) + self.assertEqual(sample(i, i), sample_expected(i, i)) + + # invalid layout format, different kind of exceptions will be + # raised + + # plain wrong format + self.assertRaises(ValueError, ttk._format_layoutlist, + ['bad', 'format']) + self.assertRaises(TypeError, ttk._format_layoutlist, None) + # _format_layoutlist always expects the second item (in every item) + # to act like a dict (except when the value evalutes to False). + self.assertRaises(AttributeError, + ttk._format_layoutlist, [('a', 'b')]) + # bad children formatting + self.assertRaises(ValueError, ttk._format_layoutlist, + [('name', {'children': {'a': None}})]) + + + def test_script_from_settings(self): + # empty options + self.assertFalse(ttk._script_from_settings({'name': + {'configure': None, 'map': None, 'element create': None}})) + + # empty layout + self.assertEqual( + ttk._script_from_settings({'name': {'layout': None}}), + "ttk::style layout name {\nnull\n}") + + configdict = {u'αβγ': True, u'á': False} + self.assertTrue( + ttk._script_from_settings({'name': {'configure': configdict}})) + + mapdict = {u'üñÃćódè': [(u'á', u'vãl')]} + self.assertTrue( + ttk._script_from_settings({'name': {'map': mapdict}})) + + # invalid image element + self.assertRaises(IndexError, + ttk._script_from_settings, {'name': {'element create': ['image']}}) + + # minimal valid image + self.assertTrue(ttk._script_from_settings({'name': + {'element create': ['image', 'name']}})) + + image = {'thing': {'element create': + ['image', 'name', ('state1', 'state2', 'val')]}} + self.assertEqual(ttk._script_from_settings(image), + "ttk::style element create thing image {name {state1 state2} val} ") + + image['thing']['element create'].append({'opt': 30}) + self.assertEqual(ttk._script_from_settings(image), + "ttk::style element create thing image {name {state1 state2} val} " + "-opt 30") + + image['thing']['element create'][-1]['opt'] = [MockTclObj(3), + MockTclObj('2m')] + self.assertEqual(ttk._script_from_settings(image), + "ttk::style element create thing image {name {state1 state2} val} " + "-opt {3 2m}") + + + def test_tclobj_to_py(self): + self.assertEqual( + ttk._tclobj_to_py((MockStateSpec('a', 'b'), 'val')), + [('a', 'b', 'val')]) + self.assertEqual( + ttk._tclobj_to_py([MockTclObj('1'), 2, MockTclObj('3m')]), + [1, 2, '3m']) + + + def test_list_from_statespec(self): + def test_it(sspec, value, res_value, states): + self.assertEqual(ttk._list_from_statespec( + (sspec, value)), [states + (res_value, )]) + + states_even = tuple('state%d' % i for i in range(6)) + statespec = MockStateSpec(*states_even) + test_it(statespec, 'val', 'val', states_even) + test_it(statespec, MockTclObj('val'), 'val', states_even) + + states_odd = tuple('state%d' % i for i in range(5)) + statespec = MockStateSpec(*states_odd) + test_it(statespec, 'val', 'val', states_odd) + + test_it(('a', 'b', 'c'), MockTclObj('val'), 'val', ('a', 'b', 'c')) + + + def test_list_from_layouttuple(self): + tk = MockTkApp() + + # empty layout tuple + self.assertFalse(ttk._list_from_layouttuple(tk, ())) + + # shortest layout tuple + self.assertEqual(ttk._list_from_layouttuple(tk, ('name', )), + [('name', {})]) + + # not so interesting ltuple + sample_ltuple = ('name', '-option', 'value') + self.assertEqual(ttk._list_from_layouttuple(tk, sample_ltuple), + [('name', {'option': 'value'})]) + + # empty children + self.assertEqual(ttk._list_from_layouttuple(tk, + ('something', '-children', ())), + [('something', {'children': []})] + ) + + # more interesting ltuple + ltuple = ( + 'name', '-option', 'niceone', '-children', ( + ('otherone', '-children', ( + ('child', )), '-otheropt', 'othervalue' + ) + ) + ) + self.assertEqual(ttk._list_from_layouttuple(tk, ltuple), + [('name', {'option': 'niceone', 'children': + [('otherone', {'otheropt': 'othervalue', 'children': + [('child', {})] + })] + })] + ) + + # bad tuples + self.assertRaises(ValueError, ttk._list_from_layouttuple, tk, + ('name', 'no_minus')) + self.assertRaises(ValueError, ttk._list_from_layouttuple, tk, + ('name', 'no_minus', 'value')) + self.assertRaises(ValueError, ttk._list_from_layouttuple, tk, + ('something', '-children')) # no children + + + def test_val_or_dict(self): + def func(res, opt=None, val=None): + if opt is None: + return res + if val is None: + return "test val" + return (opt, val) + + tk = MockTkApp() + tk.call = func + + self.assertEqual(ttk._val_or_dict(tk, {}, '-test:3'), + {'test': '3'}) + self.assertEqual(ttk._val_or_dict(tk, {}, ('-test', 3)), + {'test': 3}) + + self.assertEqual(ttk._val_or_dict(tk, {'test': None}, 'x:y'), + 'test val') + + self.assertEqual(ttk._val_or_dict(tk, {'test': 3}, 'x:y'), + {'test': 3}) + + + def test_convert_stringval(self): + tests = ( + (0, 0), ('09', 9), ('a', 'a'), (u'áÚ', u'áÚ'), ([], '[]'), + (None, 'None') + ) + for orig, expected in tests: + self.assertEqual(ttk._convert_stringval(orig), expected) + + if sys.getdefaultencoding() == 'ascii': + self.assertRaises(UnicodeDecodeError, + ttk._convert_stringval, 'á') + + +class TclObjsToPyTest(unittest.TestCase): + + def test_unicode(self): + adict = {'opt': u'välúè'} + self.assertEqual(ttk.tclobjs_to_py(adict), {'opt': u'välúè'}) + + adict['opt'] = MockTclObj(adict['opt']) + self.assertEqual(ttk.tclobjs_to_py(adict), {'opt': u'välúè'}) + + def test_multivalues(self): + adict = {'opt': [1, 2, 3, 4]} + self.assertEqual(ttk.tclobjs_to_py(adict), {'opt': [1, 2, 3, 4]}) + + adict['opt'] = [1, 'xm', 3] + self.assertEqual(ttk.tclobjs_to_py(adict), {'opt': [1, 'xm', 3]}) + + adict['opt'] = (MockStateSpec('a', 'b'), u'válũè') + self.assertEqual(ttk.tclobjs_to_py(adict), + {'opt': [('a', 'b', u'válũè')]}) + + self.assertEqual(ttk.tclobjs_to_py({'x': ['y z']}), + {'x': ['y z']}) + + def test_nosplit(self): + self.assertEqual(ttk.tclobjs_to_py({'text': 'some text'}), + {'text': 'some text'}) + +tests_nogui = (InternalFunctionsTest, TclObjsToPyTest) + +if __name__ == "__main__": + from test.test_support import run_unittest + run_unittest(*tests_nogui) diff --git a/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/test_style.py b/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/test_style.py new file mode 100644 index 0000000000..fe122e738e --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/test_style.py @@ -0,0 +1,92 @@ +import unittest +import Tkinter as tkinter +import ttk +from test.test_support import requires, run_unittest +from test_ttk.support import AbstractTkTest + +requires('gui') + +class StyleTest(AbstractTkTest, unittest.TestCase): + + def setUp(self): + super(StyleTest, self).setUp() + self.style = ttk.Style(self.root) + + + def test_configure(self): + style = self.style + style.configure('TButton', background='yellow') + self.assertEqual(style.configure('TButton', 'background'), + 'yellow') + self.assertIsInstance(style.configure('TButton'), dict) + + + def test_map(self): + style = self.style + style.map('TButton', background=[('active', 'background', 'blue')]) + self.assertEqual(style.map('TButton', 'background'), + [('active', 'background', 'blue')] if self.wantobjects else + [('active background', 'blue')]) + self.assertIsInstance(style.map('TButton'), dict) + + + def test_lookup(self): + style = self.style + style.configure('TButton', background='yellow') + style.map('TButton', background=[('active', 'background', 'blue')]) + + self.assertEqual(style.lookup('TButton', 'background'), 'yellow') + self.assertEqual(style.lookup('TButton', 'background', + ['active', 'background']), 'blue') + self.assertEqual(style.lookup('TButton', 'optionnotdefined', + default='iknewit'), 'iknewit') + + + def test_layout(self): + style = self.style + self.assertRaises(tkinter.TclError, style.layout, 'NotALayout') + tv_style = style.layout('Treeview') + + # "erase" Treeview layout + style.layout('Treeview', '') + self.assertEqual(style.layout('Treeview'), + [('null', {'sticky': 'nswe'})] + ) + + # restore layout + style.layout('Treeview', tv_style) + self.assertEqual(style.layout('Treeview'), tv_style) + + # should return a list + self.assertIsInstance(style.layout('TButton'), list) + + # correct layout, but "option" doesn't exist as option + self.assertRaises(tkinter.TclError, style.layout, 'Treeview', + [('name', {'option': 'inexistent'})]) + + + def test_theme_use(self): + self.assertRaises(tkinter.TclError, self.style.theme_use, + 'nonexistingname') + + curr_theme = self.style.theme_use() + new_theme = None + for theme in self.style.theme_names(): + if theme != curr_theme: + new_theme = theme + self.style.theme_use(theme) + break + else: + # just one theme available, can't go on with tests + return + + self.assertFalse(curr_theme == new_theme) + self.assertFalse(new_theme != self.style.theme_use()) + + self.style.theme_use(curr_theme) + + +tests_gui = (StyleTest, ) + +if __name__ == "__main__": + run_unittest(*tests_gui) diff --git a/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/test_widgets.py b/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/test_widgets.py new file mode 100644 index 0000000000..3d5683cc4f --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/test/test_ttk/test_widgets.py @@ -0,0 +1,1683 @@ +import unittest +import Tkinter as tkinter +from Tkinter import TclError +import ttk +from test.test_support import requires, run_unittest, have_unicode, u +import sys + +from test_functions import MockTclObj +from support import (AbstractTkTest, tcl_version, get_tk_patchlevel, + simulate_mouse_click) +from widget_tests import (add_standard_options, noconv, noconv_meth, + AbstractWidgetTest, StandardOptionsTests, + IntegerSizeTests, PixelSizeTests, + setUpModule) + +requires('gui') + + +class StandardTtkOptionsTests(StandardOptionsTests): + + def test_class(self): + widget = self.create() + self.assertEqual(widget['class'], '') + errmsg='attempt to change read-only option' + if get_tk_patchlevel() < (8, 6, 0, 'beta', 3): + errmsg='Attempt to change read-only option' + self.checkInvalidParam(widget, 'class', 'Foo', errmsg=errmsg) + widget2 = self.create(class_='Foo') + self.assertEqual(widget2['class'], 'Foo') + + def test_padding(self): + widget = self.create() + self.checkParam(widget, 'padding', 0, expected=('0',)) + self.checkParam(widget, 'padding', 5, expected=('5',)) + self.checkParam(widget, 'padding', (5, 6), expected=('5', '6')) + self.checkParam(widget, 'padding', (5, 6, 7), + expected=('5', '6', '7')) + self.checkParam(widget, 'padding', (5, 6, 7, 8), + expected=('5', '6', '7', '8')) + self.checkParam(widget, 'padding', ('5p', '6p', '7p', '8p')) + self.checkParam(widget, 'padding', (), expected='') + + def test_style(self): + widget = self.create() + self.assertEqual(widget['style'], '') + errmsg = 'Layout Foo not found' + if hasattr(self, 'default_orient'): + errmsg = ('Layout %s.Foo not found' % + getattr(self, 'default_orient').title()) + self.checkInvalidParam(widget, 'style', 'Foo', + errmsg=errmsg) + widget2 = self.create(class_='Foo') + self.assertEqual(widget2['class'], 'Foo') + # XXX + pass + + +class WidgetTest(AbstractTkTest, unittest.TestCase): + """Tests methods available in every ttk widget.""" + + def setUp(self): + super(WidgetTest, self).setUp() + self.widget = ttk.Button(self.root, width=0, text="Text") + self.widget.pack() + self.widget.wait_visibility() + + + def test_identify(self): + self.widget.update_idletasks() + self.assertEqual(self.widget.identify( + self.widget.winfo_width() // 2, + self.widget.winfo_height() // 2 + ), "label") + self.assertEqual(self.widget.identify(-1, -1), "") + + self.assertRaises(tkinter.TclError, self.widget.identify, None, 5) + self.assertRaises(tkinter.TclError, self.widget.identify, 5, None) + self.assertRaises(tkinter.TclError, self.widget.identify, 5, '') + + + def test_widget_state(self): + # XXX not sure about the portability of all these tests + self.assertEqual(self.widget.state(), ()) + self.assertEqual(self.widget.instate(['!disabled']), True) + + # changing from !disabled to disabled + self.assertEqual(self.widget.state(['disabled']), ('!disabled', )) + # no state change + self.assertEqual(self.widget.state(['disabled']), ()) + # change back to !disable but also active + self.assertEqual(self.widget.state(['!disabled', 'active']), + ('!active', 'disabled')) + # no state changes, again + self.assertEqual(self.widget.state(['!disabled', 'active']), ()) + self.assertEqual(self.widget.state(['active', '!disabled']), ()) + + def test_cb(arg1, **kw): + return arg1, kw + self.assertEqual(self.widget.instate(['!disabled'], + test_cb, "hi", **{"msg": "there"}), + ('hi', {'msg': 'there'})) + + # attempt to set invalid statespec + currstate = self.widget.state() + self.assertRaises(tkinter.TclError, self.widget.instate, + ['badstate']) + self.assertRaises(tkinter.TclError, self.widget.instate, + ['disabled', 'badstate']) + # verify that widget didn't change its state + self.assertEqual(currstate, self.widget.state()) + + # ensuring that passing None as state doesn't modify current state + self.widget.state(['active', '!disabled']) + self.assertEqual(self.widget.state(), ('active', )) + + +class AbstractToplevelTest(AbstractWidgetTest, PixelSizeTests): + _conv_pixels = noconv_meth + + +@add_standard_options(StandardTtkOptionsTests) +class FrameTest(AbstractToplevelTest, unittest.TestCase): + OPTIONS = ( + 'borderwidth', 'class', 'cursor', 'height', + 'padding', 'relief', 'style', 'takefocus', + 'width', + ) + + def create(self, **kwargs): + return ttk.Frame(self.root, **kwargs) + + +@add_standard_options(StandardTtkOptionsTests) +class LabelFrameTest(AbstractToplevelTest, unittest.TestCase): + OPTIONS = ( + 'borderwidth', 'class', 'cursor', 'height', + 'labelanchor', 'labelwidget', + 'padding', 'relief', 'style', 'takefocus', + 'text', 'underline', 'width', + ) + + def create(self, **kwargs): + return ttk.LabelFrame(self.root, **kwargs) + + def test_labelanchor(self): + widget = self.create() + self.checkEnumParam(widget, 'labelanchor', + 'e', 'en', 'es', 'n', 'ne', 'nw', 's', 'se', 'sw', 'w', 'wn', 'ws', + errmsg='Bad label anchor specification {}') + self.checkInvalidParam(widget, 'labelanchor', 'center') + + def test_labelwidget(self): + widget = self.create() + label = ttk.Label(self.root, text='Mupp', name='foo') + self.checkParam(widget, 'labelwidget', label, expected='.foo') + label.destroy() + + +class AbstractLabelTest(AbstractWidgetTest): + + def checkImageParam(self, widget, name): + image = tkinter.PhotoImage(master=self.root, name='image1') + image2 = tkinter.PhotoImage(master=self.root, name='image2') + self.checkParam(widget, name, image, expected=('image1',)) + self.checkParam(widget, name, 'image1', expected=('image1',)) + self.checkParam(widget, name, (image,), expected=('image1',)) + self.checkParam(widget, name, (image, 'active', image2), + expected=('image1', 'active', 'image2')) + self.checkParam(widget, name, 'image1 active image2', + expected=('image1', 'active', 'image2')) + self.checkInvalidParam(widget, name, 'spam', + errmsg='image "spam" doesn\'t exist') + + def test_compound(self): + widget = self.create() + self.checkEnumParam(widget, 'compound', + 'none', 'text', 'image', 'center', + 'top', 'bottom', 'left', 'right') + + def test_state(self): + widget = self.create() + self.checkParams(widget, 'state', 'active', 'disabled', 'normal') + + def test_width(self): + widget = self.create() + self.checkParams(widget, 'width', 402, -402, 0) + + +@add_standard_options(StandardTtkOptionsTests) +class LabelTest(AbstractLabelTest, unittest.TestCase): + OPTIONS = ( + 'anchor', 'background', 'borderwidth', + 'class', 'compound', 'cursor', 'font', 'foreground', + 'image', 'justify', 'padding', 'relief', 'state', 'style', + 'takefocus', 'text', 'textvariable', + 'underline', 'width', 'wraplength', + ) + _conv_pixels = noconv_meth + + def create(self, **kwargs): + return ttk.Label(self.root, **kwargs) + + def test_font(self): + widget = self.create() + self.checkParam(widget, 'font', + '-Adobe-Helvetica-Medium-R-Normal--*-120-*-*-*-*-*-*') + + +@add_standard_options(StandardTtkOptionsTests) +class ButtonTest(AbstractLabelTest, unittest.TestCase): + OPTIONS = ( + 'class', 'command', 'compound', 'cursor', 'default', + 'image', 'padding', 'state', 'style', + 'takefocus', 'text', 'textvariable', + 'underline', 'width', + ) + + def create(self, **kwargs): + return ttk.Button(self.root, **kwargs) + + def test_default(self): + widget = self.create() + self.checkEnumParam(widget, 'default', 'normal', 'active', 'disabled') + + def test_invoke(self): + success = [] + btn = ttk.Button(self.root, command=lambda: success.append(1)) + btn.invoke() + self.assertTrue(success) + + +@add_standard_options(StandardTtkOptionsTests) +class CheckbuttonTest(AbstractLabelTest, unittest.TestCase): + OPTIONS = ( + 'class', 'command', 'compound', 'cursor', + 'image', + 'offvalue', 'onvalue', + 'padding', 'state', 'style', + 'takefocus', 'text', 'textvariable', + 'underline', 'variable', 'width', + ) + + def create(self, **kwargs): + return ttk.Checkbutton(self.root, **kwargs) + + def test_offvalue(self): + widget = self.create() + self.checkParams(widget, 'offvalue', 1, 2.3, '', 'any string') + + def test_onvalue(self): + widget = self.create() + self.checkParams(widget, 'onvalue', 1, 2.3, '', 'any string') + + def test_invoke(self): + success = [] + def cb_test(): + success.append(1) + return "cb test called" + + cbtn = ttk.Checkbutton(self.root, command=cb_test) + # the variable automatically created by ttk.Checkbutton is actually + # undefined till we invoke the Checkbutton + self.assertEqual(cbtn.state(), ('alternate', )) + self.assertRaises(tkinter.TclError, cbtn.tk.globalgetvar, + cbtn['variable']) + + res = cbtn.invoke() + self.assertEqual(res, "cb test called") + self.assertEqual(cbtn['onvalue'], + cbtn.tk.globalgetvar(cbtn['variable'])) + self.assertTrue(success) + + cbtn['command'] = '' + res = cbtn.invoke() + self.assertFalse(str(res)) + self.assertLessEqual(len(success), 1) + self.assertEqual(cbtn['offvalue'], + cbtn.tk.globalgetvar(cbtn['variable'])) + + +@add_standard_options(IntegerSizeTests, StandardTtkOptionsTests) +class EntryTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'background', 'class', 'cursor', + 'exportselection', 'font', 'foreground', + 'invalidcommand', 'justify', + 'show', 'state', 'style', 'takefocus', 'textvariable', + 'validate', 'validatecommand', 'width', 'xscrollcommand', + ) + + def setUp(self): + super(EntryTest, self).setUp() + self.entry = self.create() + + def create(self, **kwargs): + return ttk.Entry(self.root, **kwargs) + + def test_invalidcommand(self): + widget = self.create() + self.checkCommandParam(widget, 'invalidcommand') + + def test_show(self): + widget = self.create() + self.checkParam(widget, 'show', '*') + self.checkParam(widget, 'show', '') + self.checkParam(widget, 'show', ' ') + + def test_state(self): + widget = self.create() + self.checkParams(widget, 'state', + 'disabled', 'normal', 'readonly') + + def test_validate(self): + widget = self.create() + self.checkEnumParam(widget, 'validate', + 'all', 'key', 'focus', 'focusin', 'focusout', 'none') + + def test_validatecommand(self): + widget = self.create() + self.checkCommandParam(widget, 'validatecommand') + + + def test_bbox(self): + self.assertIsBoundingBox(self.entry.bbox(0)) + self.assertRaises(tkinter.TclError, self.entry.bbox, 'noindex') + self.assertRaises(tkinter.TclError, self.entry.bbox, None) + + + def test_identify(self): + self.entry.pack() + self.entry.wait_visibility() + self.entry.update_idletasks() + + self.assertEqual(self.entry.identify(5, 5), "textarea") + self.assertEqual(self.entry.identify(-1, -1), "") + + self.assertRaises(tkinter.TclError, self.entry.identify, None, 5) + self.assertRaises(tkinter.TclError, self.entry.identify, 5, None) + self.assertRaises(tkinter.TclError, self.entry.identify, 5, '') + + + def test_validation_options(self): + success = [] + test_invalid = lambda: success.append(True) + + self.entry['validate'] = 'none' + self.entry['validatecommand'] = lambda: False + + self.entry['invalidcommand'] = test_invalid + self.entry.validate() + self.assertTrue(success) + + self.entry['invalidcommand'] = '' + self.entry.validate() + self.assertEqual(len(success), 1) + + self.entry['invalidcommand'] = test_invalid + self.entry['validatecommand'] = lambda: True + self.entry.validate() + self.assertEqual(len(success), 1) + + self.entry['validatecommand'] = '' + self.entry.validate() + self.assertEqual(len(success), 1) + + self.entry['validatecommand'] = True + self.assertRaises(tkinter.TclError, self.entry.validate) + + + def test_validation(self): + validation = [] + def validate(to_insert): + if not 'a' <= to_insert.lower() <= 'z': + validation.append(False) + return False + validation.append(True) + return True + + self.entry['validate'] = 'key' + self.entry['validatecommand'] = self.entry.register(validate), '%S' + + self.entry.insert('end', 1) + self.entry.insert('end', 'a') + self.assertEqual(validation, [False, True]) + self.assertEqual(self.entry.get(), 'a') + + + def test_revalidation(self): + def validate(content): + for letter in content: + if not 'a' <= letter.lower() <= 'z': + return False + return True + + self.entry['validatecommand'] = self.entry.register(validate), '%P' + + self.entry.insert('end', 'avocado') + self.assertEqual(self.entry.validate(), True) + self.assertEqual(self.entry.state(), ()) + + self.entry.delete(0, 'end') + self.assertEqual(self.entry.get(), '') + + self.entry.insert('end', 'a1b') + self.assertEqual(self.entry.validate(), False) + self.assertEqual(self.entry.state(), ('invalid', )) + + self.entry.delete(1) + self.assertEqual(self.entry.validate(), True) + self.assertEqual(self.entry.state(), ()) + + +@add_standard_options(IntegerSizeTests, StandardTtkOptionsTests) +class ComboboxTest(EntryTest, unittest.TestCase): + OPTIONS = ( + 'background', 'class', 'cursor', 'exportselection', + 'font', 'foreground', 'height', 'invalidcommand', + 'justify', 'postcommand', 'show', 'state', 'style', + 'takefocus', 'textvariable', + 'validate', 'validatecommand', 'values', + 'width', 'xscrollcommand', + ) + + def setUp(self): + super(ComboboxTest, self).setUp() + self.combo = self.create() + + def create(self, **kwargs): + return ttk.Combobox(self.root, **kwargs) + + def test_height(self): + widget = self.create() + self.checkParams(widget, 'height', 100, 101.2, 102.6, -100, 0, '1i') + + def _show_drop_down_listbox(self): + width = self.combo.winfo_width() + self.combo.event_generate('<ButtonPress-1>', x=width - 5, y=5) + self.combo.event_generate('<ButtonRelease-1>', x=width - 5, y=5) + self.combo.update_idletasks() + + + def test_virtual_event(self): + success = [] + + self.combo['values'] = [1] + self.combo.bind('<<ComboboxSelected>>', + lambda evt: success.append(True)) + self.combo.pack() + self.combo.wait_visibility() + + height = self.combo.winfo_height() + self._show_drop_down_listbox() + self.combo.update() + self.combo.event_generate('<Return>') + self.combo.update() + + self.assertTrue(success) + + + def test_postcommand(self): + success = [] + + self.combo['postcommand'] = lambda: success.append(True) + self.combo.pack() + self.combo.wait_visibility() + + self._show_drop_down_listbox() + self.assertTrue(success) + + # testing postcommand removal + self.combo['postcommand'] = '' + self._show_drop_down_listbox() + self.assertEqual(len(success), 1) + + + def test_values(self): + def check_get_current(getval, currval): + self.assertEqual(self.combo.get(), getval) + self.assertEqual(self.combo.current(), currval) + + self.assertEqual(self.combo['values'], + () if tcl_version < (8, 5) else '') + check_get_current('', -1) + + self.checkParam(self.combo, 'values', 'mon tue wed thur', + expected=('mon', 'tue', 'wed', 'thur')) + self.checkParam(self.combo, 'values', ('mon', 'tue', 'wed', 'thur')) + self.checkParam(self.combo, 'values', (42, 3.14, '', 'any string')) + self.checkParam(self.combo, 'values', () if tcl_version < (8, 5) else '') + + self.combo['values'] = ['a', 1, 'c'] + + self.combo.set('c') + check_get_current('c', 2) + + self.combo.current(0) + check_get_current('a', 0) + + self.combo.set('d') + check_get_current('d', -1) + + # testing values with empty string + self.combo.set('') + self.combo['values'] = (1, 2, '', 3) + check_get_current('', 2) + + # testing values with empty string set through configure + self.combo.configure(values=[1, '', 2]) + self.assertEqual(self.combo['values'], + ('1', '', '2') if self.wantobjects else + '1 {} 2') + + # testing values with spaces + self.combo['values'] = ['a b', 'a\tb', 'a\nb'] + self.assertEqual(self.combo['values'], + ('a b', 'a\tb', 'a\nb') if self.wantobjects else + '{a b} {a\tb} {a\nb}') + + # testing values with special characters + self.combo['values'] = [r'a\tb', '"a"', '} {'] + self.assertEqual(self.combo['values'], + (r'a\tb', '"a"', '} {') if self.wantobjects else + r'a\\tb {"a"} \}\ \{') + + # out of range + self.assertRaises(tkinter.TclError, self.combo.current, + len(self.combo['values'])) + # it expects an integer (or something that can be converted to int) + self.assertRaises(tkinter.TclError, self.combo.current, '') + + # testing creating combobox with empty string in values + combo2 = ttk.Combobox(self.root, values=[1, 2, '']) + self.assertEqual(combo2['values'], + ('1', '2', '') if self.wantobjects else '1 2 {}') + combo2.destroy() + + +@add_standard_options(IntegerSizeTests, StandardTtkOptionsTests) +class PanedWindowTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'class', 'cursor', 'height', + 'orient', 'style', 'takefocus', 'width', + ) + + def setUp(self): + super(PanedWindowTest, self).setUp() + self.paned = self.create() + + def create(self, **kwargs): + return ttk.PanedWindow(self.root, **kwargs) + + def test_orient(self): + widget = self.create() + self.assertEqual(str(widget['orient']), 'vertical') + errmsg='attempt to change read-only option' + if get_tk_patchlevel() < (8, 6, 0, 'beta', 3): + errmsg='Attempt to change read-only option' + self.checkInvalidParam(widget, 'orient', 'horizontal', + errmsg=errmsg) + widget2 = self.create(orient='horizontal') + self.assertEqual(str(widget2['orient']), 'horizontal') + + def test_add(self): + # attempt to add a child that is not a direct child of the paned window + label = ttk.Label(self.paned) + child = ttk.Label(label) + self.assertRaises(tkinter.TclError, self.paned.add, child) + label.destroy() + child.destroy() + # another attempt + label = ttk.Label(self.root) + child = ttk.Label(label) + self.assertRaises(tkinter.TclError, self.paned.add, child) + child.destroy() + label.destroy() + + good_child = ttk.Label(self.root) + self.paned.add(good_child) + # re-adding a child is not accepted + self.assertRaises(tkinter.TclError, self.paned.add, good_child) + + other_child = ttk.Label(self.paned) + self.paned.add(other_child) + self.assertEqual(self.paned.pane(0), self.paned.pane(1)) + self.assertRaises(tkinter.TclError, self.paned.pane, 2) + good_child.destroy() + other_child.destroy() + self.assertRaises(tkinter.TclError, self.paned.pane, 0) + + + def test_forget(self): + self.assertRaises(tkinter.TclError, self.paned.forget, None) + self.assertRaises(tkinter.TclError, self.paned.forget, 0) + + self.paned.add(ttk.Label(self.root)) + self.paned.forget(0) + self.assertRaises(tkinter.TclError, self.paned.forget, 0) + + + def test_insert(self): + self.assertRaises(tkinter.TclError, self.paned.insert, None, 0) + self.assertRaises(tkinter.TclError, self.paned.insert, 0, None) + self.assertRaises(tkinter.TclError, self.paned.insert, 0, 0) + + child = ttk.Label(self.root) + child2 = ttk.Label(self.root) + child3 = ttk.Label(self.root) + + self.assertRaises(tkinter.TclError, self.paned.insert, 0, child) + + self.paned.insert('end', child2) + self.paned.insert(0, child) + self.assertEqual(self.paned.panes(), (str(child), str(child2))) + + self.paned.insert(0, child2) + self.assertEqual(self.paned.panes(), (str(child2), str(child))) + + self.paned.insert('end', child3) + self.assertEqual(self.paned.panes(), + (str(child2), str(child), str(child3))) + + # reinserting a child should move it to its current position + panes = self.paned.panes() + self.paned.insert('end', child3) + self.assertEqual(panes, self.paned.panes()) + + # moving child3 to child2 position should result in child2 ending up + # in previous child position and child ending up in previous child3 + # position + self.paned.insert(child2, child3) + self.assertEqual(self.paned.panes(), + (str(child3), str(child2), str(child))) + + + def test_pane(self): + self.assertRaises(tkinter.TclError, self.paned.pane, 0) + + child = ttk.Label(self.root) + self.paned.add(child) + self.assertIsInstance(self.paned.pane(0), dict) + self.assertEqual(self.paned.pane(0, weight=None), + 0 if self.wantobjects else '0') + # newer form for querying a single option + self.assertEqual(self.paned.pane(0, 'weight'), + 0 if self.wantobjects else '0') + self.assertEqual(self.paned.pane(0), self.paned.pane(str(child))) + + self.assertRaises(tkinter.TclError, self.paned.pane, 0, + badoption='somevalue') + + + def test_sashpos(self): + self.assertRaises(tkinter.TclError, self.paned.sashpos, None) + self.assertRaises(tkinter.TclError, self.paned.sashpos, '') + self.assertRaises(tkinter.TclError, self.paned.sashpos, 0) + + child = ttk.Label(self.paned, text='a') + self.paned.add(child, weight=1) + self.assertRaises(tkinter.TclError, self.paned.sashpos, 0) + child2 = ttk.Label(self.paned, text='b') + self.paned.add(child2) + self.assertRaises(tkinter.TclError, self.paned.sashpos, 1) + + self.paned.pack(expand=True, fill='both') + self.paned.wait_visibility() + + curr_pos = self.paned.sashpos(0) + self.paned.sashpos(0, 1000) + self.assertNotEqual(curr_pos, self.paned.sashpos(0)) + self.assertIsInstance(self.paned.sashpos(0), int) + + +@add_standard_options(StandardTtkOptionsTests) +class RadiobuttonTest(AbstractLabelTest, unittest.TestCase): + OPTIONS = ( + 'class', 'command', 'compound', 'cursor', + 'image', + 'padding', 'state', 'style', + 'takefocus', 'text', 'textvariable', + 'underline', 'value', 'variable', 'width', + ) + + def create(self, **kwargs): + return ttk.Radiobutton(self.root, **kwargs) + + def test_value(self): + widget = self.create() + self.checkParams(widget, 'value', 1, 2.3, '', 'any string') + + def test_invoke(self): + success = [] + def cb_test(): + success.append(1) + return "cb test called" + + myvar = tkinter.IntVar(self.root) + cbtn = ttk.Radiobutton(self.root, command=cb_test, + variable=myvar, value=0) + cbtn2 = ttk.Radiobutton(self.root, command=cb_test, + variable=myvar, value=1) + + if self.wantobjects: + conv = lambda x: x + else: + conv = int + + res = cbtn.invoke() + self.assertEqual(res, "cb test called") + self.assertEqual(conv(cbtn['value']), myvar.get()) + self.assertEqual(myvar.get(), + conv(cbtn.tk.globalgetvar(cbtn['variable']))) + self.assertTrue(success) + + cbtn2['command'] = '' + res = cbtn2.invoke() + self.assertEqual(str(res), '') + self.assertLessEqual(len(success), 1) + self.assertEqual(conv(cbtn2['value']), myvar.get()) + self.assertEqual(myvar.get(), + conv(cbtn.tk.globalgetvar(cbtn['variable']))) + + self.assertEqual(str(cbtn['variable']), str(cbtn2['variable'])) + + +class MenubuttonTest(AbstractLabelTest, unittest.TestCase): + OPTIONS = ( + 'class', 'compound', 'cursor', 'direction', + 'image', 'menu', 'padding', 'state', 'style', + 'takefocus', 'text', 'textvariable', + 'underline', 'width', + ) + + def create(self, **kwargs): + return ttk.Menubutton(self.root, **kwargs) + + def test_direction(self): + widget = self.create() + self.checkEnumParam(widget, 'direction', + 'above', 'below', 'left', 'right', 'flush') + + def test_menu(self): + widget = self.create() + menu = tkinter.Menu(widget, name='menu') + self.checkParam(widget, 'menu', menu, conv=str) + menu.destroy() + + +@add_standard_options(StandardTtkOptionsTests) +class ScaleTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'class', 'command', 'cursor', 'from', 'length', + 'orient', 'style', 'takefocus', 'to', 'value', 'variable', + ) + _conv_pixels = noconv_meth + default_orient = 'horizontal' + + def setUp(self): + super(ScaleTest, self).setUp() + self.scale = self.create() + self.scale.pack() + self.scale.update() + + def create(self, **kwargs): + return ttk.Scale(self.root, **kwargs) + + def test_from(self): + widget = self.create() + self.checkFloatParam(widget, 'from', 100, 14.9, 15.1, conv=False) + + def test_length(self): + widget = self.create() + self.checkPixelsParam(widget, 'length', 130, 131.2, 135.6, '5i') + + def test_to(self): + widget = self.create() + self.checkFloatParam(widget, 'to', 300, 14.9, 15.1, -10, conv=False) + + def test_value(self): + widget = self.create() + self.checkFloatParam(widget, 'value', 300, 14.9, 15.1, -10, conv=False) + + def test_custom_event(self): + failure = [1, 1, 1] # will need to be empty + + funcid = self.scale.bind('<<RangeChanged>>', lambda evt: failure.pop()) + + self.scale['from'] = 10 + self.scale['from_'] = 10 + self.scale['to'] = 3 + + self.assertFalse(failure) + + failure = [1, 1, 1] + self.scale.configure(from_=2, to=5) + self.scale.configure(from_=0, to=-2) + self.scale.configure(to=10) + + self.assertFalse(failure) + + + def test_get(self): + if self.wantobjects: + conv = lambda x: x + else: + conv = float + + scale_width = self.scale.winfo_width() + self.assertEqual(self.scale.get(scale_width, 0), self.scale['to']) + + self.assertEqual(conv(self.scale.get(0, 0)), conv(self.scale['from'])) + self.assertEqual(self.scale.get(), self.scale['value']) + self.scale['value'] = 30 + self.assertEqual(self.scale.get(), self.scale['value']) + + self.assertRaises(tkinter.TclError, self.scale.get, '', 0) + self.assertRaises(tkinter.TclError, self.scale.get, 0, '') + + + def test_set(self): + if self.wantobjects: + conv = lambda x: x + else: + conv = float + + # set restricts the max/min values according to the current range + max = conv(self.scale['to']) + new_max = max + 10 + self.scale.set(new_max) + self.assertEqual(conv(self.scale.get()), max) + min = conv(self.scale['from']) + self.scale.set(min - 1) + self.assertEqual(conv(self.scale.get()), min) + + # changing directly the variable doesn't impose this limitation tho + var = tkinter.DoubleVar(self.root) + self.scale['variable'] = var + var.set(max + 5) + self.assertEqual(conv(self.scale.get()), var.get()) + self.assertEqual(conv(self.scale.get()), max + 5) + del var + + # the same happens with the value option + self.scale['value'] = max + 10 + self.assertEqual(conv(self.scale.get()), max + 10) + self.assertEqual(conv(self.scale.get()), conv(self.scale['value'])) + + # nevertheless, note that the max/min values we can get specifying + # x, y coords are the ones according to the current range + self.assertEqual(conv(self.scale.get(0, 0)), min) + self.assertEqual(conv(self.scale.get(self.scale.winfo_width(), 0)), max) + + self.assertRaises(tkinter.TclError, self.scale.set, None) + + +@add_standard_options(StandardTtkOptionsTests) +class ProgressbarTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'class', 'cursor', 'orient', 'length', + 'mode', 'maximum', 'phase', + 'style', 'takefocus', 'value', 'variable', + ) + _conv_pixels = noconv_meth + default_orient = 'horizontal' + + def create(self, **kwargs): + return ttk.Progressbar(self.root, **kwargs) + + def test_length(self): + widget = self.create() + self.checkPixelsParam(widget, 'length', 100.1, 56.7, '2i') + + def test_maximum(self): + widget = self.create() + self.checkFloatParam(widget, 'maximum', 150.2, 77.7, 0, -10, conv=False) + + def test_mode(self): + widget = self.create() + self.checkEnumParam(widget, 'mode', 'determinate', 'indeterminate') + + def test_phase(self): + # XXX + pass + + def test_value(self): + widget = self.create() + self.checkFloatParam(widget, 'value', 150.2, 77.7, 0, -10, + conv=False) + + +@unittest.skipIf(sys.platform == 'darwin', + 'ttk.Scrollbar is special on MacOSX') +@add_standard_options(StandardTtkOptionsTests) +class ScrollbarTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'class', 'command', 'cursor', 'orient', 'style', 'takefocus', + ) + default_orient = 'vertical' + + def create(self, **kwargs): + return ttk.Scrollbar(self.root, **kwargs) + + +@add_standard_options(IntegerSizeTests, StandardTtkOptionsTests) +class NotebookTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'class', 'cursor', 'height', 'padding', 'style', 'takefocus', 'width', + ) + + def setUp(self): + super(NotebookTest, self).setUp() + self.nb = self.create(padding=0) + self.child1 = ttk.Label(self.root) + self.child2 = ttk.Label(self.root) + self.nb.add(self.child1, text='a') + self.nb.add(self.child2, text='b') + + def create(self, **kwargs): + return ttk.Notebook(self.root, **kwargs) + + def test_tab_identifiers(self): + self.nb.forget(0) + self.nb.hide(self.child2) + self.assertRaises(tkinter.TclError, self.nb.tab, self.child1) + self.assertEqual(self.nb.index('end'), 1) + self.nb.add(self.child2) + self.assertEqual(self.nb.index('end'), 1) + self.nb.select(self.child2) + + self.assertTrue(self.nb.tab('current')) + self.nb.add(self.child1, text='a') + + self.nb.pack() + self.nb.wait_visibility() + if sys.platform == 'darwin': + tb_idx = "@20,5" + else: + tb_idx = "@5,5" + self.assertEqual(self.nb.tab(tb_idx), self.nb.tab('current')) + + for i in range(5, 100, 5): + try: + if self.nb.tab('@%d, 5' % i, text=None) == 'a': + break + except tkinter.TclError: + pass + + else: + self.fail("Tab with text 'a' not found") + + + def test_add_and_hidden(self): + self.assertRaises(tkinter.TclError, self.nb.hide, -1) + self.assertRaises(tkinter.TclError, self.nb.hide, 'hi') + self.assertRaises(tkinter.TclError, self.nb.hide, None) + self.assertRaises(tkinter.TclError, self.nb.add, None) + self.assertRaises(tkinter.TclError, self.nb.add, ttk.Label(self.root), + unknown='option') + + tabs = self.nb.tabs() + self.nb.hide(self.child1) + self.nb.add(self.child1) + self.assertEqual(self.nb.tabs(), tabs) + + child = ttk.Label(self.root) + self.nb.add(child, text='c') + tabs = self.nb.tabs() + + curr = self.nb.index('current') + # verify that the tab gets readded at its previous position + child2_index = self.nb.index(self.child2) + self.nb.hide(self.child2) + self.nb.add(self.child2) + self.assertEqual(self.nb.tabs(), tabs) + self.assertEqual(self.nb.index(self.child2), child2_index) + self.assertEqual(str(self.child2), self.nb.tabs()[child2_index]) + # but the tab next to it (not hidden) is the one selected now + self.assertEqual(self.nb.index('current'), curr + 1) + + + def test_forget(self): + self.assertRaises(tkinter.TclError, self.nb.forget, -1) + self.assertRaises(tkinter.TclError, self.nb.forget, 'hi') + self.assertRaises(tkinter.TclError, self.nb.forget, None) + + tabs = self.nb.tabs() + child1_index = self.nb.index(self.child1) + self.nb.forget(self.child1) + self.assertNotIn(str(self.child1), self.nb.tabs()) + self.assertEqual(len(tabs) - 1, len(self.nb.tabs())) + + self.nb.add(self.child1) + self.assertEqual(self.nb.index(self.child1), 1) + self.assertNotEqual(child1_index, self.nb.index(self.child1)) + + + def test_index(self): + self.assertRaises(tkinter.TclError, self.nb.index, -1) + self.assertRaises(tkinter.TclError, self.nb.index, None) + + self.assertIsInstance(self.nb.index('end'), int) + self.assertEqual(self.nb.index(self.child1), 0) + self.assertEqual(self.nb.index(self.child2), 1) + self.assertEqual(self.nb.index('end'), 2) + + + def test_insert(self): + # moving tabs + tabs = self.nb.tabs() + self.nb.insert(1, tabs[0]) + self.assertEqual(self.nb.tabs(), (tabs[1], tabs[0])) + self.nb.insert(self.child1, self.child2) + self.assertEqual(self.nb.tabs(), tabs) + self.nb.insert('end', self.child1) + self.assertEqual(self.nb.tabs(), (tabs[1], tabs[0])) + self.nb.insert('end', 0) + self.assertEqual(self.nb.tabs(), tabs) + # bad moves + self.assertRaises(tkinter.TclError, self.nb.insert, 2, tabs[0]) + self.assertRaises(tkinter.TclError, self.nb.insert, -1, tabs[0]) + + # new tab + child3 = ttk.Label(self.root) + self.nb.insert(1, child3) + self.assertEqual(self.nb.tabs(), (tabs[0], str(child3), tabs[1])) + self.nb.forget(child3) + self.assertEqual(self.nb.tabs(), tabs) + self.nb.insert(self.child1, child3) + self.assertEqual(self.nb.tabs(), (str(child3), ) + tabs) + self.nb.forget(child3) + self.assertRaises(tkinter.TclError, self.nb.insert, 2, child3) + self.assertRaises(tkinter.TclError, self.nb.insert, -1, child3) + + # bad inserts + self.assertRaises(tkinter.TclError, self.nb.insert, 'end', None) + self.assertRaises(tkinter.TclError, self.nb.insert, None, 0) + self.assertRaises(tkinter.TclError, self.nb.insert, None, None) + + + def test_select(self): + self.nb.pack() + self.nb.wait_visibility() + + success = [] + tab_changed = [] + + self.child1.bind('<Unmap>', lambda evt: success.append(True)) + self.nb.bind('<<NotebookTabChanged>>', + lambda evt: tab_changed.append(True)) + + self.assertEqual(self.nb.select(), str(self.child1)) + self.nb.select(self.child2) + self.assertTrue(success) + self.assertEqual(self.nb.select(), str(self.child2)) + + self.nb.update() + self.assertTrue(tab_changed) + + + def test_tab(self): + self.assertRaises(tkinter.TclError, self.nb.tab, -1) + self.assertRaises(tkinter.TclError, self.nb.tab, 'notab') + self.assertRaises(tkinter.TclError, self.nb.tab, None) + + self.assertIsInstance(self.nb.tab(self.child1), dict) + self.assertEqual(self.nb.tab(self.child1, text=None), 'a') + # newer form for querying a single option + self.assertEqual(self.nb.tab(self.child1, 'text'), 'a') + self.nb.tab(self.child1, text='abc') + self.assertEqual(self.nb.tab(self.child1, text=None), 'abc') + self.assertEqual(self.nb.tab(self.child1, 'text'), 'abc') + + + def test_tabs(self): + self.assertEqual(len(self.nb.tabs()), 2) + + self.nb.forget(self.child1) + self.nb.forget(self.child2) + + self.assertEqual(self.nb.tabs(), ()) + + + def test_traversal(self): + self.nb.pack() + self.nb.wait_visibility() + + self.nb.select(0) + + simulate_mouse_click(self.nb, 5, 5) + self.nb.focus_force() + self.nb.event_generate('<Control-Tab>') + self.assertEqual(self.nb.select(), str(self.child2)) + self.nb.focus_force() + self.nb.event_generate('<Shift-Control-Tab>') + self.assertEqual(self.nb.select(), str(self.child1)) + self.nb.focus_force() + self.nb.event_generate('<Shift-Control-Tab>') + self.assertEqual(self.nb.select(), str(self.child2)) + + self.nb.tab(self.child1, text='a', underline=0) + self.nb.enable_traversal() + self.nb.focus_force() + simulate_mouse_click(self.nb, 5, 5) + if sys.platform == 'darwin': + self.nb.event_generate('<Option-a>') + else: + self.nb.event_generate('<Alt-a>') + self.assertEqual(self.nb.select(), str(self.child1)) + + +@add_standard_options(StandardTtkOptionsTests) +class TreeviewTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'class', 'columns', 'cursor', 'displaycolumns', + 'height', 'padding', 'selectmode', 'show', + 'style', 'takefocus', 'xscrollcommand', 'yscrollcommand', + ) + + def setUp(self): + super(TreeviewTest, self).setUp() + self.tv = self.create(padding=0) + + def create(self, **kwargs): + return ttk.Treeview(self.root, **kwargs) + + def test_columns(self): + widget = self.create() + self.checkParam(widget, 'columns', 'a b c', + expected=('a', 'b', 'c')) + self.checkParam(widget, 'columns', ('a', 'b', 'c')) + self.checkParam(widget, 'columns', () if tcl_version < (8, 5) else '') + + def test_displaycolumns(self): + widget = self.create() + widget['columns'] = ('a', 'b', 'c') + self.checkParam(widget, 'displaycolumns', 'b a c', + expected=('b', 'a', 'c')) + self.checkParam(widget, 'displaycolumns', ('b', 'a', 'c')) + self.checkParam(widget, 'displaycolumns', '#all', + expected=('#all',)) + self.checkParam(widget, 'displaycolumns', (2, 1, 0)) + self.checkInvalidParam(widget, 'displaycolumns', ('a', 'b', 'd'), + errmsg='Invalid column index d') + self.checkInvalidParam(widget, 'displaycolumns', (1, 2, 3), + errmsg='Column index 3 out of bounds') + self.checkInvalidParam(widget, 'displaycolumns', (1, -2), + errmsg='Column index -2 out of bounds') + + def test_height(self): + widget = self.create() + self.checkPixelsParam(widget, 'height', 100, -100, 0, '3c', conv=False) + self.checkPixelsParam(widget, 'height', 101.2, 102.6, conv=noconv) + + def test_selectmode(self): + widget = self.create() + self.checkEnumParam(widget, 'selectmode', + 'none', 'browse', 'extended') + + def test_show(self): + widget = self.create() + self.checkParam(widget, 'show', 'tree headings', + expected=('tree', 'headings')) + self.checkParam(widget, 'show', ('tree', 'headings')) + self.checkParam(widget, 'show', ('headings', 'tree')) + self.checkParam(widget, 'show', 'tree', expected=('tree',)) + self.checkParam(widget, 'show', 'headings', expected=('headings',)) + + def test_bbox(self): + self.tv.pack() + self.assertEqual(self.tv.bbox(''), '') + self.tv.wait_visibility() + self.tv.update() + + item_id = self.tv.insert('', 'end') + children = self.tv.get_children() + self.assertTrue(children) + + bbox = self.tv.bbox(children[0]) + self.assertIsBoundingBox(bbox) + + # compare width in bboxes + self.tv['columns'] = ['test'] + self.tv.column('test', width=50) + bbox_column0 = self.tv.bbox(children[0], 0) + root_width = self.tv.column('#0', width=None) + if not self.wantobjects: + root_width = int(root_width) + self.assertEqual(bbox_column0[0], bbox[0] + root_width) + + # verify that bbox of a closed item is the empty string + child1 = self.tv.insert(item_id, 'end') + self.assertEqual(self.tv.bbox(child1), '') + + + def test_children(self): + # no children yet, should get an empty tuple + self.assertEqual(self.tv.get_children(), ()) + + item_id = self.tv.insert('', 'end') + self.assertIsInstance(self.tv.get_children(), tuple) + self.assertEqual(self.tv.get_children()[0], item_id) + + # add item_id and child3 as children of child2 + child2 = self.tv.insert('', 'end') + child3 = self.tv.insert('', 'end') + self.tv.set_children(child2, item_id, child3) + self.assertEqual(self.tv.get_children(child2), (item_id, child3)) + + # child3 has child2 as parent, thus trying to set child2 as a children + # of child3 should result in an error + self.assertRaises(tkinter.TclError, + self.tv.set_children, child3, child2) + + # remove child2 children + self.tv.set_children(child2) + self.assertEqual(self.tv.get_children(child2), ()) + + # remove root's children + self.tv.set_children('') + self.assertEqual(self.tv.get_children(), ()) + + + def test_column(self): + # return a dict with all options/values + self.assertIsInstance(self.tv.column('#0'), dict) + # return a single value of the given option + if self.wantobjects: + self.assertIsInstance(self.tv.column('#0', width=None), int) + # set a new value for an option + self.tv.column('#0', width=10) + # testing new way to get option value + self.assertEqual(self.tv.column('#0', 'width'), + 10 if self.wantobjects else '10') + self.assertEqual(self.tv.column('#0', width=None), + 10 if self.wantobjects else '10') + # check read-only option + self.assertRaises(tkinter.TclError, self.tv.column, '#0', id='X') + + self.assertRaises(tkinter.TclError, self.tv.column, 'invalid') + invalid_kws = [ + {'unknown_option': 'some value'}, {'stretch': 'wrong'}, + {'anchor': 'wrong'}, {'width': 'wrong'}, {'minwidth': 'wrong'} + ] + for kw in invalid_kws: + self.assertRaises(tkinter.TclError, self.tv.column, '#0', + **kw) + + + def test_delete(self): + self.assertRaises(tkinter.TclError, self.tv.delete, '#0') + + item_id = self.tv.insert('', 'end') + item2 = self.tv.insert(item_id, 'end') + self.assertEqual(self.tv.get_children(), (item_id, )) + self.assertEqual(self.tv.get_children(item_id), (item2, )) + + self.tv.delete(item_id) + self.assertFalse(self.tv.get_children()) + + # reattach should fail + self.assertRaises(tkinter.TclError, + self.tv.reattach, item_id, '', 'end') + + # test multiple item delete + item1 = self.tv.insert('', 'end') + item2 = self.tv.insert('', 'end') + self.assertEqual(self.tv.get_children(), (item1, item2)) + + self.tv.delete(item1, item2) + self.assertFalse(self.tv.get_children()) + + + def test_detach_reattach(self): + item_id = self.tv.insert('', 'end') + item2 = self.tv.insert(item_id, 'end') + + # calling detach without items is valid, although it does nothing + prev = self.tv.get_children() + self.tv.detach() # this should do nothing + self.assertEqual(prev, self.tv.get_children()) + + self.assertEqual(self.tv.get_children(), (item_id, )) + self.assertEqual(self.tv.get_children(item_id), (item2, )) + + # detach item with children + self.tv.detach(item_id) + self.assertFalse(self.tv.get_children()) + + # reattach item with children + self.tv.reattach(item_id, '', 'end') + self.assertEqual(self.tv.get_children(), (item_id, )) + self.assertEqual(self.tv.get_children(item_id), (item2, )) + + # move a children to the root + self.tv.move(item2, '', 'end') + self.assertEqual(self.tv.get_children(), (item_id, item2)) + self.assertEqual(self.tv.get_children(item_id), ()) + + # bad values + self.assertRaises(tkinter.TclError, + self.tv.reattach, 'nonexistent', '', 'end') + self.assertRaises(tkinter.TclError, + self.tv.detach, 'nonexistent') + self.assertRaises(tkinter.TclError, + self.tv.reattach, item2, 'otherparent', 'end') + self.assertRaises(tkinter.TclError, + self.tv.reattach, item2, '', 'invalid') + + # multiple detach + self.tv.detach(item_id, item2) + self.assertEqual(self.tv.get_children(), ()) + self.assertEqual(self.tv.get_children(item_id), ()) + + + def test_exists(self): + self.assertEqual(self.tv.exists('something'), False) + self.assertEqual(self.tv.exists(''), True) + self.assertEqual(self.tv.exists({}), False) + + # the following will make a tk.call equivalent to + # tk.call(treeview, "exists") which should result in an error + # in the tcl interpreter since tk requires an item. + self.assertRaises(tkinter.TclError, self.tv.exists, None) + + + def test_focus(self): + # nothing is focused right now + self.assertEqual(self.tv.focus(), '') + + item1 = self.tv.insert('', 'end') + self.tv.focus(item1) + self.assertEqual(self.tv.focus(), item1) + + self.tv.delete(item1) + self.assertEqual(self.tv.focus(), '') + + # try focusing inexistent item + self.assertRaises(tkinter.TclError, self.tv.focus, 'hi') + + + def test_heading(self): + # check a dict is returned + self.assertIsInstance(self.tv.heading('#0'), dict) + + # check a value is returned + self.tv.heading('#0', text='hi') + self.assertEqual(self.tv.heading('#0', 'text'), 'hi') + self.assertEqual(self.tv.heading('#0', text=None), 'hi') + + # invalid option + self.assertRaises(tkinter.TclError, self.tv.heading, '#0', + background=None) + # invalid value + self.assertRaises(tkinter.TclError, self.tv.heading, '#0', + anchor=1) + + def test_heading_callback(self): + def simulate_heading_click(x, y): + simulate_mouse_click(self.tv, x, y) + self.tv.update() + + success = [] # no success for now + + self.tv.pack() + self.tv.wait_visibility() + self.tv.heading('#0', command=lambda: success.append(True)) + self.tv.column('#0', width=100) + self.tv.update() + + # assuming that the coords (5, 5) fall into heading #0 + simulate_heading_click(5, 5) + if not success: + self.fail("The command associated to the treeview heading wasn't " + "invoked.") + + success = [] + commands = self.tv.master._tclCommands + self.tv.heading('#0', command=str(self.tv.heading('#0', command=None))) + self.assertEqual(commands, self.tv.master._tclCommands) + simulate_heading_click(5, 5) + if not success: + self.fail("The command associated to the treeview heading wasn't " + "invoked.") + + # XXX The following raises an error in a tcl interpreter, but not in + # Python + #self.tv.heading('#0', command='I dont exist') + #simulate_heading_click(5, 5) + + + def test_index(self): + # item 'what' doesn't exist + self.assertRaises(tkinter.TclError, self.tv.index, 'what') + + self.assertEqual(self.tv.index(''), 0) + + item1 = self.tv.insert('', 'end') + item2 = self.tv.insert('', 'end') + c1 = self.tv.insert(item1, 'end') + c2 = self.tv.insert(item1, 'end') + self.assertEqual(self.tv.index(item1), 0) + self.assertEqual(self.tv.index(c1), 0) + self.assertEqual(self.tv.index(c2), 1) + self.assertEqual(self.tv.index(item2), 1) + + self.tv.move(item2, '', 0) + self.assertEqual(self.tv.index(item2), 0) + self.assertEqual(self.tv.index(item1), 1) + + # check that index still works even after its parent and siblings + # have been detached + self.tv.detach(item1) + self.assertEqual(self.tv.index(c2), 1) + self.tv.detach(c1) + self.assertEqual(self.tv.index(c2), 0) + + # but it fails after item has been deleted + self.tv.delete(item1) + self.assertRaises(tkinter.TclError, self.tv.index, c2) + + + def test_insert_item(self): + # parent 'none' doesn't exist + self.assertRaises(tkinter.TclError, self.tv.insert, 'none', 'end') + + # open values + self.assertRaises(tkinter.TclError, self.tv.insert, '', 'end', + open='') + self.assertRaises(tkinter.TclError, self.tv.insert, '', 'end', + open='please') + self.assertFalse(self.tv.delete(self.tv.insert('', 'end', open=True))) + self.assertFalse(self.tv.delete(self.tv.insert('', 'end', open=False))) + + # invalid index + self.assertRaises(tkinter.TclError, self.tv.insert, '', 'middle') + + # trying to duplicate item id is invalid + itemid = self.tv.insert('', 'end', 'first-item') + self.assertEqual(itemid, 'first-item') + self.assertRaises(tkinter.TclError, self.tv.insert, '', 'end', + 'first-item') + self.assertRaises(tkinter.TclError, self.tv.insert, '', 'end', + MockTclObj('first-item')) + + # unicode values + value = u'\xe1ba' + item = self.tv.insert('', 'end', values=(value, )) + self.assertEqual(self.tv.item(item, 'values'), + (value,) if self.wantobjects else value) + self.assertEqual(self.tv.item(item, values=None), + (value,) if self.wantobjects else value) + + self.tv.item(item, values=self.root.splitlist(self.tv.item(item, values=None))) + self.assertEqual(self.tv.item(item, values=None), + (value,) if self.wantobjects else value) + + self.assertIsInstance(self.tv.item(item), dict) + + # erase item values + self.tv.item(item, values='') + self.assertFalse(self.tv.item(item, values=None)) + + # item tags + item = self.tv.insert('', 'end', tags=[1, 2, value]) + self.assertEqual(self.tv.item(item, tags=None), + ('1', '2', value) if self.wantobjects else + '1 2 %s' % value) + self.tv.item(item, tags=[]) + self.assertFalse(self.tv.item(item, tags=None)) + self.tv.item(item, tags=(1, 2)) + self.assertEqual(self.tv.item(item, tags=None), + ('1', '2') if self.wantobjects else '1 2') + + # values with spaces + item = self.tv.insert('', 'end', values=('a b c', + '%s %s' % (value, value))) + self.assertEqual(self.tv.item(item, values=None), + ('a b c', '%s %s' % (value, value)) if self.wantobjects else + '{a b c} {%s %s}' % (value, value)) + + # text + self.assertEqual(self.tv.item( + self.tv.insert('', 'end', text="Label here"), text=None), + "Label here") + self.assertEqual(self.tv.item( + self.tv.insert('', 'end', text=value), text=None), + value) + + # test for values which are not None + itemid = self.tv.insert('', 'end', 0) + self.assertEqual(itemid, '0') + itemid = self.tv.insert('', 'end', 0.0) + self.assertEqual(itemid, '0.0') + # this is because False resolves to 0 and element with 0 iid is already present + self.assertRaises(tkinter.TclError, self.tv.insert, '', 'end', False) + self.assertRaises(tkinter.TclError, self.tv.insert, '', 'end', '') + + + def test_selection(self): + # item 'none' doesn't exist + self.assertRaises(tkinter.TclError, self.tv.selection_set, 'none') + self.assertRaises(tkinter.TclError, self.tv.selection_add, 'none') + self.assertRaises(tkinter.TclError, self.tv.selection_remove, 'none') + self.assertRaises(tkinter.TclError, self.tv.selection_toggle, 'none') + + item1 = self.tv.insert('', 'end') + item2 = self.tv.insert('', 'end') + c1 = self.tv.insert(item1, 'end') + c2 = self.tv.insert(item1, 'end') + c3 = self.tv.insert(item1, 'end') + self.assertEqual(self.tv.selection(), ()) + + self.tv.selection_set((c1, item2)) + self.assertEqual(self.tv.selection(), (c1, item2)) + self.tv.selection_set(c2) + self.assertEqual(self.tv.selection(), (c2,)) + + self.tv.selection_add((c1, item2)) + self.assertEqual(self.tv.selection(), (c1, c2, item2)) + self.tv.selection_add(item1) + self.assertEqual(self.tv.selection(), (item1, c1, c2, item2)) + + self.tv.selection_remove((item1, c3)) + self.assertEqual(self.tv.selection(), (c1, c2, item2)) + self.tv.selection_remove(c2) + self.assertEqual(self.tv.selection(), (c1, item2)) + + self.tv.selection_toggle((c1, c3)) + self.assertEqual(self.tv.selection(), (c3, item2)) + self.tv.selection_toggle(item2) + self.assertEqual(self.tv.selection(), (c3,)) + + self.tv.insert('', 'end', id='with spaces') + self.tv.selection_set('with spaces') + self.assertEqual(self.tv.selection(), ('with spaces',)) + + self.tv.insert('', 'end', id='{brace') + self.tv.selection_set('{brace') + self.assertEqual(self.tv.selection(), ('{brace',)) + + if have_unicode: + self.tv.insert('', 'end', id=u(r'unicode\u20ac')) + self.tv.selection_set(u(r'unicode\u20ac')) + self.assertEqual(self.tv.selection(), (u(r'unicode\u20ac'),)) + + self.tv.insert('', 'end', id='bytes\xe2\x82\xac') + self.tv.selection_set('bytes\xe2\x82\xac') + self.assertEqual(self.tv.selection(), + (u(r'bytes\u20ac') if have_unicode else + 'bytes\xe2\x82\xac',)) + + + def test_set(self): + self.tv['columns'] = ['A', 'B'] + item = self.tv.insert('', 'end', values=['a', 'b']) + self.assertEqual(self.tv.set(item), {'A': 'a', 'B': 'b'}) + + self.tv.set(item, 'B', 'a') + self.assertEqual(self.tv.item(item, values=None), + ('a', 'a') if self.wantobjects else 'a a') + + self.tv['columns'] = ['B'] + self.assertEqual(self.tv.set(item), {'B': 'a'}) + + self.tv.set(item, 'B', 'b') + self.assertEqual(self.tv.set(item, column='B'), 'b') + self.assertEqual(self.tv.item(item, values=None), + ('b', 'a') if self.wantobjects else 'b a') + + self.tv.set(item, 'B', 123) + self.assertEqual(self.tv.set(item, 'B'), + 123 if self.wantobjects else '123') + self.assertEqual(self.tv.item(item, values=None), + (123, 'a') if self.wantobjects else '123 a') + self.assertEqual(self.tv.set(item), + {'B': 123} if self.wantobjects else {'B': '123'}) + + # inexistent column + self.assertRaises(tkinter.TclError, self.tv.set, item, 'A') + self.assertRaises(tkinter.TclError, self.tv.set, item, 'A', 'b') + + # inexistent item + self.assertRaises(tkinter.TclError, self.tv.set, 'notme') + + + def test_tag_bind(self): + events = [] + item1 = self.tv.insert('', 'end', tags=['call']) + item2 = self.tv.insert('', 'end', tags=['call']) + self.tv.tag_bind('call', '<ButtonPress-1>', + lambda evt: events.append(1)) + self.tv.tag_bind('call', '<ButtonRelease-1>', + lambda evt: events.append(2)) + + self.tv.pack() + self.tv.wait_visibility() + self.tv.update() + + pos_y = set() + found = set() + for i in range(0, 100, 10): + if len(found) == 2: # item1 and item2 already found + break + item_id = self.tv.identify_row(i) + if item_id and item_id not in found: + pos_y.add(i) + found.add(item_id) + + self.assertEqual(len(pos_y), 2) # item1 and item2 y pos + for y in pos_y: + simulate_mouse_click(self.tv, 0, y) + + # by now there should be 4 things in the events list, since each + # item had a bind for two events that were simulated above + self.assertEqual(len(events), 4) + for evt in zip(events[::2], events[1::2]): + self.assertEqual(evt, (1, 2)) + + + def test_tag_configure(self): + # Just testing parameter passing for now + self.assertRaises(TypeError, self.tv.tag_configure) + self.assertRaises(tkinter.TclError, self.tv.tag_configure, + 'test', sky='blue') + self.tv.tag_configure('test', foreground='blue') + self.assertEqual(str(self.tv.tag_configure('test', 'foreground')), + 'blue') + self.assertEqual(str(self.tv.tag_configure('test', foreground=None)), + 'blue') + self.assertIsInstance(self.tv.tag_configure('test'), dict) + + def test_tag_has(self): + item1 = self.tv.insert('', 'end', text='Item 1', tags=['tag1']) + item2 = self.tv.insert('', 'end', text='Item 2', tags=['tag2']) + self.assertRaises(TypeError, self.tv.tag_has) + self.assertRaises(TclError, self.tv.tag_has, 'tag1', 'non-existing') + self.assertTrue(self.tv.tag_has('tag1', item1)) + self.assertFalse(self.tv.tag_has('tag1', item2)) + self.assertFalse(self.tv.tag_has('tag2', item1)) + self.assertTrue(self.tv.tag_has('tag2', item2)) + self.assertFalse(self.tv.tag_has('tag3', item1)) + self.assertFalse(self.tv.tag_has('tag3', item2)) + self.assertEqual(self.tv.tag_has('tag1'), (item1,)) + self.assertEqual(self.tv.tag_has('tag2'), (item2,)) + self.assertEqual(self.tv.tag_has('tag3'), ()) + + +@add_standard_options(StandardTtkOptionsTests) +class SeparatorTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'class', 'cursor', 'orient', 'style', 'takefocus', + # 'state'? + ) + default_orient = 'horizontal' + + def create(self, **kwargs): + return ttk.Separator(self.root, **kwargs) + + +@add_standard_options(StandardTtkOptionsTests) +class SizegripTest(AbstractWidgetTest, unittest.TestCase): + OPTIONS = ( + 'class', 'cursor', 'style', 'takefocus', + # 'state'? + ) + + def create(self, **kwargs): + return ttk.Sizegrip(self.root, **kwargs) + + +tests_gui = ( + ButtonTest, CheckbuttonTest, ComboboxTest, EntryTest, + FrameTest, LabelFrameTest, LabelTest, MenubuttonTest, + NotebookTest, PanedWindowTest, ProgressbarTest, + RadiobuttonTest, ScaleTest, ScrollbarTest, SeparatorTest, + SizegripTest, TreeviewTest, WidgetTest, + ) + +tests_gui = ( + TreeviewTest, + ) + +if __name__ == "__main__": + run_unittest(*tests_gui) diff --git a/contrib/tools/python/src/Lib/lib-tk/test/widget_tests.py b/contrib/tools/python/src/Lib/lib-tk/test/widget_tests.py new file mode 100644 index 0000000000..33f716fc4e --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/test/widget_tests.py @@ -0,0 +1,566 @@ +# Common tests for test_tkinter/test_widgets.py and test_ttk/test_widgets.py + +import unittest +import sys +import Tkinter as tkinter +from ttk import Scale +from test_ttk.support import (AbstractTkTest, tcl_version, requires_tcl, + get_tk_patchlevel, pixels_conv, tcl_obj_eq) +import test.test_support + + +noconv = noconv_meth = False +if get_tk_patchlevel() < (8, 5, 11): + noconv = str +noconv_meth = noconv and staticmethod(noconv) + +def int_round(x): + return int(round(x)) + +pixels_round = int_round +if get_tk_patchlevel()[:3] == (8, 5, 11): + # Issue #19085: Workaround a bug in Tk + # http://core.tcl.tk/tk/info/3497848 + pixels_round = int + + +_sentinel = object() + +class AbstractWidgetTest(AbstractTkTest): + _conv_pixels = staticmethod(pixels_round) + _conv_pad_pixels = None + _stringify = False + + @property + def scaling(self): + try: + return self._scaling + except AttributeError: + self._scaling = float(self.root.call('tk', 'scaling')) + return self._scaling + + def _str(self, value): + if not self._stringify and self.wantobjects and tcl_version >= (8, 6): + return value + if isinstance(value, tuple): + return ' '.join(map(self._str, value)) + return str(value) + + def assertEqual2(self, actual, expected, msg=None, eq=object.__eq__): + if eq(actual, expected): + return + self.assertEqual(actual, expected, msg) + + def checkParam(self, widget, name, value, expected=_sentinel, + conv=False, eq=None): + widget[name] = value + if expected is _sentinel: + expected = value + if conv: + expected = conv(expected) + if self._stringify or not self.wantobjects: + if isinstance(expected, tuple): + expected = tkinter._join(expected) + else: + expected = str(expected) + if eq is None: + eq = tcl_obj_eq + self.assertEqual2(widget[name], expected, eq=eq) + self.assertEqual2(widget.cget(name), expected, eq=eq) + # XXX + if not isinstance(widget, Scale): + t = widget.configure(name) + self.assertEqual(len(t), 5) + self.assertEqual2(t[4], expected, eq=eq) + + def checkInvalidParam(self, widget, name, value, errmsg=None, + keep_orig=True): + orig = widget[name] + if errmsg is not None: + errmsg = errmsg.format(value) + with self.assertRaises(tkinter.TclError) as cm: + widget[name] = value + if errmsg is not None: + self.assertEqual(str(cm.exception), errmsg) + if keep_orig: + self.assertEqual(widget[name], orig) + else: + widget[name] = orig + with self.assertRaises(tkinter.TclError) as cm: + widget.configure({name: value}) + if errmsg is not None: + self.assertEqual(str(cm.exception), errmsg) + if keep_orig: + self.assertEqual(widget[name], orig) + else: + widget[name] = orig + + def checkParams(self, widget, name, *values, **kwargs): + for value in values: + self.checkParam(widget, name, value, **kwargs) + + def checkIntegerParam(self, widget, name, *values, **kwargs): + self.checkParams(widget, name, *values, **kwargs) + self.checkInvalidParam(widget, name, '', + errmsg='expected integer but got ""') + self.checkInvalidParam(widget, name, '10p', + errmsg='expected integer but got "10p"') + self.checkInvalidParam(widget, name, 3.2, + errmsg='expected integer but got "3.2"') + + def checkFloatParam(self, widget, name, *values, **kwargs): + if 'conv' in kwargs: + conv = kwargs.pop('conv') + else: + conv = float + for value in values: + self.checkParam(widget, name, value, conv=conv, **kwargs) + self.checkInvalidParam(widget, name, '', + errmsg='expected floating-point number but got ""') + self.checkInvalidParam(widget, name, 'spam', + errmsg='expected floating-point number but got "spam"') + + def checkBooleanParam(self, widget, name): + for value in (False, 0, 'false', 'no', 'off'): + self.checkParam(widget, name, value, expected=0) + for value in (True, 1, 'true', 'yes', 'on'): + self.checkParam(widget, name, value, expected=1) + self.checkInvalidParam(widget, name, '', + errmsg='expected boolean value but got ""') + self.checkInvalidParam(widget, name, 'spam', + errmsg='expected boolean value but got "spam"') + + def checkColorParam(self, widget, name, allow_empty=None, **kwargs): + self.checkParams(widget, name, + '#ff0000', '#00ff00', '#0000ff', '#123456', + 'red', 'green', 'blue', 'white', 'black', 'grey', + **kwargs) + self.checkInvalidParam(widget, name, 'spam', + errmsg='unknown color name "spam"') + + def checkCursorParam(self, widget, name, **kwargs): + self.checkParams(widget, name, 'arrow', 'watch', 'cross', '',**kwargs) + if tcl_version >= (8, 5): + self.checkParam(widget, name, 'none') + self.checkInvalidParam(widget, name, 'spam', + errmsg='bad cursor spec "spam"') + + def checkCommandParam(self, widget, name): + def command(*args): + pass + widget[name] = command + self.assertTrue(widget[name]) + self.checkParams(widget, name, '') + + def checkEnumParam(self, widget, name, *values, **kwargs): + if 'errmsg' in kwargs: + errmsg = kwargs.pop('errmsg') + else: + errmsg = None + self.checkParams(widget, name, *values, **kwargs) + if errmsg is None: + errmsg2 = ' %s "{}": must be %s%s or %s' % ( + name, + ', '.join(values[:-1]), + ',' if len(values) > 2 else '', + values[-1]) + self.checkInvalidParam(widget, name, '', + errmsg='ambiguous' + errmsg2) + errmsg = 'bad' + errmsg2 + self.checkInvalidParam(widget, name, 'spam', errmsg=errmsg) + + def checkPixelsParam(self, widget, name, *values, **kwargs): + if 'conv' in kwargs: + conv = kwargs.pop('conv') + else: + conv = None + if conv is None: + conv = self._conv_pixels + if 'keep_orig' in kwargs: + keep_orig = kwargs.pop('keep_orig') + else: + keep_orig = True + for value in values: + expected = _sentinel + conv1 = conv + if isinstance(value, str): + if conv1 and conv1 is not str: + expected = pixels_conv(value) * self.scaling + conv1 = int_round + self.checkParam(widget, name, value, expected=expected, + conv=conv1, **kwargs) + self.checkInvalidParam(widget, name, '6x', + errmsg='bad screen distance "6x"', keep_orig=keep_orig) + self.checkInvalidParam(widget, name, 'spam', + errmsg='bad screen distance "spam"', keep_orig=keep_orig) + + def checkReliefParam(self, widget, name): + self.checkParams(widget, name, + 'flat', 'groove', 'raised', 'ridge', 'solid', 'sunken') + errmsg='bad relief "spam": must be '\ + 'flat, groove, raised, ridge, solid, or sunken' + if tcl_version < (8, 6): + errmsg = None + self.checkInvalidParam(widget, name, 'spam', + errmsg=errmsg) + + def checkImageParam(self, widget, name): + image = tkinter.PhotoImage(master=self.root, name='image1') + self.checkParam(widget, name, image, conv=str) + self.checkInvalidParam(widget, name, 'spam', + errmsg='image "spam" doesn\'t exist') + widget[name] = '' + + def checkVariableParam(self, widget, name, var): + self.checkParam(widget, name, var, conv=str) + + def assertIsBoundingBox(self, bbox): + self.assertIsNotNone(bbox) + self.assertIsInstance(bbox, tuple) + if len(bbox) != 4: + self.fail('Invalid bounding box: %r' % (bbox,)) + for item in bbox: + if not isinstance(item, int): + self.fail('Invalid bounding box: %r' % (bbox,)) + break + + def test_keys(self): + widget = self.create() + keys = widget.keys() + # XXX + if not isinstance(widget, Scale): + self.assertEqual(sorted(keys), sorted(widget.configure())) + for k in keys: + widget[k] + # Test if OPTIONS contains all keys + if test.test_support.verbose: + aliases = { + 'bd': 'borderwidth', + 'bg': 'background', + 'fg': 'foreground', + 'invcmd': 'invalidcommand', + 'vcmd': 'validatecommand', + } + keys = set(keys) + expected = set(self.OPTIONS) + for k in sorted(keys - expected): + if not (k in aliases and + aliases[k] in keys and + aliases[k] in expected): + print('%s.OPTIONS doesn\'t contain "%s"' % + (self.__class__.__name__, k)) + + +class StandardOptionsTests(object): + STANDARD_OPTIONS = ( + 'activebackground', 'activeborderwidth', 'activeforeground', 'anchor', + 'background', 'bitmap', 'borderwidth', 'compound', 'cursor', + 'disabledforeground', 'exportselection', 'font', 'foreground', + 'highlightbackground', 'highlightcolor', 'highlightthickness', + 'image', 'insertbackground', 'insertborderwidth', + 'insertofftime', 'insertontime', 'insertwidth', + 'jump', 'justify', 'orient', 'padx', 'pady', 'relief', + 'repeatdelay', 'repeatinterval', + 'selectbackground', 'selectborderwidth', 'selectforeground', + 'setgrid', 'takefocus', 'text', 'textvariable', 'troughcolor', + 'underline', 'wraplength', 'xscrollcommand', 'yscrollcommand', + ) + + def test_activebackground(self): + widget = self.create() + self.checkColorParam(widget, 'activebackground') + + def test_activeborderwidth(self): + widget = self.create() + self.checkPixelsParam(widget, 'activeborderwidth', + 0, 1.3, 2.9, 6, -2, '10p') + + def test_activeforeground(self): + widget = self.create() + self.checkColorParam(widget, 'activeforeground') + + def test_anchor(self): + widget = self.create() + self.checkEnumParam(widget, 'anchor', + 'n', 'ne', 'e', 'se', 's', 'sw', 'w', 'nw', 'center') + + def test_background(self): + widget = self.create() + self.checkColorParam(widget, 'background') + if 'bg' in self.OPTIONS: + self.checkColorParam(widget, 'bg') + + def test_bitmap(self): + widget = self.create() + self.checkParam(widget, 'bitmap', 'questhead') + self.checkParam(widget, 'bitmap', 'gray50') + filename = test.test_support.findfile('python.xbm', subdir='imghdrdata') + self.checkParam(widget, 'bitmap', '@' + filename) + # Cocoa Tk widgets don't detect invalid -bitmap values + # See https://core.tcl.tk/tk/info/31cd33dbf0 + if not ('aqua' in self.root.tk.call('tk', 'windowingsystem') and + 'AppKit' in self.root.winfo_server()): + self.checkInvalidParam(widget, 'bitmap', 'spam', + errmsg='bitmap "spam" not defined') + + def test_borderwidth(self): + widget = self.create() + self.checkPixelsParam(widget, 'borderwidth', + 0, 1.3, 2.6, 6, -2, '10p') + if 'bd' in self.OPTIONS: + self.checkPixelsParam(widget, 'bd', 0, 1.3, 2.6, 6, -2, '10p') + + def test_compound(self): + widget = self.create() + self.checkEnumParam(widget, 'compound', + 'bottom', 'center', 'left', 'none', 'right', 'top') + + def test_cursor(self): + widget = self.create() + self.checkCursorParam(widget, 'cursor') + + def test_disabledforeground(self): + widget = self.create() + self.checkColorParam(widget, 'disabledforeground') + + def test_exportselection(self): + widget = self.create() + self.checkBooleanParam(widget, 'exportselection') + + def test_font(self): + widget = self.create() + self.checkParam(widget, 'font', + '-Adobe-Helvetica-Medium-R-Normal--*-120-*-*-*-*-*-*') + self.checkInvalidParam(widget, 'font', '', + errmsg='font "" doesn\'t exist') + + def test_foreground(self): + widget = self.create() + self.checkColorParam(widget, 'foreground') + if 'fg' in self.OPTIONS: + self.checkColorParam(widget, 'fg') + + def test_highlightbackground(self): + widget = self.create() + self.checkColorParam(widget, 'highlightbackground') + + def test_highlightcolor(self): + widget = self.create() + self.checkColorParam(widget, 'highlightcolor') + + def test_highlightthickness(self): + widget = self.create() + self.checkPixelsParam(widget, 'highlightthickness', + 0, 1.3, 2.6, 6, '10p') + self.checkParam(widget, 'highlightthickness', -2, expected=0, + conv=self._conv_pixels) + + @unittest.skipIf(sys.platform == 'darwin', + 'crashes with Cocoa Tk (issue19733)') + def test_image(self): + widget = self.create() + self.checkImageParam(widget, 'image') + + def test_insertbackground(self): + widget = self.create() + self.checkColorParam(widget, 'insertbackground') + + def test_insertborderwidth(self): + widget = self.create() + self.checkPixelsParam(widget, 'insertborderwidth', + 0, 1.3, 2.6, 6, -2, '10p') + + def test_insertofftime(self): + widget = self.create() + self.checkIntegerParam(widget, 'insertofftime', 100) + + def test_insertontime(self): + widget = self.create() + self.checkIntegerParam(widget, 'insertontime', 100) + + def test_insertwidth(self): + widget = self.create() + self.checkPixelsParam(widget, 'insertwidth', 1.3, 2.6, -2, '10p') + + def test_jump(self): + widget = self.create() + self.checkBooleanParam(widget, 'jump') + + def test_justify(self): + widget = self.create() + self.checkEnumParam(widget, 'justify', 'left', 'right', 'center', + errmsg='bad justification "{}": must be ' + 'left, right, or center') + self.checkInvalidParam(widget, 'justify', '', + errmsg='ambiguous justification "": must be ' + 'left, right, or center') + + def test_orient(self): + widget = self.create() + self.assertEqual(str(widget['orient']), self.default_orient) + self.checkEnumParam(widget, 'orient', 'horizontal', 'vertical') + + def test_padx(self): + widget = self.create() + self.checkPixelsParam(widget, 'padx', 3, 4.4, 5.6, -2, '12m', + conv=self._conv_pad_pixels) + + def test_pady(self): + widget = self.create() + self.checkPixelsParam(widget, 'pady', 3, 4.4, 5.6, -2, '12m', + conv=self._conv_pad_pixels) + + def test_relief(self): + widget = self.create() + self.checkReliefParam(widget, 'relief') + + def test_repeatdelay(self): + widget = self.create() + self.checkIntegerParam(widget, 'repeatdelay', -500, 500) + + def test_repeatinterval(self): + widget = self.create() + self.checkIntegerParam(widget, 'repeatinterval', -500, 500) + + def test_selectbackground(self): + widget = self.create() + self.checkColorParam(widget, 'selectbackground') + + def test_selectborderwidth(self): + widget = self.create() + self.checkPixelsParam(widget, 'selectborderwidth', 1.3, 2.6, -2, '10p') + + def test_selectforeground(self): + widget = self.create() + self.checkColorParam(widget, 'selectforeground') + + def test_setgrid(self): + widget = self.create() + self.checkBooleanParam(widget, 'setgrid') + + def test_state(self): + widget = self.create() + self.checkEnumParam(widget, 'state', 'active', 'disabled', 'normal') + + def test_takefocus(self): + widget = self.create() + self.checkParams(widget, 'takefocus', '0', '1', '') + + def test_text(self): + widget = self.create() + self.checkParams(widget, 'text', '', 'any string') + + def test_textvariable(self): + widget = self.create() + var = tkinter.StringVar(self.root) + self.checkVariableParam(widget, 'textvariable', var) + + def test_troughcolor(self): + widget = self.create() + self.checkColorParam(widget, 'troughcolor') + + def test_underline(self): + widget = self.create() + self.checkIntegerParam(widget, 'underline', 0, 1, 10) + + def test_wraplength(self): + widget = self.create() + self.checkPixelsParam(widget, 'wraplength', 100) + + def test_xscrollcommand(self): + widget = self.create() + self.checkCommandParam(widget, 'xscrollcommand') + + def test_yscrollcommand(self): + widget = self.create() + self.checkCommandParam(widget, 'yscrollcommand') + + # non-standard but common options + + def test_command(self): + widget = self.create() + self.checkCommandParam(widget, 'command') + + def test_indicatoron(self): + widget = self.create() + self.checkBooleanParam(widget, 'indicatoron') + + def test_offrelief(self): + widget = self.create() + self.checkReliefParam(widget, 'offrelief') + + def test_overrelief(self): + widget = self.create() + self.checkReliefParam(widget, 'overrelief') + + def test_selectcolor(self): + widget = self.create() + self.checkColorParam(widget, 'selectcolor') + + def test_selectimage(self): + widget = self.create() + self.checkImageParam(widget, 'selectimage') + + @requires_tcl(8, 5) + def test_tristateimage(self): + widget = self.create() + self.checkImageParam(widget, 'tristateimage') + + @requires_tcl(8, 5) + def test_tristatevalue(self): + widget = self.create() + self.checkParam(widget, 'tristatevalue', 'unknowable') + + def test_variable(self): + widget = self.create() + var = tkinter.DoubleVar(self.root) + self.checkVariableParam(widget, 'variable', var) + + +class IntegerSizeTests(object): + def test_height(self): + widget = self.create() + self.checkIntegerParam(widget, 'height', 100, -100, 0) + + def test_width(self): + widget = self.create() + self.checkIntegerParam(widget, 'width', 402, -402, 0) + + +class PixelSizeTests(object): + def test_height(self): + widget = self.create() + self.checkPixelsParam(widget, 'height', 100, 101.2, 102.6, -100, 0, '3c') + + def test_width(self): + widget = self.create() + self.checkPixelsParam(widget, 'width', 402, 403.4, 404.6, -402, 0, '5i') + + +def add_standard_options(*source_classes): + # This decorator adds test_xxx methods from source classes for every xxx + # option in the OPTIONS class attribute if they are not defined explicitly. + def decorator(cls): + for option in cls.OPTIONS: + methodname = 'test_' + option + if not hasattr(cls, methodname): + for source_class in source_classes: + if hasattr(source_class, methodname): + setattr(cls, methodname, + getattr(source_class, methodname).im_func) + break + else: + def test(self, option=option): + widget = self.create() + widget[option] + raise AssertionError('Option "%s" is not tested in %s' % + (option, cls.__name__)) + test.__name__ = methodname + setattr(cls, methodname, test) + return cls + return decorator + +def setUpModule(): + if test.test_support.verbose: + tcl = tkinter.Tcl() + print 'patchlevel =', tcl.call('info', 'patchlevel') diff --git a/contrib/tools/python/src/Lib/lib-tk/tkColorChooser.py b/contrib/tools/python/src/Lib/lib-tk/tkColorChooser.py new file mode 100644 index 0000000000..b65b47d478 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/tkColorChooser.py @@ -0,0 +1,72 @@ +# tk common color chooser dialogue +# +# this module provides an interface to the native color dialogue +# available in Tk 4.2 and newer. +# +# written by Fredrik Lundh, May 1997 +# +# fixed initialcolor handling in August 1998 +# + +# +# options (all have default values): +# +# - initialcolor: color to mark as selected when dialog is displayed +# (given as an RGB triplet or a Tk color string) +# +# - parent: which window to place the dialog on top of +# +# - title: dialog title +# + +from tkCommonDialog import Dialog + + +# +# color chooser class + +class Chooser(Dialog): + "Ask for a color" + + command = "tk_chooseColor" + + def _fixoptions(self): + try: + # make sure initialcolor is a tk color string + color = self.options["initialcolor"] + if isinstance(color, tuple): + # assume an RGB triplet + self.options["initialcolor"] = "#%02x%02x%02x" % color + except KeyError: + pass + + def _fixresult(self, widget, result): + # result can be somethings: an empty tuple, an empty string or + # a Tcl_Obj, so this somewhat weird check handles that + if not result or not str(result): + return None, None # canceled + + # to simplify application code, the color chooser returns + # an RGB tuple together with the Tk color string + r, g, b = widget.winfo_rgb(result) + return (r/256, g/256, b/256), str(result) + + +# +# convenience stuff + +def askcolor(color = None, **options): + "Ask for a color" + + if color: + options = options.copy() + options["initialcolor"] = color + + return Chooser(**options).show() + + +# -------------------------------------------------------------------- +# test stuff + +if __name__ == "__main__": + print "color", askcolor() diff --git a/contrib/tools/python/src/Lib/lib-tk/tkCommonDialog.py b/contrib/tools/python/src/Lib/lib-tk/tkCommonDialog.py new file mode 100644 index 0000000000..2cd9be4eac --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/tkCommonDialog.py @@ -0,0 +1,60 @@ +# base class for tk common dialogues +# +# this module provides a base class for accessing the common +# dialogues available in Tk 4.2 and newer. use tkFileDialog, +# tkColorChooser, and tkMessageBox to access the individual +# dialogs. +# +# written by Fredrik Lundh, May 1997 +# + +from Tkinter import * + +class Dialog: + + command = None + + def __init__(self, master=None, **options): + + # FIXME: should this be placed on the module level instead? + if TkVersion < 4.2: + raise TclError, "this module requires Tk 4.2 or newer" + + self.master = master + self.options = options + if not master and options.get('parent'): + self.master = options['parent'] + + def _fixoptions(self): + pass # hook + + def _fixresult(self, widget, result): + return result # hook + + def show(self, **options): + + # update instance options + for k, v in options.items(): + self.options[k] = v + + self._fixoptions() + + # we need a dummy widget to properly process the options + # (at least as long as we use Tkinter 1.63) + w = Frame(self.master) + + try: + + s = w.tk.call(self.command, *w._options(self.options)) + + s = self._fixresult(w, s) + + finally: + + try: + # get rid of the widget + w.destroy() + except: + pass + + return s diff --git a/contrib/tools/python/src/Lib/lib-tk/tkFileDialog.py b/contrib/tools/python/src/Lib/lib-tk/tkFileDialog.py new file mode 100644 index 0000000000..15c7d5f606 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/tkFileDialog.py @@ -0,0 +1,215 @@ +# +# Instant Python +# $Id: tkFileDialog.py 36560 2004-07-18 06:16:08Z tim_one $ +# +# tk common file dialogues +# +# this module provides interfaces to the native file dialogues +# available in Tk 4.2 and newer, and the directory dialogue available +# in Tk 8.3 and newer. +# +# written by Fredrik Lundh, May 1997. +# + +# +# options (all have default values): +# +# - defaultextension: added to filename if not explicitly given +# +# - filetypes: sequence of (label, pattern) tuples. the same pattern +# may occur with several patterns. use "*" as pattern to indicate +# all files. +# +# - initialdir: initial directory. preserved by dialog instance. +# +# - initialfile: initial file (ignored by the open dialog). preserved +# by dialog instance. +# +# - parent: which window to place the dialog on top of +# +# - title: dialog title +# +# - multiple: if true user may select more than one file +# +# options for the directory chooser: +# +# - initialdir, parent, title: see above +# +# - mustexist: if true, user must pick an existing directory +# +# + + +from tkCommonDialog import Dialog + +class _Dialog(Dialog): + + def _fixoptions(self): + try: + # make sure "filetypes" is a tuple + self.options["filetypes"] = tuple(self.options["filetypes"]) + except KeyError: + pass + + def _fixresult(self, widget, result): + if result: + # keep directory and filename until next time + import os + # convert Tcl path objects to strings + try: + result = result.string + except AttributeError: + # it already is a string + pass + path, file = os.path.split(result) + self.options["initialdir"] = path + self.options["initialfile"] = file + self.filename = result # compatibility + return result + + +# +# file dialogs + +class Open(_Dialog): + "Ask for a filename to open" + + command = "tk_getOpenFile" + + def _fixresult(self, widget, result): + if isinstance(result, tuple): + # multiple results: + result = tuple([getattr(r, "string", r) for r in result]) + if result: + import os + path, file = os.path.split(result[0]) + self.options["initialdir"] = path + # don't set initialfile or filename, as we have multiple of these + return result + if not widget.tk.wantobjects() and "multiple" in self.options: + # Need to split result explicitly + return self._fixresult(widget, widget.tk.splitlist(result)) + return _Dialog._fixresult(self, widget, result) + +class SaveAs(_Dialog): + "Ask for a filename to save as" + + command = "tk_getSaveFile" + + +# the directory dialog has its own _fix routines. +class Directory(Dialog): + "Ask for a directory" + + command = "tk_chooseDirectory" + + def _fixresult(self, widget, result): + if result: + # convert Tcl path objects to strings + try: + result = result.string + except AttributeError: + # it already is a string + pass + # keep directory until next time + self.options["initialdir"] = result + self.directory = result # compatibility + return result + +# +# convenience stuff + +def askopenfilename(**options): + "Ask for a filename to open" + + return Open(**options).show() + +def asksaveasfilename(**options): + "Ask for a filename to save as" + + return SaveAs(**options).show() + +def askopenfilenames(**options): + """Ask for multiple filenames to open + + Returns a list of filenames or empty list if + cancel button selected + """ + options["multiple"]=1 + return Open(**options).show() + +# FIXME: are the following perhaps a bit too convenient? + +def askopenfile(mode = "r", **options): + "Ask for a filename to open, and returned the opened file" + + filename = Open(**options).show() + if filename: + return open(filename, mode) + return None + +def askopenfiles(mode = "r", **options): + """Ask for multiple filenames and return the open file + objects + + returns a list of open file objects or an empty list if + cancel selected + """ + + files = askopenfilenames(**options) + if files: + ofiles=[] + for filename in files: + ofiles.append(open(filename, mode)) + files=ofiles + return files + + +def asksaveasfile(mode = "w", **options): + "Ask for a filename to save as, and returned the opened file" + + filename = SaveAs(**options).show() + if filename: + return open(filename, mode) + return None + +def askdirectory (**options): + "Ask for a directory, and return the file name" + return Directory(**options).show() + +# -------------------------------------------------------------------- +# test stuff + +if __name__ == "__main__": + # Since the file name may contain non-ASCII characters, we need + # to find an encoding that likely supports the file name, and + # displays correctly on the terminal. + + # Start off with UTF-8 + enc = "utf-8" + import sys + + # See whether CODESET is defined + try: + import locale + locale.setlocale(locale.LC_ALL,'') + enc = locale.nl_langinfo(locale.CODESET) + except (ImportError, AttributeError): + pass + + # dialog for openening files + + openfilename=askopenfilename(filetypes=[("all files", "*")]) + try: + fp=open(openfilename,"r") + fp.close() + except: + print "Could not open File: " + print sys.exc_info()[1] + + print "open", openfilename.encode(enc) + + # dialog for saving files + + saveasfilename=asksaveasfilename() + print "saveas", saveasfilename.encode(enc) diff --git a/contrib/tools/python/src/Lib/lib-tk/tkFont.py b/contrib/tools/python/src/Lib/lib-tk/tkFont.py new file mode 100644 index 0000000000..b245623e30 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/tkFont.py @@ -0,0 +1,218 @@ +# Tkinter font wrapper +# +# written by Fredrik Lundh, February 1998 +# +# FIXME: should add 'displayof' option where relevant (actual, families, +# measure, and metrics) +# + +__version__ = "0.9" + +import Tkinter + +# weight/slant +NORMAL = "normal" +ROMAN = "roman" +BOLD = "bold" +ITALIC = "italic" + +def nametofont(name): + """Given the name of a tk named font, returns a Font representation. + """ + return Font(name=name, exists=True) + +class Font: + + """Represents a named font. + + Constructor options are: + + font -- font specifier (name, system font, or (family, size, style)-tuple) + name -- name to use for this font configuration (defaults to a unique name) + exists -- does a named font by this name already exist? + Creates a new named font if False, points to the existing font if True. + Raises _Tkinter.TclError if the assertion is false. + + the following are ignored if font is specified: + + family -- font 'family', e.g. Courier, Times, Helvetica + size -- font size in points + weight -- font thickness: NORMAL, BOLD + slant -- font slant: ROMAN, ITALIC + underline -- font underlining: false (0), true (1) + overstrike -- font strikeout: false (0), true (1) + + """ + + def _set(self, kw): + options = [] + for k, v in kw.items(): + if not isinstance(v, basestring): + v = str(v) + options.append("-"+k) + options.append(v) + return tuple(options) + + def _get(self, args): + options = [] + for k in args: + options.append("-"+k) + return tuple(options) + + def _mkdict(self, args): + options = {} + for i in range(0, len(args), 2): + options[args[i][1:]] = args[i+1] + return options + + def __init__(self, root=None, font=None, name=None, exists=False, **options): + if not root: + root = Tkinter._default_root + tk = getattr(root, 'tk', root) + if font: + # get actual settings corresponding to the given font + font = tk.splitlist(tk.call("font", "actual", font)) + else: + font = self._set(options) + if not name: + name = "font" + str(id(self)) + self.name = name + + if exists: + self.delete_font = False + # confirm font exists + if self.name not in tk.splitlist(tk.call("font", "names")): + raise Tkinter._tkinter.TclError, "named font %s does not already exist" % (self.name,) + # if font config info supplied, apply it + if font: + tk.call("font", "configure", self.name, *font) + else: + # create new font (raises TclError if the font exists) + tk.call("font", "create", self.name, *font) + self.delete_font = True + self._tk = tk + self._split = tk.splitlist + self._call = tk.call + + def __str__(self): + return self.name + + def __eq__(self, other): + return isinstance(other, Font) and self.name == other.name + + def __getitem__(self, key): + return self.cget(key) + + def __setitem__(self, key, value): + self.configure(**{key: value}) + + def __del__(self): + try: + if self.delete_font: + self._call("font", "delete", self.name) + except (KeyboardInterrupt, SystemExit): + raise + except Exception: + pass + + def copy(self): + "Return a distinct copy of the current font" + return Font(self._tk, **self.actual()) + + def actual(self, option=None): + "Return actual font attributes" + if option: + return self._call("font", "actual", self.name, "-"+option) + else: + return self._mkdict( + self._split(self._call("font", "actual", self.name)) + ) + + def cget(self, option): + "Get font attribute" + return self._call("font", "config", self.name, "-"+option) + + def config(self, **options): + "Modify font attributes" + if options: + self._call("font", "config", self.name, + *self._set(options)) + else: + return self._mkdict( + self._split(self._call("font", "config", self.name)) + ) + + configure = config + + def measure(self, text): + "Return text width" + return int(self._call("font", "measure", self.name, text)) + + def metrics(self, *options): + """Return font metrics. + + For best performance, create a dummy widget + using this font before calling this method.""" + + if options: + return int( + self._call("font", "metrics", self.name, self._get(options)) + ) + else: + res = self._split(self._call("font", "metrics", self.name)) + options = {} + for i in range(0, len(res), 2): + options[res[i][1:]] = int(res[i+1]) + return options + +def families(root=None): + "Get font families (as a tuple)" + if not root: + root = Tkinter._default_root + return root.tk.splitlist(root.tk.call("font", "families")) + +def names(root=None): + "Get names of defined fonts (as a tuple)" + if not root: + root = Tkinter._default_root + return root.tk.splitlist(root.tk.call("font", "names")) + +# -------------------------------------------------------------------- +# test stuff + +if __name__ == "__main__": + + root = Tkinter.Tk() + + # create a font + f = Font(family="times", size=30, weight=NORMAL) + + print f.actual() + print f.actual("family") + print f.actual("weight") + + print f.config() + print f.cget("family") + print f.cget("weight") + + print names() + + print f.measure("hello"), f.metrics("linespace") + + print f.metrics() + + f = Font(font=("Courier", 20, "bold")) + print f.measure("hello"), f.metrics("linespace") + + w = Tkinter.Label(root, text="Hello, world", font=f) + w.pack() + + w = Tkinter.Button(root, text="Quit!", command=root.destroy) + w.pack() + + fb = Font(font=w["font"]).copy() + fb.config(weight=BOLD) + + w.config(font=fb) + + Tkinter.mainloop() diff --git a/contrib/tools/python/src/Lib/lib-tk/tkMessageBox.py b/contrib/tools/python/src/Lib/lib-tk/tkMessageBox.py new file mode 100644 index 0000000000..9ee923576f --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/tkMessageBox.py @@ -0,0 +1,134 @@ +# tk common message boxes +# +# this module provides an interface to the native message boxes +# available in Tk 4.2 and newer. +# +# written by Fredrik Lundh, May 1997 +# + +# +# options (all have default values): +# +# - default: which button to make default (one of the reply codes) +# +# - icon: which icon to display (see below) +# +# - message: the message to display +# +# - parent: which window to place the dialog on top of +# +# - title: dialog title +# +# - type: dialog type; that is, which buttons to display (see below) +# + +from tkCommonDialog import Dialog + +# +# constants + +# icons +ERROR = "error" +INFO = "info" +QUESTION = "question" +WARNING = "warning" + +# types +ABORTRETRYIGNORE = "abortretryignore" +OK = "ok" +OKCANCEL = "okcancel" +RETRYCANCEL = "retrycancel" +YESNO = "yesno" +YESNOCANCEL = "yesnocancel" + +# replies +ABORT = "abort" +RETRY = "retry" +IGNORE = "ignore" +OK = "ok" +CANCEL = "cancel" +YES = "yes" +NO = "no" + + +# +# message dialog class + +class Message(Dialog): + "A message box" + + command = "tk_messageBox" + + +# +# convenience stuff + +# Rename _icon and _type options to allow overriding them in options +def _show(title=None, message=None, _icon=None, _type=None, **options): + if _icon and "icon" not in options: options["icon"] = _icon + if _type and "type" not in options: options["type"] = _type + if title: options["title"] = title + if message: options["message"] = message + res = Message(**options).show() + # In some Tcl installations, yes/no is converted into a boolean. + if isinstance(res, bool): + if res: + return YES + return NO + # In others we get a Tcl_Obj. + return str(res) + +def showinfo(title=None, message=None, **options): + "Show an info message" + return _show(title, message, INFO, OK, **options) + +def showwarning(title=None, message=None, **options): + "Show a warning message" + return _show(title, message, WARNING, OK, **options) + +def showerror(title=None, message=None, **options): + "Show an error message" + return _show(title, message, ERROR, OK, **options) + +def askquestion(title=None, message=None, **options): + "Ask a question" + return _show(title, message, QUESTION, YESNO, **options) + +def askokcancel(title=None, message=None, **options): + "Ask if operation should proceed; return true if the answer is ok" + s = _show(title, message, QUESTION, OKCANCEL, **options) + return s == OK + +def askyesno(title=None, message=None, **options): + "Ask a question; return true if the answer is yes" + s = _show(title, message, QUESTION, YESNO, **options) + return s == YES + +def askyesnocancel(title=None, message=None, **options): + "Ask a question; return true if the answer is yes, None if cancelled." + s = _show(title, message, QUESTION, YESNOCANCEL, **options) + # s might be a Tcl index object, so convert it to a string + s = str(s) + if s == CANCEL: + return None + return s == YES + +def askretrycancel(title=None, message=None, **options): + "Ask if operation should be retried; return true if the answer is yes" + s = _show(title, message, WARNING, RETRYCANCEL, **options) + return s == RETRY + + +# -------------------------------------------------------------------- +# test stuff + +if __name__ == "__main__": + + print "info", showinfo("Spam", "Egg Information") + print "warning", showwarning("Spam", "Egg Warning") + print "error", showerror("Spam", "Egg Alert") + print "question", askquestion("Spam", "Question?") + print "proceed", askokcancel("Spam", "Proceed?") + print "yes/no", askyesno("Spam", "Got it?") + print "yes/no/cancel", askyesnocancel("Spam", "Want it?") + print "try again", askretrycancel("Spam", "Try again?") diff --git a/contrib/tools/python/src/Lib/lib-tk/tkSimpleDialog.py b/contrib/tools/python/src/Lib/lib-tk/tkSimpleDialog.py new file mode 100644 index 0000000000..023475db25 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/tkSimpleDialog.py @@ -0,0 +1,323 @@ +# +# An Introduction to Tkinter +# tkSimpleDialog.py +# +# Copyright (c) 1997 by Fredrik Lundh +# +# fredrik@pythonware.com +# http://www.pythonware.com +# + +# -------------------------------------------------------------------- +# dialog base class + +'''Dialog boxes + +This module handles dialog boxes. It contains the following +public symbols: + +Dialog -- a base class for dialogs + +askinteger -- get an integer from the user + +askfloat -- get a float from the user + +askstring -- get a string from the user +''' + +from Tkinter import * + +class Dialog(Toplevel): + + '''Class to open dialogs. + + This class is intended as a base class for custom dialogs + ''' + + def __init__(self, parent, title = None): + + '''Initialize a dialog. + + Arguments: + + parent -- a parent window (the application window) + + title -- the dialog title + ''' + Toplevel.__init__(self, parent) + + self.withdraw() # remain invisible for now + # If the master is not viewable, don't + # make the child transient, or else it + # would be opened withdrawn + if parent.winfo_viewable(): + self.transient(parent) + + if title: + self.title(title) + + self.parent = parent + + self.result = None + + body = Frame(self) + self.initial_focus = self.body(body) + body.pack(padx=5, pady=5) + + self.buttonbox() + + + if not self.initial_focus: + self.initial_focus = self + + self.protocol("WM_DELETE_WINDOW", self.cancel) + + if self.parent is not None: + self.geometry("+%d+%d" % (parent.winfo_rootx()+50, + parent.winfo_rooty()+50)) + + self.deiconify() # become visibile now + + self.initial_focus.focus_set() + + # wait for window to appear on screen before calling grab_set + self.wait_visibility() + self.grab_set() + self.wait_window(self) + + def destroy(self): + '''Destroy the window''' + self.initial_focus = None + Toplevel.destroy(self) + + # + # construction hooks + + def body(self, master): + '''create dialog body. + + return widget that should have initial focus. + This method should be overridden, and is called + by the __init__ method. + ''' + pass + + def buttonbox(self): + '''add standard button box. + + override if you do not want the standard buttons + ''' + + box = Frame(self) + + w = Button(box, text="OK", width=10, command=self.ok, default=ACTIVE) + w.pack(side=LEFT, padx=5, pady=5) + w = Button(box, text="Cancel", width=10, command=self.cancel) + w.pack(side=LEFT, padx=5, pady=5) + + self.bind("<Return>", self.ok) + self.bind("<Escape>", self.cancel) + + box.pack() + + # + # standard button semantics + + def ok(self, event=None): + + if not self.validate(): + self.initial_focus.focus_set() # put focus back + return + + self.withdraw() + self.update_idletasks() + + try: + self.apply() + finally: + self.cancel() + + def cancel(self, event=None): + + # put focus back to the parent window + if self.parent is not None: + self.parent.focus_set() + self.destroy() + + # + # command hooks + + def validate(self): + '''validate the data + + This method is called automatically to validate the data before the + dialog is destroyed. By default, it always validates OK. + ''' + + return 1 # override + + def apply(self): + '''process the data + + This method is called automatically to process the data, *after* + the dialog is destroyed. By default, it does nothing. + ''' + + pass # override + + +# -------------------------------------------------------------------- +# convenience dialogues + +class _QueryDialog(Dialog): + + def __init__(self, title, prompt, + initialvalue=None, + minvalue = None, maxvalue = None, + parent = None): + + if not parent: + import Tkinter + parent = Tkinter._default_root + + self.prompt = prompt + self.minvalue = minvalue + self.maxvalue = maxvalue + + self.initialvalue = initialvalue + + Dialog.__init__(self, parent, title) + + def destroy(self): + self.entry = None + Dialog.destroy(self) + + def body(self, master): + + w = Label(master, text=self.prompt, justify=LEFT) + w.grid(row=0, padx=5, sticky=W) + + self.entry = Entry(master, name="entry") + self.entry.grid(row=1, padx=5, sticky=W+E) + + if self.initialvalue is not None: + self.entry.insert(0, self.initialvalue) + self.entry.select_range(0, END) + + return self.entry + + def validate(self): + + import tkMessageBox + + try: + result = self.getresult() + except ValueError: + tkMessageBox.showwarning( + "Illegal value", + self.errormessage + "\nPlease try again", + parent = self + ) + return 0 + + if self.minvalue is not None and result < self.minvalue: + tkMessageBox.showwarning( + "Too small", + "The allowed minimum value is %s. " + "Please try again." % self.minvalue, + parent = self + ) + return 0 + + if self.maxvalue is not None and result > self.maxvalue: + tkMessageBox.showwarning( + "Too large", + "The allowed maximum value is %s. " + "Please try again." % self.maxvalue, + parent = self + ) + return 0 + + self.result = result + + return 1 + + +class _QueryInteger(_QueryDialog): + errormessage = "Not an integer." + def getresult(self): + return int(self.entry.get()) + +def askinteger(title, prompt, **kw): + '''get an integer from the user + + Arguments: + + title -- the dialog title + prompt -- the label text + **kw -- see SimpleDialog class + + Return value is an integer + ''' + d = _QueryInteger(title, prompt, **kw) + return d.result + +class _QueryFloat(_QueryDialog): + errormessage = "Not a floating point value." + def getresult(self): + return float(self.entry.get()) + +def askfloat(title, prompt, **kw): + '''get a float from the user + + Arguments: + + title -- the dialog title + prompt -- the label text + **kw -- see SimpleDialog class + + Return value is a float + ''' + d = _QueryFloat(title, prompt, **kw) + return d.result + +class _QueryString(_QueryDialog): + def __init__(self, *args, **kw): + if "show" in kw: + self.__show = kw["show"] + del kw["show"] + else: + self.__show = None + _QueryDialog.__init__(self, *args, **kw) + + def body(self, master): + entry = _QueryDialog.body(self, master) + if self.__show is not None: + entry.configure(show=self.__show) + return entry + + def getresult(self): + return self.entry.get() + +def askstring(title, prompt, **kw): + '''get a string from the user + + Arguments: + + title -- the dialog title + prompt -- the label text + **kw -- see SimpleDialog class + + Return value is a string + ''' + d = _QueryString(title, prompt, **kw) + return d.result + +if __name__ == "__main__": + + root = Tk() + root.update() + + print askinteger("Spam", "Egg count", initialvalue=12*12) + print askfloat("Spam", "Egg weight\n(in tons)", minvalue=1, maxvalue=100) + print askstring("Spam", "Egg label") diff --git a/contrib/tools/python/src/Lib/lib-tk/ttk.py b/contrib/tools/python/src/Lib/lib-tk/ttk.py new file mode 100644 index 0000000000..d4df408e47 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/ttk.py @@ -0,0 +1,1630 @@ +"""Ttk wrapper. + +This module provides classes to allow using Tk themed widget set. + +Ttk is based on a revised and enhanced version of +TIP #48 (http://tip.tcl.tk/48) specified style engine. + +Its basic idea is to separate, to the extent possible, the code +implementing a widget's behavior from the code implementing its +appearance. Widget class bindings are primarily responsible for +maintaining the widget state and invoking callbacks, all aspects +of the widgets appearance lies at Themes. +""" + +__version__ = "0.3.1" + +__author__ = "Guilherme Polo <ggpolo@gmail.com>" + +__all__ = ["Button", "Checkbutton", "Combobox", "Entry", "Frame", "Label", + "Labelframe", "LabelFrame", "Menubutton", "Notebook", "Panedwindow", + "PanedWindow", "Progressbar", "Radiobutton", "Scale", "Scrollbar", + "Separator", "Sizegrip", "Style", "Treeview", + # Extensions + "LabeledScale", "OptionMenu", + # functions + "tclobjs_to_py", "setup_master"] + +import Tkinter +from Tkinter import _flatten, _join, _stringify, _splitdict + +# Verify if Tk is new enough to not need the Tile package +_REQUIRE_TILE = True if Tkinter.TkVersion < 8.5 else False + +def _load_tile(master): + if _REQUIRE_TILE: + import os + tilelib = os.environ.get('TILE_LIBRARY') + if tilelib: + # append custom tile path to the list of directories that + # Tcl uses when attempting to resolve packages with the package + # command + master.tk.eval( + 'global auto_path; ' + 'lappend auto_path {%s}' % tilelib) + + master.tk.eval('package require tile') # TclError may be raised here + master._tile_loaded = True + +def _format_optvalue(value, script=False): + """Internal function.""" + if script: + # if caller passes a Tcl script to tk.call, all the values need to + # be grouped into words (arguments to a command in Tcl dialect) + value = _stringify(value) + elif isinstance(value, (list, tuple)): + value = _join(value) + return value + +def _format_optdict(optdict, script=False, ignore=None): + """Formats optdict to a tuple to pass it to tk.call. + + E.g. (script=False): + {'foreground': 'blue', 'padding': [1, 2, 3, 4]} returns: + ('-foreground', 'blue', '-padding', '1 2 3 4')""" + + opts = [] + for opt, value in optdict.iteritems(): + if not ignore or opt not in ignore: + opts.append("-%s" % opt) + if value is not None: + opts.append(_format_optvalue(value, script)) + + return _flatten(opts) + +def _mapdict_values(items): + # each value in mapdict is expected to be a sequence, where each item + # is another sequence containing a state (or several) and a value + # E.g. (script=False): + # [('active', 'selected', 'grey'), ('focus', [1, 2, 3, 4])] + # returns: + # ['active selected', 'grey', 'focus', [1, 2, 3, 4]] + opt_val = [] + for item in items: + state = item[:-1] + val = item[-1] + # hacks for bakward compatibility + state[0] # raise IndexError if empty + if len(state) == 1: + # if it is empty (something that evaluates to False), then + # format it to Tcl code to denote the "normal" state + state = state[0] or '' + else: + # group multiple states + state = ' '.join(state) # raise TypeError if not str + opt_val.append(state) + if val is not None: + opt_val.append(val) + return opt_val + +def _format_mapdict(mapdict, script=False): + """Formats mapdict to pass it to tk.call. + + E.g. (script=False): + {'expand': [('active', 'selected', 'grey'), ('focus', [1, 2, 3, 4])]} + + returns: + + ('-expand', '{active selected} grey focus {1, 2, 3, 4}')""" + + opts = [] + for opt, value in mapdict.iteritems(): + opts.extend(("-%s" % opt, + _format_optvalue(_mapdict_values(value), script))) + + return _flatten(opts) + +def _format_elemcreate(etype, script=False, *args, **kw): + """Formats args and kw according to the given element factory etype.""" + spec = None + opts = () + if etype in ("image", "vsapi"): + if etype == "image": # define an element based on an image + # first arg should be the default image name + iname = args[0] + # next args, if any, are statespec/value pairs which is almost + # a mapdict, but we just need the value + imagespec = _join(_mapdict_values(args[1:])) + spec = "%s %s" % (iname, imagespec) + + else: + # define an element whose visual appearance is drawn using the + # Microsoft Visual Styles API which is responsible for the + # themed styles on Windows XP and Vista. + # Availability: Tk 8.6, Windows XP and Vista. + class_name, part_id = args[:2] + statemap = _join(_mapdict_values(args[2:])) + spec = "%s %s %s" % (class_name, part_id, statemap) + + opts = _format_optdict(kw, script) + + elif etype == "from": # clone an element + # it expects a themename and optionally an element to clone from, + # otherwise it will clone {} (empty element) + spec = args[0] # theme name + if len(args) > 1: # elementfrom specified + opts = (_format_optvalue(args[1], script),) + + if script: + spec = '{%s}' % spec + opts = ' '.join(opts) + + return spec, opts + +def _format_layoutlist(layout, indent=0, indent_size=2): + """Formats a layout list so we can pass the result to ttk::style + layout and ttk::style settings. Note that the layout doesn't have to + be a list necessarily. + + E.g.: + [("Menubutton.background", None), + ("Menubutton.button", {"children": + [("Menubutton.focus", {"children": + [("Menubutton.padding", {"children": + [("Menubutton.label", {"side": "left", "expand": 1})] + })] + })] + }), + ("Menubutton.indicator", {"side": "right"}) + ] + + returns: + + Menubutton.background + Menubutton.button -children { + Menubutton.focus -children { + Menubutton.padding -children { + Menubutton.label -side left -expand 1 + } + } + } + Menubutton.indicator -side right""" + script = [] + + for layout_elem in layout: + elem, opts = layout_elem + opts = opts or {} + fopts = ' '.join(_format_optdict(opts, True, ("children",))) + head = "%s%s%s" % (' ' * indent, elem, (" %s" % fopts) if fopts else '') + + if "children" in opts: + script.append(head + " -children {") + indent += indent_size + newscript, indent = _format_layoutlist(opts['children'], indent, + indent_size) + script.append(newscript) + indent -= indent_size + script.append('%s}' % (' ' * indent)) + else: + script.append(head) + + return '\n'.join(script), indent + +def _script_from_settings(settings): + """Returns an appropriate script, based on settings, according to + theme_settings definition to be used by theme_settings and + theme_create.""" + script = [] + # a script will be generated according to settings passed, which + # will then be evaluated by Tcl + for name, opts in settings.iteritems(): + # will format specific keys according to Tcl code + if opts.get('configure'): # format 'configure' + s = ' '.join(_format_optdict(opts['configure'], True)) + script.append("ttk::style configure %s %s;" % (name, s)) + + if opts.get('map'): # format 'map' + s = ' '.join(_format_mapdict(opts['map'], True)) + script.append("ttk::style map %s %s;" % (name, s)) + + if 'layout' in opts: # format 'layout' which may be empty + if not opts['layout']: + s = 'null' # could be any other word, but this one makes sense + else: + s, _ = _format_layoutlist(opts['layout']) + script.append("ttk::style layout %s {\n%s\n}" % (name, s)) + + if opts.get('element create'): # format 'element create' + eopts = opts['element create'] + etype = eopts[0] + + # find where args end, and where kwargs start + argc = 1 # etype was the first one + while argc < len(eopts) and not hasattr(eopts[argc], 'iteritems'): + argc += 1 + + elemargs = eopts[1:argc] + elemkw = eopts[argc] if argc < len(eopts) and eopts[argc] else {} + spec, opts = _format_elemcreate(etype, True, *elemargs, **elemkw) + + script.append("ttk::style element create %s %s %s %s" % ( + name, etype, spec, opts)) + + return '\n'.join(script) + +def _list_from_statespec(stuple): + """Construct a list from the given statespec tuple according to the + accepted statespec accepted by _format_mapdict.""" + nval = [] + for val in stuple: + typename = getattr(val, 'typename', None) + if typename is None: + nval.append(val) + else: # this is a Tcl object + val = str(val) + if typename == 'StateSpec': + val = val.split() + nval.append(val) + + it = iter(nval) + return [_flatten(spec) for spec in zip(it, it)] + +def _list_from_layouttuple(tk, ltuple): + """Construct a list from the tuple returned by ttk::layout, this is + somewhat the reverse of _format_layoutlist.""" + ltuple = tk.splitlist(ltuple) + res = [] + + indx = 0 + while indx < len(ltuple): + name = ltuple[indx] + opts = {} + res.append((name, opts)) + indx += 1 + + while indx < len(ltuple): # grab name's options + opt, val = ltuple[indx:indx + 2] + if not opt.startswith('-'): # found next name + break + + opt = opt[1:] # remove the '-' from the option + indx += 2 + + if opt == 'children': + val = _list_from_layouttuple(tk, val) + + opts[opt] = val + + return res + +def _val_or_dict(tk, options, *args): + """Format options then call Tk command with args and options and return + the appropriate result. + + If no option is specified, a dict is returned. If an option is + specified with the None value, the value for that option is returned. + Otherwise, the function just sets the passed options and the caller + shouldn't be expecting a return value anyway.""" + options = _format_optdict(options) + res = tk.call(*(args + options)) + + if len(options) % 2: # option specified without a value, return its value + return res + + return _splitdict(tk, res, conv=_tclobj_to_py) + +def _convert_stringval(value): + """Converts a value to, hopefully, a more appropriate Python object.""" + value = unicode(value) + try: + value = int(value) + except (ValueError, TypeError): + pass + + return value + +def _to_number(x): + if isinstance(x, str): + if '.' in x: + x = float(x) + else: + x = int(x) + return x + +def _tclobj_to_py(val): + """Return value converted from Tcl object to Python object.""" + if val and hasattr(val, '__len__') and not isinstance(val, basestring): + if getattr(val[0], 'typename', None) == 'StateSpec': + val = _list_from_statespec(val) + else: + val = map(_convert_stringval, val) + + elif hasattr(val, 'typename'): # some other (single) Tcl object + val = _convert_stringval(val) + + return val + +def tclobjs_to_py(adict): + """Returns adict with its values converted from Tcl objects to Python + objects.""" + for opt, val in adict.items(): + adict[opt] = _tclobj_to_py(val) + + return adict + +def setup_master(master=None): + """If master is not None, itself is returned. If master is None, + the default master is returned if there is one, otherwise a new + master is created and returned. + + If it is not allowed to use the default root and master is None, + RuntimeError is raised.""" + if master is None: + if Tkinter._support_default_root: + master = Tkinter._default_root or Tkinter.Tk() + else: + raise RuntimeError( + "No master specified and Tkinter is " + "configured to not support default root") + return master + + +class Style(object): + """Manipulate style database.""" + + _name = "ttk::style" + + def __init__(self, master=None): + master = setup_master(master) + + if not getattr(master, '_tile_loaded', False): + # Load tile now, if needed + _load_tile(master) + + self.master = master + self.tk = self.master.tk + + + def configure(self, style, query_opt=None, **kw): + """Query or sets the default value of the specified option(s) in + style. + + Each key in kw is an option and each value is either a string or + a sequence identifying the value for that option.""" + if query_opt is not None: + kw[query_opt] = None + return _val_or_dict(self.tk, kw, self._name, "configure", style) + + + def map(self, style, query_opt=None, **kw): + """Query or sets dynamic values of the specified option(s) in + style. + + Each key in kw is an option and each value should be a list or a + tuple (usually) containing statespecs grouped in tuples, or list, + or something else of your preference. A statespec is compound of + one or more states and then a value.""" + if query_opt is not None: + return _list_from_statespec(self.tk.splitlist( + self.tk.call(self._name, "map", style, '-%s' % query_opt))) + + return _splitdict( + self.tk, + self.tk.call(self._name, "map", style, *_format_mapdict(kw)), + conv=_tclobj_to_py) + + + def lookup(self, style, option, state=None, default=None): + """Returns the value specified for option in style. + + If state is specified it is expected to be a sequence of one + or more states. If the default argument is set, it is used as + a fallback value in case no specification for option is found.""" + state = ' '.join(state) if state else '' + + return self.tk.call(self._name, "lookup", style, '-%s' % option, + state, default) + + + def layout(self, style, layoutspec=None): + """Define the widget layout for given style. If layoutspec is + omitted, return the layout specification for given style. + + layoutspec is expected to be a list or an object different than + None that evaluates to False if you want to "turn off" that style. + If it is a list (or tuple, or something else), each item should be + a tuple where the first item is the layout name and the second item + should have the format described below: + + LAYOUTS + + A layout can contain the value None, if takes no options, or + a dict of options specifying how to arrange the element. + The layout mechanism uses a simplified version of the pack + geometry manager: given an initial cavity, each element is + allocated a parcel. Valid options/values are: + + side: whichside + Specifies which side of the cavity to place the + element; one of top, right, bottom or left. If + omitted, the element occupies the entire cavity. + + sticky: nswe + Specifies where the element is placed inside its + allocated parcel. + + children: [sublayout... ] + Specifies a list of elements to place inside the + element. Each element is a tuple (or other sequence) + where the first item is the layout name, and the other + is a LAYOUT.""" + lspec = None + if layoutspec: + lspec = _format_layoutlist(layoutspec)[0] + elif layoutspec is not None: # will disable the layout ({}, '', etc) + lspec = "null" # could be any other word, but this may make sense + # when calling layout(style) later + + return _list_from_layouttuple(self.tk, + self.tk.call(self._name, "layout", style, lspec)) + + + def element_create(self, elementname, etype, *args, **kw): + """Create a new element in the current theme of given etype.""" + spec, opts = _format_elemcreate(etype, False, *args, **kw) + self.tk.call(self._name, "element", "create", elementname, etype, + spec, *opts) + + + def element_names(self): + """Returns the list of elements defined in the current theme.""" + return self.tk.splitlist(self.tk.call(self._name, "element", "names")) + + + def element_options(self, elementname): + """Return the list of elementname's options.""" + return self.tk.splitlist(self.tk.call(self._name, "element", "options", elementname)) + + + def theme_create(self, themename, parent=None, settings=None): + """Creates a new theme. + + It is an error if themename already exists. If parent is + specified, the new theme will inherit styles, elements and + layouts from the specified parent theme. If settings are present, + they are expected to have the same syntax used for theme_settings.""" + script = _script_from_settings(settings) if settings else '' + + if parent: + self.tk.call(self._name, "theme", "create", themename, + "-parent", parent, "-settings", script) + else: + self.tk.call(self._name, "theme", "create", themename, + "-settings", script) + + + def theme_settings(self, themename, settings): + """Temporarily sets the current theme to themename, apply specified + settings and then restore the previous theme. + + Each key in settings is a style and each value may contain the + keys 'configure', 'map', 'layout' and 'element create' and they + are expected to have the same format as specified by the methods + configure, map, layout and element_create respectively.""" + script = _script_from_settings(settings) + self.tk.call(self._name, "theme", "settings", themename, script) + + + def theme_names(self): + """Returns a list of all known themes.""" + return self.tk.splitlist(self.tk.call(self._name, "theme", "names")) + + + def theme_use(self, themename=None): + """If themename is None, returns the theme in use, otherwise, set + the current theme to themename, refreshes all widgets and emits + a <<ThemeChanged>> event.""" + if themename is None: + # Starting on Tk 8.6, checking this global is no longer needed + # since it allows doing self.tk.call(self._name, "theme", "use") + return self.tk.eval("return $ttk::currentTheme") + + # using "ttk::setTheme" instead of "ttk::style theme use" causes + # the variable currentTheme to be updated, also, ttk::setTheme calls + # "ttk::style theme use" in order to change theme. + self.tk.call("ttk::setTheme", themename) + + +class Widget(Tkinter.Widget): + """Base class for Tk themed widgets.""" + + def __init__(self, master, widgetname, kw=None): + """Constructs a Ttk Widget with the parent master. + + STANDARD OPTIONS + + class, cursor, takefocus, style + + SCROLLABLE WIDGET OPTIONS + + xscrollcommand, yscrollcommand + + LABEL WIDGET OPTIONS + + text, textvariable, underline, image, compound, width + + WIDGET STATES + + active, disabled, focus, pressed, selected, background, + readonly, alternate, invalid + """ + master = setup_master(master) + if not getattr(master, '_tile_loaded', False): + # Load tile now, if needed + _load_tile(master) + Tkinter.Widget.__init__(self, master, widgetname, kw=kw) + + + def identify(self, x, y): + """Returns the name of the element at position x, y, or the empty + string if the point does not lie within any element. + + x and y are pixel coordinates relative to the widget.""" + return self.tk.call(self._w, "identify", x, y) + + + def instate(self, statespec, callback=None, *args, **kw): + """Test the widget's state. + + If callback is not specified, returns True if the widget state + matches statespec and False otherwise. If callback is specified, + then it will be invoked with *args, **kw if the widget state + matches statespec. statespec is expected to be a sequence.""" + ret = self.tk.getboolean( + self.tk.call(self._w, "instate", ' '.join(statespec))) + if ret and callback: + return callback(*args, **kw) + + return ret + + + def state(self, statespec=None): + """Modify or inquire widget state. + + Widget state is returned if statespec is None, otherwise it is + set according to the statespec flags and then a new state spec + is returned indicating which flags were changed. statespec is + expected to be a sequence.""" + if statespec is not None: + statespec = ' '.join(statespec) + + return self.tk.splitlist(str(self.tk.call(self._w, "state", statespec))) + + +class Button(Widget): + """Ttk Button widget, displays a textual label and/or image, and + evaluates a command when pressed.""" + + def __init__(self, master=None, **kw): + """Construct a Ttk Button widget with the parent master. + + STANDARD OPTIONS + + class, compound, cursor, image, state, style, takefocus, + text, textvariable, underline, width + + WIDGET-SPECIFIC OPTIONS + + command, default, width + """ + Widget.__init__(self, master, "ttk::button", kw) + + + def invoke(self): + """Invokes the command associated with the button.""" + return self.tk.call(self._w, "invoke") + + +class Checkbutton(Widget): + """Ttk Checkbutton widget which is either in on- or off-state.""" + + def __init__(self, master=None, **kw): + """Construct a Ttk Checkbutton widget with the parent master. + + STANDARD OPTIONS + + class, compound, cursor, image, state, style, takefocus, + text, textvariable, underline, width + + WIDGET-SPECIFIC OPTIONS + + command, offvalue, onvalue, variable + """ + Widget.__init__(self, master, "ttk::checkbutton", kw) + + + def invoke(self): + """Toggles between the selected and deselected states and + invokes the associated command. If the widget is currently + selected, sets the option variable to the offvalue option + and deselects the widget; otherwise, sets the option variable + to the option onvalue. + + Returns the result of the associated command.""" + return self.tk.call(self._w, "invoke") + + +class Entry(Widget, Tkinter.Entry): + """Ttk Entry widget displays a one-line text string and allows that + string to be edited by the user.""" + + def __init__(self, master=None, widget=None, **kw): + """Constructs a Ttk Entry widget with the parent master. + + STANDARD OPTIONS + + class, cursor, style, takefocus, xscrollcommand + + WIDGET-SPECIFIC OPTIONS + + exportselection, invalidcommand, justify, show, state, + textvariable, validate, validatecommand, width + + VALIDATION MODES + + none, key, focus, focusin, focusout, all + """ + Widget.__init__(self, master, widget or "ttk::entry", kw) + + + def bbox(self, index): + """Return a tuple of (x, y, width, height) which describes the + bounding box of the character given by index.""" + return self._getints(self.tk.call(self._w, "bbox", index)) + + + def identify(self, x, y): + """Returns the name of the element at position x, y, or the + empty string if the coordinates are outside the window.""" + return self.tk.call(self._w, "identify", x, y) + + + def validate(self): + """Force revalidation, independent of the conditions specified + by the validate option. Returns False if validation fails, True + if it succeeds. Sets or clears the invalid state accordingly.""" + return self.tk.getboolean(self.tk.call(self._w, "validate")) + + +class Combobox(Entry): + """Ttk Combobox widget combines a text field with a pop-down list of + values.""" + + def __init__(self, master=None, **kw): + """Construct a Ttk Combobox widget with the parent master. + + STANDARD OPTIONS + + class, cursor, style, takefocus + + WIDGET-SPECIFIC OPTIONS + + exportselection, justify, height, postcommand, state, + textvariable, values, width + """ + Entry.__init__(self, master, "ttk::combobox", **kw) + + + def current(self, newindex=None): + """If newindex is supplied, sets the combobox value to the + element at position newindex in the list of values. Otherwise, + returns the index of the current value in the list of values + or -1 if the current value does not appear in the list.""" + if newindex is None: + return self.tk.getint(self.tk.call(self._w, "current")) + return self.tk.call(self._w, "current", newindex) + + + def set(self, value): + """Sets the value of the combobox to value.""" + self.tk.call(self._w, "set", value) + + +class Frame(Widget): + """Ttk Frame widget is a container, used to group other widgets + together.""" + + def __init__(self, master=None, **kw): + """Construct a Ttk Frame with parent master. + + STANDARD OPTIONS + + class, cursor, style, takefocus + + WIDGET-SPECIFIC OPTIONS + + borderwidth, relief, padding, width, height + """ + Widget.__init__(self, master, "ttk::frame", kw) + + +class Label(Widget): + """Ttk Label widget displays a textual label and/or image.""" + + def __init__(self, master=None, **kw): + """Construct a Ttk Label with parent master. + + STANDARD OPTIONS + + class, compound, cursor, image, style, takefocus, text, + textvariable, underline, width + + WIDGET-SPECIFIC OPTIONS + + anchor, background, font, foreground, justify, padding, + relief, text, wraplength + """ + Widget.__init__(self, master, "ttk::label", kw) + + +class Labelframe(Widget): + """Ttk Labelframe widget is a container used to group other widgets + together. It has an optional label, which may be a plain text string + or another widget.""" + + def __init__(self, master=None, **kw): + """Construct a Ttk Labelframe with parent master. + + STANDARD OPTIONS + + class, cursor, style, takefocus + + WIDGET-SPECIFIC OPTIONS + labelanchor, text, underline, padding, labelwidget, width, + height + """ + Widget.__init__(self, master, "ttk::labelframe", kw) + +LabelFrame = Labelframe # Tkinter name compatibility + + +class Menubutton(Widget): + """Ttk Menubutton widget displays a textual label and/or image, and + displays a menu when pressed.""" + + def __init__(self, master=None, **kw): + """Construct a Ttk Menubutton with parent master. + + STANDARD OPTIONS + + class, compound, cursor, image, state, style, takefocus, + text, textvariable, underline, width + + WIDGET-SPECIFIC OPTIONS + + direction, menu + """ + Widget.__init__(self, master, "ttk::menubutton", kw) + + +class Notebook(Widget): + """Ttk Notebook widget manages a collection of windows and displays + a single one at a time. Each child window is associated with a tab, + which the user may select to change the currently-displayed window.""" + + def __init__(self, master=None, **kw): + """Construct a Ttk Notebook with parent master. + + STANDARD OPTIONS + + class, cursor, style, takefocus + + WIDGET-SPECIFIC OPTIONS + + height, padding, width + + TAB OPTIONS + + state, sticky, padding, text, image, compound, underline + + TAB IDENTIFIERS (tab_id) + + The tab_id argument found in several methods may take any of + the following forms: + + * An integer between zero and the number of tabs + * The name of a child window + * A positional specification of the form "@x,y", which + defines the tab + * The string "current", which identifies the + currently-selected tab + * The string "end", which returns the number of tabs (only + valid for method index) + """ + Widget.__init__(self, master, "ttk::notebook", kw) + + + def add(self, child, **kw): + """Adds a new tab to the notebook. + + If window is currently managed by the notebook but hidden, it is + restored to its previous position.""" + self.tk.call(self._w, "add", child, *(_format_optdict(kw))) + + + def forget(self, tab_id): + """Removes the tab specified by tab_id, unmaps and unmanages the + associated window.""" + self.tk.call(self._w, "forget", tab_id) + + + def hide(self, tab_id): + """Hides the tab specified by tab_id. + + The tab will not be displayed, but the associated window remains + managed by the notebook and its configuration remembered. Hidden + tabs may be restored with the add command.""" + self.tk.call(self._w, "hide", tab_id) + + + def identify(self, x, y): + """Returns the name of the tab element at position x, y, or the + empty string if none.""" + return self.tk.call(self._w, "identify", x, y) + + + def index(self, tab_id): + """Returns the numeric index of the tab specified by tab_id, or + the total number of tabs if tab_id is the string "end".""" + return self.tk.getint(self.tk.call(self._w, "index", tab_id)) + + + def insert(self, pos, child, **kw): + """Inserts a pane at the specified position. + + pos is either the string end, an integer index, or the name of + a managed child. If child is already managed by the notebook, + moves it to the specified position.""" + self.tk.call(self._w, "insert", pos, child, *(_format_optdict(kw))) + + + def select(self, tab_id=None): + """Selects the specified tab. + + The associated child window will be displayed, and the + previously-selected window (if different) is unmapped. If tab_id + is omitted, returns the widget name of the currently selected + pane.""" + return self.tk.call(self._w, "select", tab_id) + + + def tab(self, tab_id, option=None, **kw): + """Query or modify the options of the specific tab_id. + + If kw is not given, returns a dict of the tab option values. If option + is specified, returns the value of that option. Otherwise, sets the + options to the corresponding values.""" + if option is not None: + kw[option] = None + return _val_or_dict(self.tk, kw, self._w, "tab", tab_id) + + + def tabs(self): + """Returns a list of windows managed by the notebook.""" + return self.tk.splitlist(self.tk.call(self._w, "tabs") or ()) + + + def enable_traversal(self): + """Enable keyboard traversal for a toplevel window containing + this notebook. + + This will extend the bindings for the toplevel window containing + this notebook as follows: + + Control-Tab: selects the tab following the currently selected + one + + Shift-Control-Tab: selects the tab preceding the currently + selected one + + Alt-K: where K is the mnemonic (underlined) character of any + tab, will select that tab. + + Multiple notebooks in a single toplevel may be enabled for + traversal, including nested notebooks. However, notebook traversal + only works properly if all panes are direct children of the + notebook.""" + # The only, and good, difference I see is about mnemonics, which works + # after calling this method. Control-Tab and Shift-Control-Tab always + # works (here at least). + self.tk.call("ttk::notebook::enableTraversal", self._w) + + +class Panedwindow(Widget, Tkinter.PanedWindow): + """Ttk Panedwindow widget displays a number of subwindows, stacked + either vertically or horizontally.""" + + def __init__(self, master=None, **kw): + """Construct a Ttk Panedwindow with parent master. + + STANDARD OPTIONS + + class, cursor, style, takefocus + + WIDGET-SPECIFIC OPTIONS + + orient, width, height + + PANE OPTIONS + + weight + """ + Widget.__init__(self, master, "ttk::panedwindow", kw) + + + forget = Tkinter.PanedWindow.forget # overrides Pack.forget + + + def insert(self, pos, child, **kw): + """Inserts a pane at the specified positions. + + pos is either the string end, and integer index, or the name + of a child. If child is already managed by the paned window, + moves it to the specified position.""" + self.tk.call(self._w, "insert", pos, child, *(_format_optdict(kw))) + + + def pane(self, pane, option=None, **kw): + """Query or modify the options of the specified pane. + + pane is either an integer index or the name of a managed subwindow. + If kw is not given, returns a dict of the pane option values. If + option is specified then the value for that option is returned. + Otherwise, sets the options to the corresponding values.""" + if option is not None: + kw[option] = None + return _val_or_dict(self.tk, kw, self._w, "pane", pane) + + + def sashpos(self, index, newpos=None): + """If newpos is specified, sets the position of sash number index. + + May adjust the positions of adjacent sashes to ensure that + positions are monotonically increasing. Sash positions are further + constrained to be between 0 and the total size of the widget. + + Returns the new position of sash number index.""" + return self.tk.getint(self.tk.call(self._w, "sashpos", index, newpos)) + +PanedWindow = Panedwindow # Tkinter name compatibility + + +class Progressbar(Widget): + """Ttk Progressbar widget shows the status of a long-running + operation. They can operate in two modes: determinate mode shows the + amount completed relative to the total amount of work to be done, and + indeterminate mode provides an animated display to let the user know + that something is happening.""" + + def __init__(self, master=None, **kw): + """Construct a Ttk Progressbar with parent master. + + STANDARD OPTIONS + + class, cursor, style, takefocus + + WIDGET-SPECIFIC OPTIONS + + orient, length, mode, maximum, value, variable, phase + """ + Widget.__init__(self, master, "ttk::progressbar", kw) + + + def start(self, interval=None): + """Begin autoincrement mode: schedules a recurring timer event + that calls method step every interval milliseconds. + + interval defaults to 50 milliseconds (20 steps/second) if omitted.""" + self.tk.call(self._w, "start", interval) + + + def step(self, amount=None): + """Increments the value option by amount. + + amount defaults to 1.0 if omitted.""" + self.tk.call(self._w, "step", amount) + + + def stop(self): + """Stop autoincrement mode: cancels any recurring timer event + initiated by start.""" + self.tk.call(self._w, "stop") + + +class Radiobutton(Widget): + """Ttk Radiobutton widgets are used in groups to show or change a + set of mutually-exclusive options.""" + + def __init__(self, master=None, **kw): + """Construct a Ttk Radiobutton with parent master. + + STANDARD OPTIONS + + class, compound, cursor, image, state, style, takefocus, + text, textvariable, underline, width + + WIDGET-SPECIFIC OPTIONS + + command, value, variable + """ + Widget.__init__(self, master, "ttk::radiobutton", kw) + + + def invoke(self): + """Sets the option variable to the option value, selects the + widget, and invokes the associated command. + + Returns the result of the command, or an empty string if + no command is specified.""" + return self.tk.call(self._w, "invoke") + + +class Scale(Widget, Tkinter.Scale): + """Ttk Scale widget is typically used to control the numeric value of + a linked variable that varies uniformly over some range.""" + + def __init__(self, master=None, **kw): + """Construct a Ttk Scale with parent master. + + STANDARD OPTIONS + + class, cursor, style, takefocus + + WIDGET-SPECIFIC OPTIONS + + command, from, length, orient, to, value, variable + """ + Widget.__init__(self, master, "ttk::scale", kw) + + + def configure(self, cnf=None, **kw): + """Modify or query scale options. + + Setting a value for any of the "from", "from_" or "to" options + generates a <<RangeChanged>> event.""" + if cnf: + kw.update(cnf) + Widget.configure(self, **kw) + if any(['from' in kw, 'from_' in kw, 'to' in kw]): + self.event_generate('<<RangeChanged>>') + + + def get(self, x=None, y=None): + """Get the current value of the value option, or the value + corresponding to the coordinates x, y if they are specified. + + x and y are pixel coordinates relative to the scale widget + origin.""" + return self.tk.call(self._w, 'get', x, y) + + +class Scrollbar(Widget, Tkinter.Scrollbar): + """Ttk Scrollbar controls the viewport of a scrollable widget.""" + + def __init__(self, master=None, **kw): + """Construct a Ttk Scrollbar with parent master. + + STANDARD OPTIONS + + class, cursor, style, takefocus + + WIDGET-SPECIFIC OPTIONS + + command, orient + """ + Widget.__init__(self, master, "ttk::scrollbar", kw) + + +class Separator(Widget): + """Ttk Separator widget displays a horizontal or vertical separator + bar.""" + + def __init__(self, master=None, **kw): + """Construct a Ttk Separator with parent master. + + STANDARD OPTIONS + + class, cursor, style, takefocus + + WIDGET-SPECIFIC OPTIONS + + orient + """ + Widget.__init__(self, master, "ttk::separator", kw) + + +class Sizegrip(Widget): + """Ttk Sizegrip allows the user to resize the containing toplevel + window by pressing and dragging the grip.""" + + def __init__(self, master=None, **kw): + """Construct a Ttk Sizegrip with parent master. + + STANDARD OPTIONS + + class, cursor, state, style, takefocus + """ + Widget.__init__(self, master, "ttk::sizegrip", kw) + + +class Treeview(Widget, Tkinter.XView, Tkinter.YView): + """Ttk Treeview widget displays a hierarchical collection of items. + + Each item has a textual label, an optional image, and an optional list + of data values. The data values are displayed in successive columns + after the tree label.""" + + def __init__(self, master=None, **kw): + """Construct a Ttk Treeview with parent master. + + STANDARD OPTIONS + + class, cursor, style, takefocus, xscrollcommand, + yscrollcommand + + WIDGET-SPECIFIC OPTIONS + + columns, displaycolumns, height, padding, selectmode, show + + ITEM OPTIONS + + text, image, values, open, tags + + TAG OPTIONS + + foreground, background, font, image + """ + Widget.__init__(self, master, "ttk::treeview", kw) + + + def bbox(self, item, column=None): + """Returns the bounding box (relative to the treeview widget's + window) of the specified item in the form x y width height. + + If column is specified, returns the bounding box of that cell. + If the item is not visible (i.e., if it is a descendant of a + closed item or is scrolled offscreen), returns an empty string.""" + return self._getints(self.tk.call(self._w, "bbox", item, column)) or '' + + + def get_children(self, item=None): + """Returns a tuple of children belonging to item. + + If item is not specified, returns root children.""" + return self.tk.splitlist( + self.tk.call(self._w, "children", item or '') or ()) + + + def set_children(self, item, *newchildren): + """Replaces item's child with newchildren. + + Children present in item that are not present in newchildren + are detached from tree. No items in newchildren may be an + ancestor of item.""" + self.tk.call(self._w, "children", item, newchildren) + + + def column(self, column, option=None, **kw): + """Query or modify the options for the specified column. + + If kw is not given, returns a dict of the column option values. If + option is specified then the value for that option is returned. + Otherwise, sets the options to the corresponding values.""" + if option is not None: + kw[option] = None + return _val_or_dict(self.tk, kw, self._w, "column", column) + + + def delete(self, *items): + """Delete all specified items and all their descendants. The root + item may not be deleted.""" + self.tk.call(self._w, "delete", items) + + + def detach(self, *items): + """Unlinks all of the specified items from the tree. + + The items and all of their descendants are still present, and may + be reinserted at another point in the tree, but will not be + displayed. The root item may not be detached.""" + self.tk.call(self._w, "detach", items) + + + def exists(self, item): + """Returns True if the specified item is present in the tree, + False otherwise.""" + return self.tk.getboolean(self.tk.call(self._w, "exists", item)) + + + def focus(self, item=None): + """If item is specified, sets the focus item to item. Otherwise, + returns the current focus item, or '' if there is none.""" + return self.tk.call(self._w, "focus", item) + + + def heading(self, column, option=None, **kw): + """Query or modify the heading options for the specified column. + + If kw is not given, returns a dict of the heading option values. If + option is specified then the value for that option is returned. + Otherwise, sets the options to the corresponding values. + + Valid options/values are: + text: text + The text to display in the column heading + image: image_name + Specifies an image to display to the right of the column + heading + anchor: anchor + Specifies how the heading text should be aligned. One of + the standard Tk anchor values + command: callback + A callback to be invoked when the heading label is + pressed. + + To configure the tree column heading, call this with column = "#0" """ + cmd = kw.get('command') + if cmd and not isinstance(cmd, basestring): + # callback not registered yet, do it now + kw['command'] = self.master.register(cmd, self._substitute) + + if option is not None: + kw[option] = None + + return _val_or_dict(self.tk, kw, self._w, 'heading', column) + + + def identify(self, component, x, y): + """Returns a description of the specified component under the + point given by x and y, or the empty string if no such component + is present at that position.""" + return self.tk.call(self._w, "identify", component, x, y) + + + def identify_row(self, y): + """Returns the item ID of the item at position y.""" + return self.identify("row", 0, y) + + + def identify_column(self, x): + """Returns the data column identifier of the cell at position x. + + The tree column has ID #0.""" + return self.identify("column", x, 0) + + + def identify_region(self, x, y): + """Returns one of: + + heading: Tree heading area. + separator: Space between two columns headings; + tree: The tree area. + cell: A data cell. + + * Availability: Tk 8.6""" + return self.identify("region", x, y) + + + def identify_element(self, x, y): + """Returns the element at position x, y. + + * Availability: Tk 8.6""" + return self.identify("element", x, y) + + + def index(self, item): + """Returns the integer index of item within its parent's list + of children.""" + return self.tk.getint(self.tk.call(self._w, "index", item)) + + + def insert(self, parent, index, iid=None, **kw): + """Creates a new item and return the item identifier of the newly + created item. + + parent is the item ID of the parent item, or the empty string + to create a new top-level item. index is an integer, or the value + end, specifying where in the list of parent's children to insert + the new item. If index is less than or equal to zero, the new node + is inserted at the beginning, if index is greater than or equal to + the current number of children, it is inserted at the end. If iid + is specified, it is used as the item identifier, iid must not + already exist in the tree. Otherwise, a new unique identifier + is generated.""" + opts = _format_optdict(kw) + if iid is not None: + res = self.tk.call(self._w, "insert", parent, index, + "-id", iid, *opts) + else: + res = self.tk.call(self._w, "insert", parent, index, *opts) + + return res + + + def item(self, item, option=None, **kw): + """Query or modify the options for the specified item. + + If no options are given, a dict with options/values for the item + is returned. If option is specified then the value for that option + is returned. Otherwise, sets the options to the corresponding + values as given by kw.""" + if option is not None: + kw[option] = None + return _val_or_dict(self.tk, kw, self._w, "item", item) + + + def move(self, item, parent, index): + """Moves item to position index in parent's list of children. + + It is illegal to move an item under one of its descendants. If + index is less than or equal to zero, item is moved to the + beginning, if greater than or equal to the number of children, + it is moved to the end. If item was detached it is reattached.""" + self.tk.call(self._w, "move", item, parent, index) + + reattach = move # A sensible method name for reattaching detached items + + + def next(self, item): + """Returns the identifier of item's next sibling, or '' if item + is the last child of its parent.""" + return self.tk.call(self._w, "next", item) + + + def parent(self, item): + """Returns the ID of the parent of item, or '' if item is at the + top level of the hierarchy.""" + return self.tk.call(self._w, "parent", item) + + + def prev(self, item): + """Returns the identifier of item's previous sibling, or '' if + item is the first child of its parent.""" + return self.tk.call(self._w, "prev", item) + + + def see(self, item): + """Ensure that item is visible. + + Sets all of item's ancestors open option to True, and scrolls + the widget if necessary so that item is within the visible + portion of the tree.""" + self.tk.call(self._w, "see", item) + + + def selection(self, selop=None, items=None): + """If selop is not specified, returns selected items.""" + if isinstance(items, basestring): + items = (items,) + return self.tk.splitlist(self.tk.call(self._w, "selection", selop, items)) + + + def selection_set(self, items): + """items becomes the new selection.""" + self.selection("set", items) + + + def selection_add(self, items): + """Add items to the selection.""" + self.selection("add", items) + + + def selection_remove(self, items): + """Remove items from the selection.""" + self.selection("remove", items) + + + def selection_toggle(self, items): + """Toggle the selection state of each item in items.""" + self.selection("toggle", items) + + + def set(self, item, column=None, value=None): + """Query or set the value of given item. + + With one argument, return a dictionary of column/value pairs + for the specified item. With two arguments, return the current + value of the specified column. With three arguments, set the + value of given column in given item to the specified value.""" + res = self.tk.call(self._w, "set", item, column, value) + if column is None and value is None: + return _splitdict(self.tk, res, + cut_minus=False, conv=_tclobj_to_py) + else: + return res + + + def tag_bind(self, tagname, sequence=None, callback=None): + """Bind a callback for the given event sequence to the tag tagname. + When an event is delivered to an item, the callbacks for each + of the item's tags option are called.""" + self._bind((self._w, "tag", "bind", tagname), sequence, callback, add=0) + + + def tag_configure(self, tagname, option=None, **kw): + """Query or modify the options for the specified tagname. + + If kw is not given, returns a dict of the option settings for tagname. + If option is specified, returns the value for that option for the + specified tagname. Otherwise, sets the options to the corresponding + values for the given tagname.""" + if option is not None: + kw[option] = None + return _val_or_dict(self.tk, kw, self._w, "tag", "configure", + tagname) + + + def tag_has(self, tagname, item=None): + """If item is specified, returns 1 or 0 depending on whether the + specified item has the given tagname. Otherwise, returns a list of + all items which have the specified tag. + + * Availability: Tk 8.6""" + if item is None: + return self.tk.splitlist( + self.tk.call(self._w, "tag", "has", tagname)) + else: + return self.tk.getboolean( + self.tk.call(self._w, "tag", "has", tagname, item)) + + +# Extensions + +class LabeledScale(Frame, object): + """A Ttk Scale widget with a Ttk Label widget indicating its + current value. + + The Ttk Scale can be accessed through instance.scale, and Ttk Label + can be accessed through instance.label""" + + def __init__(self, master=None, variable=None, from_=0, to=10, **kw): + """Construct a horizontal LabeledScale with parent master, a + variable to be associated with the Ttk Scale widget and its range. + If variable is not specified, a Tkinter.IntVar is created. + + WIDGET-SPECIFIC OPTIONS + + compound: 'top' or 'bottom' + Specifies how to display the label relative to the scale. + Defaults to 'top'. + """ + self._label_top = kw.pop('compound', 'top') == 'top' + + Frame.__init__(self, master, **kw) + self._variable = variable or Tkinter.IntVar(master) + self._variable.set(from_) + self._last_valid = from_ + + self.label = Label(self) + self.scale = Scale(self, variable=self._variable, from_=from_, to=to) + self.scale.bind('<<RangeChanged>>', self._adjust) + + # position scale and label according to the compound option + scale_side = 'bottom' if self._label_top else 'top' + label_side = 'top' if scale_side == 'bottom' else 'bottom' + self.scale.pack(side=scale_side, fill='x') + tmp = Label(self).pack(side=label_side) # place holder + self.label.place(anchor='n' if label_side == 'top' else 's') + + # update the label as scale or variable changes + self.__tracecb = self._variable.trace_variable('w', self._adjust) + self.bind('<Configure>', self._adjust) + self.bind('<Map>', self._adjust) + + + def destroy(self): + """Destroy this widget and possibly its associated variable.""" + try: + self._variable.trace_vdelete('w', self.__tracecb) + except AttributeError: + # widget has been destroyed already + pass + else: + del self._variable + Frame.destroy(self) + self.label = None + self.scale = None + + + def _adjust(self, *args): + """Adjust the label position according to the scale.""" + def adjust_label(): + self.update_idletasks() # "force" scale redraw + + x, y = self.scale.coords() + if self._label_top: + y = self.scale.winfo_y() - self.label.winfo_reqheight() + else: + y = self.scale.winfo_reqheight() + self.label.winfo_reqheight() + + self.label.place_configure(x=x, y=y) + + from_ = _to_number(self.scale['from']) + to = _to_number(self.scale['to']) + if to < from_: + from_, to = to, from_ + newval = self._variable.get() + if not from_ <= newval <= to: + # value outside range, set value back to the last valid one + self.value = self._last_valid + return + + self._last_valid = newval + self.label['text'] = newval + self.after_idle(adjust_label) + + + def _get_value(self): + """Return current scale value.""" + return self._variable.get() + + + def _set_value(self, val): + """Set new scale value.""" + self._variable.set(val) + + + value = property(_get_value, _set_value) + + +class OptionMenu(Menubutton): + """Themed OptionMenu, based after Tkinter's OptionMenu, which allows + the user to select a value from a menu.""" + + def __init__(self, master, variable, default=None, *values, **kwargs): + """Construct a themed OptionMenu widget with master as the parent, + the resource textvariable set to variable, the initially selected + value specified by the default parameter, the menu values given by + *values and additional keywords. + + WIDGET-SPECIFIC OPTIONS + + style: stylename + Menubutton style. + direction: 'above', 'below', 'left', 'right', or 'flush' + Menubutton direction. + command: callback + A callback that will be invoked after selecting an item. + """ + kw = {'textvariable': variable, 'style': kwargs.pop('style', None), + 'direction': kwargs.pop('direction', None)} + Menubutton.__init__(self, master, **kw) + self['menu'] = Tkinter.Menu(self, tearoff=False) + + self._variable = variable + self._callback = kwargs.pop('command', None) + if kwargs: + raise Tkinter.TclError('unknown option -%s' % ( + kwargs.iterkeys().next())) + + self.set_menu(default, *values) + + + def __getitem__(self, item): + if item == 'menu': + return self.nametowidget(Menubutton.__getitem__(self, item)) + + return Menubutton.__getitem__(self, item) + + + def set_menu(self, default=None, *values): + """Build a new menu of radiobuttons with *values and optionally + a default value.""" + menu = self['menu'] + menu.delete(0, 'end') + for val in values: + menu.add_radiobutton(label=val, + command=Tkinter._setit(self._variable, val, self._callback), + variable=self._variable) + + if default: + self._variable.set(default) + + + def destroy(self): + """Destroy this widget and its associated variable.""" + try: + del self._variable + except AttributeError: + pass + Menubutton.destroy(self) diff --git a/contrib/tools/python/src/Lib/lib-tk/turtle.py b/contrib/tools/python/src/Lib/lib-tk/turtle.py new file mode 100644 index 0000000000..ae921ce2e5 --- /dev/null +++ b/contrib/tools/python/src/Lib/lib-tk/turtle.py @@ -0,0 +1,4034 @@ +# +# turtle.py: a Tkinter based turtle graphics module for Python +# Version 1.0.1 - 24. 9. 2009 +# +# Copyright (C) 2006 - 2010 Gregor Lingl +# email: glingl@aon.at +# +# This software is provided 'as-is', without any express or implied +# warranty. In no event will the authors be held liable for any damages +# arising from the use of this software. +# +# Permission is granted to anyone to use this software for any purpose, +# including commercial applications, and to alter it and redistribute it +# freely, subject to the following restrictions: +# +# 1. The origin of this software must not be misrepresented; you must not +# claim that you wrote the original software. If you use this software +# in a product, an acknowledgment in the product documentation would be +# appreciated but is not required. +# 2. Altered source versions must be plainly marked as such, and must not be +# misrepresented as being the original software. +# 3. This notice may not be removed or altered from any source distribution. + + +""" +Turtle graphics is a popular way for introducing programming to +kids. It was part of the original Logo programming language developed +by Wally Feurzig and Seymour Papert in 1966. + +Imagine a robotic turtle starting at (0, 0) in the x-y plane. After an ``import turtle``, give it +the command turtle.forward(15), and it moves (on-screen!) 15 pixels in +the direction it is facing, drawing a line as it moves. Give it the +command turtle.right(25), and it rotates in-place 25 degrees clockwise. + +By combining together these and similar commands, intricate shapes and +pictures can easily be drawn. + +----- turtle.py + +This module is an extended reimplementation of turtle.py from the +Python standard distribution up to Python 2.5. (See: http://www.python.org) + +It tries to keep the merits of turtle.py and to be (nearly) 100% +compatible with it. This means in the first place to enable the +learning programmer to use all the commands, classes and methods +interactively when using the module from within IDLE run with +the -n switch. + +Roughly it has the following features added: + +- Better animation of the turtle movements, especially of turning the + turtle. So the turtles can more easily be used as a visual feedback + instrument by the (beginning) programmer. + +- Different turtle shapes, gif-images as turtle shapes, user defined + and user controllable turtle shapes, among them compound + (multicolored) shapes. Turtle shapes can be stretched and tilted, which + makes turtles very versatile geometrical objects. + +- Fine control over turtle movement and screen updates via delay(), + and enhanced tracer() and speed() methods. + +- Aliases for the most commonly used commands, like fd for forward etc., + following the early Logo traditions. This reduces the boring work of + typing long sequences of commands, which often occur in a natural way + when kids try to program fancy pictures on their first encounter with + turtle graphics. + +- Turtles now have an undo()-method with configurable undo-buffer. + +- Some simple commands/methods for creating event driven programs + (mouse-, key-, timer-events). Especially useful for programming games. + +- A scrollable Canvas class. The default scrollable Canvas can be + extended interactively as needed while playing around with the turtle(s). + +- A TurtleScreen class with methods controlling background color or + background image, window and canvas size and other properties of the + TurtleScreen. + +- There is a method, setworldcoordinates(), to install a user defined + coordinate-system for the TurtleScreen. + +- The implementation uses a 2-vector class named Vec2D, derived from tuple. + This class is public, so it can be imported by the application programmer, + which makes certain types of computations very natural and compact. + +- Appearance of the TurtleScreen and the Turtles at startup/import can be + configured by means of a turtle.cfg configuration file. + The default configuration mimics the appearance of the old turtle module. + +- If configured appropriately the module reads in docstrings from a docstring + dictionary in some different language, supplied separately and replaces + the English ones by those read in. There is a utility function + write_docstringdict() to write a dictionary with the original (English) + docstrings to disc, so it can serve as a template for translations. + +Behind the scenes there are some features included with possible +extensions in mind. These will be commented and documented elsewhere. + +""" + +_ver = "turtle 1.0b1 - for Python 2.6 - 30. 5. 2008, 18:08" + +#print _ver + +import Tkinter as TK +import types +import math +import time +import os + +from os.path import isfile, split, join +from copy import deepcopy + +from math import * ## for compatibility with old turtle module + +_tg_classes = ['ScrolledCanvas', 'TurtleScreen', 'Screen', + 'RawTurtle', 'Turtle', 'RawPen', 'Pen', 'Shape', 'Vec2D'] +_tg_screen_functions = ['addshape', 'bgcolor', 'bgpic', 'bye', + 'clearscreen', 'colormode', 'delay', 'exitonclick', 'getcanvas', + 'getshapes', 'listen', 'mode', 'onkey', 'onscreenclick', 'ontimer', + 'register_shape', 'resetscreen', 'screensize', 'setup', + 'setworldcoordinates', 'title', 'tracer', 'turtles', 'update', + 'window_height', 'window_width'] +_tg_turtle_functions = ['back', 'backward', 'begin_fill', 'begin_poly', 'bk', + 'circle', 'clear', 'clearstamp', 'clearstamps', 'clone', 'color', + 'degrees', 'distance', 'dot', 'down', 'end_fill', 'end_poly', 'fd', + 'fill', 'fillcolor', 'forward', 'get_poly', 'getpen', 'getscreen', + 'getturtle', 'goto', 'heading', 'hideturtle', 'home', 'ht', 'isdown', + 'isvisible', 'left', 'lt', 'onclick', 'ondrag', 'onrelease', 'pd', + 'pen', 'pencolor', 'pendown', 'pensize', 'penup', 'pos', 'position', + 'pu', 'radians', 'right', 'reset', 'resizemode', 'rt', + 'seth', 'setheading', 'setpos', 'setposition', 'settiltangle', + 'setundobuffer', 'setx', 'sety', 'shape', 'shapesize', 'showturtle', + 'speed', 'st', 'stamp', 'tilt', 'tiltangle', 'towards', 'tracer', + 'turtlesize', 'undo', 'undobufferentries', 'up', 'width', + 'window_height', 'window_width', 'write', 'xcor', 'ycor'] +_tg_utilities = ['write_docstringdict', 'done', 'mainloop'] +_math_functions = ['acos', 'asin', 'atan', 'atan2', 'ceil', 'cos', 'cosh', + 'e', 'exp', 'fabs', 'floor', 'fmod', 'frexp', 'hypot', 'ldexp', 'log', + 'log10', 'modf', 'pi', 'pow', 'sin', 'sinh', 'sqrt', 'tan', 'tanh'] + +__all__ = (_tg_classes + _tg_screen_functions + _tg_turtle_functions + + _tg_utilities + ['Terminator'] + _math_functions) + +_alias_list = ['addshape', 'backward', 'bk', 'fd', 'ht', 'lt', 'pd', 'pos', + 'pu', 'rt', 'seth', 'setpos', 'setposition', 'st', + 'turtlesize', 'up', 'width'] + +_CFG = {"width" : 0.5, # Screen + "height" : 0.75, + "canvwidth" : 400, + "canvheight": 300, + "leftright": None, + "topbottom": None, + "mode": "standard", # TurtleScreen + "colormode": 1.0, + "delay": 10, + "undobuffersize": 1000, # RawTurtle + "shape": "classic", + "pencolor" : "black", + "fillcolor" : "black", + "resizemode" : "noresize", + "visible" : True, + "language": "english", # docstrings + "exampleturtle": "turtle", + "examplescreen": "screen", + "title": "Python Turtle Graphics", + "using_IDLE": False + } + +##print "cwd:", os.getcwd() +##print "__file__:", __file__ +## +##def show(dictionary): +## print "==========================" +## for key in sorted(dictionary.keys()): +## print key, ":", dictionary[key] +## print "==========================" +## print + +def config_dict(filename): + """Convert content of config-file into dictionary.""" + f = open(filename, "r") + cfglines = f.readlines() + f.close() + cfgdict = {} + for line in cfglines: + line = line.strip() + if not line or line.startswith("#"): + continue + try: + key, value = line.split("=") + except ValueError: + print "Bad line in config-file %s:\n%s" % (filename,line) + continue + key = key.strip() + value = value.strip() + if value in ["True", "False", "None", "''", '""']: + value = eval(value) + else: + try: + if "." in value: + value = float(value) + else: + value = int(value) + except ValueError: + pass # value need not be converted + cfgdict[key] = value + return cfgdict + +def readconfig(cfgdict): + """Read config-files, change configuration-dict accordingly. + + If there is a turtle.cfg file in the current working directory, + read it from there. If this contains an importconfig-value, + say 'myway', construct filename turtle_mayway.cfg else use + turtle.cfg and read it from the import-directory, where + turtle.py is located. + Update configuration dictionary first according to config-file, + in the import directory, then according to config-file in the + current working directory. + If no config-file is found, the default configuration is used. + """ + default_cfg = "turtle.cfg" + cfgdict1 = {} + cfgdict2 = {} + if isfile(default_cfg): + cfgdict1 = config_dict(default_cfg) + #print "1. Loading config-file %s from: %s" % (default_cfg, os.getcwd()) + if "importconfig" in cfgdict1: + default_cfg = "turtle_%s.cfg" % cfgdict1["importconfig"] + try: + head, tail = split(__file__) + cfg_file2 = join(head, default_cfg) + except BaseException: + cfg_file2 = "" + if isfile(cfg_file2): + #print "2. Loading config-file %s:" % cfg_file2 + cfgdict2 = config_dict(cfg_file2) +## show(_CFG) +## show(cfgdict2) + _CFG.update(cfgdict2) +## show(_CFG) +## show(cfgdict1) + _CFG.update(cfgdict1) +## show(_CFG) + +try: + readconfig(_CFG) +except BaseException: + print "No configfile read, reason unknown" + + +class Vec2D(tuple): + """A 2 dimensional vector class, used as a helper class + for implementing turtle graphics. + May be useful for turtle graphics programs also. + Derived from tuple, so a vector is a tuple! + + Provides (for a, b vectors, k number): + a+b vector addition + a-b vector subtraction + a*b inner product + k*a and a*k multiplication with scalar + |a| absolute value of a + a.rotate(angle) rotation + """ + def __new__(cls, x, y): + return tuple.__new__(cls, (x, y)) + def __add__(self, other): + return Vec2D(self[0]+other[0], self[1]+other[1]) + def __mul__(self, other): + if isinstance(other, Vec2D): + return self[0]*other[0]+self[1]*other[1] + return Vec2D(self[0]*other, self[1]*other) + def __rmul__(self, other): + if isinstance(other, (int, long, float)): + return Vec2D(self[0]*other, self[1]*other) + def __sub__(self, other): + return Vec2D(self[0]-other[0], self[1]-other[1]) + def __neg__(self): + return Vec2D(-self[0], -self[1]) + def __abs__(self): + return (self[0]**2 + self[1]**2)**0.5 + def rotate(self, angle): + """rotate self counterclockwise by angle + """ + perp = Vec2D(-self[1], self[0]) + angle = angle * math.pi / 180.0 + c, s = math.cos(angle), math.sin(angle) + return Vec2D(self[0]*c+perp[0]*s, self[1]*c+perp[1]*s) + def __getnewargs__(self): + return (self[0], self[1]) + def __repr__(self): + return "(%.2f,%.2f)" % self + + +############################################################################## +### From here up to line : Tkinter - Interface for turtle.py ### +### May be replaced by an interface to some different graphics toolkit ### +############################################################################## + +## helper functions for Scrolled Canvas, to forward Canvas-methods +## to ScrolledCanvas class + +def __methodDict(cls, _dict): + """helper function for Scrolled Canvas""" + baseList = list(cls.__bases__) + baseList.reverse() + for _super in baseList: + __methodDict(_super, _dict) + for key, value in cls.__dict__.items(): + if type(value) == types.FunctionType: + _dict[key] = value + +def __methods(cls): + """helper function for Scrolled Canvas""" + _dict = {} + __methodDict(cls, _dict) + return _dict.keys() + +__stringBody = ( + 'def %(method)s(self, *args, **kw): return ' + + 'self.%(attribute)s.%(method)s(*args, **kw)') + +def __forwardmethods(fromClass, toClass, toPart, exclude = ()): + """Helper functions for Scrolled Canvas, used to forward + ScrolledCanvas-methods to Tkinter.Canvas class. + """ + _dict = {} + __methodDict(toClass, _dict) + for ex in _dict.keys(): + if ex[:1] == '_' or ex[-1:] == '_': + del _dict[ex] + for ex in exclude: + if ex in _dict: + del _dict[ex] + for ex in __methods(fromClass): + if ex in _dict: + del _dict[ex] + + for method, func in _dict.items(): + d = {'method': method, 'func': func} + if type(toPart) == types.StringType: + execString = \ + __stringBody % {'method' : method, 'attribute' : toPart} + exec execString in d + fromClass.__dict__[method] = d[method] + + +class ScrolledCanvas(TK.Frame): + """Modeled after the scrolled canvas class from Grayons's Tkinter book. + + Used as the default canvas, which pops up automatically when + using turtle graphics functions or the Turtle class. + """ + def __init__(self, master, width=500, height=350, + canvwidth=600, canvheight=500): + TK.Frame.__init__(self, master, width=width, height=height) + self._rootwindow = self.winfo_toplevel() + self.width, self.height = width, height + self.canvwidth, self.canvheight = canvwidth, canvheight + self.bg = "white" + self._canvas = TK.Canvas(master, width=width, height=height, + bg=self.bg, relief=TK.SUNKEN, borderwidth=2) + self.hscroll = TK.Scrollbar(master, command=self._canvas.xview, + orient=TK.HORIZONTAL) + self.vscroll = TK.Scrollbar(master, command=self._canvas.yview) + self._canvas.configure(xscrollcommand=self.hscroll.set, + yscrollcommand=self.vscroll.set) + self.rowconfigure(0, weight=1, minsize=0) + self.columnconfigure(0, weight=1, minsize=0) + self._canvas.grid(padx=1, in_ = self, pady=1, row=0, + column=0, rowspan=1, columnspan=1, sticky='news') + self.vscroll.grid(padx=1, in_ = self, pady=1, row=0, + column=1, rowspan=1, columnspan=1, sticky='news') + self.hscroll.grid(padx=1, in_ = self, pady=1, row=1, + column=0, rowspan=1, columnspan=1, sticky='news') + self.reset() + self._rootwindow.bind('<Configure>', self.onResize) + + def reset(self, canvwidth=None, canvheight=None, bg = None): + """Adjust canvas and scrollbars according to given canvas size.""" + if canvwidth: + self.canvwidth = canvwidth + if canvheight: + self.canvheight = canvheight + if bg: + self.bg = bg + self._canvas.config(bg=bg, + scrollregion=(-self.canvwidth//2, -self.canvheight//2, + self.canvwidth//2, self.canvheight//2)) + self._canvas.xview_moveto(0.5*(self.canvwidth - self.width + 30) / + self.canvwidth) + self._canvas.yview_moveto(0.5*(self.canvheight- self.height + 30) / + self.canvheight) + self.adjustScrolls() + + + def adjustScrolls(self): + """ Adjust scrollbars according to window- and canvas-size. + """ + cwidth = self._canvas.winfo_width() + cheight = self._canvas.winfo_height() + self._canvas.xview_moveto(0.5*(self.canvwidth-cwidth)/self.canvwidth) + self._canvas.yview_moveto(0.5*(self.canvheight-cheight)/self.canvheight) + if cwidth < self.canvwidth or cheight < self.canvheight: + self.hscroll.grid(padx=1, in_ = self, pady=1, row=1, + column=0, rowspan=1, columnspan=1, sticky='news') + self.vscroll.grid(padx=1, in_ = self, pady=1, row=0, + column=1, rowspan=1, columnspan=1, sticky='news') + else: + self.hscroll.grid_forget() + self.vscroll.grid_forget() + + def onResize(self, event): + """self-explanatory""" + self.adjustScrolls() + + def bbox(self, *args): + """ 'forward' method, which canvas itself has inherited... + """ + return self._canvas.bbox(*args) + + def cget(self, *args, **kwargs): + """ 'forward' method, which canvas itself has inherited... + """ + return self._canvas.cget(*args, **kwargs) + + def config(self, *args, **kwargs): + """ 'forward' method, which canvas itself has inherited... + """ + self._canvas.config(*args, **kwargs) + + def bind(self, *args, **kwargs): + """ 'forward' method, which canvas itself has inherited... + """ + self._canvas.bind(*args, **kwargs) + + def unbind(self, *args, **kwargs): + """ 'forward' method, which canvas itself has inherited... + """ + self._canvas.unbind(*args, **kwargs) + + def focus_force(self): + """ 'forward' method, which canvas itself has inherited... + """ + self._canvas.focus_force() + +__forwardmethods(ScrolledCanvas, TK.Canvas, '_canvas') + + +class _Root(TK.Tk): + """Root class for Screen based on Tkinter.""" + def __init__(self): + TK.Tk.__init__(self) + + def setupcanvas(self, width, height, cwidth, cheight): + self._canvas = ScrolledCanvas(self, width, height, cwidth, cheight) + self._canvas.pack(expand=1, fill="both") + + def _getcanvas(self): + return self._canvas + + def set_geometry(self, width, height, startx, starty): + self.geometry("%dx%d%+d%+d"%(width, height, startx, starty)) + + def ondestroy(self, destroy): + self.wm_protocol("WM_DELETE_WINDOW", destroy) + + def win_width(self): + return self.winfo_screenwidth() + + def win_height(self): + return self.winfo_screenheight() + +Canvas = TK.Canvas + + +class TurtleScreenBase(object): + """Provide the basic graphics functionality. + Interface between Tkinter and turtle.py. + + To port turtle.py to some different graphics toolkit + a corresponding TurtleScreenBase class has to be implemented. + """ + + @staticmethod + def _blankimage(): + """return a blank image object + """ + img = TK.PhotoImage(width=1, height=1) + img.blank() + return img + + @staticmethod + def _image(filename): + """return an image object containing the + imagedata from a gif-file named filename. + """ + return TK.PhotoImage(file=filename) + + def __init__(self, cv): + self.cv = cv + if isinstance(cv, ScrolledCanvas): + w = self.cv.canvwidth + h = self.cv.canvheight + else: # expected: ordinary TK.Canvas + w = int(self.cv.cget("width")) + h = int(self.cv.cget("height")) + self.cv.config(scrollregion = (-w//2, -h//2, w//2, h//2 )) + self.canvwidth = w + self.canvheight = h + self.xscale = self.yscale = 1.0 + + def _createpoly(self): + """Create an invisible polygon item on canvas self.cv) + """ + return self.cv.create_polygon((0, 0, 0, 0, 0, 0), fill="", outline="") + + def _drawpoly(self, polyitem, coordlist, fill=None, + outline=None, width=None, top=False): + """Configure polygonitem polyitem according to provided + arguments: + coordlist is sequence of coordinates + fill is filling color + outline is outline color + top is a boolean value, which specifies if polyitem + will be put on top of the canvas' displaylist so it + will not be covered by other items. + """ + cl = [] + for x, y in coordlist: + cl.append(x * self.xscale) + cl.append(-y * self.yscale) + self.cv.coords(polyitem, *cl) + if fill is not None: + self.cv.itemconfigure(polyitem, fill=fill) + if outline is not None: + self.cv.itemconfigure(polyitem, outline=outline) + if width is not None: + self.cv.itemconfigure(polyitem, width=width) + if top: + self.cv.tag_raise(polyitem) + + def _createline(self): + """Create an invisible line item on canvas self.cv) + """ + return self.cv.create_line(0, 0, 0, 0, fill="", width=2, + capstyle = TK.ROUND) + + def _drawline(self, lineitem, coordlist=None, + fill=None, width=None, top=False): + """Configure lineitem according to provided arguments: + coordlist is sequence of coordinates + fill is drawing color + width is width of drawn line. + top is a boolean value, which specifies if polyitem + will be put on top of the canvas' displaylist so it + will not be covered by other items. + """ + if coordlist is not None: + cl = [] + for x, y in coordlist: + cl.append(x * self.xscale) + cl.append(-y * self.yscale) + self.cv.coords(lineitem, *cl) + if fill is not None: + self.cv.itemconfigure(lineitem, fill=fill) + if width is not None: + self.cv.itemconfigure(lineitem, width=width) + if top: + self.cv.tag_raise(lineitem) + + def _delete(self, item): + """Delete graphics item from canvas. + If item is"all" delete all graphics items. + """ + self.cv.delete(item) + + def _update(self): + """Redraw graphics items on canvas + """ + self.cv.update() + + def _delay(self, delay): + """Delay subsequent canvas actions for delay ms.""" + self.cv.after(delay) + + def _iscolorstring(self, color): + """Check if the string color is a legal Tkinter color string. + """ + try: + rgb = self.cv.winfo_rgb(color) + ok = True + except TK.TclError: + ok = False + return ok + + def _bgcolor(self, color=None): + """Set canvas' backgroundcolor if color is not None, + else return backgroundcolor.""" + if color is not None: + self.cv.config(bg = color) + self._update() + else: + return self.cv.cget("bg") + + def _write(self, pos, txt, align, font, pencolor): + """Write txt at pos in canvas with specified font + and color. + Return text item and x-coord of right bottom corner + of text's bounding box.""" + x, y = pos + x = x * self.xscale + y = y * self.yscale + anchor = {"left":"sw", "center":"s", "right":"se" } + item = self.cv.create_text(x-1, -y, text = txt, anchor = anchor[align], + fill = pencolor, font = font) + x0, y0, x1, y1 = self.cv.bbox(item) + self.cv.update() + return item, x1-1 + +## def _dot(self, pos, size, color): +## """may be implemented for some other graphics toolkit""" + + def _onclick(self, item, fun, num=1, add=None): + """Bind fun to mouse-click event on turtle. + fun must be a function with two arguments, the coordinates + of the clicked point on the canvas. + num, the number of the mouse-button defaults to 1 + """ + if fun is None: + self.cv.tag_unbind(item, "<Button-%s>" % num) + else: + def eventfun(event): + x, y = (self.cv.canvasx(event.x)/self.xscale, + -self.cv.canvasy(event.y)/self.yscale) + fun(x, y) + self.cv.tag_bind(item, "<Button-%s>" % num, eventfun, add) + + def _onrelease(self, item, fun, num=1, add=None): + """Bind fun to mouse-button-release event on turtle. + fun must be a function with two arguments, the coordinates + of the point on the canvas where mouse button is released. + num, the number of the mouse-button defaults to 1 + + If a turtle is clicked, first _onclick-event will be performed, + then _onscreensclick-event. + """ + if fun is None: + self.cv.tag_unbind(item, "<Button%s-ButtonRelease>" % num) + else: + def eventfun(event): + x, y = (self.cv.canvasx(event.x)/self.xscale, + -self.cv.canvasy(event.y)/self.yscale) + fun(x, y) + self.cv.tag_bind(item, "<Button%s-ButtonRelease>" % num, + eventfun, add) + + def _ondrag(self, item, fun, num=1, add=None): + """Bind fun to mouse-move-event (with pressed mouse button) on turtle. + fun must be a function with two arguments, the coordinates of the + actual mouse position on the canvas. + num, the number of the mouse-button defaults to 1 + + Every sequence of mouse-move-events on a turtle is preceded by a + mouse-click event on that turtle. + """ + if fun is None: + self.cv.tag_unbind(item, "<Button%s-Motion>" % num) + else: + def eventfun(event): + try: + x, y = (self.cv.canvasx(event.x)/self.xscale, + -self.cv.canvasy(event.y)/self.yscale) + fun(x, y) + except BaseException: + pass + self.cv.tag_bind(item, "<Button%s-Motion>" % num, eventfun, add) + + def _onscreenclick(self, fun, num=1, add=None): + """Bind fun to mouse-click event on canvas. + fun must be a function with two arguments, the coordinates + of the clicked point on the canvas. + num, the number of the mouse-button defaults to 1 + + If a turtle is clicked, first _onclick-event will be performed, + then _onscreensclick-event. + """ + if fun is None: + self.cv.unbind("<Button-%s>" % num) + else: + def eventfun(event): + x, y = (self.cv.canvasx(event.x)/self.xscale, + -self.cv.canvasy(event.y)/self.yscale) + fun(x, y) + self.cv.bind("<Button-%s>" % num, eventfun, add) + + def _onkey(self, fun, key): + """Bind fun to key-release event of key. + Canvas must have focus. See method listen + """ + if fun is None: + self.cv.unbind("<KeyRelease-%s>" % key, None) + else: + def eventfun(event): + fun() + self.cv.bind("<KeyRelease-%s>" % key, eventfun) + + def _listen(self): + """Set focus on canvas (in order to collect key-events) + """ + self.cv.focus_force() + + def _ontimer(self, fun, t): + """Install a timer, which calls fun after t milliseconds. + """ + if t == 0: + self.cv.after_idle(fun) + else: + self.cv.after(t, fun) + + def _createimage(self, image): + """Create and return image item on canvas. + """ + return self.cv.create_image(0, 0, image=image) + + def _drawimage(self, item, pos, image): + """Configure image item as to draw image object + at position (x,y) on canvas) + """ + x, y = pos + self.cv.coords(item, (x * self.xscale, -y * self.yscale)) + self.cv.itemconfig(item, image=image) + + def _setbgpic(self, item, image): + """Configure image item as to draw image object + at center of canvas. Set item to the first item + in the displaylist, so it will be drawn below + any other item .""" + self.cv.itemconfig(item, image=image) + self.cv.tag_lower(item) + + def _type(self, item): + """Return 'line' or 'polygon' or 'image' depending on + type of item. + """ + return self.cv.type(item) + + def _pointlist(self, item): + """returns list of coordinate-pairs of points of item + Example (for insiders): + >>> from turtle import * + >>> getscreen()._pointlist(getturtle().turtle._item) + [(0.0, 9.9999999999999982), (0.0, -9.9999999999999982), + (9.9999999999999982, 0.0)] + >>> """ + cl = self.cv.coords(item) + pl = [(cl[i], -cl[i+1]) for i in range(0, len(cl), 2)] + return pl + + def _setscrollregion(self, srx1, sry1, srx2, sry2): + self.cv.config(scrollregion=(srx1, sry1, srx2, sry2)) + + def _rescale(self, xscalefactor, yscalefactor): + items = self.cv.find_all() + for item in items: + coordinates = self.cv.coords(item) + newcoordlist = [] + while coordinates: + x, y = coordinates[:2] + newcoordlist.append(x * xscalefactor) + newcoordlist.append(y * yscalefactor) + coordinates = coordinates[2:] + self.cv.coords(item, *newcoordlist) + + def _resize(self, canvwidth=None, canvheight=None, bg=None): + """Resize the canvas the turtles are drawing on. Does + not alter the drawing window. + """ + # needs amendment + if not isinstance(self.cv, ScrolledCanvas): + return self.canvwidth, self.canvheight + if canvwidth is canvheight is bg is None: + return self.cv.canvwidth, self.cv.canvheight + if canvwidth is not None: + self.canvwidth = canvwidth + if canvheight is not None: + self.canvheight = canvheight + self.cv.reset(canvwidth, canvheight, bg) + + def _window_size(self): + """ Return the width and height of the turtle window. + """ + width = self.cv.winfo_width() + if width <= 1: # the window isn't managed by a geometry manager + width = self.cv['width'] + height = self.cv.winfo_height() + if height <= 1: # the window isn't managed by a geometry manager + height = self.cv['height'] + return width, height + + +############################################################################## +### End of Tkinter - interface ### +############################################################################## + + +class Terminator (Exception): + """Will be raised in TurtleScreen.update, if _RUNNING becomes False. + + This stops execution of a turtle graphics script. + Main purpose: use in the Demo-Viewer turtle.Demo.py. + """ + pass + + +class TurtleGraphicsError(Exception): + """Some TurtleGraphics Error + """ + + +class Shape(object): + """Data structure modeling shapes. + + attribute _type is one of "polygon", "image", "compound" + attribute _data is - depending on _type a poygon-tuple, + an image or a list constructed using the addcomponent method. + """ + def __init__(self, type_, data=None): + self._type = type_ + if type_ == "polygon": + if isinstance(data, list): + data = tuple(data) + elif type_ == "image": + if isinstance(data, basestring): + if data.lower().endswith(".gif") and isfile(data): + data = TurtleScreen._image(data) + # else data assumed to be Photoimage + elif type_ == "compound": + data = [] + else: + raise TurtleGraphicsError("There is no shape type %s" % type_) + self._data = data + + def addcomponent(self, poly, fill, outline=None): + """Add component to a shape of type compound. + + Arguments: poly is a polygon, i. e. a tuple of number pairs. + fill is the fillcolor of the component, + outline is the outline color of the component. + + call (for a Shapeobject namend s): + -- s.addcomponent(((0,0), (10,10), (-10,10)), "red", "blue") + + Example: + >>> poly = ((0,0),(10,-5),(0,10),(-10,-5)) + >>> s = Shape("compound") + >>> s.addcomponent(poly, "red", "blue") + >>> # .. add more components and then use register_shape() + """ + if self._type != "compound": + raise TurtleGraphicsError("Cannot add component to %s Shape" + % self._type) + if outline is None: + outline = fill + self._data.append([poly, fill, outline]) + + +class Tbuffer(object): + """Ring buffer used as undobuffer for RawTurtle objects.""" + def __init__(self, bufsize=10): + self.bufsize = bufsize + self.buffer = [[None]] * bufsize + self.ptr = -1 + self.cumulate = False + def reset(self, bufsize=None): + if bufsize is None: + for i in range(self.bufsize): + self.buffer[i] = [None] + else: + self.bufsize = bufsize + self.buffer = [[None]] * bufsize + self.ptr = -1 + def push(self, item): + if self.bufsize > 0: + if not self.cumulate: + self.ptr = (self.ptr + 1) % self.bufsize + self.buffer[self.ptr] = item + else: + self.buffer[self.ptr].append(item) + def pop(self): + if self.bufsize > 0: + item = self.buffer[self.ptr] + if item is None: + return None + else: + self.buffer[self.ptr] = [None] + self.ptr = (self.ptr - 1) % self.bufsize + return (item) + def nr_of_items(self): + return self.bufsize - self.buffer.count([None]) + def __repr__(self): + return str(self.buffer) + " " + str(self.ptr) + + + +class TurtleScreen(TurtleScreenBase): + """Provides screen oriented methods like setbg etc. + + Only relies upon the methods of TurtleScreenBase and NOT + upon components of the underlying graphics toolkit - + which is Tkinter in this case. + """ +# _STANDARD_DELAY = 5 + _RUNNING = True + + def __init__(self, cv, mode=_CFG["mode"], + colormode=_CFG["colormode"], delay=_CFG["delay"]): + self._shapes = { + "arrow" : Shape("polygon", ((-10,0), (10,0), (0,10))), + "turtle" : Shape("polygon", ((0,16), (-2,14), (-1,10), (-4,7), + (-7,9), (-9,8), (-6,5), (-7,1), (-5,-3), (-8,-6), + (-6,-8), (-4,-5), (0,-7), (4,-5), (6,-8), (8,-6), + (5,-3), (7,1), (6,5), (9,8), (7,9), (4,7), (1,10), + (2,14))), + "circle" : Shape("polygon", ((10,0), (9.51,3.09), (8.09,5.88), + (5.88,8.09), (3.09,9.51), (0,10), (-3.09,9.51), + (-5.88,8.09), (-8.09,5.88), (-9.51,3.09), (-10,0), + (-9.51,-3.09), (-8.09,-5.88), (-5.88,-8.09), + (-3.09,-9.51), (-0.00,-10.00), (3.09,-9.51), + (5.88,-8.09), (8.09,-5.88), (9.51,-3.09))), + "square" : Shape("polygon", ((10,-10), (10,10), (-10,10), + (-10,-10))), + "triangle" : Shape("polygon", ((10,-5.77), (0,11.55), + (-10,-5.77))), + "classic": Shape("polygon", ((0,0),(-5,-9),(0,-7),(5,-9))), + "blank" : Shape("image", self._blankimage()) + } + + self._bgpics = {"nopic" : ""} + + TurtleScreenBase.__init__(self, cv) + self._mode = mode + self._delayvalue = delay + self._colormode = _CFG["colormode"] + self._keys = [] + self.clear() + + def clear(self): + """Delete all drawings and all turtles from the TurtleScreen. + + Reset empty TurtleScreen to its initial state: white background, + no backgroundimage, no eventbindings and tracing on. + + No argument. + + Example (for a TurtleScreen instance named screen): + >>> screen.clear() + + Note: this method is not available as function. + """ + self._delayvalue = _CFG["delay"] + self._colormode = _CFG["colormode"] + self._delete("all") + self._bgpic = self._createimage("") + self._bgpicname = "nopic" + self._tracing = 1 + self._updatecounter = 0 + self._turtles = [] + self.bgcolor("white") + for btn in 1, 2, 3: + self.onclick(None, btn) + for key in self._keys[:]: + self.onkey(None, key) + Turtle._pen = None + + def mode(self, mode=None): + """Set turtle-mode ('standard', 'logo' or 'world') and perform reset. + + Optional argument: + mode -- one of the strings 'standard', 'logo' or 'world' + + Mode 'standard' is compatible with turtle.py. + Mode 'logo' is compatible with most Logo-Turtle-Graphics. + Mode 'world' uses userdefined 'worldcoordinates'. *Attention*: in + this mode angles appear distorted if x/y unit-ratio doesn't equal 1. + If mode is not given, return the current mode. + + Mode Initial turtle heading positive angles + ------------|-------------------------|------------------- + 'standard' to the right (east) counterclockwise + 'logo' upward (north) clockwise + + Examples: + >>> mode('logo') # resets turtle heading to north + >>> mode() + 'logo' + """ + if mode is None: + return self._mode + mode = mode.lower() + if mode not in ["standard", "logo", "world"]: + raise TurtleGraphicsError("No turtle-graphics-mode %s" % mode) + self._mode = mode + if mode in ["standard", "logo"]: + self._setscrollregion(-self.canvwidth//2, -self.canvheight//2, + self.canvwidth//2, self.canvheight//2) + self.xscale = self.yscale = 1.0 + self.reset() + + def setworldcoordinates(self, llx, lly, urx, ury): + """Set up a user defined coordinate-system. + + Arguments: + llx -- a number, x-coordinate of lower left corner of canvas + lly -- a number, y-coordinate of lower left corner of canvas + urx -- a number, x-coordinate of upper right corner of canvas + ury -- a number, y-coordinate of upper right corner of canvas + + Set up user coodinat-system and switch to mode 'world' if necessary. + This performs a screen.reset. If mode 'world' is already active, + all drawings are redrawn according to the new coordinates. + + But ATTENTION: in user-defined coordinatesystems angles may appear + distorted. (see Screen.mode()) + + Example (for a TurtleScreen instance named screen): + >>> screen.setworldcoordinates(-10,-0.5,50,1.5) + >>> for _ in range(36): + ... left(10) + ... forward(0.5) + """ + if self.mode() != "world": + self.mode("world") + xspan = float(urx - llx) + yspan = float(ury - lly) + wx, wy = self._window_size() + self.screensize(wx-20, wy-20) + oldxscale, oldyscale = self.xscale, self.yscale + self.xscale = self.canvwidth / xspan + self.yscale = self.canvheight / yspan + srx1 = llx * self.xscale + sry1 = -ury * self.yscale + srx2 = self.canvwidth + srx1 + sry2 = self.canvheight + sry1 + self._setscrollregion(srx1, sry1, srx2, sry2) + self._rescale(self.xscale/oldxscale, self.yscale/oldyscale) + self.update() + + def register_shape(self, name, shape=None): + """Adds a turtle shape to TurtleScreen's shapelist. + + Arguments: + (1) name is the name of a gif-file and shape is None. + Installs the corresponding image shape. + !! Image-shapes DO NOT rotate when turning the turtle, + !! so they do not display the heading of the turtle! + (2) name is an arbitrary string and shape is a tuple + of pairs of coordinates. Installs the corresponding + polygon shape + (3) name is an arbitrary string and shape is a + (compound) Shape object. Installs the corresponding + compound shape. + To use a shape, you have to issue the command shape(shapename). + + call: register_shape("turtle.gif") + --or: register_shape("tri", ((0,0), (10,10), (-10,10))) + + Example (for a TurtleScreen instance named screen): + >>> screen.register_shape("triangle", ((5,-3),(0,5),(-5,-3))) + + """ + if shape is None: + # image + if name.lower().endswith(".gif"): + shape = Shape("image", self._image(name)) + else: + raise TurtleGraphicsError("Bad arguments for register_shape.\n" + + "Use help(register_shape)" ) + elif isinstance(shape, tuple): + shape = Shape("polygon", shape) + ## else shape assumed to be Shape-instance + self._shapes[name] = shape + # print "shape added:" , self._shapes + + def _colorstr(self, color): + """Return color string corresponding to args. + + Argument may be a string or a tuple of three + numbers corresponding to actual colormode, + i.e. in the range 0<=n<=colormode. + + If the argument doesn't represent a color, + an error is raised. + """ + if len(color) == 1: + color = color[0] + if isinstance(color, basestring): + if self._iscolorstring(color) or color == "": + return color + else: + raise TurtleGraphicsError("bad color string: %s" % str(color)) + try: + r, g, b = color + except (TypeError, ValueError): + raise TurtleGraphicsError("bad color arguments: %s" % str(color)) + if self._colormode == 1.0: + r, g, b = [round(255.0*x) for x in (r, g, b)] + if not ((0 <= r <= 255) and (0 <= g <= 255) and (0 <= b <= 255)): + raise TurtleGraphicsError("bad color sequence: %s" % str(color)) + return "#%02x%02x%02x" % (r, g, b) + + def _color(self, cstr): + if not cstr.startswith("#"): + return cstr + if len(cstr) == 7: + cl = [int(cstr[i:i+2], 16) for i in (1, 3, 5)] + elif len(cstr) == 4: + cl = [16*int(cstr[h], 16) for h in cstr[1:]] + else: + raise TurtleGraphicsError("bad colorstring: %s" % cstr) + return tuple([c * self._colormode/255 for c in cl]) + + def colormode(self, cmode=None): + """Return the colormode or set it to 1.0 or 255. + + Optional argument: + cmode -- one of the values 1.0 or 255 + + r, g, b values of colortriples have to be in range 0..cmode. + + Example (for a TurtleScreen instance named screen): + >>> screen.colormode() + 1.0 + >>> screen.colormode(255) + >>> pencolor(240,160,80) + """ + if cmode is None: + return self._colormode + if cmode == 1.0: + self._colormode = float(cmode) + elif cmode == 255: + self._colormode = int(cmode) + + def reset(self): + """Reset all Turtles on the Screen to their initial state. + + No argument. + + Example (for a TurtleScreen instance named screen): + >>> screen.reset() + """ + for turtle in self._turtles: + turtle._setmode(self._mode) + turtle.reset() + + def turtles(self): + """Return the list of turtles on the screen. + + Example (for a TurtleScreen instance named screen): + >>> screen.turtles() + [<turtle.Turtle object at 0x00E11FB0>] + """ + return self._turtles + + def bgcolor(self, *args): + """Set or return backgroundcolor of the TurtleScreen. + + Arguments (if given): a color string or three numbers + in the range 0..colormode or a 3-tuple of such numbers. + + Example (for a TurtleScreen instance named screen): + >>> screen.bgcolor("orange") + >>> screen.bgcolor() + 'orange' + >>> screen.bgcolor(0.5,0,0.5) + >>> screen.bgcolor() + '#800080' + """ + if args: + color = self._colorstr(args) + else: + color = None + color = self._bgcolor(color) + if color is not None: + color = self._color(color) + return color + + def tracer(self, n=None, delay=None): + """Turns turtle animation on/off and set delay for update drawings. + + Optional arguments: + n -- nonnegative integer + delay -- nonnegative integer + + If n is given, only each n-th regular screen update is really performed. + (Can be used to accelerate the drawing of complex graphics.) + Second arguments sets delay value (see RawTurtle.delay()) + + Example (for a TurtleScreen instance named screen): + >>> screen.tracer(8, 25) + >>> dist = 2 + >>> for i in range(200): + ... fd(dist) + ... rt(90) + ... dist += 2 + """ + if n is None: + return self._tracing + self._tracing = int(n) + self._updatecounter = 0 + if delay is not None: + self._delayvalue = int(delay) + if self._tracing: + self.update() + + def delay(self, delay=None): + """ Return or set the drawing delay in milliseconds. + + Optional argument: + delay -- positive integer + + Example (for a TurtleScreen instance named screen): + >>> screen.delay(15) + >>> screen.delay() + 15 + """ + if delay is None: + return self._delayvalue + self._delayvalue = int(delay) + + def _incrementudc(self): + """Increment update counter.""" + if not TurtleScreen._RUNNING: + TurtleScreen._RUNNING = True + raise Terminator + if self._tracing > 0: + self._updatecounter += 1 + self._updatecounter %= self._tracing + + def update(self): + """Perform a TurtleScreen update. + """ + tracing = self._tracing + self._tracing = True + for t in self.turtles(): + t._update_data() + t._drawturtle() + self._tracing = tracing + self._update() + + def window_width(self): + """ Return the width of the turtle window. + + Example (for a TurtleScreen instance named screen): + >>> screen.window_width() + 640 + """ + return self._window_size()[0] + + def window_height(self): + """ Return the height of the turtle window. + + Example (for a TurtleScreen instance named screen): + >>> screen.window_height() + 480 + """ + return self._window_size()[1] + + def getcanvas(self): + """Return the Canvas of this TurtleScreen. + + No argument. + + Example (for a Screen instance named screen): + >>> cv = screen.getcanvas() + >>> cv + <turtle.ScrolledCanvas instance at 0x010742D8> + """ + return self.cv + + def getshapes(self): + """Return a list of names of all currently available turtle shapes. + + No argument. + + Example (for a TurtleScreen instance named screen): + >>> screen.getshapes() + ['arrow', 'blank', 'circle', ... , 'turtle'] + """ + return sorted(self._shapes.keys()) + + def onclick(self, fun, btn=1, add=None): + """Bind fun to mouse-click event on canvas. + + Arguments: + fun -- a function with two arguments, the coordinates of the + clicked point on the canvas. + btn -- the number of the mouse-button, defaults to 1 + + Example (for a TurtleScreen instance named screen + and a Turtle instance named turtle): + + >>> screen.onclick(goto) + >>> # Subsequently clicking into the TurtleScreen will + >>> # make the turtle move to the clicked point. + >>> screen.onclick(None) + """ + self._onscreenclick(fun, btn, add) + + def onkey(self, fun, key): + """Bind fun to key-release event of key. + + Arguments: + fun -- a function with no arguments + key -- a string: key (e.g. "a") or key-symbol (e.g. "space") + + In order to be able to register key-events, TurtleScreen + must have focus. (See method listen.) + + Example (for a TurtleScreen instance named screen): + + >>> def f(): + ... fd(50) + ... lt(60) + ... + >>> screen.onkey(f, "Up") + >>> screen.listen() + + Subsequently the turtle can be moved by repeatedly pressing + the up-arrow key, consequently drawing a hexagon + + """ + if fun is None: + if key in self._keys: + self._keys.remove(key) + elif key not in self._keys: + self._keys.append(key) + self._onkey(fun, key) + + def listen(self, xdummy=None, ydummy=None): + """Set focus on TurtleScreen (in order to collect key-events) + + No arguments. + Dummy arguments are provided in order + to be able to pass listen to the onclick method. + + Example (for a TurtleScreen instance named screen): + >>> screen.listen() + """ + self._listen() + + def ontimer(self, fun, t=0): + """Install a timer, which calls fun after t milliseconds. + + Arguments: + fun -- a function with no arguments. + t -- a number >= 0 + + Example (for a TurtleScreen instance named screen): + + >>> running = True + >>> def f(): + ... if running: + ... fd(50) + ... lt(60) + ... screen.ontimer(f, 250) + ... + >>> f() # makes the turtle marching around + >>> running = False + """ + self._ontimer(fun, t) + + def bgpic(self, picname=None): + """Set background image or return name of current backgroundimage. + + Optional argument: + picname -- a string, name of a gif-file or "nopic". + + If picname is a filename, set the corresponding image as background. + If picname is "nopic", delete backgroundimage, if present. + If picname is None, return the filename of the current backgroundimage. + + Example (for a TurtleScreen instance named screen): + >>> screen.bgpic() + 'nopic' + >>> screen.bgpic("landscape.gif") + >>> screen.bgpic() + 'landscape.gif' + """ + if picname is None: + return self._bgpicname + if picname not in self._bgpics: + self._bgpics[picname] = self._image(picname) + self._setbgpic(self._bgpic, self._bgpics[picname]) + self._bgpicname = picname + + def screensize(self, canvwidth=None, canvheight=None, bg=None): + """Resize the canvas the turtles are drawing on. + + Optional arguments: + canvwidth -- positive integer, new width of canvas in pixels + canvheight -- positive integer, new height of canvas in pixels + bg -- colorstring or color-tuple, new backgroundcolor + If no arguments are given, return current (canvaswidth, canvasheight) + + Do not alter the drawing window. To observe hidden parts of + the canvas use the scrollbars. (Can make visible those parts + of a drawing, which were outside the canvas before!) + + Example (for a Turtle instance named turtle): + >>> turtle.screensize(2000,1500) + >>> # e. g. to search for an erroneously escaped turtle ;-) + """ + return self._resize(canvwidth, canvheight, bg) + + onscreenclick = onclick + resetscreen = reset + clearscreen = clear + addshape = register_shape + +class TNavigator(object): + """Navigation part of the RawTurtle. + Implements methods for turtle movement. + """ + START_ORIENTATION = { + "standard": Vec2D(1.0, 0.0), + "world" : Vec2D(1.0, 0.0), + "logo" : Vec2D(0.0, 1.0) } + DEFAULT_MODE = "standard" + DEFAULT_ANGLEOFFSET = 0 + DEFAULT_ANGLEORIENT = 1 + + def __init__(self, mode=DEFAULT_MODE): + self._angleOffset = self.DEFAULT_ANGLEOFFSET + self._angleOrient = self.DEFAULT_ANGLEORIENT + self._mode = mode + self.undobuffer = None + self.degrees() + self._mode = None + self._setmode(mode) + TNavigator.reset(self) + + def reset(self): + """reset turtle to its initial values + + Will be overwritten by parent class + """ + self._position = Vec2D(0.0, 0.0) + self._orient = TNavigator.START_ORIENTATION[self._mode] + + def _setmode(self, mode=None): + """Set turtle-mode to 'standard', 'world' or 'logo'. + """ + if mode is None: + return self._mode + if mode not in ["standard", "logo", "world"]: + return + self._mode = mode + if mode in ["standard", "world"]: + self._angleOffset = 0 + self._angleOrient = 1 + else: # mode == "logo": + self._angleOffset = self._fullcircle/4. + self._angleOrient = -1 + + def _setDegreesPerAU(self, fullcircle): + """Helper function for degrees() and radians()""" + self._fullcircle = fullcircle + self._degreesPerAU = 360/fullcircle + if self._mode == "standard": + self._angleOffset = 0 + else: + self._angleOffset = fullcircle/4. + + def degrees(self, fullcircle=360.0): + """ Set angle measurement units to degrees. + + Optional argument: + fullcircle - a number + + Set angle measurement units, i. e. set number + of 'degrees' for a full circle. Dafault value is + 360 degrees. + + Example (for a Turtle instance named turtle): + >>> turtle.left(90) + >>> turtle.heading() + 90 + + Change angle measurement unit to grad (also known as gon, + grade, or gradian and equals 1/100-th of the right angle.) + >>> turtle.degrees(400.0) + >>> turtle.heading() + 100 + + """ + self._setDegreesPerAU(fullcircle) + + def radians(self): + """ Set the angle measurement units to radians. + + No arguments. + + Example (for a Turtle instance named turtle): + >>> turtle.heading() + 90 + >>> turtle.radians() + >>> turtle.heading() + 1.5707963267948966 + """ + self._setDegreesPerAU(2*math.pi) + + def _go(self, distance): + """move turtle forward by specified distance""" + ende = self._position + self._orient * distance + self._goto(ende) + + def _rotate(self, angle): + """Turn turtle counterclockwise by specified angle if angle > 0.""" + angle *= self._degreesPerAU + self._orient = self._orient.rotate(angle) + + def _goto(self, end): + """move turtle to position end.""" + self._position = end + + def forward(self, distance): + """Move the turtle forward by the specified distance. + + Aliases: forward | fd + + Argument: + distance -- a number (integer or float) + + Move the turtle forward by the specified distance, in the direction + the turtle is headed. + + Example (for a Turtle instance named turtle): + >>> turtle.position() + (0.00, 0.00) + >>> turtle.forward(25) + >>> turtle.position() + (25.00,0.00) + >>> turtle.forward(-75) + >>> turtle.position() + (-50.00,0.00) + """ + self._go(distance) + + def back(self, distance): + """Move the turtle backward by distance. + + Aliases: back | backward | bk + + Argument: + distance -- a number + + Move the turtle backward by distance ,opposite to the direction the + turtle is headed. Do not change the turtle's heading. + + Example (for a Turtle instance named turtle): + >>> turtle.position() + (0.00, 0.00) + >>> turtle.backward(30) + >>> turtle.position() + (-30.00, 0.00) + """ + self._go(-distance) + + def right(self, angle): + """Turn turtle right by angle units. + + Aliases: right | rt + + Argument: + angle -- a number (integer or float) + + Turn turtle right by angle units. (Units are by default degrees, + but can be set via the degrees() and radians() functions.) + Angle orientation depends on mode. (See this.) + + Example (for a Turtle instance named turtle): + >>> turtle.heading() + 22.0 + >>> turtle.right(45) + >>> turtle.heading() + 337.0 + """ + self._rotate(-angle) + + def left(self, angle): + """Turn turtle left by angle units. + + Aliases: left | lt + + Argument: + angle -- a number (integer or float) + + Turn turtle left by angle units. (Units are by default degrees, + but can be set via the degrees() and radians() functions.) + Angle orientation depends on mode. (See this.) + + Example (for a Turtle instance named turtle): + >>> turtle.heading() + 22.0 + >>> turtle.left(45) + >>> turtle.heading() + 67.0 + """ + self._rotate(angle) + + def pos(self): + """Return the turtle's current location (x,y), as a Vec2D-vector. + + Aliases: pos | position + + No arguments. + + Example (for a Turtle instance named turtle): + >>> turtle.pos() + (0.00, 240.00) + """ + return self._position + + def xcor(self): + """ Return the turtle's x coordinate. + + No arguments. + + Example (for a Turtle instance named turtle): + >>> reset() + >>> turtle.left(60) + >>> turtle.forward(100) + >>> print turtle.xcor() + 50.0 + """ + return self._position[0] + + def ycor(self): + """ Return the turtle's y coordinate + --- + No arguments. + + Example (for a Turtle instance named turtle): + >>> reset() + >>> turtle.left(60) + >>> turtle.forward(100) + >>> print turtle.ycor() + 86.6025403784 + """ + return self._position[1] + + + def goto(self, x, y=None): + """Move turtle to an absolute position. + + Aliases: setpos | setposition | goto: + + Arguments: + x -- a number or a pair/vector of numbers + y -- a number None + + call: goto(x, y) # two coordinates + --or: goto((x, y)) # a pair (tuple) of coordinates + --or: goto(vec) # e.g. as returned by pos() + + Move turtle to an absolute position. If the pen is down, + a line will be drawn. The turtle's orientation does not change. + + Example (for a Turtle instance named turtle): + >>> tp = turtle.pos() + >>> tp + (0.00, 0.00) + >>> turtle.setpos(60,30) + >>> turtle.pos() + (60.00,30.00) + >>> turtle.setpos((20,80)) + >>> turtle.pos() + (20.00,80.00) + >>> turtle.setpos(tp) + >>> turtle.pos() + (0.00,0.00) + """ + if y is None: + self._goto(Vec2D(*x)) + else: + self._goto(Vec2D(x, y)) + + def home(self): + """Move turtle to the origin - coordinates (0,0). + + No arguments. + + Move turtle to the origin - coordinates (0,0) and set its + heading to its start-orientation (which depends on mode). + + Example (for a Turtle instance named turtle): + >>> turtle.home() + """ + self.goto(0, 0) + self.setheading(0) + + def setx(self, x): + """Set the turtle's first coordinate to x + + Argument: + x -- a number (integer or float) + + Set the turtle's first coordinate to x, leave second coordinate + unchanged. + + Example (for a Turtle instance named turtle): + >>> turtle.position() + (0.00, 240.00) + >>> turtle.setx(10) + >>> turtle.position() + (10.00, 240.00) + """ + self._goto(Vec2D(x, self._position[1])) + + def sety(self, y): + """Set the turtle's second coordinate to y + + Argument: + y -- a number (integer or float) + + Set the turtle's first coordinate to x, second coordinate remains + unchanged. + + Example (for a Turtle instance named turtle): + >>> turtle.position() + (0.00, 40.00) + >>> turtle.sety(-10) + >>> turtle.position() + (0.00, -10.00) + """ + self._goto(Vec2D(self._position[0], y)) + + def distance(self, x, y=None): + """Return the distance from the turtle to (x,y) in turtle step units. + + Arguments: + x -- a number or a pair/vector of numbers or a turtle instance + y -- a number None None + + call: distance(x, y) # two coordinates + --or: distance((x, y)) # a pair (tuple) of coordinates + --or: distance(vec) # e.g. as returned by pos() + --or: distance(mypen) # where mypen is another turtle + + Example (for a Turtle instance named turtle): + >>> turtle.pos() + (0.00, 0.00) + >>> turtle.distance(30,40) + 50.0 + >>> pen = Turtle() + >>> pen.forward(77) + >>> turtle.distance(pen) + 77.0 + """ + if y is not None: + pos = Vec2D(x, y) + if isinstance(x, Vec2D): + pos = x + elif isinstance(x, tuple): + pos = Vec2D(*x) + elif isinstance(x, TNavigator): + pos = x._position + return abs(pos - self._position) + + def towards(self, x, y=None): + """Return the angle of the line from the turtle's position to (x, y). + + Arguments: + x -- a number or a pair/vector of numbers or a turtle instance + y -- a number None None + + call: distance(x, y) # two coordinates + --or: distance((x, y)) # a pair (tuple) of coordinates + --or: distance(vec) # e.g. as returned by pos() + --or: distance(mypen) # where mypen is another turtle + + Return the angle, between the line from turtle-position to position + specified by x, y and the turtle's start orientation. (Depends on + modes - "standard" or "logo") + + Example (for a Turtle instance named turtle): + >>> turtle.pos() + (10.00, 10.00) + >>> turtle.towards(0,0) + 225.0 + """ + if y is not None: + pos = Vec2D(x, y) + if isinstance(x, Vec2D): + pos = x + elif isinstance(x, tuple): + pos = Vec2D(*x) + elif isinstance(x, TNavigator): + pos = x._position + x, y = pos - self._position + result = round(math.atan2(y, x)*180.0/math.pi, 10) % 360.0 + result /= self._degreesPerAU + return (self._angleOffset + self._angleOrient*result) % self._fullcircle + + def heading(self): + """ Return the turtle's current heading. + + No arguments. + + Example (for a Turtle instance named turtle): + >>> turtle.left(67) + >>> turtle.heading() + 67.0 + """ + x, y = self._orient + result = round(math.atan2(y, x)*180.0/math.pi, 10) % 360.0 + result /= self._degreesPerAU + return (self._angleOffset + self._angleOrient*result) % self._fullcircle + + def setheading(self, to_angle): + """Set the orientation of the turtle to to_angle. + + Aliases: setheading | seth + + Argument: + to_angle -- a number (integer or float) + + Set the orientation of the turtle to to_angle. + Here are some common directions in degrees: + + standard - mode: logo-mode: + -------------------|-------------------- + 0 - east 0 - north + 90 - north 90 - east + 180 - west 180 - south + 270 - south 270 - west + + Example (for a Turtle instance named turtle): + >>> turtle.setheading(90) + >>> turtle.heading() + 90 + """ + angle = (to_angle - self.heading())*self._angleOrient + full = self._fullcircle + angle = (angle+full/2.)%full - full/2. + self._rotate(angle) + + def circle(self, radius, extent = None, steps = None): + """ Draw a circle with given radius. + + Arguments: + radius -- a number + extent (optional) -- a number + steps (optional) -- an integer + + Draw a circle with given radius. The center is radius units left + of the turtle; extent - an angle - determines which part of the + circle is drawn. If extent is not given, draw the entire circle. + If extent is not a full circle, one endpoint of the arc is the + current pen position. Draw the arc in counterclockwise direction + if radius is positive, otherwise in clockwise direction. Finally + the direction of the turtle is changed by the amount of extent. + + As the circle is approximated by an inscribed regular polygon, + steps determines the number of steps to use. If not given, + it will be calculated automatically. Maybe used to draw regular + polygons. + + call: circle(radius) # full circle + --or: circle(radius, extent) # arc + --or: circle(radius, extent, steps) + --or: circle(radius, steps=6) # 6-sided polygon + + Example (for a Turtle instance named turtle): + >>> turtle.circle(50) + >>> turtle.circle(120, 180) # semicircle + """ + if self.undobuffer: + self.undobuffer.push(["seq"]) + self.undobuffer.cumulate = True + speed = self.speed() + if extent is None: + extent = self._fullcircle + if steps is None: + frac = abs(extent)/self._fullcircle + steps = 1+int(min(11+abs(radius)/6.0, 59.0)*frac) + w = 1.0 * extent / steps + w2 = 0.5 * w + l = 2.0 * radius * math.sin(w2*math.pi/180.0*self._degreesPerAU) + if radius < 0: + l, w, w2 = -l, -w, -w2 + tr = self.tracer() + dl = self._delay() + if speed == 0: + self.tracer(0, 0) + else: + self.speed(0) + self._rotate(w2) + for i in range(steps): + self.speed(speed) + self._go(l) + self.speed(0) + self._rotate(w) + self._rotate(-w2) + if speed == 0: + self.tracer(tr, dl) + self.speed(speed) + if self.undobuffer: + self.undobuffer.cumulate = False + +## three dummy methods to be implemented by child class: + + def speed(self, s=0): + """dummy method - to be overwritten by child class""" + def tracer(self, a=None, b=None): + """dummy method - to be overwritten by child class""" + def _delay(self, n=None): + """dummy method - to be overwritten by child class""" + + fd = forward + bk = back + backward = back + rt = right + lt = left + position = pos + setpos = goto + setposition = goto + seth = setheading + + +class TPen(object): + """Drawing part of the RawTurtle. + Implements drawing properties. + """ + def __init__(self, resizemode=_CFG["resizemode"]): + self._resizemode = resizemode # or "user" or "noresize" + self.undobuffer = None + TPen._reset(self) + + def _reset(self, pencolor=_CFG["pencolor"], + fillcolor=_CFG["fillcolor"]): + self._pensize = 1 + self._shown = True + self._pencolor = pencolor + self._fillcolor = fillcolor + self._drawing = True + self._speed = 3 + self._stretchfactor = (1, 1) + self._tilt = 0 + self._outlinewidth = 1 + ### self.screen = None # to override by child class + + def resizemode(self, rmode=None): + """Set resizemode to one of the values: "auto", "user", "noresize". + + (Optional) Argument: + rmode -- one of the strings "auto", "user", "noresize" + + Different resizemodes have the following effects: + - "auto" adapts the appearance of the turtle + corresponding to the value of pensize. + - "user" adapts the appearance of the turtle according to the + values of stretchfactor and outlinewidth (outline), + which are set by shapesize() + - "noresize" no adaption of the turtle's appearance takes place. + If no argument is given, return current resizemode. + resizemode("user") is called by a call of shapesize with arguments. + + + Examples (for a Turtle instance named turtle): + >>> turtle.resizemode("noresize") + >>> turtle.resizemode() + 'noresize' + """ + if rmode is None: + return self._resizemode + rmode = rmode.lower() + if rmode in ["auto", "user", "noresize"]: + self.pen(resizemode=rmode) + + def pensize(self, width=None): + """Set or return the line thickness. + + Aliases: pensize | width + + Argument: + width -- positive number + + Set the line thickness to width or return it. If resizemode is set + to "auto" and turtleshape is a polygon, that polygon is drawn with + the same line thickness. If no argument is given, current pensize + is returned. + + Example (for a Turtle instance named turtle): + >>> turtle.pensize() + 1 + >>> turtle.pensize(10) # from here on lines of width 10 are drawn + """ + if width is None: + return self._pensize + self.pen(pensize=width) + + + def penup(self): + """Pull the pen up -- no drawing when moving. + + Aliases: penup | pu | up + + No argument + + Example (for a Turtle instance named turtle): + >>> turtle.penup() + """ + if not self._drawing: + return + self.pen(pendown=False) + + def pendown(self): + """Pull the pen down -- drawing when moving. + + Aliases: pendown | pd | down + + No argument. + + Example (for a Turtle instance named turtle): + >>> turtle.pendown() + """ + if self._drawing: + return + self.pen(pendown=True) + + def isdown(self): + """Return True if pen is down, False if it's up. + + No argument. + + Example (for a Turtle instance named turtle): + >>> turtle.penup() + >>> turtle.isdown() + False + >>> turtle.pendown() + >>> turtle.isdown() + True + """ + return self._drawing + + def speed(self, speed=None): + """ Return or set the turtle's speed. + + Optional argument: + speed -- an integer in the range 0..10 or a speedstring (see below) + + Set the turtle's speed to an integer value in the range 0 .. 10. + If no argument is given: return current speed. + + If input is a number greater than 10 or smaller than 0.5, + speed is set to 0. + Speedstrings are mapped to speedvalues in the following way: + 'fastest' : 0 + 'fast' : 10 + 'normal' : 6 + 'slow' : 3 + 'slowest' : 1 + speeds from 1 to 10 enforce increasingly faster animation of + line drawing and turtle turning. + + Attention: + speed = 0 : *no* animation takes place. forward/back makes turtle jump + and likewise left/right make the turtle turn instantly. + + Example (for a Turtle instance named turtle): + >>> turtle.speed(3) + """ + speeds = {'fastest':0, 'fast':10, 'normal':6, 'slow':3, 'slowest':1 } + if speed is None: + return self._speed + if speed in speeds: + speed = speeds[speed] + elif 0.5 < speed < 10.5: + speed = int(round(speed)) + else: + speed = 0 + self.pen(speed=speed) + + def color(self, *args): + """Return or set the pencolor and fillcolor. + + Arguments: + Several input formats are allowed. + They use 0, 1, 2, or 3 arguments as follows: + + color() + Return the current pencolor and the current fillcolor + as a pair of color specification strings as are returned + by pencolor and fillcolor. + color(colorstring), color((r,g,b)), color(r,g,b) + inputs as in pencolor, set both, fillcolor and pencolor, + to the given value. + color(colorstring1, colorstring2), + color((r1,g1,b1), (r2,g2,b2)) + equivalent to pencolor(colorstring1) and fillcolor(colorstring2) + and analogously, if the other input format is used. + + If turtleshape is a polygon, outline and interior of that polygon + is drawn with the newly set colors. + For mor info see: pencolor, fillcolor + + Example (for a Turtle instance named turtle): + >>> turtle.color('red', 'green') + >>> turtle.color() + ('red', 'green') + >>> colormode(255) + >>> color((40, 80, 120), (160, 200, 240)) + >>> color() + ('#285078', '#a0c8f0') + """ + if args: + l = len(args) + if l == 1: + pcolor = fcolor = args[0] + elif l == 2: + pcolor, fcolor = args + elif l == 3: + pcolor = fcolor = args + pcolor = self._colorstr(pcolor) + fcolor = self._colorstr(fcolor) + self.pen(pencolor=pcolor, fillcolor=fcolor) + else: + return self._color(self._pencolor), self._color(self._fillcolor) + + def pencolor(self, *args): + """ Return or set the pencolor. + + Arguments: + Four input formats are allowed: + - pencolor() + Return the current pencolor as color specification string, + possibly in hex-number format (see example). + May be used as input to another color/pencolor/fillcolor call. + - pencolor(colorstring) + s is a Tk color specification string, such as "red" or "yellow" + - pencolor((r, g, b)) + *a tuple* of r, g, and b, which represent, an RGB color, + and each of r, g, and b are in the range 0..colormode, + where colormode is either 1.0 or 255 + - pencolor(r, g, b) + r, g, and b represent an RGB color, and each of r, g, and b + are in the range 0..colormode + + If turtleshape is a polygon, the outline of that polygon is drawn + with the newly set pencolor. + + Example (for a Turtle instance named turtle): + >>> turtle.pencolor('brown') + >>> tup = (0.2, 0.8, 0.55) + >>> turtle.pencolor(tup) + >>> turtle.pencolor() + '#33cc8c' + """ + if args: + color = self._colorstr(args) + if color == self._pencolor: + return + self.pen(pencolor=color) + else: + return self._color(self._pencolor) + + def fillcolor(self, *args): + """ Return or set the fillcolor. + + Arguments: + Four input formats are allowed: + - fillcolor() + Return the current fillcolor as color specification string, + possibly in hex-number format (see example). + May be used as input to another color/pencolor/fillcolor call. + - fillcolor(colorstring) + s is a Tk color specification string, such as "red" or "yellow" + - fillcolor((r, g, b)) + *a tuple* of r, g, and b, which represent, an RGB color, + and each of r, g, and b are in the range 0..colormode, + where colormode is either 1.0 or 255 + - fillcolor(r, g, b) + r, g, and b represent an RGB color, and each of r, g, and b + are in the range 0..colormode + + If turtleshape is a polygon, the interior of that polygon is drawn + with the newly set fillcolor. + + Example (for a Turtle instance named turtle): + >>> turtle.fillcolor('violet') + >>> col = turtle.pencolor() + >>> turtle.fillcolor(col) + >>> turtle.fillcolor(0, .5, 0) + """ + if args: + color = self._colorstr(args) + if color == self._fillcolor: + return + self.pen(fillcolor=color) + else: + return self._color(self._fillcolor) + + def showturtle(self): + """Makes the turtle visible. + + Aliases: showturtle | st + + No argument. + + Example (for a Turtle instance named turtle): + >>> turtle.hideturtle() + >>> turtle.showturtle() + """ + self.pen(shown=True) + + def hideturtle(self): + """Makes the turtle invisible. + + Aliases: hideturtle | ht + + No argument. + + It's a good idea to do this while you're in the + middle of a complicated drawing, because hiding + the turtle speeds up the drawing observably. + + Example (for a Turtle instance named turtle): + >>> turtle.hideturtle() + """ + self.pen(shown=False) + + def isvisible(self): + """Return True if the Turtle is shown, False if it's hidden. + + No argument. + + Example (for a Turtle instance named turtle): + >>> turtle.hideturtle() + >>> print turtle.isvisible(): + False + """ + return self._shown + + def pen(self, pen=None, **pendict): + """Return or set the pen's attributes. + + Arguments: + pen -- a dictionary with some or all of the below listed keys. + **pendict -- one or more keyword-arguments with the below + listed keys as keywords. + + Return or set the pen's attributes in a 'pen-dictionary' + with the following key/value pairs: + "shown" : True/False + "pendown" : True/False + "pencolor" : color-string or color-tuple + "fillcolor" : color-string or color-tuple + "pensize" : positive number + "speed" : number in range 0..10 + "resizemode" : "auto" or "user" or "noresize" + "stretchfactor": (positive number, positive number) + "outline" : positive number + "tilt" : number + + This dictionary can be used as argument for a subsequent + pen()-call to restore the former pen-state. Moreover one + or more of these attributes can be provided as keyword-arguments. + This can be used to set several pen attributes in one statement. + + + Examples (for a Turtle instance named turtle): + >>> turtle.pen(fillcolor="black", pencolor="red", pensize=10) + >>> turtle.pen() + {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1, + 'pencolor': 'red', 'pendown': True, 'fillcolor': 'black', + 'stretchfactor': (1,1), 'speed': 3} + >>> penstate=turtle.pen() + >>> turtle.color("yellow","") + >>> turtle.penup() + >>> turtle.pen() + {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1, + 'pencolor': 'yellow', 'pendown': False, 'fillcolor': '', + 'stretchfactor': (1,1), 'speed': 3} + >>> p.pen(penstate, fillcolor="green") + >>> p.pen() + {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1, + 'pencolor': 'red', 'pendown': True, 'fillcolor': 'green', + 'stretchfactor': (1,1), 'speed': 3} + """ + _pd = {"shown" : self._shown, + "pendown" : self._drawing, + "pencolor" : self._pencolor, + "fillcolor" : self._fillcolor, + "pensize" : self._pensize, + "speed" : self._speed, + "resizemode" : self._resizemode, + "stretchfactor" : self._stretchfactor, + "outline" : self._outlinewidth, + "tilt" : self._tilt + } + + if not (pen or pendict): + return _pd + + if isinstance(pen, dict): + p = pen + else: + p = {} + p.update(pendict) + + _p_buf = {} + for key in p: + _p_buf[key] = _pd[key] + + if self.undobuffer: + self.undobuffer.push(("pen", _p_buf)) + + newLine = False + if "pendown" in p: + if self._drawing != p["pendown"]: + newLine = True + if "pencolor" in p: + if isinstance(p["pencolor"], tuple): + p["pencolor"] = self._colorstr((p["pencolor"],)) + if self._pencolor != p["pencolor"]: + newLine = True + if "pensize" in p: + if self._pensize != p["pensize"]: + newLine = True + if newLine: + self._newLine() + if "pendown" in p: + self._drawing = p["pendown"] + if "pencolor" in p: + self._pencolor = p["pencolor"] + if "pensize" in p: + self._pensize = p["pensize"] + if "fillcolor" in p: + if isinstance(p["fillcolor"], tuple): + p["fillcolor"] = self._colorstr((p["fillcolor"],)) + self._fillcolor = p["fillcolor"] + if "speed" in p: + self._speed = p["speed"] + if "resizemode" in p: + self._resizemode = p["resizemode"] + if "stretchfactor" in p: + sf = p["stretchfactor"] + if isinstance(sf, (int, long, float)): + sf = (sf, sf) + self._stretchfactor = sf + if "outline" in p: + self._outlinewidth = p["outline"] + if "shown" in p: + self._shown = p["shown"] + if "tilt" in p: + self._tilt = p["tilt"] + self._update() + +## three dummy methods to be implemented by child class: + + def _newLine(self, usePos = True): + """dummy method - to be overwritten by child class""" + def _update(self, count=True, forced=False): + """dummy method - to be overwritten by child class""" + def _color(self, args): + """dummy method - to be overwritten by child class""" + def _colorstr(self, args): + """dummy method - to be overwritten by child class""" + + width = pensize + up = penup + pu = penup + pd = pendown + down = pendown + st = showturtle + ht = hideturtle + + +class _TurtleImage(object): + """Helper class: Datatype to store Turtle attributes + """ + + def __init__(self, screen, shapeIndex): + self.screen = screen + self._type = None + self._setshape(shapeIndex) + + def _setshape(self, shapeIndex): + screen = self.screen # RawTurtle.screens[self.screenIndex] + self.shapeIndex = shapeIndex + if self._type == "polygon" == screen._shapes[shapeIndex]._type: + return + if self._type == "image" == screen._shapes[shapeIndex]._type: + return + if self._type in ["image", "polygon"]: + screen._delete(self._item) + elif self._type == "compound": + for item in self._item: + screen._delete(item) + self._type = screen._shapes[shapeIndex]._type + if self._type == "polygon": + self._item = screen._createpoly() + elif self._type == "image": + self._item = screen._createimage(screen._shapes["blank"]._data) + elif self._type == "compound": + self._item = [screen._createpoly() for item in + screen._shapes[shapeIndex]._data] + + +class RawTurtle(TPen, TNavigator): + """Animation part of the RawTurtle. + Puts RawTurtle upon a TurtleScreen and provides tools for + its animation. + """ + screens = [] + + def __init__(self, canvas=None, + shape=_CFG["shape"], + undobuffersize=_CFG["undobuffersize"], + visible=_CFG["visible"]): + if isinstance(canvas, _Screen): + self.screen = canvas + elif isinstance(canvas, TurtleScreen): + if canvas not in RawTurtle.screens: + RawTurtle.screens.append(canvas) + self.screen = canvas + elif isinstance(canvas, (ScrolledCanvas, Canvas)): + for screen in RawTurtle.screens: + if screen.cv == canvas: + self.screen = screen + break + else: + self.screen = TurtleScreen(canvas) + RawTurtle.screens.append(self.screen) + else: + raise TurtleGraphicsError("bad canvas argument %s" % canvas) + + screen = self.screen + TNavigator.__init__(self, screen.mode()) + TPen.__init__(self) + screen._turtles.append(self) + self.drawingLineItem = screen._createline() + self.turtle = _TurtleImage(screen, shape) + self._poly = None + self._creatingPoly = False + self._fillitem = self._fillpath = None + self._shown = visible + self._hidden_from_screen = False + self.currentLineItem = screen._createline() + self.currentLine = [self._position] + self.items = [self.currentLineItem] + self.stampItems = [] + self._undobuffersize = undobuffersize + self.undobuffer = Tbuffer(undobuffersize) + self._update() + + def reset(self): + """Delete the turtle's drawings and restore its default values. + + No argument. +, + Delete the turtle's drawings from the screen, re-center the turtle + and set variables to the default values. + + Example (for a Turtle instance named turtle): + >>> turtle.position() + (0.00,-22.00) + >>> turtle.heading() + 100.0 + >>> turtle.reset() + >>> turtle.position() + (0.00,0.00) + >>> turtle.heading() + 0.0 + """ + TNavigator.reset(self) + TPen._reset(self) + self._clear() + self._drawturtle() + self._update() + + def setundobuffer(self, size): + """Set or disable undobuffer. + + Argument: + size -- an integer or None + + If size is an integer an empty undobuffer of given size is installed. + Size gives the maximum number of turtle-actions that can be undone + by the undo() function. + If size is None, no undobuffer is present. + + Example (for a Turtle instance named turtle): + >>> turtle.setundobuffer(42) + """ + if size is None or size <= 0: + self.undobuffer = None + else: + self.undobuffer = Tbuffer(size) + + def undobufferentries(self): + """Return count of entries in the undobuffer. + + No argument. + + Example (for a Turtle instance named turtle): + >>> while undobufferentries(): + ... undo() + """ + if self.undobuffer is None: + return 0 + return self.undobuffer.nr_of_items() + + def _clear(self): + """Delete all of pen's drawings""" + self._fillitem = self._fillpath = None + for item in self.items: + self.screen._delete(item) + self.currentLineItem = self.screen._createline() + self.currentLine = [] + if self._drawing: + self.currentLine.append(self._position) + self.items = [self.currentLineItem] + self.clearstamps() + self.setundobuffer(self._undobuffersize) + + + def clear(self): + """Delete the turtle's drawings from the screen. Do not move turtle. + + No arguments. + + Delete the turtle's drawings from the screen. Do not move turtle. + State and position of the turtle as well as drawings of other + turtles are not affected. + + Examples (for a Turtle instance named turtle): + >>> turtle.clear() + """ + self._clear() + self._update() + + def _update_data(self): + self.screen._incrementudc() + if self.screen._updatecounter != 0: + return + if len(self.currentLine)>1: + self.screen._drawline(self.currentLineItem, self.currentLine, + self._pencolor, self._pensize) + + def _update(self): + """Perform a Turtle-data update. + """ + screen = self.screen + if screen._tracing == 0: + return + elif screen._tracing == 1: + self._update_data() + self._drawturtle() + screen._update() # TurtleScreenBase + screen._delay(screen._delayvalue) # TurtleScreenBase + else: + self._update_data() + if screen._updatecounter == 0: + for t in screen.turtles(): + t._drawturtle() + screen._update() + + def tracer(self, flag=None, delay=None): + """Turns turtle animation on/off and set delay for update drawings. + + Optional arguments: + n -- nonnegative integer + delay -- nonnegative integer + + If n is given, only each n-th regular screen update is really performed. + (Can be used to accelerate the drawing of complex graphics.) + Second arguments sets delay value (see RawTurtle.delay()) + + Example (for a Turtle instance named turtle): + >>> turtle.tracer(8, 25) + >>> dist = 2 + >>> for i in range(200): + ... turtle.fd(dist) + ... turtle.rt(90) + ... dist += 2 + """ + return self.screen.tracer(flag, delay) + + def _color(self, args): + return self.screen._color(args) + + def _colorstr(self, args): + return self.screen._colorstr(args) + + def _cc(self, args): + """Convert colortriples to hexstrings. + """ + if isinstance(args, basestring): + return args + try: + r, g, b = args + except (TypeError, ValueError): + raise TurtleGraphicsError("bad color arguments: %s" % str(args)) + if self.screen._colormode == 1.0: + r, g, b = [round(255.0*x) for x in (r, g, b)] + if not ((0 <= r <= 255) and (0 <= g <= 255) and (0 <= b <= 255)): + raise TurtleGraphicsError("bad color sequence: %s" % str(args)) + return "#%02x%02x%02x" % (r, g, b) + + def clone(self): + """Create and return a clone of the turtle. + + No argument. + + Create and return a clone of the turtle with same position, heading + and turtle properties. + + Example (for a Turtle instance named mick): + mick = Turtle() + joe = mick.clone() + """ + screen = self.screen + self._newLine(self._drawing) + + turtle = self.turtle + self.screen = None + self.turtle = None # too make self deepcopy-able + + q = deepcopy(self) + + self.screen = screen + self.turtle = turtle + + q.screen = screen + q.turtle = _TurtleImage(screen, self.turtle.shapeIndex) + + screen._turtles.append(q) + ttype = screen._shapes[self.turtle.shapeIndex]._type + if ttype == "polygon": + q.turtle._item = screen._createpoly() + elif ttype == "image": + q.turtle._item = screen._createimage(screen._shapes["blank"]._data) + elif ttype == "compound": + q.turtle._item = [screen._createpoly() for item in + screen._shapes[self.turtle.shapeIndex]._data] + q.currentLineItem = screen._createline() + q._update() + return q + + def shape(self, name=None): + """Set turtle shape to shape with given name / return current shapename. + + Optional argument: + name -- a string, which is a valid shapename + + Set turtle shape to shape with given name or, if name is not given, + return name of current shape. + Shape with name must exist in the TurtleScreen's shape dictionary. + Initially there are the following polygon shapes: + 'arrow', 'turtle', 'circle', 'square', 'triangle', 'classic'. + To learn about how to deal with shapes see Screen-method register_shape. + + Example (for a Turtle instance named turtle): + >>> turtle.shape() + 'arrow' + >>> turtle.shape("turtle") + >>> turtle.shape() + 'turtle' + """ + if name is None: + return self.turtle.shapeIndex + if not name in self.screen.getshapes(): + raise TurtleGraphicsError("There is no shape named %s" % name) + self.turtle._setshape(name) + self._update() + + def shapesize(self, stretch_wid=None, stretch_len=None, outline=None): + """Set/return turtle's stretchfactors/outline. Set resizemode to "user". + + Optional arguments: + stretch_wid : positive number + stretch_len : positive number + outline : positive number + + Return or set the pen's attributes x/y-stretchfactors and/or outline. + Set resizemode to "user". + If and only if resizemode is set to "user", the turtle will be displayed + stretched according to its stretchfactors: + stretch_wid is stretchfactor perpendicular to orientation + stretch_len is stretchfactor in direction of turtles orientation. + outline determines the width of the shapes's outline. + + Examples (for a Turtle instance named turtle): + >>> turtle.resizemode("user") + >>> turtle.shapesize(5, 5, 12) + >>> turtle.shapesize(outline=8) + """ + if stretch_wid is stretch_len is outline is None: + stretch_wid, stretch_len = self._stretchfactor + return stretch_wid, stretch_len, self._outlinewidth + if stretch_wid is not None: + if stretch_len is None: + stretchfactor = stretch_wid, stretch_wid + else: + stretchfactor = stretch_wid, stretch_len + elif stretch_len is not None: + stretchfactor = self._stretchfactor[0], stretch_len + else: + stretchfactor = self._stretchfactor + if outline is None: + outline = self._outlinewidth + self.pen(resizemode="user", + stretchfactor=stretchfactor, outline=outline) + + def settiltangle(self, angle): + """Rotate the turtleshape to point in the specified direction + + Optional argument: + angle -- number + + Rotate the turtleshape to point in the direction specified by angle, + regardless of its current tilt-angle. DO NOT change the turtle's + heading (direction of movement). + + + Examples (for a Turtle instance named turtle): + >>> turtle.shape("circle") + >>> turtle.shapesize(5,2) + >>> turtle.settiltangle(45) + >>> stamp() + >>> turtle.fd(50) + >>> turtle.settiltangle(-45) + >>> stamp() + >>> turtle.fd(50) + """ + tilt = -angle * self._degreesPerAU * self._angleOrient + tilt = (tilt * math.pi / 180.0) % (2*math.pi) + self.pen(resizemode="user", tilt=tilt) + + def tiltangle(self): + """Return the current tilt-angle. + + No argument. + + Return the current tilt-angle, i. e. the angle between the + orientation of the turtleshape and the heading of the turtle + (its direction of movement). + + Examples (for a Turtle instance named turtle): + >>> turtle.shape("circle") + >>> turtle.shapesize(5,2) + >>> turtle.tilt(45) + >>> turtle.tiltangle() + """ + tilt = -self._tilt * (180.0/math.pi) * self._angleOrient + return (tilt / self._degreesPerAU) % self._fullcircle + + def tilt(self, angle): + """Rotate the turtleshape by angle. + + Argument: + angle - a number + + Rotate the turtleshape by angle from its current tilt-angle, + but do NOT change the turtle's heading (direction of movement). + + Examples (for a Turtle instance named turtle): + >>> turtle.shape("circle") + >>> turtle.shapesize(5,2) + >>> turtle.tilt(30) + >>> turtle.fd(50) + >>> turtle.tilt(30) + >>> turtle.fd(50) + """ + self.settiltangle(angle + self.tiltangle()) + + def _polytrafo(self, poly): + """Computes transformed polygon shapes from a shape + according to current position and heading. + """ + screen = self.screen + p0, p1 = self._position + e0, e1 = self._orient + e = Vec2D(e0, e1 * screen.yscale / screen.xscale) + e0, e1 = (1.0 / abs(e)) * e + return [(p0+(e1*x+e0*y)/screen.xscale, p1+(-e0*x+e1*y)/screen.yscale) + for (x, y) in poly] + + def _drawturtle(self): + """Manages the correct rendering of the turtle with respect to + its shape, resizemode, stretch and tilt etc.""" + screen = self.screen + shape = screen._shapes[self.turtle.shapeIndex] + ttype = shape._type + titem = self.turtle._item + if self._shown and screen._updatecounter == 0 and screen._tracing > 0: + self._hidden_from_screen = False + tshape = shape._data + if ttype == "polygon": + if self._resizemode == "noresize": + w = 1 + shape = tshape + else: + if self._resizemode == "auto": + lx = ly = max(1, self._pensize/5.0) + w = self._pensize + tiltangle = 0 + elif self._resizemode == "user": + lx, ly = self._stretchfactor + w = self._outlinewidth + tiltangle = self._tilt + shape = [(lx*x, ly*y) for (x, y) in tshape] + t0, t1 = math.sin(tiltangle), math.cos(tiltangle) + shape = [(t1*x+t0*y, -t0*x+t1*y) for (x, y) in shape] + shape = self._polytrafo(shape) + fc, oc = self._fillcolor, self._pencolor + screen._drawpoly(titem, shape, fill=fc, outline=oc, + width=w, top=True) + elif ttype == "image": + screen._drawimage(titem, self._position, tshape) + elif ttype == "compound": + lx, ly = self._stretchfactor + w = self._outlinewidth + for item, (poly, fc, oc) in zip(titem, tshape): + poly = [(lx*x, ly*y) for (x, y) in poly] + poly = self._polytrafo(poly) + screen._drawpoly(item, poly, fill=self._cc(fc), + outline=self._cc(oc), width=w, top=True) + else: + if self._hidden_from_screen: + return + if ttype == "polygon": + screen._drawpoly(titem, ((0, 0), (0, 0), (0, 0)), "", "") + elif ttype == "image": + screen._drawimage(titem, self._position, + screen._shapes["blank"]._data) + elif ttype == "compound": + for item in titem: + screen._drawpoly(item, ((0, 0), (0, 0), (0, 0)), "", "") + self._hidden_from_screen = True + +############################## stamp stuff ############################### + + def stamp(self): + """Stamp a copy of the turtleshape onto the canvas and return its id. + + No argument. + + Stamp a copy of the turtle shape onto the canvas at the current + turtle position. Return a stamp_id for that stamp, which can be + used to delete it by calling clearstamp(stamp_id). + + Example (for a Turtle instance named turtle): + >>> turtle.color("blue") + >>> turtle.stamp() + 13 + >>> turtle.fd(50) + """ + screen = self.screen + shape = screen._shapes[self.turtle.shapeIndex] + ttype = shape._type + tshape = shape._data + if ttype == "polygon": + stitem = screen._createpoly() + if self._resizemode == "noresize": + w = 1 + shape = tshape + else: + if self._resizemode == "auto": + lx = ly = max(1, self._pensize/5.0) + w = self._pensize + tiltangle = 0 + elif self._resizemode == "user": + lx, ly = self._stretchfactor + w = self._outlinewidth + tiltangle = self._tilt + shape = [(lx*x, ly*y) for (x, y) in tshape] + t0, t1 = math.sin(tiltangle), math.cos(tiltangle) + shape = [(t1*x+t0*y, -t0*x+t1*y) for (x, y) in shape] + shape = self._polytrafo(shape) + fc, oc = self._fillcolor, self._pencolor + screen._drawpoly(stitem, shape, fill=fc, outline=oc, + width=w, top=True) + elif ttype == "image": + stitem = screen._createimage("") + screen._drawimage(stitem, self._position, tshape) + elif ttype == "compound": + stitem = [] + for element in tshape: + item = screen._createpoly() + stitem.append(item) + stitem = tuple(stitem) + lx, ly = self._stretchfactor + w = self._outlinewidth + for item, (poly, fc, oc) in zip(stitem, tshape): + poly = [(lx*x, ly*y) for (x, y) in poly] + poly = self._polytrafo(poly) + screen._drawpoly(item, poly, fill=self._cc(fc), + outline=self._cc(oc), width=w, top=True) + self.stampItems.append(stitem) + self.undobuffer.push(("stamp", stitem)) + return stitem + + def _clearstamp(self, stampid): + """does the work for clearstamp() and clearstamps() + """ + if stampid in self.stampItems: + if isinstance(stampid, tuple): + for subitem in stampid: + self.screen._delete(subitem) + else: + self.screen._delete(stampid) + self.stampItems.remove(stampid) + # Delete stampitem from undobuffer if necessary + # if clearstamp is called directly. + item = ("stamp", stampid) + buf = self.undobuffer + if item not in buf.buffer: + return + index = buf.buffer.index(item) + buf.buffer.remove(item) + if index <= buf.ptr: + buf.ptr = (buf.ptr - 1) % buf.bufsize + buf.buffer.insert((buf.ptr+1)%buf.bufsize, [None]) + + def clearstamp(self, stampid): + """Delete stamp with given stampid + + Argument: + stampid - an integer, must be return value of previous stamp() call. + + Example (for a Turtle instance named turtle): + >>> turtle.color("blue") + >>> astamp = turtle.stamp() + >>> turtle.fd(50) + >>> turtle.clearstamp(astamp) + """ + self._clearstamp(stampid) + self._update() + + def clearstamps(self, n=None): + """Delete all or first/last n of turtle's stamps. + + Optional argument: + n -- an integer + + If n is None, delete all of pen's stamps, + else if n > 0 delete first n stamps + else if n < 0 delete last n stamps. + + Example (for a Turtle instance named turtle): + >>> for i in range(8): + ... turtle.stamp(); turtle.fd(30) + ... + >>> turtle.clearstamps(2) + >>> turtle.clearstamps(-2) + >>> turtle.clearstamps() + """ + if n is None: + toDelete = self.stampItems[:] + elif n >= 0: + toDelete = self.stampItems[:n] + else: + toDelete = self.stampItems[n:] + for item in toDelete: + self._clearstamp(item) + self._update() + + def _goto(self, end): + """Move the pen to the point end, thereby drawing a line + if pen is down. All other methods for turtle movement depend + on this one. + """ + ## Version mit undo-stuff + go_modes = ( self._drawing, + self._pencolor, + self._pensize, + isinstance(self._fillpath, list)) + screen = self.screen + undo_entry = ("go", self._position, end, go_modes, + (self.currentLineItem, + self.currentLine[:], + screen._pointlist(self.currentLineItem), + self.items[:]) + ) + if self.undobuffer: + self.undobuffer.push(undo_entry) + start = self._position + if self._speed and screen._tracing == 1: + diff = (end-start) + diffsq = (diff[0]*screen.xscale)**2 + (diff[1]*screen.yscale)**2 + nhops = 1+int((diffsq**0.5)/(3*(1.1**self._speed)*self._speed)) + delta = diff * (1.0/nhops) + for n in range(1, nhops): + if n == 1: + top = True + else: + top = False + self._position = start + delta * n + if self._drawing: + screen._drawline(self.drawingLineItem, + (start, self._position), + self._pencolor, self._pensize, top) + self._update() + if self._drawing: + screen._drawline(self.drawingLineItem, ((0, 0), (0, 0)), + fill="", width=self._pensize) + # Turtle now at end, + if self._drawing: # now update currentLine + self.currentLine.append(end) + if isinstance(self._fillpath, list): + self._fillpath.append(end) + ###### vererbung!!!!!!!!!!!!!!!!!!!!!! + self._position = end + if self._creatingPoly: + self._poly.append(end) + if len(self.currentLine) > 42: # 42! answer to the ultimate question + # of life, the universe and everything + self._newLine() + self._update() #count=True) + + def _undogoto(self, entry): + """Reverse a _goto. Used for undo() + """ + old, new, go_modes, coodata = entry + drawing, pc, ps, filling = go_modes + cLI, cL, pl, items = coodata + screen = self.screen + if abs(self._position - new) > 0.5: + print "undogoto: HALLO-DA-STIMMT-WAS-NICHT!" + # restore former situation + self.currentLineItem = cLI + self.currentLine = cL + + if pl == [(0, 0), (0, 0)]: + usepc = "" + else: + usepc = pc + screen._drawline(cLI, pl, fill=usepc, width=ps) + + todelete = [i for i in self.items if (i not in items) and + (screen._type(i) == "line")] + for i in todelete: + screen._delete(i) + self.items.remove(i) + + start = old + if self._speed and screen._tracing == 1: + diff = old - new + diffsq = (diff[0]*screen.xscale)**2 + (diff[1]*screen.yscale)**2 + nhops = 1+int((diffsq**0.5)/(3*(1.1**self._speed)*self._speed)) + delta = diff * (1.0/nhops) + for n in range(1, nhops): + if n == 1: + top = True + else: + top = False + self._position = new + delta * n + if drawing: + screen._drawline(self.drawingLineItem, + (start, self._position), + pc, ps, top) + self._update() + if drawing: + screen._drawline(self.drawingLineItem, ((0, 0), (0, 0)), + fill="", width=ps) + # Turtle now at position old, + self._position = old + ## if undo is done during creating a polygon, the last vertex + ## will be deleted. if the polygon is entirely deleted, + ## creatingPoly will be set to False. + ## Polygons created before the last one will not be affected by undo() + if self._creatingPoly: + if len(self._poly) > 0: + self._poly.pop() + if self._poly == []: + self._creatingPoly = False + self._poly = None + if filling: + if self._fillpath == []: + self._fillpath = None + print "Unwahrscheinlich in _undogoto!" + elif self._fillpath is not None: + self._fillpath.pop() + self._update() #count=True) + + def _rotate(self, angle): + """Turns pen clockwise by angle. + """ + if self.undobuffer: + self.undobuffer.push(("rot", angle, self._degreesPerAU)) + angle *= self._degreesPerAU + neworient = self._orient.rotate(angle) + tracing = self.screen._tracing + if tracing == 1 and self._speed > 0: + anglevel = 3.0 * self._speed + steps = 1 + int(abs(angle)/anglevel) + delta = 1.0*angle/steps + for _ in range(steps): + self._orient = self._orient.rotate(delta) + self._update() + self._orient = neworient + self._update() + + def _newLine(self, usePos=True): + """Closes current line item and starts a new one. + Remark: if current line became too long, animation + performance (via _drawline) slowed down considerably. + """ + if len(self.currentLine) > 1: + self.screen._drawline(self.currentLineItem, self.currentLine, + self._pencolor, self._pensize) + self.currentLineItem = self.screen._createline() + self.items.append(self.currentLineItem) + else: + self.screen._drawline(self.currentLineItem, top=True) + self.currentLine = [] + if usePos: + self.currentLine = [self._position] + + def fill(self, flag=None): + """Call fill(True) before drawing a shape to fill, fill(False) when done. + + Optional argument: + flag -- True/False (or 1/0 respectively) + + Call fill(True) before drawing the shape you want to fill, + and fill(False) when done. + When used without argument: return fillstate (True if filling, + False else) + + Example (for a Turtle instance named turtle): + >>> turtle.fill(True) + >>> turtle.forward(100) + >>> turtle.left(90) + >>> turtle.forward(100) + >>> turtle.left(90) + >>> turtle.forward(100) + >>> turtle.left(90) + >>> turtle.forward(100) + >>> turtle.fill(False) + """ + filling = isinstance(self._fillpath, list) + if flag is None: + return filling + screen = self.screen + entry1 = entry2 = () + if filling: + if len(self._fillpath) > 2: + self.screen._drawpoly(self._fillitem, self._fillpath, + fill=self._fillcolor) + entry1 = ("dofill", self._fillitem) + if flag: + self._fillitem = self.screen._createpoly() + self.items.append(self._fillitem) + self._fillpath = [self._position] + entry2 = ("beginfill", self._fillitem) # , self._fillpath) + self._newLine() + else: + self._fillitem = self._fillpath = None + if self.undobuffer: + if entry1 == (): + if entry2 != (): + self.undobuffer.push(entry2) + else: + if entry2 == (): + self.undobuffer.push(entry1) + else: + self.undobuffer.push(["seq", entry1, entry2]) + self._update() + + def begin_fill(self): + """Called just before drawing a shape to be filled. + + No argument. + + Example (for a Turtle instance named turtle): + >>> turtle.begin_fill() + >>> turtle.forward(100) + >>> turtle.left(90) + >>> turtle.forward(100) + >>> turtle.left(90) + >>> turtle.forward(100) + >>> turtle.left(90) + >>> turtle.forward(100) + >>> turtle.end_fill() + """ + self.fill(True) + + def end_fill(self): + """Fill the shape drawn after the call begin_fill(). + + No argument. + + Example (for a Turtle instance named turtle): + >>> turtle.begin_fill() + >>> turtle.forward(100) + >>> turtle.left(90) + >>> turtle.forward(100) + >>> turtle.left(90) + >>> turtle.forward(100) + >>> turtle.left(90) + >>> turtle.forward(100) + >>> turtle.end_fill() + """ + self.fill(False) + + def dot(self, size=None, *color): + """Draw a dot with diameter size, using color. + + Optional arguments: + size -- an integer >= 1 (if given) + color -- a colorstring or a numeric color tuple + + Draw a circular dot with diameter size, using color. + If size is not given, the maximum of pensize+4 and 2*pensize is used. + + Example (for a Turtle instance named turtle): + >>> turtle.dot() + >>> turtle.fd(50); turtle.dot(20, "blue"); turtle.fd(50) + """ + #print "dot-1:", size, color + if not color: + if isinstance(size, (basestring, tuple)): + color = self._colorstr(size) + size = self._pensize + max(self._pensize, 4) + else: + color = self._pencolor + if not size: + size = self._pensize + max(self._pensize, 4) + else: + if size is None: + size = self._pensize + max(self._pensize, 4) + color = self._colorstr(color) + #print "dot-2:", size, color + if hasattr(self.screen, "_dot"): + item = self.screen._dot(self._position, size, color) + #print "dot:", size, color, "item:", item + self.items.append(item) + if self.undobuffer: + self.undobuffer.push(("dot", item)) + else: + pen = self.pen() + if self.undobuffer: + self.undobuffer.push(["seq"]) + self.undobuffer.cumulate = True + try: + if self.resizemode() == 'auto': + self.ht() + self.pendown() + self.pensize(size) + self.pencolor(color) + self.forward(0) + finally: + self.pen(pen) + if self.undobuffer: + self.undobuffer.cumulate = False + + def _write(self, txt, align, font): + """Performs the writing for write() + """ + item, end = self.screen._write(self._position, txt, align, font, + self._pencolor) + self.items.append(item) + if self.undobuffer: + self.undobuffer.push(("wri", item)) + return end + + def write(self, arg, move=False, align="left", font=("Arial", 8, "normal")): + """Write text at the current turtle position. + + Arguments: + arg -- info, which is to be written to the TurtleScreen + move (optional) -- True/False + align (optional) -- one of the strings "left", "center" or right" + font (optional) -- a triple (fontname, fontsize, fonttype) + + Write text - the string representation of arg - at the current + turtle position according to align ("left", "center" or right") + and with the given font. + If move is True, the pen is moved to the bottom-right corner + of the text. By default, move is False. + + Example (for a Turtle instance named turtle): + >>> turtle.write('Home = ', True, align="center") + >>> turtle.write((0,0), True) + """ + if self.undobuffer: + self.undobuffer.push(["seq"]) + self.undobuffer.cumulate = True + end = self._write(str(arg), align.lower(), font) + if move: + x, y = self.pos() + self.setpos(end, y) + if self.undobuffer: + self.undobuffer.cumulate = False + + def begin_poly(self): + """Start recording the vertices of a polygon. + + No argument. + + Start recording the vertices of a polygon. Current turtle position + is first point of polygon. + + Example (for a Turtle instance named turtle): + >>> turtle.begin_poly() + """ + self._poly = [self._position] + self._creatingPoly = True + + def end_poly(self): + """Stop recording the vertices of a polygon. + + No argument. + + Stop recording the vertices of a polygon. Current turtle position is + last point of polygon. This will be connected with the first point. + + Example (for a Turtle instance named turtle): + >>> turtle.end_poly() + """ + self._creatingPoly = False + + def get_poly(self): + """Return the lastly recorded polygon. + + No argument. + + Example (for a Turtle instance named turtle): + >>> p = turtle.get_poly() + >>> turtle.register_shape("myFavouriteShape", p) + """ + ## check if there is any poly? -- 1st solution: + if self._poly is not None: + return tuple(self._poly) + + def getscreen(self): + """Return the TurtleScreen object, the turtle is drawing on. + + No argument. + + Return the TurtleScreen object, the turtle is drawing on. + So TurtleScreen-methods can be called for that object. + + Example (for a Turtle instance named turtle): + >>> ts = turtle.getscreen() + >>> ts + <turtle.TurtleScreen object at 0x0106B770> + >>> ts.bgcolor("pink") + """ + return self.screen + + def getturtle(self): + """Return the Turtleobject itself. + + No argument. + + Only reasonable use: as a function to return the 'anonymous turtle': + + Example: + >>> pet = getturtle() + >>> pet.fd(50) + >>> pet + <turtle.Turtle object at 0x0187D810> + >>> turtles() + [<turtle.Turtle object at 0x0187D810>] + """ + return self + + getpen = getturtle + + + ################################################################ + ### screen oriented methods recurring to methods of TurtleScreen + ################################################################ + + def window_width(self): + """ Returns the width of the turtle window. + + No argument. + + Example (for a TurtleScreen instance named screen): + >>> screen.window_width() + 640 + """ + return self.screen._window_size()[0] + + def window_height(self): + """ Return the height of the turtle window. + + No argument. + + Example (for a TurtleScreen instance named screen): + >>> screen.window_height() + 480 + """ + return self.screen._window_size()[1] + + def _delay(self, delay=None): + """Set delay value which determines speed of turtle animation. + """ + return self.screen.delay(delay) + + ##### event binding methods ##### + + def onclick(self, fun, btn=1, add=None): + """Bind fun to mouse-click event on this turtle on canvas. + + Arguments: + fun -- a function with two arguments, to which will be assigned + the coordinates of the clicked point on the canvas. + btn -- number of the mouse-button defaults to 1 (left mouse button). + add -- True or False. If True, new binding will be added, otherwise + it will replace a former binding. + + Example for the anonymous turtle, i. e. the procedural way: + + >>> def turn(x, y): + ... left(360) + ... + >>> onclick(turn) # Now clicking into the turtle will turn it. + >>> onclick(None) # event-binding will be removed + """ + self.screen._onclick(self.turtle._item, fun, btn, add) + self._update() + + def onrelease(self, fun, btn=1, add=None): + """Bind fun to mouse-button-release event on this turtle on canvas. + + Arguments: + fun -- a function with two arguments, to which will be assigned + the coordinates of the clicked point on the canvas. + btn -- number of the mouse-button defaults to 1 (left mouse button). + + Example (for a MyTurtle instance named joe): + >>> class MyTurtle(Turtle): + ... def glow(self,x,y): + ... self.fillcolor("red") + ... def unglow(self,x,y): + ... self.fillcolor("") + ... + >>> joe = MyTurtle() + >>> joe.onclick(joe.glow) + >>> joe.onrelease(joe.unglow) + + Clicking on joe turns fillcolor red, unclicking turns it to + transparent. + """ + self.screen._onrelease(self.turtle._item, fun, btn, add) + self._update() + + def ondrag(self, fun, btn=1, add=None): + """Bind fun to mouse-move event on this turtle on canvas. + + Arguments: + fun -- a function with two arguments, to which will be assigned + the coordinates of the clicked point on the canvas. + btn -- number of the mouse-button defaults to 1 (left mouse button). + + Every sequence of mouse-move-events on a turtle is preceded by a + mouse-click event on that turtle. + + Example (for a Turtle instance named turtle): + >>> turtle.ondrag(turtle.goto) + + Subsequently clicking and dragging a Turtle will move it + across the screen thereby producing handdrawings (if pen is + down). + """ + self.screen._ondrag(self.turtle._item, fun, btn, add) + + + def _undo(self, action, data): + """Does the main part of the work for undo() + """ + if self.undobuffer is None: + return + if action == "rot": + angle, degPAU = data + self._rotate(-angle*degPAU/self._degreesPerAU) + dummy = self.undobuffer.pop() + elif action == "stamp": + stitem = data[0] + self.clearstamp(stitem) + elif action == "go": + self._undogoto(data) + elif action in ["wri", "dot"]: + item = data[0] + self.screen._delete(item) + self.items.remove(item) + elif action == "dofill": + item = data[0] + self.screen._drawpoly(item, ((0, 0),(0, 0),(0, 0)), + fill="", outline="") + elif action == "beginfill": + item = data[0] + self._fillitem = self._fillpath = None + self.screen._delete(item) + self.items.remove(item) + elif action == "pen": + TPen.pen(self, data[0]) + self.undobuffer.pop() + + def undo(self): + """undo (repeatedly) the last turtle action. + + No argument. + + undo (repeatedly) the last turtle action. + Number of available undo actions is determined by the size of + the undobuffer. + + Example (for a Turtle instance named turtle): + >>> for i in range(4): + ... turtle.fd(50); turtle.lt(80) + ... + >>> for i in range(8): + ... turtle.undo() + ... + """ + if self.undobuffer is None: + return + item = self.undobuffer.pop() + action = item[0] + data = item[1:] + if action == "seq": + while data: + item = data.pop() + self._undo(item[0], item[1:]) + else: + self._undo(action, data) + + turtlesize = shapesize + +RawPen = RawTurtle + +### Screen - Singleton ######################## + +def Screen(): + """Return the singleton screen object. + If none exists at the moment, create a new one and return it, + else return the existing one.""" + if Turtle._screen is None: + Turtle._screen = _Screen() + return Turtle._screen + +class _Screen(TurtleScreen): + + _root = None + _canvas = None + _title = _CFG["title"] + + def __init__(self): + # XXX there is no need for this code to be conditional, + # as there will be only a single _Screen instance, anyway + # XXX actually, the turtle demo is injecting root window, + # so perhaps the conditional creation of a root should be + # preserved (perhaps by passing it as an optional parameter) + if _Screen._root is None: + _Screen._root = self._root = _Root() + self._root.title(_Screen._title) + self._root.ondestroy(self._destroy) + if _Screen._canvas is None: + width = _CFG["width"] + height = _CFG["height"] + canvwidth = _CFG["canvwidth"] + canvheight = _CFG["canvheight"] + leftright = _CFG["leftright"] + topbottom = _CFG["topbottom"] + self._root.setupcanvas(width, height, canvwidth, canvheight) + _Screen._canvas = self._root._getcanvas() + TurtleScreen.__init__(self, _Screen._canvas) + self.setup(width, height, leftright, topbottom) + + def setup(self, width=_CFG["width"], height=_CFG["height"], + startx=_CFG["leftright"], starty=_CFG["topbottom"]): + """ Set the size and position of the main window. + + Arguments: + width: as integer a size in pixels, as float a fraction of the screen. + Default is 50% of screen. + height: as integer the height in pixels, as float a fraction of the + screen. Default is 75% of screen. + startx: if positive, starting position in pixels from the left + edge of the screen, if negative from the right edge + Default, startx=None is to center window horizontally. + starty: if positive, starting position in pixels from the top + edge of the screen, if negative from the bottom edge + Default, starty=None is to center window vertically. + + Examples (for a Screen instance named screen): + >>> screen.setup (width=200, height=200, startx=0, starty=0) + + sets window to 200x200 pixels, in upper left of screen + + >>> screen.setup(width=.75, height=0.5, startx=None, starty=None) + + sets window to 75% of screen by 50% of screen and centers + """ + if not hasattr(self._root, "set_geometry"): + return + sw = self._root.win_width() + sh = self._root.win_height() + if isinstance(width, float) and 0 <= width <= 1: + width = sw*width + if startx is None: + startx = (sw - width) / 2 + if isinstance(height, float) and 0 <= height <= 1: + height = sh*height + if starty is None: + starty = (sh - height) / 2 + self._root.set_geometry(width, height, startx, starty) + self.update() + + def title(self, titlestring): + """Set title of turtle-window + + Argument: + titlestring -- a string, to appear in the titlebar of the + turtle graphics window. + + This is a method of Screen-class. Not available for TurtleScreen- + objects. + + Example (for a Screen instance named screen): + >>> screen.title("Welcome to the turtle-zoo!") + """ + if _Screen._root is not None: + _Screen._root.title(titlestring) + _Screen._title = titlestring + + def _destroy(self): + root = self._root + if root is _Screen._root: + Turtle._pen = None + Turtle._screen = None + _Screen._root = None + _Screen._canvas = None + TurtleScreen._RUNNING = False + root.destroy() + + def bye(self): + """Shut the turtlegraphics window. + + Example (for a TurtleScreen instance named screen): + >>> screen.bye() + """ + self._destroy() + + def exitonclick(self): + """Go into mainloop until the mouse is clicked. + + No arguments. + + Bind bye() method to mouseclick on TurtleScreen. + If "using_IDLE" - value in configuration dictionary is False + (default value), enter mainloop. + If IDLE with -n switch (no subprocess) is used, this value should be + set to True in turtle.cfg. In this case IDLE's mainloop + is active also for the client script. + + This is a method of the Screen-class and not available for + TurtleScreen instances. + + Example (for a Screen instance named screen): + >>> screen.exitonclick() + + """ + def exitGracefully(x, y): + """Screen.bye() with two dummy-parameters""" + self.bye() + self.onclick(exitGracefully) + if _CFG["using_IDLE"]: + return + try: + mainloop() + except AttributeError: + exit(0) + +class Turtle(RawTurtle): + """RawTurtle auto-creating (scrolled) canvas. + + When a Turtle object is created or a function derived from some + Turtle method is called a TurtleScreen object is automatically created. + """ + _pen = None + _screen = None + + def __init__(self, + shape=_CFG["shape"], + undobuffersize=_CFG["undobuffersize"], + visible=_CFG["visible"]): + if Turtle._screen is None: + Turtle._screen = Screen() + RawTurtle.__init__(self, Turtle._screen, + shape=shape, + undobuffersize=undobuffersize, + visible=visible) + +Pen = Turtle + +def write_docstringdict(filename="turtle_docstringdict"): + """Create and write docstring-dictionary to file. + + Optional argument: + filename -- a string, used as filename + default value is turtle_docstringdict + + Has to be called explicitly, (not used by the turtle-graphics classes) + The docstring dictionary will be written to the Python script <filname>.py + It is intended to serve as a template for translation of the docstrings + into different languages. + """ + docsdict = {} + + for methodname in _tg_screen_functions: + key = "_Screen."+methodname + docsdict[key] = eval(key).__doc__ + for methodname in _tg_turtle_functions: + key = "Turtle."+methodname + docsdict[key] = eval(key).__doc__ + + f = open("%s.py" % filename,"w") + keys = sorted([x for x in docsdict.keys() + if x.split('.')[1] not in _alias_list]) + f.write('docsdict = {\n\n') + for key in keys[:-1]: + f.write('%s :\n' % repr(key)) + f.write(' """%s\n""",\n\n' % docsdict[key]) + key = keys[-1] + f.write('%s :\n' % repr(key)) + f.write(' """%s\n"""\n\n' % docsdict[key]) + f.write("}\n") + f.close() + +def read_docstrings(lang): + """Read in docstrings from lang-specific docstring dictionary. + + Transfer docstrings, translated to lang, from a dictionary-file + to the methods of classes Screen and Turtle and - in revised form - + to the corresponding functions. + """ + modname = "turtle_docstringdict_%(language)s" % {'language':lang.lower()} + module = __import__(modname) + docsdict = module.docsdict + for key in docsdict: + #print key + try: + eval(key).im_func.__doc__ = docsdict[key] + except BaseException: + print "Bad docstring-entry: %s" % key + +_LANGUAGE = _CFG["language"] + +try: + if _LANGUAGE != "english": + read_docstrings(_LANGUAGE) +except ImportError: + print "Cannot find docsdict for", _LANGUAGE +except BaseException: + print ("Unknown Error when trying to import %s-docstring-dictionary" % + _LANGUAGE) + + +def getmethparlist(ob): + "Get strings describing the arguments for the given object" + argText1 = argText2 = "" + # bit of a hack for methods - turn it into a function + # but we drop the "self" param. + if type(ob)==types.MethodType: + fob = ob.im_func + argOffset = 1 + else: + fob = ob + argOffset = 0 + # Try and build one for Python defined functions + if type(fob) in [types.FunctionType, types.LambdaType]: + try: + counter = fob.func_code.co_argcount + items2 = list(fob.func_code.co_varnames[argOffset:counter]) + realArgs = fob.func_code.co_varnames[argOffset:counter] + defaults = fob.func_defaults or [] + defaults = list(map(lambda name: "=%s" % repr(name), defaults)) + defaults = [""] * (len(realArgs)-len(defaults)) + defaults + items1 = map(lambda arg, dflt: arg+dflt, realArgs, defaults) + if fob.func_code.co_flags & 0x4: + items1.append("*"+fob.func_code.co_varnames[counter]) + items2.append("*"+fob.func_code.co_varnames[counter]) + counter += 1 + if fob.func_code.co_flags & 0x8: + items1.append("**"+fob.func_code.co_varnames[counter]) + items2.append("**"+fob.func_code.co_varnames[counter]) + argText1 = ", ".join(items1) + argText1 = "(%s)" % argText1 + argText2 = ", ".join(items2) + argText2 = "(%s)" % argText2 + except: + pass + return argText1, argText2 + +def _turtle_docrevise(docstr): + """To reduce docstrings from RawTurtle class for functions + """ + import re + if docstr is None: + return None + turtlename = _CFG["exampleturtle"] + newdocstr = docstr.replace("%s." % turtlename,"") + parexp = re.compile(r' \(.+ %s\):' % turtlename) + newdocstr = parexp.sub(":", newdocstr) + return newdocstr + +def _screen_docrevise(docstr): + """To reduce docstrings from TurtleScreen class for functions + """ + import re + if docstr is None: + return None + screenname = _CFG["examplescreen"] + newdocstr = docstr.replace("%s." % screenname,"") + parexp = re.compile(r' \(.+ %s\):' % screenname) + newdocstr = parexp.sub(":", newdocstr) + return newdocstr + +## The following mechanism makes all methods of RawTurtle and Turtle available +## as functions. So we can enhance, change, add, delete methods to these +## classes and do not need to change anything here. + +__func_body = """\ +def {name}{paramslist}: + if {obj} is None: + if not TurtleScreen._RUNNING: + TurtleScreen._RUNNING = True + raise Terminator + {obj} = {init} + try: + return {obj}.{name}{argslist} + except TK.TclError: + if not TurtleScreen._RUNNING: + TurtleScreen._RUNNING = True + raise Terminator + raise +""" + +def _make_global_funcs(functions, cls, obj, init, docrevise): + for methodname in functions: + method = getattr(cls, methodname) + pl1, pl2 = getmethparlist(method) + if pl1 == "": + print ">>>>>>", pl1, pl2 + continue + defstr = __func_body.format(obj=obj, init=init, name=methodname, + paramslist=pl1, argslist=pl2) + exec defstr in globals() + globals()[methodname].__doc__ = docrevise(method.__doc__) + +_make_global_funcs(_tg_screen_functions, _Screen, + 'Turtle._screen', 'Screen()', _screen_docrevise) +_make_global_funcs(_tg_turtle_functions, Turtle, + 'Turtle._pen', 'Turtle()', _turtle_docrevise) + + +done = mainloop = TK.mainloop + +if __name__ == "__main__": + def switchpen(): + if isdown(): + pu() + else: + pd() + + def demo1(): + """Demo of old turtle.py - module""" + reset() + tracer(True) + up() + backward(100) + down() + # draw 3 squares; the last filled + width(3) + for i in range(3): + if i == 2: + fill(1) + for _ in range(4): + forward(20) + left(90) + if i == 2: + color("maroon") + fill(0) + up() + forward(30) + down() + width(1) + color("black") + # move out of the way + tracer(False) + up() + right(90) + forward(100) + right(90) + forward(100) + right(180) + down() + # some text + write("startstart", 1) + write(u"start", 1) + color("red") + # staircase + for i in range(5): + forward(20) + left(90) + forward(20) + right(90) + # filled staircase + tracer(True) + fill(1) + for i in range(5): + forward(20) + left(90) + forward(20) + right(90) + fill(0) + # more text + + def demo2(): + """Demo of some new features.""" + speed(1) + st() + pensize(3) + setheading(towards(0, 0)) + radius = distance(0, 0)/2.0 + rt(90) + for _ in range(18): + switchpen() + circle(radius, 10) + write("wait a moment...") + while undobufferentries(): + undo() + reset() + lt(90) + colormode(255) + laenge = 10 + pencolor("green") + pensize(3) + lt(180) + for i in range(-2, 16): + if i > 0: + begin_fill() + fillcolor(255-15*i, 0, 15*i) + for _ in range(3): + fd(laenge) + lt(120) + laenge += 10 + lt(15) + speed((speed()+1)%12) + end_fill() + + lt(120) + pu() + fd(70) + rt(30) + pd() + color("red","yellow") + speed(0) + fill(1) + for _ in range(4): + circle(50, 90) + rt(90) + fd(30) + rt(90) + fill(0) + lt(90) + pu() + fd(30) + pd() + shape("turtle") + + tri = getturtle() + tri.resizemode("auto") + turtle = Turtle() + turtle.resizemode(u"auto") + turtle.shape("turtle") + turtle.reset() + turtle.left(90) + turtle.speed(0) + turtle.up() + turtle.goto(280, 40) + turtle.lt(30) + turtle.down() + turtle.speed(6) + turtle.color("blue",u"orange") + turtle.pensize(2) + tri.speed(6) + setheading(towards(turtle)) + count = 1 + while tri.distance(turtle) > 4: + turtle.fd(3.5) + turtle.lt(0.6) + tri.setheading(tri.towards(turtle)) + tri.fd(4) + if count % 20 == 0: + turtle.stamp() + tri.stamp() + switchpen() + count += 1 + tri.write("CAUGHT! ", font=("Arial", 16, "bold"), align=u"right") + tri.pencolor("black") + tri.pencolor(u"red") + + def baba(xdummy, ydummy): + clearscreen() + bye() + + time.sleep(2) + + while undobufferentries(): + tri.undo() + turtle.undo() + tri.fd(50) + tri.write(" Click me!", font = ("Courier", 12, "bold") ) + tri.onclick(baba, 1) + + demo1() + demo2() + exitonclick() |