intermediate changes

ref:cde9a383711a11544ce7e107a78147fb96cc4029

72 files changed, 24403 insertions, 0 deletions

diff --git a/contrib/python/pytest/py3/.dist-info/METADATA b/contrib/python/pytest/py3/.dist-info/METADATA
new file mode 100644
index 0000000000..2354d6e80c
--- /dev/null
+++ b/contrib/python/pytest/py3/.dist-info/METADATA
@@ -0,0 +1,209 @@
+Metadata-Version: 2.1
+Name: pytest
+Version: 5.4.3
+Summary: pytest: simple powerful testing with Python
+Home-page: https://docs.pytest.org/en/latest/
+Author: Holger Krekel, Bruno Oliveira, Ronny Pfannschmidt, Floris Bruynooghe, Brianna Laugher, Florian Bruhin and others
+License: MIT license
+Project-URL: Source, https://github.com/pytest-dev/pytest
+Project-URL: Tracker, https://github.com/pytest-dev/pytest/issues
+Keywords: test,unittest
+Platform: unix
+Platform: linux
+Platform: osx
+Platform: cygwin
+Platform: win32
+Classifier: Development Status :: 6 - Mature
+Classifier: Intended Audience :: Developers
+Classifier: License :: OSI Approved :: MIT License
+Classifier: Operating System :: POSIX
+Classifier: Operating System :: Microsoft :: Windows
+Classifier: Operating System :: MacOS :: MacOS X
+Classifier: Topic :: Software Development :: Testing
+Classifier: Topic :: Software Development :: Libraries
+Classifier: Topic :: Utilities
+Classifier: Programming Language :: Python :: 3 :: Only
+Classifier: Programming Language :: Python :: 3.5
+Classifier: Programming Language :: Python :: 3.6
+Classifier: Programming Language :: Python :: 3.7
+Classifier: Programming Language :: Python :: 3.8
+Classifier: Programming Language :: Python :: 3.9
+Requires-Python: >=3.5
+Requires-Dist: py (>=1.5.0)
+Requires-Dist: packaging
+Requires-Dist: attrs (>=17.4.0)
+Requires-Dist: more-itertools (>=4.0.0)
+Requires-Dist: pluggy (<1.0,>=0.12)
+Requires-Dist: wcwidth
+Requires-Dist: pathlib2 (>=2.2.0) ; python_version < "3.6"
+Requires-Dist: importlib-metadata (>=0.12) ; python_version < "3.8"
+Requires-Dist: atomicwrites (>=1.0) ; sys_platform == "win32"
+Requires-Dist: colorama ; sys_platform == "win32"
+Provides-Extra: checkqa-mypy
+Requires-Dist: mypy (==v0.761) ; extra == 'checkqa-mypy'
+Provides-Extra: testing
+Requires-Dist: argcomplete ; extra == 'testing'
+Requires-Dist: hypothesis (>=3.56) ; extra == 'testing'
+Requires-Dist: mock ; extra == 'testing'
+Requires-Dist: nose ; extra == 'testing'
+Requires-Dist: requests ; extra == 'testing'
+Requires-Dist: xmlschema ; extra == 'testing'
+
+.. image:: https://docs.pytest.org/en/latest/_static/pytest1.png
+   :target: https://docs.pytest.org/en/latest/
+   :align: center
+   :alt: pytest
+
+
+------
+
+.. image:: https://img.shields.io/pypi/v/pytest.svg
+    :target: https://pypi.org/project/pytest/
+
+.. image:: https://img.shields.io/conda/vn/conda-forge/pytest.svg
+    :target: https://anaconda.org/conda-forge/pytest
+
+.. image:: https://img.shields.io/pypi/pyversions/pytest.svg
+    :target: https://pypi.org/project/pytest/
+
+.. image:: https://codecov.io/gh/pytest-dev/pytest/branch/master/graph/badge.svg
+    :target: https://codecov.io/gh/pytest-dev/pytest
+    :alt: Code coverage Status
+
+.. image:: https://travis-ci.org/pytest-dev/pytest.svg?branch=master
+    :target: https://travis-ci.org/pytest-dev/pytest
+
+.. image:: https://dev.azure.com/pytest-dev/pytest/_apis/build/status/pytest-CI?branchName=master
+    :target: https://dev.azure.com/pytest-dev/pytest
+
+.. image:: https://img.shields.io/badge/code%20style-black-000000.svg
+    :target: https://github.com/psf/black
+
+.. image:: https://www.codetriage.com/pytest-dev/pytest/badges/users.svg
+    :target: https://www.codetriage.com/pytest-dev/pytest
+
+.. image:: https://readthedocs.org/projects/pytest/badge/?version=latest
+    :target: https://pytest.readthedocs.io/en/latest/?badge=latest
+    :alt: Documentation Status
+
+The ``pytest`` framework makes it easy to write small tests, yet
+scales to support complex functional testing for applications and libraries.
+
+An example of a simple test:
+
+.. code-block:: python
+
+    # content of test_sample.py
+    def inc(x):
+        return x + 1
+
+
+    def test_answer():
+        assert inc(3) == 5
+
+
+To execute it::
+
+    $ pytest
+    ============================= test session starts =============================
+    collected 1 items
+
+    test_sample.py F
+
+    ================================== FAILURES ===================================
+    _________________________________ test_answer _________________________________
+
+        def test_answer():
+    >       assert inc(3) == 5
+    E       assert 4 == 5
+    E        +  where 4 = inc(3)
+
+    test_sample.py:5: AssertionError
+    ========================== 1 failed in 0.04 seconds ===========================
+
+
+Due to ``pytest``'s detailed assertion introspection, only plain ``assert`` statements are used. See `getting-started <https://docs.pytest.org/en/latest/getting-started.html#our-first-test-run>`_ for more examples.
+
+
+Features
+--------
+
+- Detailed info on failing `assert statements <https://docs.pytest.org/en/latest/assert.html>`_ (no need to remember ``self.assert*`` names);
+
+- `Auto-discovery
+  <https://docs.pytest.org/en/latest/goodpractices.html#python-test-discovery>`_
+  of test modules and functions;
+
+- `Modular fixtures <https://docs.pytest.org/en/latest/fixture.html>`_ for
+  managing small or parametrized long-lived test resources;
+
+- Can run `unittest <https://docs.pytest.org/en/latest/unittest.html>`_ (or trial),
+  `nose <https://docs.pytest.org/en/latest/nose.html>`_ test suites out of the box;
+
+- Python 3.5+ and PyPy3;
+
+- Rich plugin architecture, with over 315+ `external plugins <http://plugincompat.herokuapp.com>`_ and thriving community;
+
+
+Documentation
+-------------
+
+For full documentation, including installation, tutorials and PDF documents, please see https://docs.pytest.org/en/latest/.
+
+
+Bugs/Requests
+-------------
+
+Please use the `GitHub issue tracker <https://github.com/pytest-dev/pytest/issues>`_ to submit bugs or request features.
+
+
+Changelog
+---------
+
+Consult the `Changelog <https://docs.pytest.org/en/latest/changelog.html>`__ page for fixes and enhancements of each version.
+
+
+Support pytest
+--------------
+
+`Open Collective`_ is an online funding platform for open and transparent communities.
+It provides tools to raise money and share your finances in full transparency.
+
+It is the platform of choice for individuals and companies that want to make one-time or
+monthly donations directly to the project.
+
+See more details in the `pytest collective`_.
+
+.. _Open Collective: https://opencollective.com
+.. _pytest collective: https://opencollective.com/pytest
+
+
+pytest for enterprise
+---------------------
+
+Available as part of the Tidelift Subscription.
+
+The maintainers of pytest and thousands of other packages are working with Tidelift to deliver commercial support and
+maintenance for the open source dependencies you use to build your applications.
+Save time, reduce risk, and improve code health, while paying the maintainers of the exact dependencies you use.
+
+`Learn more. <https://tidelift.com/subscription/pkg/pypi-pytest?utm_source=pypi-pytest&utm_medium=referral&utm_campaign=enterprise&utm_term=repo>`_
+
+Security
+^^^^^^^^
+
+pytest has never been associated with a security vulnerability, but in any case, to report a
+security vulnerability please use the `Tidelift security contact <https://tidelift.com/security>`_.
+Tidelift will coordinate the fix and disclosure.
+
+
+License
+-------
+
+Copyright Holger Krekel and others, 2004-2020.
+
+Distributed under the terms of the `MIT`_ license, pytest is free and open source software.
+
+.. _`MIT`: https://github.com/pytest-dev/pytest/blob/master/LICENSE
+
+
diff --git a/contrib/python/pytest/py3/.dist-info/entry_points.txt b/contrib/python/pytest/py3/.dist-info/entry_points.txt
new file mode 100644
index 0000000000..d8e4fd298f
--- /dev/null
+++ b/contrib/python/pytest/py3/.dist-info/entry_points.txt
@@ -0,0 +1,4 @@
+[console_scripts]
+py.test = pytest:main
+pytest = pytest:main
+
diff --git a/contrib/python/pytest/py3/.dist-info/top_level.txt b/contrib/python/pytest/py3/.dist-info/top_level.txt
new file mode 100644
index 0000000000..e94857af96
--- /dev/null
+++ b/contrib/python/pytest/py3/.dist-info/top_level.txt
@@ -0,0 +1,2 @@
+_pytest
+pytest
diff --git a/contrib/python/pytest/py3/AUTHORS b/contrib/python/pytest/py3/AUTHORS
new file mode 100644
index 0000000000..3de12aa12f
--- /dev/null
+++ b/contrib/python/pytest/py3/AUTHORS
@@ -0,0 +1,293 @@
+Holger Krekel, holger at merlinux eu
+merlinux GmbH, Germany, office at merlinux eu
+
+Contributors include::
+
+Aaron Coleman
+Abdeali JK
+Abhijeet Kasurde
+Adam Johnson
+Adam Uhlir
+Ahn Ki-Wook
+Akiomi Kamakura
+Alan Velasco
+Alexander Johnson
+Alexei Kozlenok
+Allan Feldman
+Aly Sivji
+Amir Elkess
+Anatoly Bubenkoff
+Anders Hovmöller
+Andras Mitzki
+Andras Tim
+Andrea Cimatoribus
+Andreas Zeidler
+Andrey Paramonov
+Andrzej Klajnert
+Andrzej Ostrowski
+Andy Freeland
+Anthon van der Neut
+Anthony Shaw
+Anthony Sottile
+Anton Lodder
+Antony Lee
+Arel Cordero
+Armin Rigo
+Aron Coyle
+Aron Curzon
+Aviral Verma
+Aviv Palivoda
+Barney Gale
+Ben Webb
+Benjamin Peterson
+Bernard Pratz
+Bob Ippolito
+Brian Dorsey
+Brian Maissy
+Brian Okken
+Brianna Laugher
+Bruno Oliveira
+Cal Leeming
+Carl Friedrich Bolz
+Carlos Jenkins
+Ceridwen
+Charles Cloud
+Charles Machalow
+Charnjit SiNGH (CCSJ)
+Chris Lamb
+Christian Boelsen
+Christian Fetzer
+Christian Neumüller
+Christian Theunert
+Christian Tismer
+Christoph Buelter
+Christopher Dignam
+Christopher Gilling
+Claudio Madotto
+CrazyMerlyn
+Cyrus Maden
+Damian Skrzypczak
+Daniel Grana
+Daniel Hahler
+Daniel Nuri
+Daniel Wandschneider
+Danielle Jenkins
+Daniil Galiev
+Dave Hunt
+David Díaz-Barquero
+David Mohr
+David Paul Röthlisberger
+David Szotten
+David Vierra
+Daw-Ran Liou
+Denis Kirisov
+Dhiren Serai
+Diego Russo
+Dmitry Dygalo
+Dmitry Pribysh
+Duncan Betts
+Edison Gustavo Muenz
+Edoardo Batini
+Eduardo Schettino
+Eli Boyarski
+Elizaveta Shashkova
+Endre Galaczi
+Eric Hunsberger
+Eric Siegerman
+Erik M. Bray
+Evan Kepner
+Fabien Zarifian
+Fabio Zadrozny
+Feng Ma
+Florian Bruhin
+Floris Bruynooghe
+Gabriel Reis
+Gene Wood
+George Kussumoto
+Georgy Dyuldin
+Graham Horler
+Greg Price
+Gregory Lee
+Grig Gheorghiu
+Grigorii Eremeev (budulianin)
+Guido Wesdorp
+Guoqiang Zhang
+Harald Armin Massa
+Henk-Jaap Wagenaar
+Holger Kohr
+Hugo van Kemenade
+Hui Wang (coldnight)
+Ian Bicking
+Ian Lesperance
+Ilya Konstantinov
+Ionuț Turturică
+Iwan Briquemont
+Jaap Broekhuizen
+Jakub Mitoraj
+Jan Balster
+Janne Vanhala
+Jason R. Coombs
+Javier Domingo Cansino
+Javier Romero
+Jeff Rackauckas
+Jeff Widman
+Jenni Rinker
+John Eddie Ayson
+John Towler
+Jon Sonesen
+Jonas Obrist
+Jordan Guymon
+Jordan Moldow
+Jordan Speicher
+Joseph Hunkeler
+Josh Karpel
+Joshua Bronson
+Jurko Gospodnetić
+Justyna Janczyszyn
+Kale Kundert
+Karl O. Pinc
+Katarzyna Jachim
+Katerina Koukiou
+Kevin Cox
+Kevin J. Foley
+Kodi B. Arfer
+Kostis Anagnostopoulos
+Kristoffer Nordström
+Kyle Altendorf
+Lawrence Mitchell
+Lee Kamentsky
+Lev Maximov
+Llandy Riveron Del Risco
+Loic Esteve
+Lukas Bednar
+Luke Murphy
+Maciek Fijalkowski
+Maho
+Maik Figura
+Mandeep Bhutani
+Manuel Krebber
+Marc Schlaich
+Marcelo Duarte Trevisani
+Marcin Bachry
+Marco Gorelli
+Mark Abramowitz
+Mark Dickinson
+Markus Unterwaditzer
+Martijn Faassen
+Martin Altmayer
+Martin K. Scherer
+Martin Prusse
+Mathieu Clabaut
+Matt Bachmann
+Matt Duck
+Matt Williams
+Matthias Hafner
+Maxim Filipenko
+mbyt
+Michael Aquilina
+Michael Birtwell
+Michael Droettboom
+Michael Goerz
+Michael Krebs
+Michael Seifert
+Michal Wajszczuk
+Mihai Capotă
+Mike Hoyle (hoylemd)
+Mike Lundy
+Miro Hrončok
+Nathaniel Compton
+Nathaniel Waisbrot
+Ned Batchelder
+Neven Mundar
+Nicholas Devenish
+Nicholas Murphy
+Niclas Olofsson
+Nicolas Delaby
+Nikolay Kondratyev
+Oleg Pidsadnyi
+Oleg Sushchenko
+Oliver Bestwalter
+Omar Kohl
+Omer Hadari
+Ondřej Súkup
+Oscar Benjamin
+Patrick Hayes
+Pauli Virtanen
+Paweł Adamczak
+Pedro Algarvio
+Philipp Loose
+Pieter Mulder
+Piotr Banaszkiewicz
+Pulkit Goyal
+Punyashloka Biswal
+Quentin Pradet
+Ralf Schmitt
+Ralph Giles
+Ran Benita
+Raphael Castaneda
+Raphael Pierzina
+Raquel Alegre
+Ravi Chandra
+Robert Holt
+Roberto Polli
+Roland Puntaier
+Romain Dorgueil
+Roman Bolshakov
+Ronny Pfannschmidt
+Ross Lawley
+Russel Winder
+Ryan Wooden
+Samuel Dion-Girardeau
+Samuel Searles-Bryant
+Samuele Pedroni
+Sankt Petersbug
+Segev Finer
+Serhii Mozghovyi
+Seth Junot
+Simon Gomizelj
+Skylar Downes
+Srinivas Reddy Thatiparthy
+Stefan Farmbauer
+Stefan Scherfke
+Stefan Zimmermann
+Stefano Taschini
+Steffen Allner
+Stephan Obermann
+Sven-Hendrik Haase
+Tadek Teleżyński
+Takafumi Arakaki
+Tarcisio Fischer
+Tareq Alayan
+Ted Xiao
+Thomas Grainger
+Thomas Hisch
+Tim Hoffmann
+Tim Strazny
+Tom Dalton
+Tom Viner
+Tomáš Gavenčiak
+Tomer Keren
+Tor Colvin
+Trevor Bekolay
+Tyler Goodlet
+Tzu-ping Chung
+Vasily Kuznetsov
+Victor Maryama
+Victor Uriarte
+Vidar T. Fauske
+Virgil Dupras
+Vitaly Lashmanov
+Vlad Dragos
+Vladyslav Rachek
+Volodymyr Piskun
+Wei Lin
+Wil Cooley
+William Lee
+Wim Glenn
+Wouter van Ackooy
+Xixi Zhao
+Xuan Luong
+Xuecong Liao
+Yoav Caspi
+Zac Hatfield-Dodds
+Zoltán Máté
diff --git a/contrib/python/pytest/py3/LICENSE b/contrib/python/pytest/py3/LICENSE
new file mode 100644
index 0000000000..d14fb7ff4b
--- /dev/null
+++ b/contrib/python/pytest/py3/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2004-2020 Holger Krekel and others
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/contrib/python/pytest/py3/README.rst b/contrib/python/pytest/py3/README.rst
new file mode 100644
index 0000000000..864467ea21
--- /dev/null
+++ b/contrib/python/pytest/py3/README.rst
@@ -0,0 +1,156 @@
+.. image:: https://docs.pytest.org/en/latest/_static/pytest1.png
+   :target: https://docs.pytest.org/en/latest/
+   :align: center
+   :alt: pytest
+
+
+------
+
+.. image:: https://img.shields.io/pypi/v/pytest.svg
+    :target: https://pypi.org/project/pytest/
+
+.. image:: https://img.shields.io/conda/vn/conda-forge/pytest.svg
+    :target: https://anaconda.org/conda-forge/pytest
+
+.. image:: https://img.shields.io/pypi/pyversions/pytest.svg
+    :target: https://pypi.org/project/pytest/
+
+.. image:: https://codecov.io/gh/pytest-dev/pytest/branch/master/graph/badge.svg
+    :target: https://codecov.io/gh/pytest-dev/pytest
+    :alt: Code coverage Status
+
+.. image:: https://travis-ci.org/pytest-dev/pytest.svg?branch=master
+    :target: https://travis-ci.org/pytest-dev/pytest
+
+.. image:: https://dev.azure.com/pytest-dev/pytest/_apis/build/status/pytest-CI?branchName=master
+    :target: https://dev.azure.com/pytest-dev/pytest
+
+.. image:: https://img.shields.io/badge/code%20style-black-000000.svg
+    :target: https://github.com/psf/black
+
+.. image:: https://www.codetriage.com/pytest-dev/pytest/badges/users.svg
+    :target: https://www.codetriage.com/pytest-dev/pytest
+
+.. image:: https://readthedocs.org/projects/pytest/badge/?version=latest
+    :target: https://pytest.readthedocs.io/en/latest/?badge=latest
+    :alt: Documentation Status
+
+The ``pytest`` framework makes it easy to write small tests, yet
+scales to support complex functional testing for applications and libraries.
+
+An example of a simple test:
+
+.. code-block:: python
+
+    # content of test_sample.py
+    def inc(x):
+        return x + 1
+
+
+    def test_answer():
+        assert inc(3) == 5
+
+
+To execute it::
+
+    $ pytest
+    ============================= test session starts =============================
+    collected 1 items
+
+    test_sample.py F
+
+    ================================== FAILURES ===================================
+    _________________________________ test_answer _________________________________
+
+        def test_answer():
+    >       assert inc(3) == 5
+    E       assert 4 == 5
+    E        +  where 4 = inc(3)
+
+    test_sample.py:5: AssertionError
+    ========================== 1 failed in 0.04 seconds ===========================
+
+
+Due to ``pytest``'s detailed assertion introspection, only plain ``assert`` statements are used. See `getting-started <https://docs.pytest.org/en/latest/getting-started.html#our-first-test-run>`_ for more examples.
+
+
+Features
+--------
+
+- Detailed info on failing `assert statements <https://docs.pytest.org/en/latest/assert.html>`_ (no need to remember ``self.assert*`` names);
+
+- `Auto-discovery
+  <https://docs.pytest.org/en/latest/goodpractices.html#python-test-discovery>`_
+  of test modules and functions;
+
+- `Modular fixtures <https://docs.pytest.org/en/latest/fixture.html>`_ for
+  managing small or parametrized long-lived test resources;
+
+- Can run `unittest <https://docs.pytest.org/en/latest/unittest.html>`_ (or trial),
+  `nose <https://docs.pytest.org/en/latest/nose.html>`_ test suites out of the box;
+
+- Python 3.5+ and PyPy3;
+
+- Rich plugin architecture, with over 315+ `external plugins <http://plugincompat.herokuapp.com>`_ and thriving community;
+
+
+Documentation
+-------------
+
+For full documentation, including installation, tutorials and PDF documents, please see https://docs.pytest.org/en/latest/.
+
+
+Bugs/Requests
+-------------
+
+Please use the `GitHub issue tracker <https://github.com/pytest-dev/pytest/issues>`_ to submit bugs or request features.
+
+
+Changelog
+---------
+
+Consult the `Changelog <https://docs.pytest.org/en/latest/changelog.html>`__ page for fixes and enhancements of each version.
+
+
+Support pytest
+--------------
+
+`Open Collective`_ is an online funding platform for open and transparent communities.
+It provides tools to raise money and share your finances in full transparency.
+
+It is the platform of choice for individuals and companies that want to make one-time or
+monthly donations directly to the project.
+
+See more details in the `pytest collective`_.
+
+.. _Open Collective: https://opencollective.com
+.. _pytest collective: https://opencollective.com/pytest
+
+
+pytest for enterprise
+---------------------
+
+Available as part of the Tidelift Subscription.
+
+The maintainers of pytest and thousands of other packages are working with Tidelift to deliver commercial support and
+maintenance for the open source dependencies you use to build your applications.
+Save time, reduce risk, and improve code health, while paying the maintainers of the exact dependencies you use.
+
+`Learn more. <https://tidelift.com/subscription/pkg/pypi-pytest?utm_source=pypi-pytest&utm_medium=referral&utm_campaign=enterprise&utm_term=repo>`_
+
+Security
+^^^^^^^^
+
+pytest has never been associated with a security vulnerability, but in any case, to report a
+security vulnerability please use the `Tidelift security contact <https://tidelift.com/security>`_.
+Tidelift will coordinate the fix and disclosure.
+
+
+License
+-------
+
+Copyright Holger Krekel and others, 2004-2020.
+
+Distributed under the terms of the `MIT`_ license, pytest is free and open source software.
+
+.. _`MIT`: https://github.com/pytest-dev/pytest/blob/master/LICENSE
diff --git a/contrib/python/pytest/py3/_pytest/__init__.py b/contrib/python/pytest/py3/_pytest/__init__.py
new file mode 100644
index 0000000000..46c7827ed5
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/__init__.py
@@ -0,0 +1,8 @@
+__all__ = ["__version__"]
+
+try:
+    from ._version import version as __version__
+except ImportError:
+    # broken installation, we don't even try
+    # unknown only works because we do poor mans version compare
+    __version__ = "unknown"
diff --git a/contrib/python/pytest/py3/_pytest/_argcomplete.py b/contrib/python/pytest/py3/_pytest/_argcomplete.py
new file mode 100644
index 0000000000..7ca216ecf9
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/_argcomplete.py
@@ -0,0 +1,109 @@
+"""allow bash-completion for argparse with argcomplete if installed
+needs argcomplete>=0.5.6 for python 3.2/3.3 (older versions fail
+to find the magic string, so _ARGCOMPLETE env. var is never set, and
+this does not need special code.
+
+Function try_argcomplete(parser) should be called directly before
+the call to ArgumentParser.parse_args().
+
+The filescompleter is what you normally would use on the positional
+arguments specification, in order to get "dirname/" after "dirn<TAB>"
+instead of the default "dirname ":
+
+   optparser.add_argument(Config._file_or_dir, nargs='*'
+                               ).completer=filescompleter
+
+Other, application specific, completers should go in the file
+doing the add_argument calls as they need to be specified as .completer
+attributes as well. (If argcomplete is not installed, the function the
+attribute points to will not be used).
+
+SPEEDUP
+=======
+The generic argcomplete script for bash-completion
+(/etc/bash_completion.d/python-argcomplete.sh )
+uses a python program to determine startup script generated by pip.
+You can speed up completion somewhat by changing this script to include
+  # PYTHON_ARGCOMPLETE_OK
+so the the python-argcomplete-check-easy-install-script does not
+need to be called to find the entry point of the code and see if that is
+marked  with PYTHON_ARGCOMPLETE_OK
+
+INSTALL/DEBUGGING
+=================
+To include this support in another application that has setup.py generated
+scripts:
+- add the line:
+    # PYTHON_ARGCOMPLETE_OK
+  near the top of the main python entry point
+- include in the file calling parse_args():
+    from _argcomplete import try_argcomplete, filescompleter
+   , call try_argcomplete just before parse_args(), and optionally add
+   filescompleter to the positional arguments' add_argument()
+If things do not work right away:
+- switch on argcomplete debugging with (also helpful when doing custom
+  completers):
+    export _ARC_DEBUG=1
+- run:
+    python-argcomplete-check-easy-install-script $(which appname)
+    echo $?
+  will echo 0 if the magic line has been found, 1 if not
+- sometimes it helps to find early on errors using:
+    _ARGCOMPLETE=1 _ARC_DEBUG=1 appname
+  which should throw a KeyError: 'COMPLINE' (which is properly set by the
+  global argcomplete script).
+"""
+import argparse
+import os
+import sys
+from glob import glob
+from typing import Any
+from typing import List
+from typing import Optional
+
+
+class FastFilesCompleter:
+    "Fast file completer class"
+
+    def __init__(self, directories: bool = True) -> None:
+        self.directories = directories
+
+    def __call__(self, prefix: str, **kwargs: Any) -> List[str]:
+        """only called on non option completions"""
+        if os.path.sep in prefix[1:]:
+            prefix_dir = len(os.path.dirname(prefix) + os.path.sep)
+        else:
+            prefix_dir = 0
+        completion = []
+        globbed = []
+        if "*" not in prefix and "?" not in prefix:
+            # we are on unix, otherwise no bash
+            if not prefix or prefix[-1] == os.path.sep:
+                globbed.extend(glob(prefix + ".*"))
+            prefix += "*"
+        globbed.extend(glob(prefix))
+        for x in sorted(globbed):
+            if os.path.isdir(x):
+                x += "/"
+            # append stripping the prefix (like bash, not like compgen)
+            completion.append(x[prefix_dir:])
+        return completion
+
+
+if os.environ.get("_ARGCOMPLETE"):
+    try:
+        import argcomplete.completers
+    except ImportError:
+        sys.exit(-1)
+    filescompleter = FastFilesCompleter()  # type: Optional[FastFilesCompleter]
+
+    def try_argcomplete(parser: argparse.ArgumentParser) -> None:
+        argcomplete.autocomplete(parser, always_complete_options=False)
+
+
+else:
+
+    def try_argcomplete(parser: argparse.ArgumentParser) -> None:
+        pass
+
+    filescompleter = None
diff --git a/contrib/python/pytest/py3/_pytest/_code/__init__.py b/contrib/python/pytest/py3/_pytest/_code/__init__.py
new file mode 100644
index 0000000000..370e41dc9f
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/_code/__init__.py
@@ -0,0 +1,10 @@
+""" python inspection/code generation API """
+from .code import Code  # noqa
+from .code import ExceptionInfo  # noqa
+from .code import filter_traceback  # noqa
+from .code import Frame  # noqa
+from .code import getrawcode  # noqa
+from .code import Traceback  # noqa
+from .source import compile_ as compile  # noqa
+from .source import getfslineno  # noqa
+from .source import Source  # noqa
diff --git a/contrib/python/pytest/py3/_pytest/_code/code.py b/contrib/python/pytest/py3/_pytest/_code/code.py
new file mode 100644
index 0000000000..965074c924
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/_code/code.py
@@ -0,0 +1,1191 @@
+import inspect
+import re
+import sys
+import traceback
+from inspect import CO_VARARGS
+from inspect import CO_VARKEYWORDS
+from io import StringIO
+from traceback import format_exception_only
+from types import CodeType
+from types import FrameType
+from types import TracebackType
+from typing import Any
+from typing import Callable
+from typing import Dict
+from typing import Generic
+from typing import Iterable
+from typing import List
+from typing import Optional
+from typing import Pattern
+from typing import Sequence
+from typing import Set
+from typing import Tuple
+from typing import TypeVar
+from typing import Union
+from weakref import ref
+
+import attr
+import pluggy
+import py
+
+import _pytest
+from _pytest._io import TerminalWriter
+from _pytest._io.saferepr import safeformat
+from _pytest._io.saferepr import saferepr
+from _pytest.compat import ATTRS_EQ_FIELD
+from _pytest.compat import overload
+from _pytest.compat import TYPE_CHECKING
+
+if TYPE_CHECKING:
+    from typing import Type
+    from typing_extensions import Literal
+    from weakref import ReferenceType  # noqa: F401
+
+    from _pytest._code import Source
+
+    _TracebackStyle = Literal["long", "short", "line", "no", "native"]
+
+
+class Code:
+    """ wrapper around Python code objects """
+
+    def __init__(self, rawcode) -> None:
+        if not hasattr(rawcode, "co_filename"):
+            rawcode = getrawcode(rawcode)
+        if not isinstance(rawcode, CodeType):
+            raise TypeError("not a code object: {!r}".format(rawcode))
+        self.filename = rawcode.co_filename
+        self.firstlineno = rawcode.co_firstlineno - 1
+        self.name = rawcode.co_name
+        self.raw = rawcode
+
+    def __eq__(self, other):
+        return self.raw == other.raw
+
+    # Ignore type because of https://github.com/python/mypy/issues/4266.
+    __hash__ = None  # type: ignore
+
+    def __ne__(self, other):
+        return not self == other
+
+    @property
+    def path(self) -> Union[py.path.local, str]:
+        """ return a path object pointing to source code (or a str in case
+        of OSError / non-existing file).
+        """
+        if not self.raw.co_filename:
+            return ""
+        try:
+            p = py.path.local(self.raw.co_filename)
+            # maybe don't try this checking
+            if not p.check():
+                raise OSError("py.path check failed.")
+            return p
+        except OSError:
+            # XXX maybe try harder like the weird logic
+            # in the standard lib [linecache.updatecache] does?
+            return self.raw.co_filename
+
+    @property
+    def fullsource(self) -> Optional["Source"]:
+        """ return a _pytest._code.Source object for the full source file of the code
+        """
+        from _pytest._code import source
+
+        full, _ = source.findsource(self.raw)
+        return full
+
+    def source(self) -> "Source":
+        """ return a _pytest._code.Source object for the code object's source only
+        """
+        # return source only for that part of code
+        import _pytest._code
+
+        return _pytest._code.Source(self.raw)
+
+    def getargs(self, var: bool = False) -> Tuple[str, ...]:
+        """ return a tuple with the argument names for the code object
+
+            if 'var' is set True also return the names of the variable and
+            keyword arguments when present
+        """
+        # handfull shortcut for getting args
+        raw = self.raw
+        argcount = raw.co_argcount
+        if var:
+            argcount += raw.co_flags & CO_VARARGS
+            argcount += raw.co_flags & CO_VARKEYWORDS
+        return raw.co_varnames[:argcount]
+
+
+class Frame:
+    """Wrapper around a Python frame holding f_locals and f_globals
+    in which expressions can be evaluated."""
+
+    def __init__(self, frame: FrameType) -> None:
+        self.lineno = frame.f_lineno - 1
+        self.f_globals = frame.f_globals
+        self.f_locals = frame.f_locals
+        self.raw = frame
+        self.code = Code(frame.f_code)
+
+    @property
+    def statement(self) -> "Source":
+        """ statement this frame is at """
+        import _pytest._code
+
+        if self.code.fullsource is None:
+            return _pytest._code.Source("")
+        return self.code.fullsource.getstatement(self.lineno)
+
+    def eval(self, code, **vars):
+        """ evaluate 'code' in the frame
+
+            'vars' are optional additional local variables
+
+            returns the result of the evaluation
+        """
+        f_locals = self.f_locals.copy()
+        f_locals.update(vars)
+        return eval(code, self.f_globals, f_locals)
+
+    def exec_(self, code, **vars) -> None:
+        """ exec 'code' in the frame
+
+            'vars' are optional; additional local variables
+        """
+        f_locals = self.f_locals.copy()
+        f_locals.update(vars)
+        exec(code, self.f_globals, f_locals)
+
+    def repr(self, object: object) -> str:
+        """ return a 'safe' (non-recursive, one-line) string repr for 'object'
+        """
+        return saferepr(object)
+
+    def is_true(self, object):
+        return object
+
+    def getargs(self, var: bool = False):
+        """ return a list of tuples (name, value) for all arguments
+
+            if 'var' is set True also include the variable and keyword
+            arguments when present
+        """
+        retval = []
+        for arg in self.code.getargs(var):
+            try:
+                retval.append((arg, self.f_locals[arg]))
+            except KeyError:
+                pass  # this can occur when using Psyco
+        return retval
+
+
+class TracebackEntry:
+    """ a single entry in a traceback """
+
+    _repr_style = None  # type: Optional[Literal["short", "long"]]
+    exprinfo = None
+
+    def __init__(self, rawentry: TracebackType, excinfo=None) -> None:
+        self._excinfo = excinfo
+        self._rawentry = rawentry
+        self.lineno = rawentry.tb_lineno - 1
+
+    def set_repr_style(self, mode: "Literal['short', 'long']") -> None:
+        assert mode in ("short", "long")
+        self._repr_style = mode
+
+    @property
+    def frame(self) -> Frame:
+        return Frame(self._rawentry.tb_frame)
+
+    @property
+    def relline(self) -> int:
+        return self.lineno - self.frame.code.firstlineno
+
+    def __repr__(self) -> str:
+        return "<TracebackEntry %s:%d>" % (self.frame.code.path, self.lineno + 1)
+
+    @property
+    def statement(self) -> "Source":
+        """ _pytest._code.Source object for the current statement """
+        source = self.frame.code.fullsource
+        assert source is not None
+        return source.getstatement(self.lineno)
+
+    @property
+    def path(self):
+        """ path to the source code """
+        return self.frame.code.path
+
+    @property
+    def locals(self) -> Dict[str, Any]:
+        """ locals of underlying frame """
+        return self.frame.f_locals
+
+    def getfirstlinesource(self) -> int:
+        return self.frame.code.firstlineno
+
+    def getsource(self, astcache=None) -> Optional["Source"]:
+        """ return failing source code. """
+        # we use the passed in astcache to not reparse asttrees
+        # within exception info printing
+        from _pytest._code.source import getstatementrange_ast
+
+        source = self.frame.code.fullsource
+        if source is None:
+            return None
+        key = astnode = None
+        if astcache is not None:
+            key = self.frame.code.path
+            if key is not None:
+                astnode = astcache.get(key, None)
+        start = self.getfirstlinesource()
+        try:
+            astnode, _, end = getstatementrange_ast(
+                self.lineno, source, astnode=astnode
+            )
+        except SyntaxError:
+            end = self.lineno + 1
+        else:
+            if key is not None:
+                astcache[key] = astnode
+        return source[start:end]
+
+    source = property(getsource)
+
+    def ishidden(self):
+        """ return True if the current frame has a var __tracebackhide__
+            resolving to True.
+
+            If __tracebackhide__ is a callable, it gets called with the
+            ExceptionInfo instance and can decide whether to hide the traceback.
+
+            mostly for internal use
+        """
+        f = self.frame
+        tbh = f.f_locals.get(
+            "__tracebackhide__", f.f_globals.get("__tracebackhide__", False)
+        )
+        if tbh and callable(tbh):
+            return tbh(None if self._excinfo is None else self._excinfo())
+        return tbh
+
+    def __str__(self) -> str:
+        try:
+            fn = str(self.path)
+        except py.error.Error:
+            fn = "???"
+        name = self.frame.code.name
+        try:
+            line = str(self.statement).lstrip()
+        except KeyboardInterrupt:
+            raise
+        except:  # noqa
+            line = "???"
+        return "  File %r:%d in %s\n  %s\n" % (fn, self.lineno + 1, name, line)
+
+    @property
+    def name(self) -> str:
+        """ co_name of underlying code """
+        return self.frame.code.raw.co_name
+
+
+class Traceback(List[TracebackEntry]):
+    """ Traceback objects encapsulate and offer higher level
+        access to Traceback entries.
+    """
+
+    def __init__(
+        self,
+        tb: Union[TracebackType, Iterable[TracebackEntry]],
+        excinfo: Optional["ReferenceType[ExceptionInfo]"] = None,
+    ) -> None:
+        """ initialize from given python traceback object and ExceptionInfo """
+        self._excinfo = excinfo
+        if isinstance(tb, TracebackType):
+
+            def f(cur: TracebackType) -> Iterable[TracebackEntry]:
+                cur_ = cur  # type: Optional[TracebackType]
+                while cur_ is not None:
+                    yield TracebackEntry(cur_, excinfo=excinfo)
+                    cur_ = cur_.tb_next
+
+            super().__init__(f(tb))
+        else:
+            super().__init__(tb)
+
+    def cut(
+        self,
+        path=None,
+        lineno: Optional[int] = None,
+        firstlineno: Optional[int] = None,
+        excludepath=None,
+    ) -> "Traceback":
+        """ return a Traceback instance wrapping part of this Traceback
+
+            by providing any combination of path, lineno and firstlineno, the
+            first frame to start the to-be-returned traceback is determined
+
+            this allows cutting the first part of a Traceback instance e.g.
+            for formatting reasons (removing some uninteresting bits that deal
+            with handling of the exception/traceback)
+        """
+        for x in self:
+            code = x.frame.code
+            codepath = code.path
+            if (
+                (path is None or codepath == path)
+                and (
+                    excludepath is None
+                    or not isinstance(codepath, py.path.local)
+                    or not codepath.relto(excludepath)
+                )
+                and (lineno is None or x.lineno == lineno)
+                and (firstlineno is None or x.frame.code.firstlineno == firstlineno)
+            ):
+                return Traceback(x._rawentry, self._excinfo)
+        return self
+
+    @overload
+    def __getitem__(self, key: int) -> TracebackEntry:
+        raise NotImplementedError()
+
+    @overload  # noqa: F811
+    def __getitem__(self, key: slice) -> "Traceback":  # noqa: F811
+        raise NotImplementedError()
+
+    def __getitem__(  # noqa: F811
+        self, key: Union[int, slice]
+    ) -> Union[TracebackEntry, "Traceback"]:
+        if isinstance(key, slice):
+            return self.__class__(super().__getitem__(key))
+        else:
+            return super().__getitem__(key)
+
+    def filter(
+        self, fn: Callable[[TracebackEntry], bool] = lambda x: not x.ishidden()
+    ) -> "Traceback":
+        """ return a Traceback instance with certain items removed
+
+            fn is a function that gets a single argument, a TracebackEntry
+            instance, and should return True when the item should be added
+            to the Traceback, False when not
+
+            by default this removes all the TracebackEntries which are hidden
+            (see ishidden() above)
+        """
+        return Traceback(filter(fn, self), self._excinfo)
+
+    def getcrashentry(self) -> TracebackEntry:
+        """ return last non-hidden traceback entry that lead
+        to the exception of a traceback.
+        """
+        for i in range(-1, -len(self) - 1, -1):
+            entry = self[i]
+            if not entry.ishidden():
+                return entry
+        return self[-1]
+
+    def recursionindex(self) -> Optional[int]:
+        """ return the index of the frame/TracebackEntry where recursion
+            originates if appropriate, None if no recursion occurred
+        """
+        cache = {}  # type: Dict[Tuple[Any, int, int], List[Dict[str, Any]]]
+        for i, entry in enumerate(self):
+            # id for the code.raw is needed to work around
+            # the strange metaprogramming in the decorator lib from pypi
+            # which generates code objects that have hash/value equality
+            # XXX needs a test
+            key = entry.frame.code.path, id(entry.frame.code.raw), entry.lineno
+            # print "checking for recursion at", key
+            values = cache.setdefault(key, [])
+            if values:
+                f = entry.frame
+                loc = f.f_locals
+                for otherloc in values:
+                    if f.is_true(
+                        f.eval(
+                            co_equal,
+                            __recursioncache_locals_1=loc,
+                            __recursioncache_locals_2=otherloc,
+                        )
+                    ):
+                        return i
+            values.append(entry.frame.f_locals)
+        return None
+
+
+co_equal = compile(
+    "__recursioncache_locals_1 == __recursioncache_locals_2", "?", "eval"
+)
+
+
+_E = TypeVar("_E", bound=BaseException)
+
+
+@attr.s(repr=False)
+class ExceptionInfo(Generic[_E]):
+    """ wraps sys.exc_info() objects and offers
+        help for navigating the traceback.
+    """
+
+    _assert_start_repr = "AssertionError('assert "
+
+    _excinfo = attr.ib(type=Optional[Tuple["Type[_E]", "_E", TracebackType]])
+    _striptext = attr.ib(type=str, default="")
+    _traceback = attr.ib(type=Optional[Traceback], default=None)
+
+    @classmethod
+    def from_exc_info(
+        cls,
+        exc_info: Tuple["Type[_E]", "_E", TracebackType],
+        exprinfo: Optional[str] = None,
+    ) -> "ExceptionInfo[_E]":
+        """returns an ExceptionInfo for an existing exc_info tuple.
+
+        .. warning::
+
+            Experimental API
+
+
+        :param exprinfo: a text string helping to determine if we should
+                         strip ``AssertionError`` from the output, defaults
+                         to the exception message/``__str__()``
+        """
+        _striptext = ""
+        if exprinfo is None and isinstance(exc_info[1], AssertionError):
+            exprinfo = getattr(exc_info[1], "msg", None)
+            if exprinfo is None:
+                exprinfo = saferepr(exc_info[1])
+            if exprinfo and exprinfo.startswith(cls._assert_start_repr):
+                _striptext = "AssertionError: "
+
+        return cls(exc_info, _striptext)
+
+    @classmethod
+    def from_current(
+        cls, exprinfo: Optional[str] = None
+    ) -> "ExceptionInfo[BaseException]":
+        """returns an ExceptionInfo matching the current traceback
+
+        .. warning::
+
+            Experimental API
+
+
+        :param exprinfo: a text string helping to determine if we should
+                         strip ``AssertionError`` from the output, defaults
+                         to the exception message/``__str__()``
+        """
+        tup = sys.exc_info()
+        assert tup[0] is not None, "no current exception"
+        assert tup[1] is not None, "no current exception"
+        assert tup[2] is not None, "no current exception"
+        exc_info = (tup[0], tup[1], tup[2])
+        return ExceptionInfo.from_exc_info(exc_info, exprinfo)
+
+    @classmethod
+    def for_later(cls) -> "ExceptionInfo[_E]":
+        """return an unfilled ExceptionInfo
+        """
+        return cls(None)
+
+    def fill_unfilled(self, exc_info: Tuple["Type[_E]", _E, TracebackType]) -> None:
+        """fill an unfilled ExceptionInfo created with for_later()"""
+        assert self._excinfo is None, "ExceptionInfo was already filled"
+        self._excinfo = exc_info
+
+    @property
+    def type(self) -> "Type[_E]":
+        """the exception class"""
+        assert (
+            self._excinfo is not None
+        ), ".type can only be used after the context manager exits"
+        return self._excinfo[0]
+
+    @property
+    def value(self) -> _E:
+        """the exception value"""
+        assert (
+            self._excinfo is not None
+        ), ".value can only be used after the context manager exits"
+        return self._excinfo[1]
+
+    @property
+    def tb(self) -> TracebackType:
+        """the exception raw traceback"""
+        assert (
+            self._excinfo is not None
+        ), ".tb can only be used after the context manager exits"
+        return self._excinfo[2]
+
+    @property
+    def typename(self) -> str:
+        """the type name of the exception"""
+        assert (
+            self._excinfo is not None
+        ), ".typename can only be used after the context manager exits"
+        return self.type.__name__
+
+    @property
+    def traceback(self) -> Traceback:
+        """the traceback"""
+        if self._traceback is None:
+            self._traceback = Traceback(self.tb, excinfo=ref(self))
+        return self._traceback
+
+    @traceback.setter
+    def traceback(self, value: Traceback) -> None:
+        self._traceback = value
+
+    def __repr__(self) -> str:
+        if self._excinfo is None:
+            return "<ExceptionInfo for raises contextmanager>"
+        return "<{} {} tblen={}>".format(
+            self.__class__.__name__, saferepr(self._excinfo[1]), len(self.traceback)
+        )
+
+    def exconly(self, tryshort: bool = False) -> str:
+        """ return the exception as a string
+
+            when 'tryshort' resolves to True, and the exception is a
+            _pytest._code._AssertionError, only the actual exception part of
+            the exception representation is returned (so 'AssertionError: ' is
+            removed from the beginning)
+        """
+        lines = format_exception_only(self.type, self.value)
+        text = "".join(lines)
+        text = text.rstrip()
+        if tryshort:
+            if text.startswith(self._striptext):
+                text = text[len(self._striptext) :]
+        return text
+
+    def errisinstance(
+        self, exc: Union["Type[BaseException]", Tuple["Type[BaseException]", ...]]
+    ) -> bool:
+        """ return True if the exception is an instance of exc """
+        return isinstance(self.value, exc)
+
+    def _getreprcrash(self) -> "ReprFileLocation":
+        exconly = self.exconly(tryshort=True)
+        entry = self.traceback.getcrashentry()
+        path, lineno = entry.frame.code.raw.co_filename, entry.lineno
+        return ReprFileLocation(path, lineno + 1, exconly)
+
+    def getrepr(
+        self,
+        showlocals: bool = False,
+        style: "_TracebackStyle" = "long",
+        abspath: bool = False,
+        tbfilter: bool = True,
+        funcargs: bool = False,
+        truncate_locals: bool = True,
+        chain: bool = True,
+    ) -> Union["ReprExceptionInfo", "ExceptionChainRepr"]:
+        """
+        Return str()able representation of this exception info.
+
+        :param bool showlocals:
+            Show locals per traceback entry.
+            Ignored if ``style=="native"``.
+
+        :param str style: long|short|no|native traceback style
+
+        :param bool abspath:
+            If paths should be changed to absolute or left unchanged.
+
+        :param bool tbfilter:
+            Hide entries that contain a local variable ``__tracebackhide__==True``.
+            Ignored if ``style=="native"``.
+
+        :param bool funcargs:
+            Show fixtures ("funcargs" for legacy purposes) per traceback entry.
+
+        :param bool truncate_locals:
+            With ``showlocals==True``, make sure locals can be safely represented as strings.
+
+        :param bool chain: if chained exceptions in Python 3 should be shown.
+
+        .. versionchanged:: 3.9
+
+            Added the ``chain`` parameter.
+        """
+        if style == "native":
+            return ReprExceptionInfo(
+                ReprTracebackNative(
+                    traceback.format_exception(
+                        self.type, self.value, self.traceback[0]._rawentry
+                    )
+                ),
+                self._getreprcrash(),
+            )
+
+        fmt = FormattedExcinfo(
+            showlocals=showlocals,
+            style=style,
+            abspath=abspath,
+            tbfilter=tbfilter,
+            funcargs=funcargs,
+            truncate_locals=truncate_locals,
+            chain=chain,
+        )
+        return fmt.repr_excinfo(self)
+
+    def match(self, regexp: "Union[str, Pattern]") -> "Literal[True]":
+        """
+        Check whether the regular expression `regexp` matches the string
+        representation of the exception using :func:`python:re.search`.
+        If it matches `True` is returned.
+        If it doesn't match an `AssertionError` is raised.
+        """
+        __tracebackhide__ = True
+        assert re.search(
+            regexp, str(self.value)
+        ), "Pattern {!r} does not match {!r}".format(regexp, str(self.value))
+        # Return True to allow for "assert excinfo.match()".
+        return True
+
+
+@attr.s
+class FormattedExcinfo:
+    """ presenting information about failing Functions and Generators. """
+
+    # for traceback entries
+    flow_marker = ">"
+    fail_marker = "E"
+
+    showlocals = attr.ib(type=bool, default=False)
+    style = attr.ib(type="_TracebackStyle", default="long")
+    abspath = attr.ib(type=bool, default=True)
+    tbfilter = attr.ib(type=bool, default=True)
+    funcargs = attr.ib(type=bool, default=False)
+    truncate_locals = attr.ib(type=bool, default=True)
+    chain = attr.ib(type=bool, default=True)
+    astcache = attr.ib(default=attr.Factory(dict), init=False, repr=False)
+
+    def _getindent(self, source: "Source") -> int:
+        # figure out indent for given source
+        try:
+            s = str(source.getstatement(len(source) - 1))
+        except KeyboardInterrupt:
+            raise
+        except:  # noqa
+            try:
+                s = str(source[-1])
+            except KeyboardInterrupt:
+                raise
+            except:  # noqa
+                return 0
+        return 4 + (len(s) - len(s.lstrip()))
+
+    def _getentrysource(self, entry: TracebackEntry) -> Optional["Source"]:
+        source = entry.getsource(self.astcache)
+        if source is not None:
+            source = source.deindent()
+        return source
+
+    def repr_args(self, entry: TracebackEntry) -> Optional["ReprFuncArgs"]:
+        if self.funcargs:
+            args = []
+            for argname, argvalue in entry.frame.getargs(var=True):
+                args.append((argname, saferepr(argvalue)))
+            return ReprFuncArgs(args)
+        return None
+
+    def get_source(
+        self,
+        source: "Source",
+        line_index: int = -1,
+        excinfo: Optional[ExceptionInfo] = None,
+        short: bool = False,
+    ) -> List[str]:
+        """ return formatted and marked up source lines. """
+        import _pytest._code
+
+        lines = []
+        if source is None or line_index >= len(source.lines):
+            source = _pytest._code.Source("???")
+            line_index = 0
+        if line_index < 0:
+            line_index += len(source)
+        space_prefix = "    "
+        if short:
+            lines.append(space_prefix + source.lines[line_index].strip())
+        else:
+            for line in source.lines[:line_index]:
+                lines.append(space_prefix + line)
+            lines.append(self.flow_marker + "   " + source.lines[line_index])
+            for line in source.lines[line_index + 1 :]:
+                lines.append(space_prefix + line)
+        if excinfo is not None:
+            indent = 4 if short else self._getindent(source)
+            lines.extend(self.get_exconly(excinfo, indent=indent, markall=True))
+        return lines
+
+    def get_exconly(
+        self, excinfo: ExceptionInfo, indent: int = 4, markall: bool = False
+    ) -> List[str]:
+        lines = []
+        indentstr = " " * indent
+        # get the real exception information out
+        exlines = excinfo.exconly(tryshort=True).split("\n")
+        failindent = self.fail_marker + indentstr[1:]
+        for line in exlines:
+            lines.append(failindent + line)
+            if not markall:
+                failindent = indentstr
+        return lines
+
+    def repr_locals(self, locals: Dict[str, object]) -> Optional["ReprLocals"]:
+        if self.showlocals:
+            lines = []
+            keys = [loc for loc in locals if loc[0] != "@"]
+            keys.sort()
+            for name in keys:
+                value = locals[name]
+                if name == "__builtins__":
+                    lines.append("__builtins__ = <builtins>")
+                else:
+                    # This formatting could all be handled by the
+                    # _repr() function, which is only reprlib.Repr in
+                    # disguise, so is very configurable.
+                    if self.truncate_locals:
+                        str_repr = saferepr(value)
+                    else:
+                        str_repr = safeformat(value)
+                    # if len(str_repr) < 70 or not isinstance(value,
+                    #                            (list, tuple, dict)):
+                    lines.append("{:<10} = {}".format(name, str_repr))
+                    # else:
+                    #    self._line("%-10s =\\" % (name,))
+                    #    # XXX
+                    #    pprint.pprint(value, stream=self.excinfowriter)
+            return ReprLocals(lines)
+        return None
+
+    def repr_traceback_entry(
+        self, entry: TracebackEntry, excinfo: Optional[ExceptionInfo] = None
+    ) -> "ReprEntry":
+        import _pytest._code
+
+        source = self._getentrysource(entry)
+        if source is None:
+            source = _pytest._code.Source("???")
+            line_index = 0
+        else:
+            line_index = entry.lineno - entry.getfirstlinesource()
+
+        lines = []  # type: List[str]
+        style = entry._repr_style if entry._repr_style is not None else self.style
+        if style in ("short", "long"):
+            short = style == "short"
+            reprargs = self.repr_args(entry) if not short else None
+            s = self.get_source(source, line_index, excinfo, short=short)
+            lines.extend(s)
+            if short:
+                message = "in %s" % (entry.name)
+            else:
+                message = excinfo and excinfo.typename or ""
+            path = self._makepath(entry.path)
+            reprfileloc = ReprFileLocation(path, entry.lineno + 1, message)
+            localsrepr = self.repr_locals(entry.locals)
+            return ReprEntry(lines, reprargs, localsrepr, reprfileloc, style)
+        if excinfo:
+            lines.extend(self.get_exconly(excinfo, indent=4))
+        return ReprEntry(lines, None, None, None, style)
+
+    def _makepath(self, path):
+        if not self.abspath:
+            try:
+                np = py.path.local().bestrelpath(path)
+            except OSError:
+                return path
+            if len(np) < len(str(path)):
+                path = np
+        return path
+
+    def repr_traceback(self, excinfo: ExceptionInfo) -> "ReprTraceback":
+        traceback = excinfo.traceback
+        if self.tbfilter:
+            traceback = traceback.filter()
+
+        if excinfo.errisinstance(RecursionError):
+            traceback, extraline = self._truncate_recursive_traceback(traceback)
+        else:
+            extraline = None
+
+        last = traceback[-1]
+        entries = []
+        for index, entry in enumerate(traceback):
+            einfo = (last == entry) and excinfo or None
+            reprentry = self.repr_traceback_entry(entry, einfo)
+            entries.append(reprentry)
+        return ReprTraceback(entries, extraline, style=self.style)
+
+    def _truncate_recursive_traceback(
+        self, traceback: Traceback
+    ) -> Tuple[Traceback, Optional[str]]:
+        """
+        Truncate the given recursive traceback trying to find the starting point
+        of the recursion.
+
+        The detection is done by going through each traceback entry and finding the
+        point in which the locals of the frame are equal to the locals of a previous frame (see ``recursionindex()``.
+
+        Handle the situation where the recursion process might raise an exception (for example
+        comparing numpy arrays using equality raises a TypeError), in which case we do our best to
+        warn the user of the error and show a limited traceback.
+        """
+        try:
+            recursionindex = traceback.recursionindex()
+        except Exception as e:
+            max_frames = 10
+            extraline = (
+                "!!! Recursion error detected, but an error occurred locating the origin of recursion.\n"
+                "  The following exception happened when comparing locals in the stack frame:\n"
+                "    {exc_type}: {exc_msg}\n"
+                "  Displaying first and last {max_frames} stack frames out of {total}."
+            ).format(
+                exc_type=type(e).__name__,
+                exc_msg=str(e),
+                max_frames=max_frames,
+                total=len(traceback),
+            )  # type: Optional[str]
+            # Type ignored because adding two instaces of a List subtype
+            # currently incorrectly has type List instead of the subtype.
+            traceback = traceback[:max_frames] + traceback[-max_frames:]  # type: ignore
+        else:
+            if recursionindex is not None:
+                extraline = "!!! Recursion detected (same locals & position)"
+                traceback = traceback[: recursionindex + 1]
+            else:
+                extraline = None
+
+        return traceback, extraline
+
+    def repr_excinfo(self, excinfo: ExceptionInfo) -> "ExceptionChainRepr":
+        repr_chain = (
+            []
+        )  # type: List[Tuple[ReprTraceback, Optional[ReprFileLocation], Optional[str]]]
+        e = excinfo.value
+        excinfo_ = excinfo  # type: Optional[ExceptionInfo]
+        descr = None
+        seen = set()  # type: Set[int]
+        while e is not None and id(e) not in seen:
+            seen.add(id(e))
+            if excinfo_:
+                reprtraceback = self.repr_traceback(excinfo_)
+                reprcrash = excinfo_._getreprcrash()  # type: Optional[ReprFileLocation]
+            else:
+                # fallback to native repr if the exception doesn't have a traceback:
+                # ExceptionInfo objects require a full traceback to work
+                reprtraceback = ReprTracebackNative(
+                    traceback.format_exception(type(e), e, None)
+                )
+                reprcrash = None
+
+            repr_chain += [(reprtraceback, reprcrash, descr)]
+            if e.__cause__ is not None and self.chain:
+                e = e.__cause__
+                excinfo_ = (
+                    ExceptionInfo((type(e), e, e.__traceback__))
+                    if e.__traceback__
+                    else None
+                )
+                descr = "The above exception was the direct cause of the following exception:"
+            elif (
+                e.__context__ is not None and not e.__suppress_context__ and self.chain
+            ):
+                e = e.__context__
+                excinfo_ = (
+                    ExceptionInfo((type(e), e, e.__traceback__))
+                    if e.__traceback__
+                    else None
+                )
+                descr = "During handling of the above exception, another exception occurred:"
+            else:
+                e = None
+        repr_chain.reverse()
+        return ExceptionChainRepr(repr_chain)
+
+
+@attr.s(**{ATTRS_EQ_FIELD: False})  # type: ignore
+class TerminalRepr:
+    def __str__(self) -> str:
+        # FYI this is called from pytest-xdist's serialization of exception
+        # information.
+        io = StringIO()
+        tw = TerminalWriter(file=io)
+        self.toterminal(tw)
+        return io.getvalue().strip()
+
+    def __repr__(self) -> str:
+        return "<{} instance at {:0x}>".format(self.__class__, id(self))
+
+    def toterminal(self, tw: TerminalWriter) -> None:
+        raise NotImplementedError()
+
+
+@attr.s(**{ATTRS_EQ_FIELD: False})  # type: ignore
+class ExceptionRepr(TerminalRepr):
+    def __attrs_post_init__(self):
+        self.sections = []  # type: List[Tuple[str, str, str]]
+
+    def addsection(self, name: str, content: str, sep: str = "-") -> None:
+        self.sections.append((name, content, sep))
+
+    def toterminal(self, tw: TerminalWriter) -> None:
+        for name, content, sep in self.sections:
+            tw.sep(sep, name)
+            tw.line(content)
+
+
+@attr.s(**{ATTRS_EQ_FIELD: False})  # type: ignore
+class ExceptionChainRepr(ExceptionRepr):
+    chain = attr.ib(
+        type=Sequence[
+            Tuple["ReprTraceback", Optional["ReprFileLocation"], Optional[str]]
+        ]
+    )
+
+    def __attrs_post_init__(self):
+        super().__attrs_post_init__()
+        # reprcrash and reprtraceback of the outermost (the newest) exception
+        # in the chain
+        self.reprtraceback = self.chain[-1][0]
+        self.reprcrash = self.chain[-1][1]
+
+    def toterminal(self, tw: TerminalWriter) -> None:
+        for element in self.chain:
+            element[0].toterminal(tw)
+            if element[2] is not None:
+                tw.line("")
+                tw.line(element[2], yellow=True)
+        super().toterminal(tw)
+
+
+@attr.s(**{ATTRS_EQ_FIELD: False})  # type: ignore
+class ReprExceptionInfo(ExceptionRepr):
+    reprtraceback = attr.ib(type="ReprTraceback")
+    reprcrash = attr.ib(type="ReprFileLocation")
+
+    def toterminal(self, tw: TerminalWriter) -> None:
+        self.reprtraceback.toterminal(tw)
+        super().toterminal(tw)
+
+
+@attr.s(**{ATTRS_EQ_FIELD: False})  # type: ignore
+class ReprTraceback(TerminalRepr):
+    reprentries = attr.ib(type=Sequence[Union["ReprEntry", "ReprEntryNative"]])
+    extraline = attr.ib(type=Optional[str])
+    style = attr.ib(type="_TracebackStyle")
+
+    entrysep = "_ "
+
+    def toterminal(self, tw: TerminalWriter) -> None:
+        # the entries might have different styles
+        for i, entry in enumerate(self.reprentries):
+            if entry.style == "long":
+                tw.line("")
+            entry.toterminal(tw)
+            if i < len(self.reprentries) - 1:
+                next_entry = self.reprentries[i + 1]
+                if (
+                    entry.style == "long"
+                    or entry.style == "short"
+                    and next_entry.style == "long"
+                ):
+                    tw.sep(self.entrysep)
+
+        if self.extraline:
+            tw.line(self.extraline)
+
+
+class ReprTracebackNative(ReprTraceback):
+    def __init__(self, tblines: Sequence[str]) -> None:
+        self.style = "native"
+        self.reprentries = [ReprEntryNative(tblines)]
+        self.extraline = None
+
+
+@attr.s(**{ATTRS_EQ_FIELD: False})  # type: ignore
+class ReprEntryNative(TerminalRepr):
+    lines = attr.ib(type=Sequence[str])
+    style = "native"  # type: _TracebackStyle
+
+    def toterminal(self, tw: TerminalWriter) -> None:
+        tw.write("".join(self.lines))
+
+
+@attr.s(**{ATTRS_EQ_FIELD: False})  # type: ignore
+class ReprEntry(TerminalRepr):
+    lines = attr.ib(type=Sequence[str])
+    reprfuncargs = attr.ib(type=Optional["ReprFuncArgs"])
+    reprlocals = attr.ib(type=Optional["ReprLocals"])
+    reprfileloc = attr.ib(type=Optional["ReprFileLocation"])
+    style = attr.ib(type="_TracebackStyle")
+
+    def _write_entry_lines(self, tw: TerminalWriter) -> None:
+        """Writes the source code portions of a list of traceback entries with syntax highlighting.
+
+        Usually entries are lines like these:
+
+            "     x = 1"
+            ">    assert x == 2"
+            "E    assert 1 == 2"
+
+        This function takes care of rendering the "source" portions of it (the lines without
+        the "E" prefix) using syntax highlighting, taking care to not highlighting the ">"
+        character, as doing so might break line continuations.
+        """
+
+        indent_size = 4
+
+        def is_fail(line):
+            return line.startswith("{}   ".format(FormattedExcinfo.fail_marker))
+
+        if not self.lines:
+            return
+
+        # separate indents and source lines that are not failures: we want to
+        # highlight the code but not the indentation, which may contain markers
+        # such as ">   assert 0"
+        indents = []
+        source_lines = []
+        for line in self.lines:
+            if not is_fail(line):
+                indents.append(line[:indent_size])
+                source_lines.append(line[indent_size:])
+
+        tw._write_source(source_lines, indents)
+
+        # failure lines are always completely red and bold
+        for line in (x for x in self.lines if is_fail(x)):
+            tw.line(line, bold=True, red=True)
+
+    def toterminal(self, tw: TerminalWriter) -> None:
+        if self.style == "short":
+            assert self.reprfileloc is not None
+            self.reprfileloc.toterminal(tw)
+            self._write_entry_lines(tw)
+            if self.reprlocals:
+                self.reprlocals.toterminal(tw, indent=" " * 8)
+            return
+
+        if self.reprfuncargs:
+            self.reprfuncargs.toterminal(tw)
+
+        self._write_entry_lines(tw)
+
+        if self.reprlocals:
+            tw.line("")
+            self.reprlocals.toterminal(tw)
+        if self.reprfileloc:
+            if self.lines:
+                tw.line("")
+            self.reprfileloc.toterminal(tw)
+
+    def __str__(self) -> str:
+        return "{}\n{}\n{}".format(
+            "\n".join(self.lines), self.reprlocals, self.reprfileloc
+        )
+
+
+@attr.s(**{ATTRS_EQ_FIELD: False})  # type: ignore
+class ReprFileLocation(TerminalRepr):
+    path = attr.ib(type=str, converter=str)
+    lineno = attr.ib(type=int)
+    message = attr.ib(type=str)
+
+    def toterminal(self, tw: TerminalWriter) -> None:
+        # filename and lineno output for each entry,
+        # using an output format that most editors understand
+        msg = self.message
+        i = msg.find("\n")
+        if i != -1:
+            msg = msg[:i]
+        tw.write(self.path, bold=True, red=True)
+        tw.line(":{}: {}".format(self.lineno, msg))
+
+
+@attr.s(**{ATTRS_EQ_FIELD: False})  # type: ignore
+class ReprLocals(TerminalRepr):
+    lines = attr.ib(type=Sequence[str])
+
+    def toterminal(self, tw: TerminalWriter, indent="") -> None:
+        for line in self.lines:
+            tw.line(indent + line)
+
+
+@attr.s(**{ATTRS_EQ_FIELD: False})  # type: ignore
+class ReprFuncArgs(TerminalRepr):
+    args = attr.ib(type=Sequence[Tuple[str, object]])
+
+    def toterminal(self, tw: TerminalWriter) -> None:
+        if self.args:
+            linesofar = ""
+            for name, value in self.args:
+                ns = "{} = {}".format(name, value)
+                if len(ns) + len(linesofar) + 2 > tw.fullwidth:
+                    if linesofar:
+                        tw.line(linesofar)
+                    linesofar = ns
+                else:
+                    if linesofar:
+                        linesofar += ", " + ns
+                    else:
+                        linesofar = ns
+            if linesofar:
+                tw.line(linesofar)
+            tw.line("")
+
+
+def getrawcode(obj, trycall: bool = True):
+    """ return code object for given function. """
+    try:
+        return obj.__code__
+    except AttributeError:
+        obj = getattr(obj, "f_code", obj)
+        obj = getattr(obj, "__code__", obj)
+        if trycall and not hasattr(obj, "co_firstlineno"):
+            if hasattr(obj, "__call__") and not inspect.isclass(obj):
+                x = getrawcode(obj.__call__, trycall=False)
+                if hasattr(x, "co_firstlineno"):
+                    return x
+        return obj
+
+
+# relative paths that we use to filter traceback entries from appearing to the user;
+# see filter_traceback
+# note: if we need to add more paths than what we have now we should probably use a list
+# for better maintenance
+
+_PLUGGY_DIR = py.path.local(pluggy.__file__.rstrip("oc"))
+# pluggy is either a package or a single module depending on the version
+if _PLUGGY_DIR.basename == "__init__.py":
+    _PLUGGY_DIR = _PLUGGY_DIR.dirpath()
+_PYTEST_DIR = py.path.local(_pytest.__file__).dirpath()
+_PY_DIR = py.path.local(py.__file__).dirpath()
+
+
+def filter_traceback(entry: TracebackEntry) -> bool:
+    """Return True if a TracebackEntry instance should be removed from tracebacks:
+    * dynamically generated code (no code to show up for it);
+    * internal traceback from pytest or its internal libraries, py and pluggy.
+    """
+    # entry.path might sometimes return a str object when the entry
+    # points to dynamically generated code
+    # see https://bitbucket.org/pytest-dev/py/issues/71
+    raw_filename = entry.frame.code.raw.co_filename
+    is_generated = "<" in raw_filename and ">" in raw_filename
+    if is_generated:
+        return False
+    # entry.path might point to a non-existing file, in which case it will
+    # also return a str object. see #1133
+    p = py.path.local(entry.path)
+    return (
+        not p.relto(_PLUGGY_DIR) and not p.relto(_PYTEST_DIR) and not p.relto(_PY_DIR)
+    )
diff --git a/contrib/python/pytest/py3/_pytest/_code/source.py b/contrib/python/pytest/py3/_pytest/_code/source.py
new file mode 100644
index 0000000000..28c11e5d5e
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/_code/source.py
@@ -0,0 +1,416 @@
+import ast
+import inspect
+import linecache
+import sys
+import textwrap
+import tokenize
+import warnings
+from bisect import bisect_right
+from types import CodeType
+from types import FrameType
+from typing import Any
+from typing import Iterator
+from typing import List
+from typing import Optional
+from typing import Sequence
+from typing import Tuple
+from typing import Union
+
+import py
+
+from _pytest.compat import get_real_func
+from _pytest.compat import overload
+from _pytest.compat import TYPE_CHECKING
+
+if TYPE_CHECKING:
+    from typing_extensions import Literal
+
+
+class Source:
+    """ an immutable object holding a source code fragment,
+        possibly deindenting it.
+    """
+
+    _compilecounter = 0
+
+    def __init__(self, *parts, **kwargs) -> None:
+        self.lines = lines = []  # type: List[str]
+        de = kwargs.get("deindent", True)
+        for part in parts:
+            if not part:
+                partlines = []  # type: List[str]
+            elif isinstance(part, Source):
+                partlines = part.lines
+            elif isinstance(part, (tuple, list)):
+                partlines = [x.rstrip("\n") for x in part]
+            elif isinstance(part, str):
+                partlines = part.split("\n")
+            else:
+                partlines = getsource(part, deindent=de).lines
+            if de:
+                partlines = deindent(partlines)
+            lines.extend(partlines)
+
+    def __eq__(self, other):
+        try:
+            return self.lines == other.lines
+        except AttributeError:
+            if isinstance(other, str):
+                return str(self) == other
+            return False
+
+    # Ignore type because of https://github.com/python/mypy/issues/4266.
+    __hash__ = None  # type: ignore
+
+    @overload
+    def __getitem__(self, key: int) -> str:
+        raise NotImplementedError()
+
+    @overload  # noqa: F811
+    def __getitem__(self, key: slice) -> "Source":  # noqa: F811
+        raise NotImplementedError()
+
+    def __getitem__(self, key: Union[int, slice]) -> Union[str, "Source"]:  # noqa: F811
+        if isinstance(key, int):
+            return self.lines[key]
+        else:
+            if key.step not in (None, 1):
+                raise IndexError("cannot slice a Source with a step")
+            newsource = Source()
+            newsource.lines = self.lines[key.start : key.stop]
+            return newsource
+
+    def __iter__(self) -> Iterator[str]:
+        return iter(self.lines)
+
+    def __len__(self) -> int:
+        return len(self.lines)
+
+    def strip(self) -> "Source":
+        """ return new source object with trailing
+            and leading blank lines removed.
+        """
+        start, end = 0, len(self)
+        while start < end and not self.lines[start].strip():
+            start += 1
+        while end > start and not self.lines[end - 1].strip():
+            end -= 1
+        source = Source()
+        source.lines[:] = self.lines[start:end]
+        return source
+
+    def putaround(
+        self, before: str = "", after: str = "", indent: str = " " * 4
+    ) -> "Source":
+        """ return a copy of the source object with
+            'before' and 'after' wrapped around it.
+        """
+        beforesource = Source(before)
+        aftersource = Source(after)
+        newsource = Source()
+        lines = [(indent + line) for line in self.lines]
+        newsource.lines = beforesource.lines + lines + aftersource.lines
+        return newsource
+
+    def indent(self, indent: str = " " * 4) -> "Source":
+        """ return a copy of the source object with
+            all lines indented by the given indent-string.
+        """
+        newsource = Source()
+        newsource.lines = [(indent + line) for line in self.lines]
+        return newsource
+
+    def getstatement(self, lineno: int) -> "Source":
+        """ return Source statement which contains the
+            given linenumber (counted from 0).
+        """
+        start, end = self.getstatementrange(lineno)
+        return self[start:end]
+
+    def getstatementrange(self, lineno: int) -> Tuple[int, int]:
+        """ return (start, end) tuple which spans the minimal
+            statement region which containing the given lineno.
+        """
+        if not (0 <= lineno < len(self)):
+            raise IndexError("lineno out of range")
+        ast, start, end = getstatementrange_ast(lineno, self)
+        return start, end
+
+    def deindent(self) -> "Source":
+        """return a new source object deindented."""
+        newsource = Source()
+        newsource.lines[:] = deindent(self.lines)
+        return newsource
+
+    def isparseable(self, deindent: bool = True) -> bool:
+        """ return True if source is parseable, heuristically
+            deindenting it by default.
+        """
+        if deindent:
+            source = str(self.deindent())
+        else:
+            source = str(self)
+        try:
+            ast.parse(source)
+        except (SyntaxError, ValueError, TypeError):
+            return False
+        else:
+            return True
+
+    def __str__(self) -> str:
+        return "\n".join(self.lines)
+
+    @overload
+    def compile(
+        self,
+        filename: Optional[str] = ...,
+        mode: str = ...,
+        flag: "Literal[0]" = ...,
+        dont_inherit: int = ...,
+        _genframe: Optional[FrameType] = ...,
+    ) -> CodeType:
+        raise NotImplementedError()
+
+    @overload  # noqa: F811
+    def compile(  # noqa: F811
+        self,
+        filename: Optional[str] = ...,
+        mode: str = ...,
+        flag: int = ...,
+        dont_inherit: int = ...,
+        _genframe: Optional[FrameType] = ...,
+    ) -> Union[CodeType, ast.AST]:
+        raise NotImplementedError()
+
+    def compile(  # noqa: F811
+        self,
+        filename: Optional[str] = None,
+        mode: str = "exec",
+        flag: int = 0,
+        dont_inherit: int = 0,
+        _genframe: Optional[FrameType] = None,
+    ) -> Union[CodeType, ast.AST]:
+        """ return compiled code object. if filename is None
+            invent an artificial filename which displays
+            the source/line position of the caller frame.
+        """
+        if not filename or py.path.local(filename).check(file=0):
+            if _genframe is None:
+                _genframe = sys._getframe(1)  # the caller
+            fn, lineno = _genframe.f_code.co_filename, _genframe.f_lineno
+            base = "<%d-codegen " % self._compilecounter
+            self.__class__._compilecounter += 1
+            if not filename:
+                filename = base + "%s:%d>" % (fn, lineno)
+            else:
+                filename = base + "%r %s:%d>" % (filename, fn, lineno)
+        source = "\n".join(self.lines) + "\n"
+        try:
+            co = compile(source, filename, mode, flag)
+        except SyntaxError as ex:
+            # re-represent syntax errors from parsing python strings
+            msglines = self.lines[: ex.lineno]
+            if ex.offset:
+                msglines.append(" " * ex.offset + "^")
+            msglines.append("(code was compiled probably from here: %s)" % filename)
+            newex = SyntaxError("\n".join(msglines))
+            newex.offset = ex.offset
+            newex.lineno = ex.lineno
+            newex.text = ex.text
+            raise newex
+        else:
+            if flag & ast.PyCF_ONLY_AST:
+                assert isinstance(co, ast.AST)
+                return co
+            assert isinstance(co, CodeType)
+            lines = [(x + "\n") for x in self.lines]
+            # Type ignored because linecache.cache is private.
+            linecache.cache[filename] = (1, None, lines, filename)  # type: ignore
+            return co
+
+
+#
+# public API shortcut functions
+#
+
+
+@overload
+def compile_(
+    source: Union[str, bytes, ast.mod, ast.AST],
+    filename: Optional[str] = ...,
+    mode: str = ...,
+    flags: "Literal[0]" = ...,
+    dont_inherit: int = ...,
+) -> CodeType:
+    raise NotImplementedError()
+
+
+@overload  # noqa: F811
+def compile_(  # noqa: F811
+    source: Union[str, bytes, ast.mod, ast.AST],
+    filename: Optional[str] = ...,
+    mode: str = ...,
+    flags: int = ...,
+    dont_inherit: int = ...,
+) -> Union[CodeType, ast.AST]:
+    raise NotImplementedError()
+
+
+def compile_(  # noqa: F811
+    source: Union[str, bytes, ast.mod, ast.AST],
+    filename: Optional[str] = None,
+    mode: str = "exec",
+    flags: int = 0,
+    dont_inherit: int = 0,
+) -> Union[CodeType, ast.AST]:
+    """ compile the given source to a raw code object,
+        and maintain an internal cache which allows later
+        retrieval of the source code for the code object
+        and any recursively created code objects.
+    """
+    if isinstance(source, ast.AST):
+        # XXX should Source support having AST?
+        assert filename is not None
+        co = compile(source, filename, mode, flags, dont_inherit)
+        assert isinstance(co, (CodeType, ast.AST))
+        return co
+    _genframe = sys._getframe(1)  # the caller
+    s = Source(source)
+    return s.compile(filename, mode, flags, _genframe=_genframe)
+
+
+def getfslineno(obj: Any) -> Tuple[Union[str, py.path.local], int]:
+    """ Return source location (path, lineno) for the given object.
+    If the source cannot be determined return ("", -1).
+
+    The line number is 0-based.
+    """
+    from .code import Code
+
+    # xxx let decorators etc specify a sane ordering
+    # NOTE: this used to be done in _pytest.compat.getfslineno, initially added
+    #       in 6ec13a2b9.  It ("place_as") appears to be something very custom.
+    obj = get_real_func(obj)
+    if hasattr(obj, "place_as"):
+        obj = obj.place_as
+
+    try:
+        code = Code(obj)
+    except TypeError:
+        try:
+            fn = inspect.getsourcefile(obj) or inspect.getfile(obj)
+        except TypeError:
+            return "", -1
+
+        fspath = fn and py.path.local(fn) or ""
+        lineno = -1
+        if fspath:
+            try:
+                _, lineno = findsource(obj)
+            except IOError:
+                pass
+        return fspath, lineno
+    else:
+        return code.path, code.firstlineno
+
+
+#
+# helper functions
+#
+
+
+def findsource(obj) -> Tuple[Optional[Source], int]:
+    try:
+        sourcelines, lineno = inspect.findsource(obj)
+    except Exception:
+        return None, -1
+    source = Source()
+    source.lines = [line.rstrip() for line in sourcelines]
+    return source, lineno
+
+
+def getsource(obj, **kwargs) -> Source:
+    from .code import getrawcode
+
+    obj = getrawcode(obj)
+    try:
+        strsrc = inspect.getsource(obj)
+    except IndentationError:
+        strsrc = '"Buggy python version consider upgrading, cannot get source"'
+    assert isinstance(strsrc, str)
+    return Source(strsrc, **kwargs)
+
+
+def deindent(lines: Sequence[str]) -> List[str]:
+    return textwrap.dedent("\n".join(lines)).splitlines()
+
+
+def get_statement_startend2(lineno: int, node: ast.AST) -> Tuple[int, Optional[int]]:
+    import ast
+
+    # flatten all statements and except handlers into one lineno-list
+    # AST's line numbers start indexing at 1
+    values = []  # type: List[int]
+    for x in ast.walk(node):
+        if isinstance(x, (ast.stmt, ast.ExceptHandler)):
+            values.append(x.lineno - 1)
+            for name in ("finalbody", "orelse"):
+                val = getattr(x, name, None)  # type: Optional[List[ast.stmt]]
+                if val:
+                    # treat the finally/orelse part as its own statement
+                    values.append(val[0].lineno - 1 - 1)
+    values.sort()
+    insert_index = bisect_right(values, lineno)
+    start = values[insert_index - 1]
+    if insert_index >= len(values):
+        end = None
+    else:
+        end = values[insert_index]
+    return start, end
+
+
+def getstatementrange_ast(
+    lineno: int,
+    source: Source,
+    assertion: bool = False,
+    astnode: Optional[ast.AST] = None,
+) -> Tuple[ast.AST, int, int]:
+    if astnode is None:
+        content = str(source)
+        # See #4260:
+        # don't produce duplicate warnings when compiling source to find ast
+        with warnings.catch_warnings():
+            warnings.simplefilter("ignore")
+            astnode = ast.parse(content, "source", "exec")
+
+    start, end = get_statement_startend2(lineno, astnode)
+    # we need to correct the end:
+    # - ast-parsing strips comments
+    # - there might be empty lines
+    # - we might have lesser indented code blocks at the end
+    if end is None:
+        end = len(source.lines)
+
+    if end > start + 1:
+        # make sure we don't span differently indented code blocks
+        # by using the BlockFinder helper used which inspect.getsource() uses itself
+        block_finder = inspect.BlockFinder()
+        # if we start with an indented line, put blockfinder to "started" mode
+        block_finder.started = source.lines[start][0].isspace()
+        it = ((x + "\n") for x in source.lines[start:end])
+        try:
+            for tok in tokenize.generate_tokens(lambda: next(it)):
+                block_finder.tokeneater(*tok)
+        except (inspect.EndOfBlock, IndentationError):
+            end = block_finder.last + start
+        except Exception:
+            pass
+
+    # the end might still point to a comment or empty line, correct it
+    while end:
+        line = source.lines[end - 1].lstrip()
+        if line.startswith("#") or not line:
+            end -= 1
+        else:
+            break
+    return astnode, start, end
diff --git a/contrib/python/pytest/py3/_pytest/_io/__init__.py b/contrib/python/pytest/py3/_pytest/_io/__init__.py
new file mode 100644
index 0000000000..f56579806c
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/_io/__init__.py
@@ -0,0 +1,39 @@
+from typing import List
+from typing import Sequence
+
+from py.io import TerminalWriter as BaseTerminalWriter  # noqa: F401
+
+
+class TerminalWriter(BaseTerminalWriter):
+    def _write_source(self, lines: List[str], indents: Sequence[str] = ()) -> None:
+        """Write lines of source code possibly highlighted.
+
+        Keeping this private for now because the API is clunky. We should discuss how
+        to evolve the terminal writer so we can have more precise color support, for example
+        being able to write part of a line in one color and the rest in another, and so on.
+        """
+        if indents and len(indents) != len(lines):
+            raise ValueError(
+                "indents size ({}) should have same size as lines ({})".format(
+                    len(indents), len(lines)
+                )
+            )
+        if not indents:
+            indents = [""] * len(lines)
+        source = "\n".join(lines)
+        new_lines = self._highlight(source).splitlines()
+        for indent, new_line in zip(indents, new_lines):
+            self.line(indent + new_line)
+
+    def _highlight(self, source):
+        """Highlight the given source code according to the "code_highlight" option"""
+        if not self.hasmarkup:
+            return source
+        try:
+            from pygments.formatters.terminal import TerminalFormatter
+            from pygments.lexers.python import PythonLexer
+            from pygments import highlight
+        except ImportError:
+            return source
+        else:
+            return highlight(source, PythonLexer(), TerminalFormatter(bg="dark"))
diff --git a/contrib/python/pytest/py3/_pytest/_io/saferepr.py b/contrib/python/pytest/py3/_pytest/_io/saferepr.py
new file mode 100644
index 0000000000..47a00de606
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/_io/saferepr.py
@@ -0,0 +1,103 @@
+import pprint
+import reprlib
+from typing import Any
+
+
+def _try_repr_or_str(obj):
+    try:
+        return repr(obj)
+    except (KeyboardInterrupt, SystemExit):
+        raise
+    except BaseException:
+        return '{}("{}")'.format(type(obj).__name__, obj)
+
+
+def _format_repr_exception(exc: BaseException, obj: Any) -> str:
+    try:
+        exc_info = _try_repr_or_str(exc)
+    except (KeyboardInterrupt, SystemExit):
+        raise
+    except BaseException as exc:
+        exc_info = "unpresentable exception ({})".format(_try_repr_or_str(exc))
+    return "<[{} raised in repr()] {} object at 0x{:x}>".format(
+        exc_info, type(obj).__name__, id(obj)
+    )
+
+
+def _ellipsize(s: str, maxsize: int) -> str:
+    if len(s) > maxsize:
+        i = max(0, (maxsize - 3) // 2)
+        j = max(0, maxsize - 3 - i)
+        return s[:i] + "..." + s[len(s) - j :]
+    return s
+
+
+class SafeRepr(reprlib.Repr):
+    """subclass of repr.Repr that limits the resulting size of repr()
+    and includes information on exceptions raised during the call.
+    """
+
+    def __init__(self, maxsize: int) -> None:
+        super().__init__()
+        self.maxstring = maxsize
+        self.maxsize = maxsize
+
+    def repr(self, x: Any) -> str:
+        try:
+            s = super().repr(x)
+        except (KeyboardInterrupt, SystemExit):
+            raise
+        except BaseException as exc:
+            s = _format_repr_exception(exc, x)
+        return _ellipsize(s, self.maxsize)
+
+    def repr_instance(self, x: Any, level: int) -> str:
+        try:
+            s = repr(x)
+        except (KeyboardInterrupt, SystemExit):
+            raise
+        except BaseException as exc:
+            s = _format_repr_exception(exc, x)
+        return _ellipsize(s, self.maxsize)
+
+
+def safeformat(obj: Any) -> str:
+    """return a pretty printed string for the given object.
+    Failing __repr__ functions of user instances will be represented
+    with a short exception info.
+    """
+    try:
+        return pprint.pformat(obj)
+    except Exception as exc:
+        return _format_repr_exception(exc, obj)
+
+
+def saferepr(obj: Any, maxsize: int = 240) -> str:
+    """return a size-limited safe repr-string for the given object.
+    Failing __repr__ functions of user instances will be represented
+    with a short exception info and 'saferepr' generally takes
+    care to never raise exceptions itself.  This function is a wrapper
+    around the Repr/reprlib functionality of the standard 2.6 lib.
+    """
+    return SafeRepr(maxsize).repr(obj)
+
+
+class AlwaysDispatchingPrettyPrinter(pprint.PrettyPrinter):
+    """PrettyPrinter that always dispatches (regardless of width)."""
+
+    def _format(self, object, stream, indent, allowance, context, level):
+        p = self._dispatch.get(type(object).__repr__, None)
+
+        objid = id(object)
+        if objid in context or p is None:
+            return super()._format(object, stream, indent, allowance, context, level)
+
+        context[objid] = 1
+        p(self, object, stream, indent, allowance, context, level + 1)
+        del context[objid]
+
+
+def _pformat_dispatch(object, indent=1, width=80, depth=None, *, compact=False):
+    return AlwaysDispatchingPrettyPrinter(
+        indent=indent, width=width, depth=depth, compact=compact
+    ).pformat(object)
diff --git a/contrib/python/pytest/py3/_pytest/_version.py b/contrib/python/pytest/py3/_pytest/_version.py
new file mode 100644
index 0000000000..cfc10f60ae
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/_version.py
@@ -0,0 +1,4 @@
+# coding: utf-8
+# file generated by setuptools_scm
+# don't change, don't track in version control
+version = '5.4.3'
diff --git a/contrib/python/pytest/py3/_pytest/assertion/__init__.py b/contrib/python/pytest/py3/_pytest/assertion/__init__.py
new file mode 100644
index 0000000000..ee7fa6a3af
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/assertion/__init__.py
@@ -0,0 +1,179 @@
+"""
+support for presenting detailed information in failing assertions.
+"""
+import sys
+from typing import Any
+from typing import List
+from typing import Optional
+
+from _pytest.assertion import rewrite
+from _pytest.assertion import truncate
+from _pytest.assertion import util
+from _pytest.assertion.rewrite import assertstate_key
+from _pytest.compat import TYPE_CHECKING
+from _pytest.config import Config
+from _pytest.config import hookimpl
+
+if TYPE_CHECKING:
+    from _pytest.main import Session
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("debugconfig")
+    group.addoption(
+        "--assert",
+        action="store",
+        dest="assertmode",
+        choices=("rewrite", "plain"),
+        default="rewrite",
+        metavar="MODE",
+        help="""Control assertion debugging tools.  'plain'
+                            performs no assertion debugging.  'rewrite'
+                            (the default) rewrites assert statements in
+                            test modules on import to provide assert
+                            expression information.""",
+    )
+    parser.addini(
+        "enable_assertion_pass_hook",
+        type="bool",
+        default=False,
+        help="Enables the pytest_assertion_pass hook."
+        "Make sure to delete any previously generated pyc cache files.",
+    )
+
+
+def register_assert_rewrite(*names) -> None:
+    """Register one or more module names to be rewritten on import.
+
+    This function will make sure that this module or all modules inside
+    the package will get their assert statements rewritten.
+    Thus you should make sure to call this before the module is
+    actually imported, usually in your __init__.py if you are a plugin
+    using a package.
+
+    :raise TypeError: if the given module names are not strings.
+    """
+    for name in names:
+        if not isinstance(name, str):
+            msg = "expected module names as *args, got {0} instead"
+            raise TypeError(msg.format(repr(names)))
+    for hook in sys.meta_path:
+        if isinstance(hook, rewrite.AssertionRewritingHook):
+            importhook = hook
+            break
+    else:
+        # TODO(typing): Add a protocol for mark_rewrite() and use it
+        # for importhook and for PytestPluginManager.rewrite_hook.
+        importhook = DummyRewriteHook()  # type: ignore
+    importhook.mark_rewrite(*names)
+
+
+class DummyRewriteHook:
+    """A no-op import hook for when rewriting is disabled."""
+
+    def mark_rewrite(self, *names):
+        pass
+
+
+class AssertionState:
+    """State for the assertion plugin."""
+
+    def __init__(self, config, mode):
+        self.mode = mode
+        self.trace = config.trace.root.get("assertion")
+        self.hook = None  # type: Optional[rewrite.AssertionRewritingHook]
+
+
+def install_importhook(config):
+    """Try to install the rewrite hook, raise SystemError if it fails."""
+    config._store[assertstate_key] = AssertionState(config, "rewrite")
+    config._store[assertstate_key].hook = hook = rewrite.AssertionRewritingHook(config)
+    sys.meta_path.insert(0, hook)
+    config._store[assertstate_key].trace("installed rewrite import hook")
+
+    def undo():
+        hook = config._store[assertstate_key].hook
+        if hook is not None and hook in sys.meta_path:
+            sys.meta_path.remove(hook)
+
+    config.add_cleanup(undo)
+    return hook
+
+
+def pytest_collection(session: "Session") -> None:
+    # this hook is only called when test modules are collected
+    # so for example not in the master process of pytest-xdist
+    # (which does not collect test modules)
+    assertstate = session.config._store.get(assertstate_key, None)
+    if assertstate:
+        if assertstate.hook is not None:
+            assertstate.hook.set_session(session)
+
+
+@hookimpl(tryfirst=True, hookwrapper=True)
+def pytest_runtest_protocol(item):
+    """Setup the pytest_assertrepr_compare and pytest_assertion_pass hooks
+
+    The newinterpret and rewrite modules will use util._reprcompare if
+    it exists to use custom reporting via the
+    pytest_assertrepr_compare hook.  This sets up this custom
+    comparison for the test.
+    """
+
+    def callbinrepr(op, left, right):
+        # type: (str, object, object) -> Optional[str]
+        """Call the pytest_assertrepr_compare hook and prepare the result
+
+        This uses the first result from the hook and then ensures the
+        following:
+        * Overly verbose explanations are truncated unless configured otherwise
+          (eg. if running in verbose mode).
+        * Embedded newlines are escaped to help util.format_explanation()
+          later.
+        * If the rewrite mode is used embedded %-characters are replaced
+          to protect later % formatting.
+
+        The result can be formatted by util.format_explanation() for
+        pretty printing.
+        """
+        hook_result = item.ihook.pytest_assertrepr_compare(
+            config=item.config, op=op, left=left, right=right
+        )
+        for new_expl in hook_result:
+            if new_expl:
+                new_expl = truncate.truncate_if_required(new_expl, item)
+                new_expl = [line.replace("\n", "\\n") for line in new_expl]
+                res = "\n~".join(new_expl)
+                if item.config.getvalue("assertmode") == "rewrite":
+                    res = res.replace("%", "%%")
+                return res
+        return None
+
+    saved_assert_hooks = util._reprcompare, util._assertion_pass
+    util._reprcompare = callbinrepr
+
+    if item.ihook.pytest_assertion_pass.get_hookimpls():
+
+        def call_assertion_pass_hook(lineno, orig, expl):
+            item.ihook.pytest_assertion_pass(
+                item=item, lineno=lineno, orig=orig, expl=expl
+            )
+
+        util._assertion_pass = call_assertion_pass_hook
+
+    yield
+
+    util._reprcompare, util._assertion_pass = saved_assert_hooks
+
+
+def pytest_sessionfinish(session):
+    assertstate = session.config._store.get(assertstate_key, None)
+    if assertstate:
+        if assertstate.hook is not None:
+            assertstate.hook.set_session(None)
+
+
+def pytest_assertrepr_compare(
+    config: Config, op: str, left: Any, right: Any
+) -> Optional[List[str]]:
+    return util.assertrepr_compare(config=config, op=op, left=left, right=right)
diff --git a/contrib/python/pytest/py3/_pytest/assertion/rewrite.py b/contrib/python/pytest/py3/_pytest/assertion/rewrite.py
new file mode 100644
index 0000000000..f84127dcaf
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/assertion/rewrite.py
@@ -0,0 +1,1066 @@
+"""Rewrite assertion AST to produce nice error messages"""
+import ast
+import errno
+import functools
+import importlib.abc
+import importlib.machinery
+import importlib.util
+import io
+import itertools
+import marshal
+import os
+import struct
+import sys
+import tokenize
+import types
+from typing import Dict
+from typing import List
+from typing import Optional
+from typing import Set
+from typing import Tuple
+
+from _pytest._io.saferepr import saferepr
+from _pytest._version import version
+from _pytest.assertion import util
+from _pytest.assertion.util import (  # noqa: F401
+    format_explanation as _format_explanation,
+)
+from _pytest.compat import fspath
+from _pytest.compat import TYPE_CHECKING
+from _pytest.pathlib import fnmatch_ex
+from _pytest.pathlib import Path
+from _pytest.pathlib import PurePath
+from _pytest.store import StoreKey
+
+if TYPE_CHECKING:
+    from _pytest.assertion import AssertionState  # noqa: F401
+
+
+assertstate_key = StoreKey["AssertionState"]()
+
+
+# pytest caches rewritten pycs in pycache dirs
+PYTEST_TAG = "{}-pytest-{}".format(sys.implementation.cache_tag, version)
+PYC_EXT = ".py" + (__debug__ and "c" or "o")
+PYC_TAIL = "." + PYTEST_TAG + PYC_EXT
+
+
+class AssertionRewritingHook(importlib.abc.MetaPathFinder, importlib.abc.Loader):
+    """PEP302/PEP451 import hook which rewrites asserts."""
+
+    def __init__(self, config):
+        self.config = config
+        try:
+            self.fnpats = config.getini("python_files")
+        except ValueError:
+            self.fnpats = ["test_*.py", "*_test.py"]
+        self.session = None
+        self._rewritten_names = set()  # type: Set[str]
+        self._must_rewrite = set()  # type: Set[str]
+        # flag to guard against trying to rewrite a pyc file while we are already writing another pyc file,
+        # which might result in infinite recursion (#3506)
+        self._writing_pyc = False
+        self._basenames_to_check_rewrite = {"conftest"}
+        self._marked_for_rewrite_cache = {}  # type: Dict[str, bool]
+        self._session_paths_checked = False
+
+    def set_session(self, session):
+        self.session = session
+        self._session_paths_checked = False
+
+    # Indirection so we can mock calls to find_spec originated from the hook during testing
+    _find_spec = importlib.machinery.PathFinder.find_spec
+
+    def find_spec(self, name, path=None, target=None):
+        if self._writing_pyc:
+            return None
+        state = self.config._store[assertstate_key]
+        if self._early_rewrite_bailout(name, state):
+            return None
+        state.trace("find_module called for: %s" % name)
+
+        spec = self._find_spec(name, path)
+        if (
+            # the import machinery could not find a file to import
+            spec is None
+            # this is a namespace package (without `__init__.py`)
+            # there's nothing to rewrite there
+            # python3.5 - python3.6: `namespace`
+            # python3.7+: `None`
+            or spec.origin == "namespace"
+            or spec.origin is None
+            # we can only rewrite source files
+            or not isinstance(spec.loader, importlib.machinery.SourceFileLoader)
+            # if the file doesn't exist, we can't rewrite it
+            or not os.path.exists(spec.origin)
+        ):
+            return None
+        else:
+            fn = spec.origin
+
+        if not self._should_rewrite(name, fn, state):
+            return None
+
+        return importlib.util.spec_from_file_location(
+            name,
+            fn,
+            loader=self,
+            submodule_search_locations=spec.submodule_search_locations,
+        )
+
+    def create_module(self, spec):
+        return None  # default behaviour is fine
+
+    def exec_module(self, module):
+        fn = Path(module.__spec__.origin)
+        state = self.config._store[assertstate_key]
+
+        self._rewritten_names.add(module.__name__)
+
+        # The requested module looks like a test file, so rewrite it. This is
+        # the most magical part of the process: load the source, rewrite the
+        # asserts, and load the rewritten source. We also cache the rewritten
+        # module code in a special pyc. We must be aware of the possibility of
+        # concurrent pytest processes rewriting and loading pycs. To avoid
+        # tricky race conditions, we maintain the following invariant: The
+        # cached pyc is always a complete, valid pyc. Operations on it must be
+        # atomic. POSIX's atomic rename comes in handy.
+        write = not sys.dont_write_bytecode
+        cache_dir = get_cache_dir(fn)
+        if write:
+            ok = try_makedirs(cache_dir)
+            if not ok:
+                write = False
+                state.trace("read only directory: {}".format(cache_dir))
+
+        cache_name = fn.name[:-3] + PYC_TAIL
+        pyc = cache_dir / cache_name
+        # Notice that even if we're in a read-only directory, I'm going
+        # to check for a cached pyc. This may not be optimal...
+        co = _read_pyc(fn, pyc, state.trace)
+        if co is None:
+            state.trace("rewriting {!r}".format(fn))
+            source_stat, co = _rewrite_test(fn, self.config)
+            if write:
+                self._writing_pyc = True
+                try:
+                    _write_pyc(state, co, source_stat, pyc)
+                finally:
+                    self._writing_pyc = False
+        else:
+            state.trace("found cached rewritten pyc for {}".format(fn))
+        exec(co, module.__dict__)
+
+    def _early_rewrite_bailout(self, name, state):
+        """This is a fast way to get out of rewriting modules.
+
+        Profiling has shown that the call to PathFinder.find_spec (inside of
+        the find_spec from this class) is a major slowdown, so, this method
+        tries to filter what we're sure won't be rewritten before getting to
+        it.
+        """
+        if self.session is not None and not self._session_paths_checked:
+            self._session_paths_checked = True
+            for path in self.session._initialpaths:
+                # Make something as c:/projects/my_project/path.py ->
+                #     ['c:', 'projects', 'my_project', 'path.py']
+                parts = str(path).split(os.path.sep)
+                # add 'path' to basenames to be checked.
+                self._basenames_to_check_rewrite.add(os.path.splitext(parts[-1])[0])
+
+        # Note: conftest already by default in _basenames_to_check_rewrite.
+        parts = name.split(".")
+        if parts[-1] in self._basenames_to_check_rewrite:
+            return False
+
+        # For matching the name it must be as if it was a filename.
+        path = PurePath(os.path.sep.join(parts) + ".py")
+
+        for pat in self.fnpats:
+            # if the pattern contains subdirectories ("tests/**.py" for example) we can't bail out based
+            # on the name alone because we need to match against the full path
+            if os.path.dirname(pat):
+                return False
+            if fnmatch_ex(pat, path):
+                return False
+
+        if self._is_marked_for_rewrite(name, state):
+            return False
+
+        state.trace("early skip of rewriting module: {}".format(name))
+        return True
+
+    def _should_rewrite(self, name, fn, state):
+        # always rewrite conftest files
+        if os.path.basename(fn) == "conftest.py":
+            state.trace("rewriting conftest file: {!r}".format(fn))
+            return True
+
+        if self.session is not None:
+            if self.session.isinitpath(fn):
+                state.trace(
+                    "matched test file (was specified on cmdline): {!r}".format(fn)
+                )
+                return True
+
+        # modules not passed explicitly on the command line are only
+        # rewritten if they match the naming convention for test files
+        fn_path = PurePath(fn)
+        for pat in self.fnpats:
+            if fnmatch_ex(pat, fn_path):
+                state.trace("matched test file {!r}".format(fn))
+                return True
+
+        return self._is_marked_for_rewrite(name, state)
+
+    def _is_marked_for_rewrite(self, name: str, state):
+        try:
+            return self._marked_for_rewrite_cache[name]
+        except KeyError:
+            for marked in self._must_rewrite:
+                if name == marked or name.startswith(marked + "."):
+                    state.trace(
+                        "matched marked file {!r} (from {!r})".format(name, marked)
+                    )
+                    self._marked_for_rewrite_cache[name] = True
+                    return True
+
+            self._marked_for_rewrite_cache[name] = False
+            return False
+
+    def mark_rewrite(self, *names: str) -> None:
+        """Mark import names as needing to be rewritten.
+
+        The named module or package as well as any nested modules will
+        be rewritten on import.
+        """
+        already_imported = (
+            set(names).intersection(sys.modules).difference(self._rewritten_names)
+        )
+        for name in already_imported:
+            mod = sys.modules[name]
+            if not AssertionRewriter.is_rewrite_disabled(
+                mod.__doc__ or ""
+            ) and not isinstance(mod.__loader__, type(self)):
+                self._warn_already_imported(name)
+        self._must_rewrite.update(names)
+        self._marked_for_rewrite_cache.clear()
+
+    def _warn_already_imported(self, name):
+        from _pytest.warning_types import PytestAssertRewriteWarning
+        from _pytest.warnings import _issue_warning_captured
+
+        _issue_warning_captured(
+            PytestAssertRewriteWarning(
+                "Module already imported so cannot be rewritten: %s" % name
+            ),
+            self.config.hook,
+            stacklevel=5,
+        )
+
+    def get_data(self, pathname):
+        """Optional PEP302 get_data API."""
+        with open(pathname, "rb") as f:
+            return f.read()
+
+
+def _write_pyc_fp(fp, source_stat, co):
+    # Technically, we don't have to have the same pyc format as
+    # (C)Python, since these "pycs" should never be seen by builtin
+    # import. However, there's little reason deviate.
+    fp.write(importlib.util.MAGIC_NUMBER)
+    # as of now, bytecode header expects 32-bit numbers for size and mtime (#4903)
+    mtime = int(source_stat.st_mtime) & 0xFFFFFFFF
+    size = source_stat.st_size & 0xFFFFFFFF
+    # "<LL" stands for 2 unsigned longs, little-ending
+    fp.write(struct.pack("<LL", mtime, size))
+    fp.write(marshal.dumps(co))
+
+
+if sys.platform == "win32":
+    from atomicwrites import atomic_write
+
+    def _write_pyc(state, co, source_stat, pyc):
+        try:
+            with atomic_write(fspath(pyc), mode="wb", overwrite=True) as fp:
+                _write_pyc_fp(fp, source_stat, co)
+        except EnvironmentError as e:
+            state.trace("error writing pyc file at {}: errno={}".format(pyc, e.errno))
+            # we ignore any failure to write the cache file
+            # there are many reasons, permission-denied, pycache dir being a
+            # file etc.
+            return False
+        return True
+
+
+else:
+
+    def _write_pyc(state, co, source_stat, pyc):
+        proc_pyc = "{}.{}".format(pyc, os.getpid())
+        try:
+            fp = open(proc_pyc, "wb")
+        except EnvironmentError as e:
+            state.trace(
+                "error writing pyc file at {}: errno={}".format(proc_pyc, e.errno)
+            )
+            return False
+
+        try:
+            _write_pyc_fp(fp, source_stat, co)
+            os.rename(proc_pyc, fspath(pyc))
+        except BaseException as e:
+            state.trace("error writing pyc file at {}: errno={}".format(pyc, e.errno))
+            # we ignore any failure to write the cache file
+            # there are many reasons, permission-denied, pycache dir being a
+            # file etc.
+            return False
+        finally:
+            fp.close()
+        return True
+
+
+def _rewrite_test(fn, config):
+    """read and rewrite *fn* and return the code object."""
+    fn = fspath(fn)
+    stat = os.stat(fn)
+    with open(fn, "rb") as f:
+        source = f.read()
+    tree = ast.parse(source, filename=fn)
+    rewrite_asserts(tree, source, fn, config)
+    co = compile(tree, fn, "exec", dont_inherit=True)
+    return stat, co
+
+
+def _read_pyc(source, pyc, trace=lambda x: None):
+    """Possibly read a pytest pyc containing rewritten code.
+
+    Return rewritten code if successful or None if not.
+    """
+    try:
+        fp = open(fspath(pyc), "rb")
+    except IOError:
+        return None
+    with fp:
+        try:
+            stat_result = os.stat(fspath(source))
+            mtime = int(stat_result.st_mtime)
+            size = stat_result.st_size
+            data = fp.read(12)
+        except EnvironmentError as e:
+            trace("_read_pyc({}): EnvironmentError {}".format(source, e))
+            return None
+        # Check for invalid or out of date pyc file.
+        if (
+            len(data) != 12
+            or data[:4] != importlib.util.MAGIC_NUMBER
+            or struct.unpack("<LL", data[4:]) != (mtime & 0xFFFFFFFF, size & 0xFFFFFFFF)
+        ):
+            trace("_read_pyc(%s): invalid or out of date pyc" % source)
+            return None
+        try:
+            co = marshal.load(fp)
+        except Exception as e:
+            trace("_read_pyc({}): marshal.load error {}".format(source, e))
+            return None
+        if not isinstance(co, types.CodeType):
+            trace("_read_pyc(%s): not a code object" % source)
+            return None
+        return co
+
+
+def rewrite_asserts(mod, source, module_path=None, config=None):
+    """Rewrite the assert statements in mod."""
+    AssertionRewriter(module_path, config, source).run(mod)
+
+
+def _saferepr(obj):
+    """Get a safe repr of an object for assertion error messages.
+
+    The assertion formatting (util.format_explanation()) requires
+    newlines to be escaped since they are a special character for it.
+    Normally assertion.util.format_explanation() does this but for a
+    custom repr it is possible to contain one of the special escape
+    sequences, especially '\n{' and '\n}' are likely to be present in
+    JSON reprs.
+
+    """
+    return saferepr(obj).replace("\n", "\\n")
+
+
+def _format_assertmsg(obj):
+    """Format the custom assertion message given.
+
+    For strings this simply replaces newlines with '\n~' so that
+    util.format_explanation() will preserve them instead of escaping
+    newlines.  For other objects saferepr() is used first.
+
+    """
+    # reprlib appears to have a bug which means that if a string
+    # contains a newline it gets escaped, however if an object has a
+    # .__repr__() which contains newlines it does not get escaped.
+    # However in either case we want to preserve the newline.
+    replaces = [("\n", "\n~"), ("%", "%%")]
+    if not isinstance(obj, str):
+        obj = saferepr(obj)
+        replaces.append(("\\n", "\n~"))
+
+    for r1, r2 in replaces:
+        obj = obj.replace(r1, r2)
+
+    return obj
+
+
+def _should_repr_global_name(obj):
+    if callable(obj):
+        return False
+
+    try:
+        return not hasattr(obj, "__name__")
+    except Exception:
+        return True
+
+
+def _format_boolop(explanations, is_or):
+    explanation = "(" + (is_or and " or " or " and ").join(explanations) + ")"
+    if isinstance(explanation, str):
+        return explanation.replace("%", "%%")
+    else:
+        return explanation.replace(b"%", b"%%")
+
+
+def _call_reprcompare(ops, results, expls, each_obj):
+    # type: (Tuple[str, ...], Tuple[bool, ...], Tuple[str, ...], Tuple[object, ...]) -> str
+    for i, res, expl in zip(range(len(ops)), results, expls):
+        try:
+            done = not res
+        except Exception:
+            done = True
+        if done:
+            break
+    if util._reprcompare is not None:
+        custom = util._reprcompare(ops[i], each_obj[i], each_obj[i + 1])
+        if custom is not None:
+            return custom
+    return expl
+
+
+def _call_assertion_pass(lineno, orig, expl):
+    # type: (int, str, str) -> None
+    if util._assertion_pass is not None:
+        util._assertion_pass(lineno, orig, expl)
+
+
+def _check_if_assertion_pass_impl():
+    # type: () -> bool
+    """Checks if any plugins implement the pytest_assertion_pass hook
+    in order not to generate explanation unecessarily (might be expensive)"""
+    return True if util._assertion_pass else False
+
+
+UNARY_MAP = {ast.Not: "not %s", ast.Invert: "~%s", ast.USub: "-%s", ast.UAdd: "+%s"}
+
+BINOP_MAP = {
+    ast.BitOr: "|",
+    ast.BitXor: "^",
+    ast.BitAnd: "&",
+    ast.LShift: "<<",
+    ast.RShift: ">>",
+    ast.Add: "+",
+    ast.Sub: "-",
+    ast.Mult: "*",
+    ast.Div: "/",
+    ast.FloorDiv: "//",
+    ast.Mod: "%%",  # escaped for string formatting
+    ast.Eq: "==",
+    ast.NotEq: "!=",
+    ast.Lt: "<",
+    ast.LtE: "<=",
+    ast.Gt: ">",
+    ast.GtE: ">=",
+    ast.Pow: "**",
+    ast.Is: "is",
+    ast.IsNot: "is not",
+    ast.In: "in",
+    ast.NotIn: "not in",
+    ast.MatMult: "@",
+}
+
+
+def set_location(node, lineno, col_offset):
+    """Set node location information recursively."""
+
+    def _fix(node, lineno, col_offset):
+        if "lineno" in node._attributes:
+            node.lineno = lineno
+        if "col_offset" in node._attributes:
+            node.col_offset = col_offset
+        for child in ast.iter_child_nodes(node):
+            _fix(child, lineno, col_offset)
+
+    _fix(node, lineno, col_offset)
+    return node
+
+
+def _get_assertion_exprs(src: bytes) -> Dict[int, str]:
+    """Returns a mapping from {lineno: "assertion test expression"}"""
+    ret = {}  # type: Dict[int, str]
+
+    depth = 0
+    lines = []  # type: List[str]
+    assert_lineno = None  # type: Optional[int]
+    seen_lines = set()  # type: Set[int]
+
+    def _write_and_reset() -> None:
+        nonlocal depth, lines, assert_lineno, seen_lines
+        assert assert_lineno is not None
+        ret[assert_lineno] = "".join(lines).rstrip().rstrip("\\")
+        depth = 0
+        lines = []
+        assert_lineno = None
+        seen_lines = set()
+
+    tokens = tokenize.tokenize(io.BytesIO(src).readline)
+    for tp, source, (lineno, offset), _, line in tokens:
+        if tp == tokenize.NAME and source == "assert":
+            assert_lineno = lineno
+        elif assert_lineno is not None:
+            # keep track of depth for the assert-message `,` lookup
+            if tp == tokenize.OP and source in "([{":
+                depth += 1
+            elif tp == tokenize.OP and source in ")]}":
+                depth -= 1
+
+            if not lines:
+                lines.append(line[offset:])
+                seen_lines.add(lineno)
+            # a non-nested comma separates the expression from the message
+            elif depth == 0 and tp == tokenize.OP and source == ",":
+                # one line assert with message
+                if lineno in seen_lines and len(lines) == 1:
+                    offset_in_trimmed = offset + len(lines[-1]) - len(line)
+                    lines[-1] = lines[-1][:offset_in_trimmed]
+                # multi-line assert with message
+                elif lineno in seen_lines:
+                    lines[-1] = lines[-1][:offset]
+                # multi line assert with escapd newline before message
+                else:
+                    lines.append(line[:offset])
+                _write_and_reset()
+            elif tp in {tokenize.NEWLINE, tokenize.ENDMARKER}:
+                _write_and_reset()
+            elif lines and lineno not in seen_lines:
+                lines.append(line)
+                seen_lines.add(lineno)
+
+    return ret
+
+
+class AssertionRewriter(ast.NodeVisitor):
+    """Assertion rewriting implementation.
+
+    The main entrypoint is to call .run() with an ast.Module instance,
+    this will then find all the assert statements and rewrite them to
+    provide intermediate values and a detailed assertion error.  See
+    http://pybites.blogspot.be/2011/07/behind-scenes-of-pytests-new-assertion.html
+    for an overview of how this works.
+
+    The entry point here is .run() which will iterate over all the
+    statements in an ast.Module and for each ast.Assert statement it
+    finds call .visit() with it.  Then .visit_Assert() takes over and
+    is responsible for creating new ast statements to replace the
+    original assert statement: it rewrites the test of an assertion
+    to provide intermediate values and replace it with an if statement
+    which raises an assertion error with a detailed explanation in
+    case the expression is false and calls pytest_assertion_pass hook
+    if expression is true.
+
+    For this .visit_Assert() uses the visitor pattern to visit all the
+    AST nodes of the ast.Assert.test field, each visit call returning
+    an AST node and the corresponding explanation string.  During this
+    state is kept in several instance attributes:
+
+    :statements: All the AST statements which will replace the assert
+       statement.
+
+    :variables: This is populated by .variable() with each variable
+       used by the statements so that they can all be set to None at
+       the end of the statements.
+
+    :variable_counter: Counter to create new unique variables needed
+       by statements.  Variables are created using .variable() and
+       have the form of "@py_assert0".
+
+    :expl_stmts: The AST statements which will be executed to get
+       data from the assertion.  This is the code which will construct
+       the detailed assertion message that is used in the AssertionError
+       or for the pytest_assertion_pass hook.
+
+    :explanation_specifiers: A dict filled by .explanation_param()
+       with %-formatting placeholders and their corresponding
+       expressions to use in the building of an assertion message.
+       This is used by .pop_format_context() to build a message.
+
+    :stack: A stack of the explanation_specifiers dicts maintained by
+       .push_format_context() and .pop_format_context() which allows
+       to build another %-formatted string while already building one.
+
+    This state is reset on every new assert statement visited and used
+    by the other visitors.
+
+    """
+
+    def __init__(self, module_path, config, source):
+        super().__init__()
+        self.module_path = module_path
+        self.config = config
+        if config is not None:
+            self.enable_assertion_pass_hook = config.getini(
+                "enable_assertion_pass_hook"
+            )
+        else:
+            self.enable_assertion_pass_hook = False
+        self.source = source
+
+    @functools.lru_cache(maxsize=1)
+    def _assert_expr_to_lineno(self):
+        return _get_assertion_exprs(self.source)
+
+    def run(self, mod: ast.Module) -> None:
+        """Find all assert statements in *mod* and rewrite them."""
+        if not mod.body:
+            # Nothing to do.
+            return
+        # Insert some special imports at the top of the module but after any
+        # docstrings and __future__ imports.
+        aliases = [
+            ast.alias("builtins", "@py_builtins"),
+            ast.alias("_pytest.assertion.rewrite", "@pytest_ar"),
+        ]
+        doc = getattr(mod, "docstring", None)
+        expect_docstring = doc is None
+        if doc is not None and self.is_rewrite_disabled(doc):
+            return
+        pos = 0
+        lineno = 1
+        for item in mod.body:
+            if (
+                expect_docstring
+                and isinstance(item, ast.Expr)
+                and isinstance(item.value, ast.Str)
+            ):
+                doc = item.value.s
+                if self.is_rewrite_disabled(doc):
+                    return
+                expect_docstring = False
+            elif (
+                not isinstance(item, ast.ImportFrom)
+                or item.level > 0
+                or item.module != "__future__"
+            ):
+                lineno = item.lineno
+                break
+            pos += 1
+        else:
+            lineno = item.lineno
+        imports = [
+            ast.Import([alias], lineno=lineno, col_offset=0) for alias in aliases
+        ]
+        mod.body[pos:pos] = imports
+        # Collect asserts.
+        nodes = [mod]  # type: List[ast.AST]
+        while nodes:
+            node = nodes.pop()
+            for name, field in ast.iter_fields(node):
+                if isinstance(field, list):
+                    new = []  # type: List
+                    for i, child in enumerate(field):
+                        if isinstance(child, ast.Assert):
+                            # Transform assert.
+                            new.extend(self.visit(child))
+                        else:
+                            new.append(child)
+                            if isinstance(child, ast.AST):
+                                nodes.append(child)
+                    setattr(node, name, new)
+                elif (
+                    isinstance(field, ast.AST)
+                    # Don't recurse into expressions as they can't contain
+                    # asserts.
+                    and not isinstance(field, ast.expr)
+                ):
+                    nodes.append(field)
+
+    @staticmethod
+    def is_rewrite_disabled(docstring):
+        return "PYTEST_DONT_REWRITE" in docstring
+
+    def variable(self):
+        """Get a new variable."""
+        # Use a character invalid in python identifiers to avoid clashing.
+        name = "@py_assert" + str(next(self.variable_counter))
+        self.variables.append(name)
+        return name
+
+    def assign(self, expr):
+        """Give *expr* a name."""
+        name = self.variable()
+        self.statements.append(ast.Assign([ast.Name(name, ast.Store())], expr))
+        return ast.Name(name, ast.Load())
+
+    def display(self, expr):
+        """Call saferepr on the expression."""
+        return self.helper("_saferepr", expr)
+
+    def helper(self, name, *args):
+        """Call a helper in this module."""
+        py_name = ast.Name("@pytest_ar", ast.Load())
+        attr = ast.Attribute(py_name, name, ast.Load())
+        return ast.Call(attr, list(args), [])
+
+    def builtin(self, name):
+        """Return the builtin called *name*."""
+        builtin_name = ast.Name("@py_builtins", ast.Load())
+        return ast.Attribute(builtin_name, name, ast.Load())
+
+    def explanation_param(self, expr):
+        """Return a new named %-formatting placeholder for expr.
+
+        This creates a %-formatting placeholder for expr in the
+        current formatting context, e.g. ``%(py0)s``.  The placeholder
+        and expr are placed in the current format context so that it
+        can be used on the next call to .pop_format_context().
+
+        """
+        specifier = "py" + str(next(self.variable_counter))
+        self.explanation_specifiers[specifier] = expr
+        return "%(" + specifier + ")s"
+
+    def push_format_context(self):
+        """Create a new formatting context.
+
+        The format context is used for when an explanation wants to
+        have a variable value formatted in the assertion message.  In
+        this case the value required can be added using
+        .explanation_param().  Finally .pop_format_context() is used
+        to format a string of %-formatted values as added by
+        .explanation_param().
+
+        """
+        self.explanation_specifiers = {}  # type: Dict[str, ast.expr]
+        self.stack.append(self.explanation_specifiers)
+
+    def pop_format_context(self, expl_expr):
+        """Format the %-formatted string with current format context.
+
+        The expl_expr should be an ast.Str instance constructed from
+        the %-placeholders created by .explanation_param().  This will
+        add the required code to format said string to .expl_stmts and
+        return the ast.Name instance of the formatted string.
+
+        """
+        current = self.stack.pop()
+        if self.stack:
+            self.explanation_specifiers = self.stack[-1]
+        keys = [ast.Str(key) for key in current.keys()]
+        format_dict = ast.Dict(keys, list(current.values()))
+        form = ast.BinOp(expl_expr, ast.Mod(), format_dict)
+        name = "@py_format" + str(next(self.variable_counter))
+        if self.enable_assertion_pass_hook:
+            self.format_variables.append(name)
+        self.expl_stmts.append(ast.Assign([ast.Name(name, ast.Store())], form))
+        return ast.Name(name, ast.Load())
+
+    def generic_visit(self, node):
+        """Handle expressions we don't have custom code for."""
+        assert isinstance(node, ast.expr)
+        res = self.assign(node)
+        return res, self.explanation_param(self.display(res))
+
+    def visit_Assert(self, assert_):
+        """Return the AST statements to replace the ast.Assert instance.
+
+        This rewrites the test of an assertion to provide
+        intermediate values and replace it with an if statement which
+        raises an assertion error with a detailed explanation in case
+        the expression is false.
+
+        """
+        if isinstance(assert_.test, ast.Tuple) and len(assert_.test.elts) >= 1:
+            from _pytest.warning_types import PytestAssertRewriteWarning
+            import warnings
+
+            warnings.warn_explicit(
+                PytestAssertRewriteWarning(
+                    "assertion is always true, perhaps remove parentheses?"
+                ),
+                category=None,
+                filename=fspath(self.module_path),
+                lineno=assert_.lineno,
+            )
+
+        self.statements = []  # type: List[ast.stmt]
+        self.variables = []  # type: List[str]
+        self.variable_counter = itertools.count()
+
+        if self.enable_assertion_pass_hook:
+            self.format_variables = []  # type: List[str]
+
+        self.stack = []  # type: List[Dict[str, ast.expr]]
+        self.expl_stmts = []  # type: List[ast.stmt]
+        self.push_format_context()
+        # Rewrite assert into a bunch of statements.
+        top_condition, explanation = self.visit(assert_.test)
+
+        negation = ast.UnaryOp(ast.Not(), top_condition)
+
+        if self.enable_assertion_pass_hook:  # Experimental pytest_assertion_pass hook
+            msg = self.pop_format_context(ast.Str(explanation))
+
+            # Failed
+            if assert_.msg:
+                assertmsg = self.helper("_format_assertmsg", assert_.msg)
+                gluestr = "\n>assert "
+            else:
+                assertmsg = ast.Str("")
+                gluestr = "assert "
+            err_explanation = ast.BinOp(ast.Str(gluestr), ast.Add(), msg)
+            err_msg = ast.BinOp(assertmsg, ast.Add(), err_explanation)
+            err_name = ast.Name("AssertionError", ast.Load())
+            fmt = self.helper("_format_explanation", err_msg)
+            exc = ast.Call(err_name, [fmt], [])
+            raise_ = ast.Raise(exc, None)
+            statements_fail = []
+            statements_fail.extend(self.expl_stmts)
+            statements_fail.append(raise_)
+
+            # Passed
+            fmt_pass = self.helper("_format_explanation", msg)
+            orig = self._assert_expr_to_lineno()[assert_.lineno]
+            hook_call_pass = ast.Expr(
+                self.helper(
+                    "_call_assertion_pass",
+                    ast.Num(assert_.lineno),
+                    ast.Str(orig),
+                    fmt_pass,
+                )
+            )
+            # If any hooks implement assert_pass hook
+            hook_impl_test = ast.If(
+                self.helper("_check_if_assertion_pass_impl"),
+                self.expl_stmts + [hook_call_pass],
+                [],
+            )
+            statements_pass = [hook_impl_test]
+
+            # Test for assertion condition
+            main_test = ast.If(negation, statements_fail, statements_pass)
+            self.statements.append(main_test)
+            if self.format_variables:
+                variables = [
+                    ast.Name(name, ast.Store()) for name in self.format_variables
+                ]
+                clear_format = ast.Assign(variables, ast.NameConstant(None))
+                self.statements.append(clear_format)
+
+        else:  # Original assertion rewriting
+            # Create failure message.
+            body = self.expl_stmts
+            self.statements.append(ast.If(negation, body, []))
+            if assert_.msg:
+                assertmsg = self.helper("_format_assertmsg", assert_.msg)
+                explanation = "\n>assert " + explanation
+            else:
+                assertmsg = ast.Str("")
+                explanation = "assert " + explanation
+            template = ast.BinOp(assertmsg, ast.Add(), ast.Str(explanation))
+            msg = self.pop_format_context(template)
+            fmt = self.helper("_format_explanation", msg)
+            err_name = ast.Name("AssertionError", ast.Load())
+            exc = ast.Call(err_name, [fmt], [])
+            raise_ = ast.Raise(exc, None)
+
+            body.append(raise_)
+
+        # Clear temporary variables by setting them to None.
+        if self.variables:
+            variables = [ast.Name(name, ast.Store()) for name in self.variables]
+            clear = ast.Assign(variables, ast.NameConstant(None))
+            self.statements.append(clear)
+        # Fix line numbers.
+        for stmt in self.statements:
+            set_location(stmt, assert_.lineno, assert_.col_offset)
+        return self.statements
+
+    def visit_Name(self, name):
+        # Display the repr of the name if it's a local variable or
+        # _should_repr_global_name() thinks it's acceptable.
+        locs = ast.Call(self.builtin("locals"), [], [])
+        inlocs = ast.Compare(ast.Str(name.id), [ast.In()], [locs])
+        dorepr = self.helper("_should_repr_global_name", name)
+        test = ast.BoolOp(ast.Or(), [inlocs, dorepr])
+        expr = ast.IfExp(test, self.display(name), ast.Str(name.id))
+        return name, self.explanation_param(expr)
+
+    def visit_BoolOp(self, boolop):
+        res_var = self.variable()
+        expl_list = self.assign(ast.List([], ast.Load()))
+        app = ast.Attribute(expl_list, "append", ast.Load())
+        is_or = int(isinstance(boolop.op, ast.Or))
+        body = save = self.statements
+        fail_save = self.expl_stmts
+        levels = len(boolop.values) - 1
+        self.push_format_context()
+        # Process each operand, short-circuiting if needed.
+        for i, v in enumerate(boolop.values):
+            if i:
+                fail_inner = []  # type: List[ast.stmt]
+                # cond is set in a prior loop iteration below
+                self.expl_stmts.append(ast.If(cond, fail_inner, []))  # noqa
+                self.expl_stmts = fail_inner
+            self.push_format_context()
+            res, expl = self.visit(v)
+            body.append(ast.Assign([ast.Name(res_var, ast.Store())], res))
+            expl_format = self.pop_format_context(ast.Str(expl))
+            call = ast.Call(app, [expl_format], [])
+            self.expl_stmts.append(ast.Expr(call))
+            if i < levels:
+                cond = res  # type: ast.expr
+                if is_or:
+                    cond = ast.UnaryOp(ast.Not(), cond)
+                inner = []  # type: List[ast.stmt]
+                self.statements.append(ast.If(cond, inner, []))
+                self.statements = body = inner
+        self.statements = save
+        self.expl_stmts = fail_save
+        expl_template = self.helper("_format_boolop", expl_list, ast.Num(is_or))
+        expl = self.pop_format_context(expl_template)
+        return ast.Name(res_var, ast.Load()), self.explanation_param(expl)
+
+    def visit_UnaryOp(self, unary):
+        pattern = UNARY_MAP[unary.op.__class__]
+        operand_res, operand_expl = self.visit(unary.operand)
+        res = self.assign(ast.UnaryOp(unary.op, operand_res))
+        return res, pattern % (operand_expl,)
+
+    def visit_BinOp(self, binop):
+        symbol = BINOP_MAP[binop.op.__class__]
+        left_expr, left_expl = self.visit(binop.left)
+        right_expr, right_expl = self.visit(binop.right)
+        explanation = "({} {} {})".format(left_expl, symbol, right_expl)
+        res = self.assign(ast.BinOp(left_expr, binop.op, right_expr))
+        return res, explanation
+
+    def visit_Call(self, call):
+        """
+        visit `ast.Call` nodes
+        """
+        new_func, func_expl = self.visit(call.func)
+        arg_expls = []
+        new_args = []
+        new_kwargs = []
+        for arg in call.args:
+            res, expl = self.visit(arg)
+            arg_expls.append(expl)
+            new_args.append(res)
+        for keyword in call.keywords:
+            res, expl = self.visit(keyword.value)
+            new_kwargs.append(ast.keyword(keyword.arg, res))
+            if keyword.arg:
+                arg_expls.append(keyword.arg + "=" + expl)
+            else:  # **args have `arg` keywords with an .arg of None
+                arg_expls.append("**" + expl)
+
+        expl = "{}({})".format(func_expl, ", ".join(arg_expls))
+        new_call = ast.Call(new_func, new_args, new_kwargs)
+        res = self.assign(new_call)
+        res_expl = self.explanation_param(self.display(res))
+        outer_expl = "{}\n{{{} = {}\n}}".format(res_expl, res_expl, expl)
+        return res, outer_expl
+
+    def visit_Starred(self, starred):
+        # From Python 3.5, a Starred node can appear in a function call
+        res, expl = self.visit(starred.value)
+        new_starred = ast.Starred(res, starred.ctx)
+        return new_starred, "*" + expl
+
+    def visit_Attribute(self, attr):
+        if not isinstance(attr.ctx, ast.Load):
+            return self.generic_visit(attr)
+        value, value_expl = self.visit(attr.value)
+        res = self.assign(ast.Attribute(value, attr.attr, ast.Load()))
+        res_expl = self.explanation_param(self.display(res))
+        pat = "%s\n{%s = %s.%s\n}"
+        expl = pat % (res_expl, res_expl, value_expl, attr.attr)
+        return res, expl
+
+    def visit_Compare(self, comp: ast.Compare):
+        self.push_format_context()
+        left_res, left_expl = self.visit(comp.left)
+        if isinstance(comp.left, (ast.Compare, ast.BoolOp)):
+            left_expl = "({})".format(left_expl)
+        res_variables = [self.variable() for i in range(len(comp.ops))]
+        load_names = [ast.Name(v, ast.Load()) for v in res_variables]
+        store_names = [ast.Name(v, ast.Store()) for v in res_variables]
+        it = zip(range(len(comp.ops)), comp.ops, comp.comparators)
+        expls = []
+        syms = []
+        results = [left_res]
+        for i, op, next_operand in it:
+            next_res, next_expl = self.visit(next_operand)
+            if isinstance(next_operand, (ast.Compare, ast.BoolOp)):
+                next_expl = "({})".format(next_expl)
+            results.append(next_res)
+            sym = BINOP_MAP[op.__class__]
+            syms.append(ast.Str(sym))
+            expl = "{} {} {}".format(left_expl, sym, next_expl)
+            expls.append(ast.Str(expl))
+            res_expr = ast.Compare(left_res, [op], [next_res])
+            self.statements.append(ast.Assign([store_names[i]], res_expr))
+            left_res, left_expl = next_res, next_expl
+        # Use pytest.assertion.util._reprcompare if that's available.
+        expl_call = self.helper(
+            "_call_reprcompare",
+            ast.Tuple(syms, ast.Load()),
+            ast.Tuple(load_names, ast.Load()),
+            ast.Tuple(expls, ast.Load()),
+            ast.Tuple(results, ast.Load()),
+        )
+        if len(comp.ops) > 1:
+            res = ast.BoolOp(ast.And(), load_names)  # type: ast.expr
+        else:
+            res = load_names[0]
+        return res, self.explanation_param(self.pop_format_context(expl_call))
+
+
+def try_makedirs(cache_dir) -> bool:
+    """Attempts to create the given directory and sub-directories exist, returns True if
+    successful or it already exists"""
+    try:
+        os.makedirs(fspath(cache_dir), exist_ok=True)
+    except (FileNotFoundError, NotADirectoryError, FileExistsError):
+        # One of the path components was not a directory:
+        # - we're in a zip file
+        # - it is a file
+        return False
+    except PermissionError:
+        return False
+    except OSError as e:
+        # as of now, EROFS doesn't have an equivalent OSError-subclass
+        if e.errno == errno.EROFS:
+            return False
+        raise
+    return True
+
+
+def get_cache_dir(file_path: Path) -> Path:
+    """Returns the cache directory to write .pyc files for the given .py file path"""
+    if sys.version_info >= (3, 8) and sys.pycache_prefix:
+        # given:
+        #   prefix = '/tmp/pycs'
+        #   path = '/home/user/proj/test_app.py'
+        # we want:
+        #   '/tmp/pycs/home/user/proj'
+        return Path(sys.pycache_prefix) / Path(*file_path.parts[1:-1])
+    else:
+        # classic pycache directory
+        return file_path.parent / "__pycache__"
diff --git a/contrib/python/pytest/py3/_pytest/assertion/truncate.py b/contrib/python/pytest/py3/_pytest/assertion/truncate.py
new file mode 100644
index 0000000000..d97b05b441
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/assertion/truncate.py
@@ -0,0 +1,95 @@
+"""
+Utilities for truncating assertion output.
+
+Current default behaviour is to truncate assertion explanations at
+~8 terminal lines, unless running in "-vv" mode or running on CI.
+"""
+import os
+
+DEFAULT_MAX_LINES = 8
+DEFAULT_MAX_CHARS = 8 * 80
+USAGE_MSG = "use '-vv' to show"
+
+
+def truncate_if_required(explanation, item, max_length=None):
+    """
+    Truncate this assertion explanation if the given test item is eligible.
+    """
+    if _should_truncate_item(item):
+        return _truncate_explanation(explanation)
+    return explanation
+
+
+def _should_truncate_item(item):
+    """
+    Whether or not this test item is eligible for truncation.
+    """
+    verbose = item.config.option.verbose
+    return verbose < 2 and not _running_on_ci()
+
+
+def _running_on_ci():
+    """Check if we're currently running on a CI system."""
+    env_vars = ["CI", "BUILD_NUMBER"]
+    return any(var in os.environ for var in env_vars)
+
+
+def _truncate_explanation(input_lines, max_lines=None, max_chars=None):
+    """
+    Truncate given list of strings that makes up the assertion explanation.
+
+    Truncates to either 8 lines, or 640 characters - whichever the input reaches
+    first. The remaining lines will be replaced by a usage message.
+    """
+
+    if max_lines is None:
+        max_lines = DEFAULT_MAX_LINES
+    if max_chars is None:
+        max_chars = DEFAULT_MAX_CHARS
+
+    # Check if truncation required
+    input_char_count = len("".join(input_lines))
+    if len(input_lines) <= max_lines and input_char_count <= max_chars:
+        return input_lines
+
+    # Truncate first to max_lines, and then truncate to max_chars if max_chars
+    # is exceeded.
+    truncated_explanation = input_lines[:max_lines]
+    truncated_explanation = _truncate_by_char_count(truncated_explanation, max_chars)
+
+    # Add ellipsis to final line
+    truncated_explanation[-1] = truncated_explanation[-1] + "..."
+
+    # Append useful message to explanation
+    truncated_line_count = len(input_lines) - len(truncated_explanation)
+    truncated_line_count += 1  # Account for the part-truncated final line
+    msg = "...Full output truncated"
+    if truncated_line_count == 1:
+        msg += " ({} line hidden)".format(truncated_line_count)
+    else:
+        msg += " ({} lines hidden)".format(truncated_line_count)
+    msg += ", {}".format(USAGE_MSG)
+    truncated_explanation.extend(["", str(msg)])
+    return truncated_explanation
+
+
+def _truncate_by_char_count(input_lines, max_chars):
+    # Check if truncation required
+    if len("".join(input_lines)) <= max_chars:
+        return input_lines
+
+    # Find point at which input length exceeds total allowed length
+    iterated_char_count = 0
+    for iterated_index, input_line in enumerate(input_lines):
+        if iterated_char_count + len(input_line) > max_chars:
+            break
+        iterated_char_count += len(input_line)
+
+    # Create truncated explanation with modified final line
+    truncated_result = input_lines[:iterated_index]
+    final_line = input_lines[iterated_index]
+    if final_line:
+        final_line_truncate_point = max_chars - iterated_char_count
+        final_line = final_line[:final_line_truncate_point]
+    truncated_result.append(final_line)
+    return truncated_result
diff --git a/contrib/python/pytest/py3/_pytest/assertion/util.py b/contrib/python/pytest/py3/_pytest/assertion/util.py
new file mode 100644
index 0000000000..7d525aa4c4
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/assertion/util.py
@@ -0,0 +1,463 @@
+"""Utilities for assertion debugging"""
+import collections.abc
+import pprint
+from typing import AbstractSet
+from typing import Any
+from typing import Callable
+from typing import Iterable
+from typing import List
+from typing import Mapping
+from typing import Optional
+from typing import Sequence
+from typing import Tuple
+
+import _pytest._code
+from _pytest import outcomes
+from _pytest._io.saferepr import _pformat_dispatch
+from _pytest._io.saferepr import safeformat
+from _pytest._io.saferepr import saferepr
+from _pytest.compat import ATTRS_EQ_FIELD
+
+# The _reprcompare attribute on the util module is used by the new assertion
+# interpretation code and assertion rewriter to detect this plugin was
+# loaded and in turn call the hooks defined here as part of the
+# DebugInterpreter.
+_reprcompare = None  # type: Optional[Callable[[str, object, object], Optional[str]]]
+
+# Works similarly as _reprcompare attribute. Is populated with the hook call
+# when pytest_runtest_setup is called.
+_assertion_pass = None  # type: Optional[Callable[[int, str, str], None]]
+
+
+def format_explanation(explanation: str) -> str:
+    """This formats an explanation
+
+    Normally all embedded newlines are escaped, however there are
+    three exceptions: \n{, \n} and \n~.  The first two are intended
+    cover nested explanations, see function and attribute explanations
+    for examples (.visit_Call(), visit_Attribute()).  The last one is
+    for when one explanation needs to span multiple lines, e.g. when
+    displaying diffs.
+    """
+    lines = _split_explanation(explanation)
+    result = _format_lines(lines)
+    return "\n".join(result)
+
+
+def _split_explanation(explanation: str) -> List[str]:
+    """Return a list of individual lines in the explanation
+
+    This will return a list of lines split on '\n{', '\n}' and '\n~'.
+    Any other newlines will be escaped and appear in the line as the
+    literal '\n' characters.
+    """
+    raw_lines = (explanation or "").split("\n")
+    lines = [raw_lines[0]]
+    for values in raw_lines[1:]:
+        if values and values[0] in ["{", "}", "~", ">"]:
+            lines.append(values)
+        else:
+            lines[-1] += "\\n" + values
+    return lines
+
+
+def _format_lines(lines: Sequence[str]) -> List[str]:
+    """Format the individual lines
+
+    This will replace the '{', '}' and '~' characters of our mini
+    formatting language with the proper 'where ...', 'and ...' and ' +
+    ...' text, taking care of indentation along the way.
+
+    Return a list of formatted lines.
+    """
+    result = list(lines[:1])
+    stack = [0]
+    stackcnt = [0]
+    for line in lines[1:]:
+        if line.startswith("{"):
+            if stackcnt[-1]:
+                s = "and   "
+            else:
+                s = "where "
+            stack.append(len(result))
+            stackcnt[-1] += 1
+            stackcnt.append(0)
+            result.append(" +" + "  " * (len(stack) - 1) + s + line[1:])
+        elif line.startswith("}"):
+            stack.pop()
+            stackcnt.pop()
+            result[stack[-1]] += line[1:]
+        else:
+            assert line[0] in ["~", ">"]
+            stack[-1] += 1
+            indent = len(stack) if line.startswith("~") else len(stack) - 1
+            result.append("  " * indent + line[1:])
+    assert len(stack) == 1
+    return result
+
+
+def issequence(x: Any) -> bool:
+    return isinstance(x, collections.abc.Sequence) and not isinstance(x, str)
+
+
+def istext(x: Any) -> bool:
+    return isinstance(x, str)
+
+
+def isdict(x: Any) -> bool:
+    return isinstance(x, dict)
+
+
+def isset(x: Any) -> bool:
+    return isinstance(x, (set, frozenset))
+
+
+def isdatacls(obj: Any) -> bool:
+    return getattr(obj, "__dataclass_fields__", None) is not None
+
+
+def isattrs(obj: Any) -> bool:
+    return getattr(obj, "__attrs_attrs__", None) is not None
+
+
+def isiterable(obj: Any) -> bool:
+    try:
+        iter(obj)
+        return not istext(obj)
+    except TypeError:
+        return False
+
+
+def assertrepr_compare(config, op: str, left: Any, right: Any) -> Optional[List[str]]:
+    """Return specialised explanations for some operators/operands"""
+    verbose = config.getoption("verbose")
+    if verbose > 1:
+        left_repr = safeformat(left)
+        right_repr = safeformat(right)
+    else:
+        # XXX: "15 chars indentation" is wrong
+        #      ("E       AssertionError: assert "); should use term width.
+        maxsize = (
+            80 - 15 - len(op) - 2
+        ) // 2  # 15 chars indentation, 1 space around op
+        left_repr = saferepr(left, maxsize=maxsize)
+        right_repr = saferepr(right, maxsize=maxsize)
+
+    summary = "{} {} {}".format(left_repr, op, right_repr)
+
+    explanation = None
+    try:
+        if op == "==":
+            if istext(left) and istext(right):
+                explanation = _diff_text(left, right, verbose)
+            else:
+                if issequence(left) and issequence(right):
+                    explanation = _compare_eq_sequence(left, right, verbose)
+                elif isset(left) and isset(right):
+                    explanation = _compare_eq_set(left, right, verbose)
+                elif isdict(left) and isdict(right):
+                    explanation = _compare_eq_dict(left, right, verbose)
+                elif type(left) == type(right) and (isdatacls(left) or isattrs(left)):
+                    type_fn = (isdatacls, isattrs)
+                    explanation = _compare_eq_cls(left, right, verbose, type_fn)
+                elif verbose > 0:
+                    explanation = _compare_eq_verbose(left, right)
+                if isiterable(left) and isiterable(right):
+                    expl = _compare_eq_iterable(left, right, verbose)
+                    if explanation is not None:
+                        explanation.extend(expl)
+                    else:
+                        explanation = expl
+        elif op == "not in":
+            if istext(left) and istext(right):
+                explanation = _notin_text(left, right, verbose)
+    except outcomes.Exit:
+        raise
+    except Exception:
+        explanation = [
+            "(pytest_assertion plugin: representation of details failed: {}.".format(
+                _pytest._code.ExceptionInfo.from_current()._getreprcrash()
+            ),
+            " Probably an object has a faulty __repr__.)",
+        ]
+
+    if not explanation:
+        return None
+
+    return [summary] + explanation
+
+
+def _diff_text(left: str, right: str, verbose: int = 0) -> List[str]:
+    """Return the explanation for the diff between text.
+
+    Unless --verbose is used this will skip leading and trailing
+    characters which are identical to keep the diff minimal.
+    """
+    from difflib import ndiff
+
+    explanation = []  # type: List[str]
+
+    if verbose < 1:
+        i = 0  # just in case left or right has zero length
+        for i in range(min(len(left), len(right))):
+            if left[i] != right[i]:
+                break
+        if i > 42:
+            i -= 10  # Provide some context
+            explanation = [
+                "Skipping %s identical leading characters in diff, use -v to show" % i
+            ]
+            left = left[i:]
+            right = right[i:]
+        if len(left) == len(right):
+            for i in range(len(left)):
+                if left[-i] != right[-i]:
+                    break
+            if i > 42:
+                i -= 10  # Provide some context
+                explanation += [
+                    "Skipping {} identical trailing "
+                    "characters in diff, use -v to show".format(i)
+                ]
+                left = left[:-i]
+                right = right[:-i]
+    keepends = True
+    if left.isspace() or right.isspace():
+        left = repr(str(left))
+        right = repr(str(right))
+        explanation += ["Strings contain only whitespace, escaping them using repr()"]
+    # "right" is the expected base against which we compare "left",
+    # see https://github.com/pytest-dev/pytest/issues/3333
+    explanation += [
+        line.strip("\n")
+        for line in ndiff(right.splitlines(keepends), left.splitlines(keepends))
+    ]
+    return explanation
+
+
+def _compare_eq_verbose(left: Any, right: Any) -> List[str]:
+    keepends = True
+    left_lines = repr(left).splitlines(keepends)
+    right_lines = repr(right).splitlines(keepends)
+
+    explanation = []  # type: List[str]
+    explanation += ["+" + line for line in left_lines]
+    explanation += ["-" + line for line in right_lines]
+
+    return explanation
+
+
+def _surrounding_parens_on_own_lines(lines: List[str]) -> None:
+    """Move opening/closing parenthesis/bracket to own lines."""
+    opening = lines[0][:1]
+    if opening in ["(", "[", "{"]:
+        lines[0] = " " + lines[0][1:]
+        lines[:] = [opening] + lines
+    closing = lines[-1][-1:]
+    if closing in [")", "]", "}"]:
+        lines[-1] = lines[-1][:-1] + ","
+        lines[:] = lines + [closing]
+
+
+def _compare_eq_iterable(
+    left: Iterable[Any], right: Iterable[Any], verbose: int = 0
+) -> List[str]:
+    if not verbose:
+        return ["Use -v to get the full diff"]
+    # dynamic import to speedup pytest
+    import difflib
+
+    left_formatting = pprint.pformat(left).splitlines()
+    right_formatting = pprint.pformat(right).splitlines()
+
+    # Re-format for different output lengths.
+    lines_left = len(left_formatting)
+    lines_right = len(right_formatting)
+    if lines_left != lines_right:
+        left_formatting = _pformat_dispatch(left).splitlines()
+        right_formatting = _pformat_dispatch(right).splitlines()
+
+    if lines_left > 1 or lines_right > 1:
+        _surrounding_parens_on_own_lines(left_formatting)
+        _surrounding_parens_on_own_lines(right_formatting)
+
+    explanation = ["Full diff:"]
+    # "right" is the expected base against which we compare "left",
+    # see https://github.com/pytest-dev/pytest/issues/3333
+    explanation.extend(
+        line.rstrip() for line in difflib.ndiff(right_formatting, left_formatting)
+    )
+    return explanation
+
+
+def _compare_eq_sequence(
+    left: Sequence[Any], right: Sequence[Any], verbose: int = 0
+) -> List[str]:
+    comparing_bytes = isinstance(left, bytes) and isinstance(right, bytes)
+    explanation = []  # type: List[str]
+    len_left = len(left)
+    len_right = len(right)
+    for i in range(min(len_left, len_right)):
+        if left[i] != right[i]:
+            if comparing_bytes:
+                # when comparing bytes, we want to see their ascii representation
+                # instead of their numeric values (#5260)
+                # using a slice gives us the ascii representation:
+                # >>> s = b'foo'
+                # >>> s[0]
+                # 102
+                # >>> s[0:1]
+                # b'f'
+                left_value = left[i : i + 1]
+                right_value = right[i : i + 1]
+            else:
+                left_value = left[i]
+                right_value = right[i]
+
+            explanation += [
+                "At index {} diff: {!r} != {!r}".format(i, left_value, right_value)
+            ]
+            break
+
+    if comparing_bytes:
+        # when comparing bytes, it doesn't help to show the "sides contain one or more
+        # items" longer explanation, so skip it
+
+        return explanation
+
+    len_diff = len_left - len_right
+    if len_diff:
+        if len_diff > 0:
+            dir_with_more = "Left"
+            extra = saferepr(left[len_right])
+        else:
+            len_diff = 0 - len_diff
+            dir_with_more = "Right"
+            extra = saferepr(right[len_left])
+
+        if len_diff == 1:
+            explanation += [
+                "{} contains one more item: {}".format(dir_with_more, extra)
+            ]
+        else:
+            explanation += [
+                "%s contains %d more items, first extra item: %s"
+                % (dir_with_more, len_diff, extra)
+            ]
+    return explanation
+
+
+def _compare_eq_set(
+    left: AbstractSet[Any], right: AbstractSet[Any], verbose: int = 0
+) -> List[str]:
+    explanation = []
+    diff_left = left - right
+    diff_right = right - left
+    if diff_left:
+        explanation.append("Extra items in the left set:")
+        for item in diff_left:
+            explanation.append(saferepr(item))
+    if diff_right:
+        explanation.append("Extra items in the right set:")
+        for item in diff_right:
+            explanation.append(saferepr(item))
+    return explanation
+
+
+def _compare_eq_dict(
+    left: Mapping[Any, Any], right: Mapping[Any, Any], verbose: int = 0
+) -> List[str]:
+    explanation = []  # type: List[str]
+    set_left = set(left)
+    set_right = set(right)
+    common = set_left.intersection(set_right)
+    same = {k: left[k] for k in common if left[k] == right[k]}
+    if same and verbose < 2:
+        explanation += ["Omitting %s identical items, use -vv to show" % len(same)]
+    elif same:
+        explanation += ["Common items:"]
+        explanation += pprint.pformat(same).splitlines()
+    diff = {k for k in common if left[k] != right[k]}
+    if diff:
+        explanation += ["Differing items:"]
+        for k in diff:
+            explanation += [saferepr({k: left[k]}) + " != " + saferepr({k: right[k]})]
+    extra_left = set_left - set_right
+    len_extra_left = len(extra_left)
+    if len_extra_left:
+        explanation.append(
+            "Left contains %d more item%s:"
+            % (len_extra_left, "" if len_extra_left == 1 else "s")
+        )
+        explanation.extend(
+            pprint.pformat({k: left[k] for k in extra_left}).splitlines()
+        )
+    extra_right = set_right - set_left
+    len_extra_right = len(extra_right)
+    if len_extra_right:
+        explanation.append(
+            "Right contains %d more item%s:"
+            % (len_extra_right, "" if len_extra_right == 1 else "s")
+        )
+        explanation.extend(
+            pprint.pformat({k: right[k] for k in extra_right}).splitlines()
+        )
+    return explanation
+
+
+def _compare_eq_cls(
+    left: Any,
+    right: Any,
+    verbose: int,
+    type_fns: Tuple[Callable[[Any], bool], Callable[[Any], bool]],
+) -> List[str]:
+    isdatacls, isattrs = type_fns
+    if isdatacls(left):
+        all_fields = left.__dataclass_fields__
+        fields_to_check = [field for field, info in all_fields.items() if info.compare]
+    elif isattrs(left):
+        all_fields = left.__attrs_attrs__
+        fields_to_check = [
+            field.name for field in all_fields if getattr(field, ATTRS_EQ_FIELD)
+        ]
+
+    same = []
+    diff = []
+    for field in fields_to_check:
+        if getattr(left, field) == getattr(right, field):
+            same.append(field)
+        else:
+            diff.append(field)
+
+    explanation = []
+    if same and verbose < 2:
+        explanation.append("Omitting %s identical items, use -vv to show" % len(same))
+    elif same:
+        explanation += ["Matching attributes:"]
+        explanation += pprint.pformat(same).splitlines()
+    if diff:
+        explanation += ["Differing attributes:"]
+        for field in diff:
+            explanation += [
+                ("%s: %r != %r") % (field, getattr(left, field), getattr(right, field))
+            ]
+    return explanation
+
+
+def _notin_text(term: str, text: str, verbose: int = 0) -> List[str]:
+    index = text.find(term)
+    head = text[:index]
+    tail = text[index + len(term) :]
+    correct_text = head + tail
+    diff = _diff_text(text, correct_text, verbose)
+    newdiff = ["%s is contained here:" % saferepr(term, maxsize=42)]
+    for line in diff:
+        if line.startswith("Skipping"):
+            continue
+        if line.startswith("- "):
+            continue
+        if line.startswith("+ "):
+            newdiff.append("  " + line[2:])
+        else:
+            newdiff.append(line)
+    return newdiff
diff --git a/contrib/python/pytest/py3/_pytest/cacheprovider.py b/contrib/python/pytest/py3/_pytest/cacheprovider.py
new file mode 100644
index 0000000000..a0f486089f
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/cacheprovider.py
@@ -0,0 +1,508 @@
+"""
+merged implementation of the cache provider
+
+the name cache was not chosen to ensure pluggy automatically
+ignores the external pytest-cache
+"""
+import json
+import os
+from collections import OrderedDict
+from typing import Dict
+from typing import Generator
+from typing import List
+from typing import Optional
+from typing import Set
+
+import attr
+import py
+
+import pytest
+from .pathlib import Path
+from .pathlib import resolve_from_str
+from .pathlib import rm_rf
+from .reports import CollectReport
+from _pytest import nodes
+from _pytest._io import TerminalWriter
+from _pytest.config import Config
+from _pytest.main import Session
+from _pytest.python import Module
+
+README_CONTENT = """\
+# pytest cache directory #
+
+This directory contains data from the pytest's cache plugin,
+which provides the `--lf` and `--ff` options, as well as the `cache` fixture.
+
+**Do not** commit this to version control.
+
+See [the docs](https://docs.pytest.org/en/latest/cache.html) for more information.
+"""
+
+CACHEDIR_TAG_CONTENT = b"""\
+Signature: 8a477f597d28d172789f06886806bc55
+# This file is a cache directory tag created by pytest.
+# For information about cache directory tags, see:
+#	http://www.bford.info/cachedir/spec.html
+"""
+
+
+@attr.s
+class Cache:
+    _cachedir = attr.ib(repr=False)
+    _config = attr.ib(repr=False)
+
+    # sub-directory under cache-dir for directories created by "makedir"
+    _CACHE_PREFIX_DIRS = "d"
+
+    # sub-directory under cache-dir for values created by "set"
+    _CACHE_PREFIX_VALUES = "v"
+
+    @classmethod
+    def for_config(cls, config):
+        cachedir = cls.cache_dir_from_config(config)
+        if config.getoption("cacheclear") and cachedir.is_dir():
+            cls.clear_cache(cachedir)
+        return cls(cachedir, config)
+
+    @classmethod
+    def clear_cache(cls, cachedir: Path):
+        """Clears the sub-directories used to hold cached directories and values."""
+        for prefix in (cls._CACHE_PREFIX_DIRS, cls._CACHE_PREFIX_VALUES):
+            d = cachedir / prefix
+            if d.is_dir():
+                rm_rf(d)
+
+    @staticmethod
+    def cache_dir_from_config(config):
+        return resolve_from_str(config.getini("cache_dir"), config.rootdir)
+
+    def warn(self, fmt, **args):
+        import warnings
+        from _pytest.warning_types import PytestCacheWarning
+
+        warnings.warn(
+            PytestCacheWarning(fmt.format(**args) if args else fmt),
+            self._config.hook,
+            stacklevel=3,
+        )
+
+    def makedir(self, name):
+        """ return a directory path object with the given name.  If the
+        directory does not yet exist, it will be created.  You can use it
+        to manage files likes e. g. store/retrieve database
+        dumps across test sessions.
+
+        :param name: must be a string not containing a ``/`` separator.
+             Make sure the name contains your plugin or application
+             identifiers to prevent clashes with other cache users.
+        """
+        name = Path(name)
+        if len(name.parts) > 1:
+            raise ValueError("name is not allowed to contain path separators")
+        res = self._cachedir.joinpath(self._CACHE_PREFIX_DIRS, name)
+        res.mkdir(exist_ok=True, parents=True)
+        return py.path.local(res)
+
+    def _getvaluepath(self, key):
+        return self._cachedir.joinpath(self._CACHE_PREFIX_VALUES, Path(key))
+
+    def get(self, key, default):
+        """ return cached value for the given key.  If no value
+        was yet cached or the value cannot be read, the specified
+        default is returned.
+
+        :param key: must be a ``/`` separated value. Usually the first
+             name is the name of your plugin or your application.
+        :param default: must be provided in case of a cache-miss or
+             invalid cache values.
+
+        """
+        path = self._getvaluepath(key)
+        try:
+            with path.open("r") as f:
+                return json.load(f)
+        except (ValueError, IOError, OSError):
+            return default
+
+    def set(self, key, value):
+        """ save value for the given key.
+
+        :param key: must be a ``/`` separated value. Usually the first
+             name is the name of your plugin or your application.
+        :param value: must be of any combination of basic
+               python types, including nested types
+               like e. g. lists of dictionaries.
+        """
+        path = self._getvaluepath(key)
+        try:
+            if path.parent.is_dir():
+                cache_dir_exists_already = True
+            else:
+                cache_dir_exists_already = self._cachedir.exists()
+                path.parent.mkdir(exist_ok=True, parents=True)
+        except (IOError, OSError):
+            self.warn("could not create cache path {path}", path=path)
+            return
+        if not cache_dir_exists_already:
+            self._ensure_supporting_files()
+        data = json.dumps(value, indent=2, sort_keys=True)
+        try:
+            f = path.open("w")
+        except (IOError, OSError):
+            self.warn("cache could not write path {path}", path=path)
+        else:
+            with f:
+                f.write(data)
+
+    def _ensure_supporting_files(self):
+        """Create supporting files in the cache dir that are not really part of the cache."""
+        readme_path = self._cachedir / "README.md"
+        readme_path.write_text(README_CONTENT)
+
+        gitignore_path = self._cachedir.joinpath(".gitignore")
+        msg = "# Created by pytest automatically.\n*\n"
+        gitignore_path.write_text(msg, encoding="UTF-8")
+
+        cachedir_tag_path = self._cachedir.joinpath("CACHEDIR.TAG")
+        cachedir_tag_path.write_bytes(CACHEDIR_TAG_CONTENT)
+
+
+class LFPluginCollWrapper:
+    def __init__(self, lfplugin: "LFPlugin"):
+        self.lfplugin = lfplugin
+        self._collected_at_least_one_failure = False
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_make_collect_report(self, collector) -> Generator:
+        if isinstance(collector, Session):
+            out = yield
+            res = out.get_result()  # type: CollectReport
+
+            # Sort any lf-paths to the beginning.
+            lf_paths = self.lfplugin._last_failed_paths
+            res.result = sorted(
+                res.result, key=lambda x: 0 if Path(str(x.fspath)) in lf_paths else 1,
+            )
+            out.force_result(res)
+            return
+
+        elif isinstance(collector, Module):
+            if Path(str(collector.fspath)) in self.lfplugin._last_failed_paths:
+                out = yield
+                res = out.get_result()
+
+                filtered_result = [
+                    x for x in res.result if x.nodeid in self.lfplugin.lastfailed
+                ]
+                if filtered_result:
+                    res.result = filtered_result
+                    out.force_result(res)
+
+                    if not self._collected_at_least_one_failure:
+                        self.lfplugin.config.pluginmanager.register(
+                            LFPluginCollSkipfiles(self.lfplugin), "lfplugin-collskip"
+                        )
+                        self._collected_at_least_one_failure = True
+                return res
+        yield
+
+
+class LFPluginCollSkipfiles:
+    def __init__(self, lfplugin: "LFPlugin"):
+        self.lfplugin = lfplugin
+
+    @pytest.hookimpl
+    def pytest_make_collect_report(self, collector) -> Optional[CollectReport]:
+        if isinstance(collector, Module):
+            if Path(str(collector.fspath)) not in self.lfplugin._last_failed_paths:
+                self.lfplugin._skipped_files += 1
+
+                return CollectReport(
+                    collector.nodeid, "passed", longrepr=None, result=[]
+                )
+        return None
+
+
+class LFPlugin:
+    """ Plugin which implements the --lf (run last-failing) option """
+
+    def __init__(self, config: Config) -> None:
+        self.config = config
+        active_keys = "lf", "failedfirst"
+        self.active = any(config.getoption(key) for key in active_keys)
+        assert config.cache
+        self.lastfailed = config.cache.get(
+            "cache/lastfailed", {}
+        )  # type: Dict[str, bool]
+        self._previously_failed_count = None
+        self._report_status = None
+        self._skipped_files = 0  # count skipped files during collection due to --lf
+
+        if config.getoption("lf"):
+            self._last_failed_paths = self.get_last_failed_paths()
+            config.pluginmanager.register(
+                LFPluginCollWrapper(self), "lfplugin-collwrapper"
+            )
+
+    def get_last_failed_paths(self) -> Set[Path]:
+        """Returns a set with all Paths()s of the previously failed nodeids."""
+        rootpath = Path(str(self.config.rootdir))
+        result = {rootpath / nodeid.split("::")[0] for nodeid in self.lastfailed}
+        return {x for x in result if x.exists()}
+
+    def pytest_report_collectionfinish(self):
+        if self.active and self.config.getoption("verbose") >= 0:
+            return "run-last-failure: %s" % self._report_status
+
+    def pytest_runtest_logreport(self, report):
+        if (report.when == "call" and report.passed) or report.skipped:
+            self.lastfailed.pop(report.nodeid, None)
+        elif report.failed:
+            self.lastfailed[report.nodeid] = True
+
+    def pytest_collectreport(self, report):
+        passed = report.outcome in ("passed", "skipped")
+        if passed:
+            if report.nodeid in self.lastfailed:
+                self.lastfailed.pop(report.nodeid)
+                self.lastfailed.update((item.nodeid, True) for item in report.result)
+        else:
+            self.lastfailed[report.nodeid] = True
+
+    def pytest_collection_modifyitems(self, session, config, items):
+        if not self.active:
+            return
+
+        if self.lastfailed:
+            previously_failed = []
+            previously_passed = []
+            for item in items:
+                if item.nodeid in self.lastfailed:
+                    previously_failed.append(item)
+                else:
+                    previously_passed.append(item)
+            self._previously_failed_count = len(previously_failed)
+
+            if not previously_failed:
+                # Running a subset of all tests with recorded failures
+                # only outside of it.
+                self._report_status = "%d known failures not in selected tests" % (
+                    len(self.lastfailed),
+                )
+            else:
+                if self.config.getoption("lf"):
+                    items[:] = previously_failed
+                    config.hook.pytest_deselected(items=previously_passed)
+                else:  # --failedfirst
+                    items[:] = previously_failed + previously_passed
+
+                noun = "failure" if self._previously_failed_count == 1 else "failures"
+                suffix = " first" if self.config.getoption("failedfirst") else ""
+                self._report_status = "rerun previous {count} {noun}{suffix}".format(
+                    count=self._previously_failed_count, suffix=suffix, noun=noun
+                )
+
+            if self._skipped_files > 0:
+                files_noun = "file" if self._skipped_files == 1 else "files"
+                self._report_status += " (skipped {files} {files_noun})".format(
+                    files=self._skipped_files, files_noun=files_noun
+                )
+        else:
+            self._report_status = "no previously failed tests, "
+            if self.config.getoption("last_failed_no_failures") == "none":
+                self._report_status += "deselecting all items."
+                config.hook.pytest_deselected(items=items[:])
+                items[:] = []
+            else:
+                self._report_status += "not deselecting items."
+
+    def pytest_sessionfinish(self, session):
+        config = self.config
+        if config.getoption("cacheshow") or hasattr(config, "slaveinput"):
+            return
+
+        saved_lastfailed = config.cache.get("cache/lastfailed", {})
+        if saved_lastfailed != self.lastfailed:
+            config.cache.set("cache/lastfailed", self.lastfailed)
+
+
+class NFPlugin:
+    """ Plugin which implements the --nf (run new-first) option """
+
+    def __init__(self, config):
+        self.config = config
+        self.active = config.option.newfirst
+        self.cached_nodeids = config.cache.get("cache/nodeids", [])
+
+    def pytest_collection_modifyitems(
+        self, session: Session, config: Config, items: List[nodes.Item]
+    ) -> None:
+        new_items = OrderedDict()  # type: OrderedDict[str, nodes.Item]
+        if self.active:
+            other_items = OrderedDict()  # type: OrderedDict[str, nodes.Item]
+            for item in items:
+                if item.nodeid not in self.cached_nodeids:
+                    new_items[item.nodeid] = item
+                else:
+                    other_items[item.nodeid] = item
+
+            items[:] = self._get_increasing_order(
+                new_items.values()
+            ) + self._get_increasing_order(other_items.values())
+        else:
+            for item in items:
+                if item.nodeid not in self.cached_nodeids:
+                    new_items[item.nodeid] = item
+        self.cached_nodeids.extend(new_items)
+
+    def _get_increasing_order(self, items):
+        return sorted(items, key=lambda item: item.fspath.mtime(), reverse=True)
+
+    def pytest_sessionfinish(self, session):
+        config = self.config
+        if config.getoption("cacheshow") or hasattr(config, "slaveinput"):
+            return
+
+        config.cache.set("cache/nodeids", self.cached_nodeids)
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("general")
+    group.addoption(
+        "--lf",
+        "--last-failed",
+        action="store_true",
+        dest="lf",
+        help="rerun only the tests that failed "
+        "at the last run (or all if none failed)",
+    )
+    group.addoption(
+        "--ff",
+        "--failed-first",
+        action="store_true",
+        dest="failedfirst",
+        help="run all tests but run the last failures first.  "
+        "This may re-order tests and thus lead to "
+        "repeated fixture setup/teardown",
+    )
+    group.addoption(
+        "--nf",
+        "--new-first",
+        action="store_true",
+        dest="newfirst",
+        help="run tests from new files first, then the rest of the tests "
+        "sorted by file mtime",
+    )
+    group.addoption(
+        "--cache-show",
+        action="append",
+        nargs="?",
+        dest="cacheshow",
+        help=(
+            "show cache contents, don't perform collection or tests. "
+            "Optional argument: glob (default: '*')."
+        ),
+    )
+    group.addoption(
+        "--cache-clear",
+        action="store_true",
+        dest="cacheclear",
+        help="remove all cache contents at start of test run.",
+    )
+    cache_dir_default = ".pytest_cache"
+    if "TOX_ENV_DIR" in os.environ:
+        cache_dir_default = os.path.join(os.environ["TOX_ENV_DIR"], cache_dir_default)
+    parser.addini("cache_dir", default=cache_dir_default, help="cache directory path.")
+    group.addoption(
+        "--lfnf",
+        "--last-failed-no-failures",
+        action="store",
+        dest="last_failed_no_failures",
+        choices=("all", "none"),
+        default="all",
+        help="which tests to run with no previously (known) failures.",
+    )
+
+
+def pytest_cmdline_main(config):
+    if config.option.cacheshow:
+        from _pytest.main import wrap_session
+
+        return wrap_session(config, cacheshow)
+
+
+@pytest.hookimpl(tryfirst=True)
+def pytest_configure(config: Config) -> None:
+    config.cache = Cache.for_config(config)
+    config.pluginmanager.register(LFPlugin(config), "lfplugin")
+    config.pluginmanager.register(NFPlugin(config), "nfplugin")
+
+
+@pytest.fixture
+def cache(request):
+    """
+    Return a cache object that can persist state between testing sessions.
+
+    cache.get(key, default)
+    cache.set(key, value)
+
+    Keys must be a ``/`` separated value, where the first part is usually the
+    name of your plugin or application to avoid clashes with other cache users.
+
+    Values can be any object handled by the json stdlib module.
+    """
+    return request.config.cache
+
+
+def pytest_report_header(config):
+    """Display cachedir with --cache-show and if non-default."""
+    if config.option.verbose > 0 or config.getini("cache_dir") != ".pytest_cache":
+        cachedir = config.cache._cachedir
+        # TODO: evaluate generating upward relative paths
+        # starting with .., ../.. if sensible
+
+        try:
+            displaypath = cachedir.relative_to(config.rootdir)
+        except ValueError:
+            displaypath = cachedir
+        return "cachedir: {}".format(displaypath)
+
+
+def cacheshow(config, session):
+    from pprint import pformat
+
+    tw = TerminalWriter()
+    tw.line("cachedir: " + str(config.cache._cachedir))
+    if not config.cache._cachedir.is_dir():
+        tw.line("cache is empty")
+        return 0
+
+    glob = config.option.cacheshow[0]
+    if glob is None:
+        glob = "*"
+
+    dummy = object()
+    basedir = config.cache._cachedir
+    vdir = basedir / Cache._CACHE_PREFIX_VALUES
+    tw.sep("-", "cache values for %r" % glob)
+    for valpath in sorted(x for x in vdir.rglob(glob) if x.is_file()):
+        key = valpath.relative_to(vdir)
+        val = config.cache.get(key, dummy)
+        if val is dummy:
+            tw.line("%s contains unreadable content, will be ignored" % key)
+        else:
+            tw.line("%s contains:" % key)
+            for line in pformat(val).splitlines():
+                tw.line("  " + line)
+
+    ddir = basedir / Cache._CACHE_PREFIX_DIRS
+    if ddir.is_dir():
+        contents = sorted(ddir.rglob(glob))
+        tw.sep("-", "cache directories for %r" % glob)
+        for p in contents:
+            # if p.check(dir=1):
+            #    print("%s/" % p.relto(basedir))
+            if p.is_file():
+                key = p.relative_to(basedir)
+                tw.line("{} is a file of length {:d}".format(key, p.stat().st_size))
+    return 0
diff --git a/contrib/python/pytest/py3/_pytest/capture.py b/contrib/python/pytest/py3/_pytest/capture.py
new file mode 100644
index 0000000000..673bb07a9b
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/capture.py
@@ -0,0 +1,853 @@
+"""
+per-test stdout/stderr capturing mechanism.
+
+"""
+import collections
+import contextlib
+import io
+import os
+import sys
+from io import UnsupportedOperation
+from tempfile import TemporaryFile
+from typing import BinaryIO
+from typing import Generator
+from typing import Iterable
+from typing import Optional
+
+import pytest
+from _pytest.compat import CaptureAndPassthroughIO
+from _pytest.compat import CaptureIO
+from _pytest.compat import TYPE_CHECKING
+from _pytest.config import Config
+from _pytest.fixtures import FixtureRequest
+
+if TYPE_CHECKING:
+    from typing_extensions import Literal
+
+    _CaptureMethod = Literal["fd", "sys", "no", "tee-sys"]
+
+patchsysdict = {0: "stdin", 1: "stdout", 2: "stderr"}
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("general")
+    group._addoption(
+        "--capture",
+        action="store",
+        default="fd" if hasattr(os, "dup") else "sys",
+        metavar="method",
+        choices=["fd", "sys", "no", "tee-sys"],
+        help="per-test capturing method: one of fd|sys|no|tee-sys.",
+    )
+    group._addoption(
+        "-s",
+        action="store_const",
+        const="no",
+        dest="capture",
+        help="shortcut for --capture=no.",
+    )
+
+
+@pytest.hookimpl(hookwrapper=True)
+def pytest_load_initial_conftests(early_config: Config):
+    ns = early_config.known_args_namespace
+    if ns.capture == "fd":
+        _py36_windowsconsoleio_workaround(sys.stdout)
+    _colorama_workaround()
+    _readline_workaround()
+    pluginmanager = early_config.pluginmanager
+    capman = CaptureManager(ns.capture)
+    pluginmanager.register(capman, "capturemanager")
+
+    # make sure that capturemanager is properly reset at final shutdown
+    early_config.add_cleanup(capman.stop_global_capturing)
+
+    # finally trigger conftest loading but while capturing (issue93)
+    capman.start_global_capturing()
+    outcome = yield
+    capman.suspend_global_capture()
+    if outcome.excinfo is not None:
+        out, err = capman.read_global_capture()
+        sys.stdout.write(out)
+        sys.stderr.write(err)
+
+
+def _get_multicapture(method: "_CaptureMethod") -> "MultiCapture":
+    if method == "fd":
+        return MultiCapture(out=True, err=True, Capture=FDCapture)
+    elif method == "sys":
+        return MultiCapture(out=True, err=True, Capture=SysCapture)
+    elif method == "no":
+        return MultiCapture(out=False, err=False, in_=False)
+    elif method == "tee-sys":
+        return MultiCapture(out=True, err=True, in_=False, Capture=TeeSysCapture)
+    raise ValueError("unknown capturing method: {!r}".format(method))
+
+
+class CaptureManager:
+    """
+    Capture plugin, manages that the appropriate capture method is enabled/disabled during collection and each
+    test phase (setup, call, teardown). After each of those points, the captured output is obtained and
+    attached to the collection/runtest report.
+
+    There are two levels of capture:
+    * global: which is enabled by default and can be suppressed by the ``-s`` option. This is always enabled/disabled
+      during collection and each test phase.
+    * fixture: when a test function or one of its fixture depend on the ``capsys`` or ``capfd`` fixtures. In this
+      case special handling is needed to ensure the fixtures take precedence over the global capture.
+    """
+
+    def __init__(self, method: "_CaptureMethod") -> None:
+        self._method = method
+        self._global_capturing = None
+        self._capture_fixture = None  # type: Optional[CaptureFixture]
+
+    def __repr__(self):
+        return "<CaptureManager _method={!r} _global_capturing={!r} _capture_fixture={!r}>".format(
+            self._method, self._global_capturing, self._capture_fixture
+        )
+
+    def is_capturing(self):
+        if self.is_globally_capturing():
+            return "global"
+        if self._capture_fixture:
+            return "fixture %s" % self._capture_fixture.request.fixturename
+        return False
+
+    # Global capturing control
+
+    def is_globally_capturing(self):
+        return self._method != "no"
+
+    def start_global_capturing(self):
+        assert self._global_capturing is None
+        self._global_capturing = _get_multicapture(self._method)
+        self._global_capturing.start_capturing()
+
+    def stop_global_capturing(self):
+        if self._global_capturing is not None:
+            self._global_capturing.pop_outerr_to_orig()
+            self._global_capturing.stop_capturing()
+            self._global_capturing = None
+
+    def resume_global_capture(self):
+        # During teardown of the python process, and on rare occasions, capture
+        # attributes can be `None` while trying to resume global capture.
+        if self._global_capturing is not None:
+            self._global_capturing.resume_capturing()
+
+    def suspend_global_capture(self, in_=False):
+        cap = getattr(self, "_global_capturing", None)
+        if cap is not None:
+            cap.suspend_capturing(in_=in_)
+
+    def suspend(self, in_=False):
+        # Need to undo local capsys-et-al if it exists before disabling global capture.
+        self.suspend_fixture()
+        self.suspend_global_capture(in_)
+
+    def resume(self):
+        self.resume_global_capture()
+        self.resume_fixture()
+
+    def read_global_capture(self):
+        return self._global_capturing.readouterr()
+
+    # Fixture Control (it's just forwarding, think about removing this later)
+
+    @contextlib.contextmanager
+    def _capturing_for_request(
+        self, request: FixtureRequest
+    ) -> Generator["CaptureFixture", None, None]:
+        """
+        Context manager that creates a ``CaptureFixture`` instance for the
+        given ``request``, ensuring there is only a single one being requested
+        at the same time.
+
+        This is used as a helper with ``capsys``, ``capfd`` etc.
+        """
+        if self._capture_fixture:
+            other_name = next(
+                k
+                for k, v in map_fixname_class.items()
+                if v is self._capture_fixture.captureclass
+            )
+            raise request.raiseerror(
+                "cannot use {} and {} at the same time".format(
+                    request.fixturename, other_name
+                )
+            )
+        capture_class = map_fixname_class[request.fixturename]
+        self._capture_fixture = CaptureFixture(capture_class, request)
+        self.activate_fixture()
+        yield self._capture_fixture
+        self._capture_fixture.close()
+        self._capture_fixture = None
+
+    def activate_fixture(self):
+        """If the current item is using ``capsys`` or ``capfd``, activate them so they take precedence over
+        the global capture.
+        """
+        if self._capture_fixture:
+            self._capture_fixture._start()
+
+    def deactivate_fixture(self):
+        """Deactivates the ``capsys`` or ``capfd`` fixture of this item, if any."""
+        if self._capture_fixture:
+            self._capture_fixture.close()
+
+    def suspend_fixture(self):
+        if self._capture_fixture:
+            self._capture_fixture._suspend()
+
+    def resume_fixture(self):
+        if self._capture_fixture:
+            self._capture_fixture._resume()
+
+    # Helper context managers
+
+    @contextlib.contextmanager
+    def global_and_fixture_disabled(self):
+        """Context manager to temporarily disable global and current fixture capturing."""
+        self.suspend()
+        try:
+            yield
+        finally:
+            self.resume()
+
+    @contextlib.contextmanager
+    def item_capture(self, when, item):
+        self.resume_global_capture()
+        self.activate_fixture()
+        try:
+            yield
+        finally:
+            self.deactivate_fixture()
+            self.suspend_global_capture(in_=False)
+
+        out, err = self.read_global_capture()
+        item.add_report_section(when, "stdout", out)
+        item.add_report_section(when, "stderr", err)
+
+    # Hooks
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_make_collect_report(self, collector):
+        if isinstance(collector, pytest.File):
+            self.resume_global_capture()
+            outcome = yield
+            self.suspend_global_capture()
+            out, err = self.read_global_capture()
+            rep = outcome.get_result()
+            if out:
+                rep.sections.append(("Captured stdout", out))
+            if err:
+                rep.sections.append(("Captured stderr", err))
+        else:
+            yield
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_runtest_setup(self, item):
+        with self.item_capture("setup", item):
+            yield
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_runtest_call(self, item):
+        with self.item_capture("call", item):
+            yield
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_runtest_teardown(self, item):
+        with self.item_capture("teardown", item):
+            yield
+
+    @pytest.hookimpl(tryfirst=True)
+    def pytest_keyboard_interrupt(self, excinfo):
+        self.stop_global_capturing()
+
+    @pytest.hookimpl(tryfirst=True)
+    def pytest_internalerror(self, excinfo):
+        self.stop_global_capturing()
+
+
+@pytest.fixture
+def capsys(request):
+    """Enable text capturing of writes to ``sys.stdout`` and ``sys.stderr``.
+
+    The captured output is made available via ``capsys.readouterr()`` method
+    calls, which return a ``(out, err)`` namedtuple.
+    ``out`` and ``err`` will be ``text`` objects.
+    """
+    capman = request.config.pluginmanager.getplugin("capturemanager")
+    with capman._capturing_for_request(request) as fixture:
+        yield fixture
+
+
+@pytest.fixture
+def capsysbinary(request):
+    """Enable bytes capturing of writes to ``sys.stdout`` and ``sys.stderr``.
+
+    The captured output is made available via ``capsysbinary.readouterr()``
+    method calls, which return a ``(out, err)`` namedtuple.
+    ``out`` and ``err`` will be ``bytes`` objects.
+    """
+    capman = request.config.pluginmanager.getplugin("capturemanager")
+    with capman._capturing_for_request(request) as fixture:
+        yield fixture
+
+
+@pytest.fixture
+def capfd(request):
+    """Enable text capturing of writes to file descriptors ``1`` and ``2``.
+
+    The captured output is made available via ``capfd.readouterr()`` method
+    calls, which return a ``(out, err)`` namedtuple.
+    ``out`` and ``err`` will be ``text`` objects.
+    """
+    if not hasattr(os, "dup"):
+        pytest.skip(
+            "capfd fixture needs os.dup function which is not available in this system"
+        )
+    capman = request.config.pluginmanager.getplugin("capturemanager")
+    with capman._capturing_for_request(request) as fixture:
+        yield fixture
+
+
+@pytest.fixture
+def capfdbinary(request):
+    """Enable bytes capturing of writes to file descriptors ``1`` and ``2``.
+
+    The captured output is made available via ``capfd.readouterr()`` method
+    calls, which return a ``(out, err)`` namedtuple.
+    ``out`` and ``err`` will be ``byte`` objects.
+    """
+    if not hasattr(os, "dup"):
+        pytest.skip(
+            "capfdbinary fixture needs os.dup function which is not available in this system"
+        )
+    capman = request.config.pluginmanager.getplugin("capturemanager")
+    with capman._capturing_for_request(request) as fixture:
+        yield fixture
+
+
+class CaptureFixture:
+    """
+    Object returned by :py:func:`capsys`, :py:func:`capsysbinary`, :py:func:`capfd` and :py:func:`capfdbinary`
+    fixtures.
+    """
+
+    def __init__(self, captureclass, request):
+        self.captureclass = captureclass
+        self.request = request
+        self._capture = None
+        self._captured_out = self.captureclass.EMPTY_BUFFER
+        self._captured_err = self.captureclass.EMPTY_BUFFER
+
+    def _start(self):
+        if self._capture is None:
+            self._capture = MultiCapture(
+                out=True, err=True, in_=False, Capture=self.captureclass
+            )
+            self._capture.start_capturing()
+
+    def close(self):
+        if self._capture is not None:
+            out, err = self._capture.pop_outerr_to_orig()
+            self._captured_out += out
+            self._captured_err += err
+            self._capture.stop_capturing()
+            self._capture = None
+
+    def readouterr(self):
+        """Read and return the captured output so far, resetting the internal buffer.
+
+        :return: captured content as a namedtuple with ``out`` and ``err`` string attributes
+        """
+        captured_out, captured_err = self._captured_out, self._captured_err
+        if self._capture is not None:
+            out, err = self._capture.readouterr()
+            captured_out += out
+            captured_err += err
+        self._captured_out = self.captureclass.EMPTY_BUFFER
+        self._captured_err = self.captureclass.EMPTY_BUFFER
+        return CaptureResult(captured_out, captured_err)
+
+    def _suspend(self):
+        """Suspends this fixture's own capturing temporarily."""
+        if self._capture is not None:
+            self._capture.suspend_capturing()
+
+    def _resume(self):
+        """Resumes this fixture's own capturing temporarily."""
+        if self._capture is not None:
+            self._capture.resume_capturing()
+
+    @contextlib.contextmanager
+    def disabled(self):
+        """Temporarily disables capture while inside the 'with' block."""
+        capmanager = self.request.config.pluginmanager.getplugin("capturemanager")
+        with capmanager.global_and_fixture_disabled():
+            yield
+
+
+def safe_text_dupfile(f, mode, default_encoding="UTF8"):
+    """ return an open text file object that's a duplicate of f on the
+        FD-level if possible.
+    """
+    encoding = getattr(f, "encoding", None)
+    try:
+        fd = f.fileno()
+    except Exception:
+        if "b" not in getattr(f, "mode", "") and hasattr(f, "encoding"):
+            # we seem to have a text stream, let's just use it
+            return f
+    else:
+        newfd = os.dup(fd)
+        if "b" not in mode:
+            mode += "b"
+        f = os.fdopen(newfd, mode, 0)  # no buffering
+    return EncodedFile(f, encoding or default_encoding)
+
+
+class EncodedFile:
+    errors = "strict"  # possibly needed by py3 code (issue555)
+
+    def __init__(self, buffer: BinaryIO, encoding: str) -> None:
+        self.buffer = buffer
+        self.encoding = encoding
+
+    def write(self, s: str) -> int:
+        if not isinstance(s, str):
+            raise TypeError(
+                "write() argument must be str, not {}".format(type(s).__name__)
+            )
+        return self.buffer.write(s.encode(self.encoding, "replace"))
+
+    def writelines(self, lines: Iterable[str]) -> None:
+        self.buffer.writelines(x.encode(self.encoding, "replace") for x in lines)
+
+    @property
+    def name(self) -> str:
+        """Ensure that file.name is a string."""
+        return repr(self.buffer)
+
+    @property
+    def mode(self) -> str:
+        return self.buffer.mode.replace("b", "")
+
+    def __getattr__(self, name):
+        return getattr(object.__getattribute__(self, "buffer"), name)
+
+
+CaptureResult = collections.namedtuple("CaptureResult", ["out", "err"])
+
+
+class MultiCapture:
+    out = err = in_ = None
+    _state = None
+    _in_suspended = False
+
+    def __init__(self, out=True, err=True, in_=True, Capture=None):
+        if in_:
+            self.in_ = Capture(0)
+        if out:
+            self.out = Capture(1)
+        if err:
+            self.err = Capture(2)
+
+    def __repr__(self):
+        return "<MultiCapture out={!r} err={!r} in_={!r} _state={!r} _in_suspended={!r}>".format(
+            self.out, self.err, self.in_, self._state, self._in_suspended,
+        )
+
+    def start_capturing(self):
+        self._state = "started"
+        if self.in_:
+            self.in_.start()
+        if self.out:
+            self.out.start()
+        if self.err:
+            self.err.start()
+
+    def pop_outerr_to_orig(self):
+        """ pop current snapshot out/err capture and flush to orig streams. """
+        out, err = self.readouterr()
+        if out:
+            self.out.writeorg(out)
+        if err:
+            self.err.writeorg(err)
+        return out, err
+
+    def suspend_capturing(self, in_=False):
+        self._state = "suspended"
+        if self.out:
+            self.out.suspend()
+        if self.err:
+            self.err.suspend()
+        if in_ and self.in_:
+            self.in_.suspend()
+            self._in_suspended = True
+
+    def resume_capturing(self):
+        self._state = "resumed"
+        if self.out:
+            self.out.resume()
+        if self.err:
+            self.err.resume()
+        if self._in_suspended:
+            self.in_.resume()
+            self._in_suspended = False
+
+    def stop_capturing(self):
+        """ stop capturing and reset capturing streams """
+        if self._state == "stopped":
+            raise ValueError("was already stopped")
+        self._state = "stopped"
+        if self.out:
+            self.out.done()
+        if self.err:
+            self.err.done()
+        if self.in_:
+            self.in_.done()
+
+    def readouterr(self) -> CaptureResult:
+        if self.out:
+            out = self.out.snap()
+        else:
+            out = ""
+        if self.err:
+            err = self.err.snap()
+        else:
+            err = ""
+        return CaptureResult(out, err)
+
+
+class NoCapture:
+    EMPTY_BUFFER = None
+    __init__ = start = done = suspend = resume = lambda *args: None
+
+
+class FDCaptureBinary:
+    """Capture IO to/from a given os-level filedescriptor.
+
+    snap() produces `bytes`
+    """
+
+    EMPTY_BUFFER = b""
+    _state = None
+
+    def __init__(self, targetfd, tmpfile=None):
+        self.targetfd = targetfd
+        try:
+            self.targetfd_save = os.dup(self.targetfd)
+        except OSError:
+            self.start = lambda: None
+            self.done = lambda: None
+        else:
+            self.start = self._start
+            self.done = self._done
+            if targetfd == 0:
+                assert not tmpfile, "cannot set tmpfile with stdin"
+                tmpfile = open(os.devnull, "r")
+                self.syscapture = SysCapture(targetfd)
+            else:
+                if tmpfile is None:
+                    f = TemporaryFile()
+                    with f:
+                        tmpfile = safe_text_dupfile(f, mode="wb+")
+                if targetfd in patchsysdict:
+                    self.syscapture = SysCapture(targetfd, tmpfile)
+                else:
+                    self.syscapture = NoCapture()
+            self.tmpfile = tmpfile
+            self.tmpfile_fd = tmpfile.fileno()
+
+    def __repr__(self):
+        return "<{} {} oldfd={} _state={!r} tmpfile={}>".format(
+            self.__class__.__name__,
+            self.targetfd,
+            getattr(self, "targetfd_save", "<UNSET>"),
+            self._state,
+            hasattr(self, "tmpfile") and repr(self.tmpfile) or "<UNSET>",
+        )
+
+    def _start(self):
+        """ Start capturing on targetfd using memorized tmpfile. """
+        try:
+            os.fstat(self.targetfd_save)
+        except (AttributeError, OSError):
+            raise ValueError("saved filedescriptor not valid anymore")
+        os.dup2(self.tmpfile_fd, self.targetfd)
+        self.syscapture.start()
+        self._state = "started"
+
+    def snap(self):
+        self.tmpfile.seek(0)
+        res = self.tmpfile.read()
+        self.tmpfile.seek(0)
+        self.tmpfile.truncate()
+        return res
+
+    def _done(self):
+        """ stop capturing, restore streams, return original capture file,
+        seeked to position zero. """
+        targetfd_save = self.__dict__.pop("targetfd_save")
+        os.dup2(targetfd_save, self.targetfd)
+        os.close(targetfd_save)
+        self.syscapture.done()
+        self.tmpfile.close()
+        self._state = "done"
+
+    def suspend(self):
+        self.syscapture.suspend()
+        os.dup2(self.targetfd_save, self.targetfd)
+        self._state = "suspended"
+
+    def resume(self):
+        self.syscapture.resume()
+        os.dup2(self.tmpfile_fd, self.targetfd)
+        self._state = "resumed"
+
+    def writeorg(self, data):
+        """ write to original file descriptor. """
+        os.write(self.targetfd_save, data)
+
+
+class FDCapture(FDCaptureBinary):
+    """Capture IO to/from a given os-level filedescriptor.
+
+    snap() produces text
+    """
+
+    # Ignore type because it doesn't match the type in the superclass (bytes).
+    EMPTY_BUFFER = str()  # type: ignore
+
+    def snap(self):
+        res = super().snap()
+        enc = getattr(self.tmpfile, "encoding", None)
+        if enc and isinstance(res, bytes):
+            res = str(res, enc, "replace")
+        return res
+
+    def writeorg(self, data):
+        """ write to original file descriptor. """
+        data = data.encode("utf-8")  # XXX use encoding of original stream
+        os.write(self.targetfd_save, data)
+
+
+class SysCaptureBinary:
+
+    EMPTY_BUFFER = b""
+    _state = None
+
+    def __init__(self, fd, tmpfile=None):
+        name = patchsysdict[fd]
+        self._old = getattr(sys, name)
+        self.name = name
+        if tmpfile is None:
+            if name == "stdin":
+                tmpfile = DontReadFromInput()
+            else:
+                tmpfile = CaptureIO()
+        self.tmpfile = tmpfile
+
+    def __repr__(self):
+        return "<{} {} _old={} _state={!r} tmpfile={!r}>".format(
+            self.__class__.__name__,
+            self.name,
+            hasattr(self, "_old") and repr(self._old) or "<UNSET>",
+            self._state,
+            self.tmpfile,
+        )
+
+    def start(self):
+        setattr(sys, self.name, self.tmpfile)
+        self._state = "started"
+
+    def snap(self):
+        res = self.tmpfile.buffer.getvalue()
+        self.tmpfile.seek(0)
+        self.tmpfile.truncate()
+        return res
+
+    def done(self):
+        setattr(sys, self.name, self._old)
+        del self._old
+        self.tmpfile.close()
+        self._state = "done"
+
+    def suspend(self):
+        setattr(sys, self.name, self._old)
+        self._state = "suspended"
+
+    def resume(self):
+        setattr(sys, self.name, self.tmpfile)
+        self._state = "resumed"
+
+    def writeorg(self, data):
+        self._old.flush()
+        self._old.buffer.write(data)
+        self._old.buffer.flush()
+
+
+class SysCapture(SysCaptureBinary):
+    EMPTY_BUFFER = str()  # type: ignore[assignment]  # noqa: F821
+
+    def snap(self):
+        res = self.tmpfile.getvalue()
+        self.tmpfile.seek(0)
+        self.tmpfile.truncate()
+        return res
+
+    def writeorg(self, data):
+        self._old.write(data)
+        self._old.flush()
+
+
+class TeeSysCapture(SysCapture):
+    def __init__(self, fd, tmpfile=None):
+        name = patchsysdict[fd]
+        self._old = getattr(sys, name)
+        self.name = name
+        if tmpfile is None:
+            if name == "stdin":
+                tmpfile = DontReadFromInput()
+            else:
+                tmpfile = CaptureAndPassthroughIO(self._old)
+        self.tmpfile = tmpfile
+
+
+map_fixname_class = {
+    "capfd": FDCapture,
+    "capfdbinary": FDCaptureBinary,
+    "capsys": SysCapture,
+    "capsysbinary": SysCaptureBinary,
+}
+
+
+class DontReadFromInput:
+    encoding = None
+
+    def read(self, *args):
+        raise IOError(
+            "pytest: reading from stdin while output is captured!  Consider using `-s`."
+        )
+
+    readline = read
+    readlines = read
+    __next__ = read
+
+    def __iter__(self):
+        return self
+
+    def fileno(self):
+        raise UnsupportedOperation("redirected stdin is pseudofile, has no fileno()")
+
+    def isatty(self):
+        return False
+
+    def close(self):
+        pass
+
+    @property
+    def buffer(self):
+        return self
+
+
+def _colorama_workaround():
+    """
+    Ensure colorama is imported so that it attaches to the correct stdio
+    handles on Windows.
+
+    colorama uses the terminal on import time. So if something does the
+    first import of colorama while I/O capture is active, colorama will
+    fail in various ways.
+    """
+    if sys.platform.startswith("win32"):
+        try:
+            import colorama  # noqa: F401
+        except ImportError:
+            pass
+
+
+def _readline_workaround():
+    """
+    Ensure readline is imported so that it attaches to the correct stdio
+    handles on Windows.
+
+    Pdb uses readline support where available--when not running from the Python
+    prompt, the readline module is not imported until running the pdb REPL.  If
+    running pytest with the --pdb option this means the readline module is not
+    imported until after I/O capture has been started.
+
+    This is a problem for pyreadline, which is often used to implement readline
+    support on Windows, as it does not attach to the correct handles for stdout
+    and/or stdin if they have been redirected by the FDCapture mechanism.  This
+    workaround ensures that readline is imported before I/O capture is setup so
+    that it can attach to the actual stdin/out for the console.
+
+    See https://github.com/pytest-dev/pytest/pull/1281
+    """
+    if sys.platform.startswith("win32"):
+        try:
+            import readline  # noqa: F401
+        except ImportError:
+            pass
+
+
+def _py36_windowsconsoleio_workaround(stream):
+    """
+    Python 3.6 implemented unicode console handling for Windows. This works
+    by reading/writing to the raw console handle using
+    ``{Read,Write}ConsoleW``.
+
+    The problem is that we are going to ``dup2`` over the stdio file
+    descriptors when doing ``FDCapture`` and this will ``CloseHandle`` the
+    handles used by Python to write to the console. Though there is still some
+    weirdness and the console handle seems to only be closed randomly and not
+    on the first call to ``CloseHandle``, or maybe it gets reopened with the
+    same handle value when we suspend capturing.
+
+    The workaround in this case will reopen stdio with a different fd which
+    also means a different handle by replicating the logic in
+    "Py_lifecycle.c:initstdio/create_stdio".
+
+    :param stream: in practice ``sys.stdout`` or ``sys.stderr``, but given
+        here as parameter for unittesting purposes.
+
+    See https://github.com/pytest-dev/py/issues/103
+    """
+    if (
+        not sys.platform.startswith("win32")
+        or sys.version_info[:2] < (3, 6)
+        or hasattr(sys, "pypy_version_info")
+    ):
+        return
+
+    # bail out if ``stream`` doesn't seem like a proper ``io`` stream (#2666)
+    if not hasattr(stream, "buffer"):
+        return
+
+    buffered = hasattr(stream.buffer, "raw")
+    raw_stdout = stream.buffer.raw if buffered else stream.buffer
+
+    if not isinstance(raw_stdout, io._WindowsConsoleIO):
+        return
+
+    def _reopen_stdio(f, mode):
+        if not buffered and mode[0] == "w":
+            buffering = 0
+        else:
+            buffering = -1
+
+        return io.TextIOWrapper(
+            open(os.dup(f.fileno()), mode, buffering),
+            f.encoding,
+            f.errors,
+            f.newlines,
+            f.line_buffering,
+        )
+
+    sys.stdin = _reopen_stdio(sys.stdin, "rb")
+    sys.stdout = _reopen_stdio(sys.stdout, "wb")
+    sys.stderr = _reopen_stdio(sys.stderr, "wb")
diff --git a/contrib/python/pytest/py3/_pytest/compat.py b/contrib/python/pytest/py3/_pytest/compat.py
new file mode 100644
index 0000000000..4e11bcab76
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/compat.py
@@ -0,0 +1,428 @@
+"""
+python version compatibility code
+"""
+import functools
+import inspect
+import io
+import os
+import re
+import sys
+from contextlib import contextmanager
+from inspect import Parameter
+from inspect import signature
+from typing import Any
+from typing import Callable
+from typing import Generic
+from typing import IO
+from typing import Optional
+from typing import overload
+from typing import Tuple
+from typing import TypeVar
+from typing import Union
+
+import attr
+import py
+
+from _pytest._io.saferepr import saferepr
+from _pytest.outcomes import fail
+from _pytest.outcomes import TEST_OUTCOME
+
+if sys.version_info < (3, 5, 2):
+    TYPE_CHECKING = False  # type: bool
+else:
+    from typing import TYPE_CHECKING
+
+
+if TYPE_CHECKING:
+    from typing import Type  # noqa: F401 (used in type string)
+
+
+_T = TypeVar("_T")
+_S = TypeVar("_S")
+
+
+NOTSET = object()
+
+MODULE_NOT_FOUND_ERROR = (
+    "ModuleNotFoundError" if sys.version_info[:2] >= (3, 6) else "ImportError"
+)
+
+
+if sys.version_info >= (3, 8):
+    from importlib import metadata as importlib_metadata
+else:
+    import importlib_metadata  # noqa: F401
+
+
+def _format_args(func: Callable[..., Any]) -> str:
+    return str(signature(func))
+
+
+# The type of re.compile objects is not exposed in Python.
+REGEX_TYPE = type(re.compile(""))
+
+
+if sys.version_info < (3, 6):
+
+    def fspath(p):
+        """os.fspath replacement, useful to point out when we should replace it by the
+        real function once we drop py35.
+        """
+        return str(p)
+
+
+else:
+    fspath = os.fspath
+
+
+def is_generator(func: object) -> bool:
+    genfunc = inspect.isgeneratorfunction(func)
+    return genfunc and not iscoroutinefunction(func)
+
+
+def iscoroutinefunction(func: object) -> bool:
+    """
+    Return True if func is a coroutine function (a function defined with async
+    def syntax, and doesn't contain yield), or a function decorated with
+    @asyncio.coroutine.
+
+    Note: copied and modified from Python 3.5's builtin couroutines.py to avoid
+    importing asyncio directly, which in turns also initializes the "logging"
+    module as a side-effect (see issue #8).
+    """
+    return inspect.iscoroutinefunction(func) or getattr(func, "_is_coroutine", False)
+
+
+def is_async_function(func: object) -> bool:
+    """Return True if the given function seems to be an async function or async generator"""
+    return iscoroutinefunction(func) or (
+        sys.version_info >= (3, 6) and inspect.isasyncgenfunction(func)
+    )
+
+
+def getlocation(function, curdir=None) -> str:
+    function = get_real_func(function)
+    fn = py.path.local(inspect.getfile(function))
+    lineno = function.__code__.co_firstlineno
+    if curdir is not None:
+        relfn = fn.relto(curdir)
+        if relfn:
+            return "%s:%d" % (relfn, lineno + 1)
+    return "%s:%d" % (fn, lineno + 1)
+
+
+def num_mock_patch_args(function) -> int:
+    """ return number of arguments used up by mock arguments (if any) """
+    patchings = getattr(function, "patchings", None)
+    if not patchings:
+        return 0
+
+    mock_sentinel = getattr(sys.modules.get("mock"), "DEFAULT", object())
+    ut_mock_sentinel = getattr(sys.modules.get("unittest.mock"), "DEFAULT", object())
+
+    return len(
+        [
+            p
+            for p in patchings
+            if not p.attribute_name
+            and (p.new is mock_sentinel or p.new is ut_mock_sentinel)
+        ]
+    )
+
+
+def getfuncargnames(
+    function: Callable[..., Any],
+    *,
+    name: str = "",
+    is_method: bool = False,
+    cls: Optional[type] = None
+) -> Tuple[str, ...]:
+    """Returns the names of a function's mandatory arguments.
+
+    This should return the names of all function arguments that:
+        * Aren't bound to an instance or type as in instance or class methods.
+        * Don't have default values.
+        * Aren't bound with functools.partial.
+        * Aren't replaced with mocks.
+
+    The is_method and cls arguments indicate that the function should
+    be treated as a bound method even though it's not unless, only in
+    the case of cls, the function is a static method.
+
+    The name parameter should be the original name in which the function was collected.
+    """
+    # TODO(RonnyPfannschmidt): This function should be refactored when we
+    # revisit fixtures. The fixture mechanism should ask the node for
+    # the fixture names, and not try to obtain directly from the
+    # function object well after collection has occurred.
+
+    # The parameters attribute of a Signature object contains an
+    # ordered mapping of parameter names to Parameter instances.  This
+    # creates a tuple of the names of the parameters that don't have
+    # defaults.
+    try:
+        parameters = signature(function).parameters
+    except (ValueError, TypeError) as e:
+        fail(
+            "Could not determine arguments of {!r}: {}".format(function, e),
+            pytrace=False,
+        )
+
+    arg_names = tuple(
+        p.name
+        for p in parameters.values()
+        if (
+            p.kind is Parameter.POSITIONAL_OR_KEYWORD
+            or p.kind is Parameter.KEYWORD_ONLY
+        )
+        and p.default is Parameter.empty
+    )
+    if not name:
+        name = function.__name__
+
+    # If this function should be treated as a bound method even though
+    # it's passed as an unbound method or function, remove the first
+    # parameter name.
+    if is_method or (
+        cls and not isinstance(cls.__dict__.get(name, None), staticmethod)
+    ):
+        arg_names = arg_names[1:]
+    # Remove any names that will be replaced with mocks.
+    if hasattr(function, "__wrapped__"):
+        arg_names = arg_names[num_mock_patch_args(function) :]
+    return arg_names
+
+
+if sys.version_info < (3, 7):
+
+    @contextmanager
+    def nullcontext():
+        yield
+
+
+else:
+    from contextlib import nullcontext  # noqa
+
+
+def get_default_arg_names(function: Callable[..., Any]) -> Tuple[str, ...]:
+    # Note: this code intentionally mirrors the code at the beginning of getfuncargnames,
+    # to get the arguments which were excluded from its result because they had default values
+    return tuple(
+        p.name
+        for p in signature(function).parameters.values()
+        if p.kind in (Parameter.POSITIONAL_OR_KEYWORD, Parameter.KEYWORD_ONLY)
+        and p.default is not Parameter.empty
+    )
+
+
+_non_printable_ascii_translate_table = {
+    i: "\\x{:02x}".format(i) for i in range(128) if i not in range(32, 127)
+}
+_non_printable_ascii_translate_table.update(
+    {ord("\t"): "\\t", ord("\r"): "\\r", ord("\n"): "\\n"}
+)
+
+
+def _translate_non_printable(s: str) -> str:
+    return s.translate(_non_printable_ascii_translate_table)
+
+
+STRING_TYPES = bytes, str
+
+
+def _bytes_to_ascii(val: bytes) -> str:
+    return val.decode("ascii", "backslashreplace")
+
+
+def ascii_escaped(val: Union[bytes, str]) -> str:
+    """If val is pure ascii, returns it as a str().  Otherwise, escapes
+    bytes objects into a sequence of escaped bytes:
+
+    b'\xc3\xb4\xc5\xd6' -> '\\xc3\\xb4\\xc5\\xd6'
+
+    and escapes unicode objects into a sequence of escaped unicode
+    ids, e.g.:
+
+    '4\\nV\\U00043efa\\x0eMXWB\\x1e\\u3028\\u15fd\\xcd\\U0007d944'
+
+    note:
+       the obvious "v.decode('unicode-escape')" will return
+       valid utf-8 unicode if it finds them in bytes, but we
+       want to return escaped bytes for any byte, even if they match
+       a utf-8 string.
+
+    """
+    if isinstance(val, bytes):
+        ret = _bytes_to_ascii(val)
+    else:
+        ret = val
+    return ret
+
+
+@attr.s
+class _PytestWrapper:
+    """Dummy wrapper around a function object for internal use only.
+
+    Used to correctly unwrap the underlying function object
+    when we are creating fixtures, because we wrap the function object ourselves with a decorator
+    to issue warnings when the fixture function is called directly.
+    """
+
+    obj = attr.ib()
+
+
+def get_real_func(obj):
+    """ gets the real function object of the (possibly) wrapped object by
+    functools.wraps or functools.partial.
+    """
+    start_obj = obj
+    for i in range(100):
+        # __pytest_wrapped__ is set by @pytest.fixture when wrapping the fixture function
+        # to trigger a warning if it gets called directly instead of by pytest: we don't
+        # want to unwrap further than this otherwise we lose useful wrappings like @mock.patch (#3774)
+        new_obj = getattr(obj, "__pytest_wrapped__", None)
+        if isinstance(new_obj, _PytestWrapper):
+            obj = new_obj.obj
+            break
+        new_obj = getattr(obj, "__wrapped__", None)
+        if new_obj is None:
+            break
+        obj = new_obj
+    else:
+        raise ValueError(
+            ("could not find real function of {start}\nstopped at {current}").format(
+                start=saferepr(start_obj), current=saferepr(obj)
+            )
+        )
+    if isinstance(obj, functools.partial):
+        obj = obj.func
+    return obj
+
+
+def get_real_method(obj, holder):
+    """
+    Attempts to obtain the real function object that might be wrapping ``obj``, while at the same time
+    returning a bound method to ``holder`` if the original object was a bound method.
+    """
+    try:
+        is_method = hasattr(obj, "__func__")
+        obj = get_real_func(obj)
+    except Exception:  # pragma: no cover
+        return obj
+    if is_method and hasattr(obj, "__get__") and callable(obj.__get__):
+        obj = obj.__get__(holder)
+    return obj
+
+
+def getimfunc(func):
+    try:
+        return func.__func__
+    except AttributeError:
+        return func
+
+
+def safe_getattr(object: Any, name: str, default: Any) -> Any:
+    """ Like getattr but return default upon any Exception or any OutcomeException.
+
+    Attribute access can potentially fail for 'evil' Python objects.
+    See issue #214.
+    It catches OutcomeException because of #2490 (issue #580), new outcomes are derived from BaseException
+    instead of Exception (for more details check #2707)
+    """
+    try:
+        return getattr(object, name, default)
+    except TEST_OUTCOME:
+        return default
+
+
+def safe_isclass(obj: object) -> bool:
+    """Ignore any exception via isinstance on Python 3."""
+    try:
+        return inspect.isclass(obj)
+    except Exception:
+        return False
+
+
+COLLECT_FAKEMODULE_ATTRIBUTES = (
+    "Collector",
+    "Module",
+    "Function",
+    "Instance",
+    "Session",
+    "Item",
+    "Class",
+    "File",
+    "_fillfuncargs",
+)
+
+
+def _setup_collect_fakemodule() -> None:
+    from types import ModuleType
+    import pytest
+
+    # Types ignored because the module is created dynamically.
+    pytest.collect = ModuleType("pytest.collect")  # type: ignore
+    pytest.collect.__all__ = []  # type: ignore  # used for setns
+    for attr_name in COLLECT_FAKEMODULE_ATTRIBUTES:
+        setattr(pytest.collect, attr_name, getattr(pytest, attr_name))  # type: ignore
+
+
+class CaptureIO(io.TextIOWrapper):
+    def __init__(self) -> None:
+        super().__init__(io.BytesIO(), encoding="UTF-8", newline="", write_through=True)
+
+    def getvalue(self) -> str:
+        assert isinstance(self.buffer, io.BytesIO)
+        return self.buffer.getvalue().decode("UTF-8")
+
+
+class CaptureAndPassthroughIO(CaptureIO):
+    def __init__(self, other: IO) -> None:
+        self._other = other
+        super().__init__()
+
+    def write(self, s) -> int:
+        super().write(s)
+        return self._other.write(s)
+
+
+if sys.version_info < (3, 5, 2):
+
+    def overload(f):  # noqa: F811
+        return f
+
+
+if getattr(attr, "__version_info__", ()) >= (19, 2):
+    ATTRS_EQ_FIELD = "eq"
+else:
+    ATTRS_EQ_FIELD = "cmp"
+
+
+if sys.version_info >= (3, 8):
+    from functools import cached_property
+else:
+
+    class cached_property(Generic[_S, _T]):
+        __slots__ = ("func", "__doc__")
+
+        def __init__(self, func: Callable[[_S], _T]) -> None:
+            self.func = func
+            self.__doc__ = func.__doc__
+
+        @overload
+        def __get__(
+            self, instance: None, owner: Optional["Type[_S]"] = ...
+        ) -> "cached_property[_S, _T]":
+            raise NotImplementedError()
+
+        @overload  # noqa: F811
+        def __get__(  # noqa: F811
+            self, instance: _S, owner: Optional["Type[_S]"] = ...
+        ) -> _T:
+            raise NotImplementedError()
+
+        def __get__(self, instance, owner=None):  # noqa: F811
+            if instance is None:
+                return self
+            value = instance.__dict__[self.func.__name__] = self.func(instance)
+            return value
diff --git a/contrib/python/pytest/py3/_pytest/config/__init__.py b/contrib/python/pytest/py3/_pytest/config/__init__.py
new file mode 100644
index 0000000000..e21b9f1e2b
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/config/__init__.py
@@ -0,0 +1,1232 @@
+""" command line options, ini-file and conftest.py processing. """
+import argparse
+import copy
+import enum
+import inspect
+import os
+import shlex
+import sys
+import types
+import warnings
+from functools import lru_cache
+from types import TracebackType
+from typing import Any
+from typing import Callable
+from typing import Dict
+from typing import List
+from typing import Optional
+from typing import Sequence
+from typing import Set
+from typing import Tuple
+from typing import Union
+
+import attr
+import py
+from packaging.version import Version
+from pluggy import HookimplMarker
+from pluggy import HookspecMarker
+from pluggy import PluginManager
+
+import _pytest._code
+import _pytest.deprecated
+import _pytest.hookspec  # the extension point definitions
+from .exceptions import PrintHelp
+from .exceptions import UsageError
+from .findpaths import determine_setup
+from .findpaths import exists
+from _pytest._code import ExceptionInfo
+from _pytest._code import filter_traceback
+from _pytest._io import TerminalWriter
+from _pytest.compat import importlib_metadata
+from _pytest.compat import TYPE_CHECKING
+from _pytest.outcomes import fail
+from _pytest.outcomes import Skipped
+from _pytest.pathlib import Path
+from _pytest.store import Store
+from _pytest.warning_types import PytestConfigWarning
+
+if TYPE_CHECKING:
+    from typing import Type
+
+    from .argparsing import Argument
+
+
+_PluggyPlugin = object
+"""A type to represent plugin objects.
+Plugins can be any namespace, so we can't narrow it down much, but we use an
+alias to make the intent clear.
+Ideally this type would be provided by pluggy itself."""
+
+
+hookimpl = HookimplMarker("pytest")
+hookspec = HookspecMarker("pytest")
+
+
+class ExitCode(enum.IntEnum):
+    """
+    .. versionadded:: 5.0
+
+    Encodes the valid exit codes by pytest.
+
+    Currently users and plugins may supply other exit codes as well.
+    """
+
+    #: tests passed
+    OK = 0
+    #: tests failed
+    TESTS_FAILED = 1
+    #: pytest was interrupted
+    INTERRUPTED = 2
+    #: an internal error got in the way
+    INTERNAL_ERROR = 3
+    #: pytest was misused
+    USAGE_ERROR = 4
+    #: pytest couldn't find tests
+    NO_TESTS_COLLECTED = 5
+
+
+class ConftestImportFailure(Exception):
+    def __init__(self, path, excinfo):
+        Exception.__init__(self, path, excinfo)
+        self.path = path
+        self.excinfo = excinfo  # type: Tuple[Type[Exception], Exception, TracebackType]
+
+
+def main(args=None, plugins=None) -> Union[int, ExitCode]:
+    """ return exit code, after performing an in-process test run.
+
+    :arg args: list of command line arguments.
+
+    :arg plugins: list of plugin objects to be auto-registered during
+                  initialization.
+    """
+    try:
+        try:
+            config = _prepareconfig(args, plugins)
+        except ConftestImportFailure as e:
+            exc_info = ExceptionInfo(e.excinfo)
+            tw = TerminalWriter(sys.stderr)
+            tw.line(
+                "ImportError while loading conftest '{e.path}'.".format(e=e), red=True
+            )
+            exc_info.traceback = exc_info.traceback.filter(filter_traceback)
+            exc_repr = (
+                exc_info.getrepr(style="short", chain=False)
+                if exc_info.traceback
+                else exc_info.exconly()
+            )
+            formatted_tb = str(exc_repr)
+            for line in formatted_tb.splitlines():
+                tw.line(line.rstrip(), red=True)
+            return ExitCode.USAGE_ERROR
+        else:
+            try:
+                ret = config.hook.pytest_cmdline_main(
+                    config=config
+                )  # type: Union[ExitCode, int]
+                try:
+                    return ExitCode(ret)
+                except ValueError:
+                    return ret
+            finally:
+                config._ensure_unconfigure()
+    except UsageError as e:
+        tw = TerminalWriter(sys.stderr)
+        for msg in e.args:
+            tw.line("ERROR: {}\n".format(msg), red=True)
+        return ExitCode.USAGE_ERROR
+
+
+class cmdline:  # compatibility namespace
+    main = staticmethod(main)
+
+
+def filename_arg(path, optname):
+    """ Argparse type validator for filename arguments.
+
+    :path: path of filename
+    :optname: name of the option
+    """
+    if os.path.isdir(path):
+        raise UsageError("{} must be a filename, given: {}".format(optname, path))
+    return path
+
+
+def directory_arg(path, optname):
+    """Argparse type validator for directory arguments.
+
+    :path: path of directory
+    :optname: name of the option
+    """
+    if not os.path.isdir(path):
+        raise UsageError("{} must be a directory, given: {}".format(optname, path))
+    return path
+
+
+# Plugins that cannot be disabled via "-p no:X" currently.
+essential_plugins = (
+    "mark",
+    "main",
+    "runner",
+    "fixtures",
+    "helpconfig",  # Provides -p.
+)
+
+default_plugins = essential_plugins + (
+    "python",
+    "terminal",
+    "debugging",
+    "unittest",
+    "capture",
+    "skipping",
+    "tmpdir",
+    "monkeypatch",
+    "recwarn",
+    "pastebin",
+    "nose",
+    "assertion",
+    "junitxml",
+    "resultlog",
+    "doctest",
+    "cacheprovider",
+    "freeze_support",
+    "setuponly",
+    "setupplan",
+    "stepwise",
+    "warnings",
+    "logging",
+    "reports",
+    "faulthandler",
+)
+
+builtin_plugins = set(default_plugins)
+builtin_plugins.add("pytester")
+
+
+def get_config(args=None, plugins=None):
+    # subsequent calls to main will create a fresh instance
+    pluginmanager = PytestPluginManager()
+    config = Config(
+        pluginmanager,
+        invocation_params=Config.InvocationParams(
+            args=args or (), plugins=plugins, dir=Path().resolve()
+        ),
+    )
+
+    if args is not None:
+        # Handle any "-p no:plugin" args.
+        pluginmanager.consider_preparse(args, exclude_only=True)
+
+    for spec in default_plugins:
+        pluginmanager.import_plugin(spec)
+    return config
+
+
+def get_plugin_manager():
+    """
+    Obtain a new instance of the
+    :py:class:`_pytest.config.PytestPluginManager`, with default plugins
+    already loaded.
+
+    This function can be used by integration with other tools, like hooking
+    into pytest to run tests into an IDE.
+    """
+    return get_config().pluginmanager
+
+
+def _prepareconfig(
+    args: Optional[Union[py.path.local, List[str]]] = None, plugins=None
+):
+    if args is None:
+        args = sys.argv[1:]
+    elif isinstance(args, py.path.local):
+        args = [str(args)]
+    elif not isinstance(args, list):
+        msg = "`args` parameter expected to be a list of strings, got: {!r} (type: {})"
+        raise TypeError(msg.format(args, type(args)))
+
+    config = get_config(args, plugins)
+    pluginmanager = config.pluginmanager
+    try:
+        if plugins:
+            for plugin in plugins:
+                if isinstance(plugin, str):
+                    pluginmanager.consider_pluginarg(plugin)
+                else:
+                    pluginmanager.register(plugin)
+        return pluginmanager.hook.pytest_cmdline_parse(
+            pluginmanager=pluginmanager, args=args
+        )
+    except BaseException:
+        config._ensure_unconfigure()
+        raise
+
+
+def _fail_on_non_top_pytest_plugins(conftestpath, confcutdir):
+    msg = (
+        "Defining 'pytest_plugins' in a non-top-level conftest is no longer supported:\n"
+        "It affects the entire test suite instead of just below the conftest as expected.\n"
+        "  {}\n"
+        "Please move it to a top level conftest file at the rootdir:\n"
+        "  {}\n"
+        "For more information, visit:\n"
+        "  https://docs.pytest.org/en/latest/deprecations.html#pytest-plugins-in-non-top-level-conftest-files"
+    )
+    fail(msg.format(conftestpath, confcutdir), pytrace=False)
+
+
+class PytestPluginManager(PluginManager):
+    """
+    Overwrites :py:class:`pluggy.PluginManager <pluggy.PluginManager>` to add pytest-specific
+    functionality:
+
+    * loading plugins from the command line, ``PYTEST_PLUGINS`` env variable and
+      ``pytest_plugins`` global variables found in plugins being loaded;
+    * ``conftest.py`` loading during start-up;
+    """
+
+    def __init__(self):
+        import _pytest.assertion
+
+        super().__init__("pytest")
+        # The objects are module objects, only used generically.
+        self._conftest_plugins = set()  # type: Set[object]
+
+        # state related to local conftest plugins
+        # Maps a py.path.local to a list of module objects.
+        self._dirpath2confmods = {}  # type: Dict[Any, List[object]]
+        # Maps a py.path.local to a module object.
+        self._conftestpath2mod = {}  # type: Dict[Any, object]
+        self._confcutdir = None
+        self._noconftest = False
+        # Set of py.path.local's.
+        self._duplicatepaths = set()  # type: Set[Any]
+
+        self.add_hookspecs(_pytest.hookspec)
+        self.register(self)
+        if os.environ.get("PYTEST_DEBUG"):
+            err = sys.stderr
+            encoding = getattr(err, "encoding", "utf8")
+            try:
+                err = py.io.dupfile(err, encoding=encoding)
+            except Exception:
+                pass
+            self.trace.root.setwriter(err.write)
+            self.enable_tracing()
+
+        # Config._consider_importhook will set a real object if required.
+        self.rewrite_hook = _pytest.assertion.DummyRewriteHook()
+        # Used to know when we are importing conftests after the pytest_configure stage
+        self._configured = False
+
+    def parse_hookimpl_opts(self, plugin, name):
+        # pytest hooks are always prefixed with pytest_
+        # so we avoid accessing possibly non-readable attributes
+        # (see issue #1073)
+        if not name.startswith("pytest_"):
+            return
+        # ignore names which can not be hooks
+        if name == "pytest_plugins":
+            return
+
+        method = getattr(plugin, name)
+        opts = super().parse_hookimpl_opts(plugin, name)
+
+        # consider only actual functions for hooks (#3775)
+        if not inspect.isroutine(method):
+            return
+
+        # collect unmarked hooks as long as they have the `pytest_' prefix
+        if opts is None and name.startswith("pytest_"):
+            opts = {}
+        if opts is not None:
+            # TODO: DeprecationWarning, people should use hookimpl
+            # https://github.com/pytest-dev/pytest/issues/4562
+            known_marks = {m.name for m in getattr(method, "pytestmark", [])}
+
+            for name in ("tryfirst", "trylast", "optionalhook", "hookwrapper"):
+                opts.setdefault(name, hasattr(method, name) or name in known_marks)
+        return opts
+
+    def parse_hookspec_opts(self, module_or_class, name):
+        opts = super().parse_hookspec_opts(module_or_class, name)
+        if opts is None:
+            method = getattr(module_or_class, name)
+
+            if name.startswith("pytest_"):
+                # todo: deprecate hookspec hacks
+                # https://github.com/pytest-dev/pytest/issues/4562
+                known_marks = {m.name for m in getattr(method, "pytestmark", [])}
+                opts = {
+                    "firstresult": hasattr(method, "firstresult")
+                    or "firstresult" in known_marks,
+                    "historic": hasattr(method, "historic")
+                    or "historic" in known_marks,
+                }
+        return opts
+
+    def register(self, plugin, name=None):
+        if name in _pytest.deprecated.DEPRECATED_EXTERNAL_PLUGINS:
+            warnings.warn(
+                PytestConfigWarning(
+                    "{} plugin has been merged into the core, "
+                    "please remove it from your requirements.".format(
+                        name.replace("_", "-")
+                    )
+                )
+            )
+            return
+        ret = super().register(plugin, name)
+        if ret:
+            self.hook.pytest_plugin_registered.call_historic(
+                kwargs=dict(plugin=plugin, manager=self)
+            )
+
+            if isinstance(plugin, types.ModuleType):
+                self.consider_module(plugin)
+        return ret
+
+    def getplugin(self, name):
+        # support deprecated naming because plugins (xdist e.g.) use it
+        return self.get_plugin(name)
+
+    def hasplugin(self, name):
+        """Return True if the plugin with the given name is registered."""
+        return bool(self.get_plugin(name))
+
+    def pytest_configure(self, config):
+        # XXX now that the pluginmanager exposes hookimpl(tryfirst...)
+        # we should remove tryfirst/trylast as markers
+        config.addinivalue_line(
+            "markers",
+            "tryfirst: mark a hook implementation function such that the "
+            "plugin machinery will try to call it first/as early as possible.",
+        )
+        config.addinivalue_line(
+            "markers",
+            "trylast: mark a hook implementation function such that the "
+            "plugin machinery will try to call it last/as late as possible.",
+        )
+        self._configured = True
+
+    #
+    # internal API for local conftest plugin handling
+    #
+    def _set_initial_conftests(self, namespace):
+        """ load initial conftest files given a preparsed "namespace".
+            As conftest files may add their own command line options
+            which have arguments ('--my-opt somepath') we might get some
+            false positives.  All builtin and 3rd party plugins will have
+            been loaded, however, so common options will not confuse our logic
+            here.
+        """
+        current = py.path.local()
+        self._confcutdir = (
+            current.join(namespace.confcutdir, abs=True)
+            if namespace.confcutdir
+            else None
+        )
+        self._noconftest = namespace.noconftest
+        self._using_pyargs = namespace.pyargs
+        testpaths = namespace.file_or_dir
+        foundanchor = False
+        for path in testpaths:
+            path = str(path)
+            # remove node-id syntax
+            i = path.find("::")
+            if i != -1:
+                path = path[:i]
+            anchor = current.join(path, abs=1)
+            if exists(anchor):  # we found some file object
+                self._try_load_conftest(anchor)
+                foundanchor = True
+        if not foundanchor:
+            self._try_load_conftest(current)
+
+    def _try_load_conftest(self, anchor):
+        self._getconftestmodules(anchor)
+        # let's also consider test* subdirs
+        if anchor.check(dir=1):
+            for x in anchor.listdir("test*"):
+                if x.check(dir=1):
+                    self._getconftestmodules(x)
+
+    @lru_cache(maxsize=128)
+    def _getconftestmodules(self, path):
+        if self._noconftest:
+            return []
+
+        if path.isfile():
+            directory = path.dirpath()
+        else:
+            directory = path
+
+        # XXX these days we may rather want to use config.rootdir
+        # and allow users to opt into looking into the rootdir parent
+        # directories instead of requiring to specify confcutdir
+        clist = []
+        for parent in directory.realpath().parts():
+            if self._confcutdir and self._confcutdir.relto(parent):
+                continue
+            conftestpath = parent.join("conftest.py")
+            if conftestpath.isfile():
+                mod = self._importconftest(conftestpath)
+                clist.append(mod)
+        self._dirpath2confmods[directory] = clist
+        return clist
+
+    def _rget_with_confmod(self, name, path):
+        modules = self._getconftestmodules(path)
+        for mod in reversed(modules):
+            try:
+                return mod, getattr(mod, name)
+            except AttributeError:
+                continue
+        raise KeyError(name)
+
+    def _importconftest(self, conftestpath):
+        # Use a resolved Path object as key to avoid loading the same conftest twice
+        # with build systems that create build directories containing
+        # symlinks to actual files.
+        # Using Path().resolve() is better than py.path.realpath because
+        # it resolves to the correct path/drive in case-insensitive file systems (#5792)
+        key = Path(str(conftestpath)).resolve()
+        try:
+            return self._conftestpath2mod[key]
+        except KeyError:
+            pkgpath = conftestpath.pypkgpath()
+            if pkgpath is None:
+                _ensure_removed_sysmodule(conftestpath.purebasename)
+            try:
+                mod = conftestpath.pyimport()
+                if (
+                    hasattr(mod, "pytest_plugins")
+                    and self._configured
+                    and not self._using_pyargs
+                ):
+                    _fail_on_non_top_pytest_plugins(conftestpath, self._confcutdir)
+            except Exception:
+                raise ConftestImportFailure(conftestpath, sys.exc_info())
+
+            self._conftest_plugins.add(mod)
+            self._conftestpath2mod[key] = mod
+            dirpath = conftestpath.dirpath()
+            if dirpath in self._dirpath2confmods:
+                for path, mods in self._dirpath2confmods.items():
+                    if path and path.relto(dirpath) or path == dirpath:
+                        assert mod not in mods
+                        mods.append(mod)
+            self.trace("loading conftestmodule {!r}".format(mod))
+            self.consider_conftest(mod)
+            return mod
+
+    #
+    # API for bootstrapping plugin loading
+    #
+    #
+
+    def consider_preparse(self, args, *, exclude_only=False):
+        i = 0
+        n = len(args)
+        while i < n:
+            opt = args[i]
+            i += 1
+            if isinstance(opt, str):
+                if opt == "-p":
+                    try:
+                        parg = args[i]
+                    except IndexError:
+                        return
+                    i += 1
+                elif opt.startswith("-p"):
+                    parg = opt[2:]
+                else:
+                    continue
+                if exclude_only and not parg.startswith("no:"):
+                    continue
+                self.consider_pluginarg(parg)
+
+    def consider_pluginarg(self, arg):
+        if arg.startswith("no:"):
+            name = arg[3:]
+            if name in essential_plugins:
+                raise UsageError("plugin %s cannot be disabled" % name)
+
+            # PR #4304 : remove stepwise if cacheprovider is blocked
+            if name == "cacheprovider":
+                self.set_blocked("stepwise")
+                self.set_blocked("pytest_stepwise")
+
+            self.set_blocked(name)
+            if not name.startswith("pytest_"):
+                self.set_blocked("pytest_" + name)
+        else:
+            name = arg
+            # Unblock the plugin.  None indicates that it has been blocked.
+            # There is no interface with pluggy for this.
+            if self._name2plugin.get(name, -1) is None:
+                del self._name2plugin[name]
+            if not name.startswith("pytest_"):
+                if self._name2plugin.get("pytest_" + name, -1) is None:
+                    del self._name2plugin["pytest_" + name]
+            self.import_plugin(arg, consider_entry_points=True)
+
+    def consider_conftest(self, conftestmodule):
+        self.register(conftestmodule, name=conftestmodule.__file__)
+
+    def consider_env(self):
+        self._import_plugin_specs(os.environ.get("PYTEST_PLUGINS"))
+
+    def consider_module(self, mod):
+        self._import_plugin_specs(getattr(mod, "pytest_plugins", []))
+
+    def _import_plugin_specs(self, spec):
+        plugins = _get_plugin_specs_as_list(spec)
+        for import_spec in plugins:
+            self.import_plugin(import_spec)
+
+    def import_plugin(self, modname, consider_entry_points=False):
+        """
+        Imports a plugin with ``modname``. If ``consider_entry_points`` is True, entry point
+        names are also considered to find a plugin.
+        """
+        # most often modname refers to builtin modules, e.g. "pytester",
+        # "terminal" or "capture".  Those plugins are registered under their
+        # basename for historic purposes but must be imported with the
+        # _pytest prefix.
+        assert isinstance(modname, str), (
+            "module name as text required, got %r" % modname
+        )
+        modname = str(modname)
+        if self.is_blocked(modname) or self.get_plugin(modname) is not None:
+            return
+
+        importspec = "_pytest." + modname if modname in builtin_plugins else modname
+        self.rewrite_hook.mark_rewrite(importspec)
+
+        if consider_entry_points:
+            loaded = self.load_setuptools_entrypoints("pytest11", name=modname)
+            if loaded:
+                return
+
+        try:
+            __import__(importspec)
+        except ImportError as e:
+            raise ImportError(
+                'Error importing plugin "{}": {}'.format(modname, str(e.args[0]))
+            ).with_traceback(e.__traceback__)
+
+        except Skipped as e:
+            from _pytest.warnings import _issue_warning_captured
+
+            _issue_warning_captured(
+                PytestConfigWarning("skipped plugin {!r}: {}".format(modname, e.msg)),
+                self.hook,
+                stacklevel=2,
+            )
+        else:
+            mod = sys.modules[importspec]
+            self.register(mod, modname)
+
+
+def _get_plugin_specs_as_list(specs):
+    """
+    Parses a list of "plugin specs" and returns a list of plugin names.
+
+    Plugin specs can be given as a list of strings separated by "," or already as a list/tuple in
+    which case it is returned as a list. Specs can also be `None` in which case an
+    empty list is returned.
+    """
+    if specs is not None and not isinstance(specs, types.ModuleType):
+        if isinstance(specs, str):
+            specs = specs.split(",") if specs else []
+        if not isinstance(specs, (list, tuple)):
+            raise UsageError(
+                "Plugin specs must be a ','-separated string or a "
+                "list/tuple of strings for plugin names. Given: %r" % specs
+            )
+        return list(specs)
+    return []
+
+
+def _ensure_removed_sysmodule(modname):
+    try:
+        del sys.modules[modname]
+    except KeyError:
+        pass
+
+
+class Notset:
+    def __repr__(self):
+        return "<NOTSET>"
+
+
+notset = Notset()
+
+
+def _iter_rewritable_modules(package_files):
+    """
+    Given an iterable of file names in a source distribution, return the "names" that should
+    be marked for assertion rewrite (for example the package "pytest_mock/__init__.py" should
+    be added as "pytest_mock" in the assertion rewrite mechanism.
+
+    This function has to deal with dist-info based distributions and egg based distributions
+    (which are still very much in use for "editable" installs).
+
+    Here are the file names as seen in a dist-info based distribution:
+
+        pytest_mock/__init__.py
+        pytest_mock/_version.py
+        pytest_mock/plugin.py
+        pytest_mock.egg-info/PKG-INFO
+
+    Here are the file names as seen in an egg based distribution:
+
+        src/pytest_mock/__init__.py
+        src/pytest_mock/_version.py
+        src/pytest_mock/plugin.py
+        src/pytest_mock.egg-info/PKG-INFO
+        LICENSE
+        setup.py
+
+    We have to take in account those two distribution flavors in order to determine which
+    names should be considered for assertion rewriting.
+
+    More information:
+        https://github.com/pytest-dev/pytest-mock/issues/167
+    """
+    package_files = list(package_files)
+    seen_some = False
+    for fn in package_files:
+        is_simple_module = "/" not in fn and fn.endswith(".py")
+        is_package = fn.count("/") == 1 and fn.endswith("__init__.py")
+        if is_simple_module:
+            module_name, _ = os.path.splitext(fn)
+            # we ignore "setup.py" at the root of the distribution
+            if module_name != "setup":
+                seen_some = True
+                yield module_name
+        elif is_package:
+            package_name = os.path.dirname(fn)
+            seen_some = True
+            yield package_name
+
+    if not seen_some:
+        # at this point we did not find any packages or modules suitable for assertion
+        # rewriting, so we try again by stripping the first path component (to account for
+        # "src" based source trees for example)
+        # this approach lets us have the common case continue to be fast, as egg-distributions
+        # are rarer
+        new_package_files = []
+        for fn in package_files:
+            parts = fn.split("/")
+            new_fn = "/".join(parts[1:])
+            if new_fn:
+                new_package_files.append(new_fn)
+        if new_package_files:
+            yield from _iter_rewritable_modules(new_package_files)
+
+
+class Config:
+    """
+    Access to configuration values, pluginmanager and plugin hooks.
+
+    :ivar PytestPluginManager pluginmanager: the plugin manager handles plugin registration and hook invocation.
+
+    :ivar argparse.Namespace option: access to command line option as attributes.
+
+    :ivar InvocationParams invocation_params:
+
+        Object containing the parameters regarding the ``pytest.main``
+        invocation.
+
+        Contains the following read-only attributes:
+
+        * ``args``: tuple of command-line arguments as passed to ``pytest.main()``.
+        * ``plugins``: list of extra plugins, might be None.
+        * ``dir``: directory where ``pytest.main()`` was invoked from.
+    """
+
+    @attr.s(frozen=True)
+    class InvocationParams:
+        """Holds parameters passed during ``pytest.main()``
+
+        .. versionadded:: 5.1
+
+        .. note::
+
+            Note that the environment variable ``PYTEST_ADDOPTS`` and the ``addopts``
+            ini option are handled by pytest, not being included in the ``args`` attribute.
+
+            Plugins accessing ``InvocationParams`` must be aware of that.
+        """
+
+        args = attr.ib(converter=tuple)
+        plugins = attr.ib()
+        dir = attr.ib(type=Path)
+
+    def __init__(self, pluginmanager, *, invocation_params=None) -> None:
+        from .argparsing import Parser, FILE_OR_DIR
+
+        if invocation_params is None:
+            invocation_params = self.InvocationParams(
+                args=(), plugins=None, dir=Path().resolve()
+            )
+
+        self.option = argparse.Namespace()
+        self.invocation_params = invocation_params
+
+        _a = FILE_OR_DIR
+        self._parser = Parser(
+            usage="%(prog)s [options] [{}] [{}] [...]".format(_a, _a),
+            processopt=self._processopt,
+        )
+        self.pluginmanager = pluginmanager
+        self.trace = self.pluginmanager.trace.root.get("config")
+        self.hook = self.pluginmanager.hook
+        self._inicache = {}  # type: Dict[str, Any]
+        self._override_ini = ()  # type: Sequence[str]
+        self._opt2dest = {}  # type: Dict[str, str]
+        self._cleanup = []  # type: List[Callable[[], None]]
+        # A place where plugins can store information on the config for their
+        # own use. Currently only intended for internal plugins.
+        self._store = Store()
+        self.pluginmanager.register(self, "pytestconfig")
+        self._configured = False
+        self.hook.pytest_addoption.call_historic(
+            kwargs=dict(parser=self._parser, pluginmanager=self.pluginmanager)
+        )
+
+        if TYPE_CHECKING:
+            from _pytest.cacheprovider import Cache
+
+            self.cache = None  # type: Optional[Cache]
+
+    @property
+    def invocation_dir(self):
+        """Backward compatibility"""
+        return py.path.local(str(self.invocation_params.dir))
+
+    def add_cleanup(self, func):
+        """ Add a function to be called when the config object gets out of
+        use (usually coninciding with pytest_unconfigure)."""
+        self._cleanup.append(func)
+
+    def _do_configure(self):
+        assert not self._configured
+        self._configured = True
+        with warnings.catch_warnings():
+            warnings.simplefilter("default")
+            self.hook.pytest_configure.call_historic(kwargs=dict(config=self))
+
+    def _ensure_unconfigure(self):
+        if self._configured:
+            self._configured = False
+            self.hook.pytest_unconfigure(config=self)
+            self.hook.pytest_configure._call_history = []
+        while self._cleanup:
+            fin = self._cleanup.pop()
+            fin()
+
+    def get_terminal_writer(self):
+        return self.pluginmanager.get_plugin("terminalreporter")._tw
+
+    def pytest_cmdline_parse(self, pluginmanager, args):
+        try:
+            self.parse(args)
+        except UsageError:
+
+            # Handle --version and --help here in a minimal fashion.
+            # This gets done via helpconfig normally, but its
+            # pytest_cmdline_main is not called in case of errors.
+            if getattr(self.option, "version", False) or "--version" in args:
+                from _pytest.helpconfig import showversion
+
+                showversion(self)
+            elif (
+                getattr(self.option, "help", False) or "--help" in args or "-h" in args
+            ):
+                self._parser._getparser().print_help()
+                sys.stdout.write(
+                    "\nNOTE: displaying only minimal help due to UsageError.\n\n"
+                )
+
+            raise
+
+        return self
+
+    def notify_exception(self, excinfo, option=None):
+        if option and getattr(option, "fulltrace", False):
+            style = "long"
+        else:
+            style = "native"
+        excrepr = excinfo.getrepr(
+            funcargs=True, showlocals=getattr(option, "showlocals", False), style=style
+        )
+        res = self.hook.pytest_internalerror(excrepr=excrepr, excinfo=excinfo)
+        if not any(res):
+            for line in str(excrepr).split("\n"):
+                sys.stderr.write("INTERNALERROR> %s\n" % line)
+                sys.stderr.flush()
+
+    def cwd_relative_nodeid(self, nodeid):
+        # nodeid's are relative to the rootpath, compute relative to cwd
+        if self.invocation_dir != self.rootdir:
+            fullpath = self.rootdir.join(nodeid)
+            nodeid = self.invocation_dir.bestrelpath(fullpath)
+        return nodeid
+
+    @classmethod
+    def fromdictargs(cls, option_dict, args):
+        """ constructor usable for subprocesses. """
+        config = get_config(args)
+        config.option.__dict__.update(option_dict)
+        config.parse(args, addopts=False)
+        for x in config.option.plugins:
+            config.pluginmanager.consider_pluginarg(x)
+        return config
+
+    def _processopt(self, opt: "Argument") -> None:
+        for name in opt._short_opts + opt._long_opts:
+            self._opt2dest[name] = opt.dest
+
+        if hasattr(opt, "default"):
+            if not hasattr(self.option, opt.dest):
+                setattr(self.option, opt.dest, opt.default)
+
+    @hookimpl(trylast=True)
+    def pytest_load_initial_conftests(self, early_config):
+        self.pluginmanager._set_initial_conftests(early_config.known_args_namespace)
+
+    def _initini(self, args: Sequence[str]) -> None:
+        ns, unknown_args = self._parser.parse_known_and_unknown_args(
+            args, namespace=copy.copy(self.option)
+        )
+        r = determine_setup(
+            ns.inifilename,
+            ns.file_or_dir + unknown_args,
+            rootdir_cmd_arg=ns.rootdir or None,
+            config=self,
+        )
+        self.rootdir, self.inifile, self.inicfg = r
+        self._parser.extra_info["rootdir"] = self.rootdir
+        self._parser.extra_info["inifile"] = self.inifile
+        self._parser.addini("addopts", "extra command line options", "args")
+        self._parser.addini("minversion", "minimally required pytest version")
+        self._override_ini = ns.override_ini or ()
+
+    def _consider_importhook(self, args: Sequence[str]) -> None:
+        """Install the PEP 302 import hook if using assertion rewriting.
+
+        Needs to parse the --assert=<mode> option from the commandline
+        and find all the installed plugins to mark them for rewriting
+        by the importhook.
+        """
+        ns, unknown_args = self._parser.parse_known_and_unknown_args(args)
+        mode = getattr(ns, "assertmode", "plain")
+        if mode == "rewrite":
+            import _pytest.assertion
+
+            try:
+                hook = _pytest.assertion.install_importhook(self)
+            except SystemError:
+                mode = "plain"
+            else:
+                self._mark_plugins_for_rewrite(hook)
+        _warn_about_missing_assertion(mode)
+
+    def _mark_plugins_for_rewrite(self, hook):
+        """
+        Given an importhook, mark for rewrite any top-level
+        modules or packages in the distribution package for
+        all pytest plugins.
+        """
+        self.pluginmanager.rewrite_hook = hook
+
+        if os.environ.get("PYTEST_DISABLE_PLUGIN_AUTOLOAD"):
+            # We don't autoload from setuptools entry points, no need to continue.
+            return
+
+        package_files = (
+            str(file)
+            for dist in importlib_metadata.distributions()
+            if any(ep.group == "pytest11" for ep in dist.entry_points)
+            for file in dist.files or []
+        )
+
+        for name in _iter_rewritable_modules(package_files):
+            hook.mark_rewrite(name)
+
+    def _validate_args(self, args: List[str], via: str) -> List[str]:
+        """Validate known args."""
+        self._parser._config_source_hint = via  # type: ignore
+        try:
+            self._parser.parse_known_and_unknown_args(
+                args, namespace=copy.copy(self.option)
+            )
+        finally:
+            del self._parser._config_source_hint  # type: ignore
+
+        return args
+
+    def _preparse(self, args: List[str], addopts: bool = True) -> None:
+        if addopts:
+            env_addopts = os.environ.get("PYTEST_ADDOPTS", "")
+            if len(env_addopts):
+                args[:] = (
+                    self._validate_args(shlex.split(env_addopts), "via PYTEST_ADDOPTS")
+                    + args
+                )
+        self._initini(args)
+        if addopts:
+            args[:] = (
+                self._validate_args(self.getini("addopts"), "via addopts config") + args
+            )
+
+        self._checkversion()
+        self._consider_importhook(args)
+        self.pluginmanager.consider_preparse(args, exclude_only=False)
+        if not os.environ.get("PYTEST_DISABLE_PLUGIN_AUTOLOAD"):
+            # Don't autoload from setuptools entry point. Only explicitly specified
+            # plugins are going to be loaded.
+            self.pluginmanager.load_setuptools_entrypoints("pytest11")
+        self.pluginmanager.consider_env()
+        self.known_args_namespace = ns = self._parser.parse_known_args(
+            args, namespace=copy.copy(self.option)
+        )
+        if self.known_args_namespace.confcutdir is None and self.inifile:
+            confcutdir = py.path.local(self.inifile).dirname
+            self.known_args_namespace.confcutdir = confcutdir
+        try:
+            self.hook.pytest_load_initial_conftests(
+                early_config=self, args=args, parser=self._parser
+            )
+        except ConftestImportFailure as e:
+            if ns.help or ns.version:
+                # we don't want to prevent --help/--version to work
+                # so just let is pass and print a warning at the end
+                from _pytest.warnings import _issue_warning_captured
+
+                _issue_warning_captured(
+                    PytestConfigWarning(
+                        "could not load initial conftests: {}".format(e.path)
+                    ),
+                    self.hook,
+                    stacklevel=2,
+                )
+            else:
+                raise
+
+    def _checkversion(self):
+        import pytest
+
+        minver = self.inicfg.get("minversion", None)
+        if minver:
+            if Version(minver) > Version(pytest.__version__):
+                raise pytest.UsageError(
+                    "%s:%d: requires pytest-%s, actual pytest-%s'"
+                    % (
+                        self.inicfg.config.path,
+                        self.inicfg.lineof("minversion"),
+                        minver,
+                        pytest.__version__,
+                    )
+                )
+
+    def parse(self, args: List[str], addopts: bool = True) -> None:
+        # parse given cmdline arguments into this config object.
+        assert not hasattr(
+            self, "args"
+        ), "can only parse cmdline args at most once per Config object"
+        self.hook.pytest_addhooks.call_historic(
+            kwargs=dict(pluginmanager=self.pluginmanager)
+        )
+        self._preparse(args, addopts=addopts)
+        # XXX deprecated hook:
+        self.hook.pytest_cmdline_preparse(config=self, args=args)
+        self._parser.after_preparse = True  # type: ignore
+        try:
+            args = self._parser.parse_setoption(
+                args, self.option, namespace=self.option
+            )
+            if not args:
+                if self.invocation_dir == self.rootdir:
+                    args = self.getini("testpaths")
+                if not args:
+                    args = [str(self.invocation_dir)]
+            self.args = args
+        except PrintHelp:
+            pass
+
+    def addinivalue_line(self, name, line):
+        """ add a line to an ini-file option. The option must have been
+        declared but might not yet be set in which case the line becomes the
+        the first line in its value. """
+        x = self.getini(name)
+        assert isinstance(x, list)
+        x.append(line)  # modifies the cached list inline
+
+    def getini(self, name: str):
+        """ return configuration value from an :ref:`ini file <inifiles>`. If the
+        specified name hasn't been registered through a prior
+        :py:func:`parser.addini <_pytest.config.argparsing.Parser.addini>`
+        call (usually from a plugin), a ValueError is raised. """
+        try:
+            return self._inicache[name]
+        except KeyError:
+            self._inicache[name] = val = self._getini(name)
+            return val
+
+    def _getini(self, name: str) -> Any:
+        try:
+            description, type, default = self._parser._inidict[name]
+        except KeyError:
+            raise ValueError("unknown configuration value: {!r}".format(name))
+        value = self._get_override_ini_value(name)
+        if value is None:
+            try:
+                value = self.inicfg[name]
+            except KeyError:
+                if default is not None:
+                    return default
+                if type is None:
+                    return ""
+                return []
+        if type == "pathlist":
+            dp = py.path.local(self.inicfg.config.path).dirpath()
+            values = []
+            for relpath in shlex.split(value):
+                values.append(dp.join(relpath, abs=True))
+            return values
+        elif type == "args":
+            return shlex.split(value)
+        elif type == "linelist":
+            return [t for t in map(lambda x: x.strip(), value.split("\n")) if t]
+        elif type == "bool":
+            return bool(_strtobool(value.strip()))
+        else:
+            assert type is None
+            return value
+
+    def _getconftest_pathlist(self, name, path):
+        try:
+            mod, relroots = self.pluginmanager._rget_with_confmod(name, path)
+        except KeyError:
+            return None
+        modpath = py.path.local(mod.__file__).dirpath()
+        values = []
+        for relroot in relroots:
+            if not isinstance(relroot, py.path.local):
+                relroot = relroot.replace("/", py.path.local.sep)
+                relroot = modpath.join(relroot, abs=True)
+            values.append(relroot)
+        return values
+
+    def _get_override_ini_value(self, name: str) -> Optional[str]:
+        value = None
+        # override_ini is a list of "ini=value" options
+        # always use the last item if multiple values are set for same ini-name,
+        # e.g. -o foo=bar1 -o foo=bar2 will set foo to bar2
+        for ini_config in self._override_ini:
+            try:
+                key, user_ini_value = ini_config.split("=", 1)
+            except ValueError:
+                raise UsageError(
+                    "-o/--override-ini expects option=value style (got: {!r}).".format(
+                        ini_config
+                    )
+                )
+            else:
+                if key == name:
+                    value = user_ini_value
+        return value
+
+    def getoption(self, name: str, default=notset, skip: bool = False):
+        """ return command line option value.
+
+        :arg name: name of the option.  You may also specify
+            the literal ``--OPT`` option instead of the "dest" option name.
+        :arg default: default value if no option of that name exists.
+        :arg skip: if True raise pytest.skip if option does not exists
+            or has a None value.
+        """
+        name = self._opt2dest.get(name, name)
+        try:
+            val = getattr(self.option, name)
+            if val is None and skip:
+                raise AttributeError(name)
+            return val
+        except AttributeError:
+            if default is not notset:
+                return default
+            if skip:
+                import pytest
+
+                pytest.skip("no {!r} option found".format(name))
+            raise ValueError("no option named {!r}".format(name))
+
+    def getvalue(self, name, path=None):
+        """ (deprecated, use getoption()) """
+        return self.getoption(name)
+
+    def getvalueorskip(self, name, path=None):
+        """ (deprecated, use getoption(skip=True)) """
+        return self.getoption(name, skip=True)
+
+
+def _assertion_supported():
+    try:
+        assert False
+    except AssertionError:
+        return True
+    else:
+        return False
+
+
+def _warn_about_missing_assertion(mode):
+    if not _assertion_supported():
+        if mode == "plain":
+            sys.stderr.write(
+                "WARNING: ASSERTIONS ARE NOT EXECUTED"
+                " and FAILING TESTS WILL PASS.  Are you"
+                " using python -O?"
+            )
+        else:
+            sys.stderr.write(
+                "WARNING: assertions not in test modules or"
+                " plugins will be ignored"
+                " because assert statements are not executed "
+                "by the underlying Python interpreter "
+                "(are you using python -O?)\n"
+            )
+
+
+def create_terminal_writer(config: Config, *args, **kwargs) -> TerminalWriter:
+    """Create a TerminalWriter instance configured according to the options
+    in the config object. Every code which requires a TerminalWriter object
+    and has access to a config object should use this function.
+    """
+    tw = TerminalWriter(*args, **kwargs)
+    if config.option.color == "yes":
+        tw.hasmarkup = True
+    if config.option.color == "no":
+        tw.hasmarkup = False
+    return tw
+
+
+def _strtobool(val):
+    """Convert a string representation of truth to true (1) or false (0).
+
+    True values are 'y', 'yes', 't', 'true', 'on', and '1'; false values
+    are 'n', 'no', 'f', 'false', 'off', and '0'.  Raises ValueError if
+    'val' is anything else.
+
+    .. note:: copied from distutils.util
+    """
+    val = val.lower()
+    if val in ("y", "yes", "t", "true", "on", "1"):
+        return 1
+    elif val in ("n", "no", "f", "false", "off", "0"):
+        return 0
+    else:
+        raise ValueError("invalid truth value {!r}".format(val))
diff --git a/contrib/python/pytest/py3/_pytest/config/argparsing.py b/contrib/python/pytest/py3/_pytest/config/argparsing.py
new file mode 100644
index 0000000000..140e04e972
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/config/argparsing.py
@@ -0,0 +1,510 @@
+import argparse
+import sys
+import warnings
+from gettext import gettext
+from typing import Any
+from typing import Callable
+from typing import cast
+from typing import Dict
+from typing import List
+from typing import Mapping
+from typing import Optional
+from typing import Sequence
+from typing import Tuple
+from typing import Union
+
+import py
+
+from _pytest.compat import TYPE_CHECKING
+from _pytest.config.exceptions import UsageError
+
+if TYPE_CHECKING:
+    from typing import NoReturn
+    from typing_extensions import Literal  # noqa: F401
+
+FILE_OR_DIR = "file_or_dir"
+
+
+class Parser:
+    """ Parser for command line arguments and ini-file values.
+
+    :ivar extra_info: dict of generic param -> value to display in case
+        there's an error processing the command line arguments.
+    """
+
+    prog = None  # type: Optional[str]
+
+    def __init__(
+        self,
+        usage: Optional[str] = None,
+        processopt: Optional[Callable[["Argument"], None]] = None,
+    ) -> None:
+        self._anonymous = OptionGroup("custom options", parser=self)
+        self._groups = []  # type: List[OptionGroup]
+        self._processopt = processopt
+        self._usage = usage
+        self._inidict = {}  # type: Dict[str, Tuple[str, Optional[str], Any]]
+        self._ininames = []  # type: List[str]
+        self.extra_info = {}  # type: Dict[str, Any]
+
+    def processoption(self, option: "Argument") -> None:
+        if self._processopt:
+            if option.dest:
+                self._processopt(option)
+
+    def getgroup(
+        self, name: str, description: str = "", after: Optional[str] = None
+    ) -> "OptionGroup":
+        """ get (or create) a named option Group.
+
+        :name: name of the option group.
+        :description: long description for --help output.
+        :after: name of other group, used for ordering --help output.
+
+        The returned group object has an ``addoption`` method with the same
+        signature as :py:func:`parser.addoption
+        <_pytest.config.argparsing.Parser.addoption>` but will be shown in the
+        respective group in the output of ``pytest. --help``.
+        """
+        for group in self._groups:
+            if group.name == name:
+                return group
+        group = OptionGroup(name, description, parser=self)
+        i = 0
+        for i, grp in enumerate(self._groups):
+            if grp.name == after:
+                break
+        self._groups.insert(i + 1, group)
+        return group
+
+    def addoption(self, *opts: str, **attrs: Any) -> None:
+        """ register a command line option.
+
+        :opts: option names, can be short or long options.
+        :attrs: same attributes which the ``add_argument()`` function of the
+           `argparse library
+           <https://docs.python.org/library/argparse.html>`_
+           accepts.
+
+        After command line parsing options are available on the pytest config
+        object via ``config.option.NAME`` where ``NAME`` is usually set
+        by passing a ``dest`` attribute, for example
+        ``addoption("--long", dest="NAME", ...)``.
+        """
+        self._anonymous.addoption(*opts, **attrs)
+
+    def parse(
+        self,
+        args: Sequence[Union[str, py.path.local]],
+        namespace: Optional[argparse.Namespace] = None,
+    ) -> argparse.Namespace:
+        from _pytest._argcomplete import try_argcomplete
+
+        self.optparser = self._getparser()
+        try_argcomplete(self.optparser)
+        strargs = [str(x) if isinstance(x, py.path.local) else x for x in args]
+        return self.optparser.parse_args(strargs, namespace=namespace)
+
+    def _getparser(self) -> "MyOptionParser":
+        from _pytest._argcomplete import filescompleter
+
+        optparser = MyOptionParser(self, self.extra_info, prog=self.prog)
+        groups = self._groups + [self._anonymous]
+        for group in groups:
+            if group.options:
+                desc = group.description or group.name
+                arggroup = optparser.add_argument_group(desc)
+                for option in group.options:
+                    n = option.names()
+                    a = option.attrs()
+                    arggroup.add_argument(*n, **a)
+        file_or_dir_arg = optparser.add_argument(FILE_OR_DIR, nargs="*")
+        # bash like autocompletion for dirs (appending '/')
+        # Type ignored because typeshed doesn't know about argcomplete.
+        file_or_dir_arg.completer = filescompleter  # type: ignore
+        return optparser
+
+    def parse_setoption(
+        self,
+        args: Sequence[Union[str, py.path.local]],
+        option: argparse.Namespace,
+        namespace: Optional[argparse.Namespace] = None,
+    ) -> List[str]:
+        parsedoption = self.parse(args, namespace=namespace)
+        for name, value in parsedoption.__dict__.items():
+            setattr(option, name, value)
+        return cast(List[str], getattr(parsedoption, FILE_OR_DIR))
+
+    def parse_known_args(
+        self,
+        args: Sequence[Union[str, py.path.local]],
+        namespace: Optional[argparse.Namespace] = None,
+    ) -> argparse.Namespace:
+        """parses and returns a namespace object with known arguments at this
+        point.
+        """
+        return self.parse_known_and_unknown_args(args, namespace=namespace)[0]
+
+    def parse_known_and_unknown_args(
+        self,
+        args: Sequence[Union[str, py.path.local]],
+        namespace: Optional[argparse.Namespace] = None,
+    ) -> Tuple[argparse.Namespace, List[str]]:
+        """parses and returns a namespace object with known arguments, and
+        the remaining arguments unknown at this point.
+        """
+        optparser = self._getparser()
+        strargs = [str(x) if isinstance(x, py.path.local) else x for x in args]
+        return optparser.parse_known_args(strargs, namespace=namespace)
+
+    def addini(
+        self,
+        name: str,
+        help: str,
+        type: Optional["Literal['pathlist', 'args', 'linelist', 'bool']"] = None,
+        default=None,
+    ) -> None:
+        """ register an ini-file option.
+
+        :name: name of the ini-variable
+        :type: type of the variable, can be ``pathlist``, ``args``, ``linelist``
+               or ``bool``.
+        :default: default value if no ini-file option exists but is queried.
+
+        The value of ini-variables can be retrieved via a call to
+        :py:func:`config.getini(name) <_pytest.config.Config.getini>`.
+        """
+        assert type in (None, "pathlist", "args", "linelist", "bool")
+        self._inidict[name] = (help, type, default)
+        self._ininames.append(name)
+
+
+class ArgumentError(Exception):
+    """
+    Raised if an Argument instance is created with invalid or
+    inconsistent arguments.
+    """
+
+    def __init__(self, msg: str, option: Union["Argument", str]) -> None:
+        self.msg = msg
+        self.option_id = str(option)
+
+    def __str__(self) -> str:
+        if self.option_id:
+            return "option {}: {}".format(self.option_id, self.msg)
+        else:
+            return self.msg
+
+
+class Argument:
+    """class that mimics the necessary behaviour of optparse.Option
+
+    it's currently a least effort implementation
+    and ignoring choices and integer prefixes
+    https://docs.python.org/3/library/optparse.html#optparse-standard-option-types
+    """
+
+    _typ_map = {"int": int, "string": str, "float": float, "complex": complex}
+
+    def __init__(self, *names: str, **attrs: Any) -> None:
+        """store parms in private vars for use in add_argument"""
+        self._attrs = attrs
+        self._short_opts = []  # type: List[str]
+        self._long_opts = []  # type: List[str]
+        if "%default" in (attrs.get("help") or ""):
+            warnings.warn(
+                'pytest now uses argparse. "%default" should be'
+                ' changed to "%(default)s" ',
+                DeprecationWarning,
+                stacklevel=3,
+            )
+        try:
+            typ = attrs["type"]
+        except KeyError:
+            pass
+        else:
+            # this might raise a keyerror as well, don't want to catch that
+            if isinstance(typ, str):
+                if typ == "choice":
+                    warnings.warn(
+                        "`type` argument to addoption() is the string %r."
+                        " For choices this is optional and can be omitted, "
+                        " but when supplied should be a type (for example `str` or `int`)."
+                        " (options: %s)" % (typ, names),
+                        DeprecationWarning,
+                        stacklevel=4,
+                    )
+                    # argparse expects a type here take it from
+                    # the type of the first element
+                    attrs["type"] = type(attrs["choices"][0])
+                else:
+                    warnings.warn(
+                        "`type` argument to addoption() is the string %r, "
+                        " but when supplied should be a type (for example `str` or `int`)."
+                        " (options: %s)" % (typ, names),
+                        DeprecationWarning,
+                        stacklevel=4,
+                    )
+                    attrs["type"] = Argument._typ_map[typ]
+                # used in test_parseopt -> test_parse_defaultgetter
+                self.type = attrs["type"]
+            else:
+                self.type = typ
+        try:
+            # attribute existence is tested in Config._processopt
+            self.default = attrs["default"]
+        except KeyError:
+            pass
+        self._set_opt_strings(names)
+        dest = attrs.get("dest")  # type: Optional[str]
+        if dest:
+            self.dest = dest
+        elif self._long_opts:
+            self.dest = self._long_opts[0][2:].replace("-", "_")
+        else:
+            try:
+                self.dest = self._short_opts[0][1:]
+            except IndexError:
+                self.dest = "???"  # Needed for the error repr.
+                raise ArgumentError("need a long or short option", self)
+
+    def names(self) -> List[str]:
+        return self._short_opts + self._long_opts
+
+    def attrs(self) -> Mapping[str, Any]:
+        # update any attributes set by processopt
+        attrs = "default dest help".split()
+        attrs.append(self.dest)
+        for attr in attrs:
+            try:
+                self._attrs[attr] = getattr(self, attr)
+            except AttributeError:
+                pass
+        if self._attrs.get("help"):
+            a = self._attrs["help"]
+            a = a.replace("%default", "%(default)s")
+            # a = a.replace('%prog', '%(prog)s')
+            self._attrs["help"] = a
+        return self._attrs
+
+    def _set_opt_strings(self, opts: Sequence[str]) -> None:
+        """directly from optparse
+
+        might not be necessary as this is passed to argparse later on"""
+        for opt in opts:
+            if len(opt) < 2:
+                raise ArgumentError(
+                    "invalid option string %r: "
+                    "must be at least two characters long" % opt,
+                    self,
+                )
+            elif len(opt) == 2:
+                if not (opt[0] == "-" and opt[1] != "-"):
+                    raise ArgumentError(
+                        "invalid short option string %r: "
+                        "must be of the form -x, (x any non-dash char)" % opt,
+                        self,
+                    )
+                self._short_opts.append(opt)
+            else:
+                if not (opt[0:2] == "--" and opt[2] != "-"):
+                    raise ArgumentError(
+                        "invalid long option string %r: "
+                        "must start with --, followed by non-dash" % opt,
+                        self,
+                    )
+                self._long_opts.append(opt)
+
+    def __repr__(self) -> str:
+        args = []  # type: List[str]
+        if self._short_opts:
+            args += ["_short_opts: " + repr(self._short_opts)]
+        if self._long_opts:
+            args += ["_long_opts: " + repr(self._long_opts)]
+        args += ["dest: " + repr(self.dest)]
+        if hasattr(self, "type"):
+            args += ["type: " + repr(self.type)]
+        if hasattr(self, "default"):
+            args += ["default: " + repr(self.default)]
+        return "Argument({})".format(", ".join(args))
+
+
+class OptionGroup:
+    def __init__(
+        self, name: str, description: str = "", parser: Optional[Parser] = None
+    ) -> None:
+        self.name = name
+        self.description = description
+        self.options = []  # type: List[Argument]
+        self.parser = parser
+
+    def addoption(self, *optnames: str, **attrs: Any) -> None:
+        """ add an option to this group.
+
+        if a shortened version of a long option is specified it will
+        be suppressed in the help. addoption('--twowords', '--two-words')
+        results in help showing '--two-words' only, but --twowords gets
+        accepted **and** the automatic destination is in args.twowords
+        """
+        conflict = set(optnames).intersection(
+            name for opt in self.options for name in opt.names()
+        )
+        if conflict:
+            raise ValueError("option names %s already added" % conflict)
+        option = Argument(*optnames, **attrs)
+        self._addoption_instance(option, shortupper=False)
+
+    def _addoption(self, *optnames: str, **attrs: Any) -> None:
+        option = Argument(*optnames, **attrs)
+        self._addoption_instance(option, shortupper=True)
+
+    def _addoption_instance(self, option: "Argument", shortupper: bool = False) -> None:
+        if not shortupper:
+            for opt in option._short_opts:
+                if opt[0] == "-" and opt[1].islower():
+                    raise ValueError("lowercase shortoptions reserved")
+        if self.parser:
+            self.parser.processoption(option)
+        self.options.append(option)
+
+
+class MyOptionParser(argparse.ArgumentParser):
+    def __init__(
+        self,
+        parser: Parser,
+        extra_info: Optional[Dict[str, Any]] = None,
+        prog: Optional[str] = None,
+    ) -> None:
+        self._parser = parser
+        argparse.ArgumentParser.__init__(
+            self,
+            prog=prog,
+            usage=parser._usage,
+            add_help=False,
+            formatter_class=DropShorterLongHelpFormatter,
+            allow_abbrev=False,
+        )
+        # extra_info is a dict of (param -> value) to display if there's
+        # an usage error to provide more contextual information to the user
+        self.extra_info = extra_info if extra_info else {}
+
+    def error(self, message: str) -> "NoReturn":
+        """Transform argparse error message into UsageError."""
+        msg = "{}: error: {}".format(self.prog, message)
+
+        if hasattr(self._parser, "_config_source_hint"):
+            # Type ignored because the attribute is set dynamically.
+            msg = "{} ({})".format(msg, self._parser._config_source_hint)  # type: ignore
+
+        raise UsageError(self.format_usage() + msg)
+
+    # Type ignored because typeshed has a very complex type in the superclass.
+    def parse_args(  # type: ignore
+        self,
+        args: Optional[Sequence[str]] = None,
+        namespace: Optional[argparse.Namespace] = None,
+    ) -> argparse.Namespace:
+        """allow splitting of positional arguments"""
+        parsed, unrecognized = self.parse_known_args(args, namespace)
+        if unrecognized:
+            for arg in unrecognized:
+                if arg and arg[0] == "-":
+                    lines = ["unrecognized arguments: %s" % (" ".join(unrecognized))]
+                    for k, v in sorted(self.extra_info.items()):
+                        lines.append("  {}: {}".format(k, v))
+                    self.error("\n".join(lines))
+            getattr(parsed, FILE_OR_DIR).extend(unrecognized)
+        return parsed
+
+    if sys.version_info[:2] < (3, 9):  # pragma: no cover
+        # Backport of https://github.com/python/cpython/pull/14316 so we can
+        # disable long --argument abbreviations without breaking short flags.
+        def _parse_optional(
+            self, arg_string: str
+        ) -> Optional[Tuple[Optional[argparse.Action], str, Optional[str]]]:
+            if not arg_string:
+                return None
+            if not arg_string[0] in self.prefix_chars:
+                return None
+            if arg_string in self._option_string_actions:
+                action = self._option_string_actions[arg_string]
+                return action, arg_string, None
+            if len(arg_string) == 1:
+                return None
+            if "=" in arg_string:
+                option_string, explicit_arg = arg_string.split("=", 1)
+                if option_string in self._option_string_actions:
+                    action = self._option_string_actions[option_string]
+                    return action, option_string, explicit_arg
+            if self.allow_abbrev or not arg_string.startswith("--"):
+                option_tuples = self._get_option_tuples(arg_string)
+                if len(option_tuples) > 1:
+                    msg = gettext(
+                        "ambiguous option: %(option)s could match %(matches)s"
+                    )
+                    options = ", ".join(option for _, option, _ in option_tuples)
+                    self.error(msg % {"option": arg_string, "matches": options})
+                elif len(option_tuples) == 1:
+                    (option_tuple,) = option_tuples
+                    return option_tuple
+            if self._negative_number_matcher.match(arg_string):
+                if not self._has_negative_number_optionals:
+                    return None
+            if " " in arg_string:
+                return None
+            return None, arg_string, None
+
+
+class DropShorterLongHelpFormatter(argparse.HelpFormatter):
+    """shorten help for long options that differ only in extra hyphens
+
+    - collapse **long** options that are the same except for extra hyphens
+    - shortcut if there are only two options and one of them is a short one
+    - cache result on action object as this is called at least 2 times
+    """
+
+    def __init__(self, *args: Any, **kwargs: Any) -> None:
+        """Use more accurate terminal width via pylib."""
+        if "width" not in kwargs:
+            kwargs["width"] = py.io.get_terminal_width()
+        super().__init__(*args, **kwargs)
+
+    def _format_action_invocation(self, action: argparse.Action) -> str:
+        orgstr = argparse.HelpFormatter._format_action_invocation(self, action)
+        if orgstr and orgstr[0] != "-":  # only optional arguments
+            return orgstr
+        res = getattr(
+            action, "_formatted_action_invocation", None
+        )  # type: Optional[str]
+        if res:
+            return res
+        options = orgstr.split(", ")
+        if len(options) == 2 and (len(options[0]) == 2 or len(options[1]) == 2):
+            # a shortcut for '-h, --help' or '--abc', '-a'
+            action._formatted_action_invocation = orgstr  # type: ignore
+            return orgstr
+        return_list = []
+        short_long = {}  # type: Dict[str, str]
+        for option in options:
+            if len(option) == 2 or option[2] == " ":
+                continue
+            if not option.startswith("--"):
+                raise ArgumentError(
+                    'long optional argument without "--": [%s]' % (option), option
+                )
+            xxoption = option[2:]
+            shortened = xxoption.replace("-", "")
+            if shortened not in short_long or len(short_long[shortened]) < len(
+                xxoption
+            ):
+                short_long[shortened] = xxoption
+        # now short_long has been filled out to the longest with dashes
+        # **and** we keep the right option ordering from add_argument
+        for option in options:
+            if len(option) == 2 or option[2] == " ":
+                return_list.append(option)
+            if option[2:] == short_long.get(option.replace("-", "")):
+                return_list.append(option.replace(" ", "=", 1))
+        formatted_action_invocation = ", ".join(return_list)
+        action._formatted_action_invocation = formatted_action_invocation  # type: ignore
+        return formatted_action_invocation
diff --git a/contrib/python/pytest/py3/_pytest/config/exceptions.py b/contrib/python/pytest/py3/_pytest/config/exceptions.py
new file mode 100644
index 0000000000..19fe5cb08e
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/config/exceptions.py
@@ -0,0 +1,9 @@
+class UsageError(Exception):
+    """ error in pytest usage or invocation"""
+
+
+class PrintHelp(Exception):
+    """Raised when pytest should print it's help to skip the rest of the
+    argument parsing and validation."""
+
+    pass
diff --git a/contrib/python/pytest/py3/_pytest/config/findpaths.py b/contrib/python/pytest/py3/_pytest/config/findpaths.py
new file mode 100644
index 0000000000..fb84160c1f
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/config/findpaths.py
@@ -0,0 +1,167 @@
+import os
+from typing import Any
+from typing import Iterable
+from typing import List
+from typing import Optional
+from typing import Tuple
+
+import py
+
+from .exceptions import UsageError
+from _pytest.compat import TYPE_CHECKING
+from _pytest.outcomes import fail
+
+if TYPE_CHECKING:
+    from . import Config  # noqa: F401
+
+
+def exists(path, ignore=EnvironmentError):
+    try:
+        return path.check()
+    except ignore:
+        return False
+
+
+def getcfg(args, config=None):
+    """
+    Search the list of arguments for a valid ini-file for pytest,
+    and return a tuple of (rootdir, inifile, cfg-dict).
+
+    note: config is optional and used only to issue warnings explicitly (#2891).
+    """
+    inibasenames = ["pytest.ini", "tox.ini", "setup.cfg"]
+    args = [x for x in args if not str(x).startswith("-")]
+    if not args:
+        args = [py.path.local()]
+    for arg in args:
+        arg = py.path.local(arg)
+        for base in arg.parts(reverse=True):
+            for inibasename in inibasenames:
+                p = base.join(inibasename)
+                if exists(p):
+                    try:
+                        iniconfig = py.iniconfig.IniConfig(p)
+                    except py.iniconfig.ParseError as exc:
+                        raise UsageError(str(exc))
+
+                    if (
+                        inibasename == "setup.cfg"
+                        and "tool:pytest" in iniconfig.sections
+                    ):
+                        return base, p, iniconfig["tool:pytest"]
+                    elif "pytest" in iniconfig.sections:
+                        if inibasename == "setup.cfg" and config is not None:
+
+                            fail(
+                                CFG_PYTEST_SECTION.format(filename=inibasename),
+                                pytrace=False,
+                            )
+                        return base, p, iniconfig["pytest"]
+                    elif inibasename == "pytest.ini":
+                        # allowed to be empty
+                        return base, p, {}
+    return None, None, None
+
+
+def get_common_ancestor(paths: Iterable[py.path.local]) -> py.path.local:
+    common_ancestor = None
+    for path in paths:
+        if not path.exists():
+            continue
+        if common_ancestor is None:
+            common_ancestor = path
+        else:
+            if path.relto(common_ancestor) or path == common_ancestor:
+                continue
+            elif common_ancestor.relto(path):
+                common_ancestor = path
+            else:
+                shared = path.common(common_ancestor)
+                if shared is not None:
+                    common_ancestor = shared
+    if common_ancestor is None:
+        common_ancestor = py.path.local()
+    elif common_ancestor.isfile():
+        common_ancestor = common_ancestor.dirpath()
+    return common_ancestor
+
+
+def get_dirs_from_args(args):
+    def is_option(x):
+        return str(x).startswith("-")
+
+    def get_file_part_from_node_id(x):
+        return str(x).split("::")[0]
+
+    def get_dir_from_path(path):
+        if path.isdir():
+            return path
+        return py.path.local(path.dirname)
+
+    # These look like paths but may not exist
+    possible_paths = (
+        py.path.local(get_file_part_from_node_id(arg))
+        for arg in args
+        if not is_option(arg)
+    )
+
+    return [get_dir_from_path(path) for path in possible_paths if path.exists()]
+
+
+CFG_PYTEST_SECTION = "[pytest] section in {filename} files is no longer supported, change to [tool:pytest] instead."
+
+
+def determine_setup(
+    inifile: Optional[str],
+    args: List[str],
+    rootdir_cmd_arg: Optional[str] = None,
+    config: Optional["Config"] = None,
+) -> Tuple[py.path.local, Optional[str], Any]:
+    dirs = get_dirs_from_args(args)
+    if inifile:
+        iniconfig = py.iniconfig.IniConfig(inifile)
+        is_cfg_file = str(inifile).endswith(".cfg")
+        sections = ["tool:pytest", "pytest"] if is_cfg_file else ["pytest"]
+        for section in sections:
+            try:
+                inicfg = iniconfig[
+                    section
+                ]  # type: Optional[py.iniconfig._SectionWrapper]
+                if is_cfg_file and section == "pytest" and config is not None:
+                    fail(
+                        CFG_PYTEST_SECTION.format(filename=str(inifile)), pytrace=False
+                    )
+                break
+            except KeyError:
+                inicfg = None
+        if rootdir_cmd_arg is None:
+            rootdir = get_common_ancestor(dirs)
+    else:
+        ancestor = get_common_ancestor(dirs)
+        rootdir, inifile, inicfg = getcfg([ancestor], config=config)
+        if rootdir is None and rootdir_cmd_arg is None:
+            for possible_rootdir in ancestor.parts(reverse=True):
+                if possible_rootdir.join("setup.py").exists():
+                    rootdir = possible_rootdir
+                    break
+            else:
+                if dirs != [ancestor]:
+                    rootdir, inifile, inicfg = getcfg(dirs, config=config)
+                if rootdir is None:
+                    if config is not None:
+                        cwd = config.invocation_dir
+                    else:
+                        cwd = py.path.local()
+                    rootdir = get_common_ancestor([cwd, ancestor])
+                    is_fs_root = os.path.splitdrive(str(rootdir))[1] == "/"
+                    if is_fs_root:
+                        rootdir = ancestor
+    if rootdir_cmd_arg:
+        rootdir = py.path.local(os.path.expandvars(rootdir_cmd_arg))
+        if not rootdir.isdir():
+            raise UsageError(
+                "Directory '{}' not found. Check your '--rootdir' option.".format(
+                    rootdir
+                )
+            )
+    return rootdir, inifile, inicfg or {}
diff --git a/contrib/python/pytest/py3/_pytest/debugging.py b/contrib/python/pytest/py3/_pytest/debugging.py
new file mode 100644
index 0000000000..07f212fa5e
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/debugging.py
@@ -0,0 +1,394 @@
+""" interactive debugging with PDB, the Python Debugger. """
+import argparse
+import functools
+import os
+import sys
+
+from _pytest import outcomes
+from _pytest.config import ConftestImportFailure
+from _pytest.config import hookimpl
+from _pytest.config.exceptions import UsageError
+
+
+def import_readline():
+    try:
+        import readline
+    except ImportError:
+        sys.path.append('/usr/lib/python2.7/lib-dynload')
+
+    try:
+        import readline
+    except ImportError as e:
+        print('can not import readline:', e)
+
+        import subprocess
+        try:
+            subprocess.check_call('stty icrnl'.split())
+        except OSError as e:
+            print('can not restore Enter, use Control+J:', e)
+
+
+def tty():
+    if os.isatty(1):
+        return
+
+    fd = os.open('/dev/tty', os.O_RDWR)
+    os.dup2(fd, 0)
+    os.dup2(fd, 1)
+    os.dup2(fd, 2)
+    os.close(fd)
+
+    old_sys_path = sys.path
+    sys.path = list(sys.path)
+    try:
+        import_readline()
+    finally:
+        sys.path = old_sys_path
+
+
+def _validate_usepdb_cls(value):
+    """Validate syntax of --pdbcls option."""
+    try:
+        modname, classname = value.split(":")
+    except ValueError:
+        raise argparse.ArgumentTypeError(
+            "{!r} is not in the format 'modname:classname'".format(value)
+        )
+    return (modname, classname)
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("general")
+    group._addoption(
+        "--pdb",
+        dest="usepdb",
+        action="store_true",
+        help="start the interactive Python debugger on errors or KeyboardInterrupt.",
+    )
+    group._addoption(
+        "--pdbcls",
+        dest="usepdb_cls",
+        metavar="modulename:classname",
+        type=_validate_usepdb_cls,
+        help="start a custom interactive Python debugger on errors. "
+        "For example: --pdbcls=IPython.terminal.debugger:TerminalPdb",
+    )
+    group._addoption(
+        "--trace",
+        dest="trace",
+        action="store_true",
+        help="Immediately break when running each test.",
+    )
+
+
+def pytest_configure(config):
+    import pdb
+
+    if config.getvalue("trace"):
+        config.pluginmanager.register(PdbTrace(), "pdbtrace")
+    if config.getvalue("usepdb"):
+        config.pluginmanager.register(PdbInvoke(), "pdbinvoke")
+
+    pytestPDB._saved.append(
+        (pdb.set_trace, pytestPDB._pluginmanager, pytestPDB._config)
+    )
+    pdb.set_trace = pytestPDB.set_trace
+    pytestPDB._pluginmanager = config.pluginmanager
+    pytestPDB._config = config
+
+    # NOTE: not using pytest_unconfigure, since it might get called although
+    #       pytest_configure was not (if another plugin raises UsageError).
+    def fin():
+        (
+            pdb.set_trace,
+            pytestPDB._pluginmanager,
+            pytestPDB._config,
+        ) = pytestPDB._saved.pop()
+
+    config._cleanup.append(fin)
+
+
+class pytestPDB:
+    """ Pseudo PDB that defers to the real pdb. """
+
+    _pluginmanager = None
+    _config = None
+    _saved = []  # type: list
+    _recursive_debug = 0
+    _wrapped_pdb_cls = None
+
+    @classmethod
+    def _is_capturing(cls, capman):
+        if capman:
+            return capman.is_capturing()
+        return False
+
+    @classmethod
+    def _import_pdb_cls(cls, capman):
+        if not cls._config:
+            import pdb
+
+            # Happens when using pytest.set_trace outside of a test.
+            return pdb.Pdb
+
+        usepdb_cls = cls._config.getvalue("usepdb_cls")
+
+        if cls._wrapped_pdb_cls and cls._wrapped_pdb_cls[0] == usepdb_cls:
+            return cls._wrapped_pdb_cls[1]
+
+        if usepdb_cls:
+            modname, classname = usepdb_cls
+
+            try:
+                __import__(modname)
+                mod = sys.modules[modname]
+
+                # Handle --pdbcls=pdb:pdb.Pdb (useful e.g. with pdbpp).
+                parts = classname.split(".")
+                pdb_cls = getattr(mod, parts[0])
+                for part in parts[1:]:
+                    pdb_cls = getattr(pdb_cls, part)
+            except Exception as exc:
+                value = ":".join((modname, classname))
+                raise UsageError(
+                    "--pdbcls: could not import {!r}: {}".format(value, exc)
+                )
+        else:
+            import pdb
+
+            pdb_cls = pdb.Pdb
+
+        wrapped_cls = cls._get_pdb_wrapper_class(pdb_cls, capman)
+        cls._wrapped_pdb_cls = (usepdb_cls, wrapped_cls)
+        return wrapped_cls
+
+    @classmethod
+    def _get_pdb_wrapper_class(cls, pdb_cls, capman):
+        import _pytest.config
+
+        class PytestPdbWrapper(pdb_cls):
+            _pytest_capman = capman
+            _continued = False
+
+            def do_debug(self, arg):
+                cls._recursive_debug += 1
+                ret = super().do_debug(arg)
+                cls._recursive_debug -= 1
+                return ret
+
+            def do_continue(self, arg):
+                ret = super().do_continue(arg)
+                if cls._recursive_debug == 0:
+                    tw = _pytest.config.create_terminal_writer(cls._config)
+                    tw.line()
+
+                    capman = self._pytest_capman
+                    capturing = pytestPDB._is_capturing(capman)
+                    if capturing:
+                        if capturing == "global":
+                            tw.sep(">", "PDB continue (IO-capturing resumed)")
+                        else:
+                            tw.sep(
+                                ">",
+                                "PDB continue (IO-capturing resumed for %s)"
+                                % capturing,
+                            )
+                        capman.resume()
+                    else:
+                        tw.sep(">", "PDB continue")
+                cls._pluginmanager.hook.pytest_leave_pdb(config=cls._config, pdb=self)
+                self._continued = True
+                return ret
+
+            do_c = do_cont = do_continue
+
+            def do_quit(self, arg):
+                """Raise Exit outcome when quit command is used in pdb.
+
+                This is a bit of a hack - it would be better if BdbQuit
+                could be handled, but this would require to wrap the
+                whole pytest run, and adjust the report etc.
+                """
+                ret = super().do_quit(arg)
+
+                if cls._recursive_debug == 0:
+                    outcomes.exit("Quitting debugger")
+
+                return ret
+
+            do_q = do_quit
+            do_exit = do_quit
+
+            def setup(self, f, tb):
+                """Suspend on setup().
+
+                Needed after do_continue resumed, and entering another
+                breakpoint again.
+                """
+                ret = super().setup(f, tb)
+                if not ret and self._continued:
+                    # pdb.setup() returns True if the command wants to exit
+                    # from the interaction: do not suspend capturing then.
+                    if self._pytest_capman:
+                        self._pytest_capman.suspend_global_capture(in_=True)
+                return ret
+
+            def get_stack(self, f, t):
+                stack, i = super().get_stack(f, t)
+                if f is None:
+                    # Find last non-hidden frame.
+                    i = max(0, len(stack) - 1)
+                    while i and stack[i][0].f_locals.get("__tracebackhide__", False):
+                        i -= 1
+                return stack, i
+
+        return PytestPdbWrapper
+
+    @classmethod
+    def _init_pdb(cls, method, *args, **kwargs):
+        """ Initialize PDB debugging, dropping any IO capturing. """
+        import _pytest.config
+
+        if cls._pluginmanager is not None:
+            capman = cls._pluginmanager.getplugin("capturemanager")
+        else:
+            capman = None
+        if capman:
+            capman.suspend(in_=True)
+
+        if cls._config:
+            tw = _pytest.config.create_terminal_writer(cls._config)
+            tw.line()
+
+            if cls._recursive_debug == 0:
+                # Handle header similar to pdb.set_trace in py37+.
+                header = kwargs.pop("header", None)
+                if header is not None:
+                    tw.sep(">", header)
+                else:
+                    capturing = cls._is_capturing(capman)
+                    if capturing == "global":
+                        tw.sep(">", "PDB {} (IO-capturing turned off)".format(method))
+                    elif capturing:
+                        tw.sep(
+                            ">",
+                            "PDB %s (IO-capturing turned off for %s)"
+                            % (method, capturing),
+                        )
+                    else:
+                        tw.sep(">", "PDB {}".format(method))
+
+        _pdb = cls._import_pdb_cls(capman)(**kwargs)
+
+        if cls._pluginmanager:
+            cls._pluginmanager.hook.pytest_enter_pdb(config=cls._config, pdb=_pdb)
+        return _pdb
+
+    @classmethod
+    def set_trace(cls, *args, **kwargs):
+        """Invoke debugging via ``Pdb.set_trace``, dropping any IO capturing."""
+        tty()
+        frame = sys._getframe().f_back
+        _pdb = cls._init_pdb("set_trace", *args, **kwargs)
+        _pdb.set_trace(frame)
+
+
+class PdbInvoke:
+    def pytest_exception_interact(self, node, call, report):
+        capman = node.config.pluginmanager.getplugin("capturemanager")
+        if capman:
+            capman.suspend_global_capture(in_=True)
+            out, err = capman.read_global_capture()
+            sys.stdout.write(out)
+            sys.stdout.write(err)
+        tty()
+        _enter_pdb(node, call.excinfo, report)
+
+    def pytest_internalerror(self, excrepr, excinfo):
+        tb = _postmortem_traceback(excinfo)
+        post_mortem(tb)
+
+
+class PdbTrace:
+    @hookimpl(hookwrapper=True)
+    def pytest_pyfunc_call(self, pyfuncitem):
+        wrap_pytest_function_for_tracing(pyfuncitem)
+        yield
+
+
+def wrap_pytest_function_for_tracing(pyfuncitem):
+    """Changes the python function object of the given Function item by a wrapper which actually
+    enters pdb before calling the python function itself, effectively leaving the user
+    in the pdb prompt in the first statement of the function.
+    """
+    _pdb = pytestPDB._init_pdb("runcall")
+    testfunction = pyfuncitem.obj
+
+    # we can't just return `partial(pdb.runcall, testfunction)` because (on
+    # python < 3.7.4) runcall's first param is `func`, which means we'd get
+    # an exception if one of the kwargs to testfunction was called `func`
+    @functools.wraps(testfunction)
+    def wrapper(*args, **kwargs):
+        func = functools.partial(testfunction, *args, **kwargs)
+        _pdb.runcall(func)
+
+    pyfuncitem.obj = wrapper
+
+
+def maybe_wrap_pytest_function_for_tracing(pyfuncitem):
+    """Wrap the given pytestfunct item for tracing support if --trace was given in
+    the command line"""
+    if pyfuncitem.config.getvalue("trace"):
+        wrap_pytest_function_for_tracing(pyfuncitem)
+
+
+def _enter_pdb(node, excinfo, rep):
+    # XXX we re-use the TerminalReporter's terminalwriter
+    # because this seems to avoid some encoding related troubles
+    # for not completely clear reasons.
+    tw = node.config.pluginmanager.getplugin("terminalreporter")._tw
+    tw.line()
+
+    showcapture = node.config.option.showcapture
+
+    for sectionname, content in (
+        ("stdout", rep.capstdout),
+        ("stderr", rep.capstderr),
+        ("log", rep.caplog),
+    ):
+        if showcapture in (sectionname, "all") and content:
+            tw.sep(">", "captured " + sectionname)
+            if content[-1:] == "\n":
+                content = content[:-1]
+            tw.line(content)
+
+    tw.sep(">", "traceback")
+    rep.toterminal(tw)
+    tw.sep(">", "entering PDB")
+    tb = _postmortem_traceback(excinfo)
+    rep._pdbshown = True
+    post_mortem(tb)
+    return rep
+
+
+def _postmortem_traceback(excinfo):
+    from doctest import UnexpectedException
+
+    if isinstance(excinfo.value, UnexpectedException):
+        # A doctest.UnexpectedException is not useful for post_mortem.
+        # Use the underlying exception instead:
+        return excinfo.value.exc_info[2]
+    elif isinstance(excinfo.value, ConftestImportFailure):
+        # A config.ConftestImportFailure is not useful for post_mortem.
+        # Use the underlying exception instead:
+        return excinfo.value.excinfo[2]
+    else:
+        return excinfo._excinfo[2]
+
+
+def post_mortem(t):
+    p = pytestPDB._init_pdb("post_mortem")
+    p.reset()
+    p.interaction(None, t)
+    if p.quitting:
+        outcomes.exit("Quitting debugger")
diff --git a/contrib/python/pytest/py3/_pytest/deprecated.py b/contrib/python/pytest/py3/_pytest/deprecated.py
new file mode 100644
index 0000000000..b11093910a
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/deprecated.py
@@ -0,0 +1,62 @@
+"""
+This module contains deprecation messages and bits of code used elsewhere in the codebase
+that is planned to be removed in the next pytest release.
+
+Keeping it in a central location makes it easy to track what is deprecated and should
+be removed when the time comes.
+
+All constants defined in this module should be either PytestWarning instances or UnformattedWarning
+in case of warnings which need to format their messages.
+"""
+from _pytest.warning_types import PytestDeprecationWarning
+from _pytest.warning_types import UnformattedWarning
+
+# set of plugins which have been integrated into the core; we use this list to ignore
+# them during registration to avoid conflicts
+DEPRECATED_EXTERNAL_PLUGINS = {
+    "pytest_catchlog",
+    "pytest_capturelog",
+    "pytest_faulthandler",
+}
+
+FUNCARGNAMES = PytestDeprecationWarning(
+    "The `funcargnames` attribute was an alias for `fixturenames`, "
+    "since pytest 2.3 - use the newer attribute instead."
+)
+
+RESULT_LOG = PytestDeprecationWarning(
+    "--result-log is deprecated, please try the new pytest-reportlog plugin.\n"
+    "See https://docs.pytest.org/en/latest/deprecations.html#result-log-result-log for more information."
+)
+
+FIXTURE_POSITIONAL_ARGUMENTS = PytestDeprecationWarning(
+    "Passing arguments to pytest.fixture() as positional arguments is deprecated - pass them "
+    "as a keyword argument instead."
+)
+
+NODE_USE_FROM_PARENT = UnformattedWarning(
+    PytestDeprecationWarning,
+    "direct construction of {name} has been deprecated, please use {name}.from_parent",
+)
+
+JUNIT_XML_DEFAULT_FAMILY = PytestDeprecationWarning(
+    "The 'junit_family' default value will change to 'xunit2' in pytest 6.0.\n"
+    "Add 'junit_family=xunit1' to your pytest.ini file to keep the current format "
+    "in future versions of pytest and silence this warning."
+)
+
+NO_PRINT_LOGS = PytestDeprecationWarning(
+    "--no-print-logs is deprecated and scheduled for removal in pytest 6.0.\n"
+    "Please use --show-capture instead."
+)
+
+COLLECT_DIRECTORY_HOOK = PytestDeprecationWarning(
+    "The pytest_collect_directory hook is not working.\n"
+    "Please use collect_ignore in conftests or pytest_collection_modifyitems."
+)
+
+
+TERMINALWRITER_WRITER = PytestDeprecationWarning(
+    "The TerminalReporter.writer attribute is deprecated, use TerminalReporter._tw instead at your own risk.\n"
+    "See https://docs.pytest.org/en/latest/deprecations.html#terminalreporter-writer for more information."
+)
diff --git a/contrib/python/pytest/py3/_pytest/doctest.py b/contrib/python/pytest/py3/_pytest/doctest.py
new file mode 100644
index 0000000000..e1dd9691cc
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/doctest.py
@@ -0,0 +1,686 @@
+""" discover and run doctests in modules and test files."""
+import bdb
+import inspect
+import platform
+import sys
+import traceback
+import warnings
+from contextlib import contextmanager
+from typing import Dict
+from typing import List
+from typing import Optional
+from typing import Sequence
+from typing import Tuple
+from typing import Union
+
+import py.path
+
+import pytest
+from _pytest import outcomes
+from _pytest._code.code import ExceptionInfo
+from _pytest._code.code import ReprFileLocation
+from _pytest._code.code import TerminalRepr
+from _pytest._io import TerminalWriter
+from _pytest.compat import safe_getattr
+from _pytest.compat import TYPE_CHECKING
+from _pytest.fixtures import FixtureRequest
+from _pytest.outcomes import OutcomeException
+from _pytest.python_api import approx
+from _pytest.warning_types import PytestWarning
+
+if TYPE_CHECKING:
+    import doctest
+    from typing import Type
+
+DOCTEST_REPORT_CHOICE_NONE = "none"
+DOCTEST_REPORT_CHOICE_CDIFF = "cdiff"
+DOCTEST_REPORT_CHOICE_NDIFF = "ndiff"
+DOCTEST_REPORT_CHOICE_UDIFF = "udiff"
+DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE = "only_first_failure"
+
+DOCTEST_REPORT_CHOICES = (
+    DOCTEST_REPORT_CHOICE_NONE,
+    DOCTEST_REPORT_CHOICE_CDIFF,
+    DOCTEST_REPORT_CHOICE_NDIFF,
+    DOCTEST_REPORT_CHOICE_UDIFF,
+    DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE,
+)
+
+# Lazy definition of runner class
+RUNNER_CLASS = None
+# Lazy definition of output checker class
+CHECKER_CLASS = None  # type: Optional[Type[doctest.OutputChecker]]
+
+
+def pytest_addoption(parser):
+    parser.addini(
+        "doctest_optionflags",
+        "option flags for doctests",
+        type="args",
+        default=["ELLIPSIS"],
+    )
+    parser.addini(
+        "doctest_encoding", "encoding used for doctest files", default="utf-8"
+    )
+    group = parser.getgroup("collect")
+    group.addoption(
+        "--doctest-modules",
+        action="store_true",
+        default=False,
+        help="run doctests in all .py modules",
+        dest="doctestmodules",
+    )
+    group.addoption(
+        "--doctest-report",
+        type=str.lower,
+        default="udiff",
+        help="choose another output format for diffs on doctest failure",
+        choices=DOCTEST_REPORT_CHOICES,
+        dest="doctestreport",
+    )
+    group.addoption(
+        "--doctest-glob",
+        action="append",
+        default=[],
+        metavar="pat",
+        help="doctests file matching pattern, default: test*.txt",
+        dest="doctestglob",
+    )
+    group.addoption(
+        "--doctest-ignore-import-errors",
+        action="store_true",
+        default=False,
+        help="ignore doctest ImportErrors",
+        dest="doctest_ignore_import_errors",
+    )
+    group.addoption(
+        "--doctest-continue-on-failure",
+        action="store_true",
+        default=False,
+        help="for a given doctest, continue to run after the first failure",
+        dest="doctest_continue_on_failure",
+    )
+
+
+def pytest_unconfigure():
+    global RUNNER_CLASS
+
+    RUNNER_CLASS = None
+
+
+def pytest_collect_file(path: py.path.local, parent):
+    config = parent.config
+    if path.ext == ".py":
+        if config.option.doctestmodules and not _is_setup_py(path):
+            return DoctestModule.from_parent(parent, fspath=path)
+    elif _is_doctest(config, path, parent):
+        return DoctestTextfile.from_parent(parent, fspath=path)
+
+
+def _is_setup_py(path: py.path.local) -> bool:
+    if path.basename != "setup.py":
+        return False
+    contents = path.read_binary()
+    return b"setuptools" in contents or b"distutils" in contents
+
+
+def _is_doctest(config, path, parent):
+    if path.ext in (".txt", ".rst") and parent.session.isinitpath(path):
+        return True
+    globs = config.getoption("doctestglob") or ["test*.txt"]
+    for glob in globs:
+        if path.check(fnmatch=glob):
+            return True
+    return False
+
+
+class ReprFailDoctest(TerminalRepr):
+    def __init__(
+        self, reprlocation_lines: Sequence[Tuple[ReprFileLocation, Sequence[str]]]
+    ):
+        self.reprlocation_lines = reprlocation_lines
+
+    def toterminal(self, tw: TerminalWriter) -> None:
+        for reprlocation, lines in self.reprlocation_lines:
+            for line in lines:
+                tw.line(line)
+            reprlocation.toterminal(tw)
+
+
+class MultipleDoctestFailures(Exception):
+    def __init__(self, failures):
+        super().__init__()
+        self.failures = failures
+
+
+def _init_runner_class() -> "Type[doctest.DocTestRunner]":
+    import doctest
+
+    class PytestDoctestRunner(doctest.DebugRunner):
+        """
+        Runner to collect failures.  Note that the out variable in this case is
+        a list instead of a stdout-like object
+        """
+
+        def __init__(
+            self, checker=None, verbose=None, optionflags=0, continue_on_failure=True
+        ):
+            doctest.DebugRunner.__init__(
+                self, checker=checker, verbose=verbose, optionflags=optionflags
+            )
+            self.continue_on_failure = continue_on_failure
+
+        def report_failure(self, out, test, example, got):
+            failure = doctest.DocTestFailure(test, example, got)
+            if self.continue_on_failure:
+                out.append(failure)
+            else:
+                raise failure
+
+        def report_unexpected_exception(self, out, test, example, exc_info):
+            if isinstance(exc_info[1], OutcomeException):
+                raise exc_info[1]
+            if isinstance(exc_info[1], bdb.BdbQuit):
+                outcomes.exit("Quitting debugger")
+            failure = doctest.UnexpectedException(test, example, exc_info)
+            if self.continue_on_failure:
+                out.append(failure)
+            else:
+                raise failure
+
+    return PytestDoctestRunner
+
+
+def _get_runner(
+    checker: Optional["doctest.OutputChecker"] = None,
+    verbose: Optional[bool] = None,
+    optionflags: int = 0,
+    continue_on_failure: bool = True,
+) -> "doctest.DocTestRunner":
+    # We need this in order to do a lazy import on doctest
+    global RUNNER_CLASS
+    if RUNNER_CLASS is None:
+        RUNNER_CLASS = _init_runner_class()
+    # Type ignored because the continue_on_failure argument is only defined on
+    # PytestDoctestRunner, which is lazily defined so can't be used as a type.
+    return RUNNER_CLASS(  # type: ignore
+        checker=checker,
+        verbose=verbose,
+        optionflags=optionflags,
+        continue_on_failure=continue_on_failure,
+    )
+
+
+class DoctestItem(pytest.Item):
+    def __init__(self, name, parent, runner=None, dtest=None):
+        super().__init__(name, parent)
+        self.runner = runner
+        self.dtest = dtest
+        self.obj = None
+        self.fixture_request = None
+
+    @classmethod
+    def from_parent(  # type: ignore
+        cls, parent: "Union[DoctestTextfile, DoctestModule]", *, name, runner, dtest
+    ):
+        # incompatible signature due to to imposed limits on sublcass
+        """
+        the public named constructor
+        """
+        return super().from_parent(name=name, parent=parent, runner=runner, dtest=dtest)
+
+    def setup(self):
+        if self.dtest is not None:
+            self.fixture_request = _setup_fixtures(self)
+            globs = dict(getfixture=self.fixture_request.getfixturevalue)
+            for name, value in self.fixture_request.getfixturevalue(
+                "doctest_namespace"
+            ).items():
+                globs[name] = value
+            self.dtest.globs.update(globs)
+
+    def runtest(self) -> None:
+        _check_all_skipped(self.dtest)
+        self._disable_output_capturing_for_darwin()
+        failures = []  # type: List[doctest.DocTestFailure]
+        self.runner.run(self.dtest, out=failures)
+        if failures:
+            raise MultipleDoctestFailures(failures)
+
+    def _disable_output_capturing_for_darwin(self):
+        """
+        Disable output capturing. Otherwise, stdout is lost to doctest (#985)
+        """
+        if platform.system() != "Darwin":
+            return
+        capman = self.config.pluginmanager.getplugin("capturemanager")
+        if capman:
+            capman.suspend_global_capture(in_=True)
+            out, err = capman.read_global_capture()
+            sys.stdout.write(out)
+            sys.stderr.write(err)
+
+    def repr_failure(self, excinfo):
+        import doctest
+
+        failures = (
+            None
+        )  # type: Optional[List[Union[doctest.DocTestFailure, doctest.UnexpectedException]]]
+        if excinfo.errisinstance((doctest.DocTestFailure, doctest.UnexpectedException)):
+            failures = [excinfo.value]
+        elif excinfo.errisinstance(MultipleDoctestFailures):
+            failures = excinfo.value.failures
+
+        if failures is not None:
+            reprlocation_lines = []
+            for failure in failures:
+                example = failure.example
+                test = failure.test
+                filename = test.filename
+                if test.lineno is None:
+                    lineno = None
+                else:
+                    lineno = test.lineno + example.lineno + 1
+                message = type(failure).__name__
+                reprlocation = ReprFileLocation(filename, lineno, message)
+                checker = _get_checker()
+                report_choice = _get_report_choice(
+                    self.config.getoption("doctestreport")
+                )
+                if lineno is not None:
+                    assert failure.test.docstring is not None
+                    lines = failure.test.docstring.splitlines(False)
+                    # add line numbers to the left of the error message
+                    assert test.lineno is not None
+                    lines = [
+                        "%03d %s" % (i + test.lineno + 1, x)
+                        for (i, x) in enumerate(lines)
+                    ]
+                    # trim docstring error lines to 10
+                    lines = lines[max(example.lineno - 9, 0) : example.lineno + 1]
+                else:
+                    lines = [
+                        "EXAMPLE LOCATION UNKNOWN, not showing all tests of that example"
+                    ]
+                    indent = ">>>"
+                    for line in example.source.splitlines():
+                        lines.append("??? {} {}".format(indent, line))
+                        indent = "..."
+                if isinstance(failure, doctest.DocTestFailure):
+                    lines += checker.output_difference(
+                        example, failure.got, report_choice
+                    ).split("\n")
+                else:
+                    inner_excinfo = ExceptionInfo(failure.exc_info)
+                    lines += ["UNEXPECTED EXCEPTION: %s" % repr(inner_excinfo.value)]
+                    lines += [
+                        x.strip("\n")
+                        for x in traceback.format_exception(*failure.exc_info)
+                    ]
+                reprlocation_lines.append((reprlocation, lines))
+            return ReprFailDoctest(reprlocation_lines)
+        else:
+            return super().repr_failure(excinfo)
+
+    def reportinfo(self) -> Tuple[py.path.local, int, str]:
+        return self.fspath, self.dtest.lineno, "[doctest] %s" % self.name
+
+
+def _get_flag_lookup() -> Dict[str, int]:
+    import doctest
+
+    return dict(
+        DONT_ACCEPT_TRUE_FOR_1=doctest.DONT_ACCEPT_TRUE_FOR_1,
+        DONT_ACCEPT_BLANKLINE=doctest.DONT_ACCEPT_BLANKLINE,
+        NORMALIZE_WHITESPACE=doctest.NORMALIZE_WHITESPACE,
+        ELLIPSIS=doctest.ELLIPSIS,
+        IGNORE_EXCEPTION_DETAIL=doctest.IGNORE_EXCEPTION_DETAIL,
+        COMPARISON_FLAGS=doctest.COMPARISON_FLAGS,
+        ALLOW_UNICODE=_get_allow_unicode_flag(),
+        ALLOW_BYTES=_get_allow_bytes_flag(),
+        NUMBER=_get_number_flag(),
+    )
+
+
+def get_optionflags(parent):
+    optionflags_str = parent.config.getini("doctest_optionflags")
+    flag_lookup_table = _get_flag_lookup()
+    flag_acc = 0
+    for flag in optionflags_str:
+        flag_acc |= flag_lookup_table[flag]
+    return flag_acc
+
+
+def _get_continue_on_failure(config):
+    continue_on_failure = config.getvalue("doctest_continue_on_failure")
+    if continue_on_failure:
+        # We need to turn off this if we use pdb since we should stop at
+        # the first failure
+        if config.getvalue("usepdb"):
+            continue_on_failure = False
+    return continue_on_failure
+
+
+class DoctestTextfile(pytest.Module):
+    obj = None
+
+    def collect(self):
+        import doctest
+
+        # inspired by doctest.testfile; ideally we would use it directly,
+        # but it doesn't support passing a custom checker
+        encoding = self.config.getini("doctest_encoding")
+        text = self.fspath.read_text(encoding)
+        filename = str(self.fspath)
+        name = self.fspath.basename
+        globs = {"__name__": "__main__"}
+
+        optionflags = get_optionflags(self)
+
+        runner = _get_runner(
+            verbose=False,
+            optionflags=optionflags,
+            checker=_get_checker(),
+            continue_on_failure=_get_continue_on_failure(self.config),
+        )
+
+        parser = doctest.DocTestParser()
+        test = parser.get_doctest(text, globs, name, filename, 0)
+        if test.examples:
+            yield DoctestItem.from_parent(
+                self, name=test.name, runner=runner, dtest=test
+            )
+
+
+def _check_all_skipped(test):
+    """raises pytest.skip() if all examples in the given DocTest have the SKIP
+    option set.
+    """
+    import doctest
+
+    all_skipped = all(x.options.get(doctest.SKIP, False) for x in test.examples)
+    if all_skipped:
+        pytest.skip("all tests skipped by +SKIP option")
+
+
+def _is_mocked(obj):
+    """
+    returns if a object is possibly a mock object by checking the existence of a highly improbable attribute
+    """
+    return (
+        safe_getattr(obj, "pytest_mock_example_attribute_that_shouldnt_exist", None)
+        is not None
+    )
+
+
+@contextmanager
+def _patch_unwrap_mock_aware():
+    """
+    contextmanager which replaces ``inspect.unwrap`` with a version
+    that's aware of mock objects and doesn't recurse on them
+    """
+    real_unwrap = inspect.unwrap
+
+    def _mock_aware_unwrap(obj, stop=None):
+        try:
+            if stop is None or stop is _is_mocked:
+                return real_unwrap(obj, stop=_is_mocked)
+            return real_unwrap(obj, stop=lambda obj: _is_mocked(obj) or stop(obj))
+        except Exception as e:
+            warnings.warn(
+                "Got %r when unwrapping %r.  This is usually caused "
+                "by a violation of Python's object protocol; see e.g. "
+                "https://github.com/pytest-dev/pytest/issues/5080" % (e, obj),
+                PytestWarning,
+            )
+            raise
+
+    inspect.unwrap = _mock_aware_unwrap
+    try:
+        yield
+    finally:
+        inspect.unwrap = real_unwrap
+
+
+class DoctestModule(pytest.Module):
+    def collect(self):
+        import doctest
+
+        class MockAwareDocTestFinder(doctest.DocTestFinder):
+            """
+            a hackish doctest finder that overrides stdlib internals to fix a stdlib bug
+
+            https://github.com/pytest-dev/pytest/issues/3456
+            https://bugs.python.org/issue25532
+            """
+
+            def _find_lineno(self, obj, source_lines):
+                """
+                Doctest code does not take into account `@property`, this is a hackish way to fix it.
+
+                https://bugs.python.org/issue17446
+                """
+                if isinstance(obj, property):
+                    obj = getattr(obj, "fget", obj)
+                return doctest.DocTestFinder._find_lineno(self, obj, source_lines)
+
+            def _find(
+                self, tests, obj, name, module, source_lines, globs, seen
+            ) -> None:
+                if _is_mocked(obj):
+                    return
+                with _patch_unwrap_mock_aware():
+
+                    # Type ignored because this is a private function.
+                    doctest.DocTestFinder._find(  # type: ignore
+                        self, tests, obj, name, module, source_lines, globs, seen
+                    )
+
+        if self.fspath.basename == "conftest.py":
+            module = self.config.pluginmanager._importconftest(self.fspath)
+        else:
+            try:
+                module = self.fspath.pyimport()
+            except ImportError:
+                if self.config.getvalue("doctest_ignore_import_errors"):
+                    pytest.skip("unable to import module %r" % self.fspath)
+                else:
+                    raise
+        # uses internal doctest module parsing mechanism
+        finder = MockAwareDocTestFinder()
+        optionflags = get_optionflags(self)
+        runner = _get_runner(
+            verbose=False,
+            optionflags=optionflags,
+            checker=_get_checker(),
+            continue_on_failure=_get_continue_on_failure(self.config),
+        )
+
+        for test in finder.find(module, module.__name__):
+            if test.examples:  # skip empty doctests
+                yield DoctestItem.from_parent(
+                    self, name=test.name, runner=runner, dtest=test
+                )
+
+
+def _setup_fixtures(doctest_item):
+    """
+    Used by DoctestTextfile and DoctestItem to setup fixture information.
+    """
+
+    def func():
+        pass
+
+    doctest_item.funcargs = {}
+    fm = doctest_item.session._fixturemanager
+    doctest_item._fixtureinfo = fm.getfixtureinfo(
+        node=doctest_item, func=func, cls=None, funcargs=False
+    )
+    fixture_request = FixtureRequest(doctest_item)
+    fixture_request._fillfixtures()
+    return fixture_request
+
+
+def _init_checker_class() -> "Type[doctest.OutputChecker]":
+    import doctest
+    import re
+
+    class LiteralsOutputChecker(doctest.OutputChecker):
+        """
+        Based on doctest_nose_plugin.py from the nltk project
+        (https://github.com/nltk/nltk) and on the "numtest" doctest extension
+        by Sebastien Boisgerault (https://github.com/boisgera/numtest).
+        """
+
+        _unicode_literal_re = re.compile(r"(\W|^)[uU]([rR]?[\'\"])", re.UNICODE)
+        _bytes_literal_re = re.compile(r"(\W|^)[bB]([rR]?[\'\"])", re.UNICODE)
+        _number_re = re.compile(
+            r"""
+            (?P<number>
+              (?P<mantissa>
+                (?P<integer1> [+-]?\d*)\.(?P<fraction>\d+)
+                |
+                (?P<integer2> [+-]?\d+)\.
+              )
+              (?:
+                [Ee]
+                (?P<exponent1> [+-]?\d+)
+              )?
+              |
+              (?P<integer3> [+-]?\d+)
+              (?:
+                [Ee]
+                (?P<exponent2> [+-]?\d+)
+              )
+            )
+            """,
+            re.VERBOSE,
+        )
+
+        def check_output(self, want, got, optionflags):
+            if doctest.OutputChecker.check_output(self, want, got, optionflags):
+                return True
+
+            allow_unicode = optionflags & _get_allow_unicode_flag()
+            allow_bytes = optionflags & _get_allow_bytes_flag()
+            allow_number = optionflags & _get_number_flag()
+
+            if not allow_unicode and not allow_bytes and not allow_number:
+                return False
+
+            def remove_prefixes(regex, txt):
+                return re.sub(regex, r"\1\2", txt)
+
+            if allow_unicode:
+                want = remove_prefixes(self._unicode_literal_re, want)
+                got = remove_prefixes(self._unicode_literal_re, got)
+
+            if allow_bytes:
+                want = remove_prefixes(self._bytes_literal_re, want)
+                got = remove_prefixes(self._bytes_literal_re, got)
+
+            if allow_number:
+                got = self._remove_unwanted_precision(want, got)
+
+            return doctest.OutputChecker.check_output(self, want, got, optionflags)
+
+        def _remove_unwanted_precision(self, want, got):
+            wants = list(self._number_re.finditer(want))
+            gots = list(self._number_re.finditer(got))
+            if len(wants) != len(gots):
+                return got
+            offset = 0
+            for w, g in zip(wants, gots):
+                fraction = w.group("fraction")
+                exponent = w.group("exponent1")
+                if exponent is None:
+                    exponent = w.group("exponent2")
+                if fraction is None:
+                    precision = 0
+                else:
+                    precision = len(fraction)
+                if exponent is not None:
+                    precision -= int(exponent)
+                if float(w.group()) == approx(float(g.group()), abs=10 ** -precision):
+                    # They're close enough. Replace the text we actually
+                    # got with the text we want, so that it will match when we
+                    # check the string literally.
+                    got = (
+                        got[: g.start() + offset] + w.group() + got[g.end() + offset :]
+                    )
+                    offset += w.end() - w.start() - (g.end() - g.start())
+            return got
+
+    return LiteralsOutputChecker
+
+
+def _get_checker() -> "doctest.OutputChecker":
+    """
+    Returns a doctest.OutputChecker subclass that supports some
+    additional options:
+
+    * ALLOW_UNICODE and ALLOW_BYTES options to ignore u'' and b''
+      prefixes (respectively) in string literals. Useful when the same
+      doctest should run in Python 2 and Python 3.
+
+    * NUMBER to ignore floating-point differences smaller than the
+      precision of the literal number in the doctest.
+
+    An inner class is used to avoid importing "doctest" at the module
+    level.
+    """
+    global CHECKER_CLASS
+    if CHECKER_CLASS is None:
+        CHECKER_CLASS = _init_checker_class()
+    return CHECKER_CLASS()
+
+
+def _get_allow_unicode_flag() -> int:
+    """
+    Registers and returns the ALLOW_UNICODE flag.
+    """
+    import doctest
+
+    return doctest.register_optionflag("ALLOW_UNICODE")
+
+
+def _get_allow_bytes_flag() -> int:
+    """
+    Registers and returns the ALLOW_BYTES flag.
+    """
+    import doctest
+
+    return doctest.register_optionflag("ALLOW_BYTES")
+
+
+def _get_number_flag() -> int:
+    """
+    Registers and returns the NUMBER flag.
+    """
+    import doctest
+
+    return doctest.register_optionflag("NUMBER")
+
+
+def _get_report_choice(key: str) -> int:
+    """
+    This function returns the actual `doctest` module flag value, we want to do it as late as possible to avoid
+    importing `doctest` and all its dependencies when parsing options, as it adds overhead and breaks tests.
+    """
+    import doctest
+
+    return {
+        DOCTEST_REPORT_CHOICE_UDIFF: doctest.REPORT_UDIFF,
+        DOCTEST_REPORT_CHOICE_CDIFF: doctest.REPORT_CDIFF,
+        DOCTEST_REPORT_CHOICE_NDIFF: doctest.REPORT_NDIFF,
+        DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE: doctest.REPORT_ONLY_FIRST_FAILURE,
+        DOCTEST_REPORT_CHOICE_NONE: 0,
+    }[key]
+
+
+@pytest.fixture(scope="session")
+def doctest_namespace():
+    """
+    Fixture that returns a :py:class:`dict` that will be injected into the namespace of doctests.
+    """
+    return dict()
diff --git a/contrib/python/pytest/py3/_pytest/faulthandler.py b/contrib/python/pytest/py3/_pytest/faulthandler.py
new file mode 100644
index 0000000000..8d723c206c
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/faulthandler.py
@@ -0,0 +1,113 @@
+import io
+import os
+import sys
+from typing import TextIO
+
+import pytest
+from _pytest.store import StoreKey
+
+
+fault_handler_stderr_key = StoreKey[TextIO]()
+
+
+def pytest_addoption(parser):
+    help = (
+        "Dump the traceback of all threads if a test takes "
+        "more than TIMEOUT seconds to finish.\n"
+        "Not available on Windows."
+    )
+    parser.addini("faulthandler_timeout", help, default=0.0)
+
+
+def pytest_configure(config):
+    import faulthandler
+
+    if not faulthandler.is_enabled():
+        # faulthhandler is not enabled, so install plugin that does the actual work
+        # of enabling faulthandler before each test executes.
+        config.pluginmanager.register(FaultHandlerHooks(), "faulthandler-hooks")
+    else:
+        from _pytest.warnings import _issue_warning_captured
+
+        # Do not handle dumping to stderr if faulthandler is already enabled, so warn
+        # users that the option is being ignored.
+        timeout = FaultHandlerHooks.get_timeout_config_value(config)
+        if timeout > 0:
+            _issue_warning_captured(
+                pytest.PytestConfigWarning(
+                    "faulthandler module enabled before pytest configuration step, "
+                    "'faulthandler_timeout' option ignored"
+                ),
+                config.hook,
+                stacklevel=2,
+            )
+
+
+class FaultHandlerHooks:
+    """Implements hooks that will actually install fault handler before tests execute,
+    as well as correctly handle pdb and internal errors."""
+
+    def pytest_configure(self, config):
+        import faulthandler
+
+        stderr_fd_copy = os.dup(self._get_stderr_fileno())
+        config._store[fault_handler_stderr_key] = open(stderr_fd_copy, "w")
+        faulthandler.enable(file=config._store[fault_handler_stderr_key])
+
+    def pytest_unconfigure(self, config):
+        import faulthandler
+
+        faulthandler.disable()
+        # close our dup file installed during pytest_configure
+        # re-enable the faulthandler, attaching it to the default sys.stderr
+        # so we can see crashes after pytest has finished, usually during
+        # garbage collection during interpreter shutdown
+        config._store[fault_handler_stderr_key].close()
+        del config._store[fault_handler_stderr_key]
+        faulthandler.enable(file=self._get_stderr_fileno())
+
+    @staticmethod
+    def _get_stderr_fileno():
+        try:
+            return sys.stderr.fileno()
+        except (AttributeError, io.UnsupportedOperation):
+            # pytest-xdist monkeypatches sys.stderr with an object that is not an actual file.
+            # https://docs.python.org/3/library/faulthandler.html#issue-with-file-descriptors
+            # This is potentially dangerous, but the best we can do.
+            return sys.__stderr__.fileno()
+
+    @staticmethod
+    def get_timeout_config_value(config):
+        return float(config.getini("faulthandler_timeout") or 0.0)
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_runtest_protocol(self, item):
+        timeout = self.get_timeout_config_value(item.config)
+        stderr = item.config._store[fault_handler_stderr_key]
+        if timeout > 0 and stderr is not None:
+            import faulthandler
+
+            faulthandler.dump_traceback_later(timeout, file=stderr)
+            try:
+                yield
+            finally:
+                faulthandler.cancel_dump_traceback_later()
+        else:
+            yield
+
+    @pytest.hookimpl(tryfirst=True)
+    def pytest_enter_pdb(self):
+        """Cancel any traceback dumping due to timeout before entering pdb.
+        """
+        import faulthandler
+
+        faulthandler.cancel_dump_traceback_later()
+
+    @pytest.hookimpl(tryfirst=True)
+    def pytest_exception_interact(self):
+        """Cancel any traceback dumping due to an interactive exception being
+        raised.
+        """
+        import faulthandler
+
+        faulthandler.cancel_dump_traceback_later()
diff --git a/contrib/python/pytest/py3/_pytest/fixtures.py b/contrib/python/pytest/py3/_pytest/fixtures.py
new file mode 100644
index 0000000000..22964770d2
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/fixtures.py
@@ -0,0 +1,1480 @@
+import functools
+import inspect
+import itertools
+import sys
+import warnings
+from collections import defaultdict
+from collections import deque
+from collections import OrderedDict
+from typing import Dict
+from typing import List
+from typing import Tuple
+
+import attr
+import py
+
+import _pytest
+from _pytest._code.code import FormattedExcinfo
+from _pytest._code.code import TerminalRepr
+from _pytest._code.source import getfslineno
+from _pytest._io import TerminalWriter
+from _pytest.compat import _format_args
+from _pytest.compat import _PytestWrapper
+from _pytest.compat import get_real_func
+from _pytest.compat import get_real_method
+from _pytest.compat import getfuncargnames
+from _pytest.compat import getimfunc
+from _pytest.compat import getlocation
+from _pytest.compat import is_generator
+from _pytest.compat import NOTSET
+from _pytest.compat import safe_getattr
+from _pytest.compat import TYPE_CHECKING
+from _pytest.deprecated import FIXTURE_POSITIONAL_ARGUMENTS
+from _pytest.deprecated import FUNCARGNAMES
+from _pytest.mark import ParameterSet
+from _pytest.outcomes import fail
+from _pytest.outcomes import TEST_OUTCOME
+
+if TYPE_CHECKING:
+    from typing import Type
+
+    from _pytest import nodes
+    from _pytest.main import Session
+
+
+@attr.s(frozen=True)
+class PseudoFixtureDef:
+    cached_result = attr.ib()
+    scope = attr.ib()
+
+
+def pytest_sessionstart(session: "Session"):
+    import _pytest.python
+    import _pytest.nodes
+
+    scopename2class.update(
+        {
+            "package": _pytest.python.Package,
+            "class": _pytest.python.Class,
+            "module": _pytest.python.Module,
+            "function": _pytest.nodes.Item,
+            "session": _pytest.main.Session,
+        }
+    )
+    session._fixturemanager = FixtureManager(session)
+
+
+scopename2class = {}  # type: Dict[str, Type[nodes.Node]]
+
+scope2props = dict(session=())  # type: Dict[str, Tuple[str, ...]]
+scope2props["package"] = ("fspath",)
+scope2props["module"] = ("fspath", "module")
+scope2props["class"] = scope2props["module"] + ("cls",)
+scope2props["instance"] = scope2props["class"] + ("instance",)
+scope2props["function"] = scope2props["instance"] + ("function", "keywords")
+
+
+def scopeproperty(name=None, doc=None):
+    def decoratescope(func):
+        scopename = name or func.__name__
+
+        def provide(self):
+            if func.__name__ in scope2props[self.scope]:
+                return func(self)
+            raise AttributeError(
+                "{} not available in {}-scoped context".format(scopename, self.scope)
+            )
+
+        return property(provide, None, None, func.__doc__)
+
+    return decoratescope
+
+
+def get_scope_package(node, fixturedef):
+    import pytest
+
+    cls = pytest.Package
+    current = node
+    fixture_package_name = "{}/{}".format(fixturedef.baseid, "__init__.py")
+    while current and (
+        type(current) is not cls or fixture_package_name != current.nodeid
+    ):
+        current = current.parent
+    if current is None:
+        return node.session
+    return current
+
+
+def get_scope_node(node, scope):
+    cls = scopename2class.get(scope)
+    if cls is None:
+        raise ValueError("unknown scope")
+    return node.getparent(cls)
+
+
+def add_funcarg_pseudo_fixture_def(collector, metafunc, fixturemanager):
+    # this function will transform all collected calls to a functions
+    # if they use direct funcargs (i.e. direct parametrization)
+    # because we want later test execution to be able to rely on
+    # an existing FixtureDef structure for all arguments.
+    # XXX we can probably avoid this algorithm  if we modify CallSpec2
+    # to directly care for creating the fixturedefs within its methods.
+    if not metafunc._calls[0].funcargs:
+        return  # this function call does not have direct parametrization
+    # collect funcargs of all callspecs into a list of values
+    arg2params = {}
+    arg2scope = {}
+    for callspec in metafunc._calls:
+        for argname, argvalue in callspec.funcargs.items():
+            assert argname not in callspec.params
+            callspec.params[argname] = argvalue
+            arg2params_list = arg2params.setdefault(argname, [])
+            callspec.indices[argname] = len(arg2params_list)
+            arg2params_list.append(argvalue)
+            if argname not in arg2scope:
+                scopenum = callspec._arg2scopenum.get(argname, scopenum_function)
+                arg2scope[argname] = scopes[scopenum]
+        callspec.funcargs.clear()
+
+    # register artificial FixtureDef's so that later at test execution
+    # time we can rely on a proper FixtureDef to exist for fixture setup.
+    arg2fixturedefs = metafunc._arg2fixturedefs
+    for argname, valuelist in arg2params.items():
+        # if we have a scope that is higher than function we need
+        # to make sure we only ever create an according fixturedef on
+        # a per-scope basis. We thus store and cache the fixturedef on the
+        # node related to the scope.
+        scope = arg2scope[argname]
+        node = None
+        if scope != "function":
+            node = get_scope_node(collector, scope)
+            if node is None:
+                assert scope == "class" and isinstance(collector, _pytest.python.Module)
+                # use module-level collector for class-scope (for now)
+                node = collector
+        if node and argname in node._name2pseudofixturedef:
+            arg2fixturedefs[argname] = [node._name2pseudofixturedef[argname]]
+        else:
+            fixturedef = FixtureDef(
+                fixturemanager,
+                "",
+                argname,
+                get_direct_param_fixture_func,
+                arg2scope[argname],
+                valuelist,
+                False,
+                False,
+            )
+            arg2fixturedefs[argname] = [fixturedef]
+            if node is not None:
+                node._name2pseudofixturedef[argname] = fixturedef
+
+
+def getfixturemarker(obj):
+    """ return fixturemarker or None if it doesn't exist or raised
+    exceptions."""
+    try:
+        return getattr(obj, "_pytestfixturefunction", None)
+    except TEST_OUTCOME:
+        # some objects raise errors like request (from flask import request)
+        # we don't expect them to be fixture functions
+        return None
+
+
+def get_parametrized_fixture_keys(item, scopenum):
+    """ return list of keys for all parametrized arguments which match
+    the specified scope. """
+    assert scopenum < scopenum_function  # function
+    try:
+        cs = item.callspec
+    except AttributeError:
+        pass
+    else:
+        # cs.indices.items() is random order of argnames.  Need to
+        # sort this so that different calls to
+        # get_parametrized_fixture_keys will be deterministic.
+        for argname, param_index in sorted(cs.indices.items()):
+            if cs._arg2scopenum[argname] != scopenum:
+                continue
+            if scopenum == 0:  # session
+                key = (argname, param_index)
+            elif scopenum == 1:  # package
+                key = (argname, param_index, item.fspath.dirpath())
+            elif scopenum == 2:  # module
+                key = (argname, param_index, item.fspath)
+            elif scopenum == 3:  # class
+                key = (argname, param_index, item.fspath, item.cls)
+            yield key
+
+
+# algorithm for sorting on a per-parametrized resource setup basis
+# it is called for scopenum==0 (session) first and performs sorting
+# down to the lower scopes such as to minimize number of "high scope"
+# setups and teardowns
+
+
+def reorder_items(items):
+    argkeys_cache = {}
+    items_by_argkey = {}
+    for scopenum in range(0, scopenum_function):
+        argkeys_cache[scopenum] = d = {}
+        items_by_argkey[scopenum] = item_d = defaultdict(deque)
+        for item in items:
+            keys = OrderedDict.fromkeys(get_parametrized_fixture_keys(item, scopenum))
+            if keys:
+                d[item] = keys
+                for key in keys:
+                    item_d[key].append(item)
+    items = OrderedDict.fromkeys(items)
+    return list(reorder_items_atscope(items, argkeys_cache, items_by_argkey, 0))
+
+
+def fix_cache_order(item, argkeys_cache, items_by_argkey):
+    for scopenum in range(0, scopenum_function):
+        for key in argkeys_cache[scopenum].get(item, []):
+            items_by_argkey[scopenum][key].appendleft(item)
+
+
+def reorder_items_atscope(items, argkeys_cache, items_by_argkey, scopenum):
+    if scopenum >= scopenum_function or len(items) < 3:
+        return items
+    ignore = set()
+    items_deque = deque(items)
+    items_done = OrderedDict()
+    scoped_items_by_argkey = items_by_argkey[scopenum]
+    scoped_argkeys_cache = argkeys_cache[scopenum]
+    while items_deque:
+        no_argkey_group = OrderedDict()
+        slicing_argkey = None
+        while items_deque:
+            item = items_deque.popleft()
+            if item in items_done or item in no_argkey_group:
+                continue
+            argkeys = OrderedDict.fromkeys(
+                k for k in scoped_argkeys_cache.get(item, []) if k not in ignore
+            )
+            if not argkeys:
+                no_argkey_group[item] = None
+            else:
+                slicing_argkey, _ = argkeys.popitem()
+                # we don't have to remove relevant items from later in the deque because they'll just be ignored
+                matching_items = [
+                    i for i in scoped_items_by_argkey[slicing_argkey] if i in items
+                ]
+                for i in reversed(matching_items):
+                    fix_cache_order(i, argkeys_cache, items_by_argkey)
+                    items_deque.appendleft(i)
+                break
+        if no_argkey_group:
+            no_argkey_group = reorder_items_atscope(
+                no_argkey_group, argkeys_cache, items_by_argkey, scopenum + 1
+            )
+            for item in no_argkey_group:
+                items_done[item] = None
+        ignore.add(slicing_argkey)
+    return items_done
+
+
+def fillfixtures(function):
+    """ fill missing funcargs for a test function. """
+    try:
+        request = function._request
+    except AttributeError:
+        # XXX this special code path is only expected to execute
+        # with the oejskit plugin.  It uses classes with funcargs
+        # and we thus have to work a bit to allow this.
+        fm = function.session._fixturemanager
+        fi = fm.getfixtureinfo(function.parent, function.obj, None)
+        function._fixtureinfo = fi
+        request = function._request = FixtureRequest(function)
+        request._fillfixtures()
+        # prune out funcargs for jstests
+        newfuncargs = {}
+        for name in fi.argnames:
+            newfuncargs[name] = function.funcargs[name]
+        function.funcargs = newfuncargs
+    else:
+        request._fillfixtures()
+
+
+def get_direct_param_fixture_func(request):
+    return request.param
+
+
+@attr.s(slots=True)
+class FuncFixtureInfo:
+    # original function argument names
+    argnames = attr.ib(type=tuple)
+    # argnames that function immediately requires. These include argnames +
+    # fixture names specified via usefixtures and via autouse=True in fixture
+    # definitions.
+    initialnames = attr.ib(type=tuple)
+    names_closure = attr.ib()  # List[str]
+    name2fixturedefs = attr.ib()  # List[str, List[FixtureDef]]
+
+    def prune_dependency_tree(self):
+        """Recompute names_closure from initialnames and name2fixturedefs
+
+        Can only reduce names_closure, which means that the new closure will
+        always be a subset of the old one. The order is preserved.
+
+        This method is needed because direct parametrization may shadow some
+        of the fixtures that were included in the originally built dependency
+        tree. In this way the dependency tree can get pruned, and the closure
+        of argnames may get reduced.
+        """
+        closure = set()
+        working_set = set(self.initialnames)
+        while working_set:
+            argname = working_set.pop()
+            # argname may be smth not included in the original names_closure,
+            # in which case we ignore it. This currently happens with pseudo
+            # FixtureDefs which wrap 'get_direct_param_fixture_func(request)'.
+            # So they introduce the new dependency 'request' which might have
+            # been missing in the original tree (closure).
+            if argname not in closure and argname in self.names_closure:
+                closure.add(argname)
+                if argname in self.name2fixturedefs:
+                    working_set.update(self.name2fixturedefs[argname][-1].argnames)
+
+        self.names_closure[:] = sorted(closure, key=self.names_closure.index)
+
+
+class FixtureRequest:
+    """ A request for a fixture from a test or fixture function.
+
+    A request object gives access to the requesting test context
+    and has an optional ``param`` attribute in case
+    the fixture is parametrized indirectly.
+    """
+
+    def __init__(self, pyfuncitem):
+        self._pyfuncitem = pyfuncitem
+        #: fixture for which this request is being performed
+        self.fixturename = None
+        #: Scope string, one of "function", "class", "module", "session"
+        self.scope = "function"
+        self._fixture_defs = {}  # type: Dict[str, FixtureDef]
+        fixtureinfo = pyfuncitem._fixtureinfo
+        self._arg2fixturedefs = fixtureinfo.name2fixturedefs.copy()
+        self._arg2index = {}
+        self._fixturemanager = pyfuncitem.session._fixturemanager
+
+    @property
+    def fixturenames(self):
+        """names of all active fixtures in this request"""
+        result = list(self._pyfuncitem._fixtureinfo.names_closure)
+        result.extend(set(self._fixture_defs).difference(result))
+        return result
+
+    @property
+    def funcargnames(self):
+        """ alias attribute for ``fixturenames`` for pre-2.3 compatibility"""
+        warnings.warn(FUNCARGNAMES, stacklevel=2)
+        return self.fixturenames
+
+    @property
+    def node(self):
+        """ underlying collection node (depends on current request scope)"""
+        return self._getscopeitem(self.scope)
+
+    def _getnextfixturedef(self, argname):
+        fixturedefs = self._arg2fixturedefs.get(argname, None)
+        if fixturedefs is None:
+            # we arrive here because of a dynamic call to
+            # getfixturevalue(argname) usage which was naturally
+            # not known at parsing/collection time
+            parentid = self._pyfuncitem.parent.nodeid
+            fixturedefs = self._fixturemanager.getfixturedefs(argname, parentid)
+            self._arg2fixturedefs[argname] = fixturedefs
+        # fixturedefs list is immutable so we maintain a decreasing index
+        index = self._arg2index.get(argname, 0) - 1
+        if fixturedefs is None or (-index > len(fixturedefs)):
+            raise FixtureLookupError(argname, self)
+        self._arg2index[argname] = index
+        return fixturedefs[index]
+
+    @property
+    def config(self):
+        """ the pytest config object associated with this request. """
+        return self._pyfuncitem.config
+
+    @scopeproperty()
+    def function(self):
+        """ test function object if the request has a per-function scope. """
+        return self._pyfuncitem.obj
+
+    @scopeproperty("class")
+    def cls(self):
+        """ class (can be None) where the test function was collected. """
+        clscol = self._pyfuncitem.getparent(_pytest.python.Class)
+        if clscol:
+            return clscol.obj
+
+    @property
+    def instance(self):
+        """ instance (can be None) on which test function was collected. """
+        # unittest support hack, see _pytest.unittest.TestCaseFunction
+        try:
+            return self._pyfuncitem._testcase
+        except AttributeError:
+            function = getattr(self, "function", None)
+            return getattr(function, "__self__", None)
+
+    @scopeproperty()
+    def module(self):
+        """ python module object where the test function was collected. """
+        return self._pyfuncitem.getparent(_pytest.python.Module).obj
+
+    @scopeproperty()
+    def fspath(self) -> py.path.local:
+        """ the file system path of the test module which collected this test. """
+        # TODO: Remove ignore once _pyfuncitem is properly typed.
+        return self._pyfuncitem.fspath  # type: ignore
+
+    @property
+    def keywords(self):
+        """ keywords/markers dictionary for the underlying node. """
+        return self.node.keywords
+
+    @property
+    def session(self):
+        """ pytest session object. """
+        return self._pyfuncitem.session
+
+    def addfinalizer(self, finalizer):
+        """ add finalizer/teardown function to be called after the
+        last test within the requesting test context finished
+        execution. """
+        # XXX usually this method is shadowed by fixturedef specific ones
+        self._addfinalizer(finalizer, scope=self.scope)
+
+    def _addfinalizer(self, finalizer, scope):
+        colitem = self._getscopeitem(scope)
+        self._pyfuncitem.session._setupstate.addfinalizer(
+            finalizer=finalizer, colitem=colitem
+        )
+
+    def applymarker(self, marker):
+        """ Apply a marker to a single test function invocation.
+        This method is useful if you don't want to have a keyword/marker
+        on all function invocations.
+
+        :arg marker: a :py:class:`_pytest.mark.MarkDecorator` object
+            created by a call to ``pytest.mark.NAME(...)``.
+        """
+        self.node.add_marker(marker)
+
+    def raiseerror(self, msg):
+        """ raise a FixtureLookupError with the given message. """
+        raise self._fixturemanager.FixtureLookupError(None, self, msg)
+
+    def _fillfixtures(self):
+        item = self._pyfuncitem
+        fixturenames = getattr(item, "fixturenames", self.fixturenames)
+        for argname in fixturenames:
+            if argname not in item.funcargs:
+                item.funcargs[argname] = self.getfixturevalue(argname)
+
+    def getfixturevalue(self, argname):
+        """ Dynamically run a named fixture function.
+
+        Declaring fixtures via function argument is recommended where possible.
+        But if you can only decide whether to use another fixture at test
+        setup time, you may use this function to retrieve it inside a fixture
+        or test function body.
+        """
+        return self._get_active_fixturedef(argname).cached_result[0]
+
+    def _get_active_fixturedef(self, argname):
+        try:
+            return self._fixture_defs[argname]
+        except KeyError:
+            try:
+                fixturedef = self._getnextfixturedef(argname)
+            except FixtureLookupError:
+                if argname == "request":
+                    cached_result = (self, [0], None)
+                    scope = "function"
+                    return PseudoFixtureDef(cached_result, scope)
+                raise
+        # remove indent to prevent the python3 exception
+        # from leaking into the call
+        self._compute_fixture_value(fixturedef)
+        self._fixture_defs[argname] = fixturedef
+        return fixturedef
+
+    def _get_fixturestack(self):
+        current = self
+        values = []
+        while 1:
+            fixturedef = getattr(current, "_fixturedef", None)
+            if fixturedef is None:
+                values.reverse()
+                return values
+            values.append(fixturedef)
+            current = current._parent_request
+
+    def _compute_fixture_value(self, fixturedef: "FixtureDef") -> None:
+        """
+        Creates a SubRequest based on "self" and calls the execute method of the given fixturedef object. This will
+        force the FixtureDef object to throw away any previous results and compute a new fixture value, which
+        will be stored into the FixtureDef object itself.
+        """
+        # prepare a subrequest object before calling fixture function
+        # (latter managed by fixturedef)
+        argname = fixturedef.argname
+        funcitem = self._pyfuncitem
+        scope = fixturedef.scope
+        try:
+            param = funcitem.callspec.getparam(argname)
+        except (AttributeError, ValueError):
+            param = NOTSET
+            param_index = 0
+            has_params = fixturedef.params is not None
+            fixtures_not_supported = getattr(funcitem, "nofuncargs", False)
+            if has_params and fixtures_not_supported:
+                msg = (
+                    "{name} does not support fixtures, maybe unittest.TestCase subclass?\n"
+                    "Node id: {nodeid}\n"
+                    "Function type: {typename}"
+                ).format(
+                    name=funcitem.name,
+                    nodeid=funcitem.nodeid,
+                    typename=type(funcitem).__name__,
+                )
+                fail(msg, pytrace=False)
+            if has_params:
+                frame = inspect.stack()[3]
+                frameinfo = inspect.getframeinfo(frame[0])
+                source_path = py.path.local(frameinfo.filename)
+                source_lineno = frameinfo.lineno
+                rel_source_path = source_path.relto(funcitem.config.rootdir)
+                if rel_source_path:
+                    source_path_str = rel_source_path
+                else:
+                    source_path_str = str(source_path)
+                msg = (
+                    "The requested fixture has no parameter defined for test:\n"
+                    "    {}\n\n"
+                    "Requested fixture '{}' defined in:\n{}"
+                    "\n\nRequested here:\n{}:{}".format(
+                        funcitem.nodeid,
+                        fixturedef.argname,
+                        getlocation(fixturedef.func, funcitem.config.rootdir),
+                        source_path_str,
+                        source_lineno,
+                    )
+                )
+                fail(msg, pytrace=False)
+        else:
+            param_index = funcitem.callspec.indices[argname]
+            # if a parametrize invocation set a scope it will override
+            # the static scope defined with the fixture function
+            paramscopenum = funcitem.callspec._arg2scopenum.get(argname)
+            if paramscopenum is not None:
+                scope = scopes[paramscopenum]
+
+        subrequest = SubRequest(self, scope, param, param_index, fixturedef)
+
+        # check if a higher-level scoped fixture accesses a lower level one
+        subrequest._check_scope(argname, self.scope, scope)
+        try:
+            # call the fixture function
+            fixturedef.execute(request=subrequest)
+        finally:
+            self._schedule_finalizers(fixturedef, subrequest)
+
+    def _schedule_finalizers(self, fixturedef, subrequest):
+        # if fixture function failed it might have registered finalizers
+        self.session._setupstate.addfinalizer(
+            functools.partial(fixturedef.finish, request=subrequest), subrequest.node
+        )
+
+    def _check_scope(self, argname, invoking_scope, requested_scope):
+        if argname == "request":
+            return
+        if scopemismatch(invoking_scope, requested_scope):
+            # try to report something helpful
+            lines = self._factorytraceback()
+            fail(
+                "ScopeMismatch: You tried to access the %r scoped "
+                "fixture %r with a %r scoped request object, "
+                "involved factories\n%s"
+                % ((requested_scope, argname, invoking_scope, "\n".join(lines))),
+                pytrace=False,
+            )
+
+    def _factorytraceback(self):
+        lines = []
+        for fixturedef in self._get_fixturestack():
+            factory = fixturedef.func
+            fs, lineno = getfslineno(factory)
+            p = self._pyfuncitem.session.fspath.bestrelpath(fs)
+            args = _format_args(factory)
+            lines.append("%s:%d:  def %s%s" % (p, lineno + 1, factory.__name__, args))
+        return lines
+
+    def _getscopeitem(self, scope):
+        if scope == "function":
+            # this might also be a non-function Item despite its attribute name
+            return self._pyfuncitem
+        if scope == "package":
+            node = get_scope_package(self._pyfuncitem, self._fixturedef)
+        else:
+            node = get_scope_node(self._pyfuncitem, scope)
+        if node is None and scope == "class":
+            # fallback to function item itself
+            node = self._pyfuncitem
+        assert node, 'Could not obtain a node for scope "{}" for function {!r}'.format(
+            scope, self._pyfuncitem
+        )
+        return node
+
+    def __repr__(self):
+        return "<FixtureRequest for %r>" % (self.node)
+
+
+class SubRequest(FixtureRequest):
+    """ a sub request for handling getting a fixture from a
+    test function/fixture. """
+
+    def __init__(self, request, scope, param, param_index, fixturedef):
+        self._parent_request = request
+        self.fixturename = fixturedef.argname
+        if param is not NOTSET:
+            self.param = param
+        self.param_index = param_index
+        self.scope = scope
+        self._fixturedef = fixturedef
+        self._pyfuncitem = request._pyfuncitem
+        self._fixture_defs = request._fixture_defs
+        self._arg2fixturedefs = request._arg2fixturedefs
+        self._arg2index = request._arg2index
+        self._fixturemanager = request._fixturemanager
+
+    def __repr__(self):
+        return "<SubRequest {!r} for {!r}>".format(self.fixturename, self._pyfuncitem)
+
+    def addfinalizer(self, finalizer):
+        self._fixturedef.addfinalizer(finalizer)
+
+    def _schedule_finalizers(self, fixturedef, subrequest):
+        # if the executing fixturedef was not explicitly requested in the argument list (via
+        # getfixturevalue inside the fixture call) then ensure this fixture def will be finished
+        # first
+        if fixturedef.argname not in self.fixturenames:
+            fixturedef.addfinalizer(
+                functools.partial(self._fixturedef.finish, request=self)
+            )
+        super()._schedule_finalizers(fixturedef, subrequest)
+
+
+scopes = "session package module class function".split()
+scopenum_function = scopes.index("function")
+
+
+def scopemismatch(currentscope, newscope):
+    return scopes.index(newscope) > scopes.index(currentscope)
+
+
+def scope2index(scope, descr, where=None):
+    """Look up the index of ``scope`` and raise a descriptive value error
+    if not defined.
+    """
+    try:
+        return scopes.index(scope)
+    except ValueError:
+        fail(
+            "{} {}got an unexpected scope value '{}'".format(
+                descr, "from {} ".format(where) if where else "", scope
+            ),
+            pytrace=False,
+        )
+
+
+class FixtureLookupError(LookupError):
+    """ could not return a requested Fixture (missing or invalid). """
+
+    def __init__(self, argname, request, msg=None):
+        self.argname = argname
+        self.request = request
+        self.fixturestack = request._get_fixturestack()
+        self.msg = msg
+
+    def formatrepr(self) -> "FixtureLookupErrorRepr":
+        tblines = []  # type: List[str]
+        addline = tblines.append
+        stack = [self.request._pyfuncitem.obj]
+        stack.extend(map(lambda x: x.func, self.fixturestack))
+        msg = self.msg
+        if msg is not None:
+            # the last fixture raise an error, let's present
+            # it at the requesting side
+            stack = stack[:-1]
+        for function in stack:
+            fspath, lineno = getfslineno(function)
+            try:
+                lines, _ = inspect.getsourcelines(get_real_func(function))
+            except (IOError, IndexError, TypeError):
+                error_msg = "file %s, line %s: source code not available"
+                addline(error_msg % (fspath, lineno + 1))
+            else:
+                addline("file {}, line {}".format(fspath, lineno + 1))
+                for i, line in enumerate(lines):
+                    line = line.rstrip()
+                    addline("  " + line)
+                    if line.lstrip().startswith("def"):
+                        break
+
+        if msg is None:
+            fm = self.request._fixturemanager
+            available = set()
+            parentid = self.request._pyfuncitem.parent.nodeid
+            for name, fixturedefs in fm._arg2fixturedefs.items():
+                faclist = list(fm._matchfactories(fixturedefs, parentid))
+                if faclist:
+                    available.add(name)
+            if self.argname in available:
+                msg = " recursive dependency involving fixture '{}' detected".format(
+                    self.argname
+                )
+            else:
+                msg = "fixture '{}' not found".format(self.argname)
+            msg += "\n available fixtures: {}".format(", ".join(sorted(available)))
+            msg += "\n use 'pytest --fixtures [testpath]' for help on them."
+
+        return FixtureLookupErrorRepr(fspath, lineno, tblines, msg, self.argname)
+
+
+class FixtureLookupErrorRepr(TerminalRepr):
+    def __init__(self, filename, firstlineno, tblines, errorstring, argname):
+        self.tblines = tblines
+        self.errorstring = errorstring
+        self.filename = filename
+        self.firstlineno = firstlineno
+        self.argname = argname
+
+    def toterminal(self, tw: TerminalWriter) -> None:
+        # tw.line("FixtureLookupError: %s" %(self.argname), red=True)
+        for tbline in self.tblines:
+            tw.line(tbline.rstrip())
+        lines = self.errorstring.split("\n")
+        if lines:
+            tw.line(
+                "{}       {}".format(FormattedExcinfo.fail_marker, lines[0].strip()),
+                red=True,
+            )
+            for line in lines[1:]:
+                tw.line(
+                    "{}       {}".format(FormattedExcinfo.flow_marker, line.strip()),
+                    red=True,
+                )
+        tw.line()
+        tw.line("%s:%d" % (self.filename, self.firstlineno + 1))
+
+
+def fail_fixturefunc(fixturefunc, msg):
+    fs, lineno = getfslineno(fixturefunc)
+    location = "{}:{}".format(fs, lineno + 1)
+    source = _pytest._code.Source(fixturefunc)
+    fail(msg + ":\n\n" + str(source.indent()) + "\n" + location, pytrace=False)
+
+
+def call_fixture_func(fixturefunc, request, kwargs):
+    yieldctx = is_generator(fixturefunc)
+    if yieldctx:
+        it = fixturefunc(**kwargs)
+        res = next(it)
+        finalizer = functools.partial(_teardown_yield_fixture, fixturefunc, it)
+        request.addfinalizer(finalizer)
+    else:
+        res = fixturefunc(**kwargs)
+    return res
+
+
+def _teardown_yield_fixture(fixturefunc, it):
+    """Executes the teardown of a fixture function by advancing the iterator after the
+    yield and ensure the iteration ends (if not it means there is more than one yield in the function)"""
+    try:
+        next(it)
+    except StopIteration:
+        pass
+    else:
+        fail_fixturefunc(
+            fixturefunc, "yield_fixture function has more than one 'yield'"
+        )
+
+
+def _eval_scope_callable(scope_callable, fixture_name, config):
+    try:
+        result = scope_callable(fixture_name=fixture_name, config=config)
+    except Exception:
+        raise TypeError(
+            "Error evaluating {} while defining fixture '{}'.\n"
+            "Expected a function with the signature (*, fixture_name, config)".format(
+                scope_callable, fixture_name
+            )
+        )
+    if not isinstance(result, str):
+        fail(
+            "Expected {} to return a 'str' while defining fixture '{}', but it returned:\n"
+            "{!r}".format(scope_callable, fixture_name, result),
+            pytrace=False,
+        )
+    return result
+
+
+class FixtureDef:
+    """ A container for a factory definition. """
+
+    def __init__(
+        self,
+        fixturemanager,
+        baseid,
+        argname,
+        func,
+        scope,
+        params,
+        unittest=False,
+        ids=None,
+    ):
+        self._fixturemanager = fixturemanager
+        self.baseid = baseid or ""
+        self.has_location = baseid is not None
+        self.func = func
+        self.argname = argname
+        if callable(scope):
+            scope = _eval_scope_callable(scope, argname, fixturemanager.config)
+        self.scope = scope
+        self.scopenum = scope2index(
+            scope or "function",
+            descr="Fixture '{}'".format(func.__name__),
+            where=baseid,
+        )
+        self.params = params
+        self.argnames = getfuncargnames(func, name=argname, is_method=unittest)
+        self.unittest = unittest
+        self.ids = ids
+        self.cached_result = None
+        self._finalizers = []
+
+    def addfinalizer(self, finalizer):
+        self._finalizers.append(finalizer)
+
+    def finish(self, request):
+        exc = None
+        try:
+            while self._finalizers:
+                try:
+                    func = self._finalizers.pop()
+                    func()
+                except BaseException as e:
+                    # XXX Only first exception will be seen by user,
+                    #     ideally all should be reported.
+                    if exc is None:
+                        exc = e
+            if exc:
+                raise exc
+        finally:
+            hook = self._fixturemanager.session.gethookproxy(request.node.fspath)
+            hook.pytest_fixture_post_finalizer(fixturedef=self, request=request)
+            # even if finalization fails, we invalidate
+            # the cached fixture value and remove
+            # all finalizers because they may be bound methods which will
+            # keep instances alive
+            self.cached_result = None
+            self._finalizers = []
+
+    def execute(self, request):
+        # get required arguments and register our own finish()
+        # with their finalization
+        for argname in self.argnames:
+            fixturedef = request._get_active_fixturedef(argname)
+            if argname != "request":
+                fixturedef.addfinalizer(functools.partial(self.finish, request=request))
+
+        my_cache_key = self.cache_key(request)
+        if self.cached_result is not None:
+            result, cache_key, err = self.cached_result
+            # note: comparison with `==` can fail (or be expensive) for e.g.
+            # numpy arrays (#6497)
+            if my_cache_key is cache_key:
+                if err is not None:
+                    _, val, tb = err
+                    raise val.with_traceback(tb)
+                else:
+                    return result
+            # we have a previous but differently parametrized fixture instance
+            # so we need to tear it down before creating a new one
+            self.finish(request)
+            assert self.cached_result is None
+
+        hook = self._fixturemanager.session.gethookproxy(request.node.fspath)
+        return hook.pytest_fixture_setup(fixturedef=self, request=request)
+
+    def cache_key(self, request):
+        return request.param_index if not hasattr(request, "param") else request.param
+
+    def __repr__(self):
+        return "<FixtureDef argname={!r} scope={!r} baseid={!r}>".format(
+            self.argname, self.scope, self.baseid
+        )
+
+
+def resolve_fixture_function(fixturedef, request):
+    """Gets the actual callable that can be called to obtain the fixture value, dealing with unittest-specific
+    instances and bound methods.
+    """
+    fixturefunc = fixturedef.func
+    if fixturedef.unittest:
+        if request.instance is not None:
+            # bind the unbound method to the TestCase instance
+            fixturefunc = fixturedef.func.__get__(request.instance)
+    else:
+        # the fixture function needs to be bound to the actual
+        # request.instance so that code working with "fixturedef" behaves
+        # as expected.
+        if request.instance is not None:
+            # handle the case where fixture is defined not in a test class, but some other class
+            # (for example a plugin class with a fixture), see #2270
+            if hasattr(fixturefunc, "__self__") and not isinstance(
+                request.instance, fixturefunc.__self__.__class__
+            ):
+                return fixturefunc
+            fixturefunc = getimfunc(fixturedef.func)
+            if fixturefunc != fixturedef.func:
+                fixturefunc = fixturefunc.__get__(request.instance)
+    return fixturefunc
+
+
+def pytest_fixture_setup(fixturedef, request):
+    """ Execution of fixture setup. """
+    kwargs = {}
+    for argname in fixturedef.argnames:
+        fixdef = request._get_active_fixturedef(argname)
+        assert fixdef.cached_result is not None
+        result, arg_cache_key, exc = fixdef.cached_result
+        request._check_scope(argname, request.scope, fixdef.scope)
+        kwargs[argname] = result
+
+    fixturefunc = resolve_fixture_function(fixturedef, request)
+    my_cache_key = fixturedef.cache_key(request)
+    try:
+        result = call_fixture_func(fixturefunc, request, kwargs)
+    except TEST_OUTCOME:
+        fixturedef.cached_result = (None, my_cache_key, sys.exc_info())
+        raise
+    fixturedef.cached_result = (result, my_cache_key, None)
+    return result
+
+
+def _ensure_immutable_ids(ids):
+    if ids is None:
+        return
+    if callable(ids):
+        return ids
+    return tuple(ids)
+
+
+def wrap_function_to_error_out_if_called_directly(function, fixture_marker):
+    """Wrap the given fixture function so we can raise an error about it being called directly,
+    instead of used as an argument in a test function.
+    """
+    message = (
+        'Fixture "{name}" called directly. Fixtures are not meant to be called directly,\n'
+        "but are created automatically when test functions request them as parameters.\n"
+        "See https://docs.pytest.org/en/latest/fixture.html for more information about fixtures, and\n"
+        "https://docs.pytest.org/en/latest/deprecations.html#calling-fixtures-directly about how to update your code."
+    ).format(name=fixture_marker.name or function.__name__)
+
+    @functools.wraps(function)
+    def result(*args, **kwargs):
+        fail(message, pytrace=False)
+
+    # keep reference to the original function in our own custom attribute so we don't unwrap
+    # further than this point and lose useful wrappings like @mock.patch (#3774)
+    result.__pytest_wrapped__ = _PytestWrapper(function)
+
+    return result
+
+
+@attr.s(frozen=True)
+class FixtureFunctionMarker:
+    scope = attr.ib()
+    params = attr.ib(converter=attr.converters.optional(tuple))
+    autouse = attr.ib(default=False)
+    # Ignore type because of https://github.com/python/mypy/issues/6172.
+    ids = attr.ib(default=None, converter=_ensure_immutable_ids)  # type: ignore
+    name = attr.ib(default=None)
+
+    def __call__(self, function):
+        if inspect.isclass(function):
+            raise ValueError("class fixtures not supported (maybe in the future)")
+
+        if getattr(function, "_pytestfixturefunction", False):
+            raise ValueError(
+                "fixture is being applied more than once to the same function"
+            )
+
+        function = wrap_function_to_error_out_if_called_directly(function, self)
+
+        name = self.name or function.__name__
+        if name == "request":
+            location = getlocation(function)
+            fail(
+                "'request' is a reserved word for fixtures, use another name:\n  {}".format(
+                    location
+                ),
+                pytrace=False,
+            )
+        function._pytestfixturefunction = self
+        return function
+
+
+FIXTURE_ARGS_ORDER = ("scope", "params", "autouse", "ids", "name")
+
+
+def _parse_fixture_args(callable_or_scope, *args, **kwargs):
+    arguments = {
+        "scope": "function",
+        "params": None,
+        "autouse": False,
+        "ids": None,
+        "name": None,
+    }
+    kwargs = {
+        key: value for key, value in kwargs.items() if arguments.get(key) != value
+    }
+
+    fixture_function = None
+    if isinstance(callable_or_scope, str):
+        args = list(args)
+        args.insert(0, callable_or_scope)
+    else:
+        fixture_function = callable_or_scope
+
+    positionals = set()
+    for positional, argument_name in zip(args, FIXTURE_ARGS_ORDER):
+        arguments[argument_name] = positional
+        positionals.add(argument_name)
+
+    duplicated_kwargs = {kwarg for kwarg in kwargs.keys() if kwarg in positionals}
+    if duplicated_kwargs:
+        raise TypeError(
+            "The fixture arguments are defined as positional and keyword: {}. "
+            "Use only keyword arguments.".format(", ".join(duplicated_kwargs))
+        )
+
+    if positionals:
+        warnings.warn(FIXTURE_POSITIONAL_ARGUMENTS, stacklevel=2)
+
+    arguments.update(kwargs)
+
+    return fixture_function, arguments
+
+
+def fixture(
+    callable_or_scope=None,
+    *args,
+    scope="function",
+    params=None,
+    autouse=False,
+    ids=None,
+    name=None
+):
+    """Decorator to mark a fixture factory function.
+
+    This decorator can be used, with or without parameters, to define a
+    fixture function.
+
+    The name of the fixture function can later be referenced to cause its
+    invocation ahead of running tests: test
+    modules or classes can use the ``pytest.mark.usefixtures(fixturename)``
+    marker.
+
+    Test functions can directly use fixture names as input
+    arguments in which case the fixture instance returned from the fixture
+    function will be injected.
+
+    Fixtures can provide their values to test functions using ``return`` or ``yield``
+    statements. When using ``yield`` the code block after the ``yield`` statement is executed
+    as teardown code regardless of the test outcome, and must yield exactly once.
+
+    :arg scope: the scope for which this fixture is shared, one of
+                ``"function"`` (default), ``"class"``, ``"module"``,
+                ``"package"`` or ``"session"`` (``"package"`` is considered **experimental**
+                at this time).
+
+                This parameter may also be a callable which receives ``(fixture_name, config)``
+                as parameters, and must return a ``str`` with one of the values mentioned above.
+
+                See :ref:`dynamic scope` in the docs for more information.
+
+    :arg params: an optional list of parameters which will cause multiple
+                invocations of the fixture function and all of the tests
+                using it.
+                The current parameter is available in ``request.param``.
+
+    :arg autouse: if True, the fixture func is activated for all tests that
+                can see it.  If False (the default) then an explicit
+                reference is needed to activate the fixture.
+
+    :arg ids: list of string ids each corresponding to the params
+                so that they are part of the test id. If no ids are provided
+                they will be generated automatically from the params.
+
+    :arg name: the name of the fixture. This defaults to the name of the
+                decorated function. If a fixture is used in the same module in
+                which it is defined, the function name of the fixture will be
+                shadowed by the function arg that requests the fixture; one way
+                to resolve this is to name the decorated function
+                ``fixture_<fixturename>`` and then use
+                ``@pytest.fixture(name='<fixturename>')``.
+    """
+    if params is not None:
+        params = list(params)
+
+    fixture_function, arguments = _parse_fixture_args(
+        callable_or_scope,
+        *args,
+        scope=scope,
+        params=params,
+        autouse=autouse,
+        ids=ids,
+        name=name,
+    )
+    scope = arguments.get("scope")
+    params = arguments.get("params")
+    autouse = arguments.get("autouse")
+    ids = arguments.get("ids")
+    name = arguments.get("name")
+
+    if fixture_function and params is None and autouse is False:
+        # direct decoration
+        return FixtureFunctionMarker(scope, params, autouse, name=name)(
+            fixture_function
+        )
+
+    return FixtureFunctionMarker(scope, params, autouse, ids=ids, name=name)
+
+
+def yield_fixture(
+    callable_or_scope=None,
+    *args,
+    scope="function",
+    params=None,
+    autouse=False,
+    ids=None,
+    name=None
+):
+    """ (return a) decorator to mark a yield-fixture factory function.
+
+    .. deprecated:: 3.0
+        Use :py:func:`pytest.fixture` directly instead.
+    """
+    return fixture(
+        callable_or_scope,
+        *args,
+        scope=scope,
+        params=params,
+        autouse=autouse,
+        ids=ids,
+        name=name,
+    )
+
+
+defaultfuncargprefixmarker = fixture()
+
+
+@fixture(scope="session")
+def pytestconfig(request):
+    """Session-scoped fixture that returns the :class:`_pytest.config.Config` object.
+
+    Example::
+
+        def test_foo(pytestconfig):
+            if pytestconfig.getoption("verbose") > 0:
+                ...
+
+    """
+    return request.config
+
+
+def pytest_addoption(parser):
+    parser.addini(
+        "usefixtures",
+        type="args",
+        default=[],
+        help="list of default fixtures to be used with this project",
+    )
+
+
+class FixtureManager:
+    """
+    pytest fixtures definitions and information is stored and managed
+    from this class.
+
+    During collection fm.parsefactories() is called multiple times to parse
+    fixture function definitions into FixtureDef objects and internal
+    data structures.
+
+    During collection of test functions, metafunc-mechanics instantiate
+    a FuncFixtureInfo object which is cached per node/func-name.
+    This FuncFixtureInfo object is later retrieved by Function nodes
+    which themselves offer a fixturenames attribute.
+
+    The FuncFixtureInfo object holds information about fixtures and FixtureDefs
+    relevant for a particular function.  An initial list of fixtures is
+    assembled like this:
+
+    - ini-defined usefixtures
+    - autouse-marked fixtures along the collection chain up from the function
+    - usefixtures markers at module/class/function level
+    - test function funcargs
+
+    Subsequently the funcfixtureinfo.fixturenames attribute is computed
+    as the closure of the fixtures needed to setup the initial fixtures,
+    i. e. fixtures needed by fixture functions themselves are appended
+    to the fixturenames list.
+
+    Upon the test-setup phases all fixturenames are instantiated, retrieved
+    by a lookup of their FuncFixtureInfo.
+    """
+
+    FixtureLookupError = FixtureLookupError
+    FixtureLookupErrorRepr = FixtureLookupErrorRepr
+
+    def __init__(self, session):
+        self.session = session
+        self.config = session.config
+        self._arg2fixturedefs = {}
+        self._holderobjseen = set()
+        self._nodeid_and_autousenames = [("", self.config.getini("usefixtures"))]
+        session.config.pluginmanager.register(self, "funcmanage")
+
+    def _get_direct_parametrize_args(self, node):
+        """This function returns all the direct parametrization
+        arguments of a node, so we don't mistake them for fixtures
+
+        Check https://github.com/pytest-dev/pytest/issues/5036
+
+        This things are done later as well when dealing with parametrization
+        so this could be improved
+        """
+        parametrize_argnames = []
+        for marker in node.iter_markers(name="parametrize"):
+            if not marker.kwargs.get("indirect", False):
+                p_argnames, _ = ParameterSet._parse_parametrize_args(
+                    *marker.args, **marker.kwargs
+                )
+                parametrize_argnames.extend(p_argnames)
+
+        return parametrize_argnames
+
+    def getfixtureinfo(self, node, func, cls, funcargs=True):
+        if funcargs and not getattr(node, "nofuncargs", False):
+            argnames = getfuncargnames(func, name=node.name, cls=cls)
+        else:
+            argnames = ()
+
+        usefixtures = itertools.chain.from_iterable(
+            mark.args for mark in node.iter_markers(name="usefixtures")
+        )
+        initialnames = tuple(usefixtures) + argnames
+        fm = node.session._fixturemanager
+        initialnames, names_closure, arg2fixturedefs = fm.getfixtureclosure(
+            initialnames, node, ignore_args=self._get_direct_parametrize_args(node)
+        )
+        return FuncFixtureInfo(argnames, initialnames, names_closure, arg2fixturedefs)
+
+    def pytest_plugin_registered(self, plugin):
+        nodeid = None
+        try:
+            p = py.path.local(plugin.__file__).realpath()
+        except AttributeError:
+            pass
+        else:
+            from _pytest import nodes
+
+            # construct the base nodeid which is later used to check
+            # what fixtures are visible for particular tests (as denoted
+            # by their test id)
+            if p.basename.startswith("conftest.py"):
+                nodeid = p.dirpath().relto(self.config.rootdir)
+                if p.sep != nodes.SEP:
+                    nodeid = nodeid.replace(p.sep, nodes.SEP)
+
+        self.parsefactories(plugin, nodeid)
+
+    def _getautousenames(self, nodeid):
+        """ return a tuple of fixture names to be used. """
+        autousenames = []
+        for baseid, basenames in self._nodeid_and_autousenames:
+            if nodeid.startswith(baseid):
+                if baseid:
+                    i = len(baseid)
+                    nextchar = nodeid[i : i + 1]
+                    if nextchar and nextchar not in ":/":
+                        continue
+                autousenames.extend(basenames)
+        return autousenames
+
+    def getfixtureclosure(self, fixturenames, parentnode, ignore_args=()):
+        # collect the closure of all fixtures , starting with the given
+        # fixturenames as the initial set.  As we have to visit all
+        # factory definitions anyway, we also return an arg2fixturedefs
+        # mapping so that the caller can reuse it and does not have
+        # to re-discover fixturedefs again for each fixturename
+        # (discovering matching fixtures for a given name/node is expensive)
+
+        parentid = parentnode.nodeid
+        fixturenames_closure = self._getautousenames(parentid)
+
+        def merge(otherlist):
+            for arg in otherlist:
+                if arg not in fixturenames_closure:
+                    fixturenames_closure.append(arg)
+
+        merge(fixturenames)
+
+        # at this point, fixturenames_closure contains what we call "initialnames",
+        # which is a set of fixturenames the function immediately requests. We
+        # need to return it as well, so save this.
+        initialnames = tuple(fixturenames_closure)
+
+        arg2fixturedefs = {}
+        lastlen = -1
+        while lastlen != len(fixturenames_closure):
+            lastlen = len(fixturenames_closure)
+            for argname in fixturenames_closure:
+                if argname in ignore_args:
+                    continue
+                if argname in arg2fixturedefs:
+                    continue
+                fixturedefs = self.getfixturedefs(argname, parentid)
+                if fixturedefs:
+                    arg2fixturedefs[argname] = fixturedefs
+                    merge(fixturedefs[-1].argnames)
+
+        def sort_by_scope(arg_name):
+            try:
+                fixturedefs = arg2fixturedefs[arg_name]
+            except KeyError:
+                return scopes.index("function")
+            else:
+                return fixturedefs[-1].scopenum
+
+        fixturenames_closure.sort(key=sort_by_scope)
+        return initialnames, fixturenames_closure, arg2fixturedefs
+
+    def pytest_generate_tests(self, metafunc):
+        for argname in metafunc.fixturenames:
+            faclist = metafunc._arg2fixturedefs.get(argname)
+            if faclist:
+                fixturedef = faclist[-1]
+                if fixturedef.params is not None:
+                    markers = list(metafunc.definition.iter_markers("parametrize"))
+                    for parametrize_mark in markers:
+                        if "argnames" in parametrize_mark.kwargs:
+                            argnames = parametrize_mark.kwargs["argnames"]
+                        else:
+                            argnames = parametrize_mark.args[0]
+
+                        if not isinstance(argnames, (tuple, list)):
+                            argnames = [
+                                x.strip() for x in argnames.split(",") if x.strip()
+                            ]
+                        if argname in argnames:
+                            break
+                    else:
+                        metafunc.parametrize(
+                            argname,
+                            fixturedef.params,
+                            indirect=True,
+                            scope=fixturedef.scope,
+                            ids=fixturedef.ids,
+                        )
+            else:
+                continue  # will raise FixtureLookupError at setup time
+
+    def pytest_collection_modifyitems(self, items):
+        # separate parametrized setups
+        items[:] = reorder_items(items)
+
+    def parsefactories(self, node_or_obj, nodeid=NOTSET, unittest=False):
+        if nodeid is not NOTSET:
+            holderobj = node_or_obj
+        else:
+            holderobj = node_or_obj.obj
+            nodeid = node_or_obj.nodeid
+        if holderobj in self._holderobjseen:
+            return
+
+        self._holderobjseen.add(holderobj)
+        autousenames = []
+        for name in dir(holderobj):
+            # The attribute can be an arbitrary descriptor, so the attribute
+            # access below can raise. safe_getatt() ignores such exceptions.
+            obj = safe_getattr(holderobj, name, None)
+            marker = getfixturemarker(obj)
+            if not isinstance(marker, FixtureFunctionMarker):
+                # magic globals  with __getattr__ might have got us a wrong
+                # fixture attribute
+                continue
+
+            if marker.name:
+                name = marker.name
+
+            # during fixture definition we wrap the original fixture function
+            # to issue a warning if called directly, so here we unwrap it in order to not emit the warning
+            # when pytest itself calls the fixture function
+            obj = get_real_method(obj, holderobj)
+
+            fixture_def = FixtureDef(
+                self,
+                nodeid,
+                name,
+                obj,
+                marker.scope,
+                marker.params,
+                unittest=unittest,
+                ids=marker.ids,
+            )
+
+            faclist = self._arg2fixturedefs.setdefault(name, [])
+            if fixture_def.has_location:
+                faclist.append(fixture_def)
+            else:
+                # fixturedefs with no location are at the front
+                # so this inserts the current fixturedef after the
+                # existing fixturedefs from external plugins but
+                # before the fixturedefs provided in conftests.
+                i = len([f for f in faclist if not f.has_location])
+                faclist.insert(i, fixture_def)
+            if marker.autouse:
+                autousenames.append(name)
+
+        if autousenames:
+            self._nodeid_and_autousenames.append((nodeid or "", autousenames))
+
+    def getfixturedefs(self, argname, nodeid):
+        """
+        Gets a list of fixtures which are applicable to the given node id.
+
+        :param str argname: name of the fixture to search for
+        :param str nodeid: full node id of the requesting test.
+        :return: list[FixtureDef]
+        """
+        try:
+            fixturedefs = self._arg2fixturedefs[argname]
+        except KeyError:
+            return None
+        return tuple(self._matchfactories(fixturedefs, nodeid))
+
+    def _matchfactories(self, fixturedefs, nodeid):
+        from _pytest import nodes
+
+        for fixturedef in fixturedefs:
+            if nodes.ischildnode(fixturedef.baseid, nodeid):
+                yield fixturedef
diff --git a/contrib/python/pytest/py3/_pytest/freeze_support.py b/contrib/python/pytest/py3/_pytest/freeze_support.py
new file mode 100644
index 0000000000..f9d613a2b6
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/freeze_support.py
@@ -0,0 +1,44 @@
+"""
+Provides a function to report all internal modules for using freezing tools
+pytest
+"""
+
+
+def freeze_includes():
+    """
+    Returns a list of module names used by pytest that should be
+    included by cx_freeze.
+    """
+    import py
+    import _pytest
+
+    result = list(_iter_all_modules(py))
+    result += list(_iter_all_modules(_pytest))
+    return result
+
+
+def _iter_all_modules(package, prefix=""):
+    """
+    Iterates over the names of all modules that can be found in the given
+    package, recursively.
+    Example:
+        _iter_all_modules(_pytest) ->
+            ['_pytest.assertion.newinterpret',
+             '_pytest.capture',
+             '_pytest.core',
+             ...
+            ]
+    """
+    import os
+    import pkgutil
+
+    if type(package) is not str:
+        path, prefix = package.__path__[0], package.__name__ + "."
+    else:
+        path = package
+    for _, name, is_package in pkgutil.iter_modules([path]):
+        if is_package:
+            for m in _iter_all_modules(os.path.join(path, name), prefix=name + "."):
+                yield prefix + m
+        else:
+            yield prefix + name
diff --git a/contrib/python/pytest/py3/_pytest/helpconfig.py b/contrib/python/pytest/py3/_pytest/helpconfig.py
new file mode 100644
index 0000000000..ae37fdea45
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/helpconfig.py
@@ -0,0 +1,246 @@
+""" version info, help messages, tracing configuration.  """
+import os
+import sys
+from argparse import Action
+
+import py
+
+import pytest
+from _pytest.config import PrintHelp
+
+
+class HelpAction(Action):
+    """This is an argparse Action that will raise an exception in
+    order to skip the rest of the argument parsing when --help is passed.
+    This prevents argparse from quitting due to missing required arguments
+    when any are defined, for example by ``pytest_addoption``.
+    This is similar to the way that the builtin argparse --help option is
+    implemented by raising SystemExit.
+    """
+
+    def __init__(self, option_strings, dest=None, default=False, help=None):
+        super().__init__(
+            option_strings=option_strings,
+            dest=dest,
+            const=True,
+            default=default,
+            nargs=0,
+            help=help,
+        )
+
+    def __call__(self, parser, namespace, values, option_string=None):
+        setattr(namespace, self.dest, self.const)
+
+        # We should only skip the rest of the parsing after preparse is done
+        if getattr(parser._parser, "after_preparse", False):
+            raise PrintHelp
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("debugconfig")
+    group.addoption(
+        "--version",
+        "-V",
+        action="store_true",
+        help="display pytest version and information about plugins.",
+    )
+    group._addoption(
+        "-h",
+        "--help",
+        action=HelpAction,
+        dest="help",
+        help="show help message and configuration info",
+    )
+    group._addoption(
+        "-p",
+        action="append",
+        dest="plugins",
+        default=[],
+        metavar="name",
+        help="early-load given plugin module name or entry point (multi-allowed). "
+        "To avoid loading of plugins, use the `no:` prefix, e.g. "
+        "`no:doctest`.",
+    )
+    group.addoption(
+        "--traceconfig",
+        "--trace-config",
+        action="store_true",
+        default=False,
+        help="trace considerations of conftest.py files.",
+    )
+    group.addoption(
+        "--debug",
+        action="store_true",
+        dest="debug",
+        default=False,
+        help="store internal tracing debug information in 'pytestdebug.log'.",
+    )
+    group._addoption(
+        "-o",
+        "--override-ini",
+        dest="override_ini",
+        action="append",
+        help='override ini option with "option=value" style, e.g. `-o xfail_strict=True -o cache_dir=cache`.',
+    )
+
+
+@pytest.hookimpl(hookwrapper=True)
+def pytest_cmdline_parse():
+    outcome = yield
+    config = outcome.get_result()
+    if config.option.debug:
+        path = os.path.abspath("pytestdebug.log")
+        debugfile = open(path, "w")
+        debugfile.write(
+            "versions pytest-%s, py-%s, "
+            "python-%s\ncwd=%s\nargs=%s\n\n"
+            % (
+                pytest.__version__,
+                py.__version__,
+                ".".join(map(str, sys.version_info)),
+                os.getcwd(),
+                config.invocation_params.args,
+            )
+        )
+        config.trace.root.setwriter(debugfile.write)
+        undo_tracing = config.pluginmanager.enable_tracing()
+        sys.stderr.write("writing pytestdebug information to %s\n" % path)
+
+        def unset_tracing():
+            debugfile.close()
+            sys.stderr.write("wrote pytestdebug information to %s\n" % debugfile.name)
+            config.trace.root.setwriter(None)
+            undo_tracing()
+
+        config.add_cleanup(unset_tracing)
+
+
+def showversion(config):
+    sys.stderr.write(
+        "This is pytest version {}, imported from {}\n".format(
+            pytest.__version__, pytest.__file__
+        )
+    )
+    plugininfo = getpluginversioninfo(config)
+    if plugininfo:
+        for line in plugininfo:
+            sys.stderr.write(line + "\n")
+
+
+def pytest_cmdline_main(config):
+    if config.option.version:
+        showversion(config)
+        return 0
+    elif config.option.help:
+        config._do_configure()
+        showhelp(config)
+        config._ensure_unconfigure()
+        return 0
+
+
+def showhelp(config):
+    import textwrap
+
+    reporter = config.pluginmanager.get_plugin("terminalreporter")
+    tw = reporter._tw
+    tw.write(config._parser.optparser.format_help())
+    tw.line()
+    tw.line(
+        "[pytest] ini-options in the first pytest.ini|tox.ini|setup.cfg file found:"
+    )
+    tw.line()
+
+    columns = tw.fullwidth  # costly call
+    indent_len = 24  # based on argparse's max_help_position=24
+    indent = " " * indent_len
+    for name in config._parser._ininames:
+        help, type, default = config._parser._inidict[name]
+        if type is None:
+            type = "string"
+        spec = "{} ({}):".format(name, type)
+        tw.write("  %s" % spec)
+        spec_len = len(spec)
+        if spec_len > (indent_len - 3):
+            # Display help starting at a new line.
+            tw.line()
+            helplines = textwrap.wrap(
+                help,
+                columns,
+                initial_indent=indent,
+                subsequent_indent=indent,
+                break_on_hyphens=False,
+            )
+
+            for line in helplines:
+                tw.line(line)
+        else:
+            # Display help starting after the spec, following lines indented.
+            tw.write(" " * (indent_len - spec_len - 2))
+            wrapped = textwrap.wrap(help, columns - indent_len, break_on_hyphens=False)
+
+            tw.line(wrapped[0])
+            for line in wrapped[1:]:
+                tw.line(indent + line)
+
+    tw.line()
+    tw.line("environment variables:")
+    vars = [
+        ("PYTEST_ADDOPTS", "extra command line options"),
+        ("PYTEST_PLUGINS", "comma-separated plugins to load during startup"),
+        ("PYTEST_DISABLE_PLUGIN_AUTOLOAD", "set to disable plugin auto-loading"),
+        ("PYTEST_DEBUG", "set to enable debug tracing of pytest's internals"),
+    ]
+    for name, help in vars:
+        tw.line("  {:<24} {}".format(name, help))
+    tw.line()
+    tw.line()
+
+    tw.line("to see available markers type: pytest --markers")
+    tw.line("to see available fixtures type: pytest --fixtures")
+    tw.line(
+        "(shown according to specified file_or_dir or current dir "
+        "if not specified; fixtures with leading '_' are only shown "
+        "with the '-v' option"
+    )
+
+    for warningreport in reporter.stats.get("warnings", []):
+        tw.line("warning : " + warningreport.message, red=True)
+    return
+
+
+conftest_options = [("pytest_plugins", "list of plugin names to load")]
+
+
+def getpluginversioninfo(config):
+    lines = []
+    plugininfo = config.pluginmanager.list_plugin_distinfo()
+    if plugininfo:
+        lines.append("setuptools registered plugins:")
+        for plugin, dist in plugininfo:
+            loc = getattr(plugin, "__file__", repr(plugin))
+            content = "{}-{} at {}".format(dist.project_name, dist.version, loc)
+            lines.append("  " + content)
+    return lines
+
+
+def pytest_report_header(config):
+    lines = []
+    if config.option.debug or config.option.traceconfig:
+        lines.append(
+            "using: pytest-{} pylib-{}".format(pytest.__version__, py.__version__)
+        )
+
+        verinfo = getpluginversioninfo(config)
+        if verinfo:
+            lines.extend(verinfo)
+
+    if config.option.traceconfig:
+        lines.append("active plugins:")
+        items = config.pluginmanager.list_name_plugin()
+        for name, plugin in items:
+            if hasattr(plugin, "__file__"):
+                r = plugin.__file__
+            else:
+                r = repr(plugin)
+            lines.append("    {:<20}: {}".format(name, r))
+    return lines
diff --git a/contrib/python/pytest/py3/_pytest/hookspec.py b/contrib/python/pytest/py3/_pytest/hookspec.py
new file mode 100644
index 0000000000..1e16d092d0
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/hookspec.py
@@ -0,0 +1,648 @@
+""" hook specifications for pytest plugins, invoked from main.py and builtin plugins.  """
+from typing import Any
+from typing import Optional
+
+from pluggy import HookspecMarker
+
+from .deprecated import COLLECT_DIRECTORY_HOOK
+from _pytest.compat import TYPE_CHECKING
+
+if TYPE_CHECKING:
+    from _pytest.main import Session
+
+
+hookspec = HookspecMarker("pytest")
+
+# -------------------------------------------------------------------------
+# Initialization hooks called for every plugin
+# -------------------------------------------------------------------------
+
+
+@hookspec(historic=True)
+def pytest_addhooks(pluginmanager):
+    """called at plugin registration time to allow adding new hooks via a call to
+    ``pluginmanager.add_hookspecs(module_or_class, prefix)``.
+
+
+    :param _pytest.config.PytestPluginManager pluginmanager: pytest plugin manager
+
+    .. note::
+        This hook is incompatible with ``hookwrapper=True``.
+    """
+
+
+@hookspec(historic=True)
+def pytest_plugin_registered(plugin, manager):
+    """ a new pytest plugin got registered.
+
+    :param plugin: the plugin module or instance
+    :param _pytest.config.PytestPluginManager manager: pytest plugin manager
+
+    .. note::
+        This hook is incompatible with ``hookwrapper=True``.
+    """
+
+
+@hookspec(historic=True)
+def pytest_addoption(parser, pluginmanager):
+    """register argparse-style options and ini-style config values,
+    called once at the beginning of a test run.
+
+    .. note::
+
+        This function should be implemented only in plugins or ``conftest.py``
+        files situated at the tests root directory due to how pytest
+        :ref:`discovers plugins during startup <pluginorder>`.
+
+    :arg _pytest.config.argparsing.Parser parser: To add command line options, call
+        :py:func:`parser.addoption(...) <_pytest.config.argparsing.Parser.addoption>`.
+        To add ini-file values call :py:func:`parser.addini(...)
+        <_pytest.config.argparsing.Parser.addini>`.
+
+    :arg _pytest.config.PytestPluginManager pluginmanager: pytest plugin manager,
+        which can be used to install :py:func:`hookspec`'s or :py:func:`hookimpl`'s
+        and allow one plugin to call another plugin's hooks to change how
+        command line options are added.
+
+    Options can later be accessed through the
+    :py:class:`config <_pytest.config.Config>` object, respectively:
+
+    - :py:func:`config.getoption(name) <_pytest.config.Config.getoption>` to
+      retrieve the value of a command line option.
+
+    - :py:func:`config.getini(name) <_pytest.config.Config.getini>` to retrieve
+      a value read from an ini-style file.
+
+    The config object is passed around on many internal objects via the ``.config``
+    attribute or can be retrieved as the ``pytestconfig`` fixture.
+
+    .. note::
+        This hook is incompatible with ``hookwrapper=True``.
+    """
+
+
+@hookspec(historic=True)
+def pytest_configure(config):
+    """
+    Allows plugins and conftest files to perform initial configuration.
+
+    This hook is called for every plugin and initial conftest file
+    after command line options have been parsed.
+
+    After that, the hook is called for other conftest files as they are
+    imported.
+
+    .. note::
+        This hook is incompatible with ``hookwrapper=True``.
+
+    :arg _pytest.config.Config config: pytest config object
+    """
+
+
+# -------------------------------------------------------------------------
+# Bootstrapping hooks called for plugins registered early enough:
+# internal and 3rd party plugins.
+# -------------------------------------------------------------------------
+
+
+@hookspec(firstresult=True)
+def pytest_cmdline_parse(pluginmanager, args):
+    """return initialized config object, parsing the specified args.
+
+    Stops at first non-None result, see :ref:`firstresult`
+
+    .. note::
+        This hook will only be called for plugin classes passed to the ``plugins`` arg when using `pytest.main`_ to
+        perform an in-process test run.
+
+    :param _pytest.config.PytestPluginManager pluginmanager: pytest plugin manager
+    :param list[str] args: list of arguments passed on the command line
+    """
+
+
+def pytest_cmdline_preparse(config, args):
+    """(**Deprecated**) modify command line arguments before option parsing.
+
+    This hook is considered deprecated and will be removed in a future pytest version. Consider
+    using :func:`pytest_load_initial_conftests` instead.
+
+    .. note::
+        This hook will not be called for ``conftest.py`` files, only for setuptools plugins.
+
+    :param _pytest.config.Config config: pytest config object
+    :param list[str] args: list of arguments passed on the command line
+    """
+
+
+@hookspec(firstresult=True)
+def pytest_cmdline_main(config):
+    """ called for performing the main command line action. The default
+    implementation will invoke the configure hooks and runtest_mainloop.
+
+    .. note::
+        This hook will not be called for ``conftest.py`` files, only for setuptools plugins.
+
+    Stops at first non-None result, see :ref:`firstresult`
+
+    :param _pytest.config.Config config: pytest config object
+    """
+
+
+def pytest_load_initial_conftests(early_config, parser, args):
+    """ implements the loading of initial conftest files ahead
+    of command line option parsing.
+
+    .. note::
+        This hook will not be called for ``conftest.py`` files, only for setuptools plugins.
+
+    :param _pytest.config.Config early_config: pytest config object
+    :param list[str] args: list of arguments passed on the command line
+    :param _pytest.config.argparsing.Parser parser: to add command line options
+    """
+
+
+# -------------------------------------------------------------------------
+# collection hooks
+# -------------------------------------------------------------------------
+
+
+@hookspec(firstresult=True)
+def pytest_collection(session: "Session") -> Optional[Any]:
+    """Perform the collection protocol for the given session.
+
+    Stops at first non-None result, see :ref:`firstresult`.
+
+    :param _pytest.main.Session session: the pytest session object
+    """
+
+
+def pytest_collection_modifyitems(session, config, items):
+    """ called after collection has been performed, may filter or re-order
+    the items in-place.
+
+    :param _pytest.main.Session session: the pytest session object
+    :param _pytest.config.Config config: pytest config object
+    :param List[_pytest.nodes.Item] items: list of item objects
+    """
+
+
+def pytest_collection_finish(session):
+    """ called after collection has been performed and modified.
+
+    :param _pytest.main.Session session: the pytest session object
+    """
+
+
+@hookspec(firstresult=True)
+def pytest_ignore_collect(path, config):
+    """ return True to prevent considering this path for collection.
+    This hook is consulted for all files and directories prior to calling
+    more specific hooks.
+
+    Stops at first non-None result, see :ref:`firstresult`
+
+    :param path: a :py:class:`py.path.local` - the path to analyze
+    :param _pytest.config.Config config: pytest config object
+    """
+
+
+@hookspec(firstresult=True, warn_on_impl=COLLECT_DIRECTORY_HOOK)
+def pytest_collect_directory(path, parent):
+    """ called before traversing a directory for collection files.
+
+    Stops at first non-None result, see :ref:`firstresult`
+
+    :param path: a :py:class:`py.path.local` - the path to analyze
+    """
+
+
+def pytest_collect_file(path, parent):
+    """ return collection Node or None for the given path. Any new node
+    needs to have the specified ``parent`` as a parent.
+
+    :param path: a :py:class:`py.path.local` - the path to collect
+    """
+
+
+# logging hooks for collection
+
+
+def pytest_collectstart(collector):
+    """ collector starts collecting. """
+
+
+def pytest_itemcollected(item):
+    """ we just collected a test item. """
+
+
+def pytest_collectreport(report):
+    """ collector finished collecting. """
+
+
+def pytest_deselected(items):
+    """ called for test items deselected, e.g. by keyword. """
+
+
+@hookspec(firstresult=True)
+def pytest_make_collect_report(collector):
+    """ perform ``collector.collect()`` and return a CollectReport.
+
+    Stops at first non-None result, see :ref:`firstresult` """
+
+
+# -------------------------------------------------------------------------
+# Python test function related hooks
+# -------------------------------------------------------------------------
+
+
+@hookspec(firstresult=True)
+def pytest_pycollect_makemodule(path, parent):
+    """ return a Module collector or None for the given path.
+    This hook will be called for each matching test module path.
+    The pytest_collect_file hook needs to be used if you want to
+    create test modules for files that do not match as a test module.
+
+    Stops at first non-None result, see :ref:`firstresult`
+
+    :param path: a :py:class:`py.path.local` - the path of module to collect
+    """
+
+
+@hookspec(firstresult=True)
+def pytest_pycollect_makeitem(collector, name, obj):
+    """ return custom item/collector for a python object in a module, or None.
+
+    Stops at first non-None result, see :ref:`firstresult` """
+
+
+@hookspec(firstresult=True)
+def pytest_pyfunc_call(pyfuncitem):
+    """ call underlying test function.
+
+    Stops at first non-None result, see :ref:`firstresult` """
+
+
+def pytest_generate_tests(metafunc):
+    """ generate (multiple) parametrized calls to a test function."""
+
+
+@hookspec(firstresult=True)
+def pytest_make_parametrize_id(config, val, argname):
+    """Return a user-friendly string representation of the given ``val`` that will be used
+    by @pytest.mark.parametrize calls. Return None if the hook doesn't know about ``val``.
+    The parameter name is available as ``argname``, if required.
+
+    Stops at first non-None result, see :ref:`firstresult`
+
+    :param _pytest.config.Config config: pytest config object
+    :param val: the parametrized value
+    :param str argname: the automatic parameter name produced by pytest
+    """
+
+
+# -------------------------------------------------------------------------
+# generic runtest related hooks
+# -------------------------------------------------------------------------
+
+
+@hookspec(firstresult=True)
+def pytest_runtestloop(session):
+    """ called for performing the main runtest loop
+    (after collection finished).
+
+    Stops at first non-None result, see :ref:`firstresult`
+
+    :param _pytest.main.Session session: the pytest session object
+    """
+
+
+@hookspec(firstresult=True)
+def pytest_runtest_protocol(item, nextitem):
+    """ implements the runtest_setup/call/teardown protocol for
+    the given test item, including capturing exceptions and calling
+    reporting hooks.
+
+    :arg item: test item for which the runtest protocol is performed.
+
+    :arg nextitem: the scheduled-to-be-next test item (or None if this
+                   is the end my friend).  This argument is passed on to
+                   :py:func:`pytest_runtest_teardown`.
+
+    :return boolean: True if no further hook implementations should be invoked.
+
+
+    Stops at first non-None result, see :ref:`firstresult` """
+
+
+def pytest_runtest_logstart(nodeid, location):
+    """ signal the start of running a single test item.
+
+    This hook will be called **before** :func:`pytest_runtest_setup`, :func:`pytest_runtest_call` and
+    :func:`pytest_runtest_teardown` hooks.
+
+    :param str nodeid: full id of the item
+    :param location: a triple of ``(filename, linenum, testname)``
+    """
+
+
+def pytest_runtest_logfinish(nodeid, location):
+    """ signal the complete finish of running a single test item.
+
+    This hook will be called **after** :func:`pytest_runtest_setup`, :func:`pytest_runtest_call` and
+    :func:`pytest_runtest_teardown` hooks.
+
+    :param str nodeid: full id of the item
+    :param location: a triple of ``(filename, linenum, testname)``
+    """
+
+
+def pytest_runtest_setup(item):
+    """ called before ``pytest_runtest_call(item)``. """
+
+
+def pytest_runtest_call(item):
+    """ called to execute the test ``item``. """
+
+
+def pytest_runtest_teardown(item, nextitem):
+    """ called after ``pytest_runtest_call``.
+
+    :arg nextitem: the scheduled-to-be-next test item (None if no further
+                   test item is scheduled).  This argument can be used to
+                   perform exact teardowns, i.e. calling just enough finalizers
+                   so that nextitem only needs to call setup-functions.
+    """
+
+
+@hookspec(firstresult=True)
+def pytest_runtest_makereport(item, call):
+    """ return a :py:class:`_pytest.runner.TestReport` object
+    for the given :py:class:`pytest.Item <_pytest.main.Item>` and
+    :py:class:`_pytest.runner.CallInfo`.
+
+    Stops at first non-None result, see :ref:`firstresult` """
+
+
+def pytest_runtest_logreport(report):
+    """ process a test setup/call/teardown report relating to
+    the respective phase of executing a test. """
+
+
+@hookspec(firstresult=True)
+def pytest_report_to_serializable(config, report):
+    """
+    Serializes the given report object into a data structure suitable for sending
+    over the wire, e.g. converted to JSON.
+    """
+
+
+@hookspec(firstresult=True)
+def pytest_report_from_serializable(config, data):
+    """
+    Restores a report object previously serialized with pytest_report_to_serializable().
+    """
+
+
+# -------------------------------------------------------------------------
+# Fixture related hooks
+# -------------------------------------------------------------------------
+
+
+@hookspec(firstresult=True)
+def pytest_fixture_setup(fixturedef, request):
+    """ performs fixture setup execution.
+
+    :return: The return value of the call to the fixture function
+
+    Stops at first non-None result, see :ref:`firstresult`
+
+    .. note::
+        If the fixture function returns None, other implementations of
+        this hook function will continue to be called, according to the
+        behavior of the :ref:`firstresult` option.
+    """
+
+
+def pytest_fixture_post_finalizer(fixturedef, request):
+    """Called after fixture teardown, but before the cache is cleared, so
+    the fixture result ``fixturedef.cached_result`` is still available (not
+    ``None``)."""
+
+
+# -------------------------------------------------------------------------
+# test session related hooks
+# -------------------------------------------------------------------------
+
+
+def pytest_sessionstart(session):
+    """ called after the ``Session`` object has been created and before performing collection
+    and entering the run test loop.
+
+    :param _pytest.main.Session session: the pytest session object
+    """
+
+
+def pytest_sessionfinish(session, exitstatus):
+    """ called after whole test run finished, right before returning the exit status to the system.
+
+    :param _pytest.main.Session session: the pytest session object
+    :param int exitstatus: the status which pytest will return to the system
+    """
+
+
+def pytest_unconfigure(config):
+    """ called before test process is exited.
+
+    :param _pytest.config.Config config: pytest config object
+    """
+
+
+# -------------------------------------------------------------------------
+# hooks for customizing the assert methods
+# -------------------------------------------------------------------------
+
+
+def pytest_assertrepr_compare(config, op, left, right):
+    """return explanation for comparisons in failing assert expressions.
+
+    Return None for no custom explanation, otherwise return a list
+    of strings.  The strings will be joined by newlines but any newlines
+    *in* a string will be escaped.  Note that all but the first line will
+    be indented slightly, the intention is for the first line to be a summary.
+
+    :param _pytest.config.Config config: pytest config object
+    """
+
+
+def pytest_assertion_pass(item, lineno, orig, expl):
+    """
+    **(Experimental)**
+
+    .. versionadded:: 5.0
+
+    Hook called whenever an assertion *passes*.
+
+    Use this hook to do some processing after a passing assertion.
+    The original assertion information is available in the `orig` string
+    and the pytest introspected assertion information is available in the
+    `expl` string.
+
+    This hook must be explicitly enabled by the ``enable_assertion_pass_hook``
+    ini-file option:
+
+    .. code-block:: ini
+
+        [pytest]
+        enable_assertion_pass_hook=true
+
+    You need to **clean the .pyc** files in your project directory and interpreter libraries
+    when enabling this option, as assertions will require to be re-written.
+
+    :param _pytest.nodes.Item item: pytest item object of current test
+    :param int lineno: line number of the assert statement
+    :param string orig: string with original assertion
+    :param string expl: string with assert explanation
+
+    .. note::
+
+        This hook is **experimental**, so its parameters or even the hook itself might
+        be changed/removed without warning in any future pytest release.
+
+        If you find this hook useful, please share your feedback opening an issue.
+    """
+
+
+# -------------------------------------------------------------------------
+# hooks for influencing reporting (invoked from _pytest_terminal)
+# -------------------------------------------------------------------------
+
+
+def pytest_report_header(config, startdir):
+    """ return a string or list of strings to be displayed as header info for terminal reporting.
+
+    :param _pytest.config.Config config: pytest config object
+    :param startdir: py.path object with the starting dir
+
+    .. note::
+
+        This function should be implemented only in plugins or ``conftest.py``
+        files situated at the tests root directory due to how pytest
+        :ref:`discovers plugins during startup <pluginorder>`.
+    """
+
+
+def pytest_report_collectionfinish(config, startdir, items):
+    """
+    .. versionadded:: 3.2
+
+    return a string or list of strings to be displayed after collection has finished successfully.
+
+    This strings will be displayed after the standard "collected X items" message.
+
+    :param _pytest.config.Config config: pytest config object
+    :param startdir: py.path object with the starting dir
+    :param items: list of pytest items that are going to be executed; this list should not be modified.
+    """
+
+
+@hookspec(firstresult=True)
+def pytest_report_teststatus(report, config):
+    """ return result-category, shortletter and verbose word for reporting.
+
+    :param _pytest.config.Config config: pytest config object
+
+    Stops at first non-None result, see :ref:`firstresult` """
+
+
+def pytest_terminal_summary(terminalreporter, exitstatus, config):
+    """Add a section to terminal summary reporting.
+
+    :param _pytest.terminal.TerminalReporter terminalreporter: the internal terminal reporter object
+    :param int exitstatus: the exit status that will be reported back to the OS
+    :param _pytest.config.Config config: pytest config object
+
+    .. versionadded:: 4.2
+        The ``config`` parameter.
+    """
+
+
+@hookspec(historic=True)
+def pytest_warning_captured(warning_message, when, item, location):
+    """
+    Process a warning captured by the internal pytest warnings plugin.
+
+    :param warnings.WarningMessage warning_message:
+        The captured warning. This is the same object produced by :py:func:`warnings.catch_warnings`, and contains
+        the same attributes as the parameters of :py:func:`warnings.showwarning`.
+
+    :param str when:
+        Indicates when the warning was captured. Possible values:
+
+        * ``"config"``: during pytest configuration/initialization stage.
+        * ``"collect"``: during test collection.
+        * ``"runtest"``: during test execution.
+
+    :param pytest.Item|None item:
+        **DEPRECATED**: This parameter is incompatible with ``pytest-xdist``, and will always receive ``None``
+        in a future release.
+
+        The item being executed if ``when`` is ``"runtest"``, otherwise ``None``.
+
+    :param tuple location:
+        Holds information about the execution context of the captured warning (filename, linenumber, function).
+        ``function`` evaluates to <module> when the execution context is at the module level.
+    """
+
+
+# -------------------------------------------------------------------------
+# doctest hooks
+# -------------------------------------------------------------------------
+
+
+@hookspec(firstresult=True)
+def pytest_doctest_prepare_content(content):
+    """ return processed content for a given doctest
+
+    Stops at first non-None result, see :ref:`firstresult` """
+
+
+# -------------------------------------------------------------------------
+# error handling and internal debugging hooks
+# -------------------------------------------------------------------------
+
+
+def pytest_internalerror(excrepr, excinfo):
+    """ called for internal errors. """
+
+
+def pytest_keyboard_interrupt(excinfo):
+    """ called for keyboard interrupt. """
+
+
+def pytest_exception_interact(node, call, report):
+    """called when an exception was raised which can potentially be
+    interactively handled.
+
+    This hook is only called if an exception was raised
+    that is not an internal exception like ``skip.Exception``.
+    """
+
+
+def pytest_enter_pdb(config, pdb):
+    """ called upon pdb.set_trace(), can be used by plugins to take special
+    action just before the python debugger enters in interactive mode.
+
+    :param _pytest.config.Config config: pytest config object
+    :param pdb.Pdb pdb: Pdb instance
+    """
+
+
+def pytest_leave_pdb(config, pdb):
+    """ called when leaving pdb (e.g. with continue after pdb.set_trace()).
+
+    Can be used by plugins to take special action just after the python
+    debugger leaves interactive mode.
+
+    :param _pytest.config.Config config: pytest config object
+    :param pdb.Pdb pdb: Pdb instance
+    """
diff --git a/contrib/python/pytest/py3/_pytest/junitxml.py b/contrib/python/pytest/py3/_pytest/junitxml.py
new file mode 100644
index 0000000000..77e1843127
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/junitxml.py
@@ -0,0 +1,682 @@
+"""
+    report test results in JUnit-XML format,
+    for use with Jenkins and build integration servers.
+
+
+Based on initial code from Ross Lawley.
+
+Output conforms to https://github.com/jenkinsci/xunit-plugin/blob/master/
+src/main/resources/org/jenkinsci/plugins/xunit/types/model/xsd/junit-10.xsd
+"""
+import functools
+import os
+import platform
+import re
+import sys
+import time
+from datetime import datetime
+
+import py
+
+import pytest
+from _pytest import deprecated
+from _pytest import nodes
+from _pytest.config import filename_arg
+from _pytest.store import StoreKey
+from _pytest.warnings import _issue_warning_captured
+
+
+xml_key = StoreKey["LogXML"]()
+
+
+class Junit(py.xml.Namespace):
+    pass
+
+
+# We need to get the subset of the invalid unicode ranges according to
+# XML 1.0 which are valid in this python build.  Hence we calculate
+# this dynamically instead of hardcoding it.  The spec range of valid
+# chars is: Char ::= #x9 | #xA | #xD | [#x20-#xD7FF] | [#xE000-#xFFFD]
+#                    | [#x10000-#x10FFFF]
+_legal_chars = (0x09, 0x0A, 0x0D)
+_legal_ranges = ((0x20, 0x7E), (0x80, 0xD7FF), (0xE000, 0xFFFD), (0x10000, 0x10FFFF))
+_legal_xml_re = [
+    "{}-{}".format(chr(low), chr(high))
+    for (low, high) in _legal_ranges
+    if low < sys.maxunicode
+]
+_legal_xml_re = [chr(x) for x in _legal_chars] + _legal_xml_re
+illegal_xml_re = re.compile("[^%s]" % "".join(_legal_xml_re))
+del _legal_chars
+del _legal_ranges
+del _legal_xml_re
+
+_py_ext_re = re.compile(r"\.py$")
+
+
+def bin_xml_escape(arg):
+    def repl(matchobj):
+        i = ord(matchobj.group())
+        if i <= 0xFF:
+            return "#x%02X" % i
+        else:
+            return "#x%04X" % i
+
+    return py.xml.raw(illegal_xml_re.sub(repl, py.xml.escape(arg)))
+
+
+def merge_family(left, right):
+    result = {}
+    for kl, vl in left.items():
+        for kr, vr in right.items():
+            if not isinstance(vl, list):
+                raise TypeError(type(vl))
+            result[kl] = vl + vr
+    left.update(result)
+
+
+families = {}
+families["_base"] = {"testcase": ["classname", "name"]}
+families["_base_legacy"] = {"testcase": ["file", "line", "url"]}
+
+# xUnit 1.x inherits legacy attributes
+families["xunit1"] = families["_base"].copy()
+merge_family(families["xunit1"], families["_base_legacy"])
+
+# xUnit 2.x uses strict base attributes
+families["xunit2"] = families["_base"]
+
+
+class _NodeReporter:
+    def __init__(self, nodeid, xml):
+        self.id = nodeid
+        self.xml = xml
+        self.add_stats = self.xml.add_stats
+        self.family = self.xml.family
+        self.duration = 0
+        self.properties = []
+        self.nodes = []
+        self.testcase = None
+        self.attrs = {}
+
+    def append(self, node):
+        self.xml.add_stats(type(node).__name__)
+        self.nodes.append(node)
+
+    def add_property(self, name, value):
+        self.properties.append((str(name), bin_xml_escape(value)))
+
+    def add_attribute(self, name, value):
+        self.attrs[str(name)] = bin_xml_escape(value)
+
+    def make_properties_node(self):
+        """Return a Junit node containing custom properties, if any.
+        """
+        if self.properties:
+            return Junit.properties(
+                [
+                    Junit.property(name=name, value=value)
+                    for name, value in self.properties
+                ]
+            )
+        return ""
+
+    def record_testreport(self, testreport):
+        assert not self.testcase
+        names = mangle_test_address(testreport.nodeid)
+        existing_attrs = self.attrs
+        classnames = names[:-1]
+        if self.xml.prefix:
+            classnames.insert(0, self.xml.prefix)
+        attrs = {
+            "classname": ".".join(classnames),
+            "name": bin_xml_escape(names[-1]),
+            "file": testreport.location[0],
+        }
+        if testreport.location[1] is not None:
+            attrs["line"] = testreport.location[1]
+        if hasattr(testreport, "url"):
+            attrs["url"] = testreport.url
+        self.attrs = attrs
+        self.attrs.update(existing_attrs)  # restore any user-defined attributes
+
+        # Preserve legacy testcase behavior
+        if self.family == "xunit1":
+            return
+
+        # Filter out attributes not permitted by this test family.
+        # Including custom attributes because they are not valid here.
+        temp_attrs = {}
+        for key in self.attrs.keys():
+            if key in families[self.family]["testcase"]:
+                temp_attrs[key] = self.attrs[key]
+        self.attrs = temp_attrs
+
+    def to_xml(self):
+        testcase = Junit.testcase(time="%.3f" % self.duration, **self.attrs)
+        testcase.append(self.make_properties_node())
+        for node in self.nodes:
+            testcase.append(node)
+        return testcase
+
+    def _add_simple(self, kind, message, data=None):
+        data = bin_xml_escape(data)
+        node = kind(data, message=message)
+        self.append(node)
+
+    def write_captured_output(self, report):
+        if not self.xml.log_passing_tests and report.passed:
+            return
+
+        content_out = report.capstdout
+        content_log = report.caplog
+        content_err = report.capstderr
+        if self.xml.logging == "no":
+            return
+        content_all = ""
+        if self.xml.logging in ["log", "all"]:
+            content_all = self._prepare_content(content_log, " Captured Log ")
+        if self.xml.logging in ["system-out", "out-err", "all"]:
+            content_all += self._prepare_content(content_out, " Captured Out ")
+            self._write_content(report, content_all, "system-out")
+            content_all = ""
+        if self.xml.logging in ["system-err", "out-err", "all"]:
+            content_all += self._prepare_content(content_err, " Captured Err ")
+            self._write_content(report, content_all, "system-err")
+            content_all = ""
+        if content_all:
+            self._write_content(report, content_all, "system-out")
+
+    def _prepare_content(self, content, header):
+        return "\n".join([header.center(80, "-"), content, ""])
+
+    def _write_content(self, report, content, jheader):
+        tag = getattr(Junit, jheader)
+        self.append(tag(bin_xml_escape(content)))
+
+    def append_pass(self, report):
+        self.add_stats("passed")
+
+    def append_failure(self, report):
+        # msg = str(report.longrepr.reprtraceback.extraline)
+        if hasattr(report, "wasxfail"):
+            self._add_simple(Junit.skipped, "xfail-marked test passes unexpectedly")
+        else:
+            if hasattr(report.longrepr, "reprcrash"):
+                message = report.longrepr.reprcrash.message
+            elif isinstance(report.longrepr, str):
+                message = report.longrepr
+            else:
+                message = str(report.longrepr)
+            message = bin_xml_escape(message)
+            fail = Junit.failure(message=message)
+            fail.append(bin_xml_escape(report.longrepr))
+            self.append(fail)
+
+    def append_collect_error(self, report):
+        # msg = str(report.longrepr.reprtraceback.extraline)
+        self.append(
+            Junit.error(bin_xml_escape(report.longrepr), message="collection failure")
+        )
+
+    def append_collect_skipped(self, report):
+        self._add_simple(Junit.skipped, "collection skipped", report.longrepr)
+
+    def append_error(self, report):
+        if report.when == "teardown":
+            msg = "test teardown failure"
+        else:
+            msg = "test setup failure"
+        self._add_simple(Junit.error, msg, report.longrepr)
+
+    def append_skipped(self, report):
+        if hasattr(report, "wasxfail"):
+            xfailreason = report.wasxfail
+            if xfailreason.startswith("reason: "):
+                xfailreason = xfailreason[8:]
+            self.append(
+                Junit.skipped(
+                    "", type="pytest.xfail", message=bin_xml_escape(xfailreason)
+                )
+            )
+        else:
+            filename, lineno, skipreason = report.longrepr
+            if skipreason.startswith("Skipped: "):
+                skipreason = skipreason[9:]
+            details = "{}:{}: {}".format(filename, lineno, skipreason)
+
+            self.append(
+                Junit.skipped(
+                    bin_xml_escape(details),
+                    type="pytest.skip",
+                    message=bin_xml_escape(skipreason),
+                )
+            )
+            self.write_captured_output(report)
+
+    def finalize(self):
+        data = self.to_xml().unicode(indent=0)
+        self.__dict__.clear()
+        self.to_xml = lambda: py.xml.raw(data)
+
+
+def _warn_incompatibility_with_xunit2(request, fixture_name):
+    """Emits a PytestWarning about the given fixture being incompatible with newer xunit revisions"""
+    from _pytest.warning_types import PytestWarning
+
+    xml = request.config._store.get(xml_key, None)
+    if xml is not None and xml.family not in ("xunit1", "legacy"):
+        request.node.warn(
+            PytestWarning(
+                "{fixture_name} is incompatible with junit_family '{family}' (use 'legacy' or 'xunit1')".format(
+                    fixture_name=fixture_name, family=xml.family
+                )
+            )
+        )
+
+
+@pytest.fixture
+def record_property(request):
+    """Add an extra properties the calling test.
+    User properties become part of the test report and are available to the
+    configured reporters, like JUnit XML.
+    The fixture is callable with ``(name, value)``, with value being automatically
+    xml-encoded.
+
+    Example::
+
+        def test_function(record_property):
+            record_property("example_key", 1)
+    """
+    _warn_incompatibility_with_xunit2(request, "record_property")
+
+    def append_property(name, value):
+        request.node.user_properties.append((name, value))
+
+    return append_property
+
+
+@pytest.fixture
+def record_xml_attribute(request):
+    """Add extra xml attributes to the tag for the calling test.
+    The fixture is callable with ``(name, value)``, with value being
+    automatically xml-encoded
+    """
+    from _pytest.warning_types import PytestExperimentalApiWarning
+
+    request.node.warn(
+        PytestExperimentalApiWarning("record_xml_attribute is an experimental feature")
+    )
+
+    _warn_incompatibility_with_xunit2(request, "record_xml_attribute")
+
+    # Declare noop
+    def add_attr_noop(name, value):
+        pass
+
+    attr_func = add_attr_noop
+
+    xml = request.config._store.get(xml_key, None)
+    if xml is not None:
+        node_reporter = xml.node_reporter(request.node.nodeid)
+        attr_func = node_reporter.add_attribute
+
+    return attr_func
+
+
+def _check_record_param_type(param, v):
+    """Used by record_testsuite_property to check that the given parameter name is of the proper
+    type"""
+    __tracebackhide__ = True
+    if not isinstance(v, str):
+        msg = "{param} parameter needs to be a string, but {g} given"
+        raise TypeError(msg.format(param=param, g=type(v).__name__))
+
+
+@pytest.fixture(scope="session")
+def record_testsuite_property(request):
+    """
+    Records a new ``<property>`` tag as child of the root ``<testsuite>``. This is suitable to
+    writing global information regarding the entire test suite, and is compatible with ``xunit2`` JUnit family.
+
+    This is a ``session``-scoped fixture which is called with ``(name, value)``. Example:
+
+    .. code-block:: python
+
+        def test_foo(record_testsuite_property):
+            record_testsuite_property("ARCH", "PPC")
+            record_testsuite_property("STORAGE_TYPE", "CEPH")
+
+    ``name`` must be a string, ``value`` will be converted to a string and properly xml-escaped.
+    """
+
+    __tracebackhide__ = True
+
+    def record_func(name, value):
+        """noop function in case --junitxml was not passed in the command-line"""
+        __tracebackhide__ = True
+        _check_record_param_type("name", name)
+
+    xml = request.config._store.get(xml_key, None)
+    if xml is not None:
+        record_func = xml.add_global_property  # noqa
+    return record_func
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("terminal reporting")
+    group.addoption(
+        "--junitxml",
+        "--junit-xml",
+        action="store",
+        dest="xmlpath",
+        metavar="path",
+        type=functools.partial(filename_arg, optname="--junitxml"),
+        default=None,
+        help="create junit-xml style report file at given path.",
+    )
+    group.addoption(
+        "--junitprefix",
+        "--junit-prefix",
+        action="store",
+        metavar="str",
+        default=None,
+        help="prepend prefix to classnames in junit-xml output",
+    )
+    parser.addini(
+        "junit_suite_name", "Test suite name for JUnit report", default="pytest"
+    )
+    parser.addini(
+        "junit_logging",
+        "Write captured log messages to JUnit report: "
+        "one of no|log|system-out|system-err|out-err|all",
+        default="no",
+    )
+    parser.addini(
+        "junit_log_passing_tests",
+        "Capture log information for passing tests to JUnit report: ",
+        type="bool",
+        default=True,
+    )
+    parser.addini(
+        "junit_duration_report",
+        "Duration time to report: one of total|call",
+        default="total",
+    )  # choices=['total', 'call'])
+    parser.addini(
+        "junit_family", "Emit XML for schema: one of legacy|xunit1|xunit2", default=None
+    )
+
+
+def pytest_configure(config):
+    xmlpath = config.option.xmlpath
+    # prevent opening xmllog on slave nodes (xdist)
+    if xmlpath and not hasattr(config, "slaveinput"):
+        junit_family = config.getini("junit_family")
+        if not junit_family:
+            _issue_warning_captured(deprecated.JUNIT_XML_DEFAULT_FAMILY, config.hook, 2)
+            junit_family = "xunit1"
+        config._store[xml_key] = LogXML(
+            xmlpath,
+            config.option.junitprefix,
+            config.getini("junit_suite_name"),
+            config.getini("junit_logging"),
+            config.getini("junit_duration_report"),
+            junit_family,
+            config.getini("junit_log_passing_tests"),
+        )
+        config.pluginmanager.register(config._store[xml_key])
+
+
+def pytest_unconfigure(config):
+    xml = config._store.get(xml_key, None)
+    if xml:
+        del config._store[xml_key]
+        config.pluginmanager.unregister(xml)
+
+
+def mangle_test_address(address):
+    path, possible_open_bracket, params = address.partition("[")
+    names = path.split("::")
+    try:
+        names.remove("()")
+    except ValueError:
+        pass
+    # convert file path to dotted path
+    names[0] = names[0].replace(nodes.SEP, ".")
+    names[0] = _py_ext_re.sub("", names[0])
+    # put any params back
+    names[-1] += possible_open_bracket + params
+    return names
+
+
+class LogXML:
+    def __init__(
+        self,
+        logfile,
+        prefix,
+        suite_name="pytest",
+        logging="no",
+        report_duration="total",
+        family="xunit1",
+        log_passing_tests=True,
+    ):
+        logfile = os.path.expanduser(os.path.expandvars(logfile))
+        self.logfile = os.path.normpath(os.path.abspath(logfile))
+        self.prefix = prefix
+        self.suite_name = suite_name
+        self.logging = logging
+        self.log_passing_tests = log_passing_tests
+        self.report_duration = report_duration
+        self.family = family
+        self.stats = dict.fromkeys(["error", "passed", "failure", "skipped"], 0)
+        self.node_reporters = {}  # nodeid -> _NodeReporter
+        self.node_reporters_ordered = []
+        self.global_properties = []
+
+        # List of reports that failed on call but teardown is pending.
+        self.open_reports = []
+        self.cnt_double_fail_tests = 0
+
+        # Replaces convenience family with real family
+        if self.family == "legacy":
+            self.family = "xunit1"
+
+    def finalize(self, report):
+        nodeid = getattr(report, "nodeid", report)
+        # local hack to handle xdist report order
+        slavenode = getattr(report, "node", None)
+        reporter = self.node_reporters.pop((nodeid, slavenode))
+        if reporter is not None:
+            reporter.finalize()
+
+    def node_reporter(self, report):
+        nodeid = getattr(report, "nodeid", report)
+        # local hack to handle xdist report order
+        slavenode = getattr(report, "node", None)
+
+        key = nodeid, slavenode
+
+        if key in self.node_reporters:
+            # TODO: breaks for --dist=each
+            return self.node_reporters[key]
+
+        reporter = _NodeReporter(nodeid, self)
+
+        self.node_reporters[key] = reporter
+        self.node_reporters_ordered.append(reporter)
+
+        return reporter
+
+    def add_stats(self, key):
+        if key in self.stats:
+            self.stats[key] += 1
+
+    def _opentestcase(self, report):
+        reporter = self.node_reporter(report)
+        reporter.record_testreport(report)
+        return reporter
+
+    def pytest_runtest_logreport(self, report):
+        """handle a setup/call/teardown report, generating the appropriate
+        xml tags as necessary.
+
+        note: due to plugins like xdist, this hook may be called in interlaced
+        order with reports from other nodes. for example:
+
+        usual call order:
+            -> setup node1
+            -> call node1
+            -> teardown node1
+            -> setup node2
+            -> call node2
+            -> teardown node2
+
+        possible call order in xdist:
+            -> setup node1
+            -> call node1
+            -> setup node2
+            -> call node2
+            -> teardown node2
+            -> teardown node1
+        """
+        close_report = None
+        if report.passed:
+            if report.when == "call":  # ignore setup/teardown
+                reporter = self._opentestcase(report)
+                reporter.append_pass(report)
+        elif report.failed:
+            if report.when == "teardown":
+                # The following vars are needed when xdist plugin is used
+                report_wid = getattr(report, "worker_id", None)
+                report_ii = getattr(report, "item_index", None)
+                close_report = next(
+                    (
+                        rep
+                        for rep in self.open_reports
+                        if (
+                            rep.nodeid == report.nodeid
+                            and getattr(rep, "item_index", None) == report_ii
+                            and getattr(rep, "worker_id", None) == report_wid
+                        )
+                    ),
+                    None,
+                )
+                if close_report:
+                    # We need to open new testcase in case we have failure in
+                    # call and error in teardown in order to follow junit
+                    # schema
+                    self.finalize(close_report)
+                    self.cnt_double_fail_tests += 1
+            reporter = self._opentestcase(report)
+            if report.when == "call":
+                reporter.append_failure(report)
+                self.open_reports.append(report)
+                if not self.log_passing_tests:
+                    reporter.write_captured_output(report)
+            else:
+                reporter.append_error(report)
+        elif report.skipped:
+            reporter = self._opentestcase(report)
+            reporter.append_skipped(report)
+        self.update_testcase_duration(report)
+        if report.when == "teardown":
+            reporter = self._opentestcase(report)
+            reporter.write_captured_output(report)
+
+            for propname, propvalue in report.user_properties:
+                reporter.add_property(propname, propvalue)
+
+            self.finalize(report)
+            report_wid = getattr(report, "worker_id", None)
+            report_ii = getattr(report, "item_index", None)
+            close_report = next(
+                (
+                    rep
+                    for rep in self.open_reports
+                    if (
+                        rep.nodeid == report.nodeid
+                        and getattr(rep, "item_index", None) == report_ii
+                        and getattr(rep, "worker_id", None) == report_wid
+                    )
+                ),
+                None,
+            )
+            if close_report:
+                self.open_reports.remove(close_report)
+
+    def update_testcase_duration(self, report):
+        """accumulates total duration for nodeid from given report and updates
+        the Junit.testcase with the new total if already created.
+        """
+        if self.report_duration == "total" or report.when == self.report_duration:
+            reporter = self.node_reporter(report)
+            reporter.duration += getattr(report, "duration", 0.0)
+
+    def pytest_collectreport(self, report):
+        if not report.passed:
+            reporter = self._opentestcase(report)
+            if report.failed:
+                reporter.append_collect_error(report)
+            else:
+                reporter.append_collect_skipped(report)
+
+    def pytest_internalerror(self, excrepr):
+        reporter = self.node_reporter("internal")
+        reporter.attrs.update(classname="pytest", name="internal")
+        reporter._add_simple(Junit.error, "internal error", excrepr)
+
+    def pytest_sessionstart(self):
+        self.suite_start_time = time.time()
+
+    def pytest_sessionfinish(self):
+        dirname = os.path.dirname(os.path.abspath(self.logfile))
+        if not os.path.isdir(dirname):
+            os.makedirs(dirname)
+        logfile = open(self.logfile, "w", encoding="utf-8")
+        suite_stop_time = time.time()
+        suite_time_delta = suite_stop_time - self.suite_start_time
+
+        numtests = (
+            self.stats["passed"]
+            + self.stats["failure"]
+            + self.stats["skipped"]
+            + self.stats["error"]
+            - self.cnt_double_fail_tests
+        )
+        logfile.write('<?xml version="1.0" encoding="utf-8"?>')
+
+        suite_node = Junit.testsuite(
+            self._get_global_properties_node(),
+            [x.to_xml() for x in self.node_reporters_ordered],
+            name=self.suite_name,
+            errors=self.stats["error"],
+            failures=self.stats["failure"],
+            skipped=self.stats["skipped"],
+            tests=numtests,
+            time="%.3f" % suite_time_delta,
+            timestamp=datetime.fromtimestamp(self.suite_start_time).isoformat(),
+            hostname=platform.node(),
+        )
+        logfile.write(Junit.testsuites([suite_node]).unicode(indent=0))
+        logfile.close()
+
+    def pytest_terminal_summary(self, terminalreporter):
+        terminalreporter.write_sep("-", "generated xml file: %s" % (self.logfile))
+
+    def add_global_property(self, name, value):
+        __tracebackhide__ = True
+        _check_record_param_type("name", name)
+        self.global_properties.append((name, bin_xml_escape(value)))
+
+    def _get_global_properties_node(self):
+        """Return a Junit node containing custom properties, if any.
+        """
+        if self.global_properties:
+            return Junit.properties(
+                [
+                    Junit.property(name=name, value=value)
+                    for name, value in self.global_properties
+                ]
+            )
+        return ""
diff --git a/contrib/python/pytest/py3/_pytest/logging.py b/contrib/python/pytest/py3/_pytest/logging.py
new file mode 100644
index 0000000000..5e60a23217
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/logging.py
@@ -0,0 +1,787 @@
+""" Access and control log capturing. """
+import logging
+import re
+from contextlib import contextmanager
+from io import StringIO
+from typing import AbstractSet
+from typing import Dict
+from typing import Generator
+from typing import List
+from typing import Mapping
+from typing import Optional
+
+import pytest
+from _pytest import nodes
+from _pytest.compat import nullcontext
+from _pytest.config import _strtobool
+from _pytest.config import Config
+from _pytest.config import create_terminal_writer
+from _pytest.pathlib import Path
+
+DEFAULT_LOG_FORMAT = "%(levelname)-8s %(name)s:%(filename)s:%(lineno)d %(message)s"
+DEFAULT_LOG_DATE_FORMAT = "%H:%M:%S"
+_ANSI_ESCAPE_SEQ = re.compile(r"\x1b\[[\d;]+m")
+
+
+def _remove_ansi_escape_sequences(text):
+    return _ANSI_ESCAPE_SEQ.sub("", text)
+
+
+class ColoredLevelFormatter(logging.Formatter):
+    """
+    Colorize the %(levelname)..s part of the log format passed to __init__.
+    """
+
+    LOGLEVEL_COLOROPTS = {
+        logging.CRITICAL: {"red"},
+        logging.ERROR: {"red", "bold"},
+        logging.WARNING: {"yellow"},
+        logging.WARN: {"yellow"},
+        logging.INFO: {"green"},
+        logging.DEBUG: {"purple"},
+        logging.NOTSET: set(),
+    }  # type: Mapping[int, AbstractSet[str]]
+    LEVELNAME_FMT_REGEX = re.compile(r"%\(levelname\)([+-.]?\d*s)")
+
+    def __init__(self, terminalwriter, *args, **kwargs) -> None:
+        super().__init__(*args, **kwargs)
+        self._original_fmt = self._style._fmt
+        self._level_to_fmt_mapping = {}  # type: Dict[int, str]
+
+        assert self._fmt is not None
+        levelname_fmt_match = self.LEVELNAME_FMT_REGEX.search(self._fmt)
+        if not levelname_fmt_match:
+            return
+        levelname_fmt = levelname_fmt_match.group()
+
+        for level, color_opts in self.LOGLEVEL_COLOROPTS.items():
+            formatted_levelname = levelname_fmt % {
+                "levelname": logging.getLevelName(level)
+            }
+
+            # add ANSI escape sequences around the formatted levelname
+            color_kwargs = {name: True for name in color_opts}
+            colorized_formatted_levelname = terminalwriter.markup(
+                formatted_levelname, **color_kwargs
+            )
+            self._level_to_fmt_mapping[level] = self.LEVELNAME_FMT_REGEX.sub(
+                colorized_formatted_levelname, self._fmt
+            )
+
+    def format(self, record):
+        fmt = self._level_to_fmt_mapping.get(record.levelno, self._original_fmt)
+        self._style._fmt = fmt
+        return super().format(record)
+
+
+class PercentStyleMultiline(logging.PercentStyle):
+    """A logging style with special support for multiline messages.
+
+    If the message of a record consists of multiple lines, this style
+    formats the message as if each line were logged separately.
+    """
+
+    def __init__(self, fmt, auto_indent):
+        super().__init__(fmt)
+        self._auto_indent = self._get_auto_indent(auto_indent)
+
+    @staticmethod
+    def _update_message(record_dict, message):
+        tmp = record_dict.copy()
+        tmp["message"] = message
+        return tmp
+
+    @staticmethod
+    def _get_auto_indent(auto_indent_option) -> int:
+        """Determines the current auto indentation setting
+
+        Specify auto indent behavior (on/off/fixed) by passing in
+        extra={"auto_indent": [value]} to the call to logging.log() or
+        using a --log-auto-indent [value] command line or the
+        log_auto_indent [value] config option.
+
+        Default behavior is auto-indent off.
+
+        Using the string "True" or "on" or the boolean True as the value
+        turns auto indent on, using the string "False" or "off" or the
+        boolean False or the int 0 turns it off, and specifying a
+        positive integer fixes the indentation position to the value
+        specified.
+
+        Any other values for the option are invalid, and will silently be
+        converted to the default.
+
+        :param any auto_indent_option: User specified option for indentation
+            from command line, config or extra kwarg. Accepts int, bool or str.
+            str option accepts the same range of values as boolean config options,
+            as well as positive integers represented in str form.
+
+        :returns: indentation value, which can be
+            -1 (automatically determine indentation) or
+            0 (auto-indent turned off) or
+            >0 (explicitly set indentation position).
+        """
+
+        if type(auto_indent_option) is int:
+            return int(auto_indent_option)
+        elif type(auto_indent_option) is str:
+            try:
+                return int(auto_indent_option)
+            except ValueError:
+                pass
+            try:
+                if _strtobool(auto_indent_option):
+                    return -1
+            except ValueError:
+                return 0
+        elif type(auto_indent_option) is bool:
+            if auto_indent_option:
+                return -1
+
+        return 0
+
+    def format(self, record):
+        if "\n" in record.message:
+            if hasattr(record, "auto_indent"):
+                # passed in from the "extra={}" kwarg on the call to logging.log()
+                auto_indent = self._get_auto_indent(record.auto_indent)
+            else:
+                auto_indent = self._auto_indent
+
+            if auto_indent:
+                lines = record.message.splitlines()
+                formatted = self._fmt % self._update_message(record.__dict__, lines[0])
+
+                if auto_indent < 0:
+                    indentation = _remove_ansi_escape_sequences(formatted).find(
+                        lines[0]
+                    )
+                else:
+                    # optimizes logging by allowing a fixed indentation
+                    indentation = auto_indent
+                lines[0] = formatted
+                return ("\n" + " " * indentation).join(lines)
+        return self._fmt % record.__dict__
+
+
+def get_option_ini(config, *names):
+    for name in names:
+        ret = config.getoption(name)  # 'default' arg won't work as expected
+        if ret is None:
+            ret = config.getini(name)
+        if ret:
+            return ret
+
+
+def pytest_addoption(parser):
+    """Add options to control log capturing."""
+    group = parser.getgroup("logging")
+
+    def add_option_ini(option, dest, default=None, type=None, **kwargs):
+        parser.addini(
+            dest, default=default, type=type, help="default value for " + option
+        )
+        group.addoption(option, dest=dest, **kwargs)
+
+    add_option_ini(
+        "--no-print-logs",
+        dest="log_print",
+        action="store_const",
+        const=False,
+        default=True,
+        type="bool",
+        help="disable printing caught logs on failed tests.",
+    )
+    add_option_ini(
+        "--log-level",
+        dest="log_level",
+        default=None,
+        metavar="LEVEL",
+        help=(
+            "level of messages to catch/display.\n"
+            "Not set by default, so it depends on the root/parent log handler's"
+            ' effective level, where it is "WARNING" by default.'
+        ),
+    )
+    add_option_ini(
+        "--log-format",
+        dest="log_format",
+        default=DEFAULT_LOG_FORMAT,
+        help="log format as used by the logging module.",
+    )
+    add_option_ini(
+        "--log-date-format",
+        dest="log_date_format",
+        default=DEFAULT_LOG_DATE_FORMAT,
+        help="log date format as used by the logging module.",
+    )
+    parser.addini(
+        "log_cli",
+        default=False,
+        type="bool",
+        help='enable log display during test run (also known as "live logging").',
+    )
+    add_option_ini(
+        "--log-cli-level", dest="log_cli_level", default=None, help="cli logging level."
+    )
+    add_option_ini(
+        "--log-cli-format",
+        dest="log_cli_format",
+        default=None,
+        help="log format as used by the logging module.",
+    )
+    add_option_ini(
+        "--log-cli-date-format",
+        dest="log_cli_date_format",
+        default=None,
+        help="log date format as used by the logging module.",
+    )
+    add_option_ini(
+        "--log-file",
+        dest="log_file",
+        default=None,
+        help="path to a file when logging will be written to.",
+    )
+    add_option_ini(
+        "--log-file-level",
+        dest="log_file_level",
+        default=None,
+        help="log file logging level.",
+    )
+    add_option_ini(
+        "--log-file-format",
+        dest="log_file_format",
+        default=DEFAULT_LOG_FORMAT,
+        help="log format as used by the logging module.",
+    )
+    add_option_ini(
+        "--log-file-date-format",
+        dest="log_file_date_format",
+        default=DEFAULT_LOG_DATE_FORMAT,
+        help="log date format as used by the logging module.",
+    )
+    add_option_ini(
+        "--log-auto-indent",
+        dest="log_auto_indent",
+        default=None,
+        help="Auto-indent multiline messages passed to the logging module. Accepts true|on, false|off or an integer.",
+    )
+
+
+@contextmanager
+def catching_logs(handler, formatter=None, level=None):
+    """Context manager that prepares the whole logging machinery properly."""
+    root_logger = logging.getLogger()
+
+    if formatter is not None:
+        handler.setFormatter(formatter)
+    if level is not None:
+        handler.setLevel(level)
+
+    # Adding the same handler twice would confuse logging system.
+    # Just don't do that.
+    add_new_handler = handler not in root_logger.handlers
+
+    if add_new_handler:
+        root_logger.addHandler(handler)
+    if level is not None:
+        orig_level = root_logger.level
+        root_logger.setLevel(min(orig_level, level))
+    try:
+        yield handler
+    finally:
+        if level is not None:
+            root_logger.setLevel(orig_level)
+        if add_new_handler:
+            root_logger.removeHandler(handler)
+
+
+class LogCaptureHandler(logging.StreamHandler):
+    """A logging handler that stores log records and the log text."""
+
+    def __init__(self) -> None:
+        """Creates a new log handler."""
+        logging.StreamHandler.__init__(self, StringIO())
+        self.records = []  # type: List[logging.LogRecord]
+
+    def emit(self, record: logging.LogRecord) -> None:
+        """Keep the log records in a list in addition to the log text."""
+        self.records.append(record)
+        logging.StreamHandler.emit(self, record)
+
+    def reset(self) -> None:
+        self.records = []
+        self.stream = StringIO()
+
+
+class LogCaptureFixture:
+    """Provides access and control of log capturing."""
+
+    def __init__(self, item) -> None:
+        """Creates a new funcarg."""
+        self._item = item
+        # dict of log name -> log level
+        self._initial_log_levels = {}  # type: Dict[str, int]
+
+    def _finalize(self) -> None:
+        """Finalizes the fixture.
+
+        This restores the log levels changed by :meth:`set_level`.
+        """
+        # restore log levels
+        for logger_name, level in self._initial_log_levels.items():
+            logger = logging.getLogger(logger_name)
+            logger.setLevel(level)
+
+    @property
+    def handler(self) -> LogCaptureHandler:
+        """
+        :rtype: LogCaptureHandler
+        """
+        return self._item.catch_log_handler  # type: ignore[no-any-return]  # noqa: F723
+
+    def get_records(self, when: str) -> List[logging.LogRecord]:
+        """
+        Get the logging records for one of the possible test phases.
+
+        :param str when:
+            Which test phase to obtain the records from. Valid values are: "setup", "call" and "teardown".
+
+        :rtype: List[logging.LogRecord]
+        :return: the list of captured records at the given stage
+
+        .. versionadded:: 3.4
+        """
+        handler = self._item.catch_log_handlers.get(when)
+        if handler:
+            return handler.records  # type: ignore[no-any-return]  # noqa: F723
+        else:
+            return []
+
+    @property
+    def text(self):
+        """Returns the formatted log text."""
+        return _remove_ansi_escape_sequences(self.handler.stream.getvalue())
+
+    @property
+    def records(self):
+        """Returns the list of log records."""
+        return self.handler.records
+
+    @property
+    def record_tuples(self):
+        """Returns a list of a stripped down version of log records intended
+        for use in assertion comparison.
+
+        The format of the tuple is:
+
+            (logger_name, log_level, message)
+        """
+        return [(r.name, r.levelno, r.getMessage()) for r in self.records]
+
+    @property
+    def messages(self):
+        """Returns a list of format-interpolated log messages.
+
+        Unlike 'records', which contains the format string and parameters for interpolation, log messages in this list
+        are all interpolated.
+        Unlike 'text', which contains the output from the handler, log messages in this list are unadorned with
+        levels, timestamps, etc, making exact comparisons more reliable.
+
+        Note that traceback or stack info (from :func:`logging.exception` or the `exc_info` or `stack_info` arguments
+        to the logging functions) is not included, as this is added by the formatter in the handler.
+
+        .. versionadded:: 3.7
+        """
+        return [r.getMessage() for r in self.records]
+
+    def clear(self):
+        """Reset the list of log records and the captured log text."""
+        self.handler.reset()
+
+    def set_level(self, level, logger=None):
+        """Sets the level for capturing of logs. The level will be restored to its previous value at the end of
+        the test.
+
+        :param int level: the logger to level.
+        :param str logger: the logger to update the level. If not given, the root logger level is updated.
+
+        .. versionchanged:: 3.4
+            The levels of the loggers changed by this function will be restored to their initial values at the
+            end of the test.
+        """
+        logger_name = logger
+        logger = logging.getLogger(logger_name)
+        # save the original log-level to restore it during teardown
+        self._initial_log_levels.setdefault(logger_name, logger.level)
+        logger.setLevel(level)
+
+    @contextmanager
+    def at_level(self, level, logger=None):
+        """Context manager that sets the level for capturing of logs. After the end of the 'with' statement the
+        level is restored to its original value.
+
+        :param int level: the logger to level.
+        :param str logger: the logger to update the level. If not given, the root logger level is updated.
+        """
+        logger = logging.getLogger(logger)
+        orig_level = logger.level
+        logger.setLevel(level)
+        try:
+            yield
+        finally:
+            logger.setLevel(orig_level)
+
+
+@pytest.fixture
+def caplog(request):
+    """Access and control log capturing.
+
+    Captured logs are available through the following properties/methods::
+
+    * caplog.messages        -> list of format-interpolated log messages
+    * caplog.text            -> string containing formatted log output
+    * caplog.records         -> list of logging.LogRecord instances
+    * caplog.record_tuples   -> list of (logger_name, level, message) tuples
+    * caplog.clear()         -> clear captured records and formatted log output string
+    """
+    result = LogCaptureFixture(request.node)
+    yield result
+    result._finalize()
+
+
+def get_log_level_for_setting(config: Config, *setting_names: str) -> Optional[int]:
+    for setting_name in setting_names:
+        log_level = config.getoption(setting_name)
+        if log_level is None:
+            log_level = config.getini(setting_name)
+        if log_level:
+            break
+    else:
+        return None
+
+    if isinstance(log_level, str):
+        log_level = log_level.upper()
+    try:
+        return int(getattr(logging, log_level, log_level))
+    except ValueError:
+        # Python logging does not recognise this as a logging level
+        raise pytest.UsageError(
+            "'{}' is not recognized as a logging level name for "
+            "'{}'. Please consider passing the "
+            "logging level num instead.".format(log_level, setting_name)
+        )
+
+
+# run after terminalreporter/capturemanager are configured
+@pytest.hookimpl(trylast=True)
+def pytest_configure(config):
+    config.pluginmanager.register(LoggingPlugin(config), "logging-plugin")
+
+
+class LoggingPlugin:
+    """Attaches to the logging module and captures log messages for each test.
+    """
+
+    def __init__(self, config: Config) -> None:
+        """Creates a new plugin to capture log messages.
+
+        The formatter can be safely shared across all handlers so
+        create a single one for the entire test session here.
+        """
+        self._config = config
+
+        self.print_logs = get_option_ini(config, "log_print")
+        if not self.print_logs:
+            from _pytest.warnings import _issue_warning_captured
+            from _pytest.deprecated import NO_PRINT_LOGS
+
+            _issue_warning_captured(NO_PRINT_LOGS, self._config.hook, stacklevel=2)
+
+        self.formatter = self._create_formatter(
+            get_option_ini(config, "log_format"),
+            get_option_ini(config, "log_date_format"),
+            get_option_ini(config, "log_auto_indent"),
+        )
+        self.log_level = get_log_level_for_setting(config, "log_level")
+
+        self.log_file_level = get_log_level_for_setting(config, "log_file_level")
+        self.log_file_format = get_option_ini(config, "log_file_format", "log_format")
+        self.log_file_date_format = get_option_ini(
+            config, "log_file_date_format", "log_date_format"
+        )
+        self.log_file_formatter = logging.Formatter(
+            self.log_file_format, datefmt=self.log_file_date_format
+        )
+
+        log_file = get_option_ini(config, "log_file")
+        if log_file:
+            self.log_file_handler = logging.FileHandler(
+                log_file, mode="w", encoding="UTF-8"
+            )  # type: Optional[logging.FileHandler]
+            self.log_file_handler.setFormatter(self.log_file_formatter)
+        else:
+            self.log_file_handler = None
+
+        self.log_cli_handler = None
+
+        self.live_logs_context = lambda: nullcontext()
+        # Note that the lambda for the live_logs_context is needed because
+        # live_logs_context can otherwise not be entered multiple times due
+        # to limitations of contextlib.contextmanager.
+
+        if self._log_cli_enabled():
+            self._setup_cli_logging()
+
+    def _create_formatter(self, log_format, log_date_format, auto_indent):
+        # color option doesn't exist if terminal plugin is disabled
+        color = getattr(self._config.option, "color", "no")
+        if color != "no" and ColoredLevelFormatter.LEVELNAME_FMT_REGEX.search(
+            log_format
+        ):
+            formatter = ColoredLevelFormatter(
+                create_terminal_writer(self._config), log_format, log_date_format
+            )  # type: logging.Formatter
+        else:
+            formatter = logging.Formatter(log_format, log_date_format)
+
+        formatter._style = PercentStyleMultiline(
+            formatter._style._fmt, auto_indent=auto_indent
+        )
+
+        return formatter
+
+    def _setup_cli_logging(self):
+        config = self._config
+        terminal_reporter = config.pluginmanager.get_plugin("terminalreporter")
+        if terminal_reporter is None:
+            # terminal reporter is disabled e.g. by pytest-xdist.
+            return
+
+        capture_manager = config.pluginmanager.get_plugin("capturemanager")
+        # if capturemanager plugin is disabled, live logging still works.
+        log_cli_handler = _LiveLoggingStreamHandler(terminal_reporter, capture_manager)
+
+        log_cli_formatter = self._create_formatter(
+            get_option_ini(config, "log_cli_format", "log_format"),
+            get_option_ini(config, "log_cli_date_format", "log_date_format"),
+            get_option_ini(config, "log_auto_indent"),
+        )
+
+        log_cli_level = get_log_level_for_setting(config, "log_cli_level", "log_level")
+        self.log_cli_handler = log_cli_handler
+        self.live_logs_context = lambda: catching_logs(
+            log_cli_handler, formatter=log_cli_formatter, level=log_cli_level
+        )
+
+    def set_log_path(self, fname):
+        """Public method, which can set filename parameter for
+        Logging.FileHandler(). Also creates parent directory if
+        it does not exist.
+
+        .. warning::
+            Please considered as an experimental API.
+        """
+        fname = Path(fname)
+
+        if not fname.is_absolute():
+            fname = Path(self._config.rootdir, fname)
+
+        if not fname.parent.exists():
+            fname.parent.mkdir(exist_ok=True, parents=True)
+
+        self.log_file_handler = logging.FileHandler(
+            str(fname), mode="w", encoding="UTF-8"
+        )
+        self.log_file_handler.setFormatter(self.log_file_formatter)
+
+    def _log_cli_enabled(self):
+        """Return True if log_cli should be considered enabled, either explicitly
+        or because --log-cli-level was given in the command-line.
+        """
+        return self._config.getoption(
+            "--log-cli-level"
+        ) is not None or self._config.getini("log_cli")
+
+    @pytest.hookimpl(hookwrapper=True, tryfirst=True)
+    def pytest_collection(self) -> Generator[None, None, None]:
+        with self.live_logs_context():
+            if self.log_cli_handler:
+                self.log_cli_handler.set_when("collection")
+
+            if self.log_file_handler is not None:
+                with catching_logs(self.log_file_handler, level=self.log_file_level):
+                    yield
+            else:
+                yield
+
+    @contextmanager
+    def _runtest_for(self, item, when):
+        with self._runtest_for_main(item, when):
+            if self.log_file_handler is not None:
+                with catching_logs(self.log_file_handler, level=self.log_file_level):
+                    yield
+            else:
+                yield
+
+    @contextmanager
+    def _runtest_for_main(
+        self, item: nodes.Item, when: str
+    ) -> Generator[None, None, None]:
+        """Implements the internals of pytest_runtest_xxx() hook."""
+        with catching_logs(
+            LogCaptureHandler(), formatter=self.formatter, level=self.log_level
+        ) as log_handler:
+            if self.log_cli_handler:
+                self.log_cli_handler.set_when(when)
+
+            if item is None:
+                yield  # run the test
+                return
+
+            if not hasattr(item, "catch_log_handlers"):
+                item.catch_log_handlers = {}  # type: ignore[attr-defined]  # noqa: F821
+            item.catch_log_handlers[when] = log_handler  # type: ignore[attr-defined]  # noqa: F821
+            item.catch_log_handler = log_handler  # type: ignore[attr-defined]  # noqa: F821
+            try:
+                yield  # run test
+            finally:
+                if when == "teardown":
+                    del item.catch_log_handler  # type: ignore[attr-defined]  # noqa: F821
+                    del item.catch_log_handlers  # type: ignore[attr-defined]  # noqa: F821
+
+            if self.print_logs:
+                # Add a captured log section to the report.
+                log = log_handler.stream.getvalue().strip()
+                item.add_report_section(when, "log", log)
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_runtest_setup(self, item):
+        with self._runtest_for(item, "setup"):
+            yield
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_runtest_call(self, item):
+        with self._runtest_for(item, "call"):
+            yield
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_runtest_teardown(self, item):
+        with self._runtest_for(item, "teardown"):
+            yield
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_runtest_logstart(self):
+        if self.log_cli_handler:
+            self.log_cli_handler.reset()
+        with self._runtest_for(None, "start"):
+            yield
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_runtest_logfinish(self):
+        with self._runtest_for(None, "finish"):
+            yield
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_runtest_logreport(self):
+        with self._runtest_for(None, "logreport"):
+            yield
+
+    @pytest.hookimpl(hookwrapper=True, tryfirst=True)
+    def pytest_sessionfinish(self):
+        with self.live_logs_context():
+            if self.log_cli_handler:
+                self.log_cli_handler.set_when("sessionfinish")
+            if self.log_file_handler is not None:
+                try:
+                    with catching_logs(
+                        self.log_file_handler, level=self.log_file_level
+                    ):
+                        yield
+                finally:
+                    # Close the FileHandler explicitly.
+                    # (logging.shutdown might have lost the weakref?!)
+                    self.log_file_handler.close()
+            else:
+                yield
+
+    @pytest.hookimpl(hookwrapper=True, tryfirst=True)
+    def pytest_sessionstart(self):
+        with self.live_logs_context():
+            if self.log_cli_handler:
+                self.log_cli_handler.set_when("sessionstart")
+            if self.log_file_handler is not None:
+                with catching_logs(self.log_file_handler, level=self.log_file_level):
+                    yield
+            else:
+                yield
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_runtestloop(self, session):
+        """Runs all collected test items."""
+
+        if session.config.option.collectonly:
+            yield
+            return
+
+        if self._log_cli_enabled() and self._config.getoption("verbose") < 1:
+            # setting verbose flag is needed to avoid messy test progress output
+            self._config.option.verbose = 1
+
+        with self.live_logs_context():
+            if self.log_file_handler is not None:
+                with catching_logs(self.log_file_handler, level=self.log_file_level):
+                    yield  # run all the tests
+            else:
+                yield  # run all the tests
+
+
+class _LiveLoggingStreamHandler(logging.StreamHandler):
+    """
+    Custom StreamHandler used by the live logging feature: it will write a newline before the first log message
+    in each test.
+
+    During live logging we must also explicitly disable stdout/stderr capturing otherwise it will get captured
+    and won't appear in the terminal.
+    """
+
+    def __init__(self, terminal_reporter, capture_manager):
+        """
+        :param _pytest.terminal.TerminalReporter terminal_reporter:
+        :param _pytest.capture.CaptureManager capture_manager:
+        """
+        logging.StreamHandler.__init__(self, stream=terminal_reporter)
+        self.capture_manager = capture_manager
+        self.reset()
+        self.set_when(None)
+        self._test_outcome_written = False
+
+    def reset(self):
+        """Reset the handler; should be called before the start of each test"""
+        self._first_record_emitted = False
+
+    def set_when(self, when):
+        """Prepares for the given test phase (setup/call/teardown)"""
+        self._when = when
+        self._section_name_shown = False
+        if when == "start":
+            self._test_outcome_written = False
+
+    def emit(self, record):
+        ctx_manager = (
+            self.capture_manager.global_and_fixture_disabled()
+            if self.capture_manager
+            else nullcontext()
+        )
+        with ctx_manager:
+            if not self._first_record_emitted:
+                self.stream.write("\n")
+                self._first_record_emitted = True
+            elif self._when in ("teardown", "finish"):
+                if not self._test_outcome_written:
+                    self._test_outcome_written = True
+                    self.stream.write("\n")
+            if not self._section_name_shown and self._when:
+                self.stream.section("live log " + self._when, sep="-", bold=True)
+                self._section_name_shown = True
+            logging.StreamHandler.emit(self, record)
diff --git a/contrib/python/pytest/py3/_pytest/main.py b/contrib/python/pytest/py3/_pytest/main.py
new file mode 100644
index 0000000000..61eb7ca74c
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/main.py
@@ -0,0 +1,685 @@
+""" core implementation of testing process: init, session, runtest loop. """
+import fnmatch
+import functools
+import importlib
+import os
+import sys
+from typing import Callable
+from typing import Dict
+from typing import FrozenSet
+from typing import List
+from typing import Optional
+from typing import Sequence
+from typing import Tuple
+from typing import Union
+
+import attr
+import py
+
+import _pytest._code
+from _pytest import nodes
+from _pytest.compat import TYPE_CHECKING
+from _pytest.config import Config
+from _pytest.config import directory_arg
+from _pytest.config import ExitCode
+from _pytest.config import hookimpl
+from _pytest.config import UsageError
+from _pytest.fixtures import FixtureManager
+from _pytest.outcomes import exit
+from _pytest.reports import CollectReport
+from _pytest.runner import collect_one_node
+from _pytest.runner import SetupState
+
+
+if TYPE_CHECKING:
+    from typing import Type
+    from typing_extensions import Literal
+
+    from _pytest.python import Package
+
+
+def pytest_addoption(parser):
+    parser.addini(
+        "norecursedirs",
+        "directory patterns to avoid for recursion",
+        type="args",
+        default=[".*", "build", "dist", "CVS", "_darcs", "{arch}", "*.egg", "venv"],
+    )
+    parser.addini(
+        "testpaths",
+        "directories to search for tests when no files or directories are given in the "
+        "command line.",
+        type="args",
+        default=[],
+    )
+    group = parser.getgroup("general", "running and selection options")
+    group._addoption(
+        "-x",
+        "--exitfirst",
+        action="store_const",
+        dest="maxfail",
+        const=1,
+        help="exit instantly on first error or failed test.",
+    )
+    group._addoption(
+        "--maxfail",
+        metavar="num",
+        action="store",
+        type=int,
+        dest="maxfail",
+        default=0,
+        help="exit after first num failures or errors.",
+    )
+    group._addoption(
+        "--strict-markers",
+        "--strict",
+        action="store_true",
+        help="markers not registered in the `markers` section of the configuration file raise errors.",
+    )
+    group._addoption(
+        "-c",
+        metavar="file",
+        type=str,
+        dest="inifilename",
+        help="load configuration from `file` instead of trying to locate one of the implicit "
+        "configuration files.",
+    )
+    group._addoption(
+        "--continue-on-collection-errors",
+        action="store_true",
+        default=False,
+        dest="continue_on_collection_errors",
+        help="Force test execution even if collection errors occur.",
+    )
+    group._addoption(
+        "--rootdir",
+        action="store",
+        dest="rootdir",
+        help="Define root directory for tests. Can be relative path: 'root_dir', './root_dir', "
+        "'root_dir/another_dir/'; absolute path: '/home/user/root_dir'; path with variables: "
+        "'$HOME/root_dir'.",
+    )
+
+    group = parser.getgroup("collect", "collection")
+    group.addoption(
+        "--collectonly",
+        "--collect-only",
+        "--co",
+        action="store_true",
+        help="only collect tests, don't execute them.",
+    )
+    group.addoption(
+        "--pyargs",
+        action="store_true",
+        help="try to interpret all arguments as python packages.",
+    )
+    group.addoption(
+        "--ignore",
+        action="append",
+        metavar="path",
+        help="ignore path during collection (multi-allowed).",
+    )
+    group.addoption(
+        "--ignore-glob",
+        action="append",
+        metavar="path",
+        help="ignore path pattern during collection (multi-allowed).",
+    )
+    group.addoption(
+        "--deselect",
+        action="append",
+        metavar="nodeid_prefix",
+        help="deselect item (via node id prefix) during collection (multi-allowed).",
+    )
+    group.addoption(
+        "--confcutdir",
+        dest="confcutdir",
+        default=None,
+        metavar="dir",
+        type=functools.partial(directory_arg, optname="--confcutdir"),
+        help="only load conftest.py's relative to specified dir.",
+    )
+    group.addoption(
+        "--noconftest",
+        action="store_true",
+        dest="noconftest",
+        default=False,
+        help="Don't load any conftest.py files.",
+    )
+    group.addoption(
+        "--keepduplicates",
+        "--keep-duplicates",
+        action="store_true",
+        dest="keepduplicates",
+        default=False,
+        help="Keep duplicate tests.",
+    )
+    group.addoption(
+        "--collect-in-virtualenv",
+        action="store_true",
+        dest="collect_in_virtualenv",
+        default=False,
+        help="Don't ignore tests in a local virtualenv directory",
+    )
+
+    group = parser.getgroup("debugconfig", "test session debugging and configuration")
+    group.addoption(
+        "--basetemp",
+        dest="basetemp",
+        default=None,
+        metavar="dir",
+        help=(
+            "base temporary directory for this test run."
+            "(warning: this directory is removed if it exists)"
+        ),
+    )
+
+
+def wrap_session(
+    config: Config, doit: Callable[[Config, "Session"], Optional[Union[int, ExitCode]]]
+) -> Union[int, ExitCode]:
+    """Skeleton command line program"""
+    session = Session.from_config(config)
+    session.exitstatus = ExitCode.OK
+    initstate = 0
+    try:
+        try:
+            config._do_configure()
+            initstate = 1
+            config.hook.pytest_sessionstart(session=session)
+            initstate = 2
+            session.exitstatus = doit(config, session) or 0
+        except UsageError:
+            session.exitstatus = ExitCode.USAGE_ERROR
+            raise
+        except Failed:
+            session.exitstatus = ExitCode.TESTS_FAILED
+        except (KeyboardInterrupt, exit.Exception):
+            excinfo = _pytest._code.ExceptionInfo.from_current()
+            exitstatus = ExitCode.INTERRUPTED  # type: Union[int, ExitCode]
+            if isinstance(excinfo.value, exit.Exception):
+                if excinfo.value.returncode is not None:
+                    exitstatus = excinfo.value.returncode
+                if initstate < 2:
+                    sys.stderr.write(
+                        "{}: {}\n".format(excinfo.typename, excinfo.value.msg)
+                    )
+            config.hook.pytest_keyboard_interrupt(excinfo=excinfo)
+            session.exitstatus = exitstatus
+        except:  # noqa
+            session.exitstatus = ExitCode.INTERNAL_ERROR
+            excinfo = _pytest._code.ExceptionInfo.from_current()
+            try:
+                config.notify_exception(excinfo, config.option)
+            except exit.Exception as exc:
+                if exc.returncode is not None:
+                    session.exitstatus = exc.returncode
+                sys.stderr.write("{}: {}\n".format(type(exc).__name__, exc))
+            else:
+                if excinfo.errisinstance(SystemExit):
+                    sys.stderr.write("mainloop: caught unexpected SystemExit!\n")
+
+    finally:
+        # Explicitly break reference cycle.
+        excinfo = None  # type: ignore
+        session.startdir.chdir()
+        if initstate >= 2:
+            try:
+                config.hook.pytest_sessionfinish(
+                    session=session, exitstatus=session.exitstatus
+                )
+            except exit.Exception as exc:
+                if exc.returncode is not None:
+                    session.exitstatus = exc.returncode
+                sys.stderr.write("{}: {}\n".format(type(exc).__name__, exc))
+        config._ensure_unconfigure()
+    return session.exitstatus
+
+
+def pytest_cmdline_main(config):
+    return wrap_session(config, _main)
+
+
+def _main(config: Config, session: "Session") -> Optional[Union[int, ExitCode]]:
+    """ default command line protocol for initialization, session,
+    running tests and reporting. """
+    config.hook.pytest_collection(session=session)
+    config.hook.pytest_runtestloop(session=session)
+
+    if session.testsfailed:
+        return ExitCode.TESTS_FAILED
+    elif session.testscollected == 0:
+        return ExitCode.NO_TESTS_COLLECTED
+    return None
+
+
+def pytest_collection(session):
+    return session.perform_collect()
+
+
+def pytest_runtestloop(session):
+    if session.testsfailed and not session.config.option.continue_on_collection_errors:
+        raise session.Interrupted(
+            "%d error%s during collection"
+            % (session.testsfailed, "s" if session.testsfailed != 1 else "")
+        )
+
+    if session.config.option.collectonly:
+        return True
+
+    for i, item in enumerate(session.items):
+        nextitem = session.items[i + 1] if i + 1 < len(session.items) else None
+        item.config.hook.pytest_runtest_protocol(item=item, nextitem=nextitem)
+        if session.shouldfail:
+            raise session.Failed(session.shouldfail)
+        if session.shouldstop:
+            raise session.Interrupted(session.shouldstop)
+    return True
+
+
+def _in_venv(path):
+    """Attempts to detect if ``path`` is the root of a Virtual Environment by
+    checking for the existence of the appropriate activate script"""
+    bindir = path.join("Scripts" if sys.platform.startswith("win") else "bin")
+    if not bindir.isdir():
+        return False
+    activates = (
+        "activate",
+        "activate.csh",
+        "activate.fish",
+        "Activate",
+        "Activate.bat",
+        "Activate.ps1",
+    )
+    return any([fname.basename in activates for fname in bindir.listdir()])
+
+
+def pytest_ignore_collect(
+    path: py.path.local, config: Config
+) -> "Optional[Literal[True]]":
+    ignore_paths = config._getconftest_pathlist("collect_ignore", path=path.dirpath())
+    ignore_paths = ignore_paths or []
+    excludeopt = config.getoption("ignore")
+    if excludeopt:
+        ignore_paths.extend([py.path.local(x) for x in excludeopt])
+
+    if py.path.local(path) in ignore_paths:
+        return True
+
+    ignore_globs = config._getconftest_pathlist(
+        "collect_ignore_glob", path=path.dirpath()
+    )
+    ignore_globs = ignore_globs or []
+    excludeglobopt = config.getoption("ignore_glob")
+    if excludeglobopt:
+        ignore_globs.extend([py.path.local(x) for x in excludeglobopt])
+
+    if any(fnmatch.fnmatch(str(path), str(glob)) for glob in ignore_globs):
+        return True
+
+    allow_in_venv = config.getoption("collect_in_virtualenv")
+    if not allow_in_venv and _in_venv(path):
+        return True
+    return None
+
+
+def pytest_collection_modifyitems(items, config):
+    deselect_prefixes = tuple(config.getoption("deselect") or [])
+    if not deselect_prefixes:
+        return
+
+    remaining = []
+    deselected = []
+    for colitem in items:
+        if colitem.nodeid.startswith(deselect_prefixes):
+            deselected.append(colitem)
+        else:
+            remaining.append(colitem)
+
+    if deselected:
+        config.hook.pytest_deselected(items=deselected)
+        items[:] = remaining
+
+
+class NoMatch(Exception):
+    """ raised if matching cannot locate a matching names. """
+
+
+class Interrupted(KeyboardInterrupt):
+    """ signals an interrupted test run. """
+
+    __module__ = "builtins"  # for py3
+
+
+class Failed(Exception):
+    """ signals a stop as failed test run. """
+
+
+@attr.s
+class _bestrelpath_cache(dict):
+    path = attr.ib(type=py.path.local)
+
+    def __missing__(self, path: py.path.local) -> str:
+        r = self.path.bestrelpath(path)  # type: str
+        self[path] = r
+        return r
+
+
+class Session(nodes.FSCollector):
+    Interrupted = Interrupted
+    Failed = Failed
+    # Set on the session by runner.pytest_sessionstart.
+    _setupstate = None  # type: SetupState
+    # Set on the session by fixtures.pytest_sessionstart.
+    _fixturemanager = None  # type: FixtureManager
+    exitstatus = None  # type: Union[int, ExitCode]
+
+    def __init__(self, config: Config) -> None:
+        nodes.FSCollector.__init__(
+            self, config.rootdir, parent=None, config=config, session=self, nodeid=""
+        )
+        self.testsfailed = 0
+        self.testscollected = 0
+        self.shouldstop = False
+        self.shouldfail = False
+        self.trace = config.trace.root.get("collection")
+        self.startdir = config.invocation_dir
+        self._initialpaths = frozenset()  # type: FrozenSet[py.path.local]
+
+        # Keep track of any collected nodes in here, so we don't duplicate fixtures
+        self._collection_node_cache1 = (
+            {}
+        )  # type: Dict[py.path.local, Sequence[nodes.Collector]]
+        self._collection_node_cache2 = (
+            {}
+        )  # type: Dict[Tuple[Type[nodes.Collector], py.path.local], nodes.Collector]
+        self._collection_node_cache3 = (
+            {}
+        )  # type: Dict[Tuple[Type[nodes.Collector], str], CollectReport]
+
+        # Dirnames of pkgs with dunder-init files.
+        self._collection_pkg_roots = {}  # type: Dict[py.path.local, Package]
+
+        self._bestrelpathcache = _bestrelpath_cache(
+            config.rootdir
+        )  # type: Dict[py.path.local, str]
+
+        self.config.pluginmanager.register(self, name="session")
+
+    @classmethod
+    def from_config(cls, config):
+        return cls._create(config)
+
+    def __repr__(self):
+        return "<%s %s exitstatus=%r testsfailed=%d testscollected=%d>" % (
+            self.__class__.__name__,
+            self.name,
+            getattr(self, "exitstatus", "<UNSET>"),
+            self.testsfailed,
+            self.testscollected,
+        )
+
+    def _node_location_to_relpath(self, node_path: py.path.local) -> str:
+        # bestrelpath is a quite slow function
+        return self._bestrelpathcache[node_path]
+
+    @hookimpl(tryfirst=True)
+    def pytest_collectstart(self):
+        if self.shouldfail:
+            raise self.Failed(self.shouldfail)
+        if self.shouldstop:
+            raise self.Interrupted(self.shouldstop)
+
+    @hookimpl(tryfirst=True)
+    def pytest_runtest_logreport(self, report):
+        if report.failed and not hasattr(report, "wasxfail"):
+            self.testsfailed += 1
+            maxfail = self.config.getvalue("maxfail")
+            if maxfail and self.testsfailed >= maxfail:
+                self.shouldfail = "stopping after %d failures" % (self.testsfailed)
+
+    pytest_collectreport = pytest_runtest_logreport
+
+    def isinitpath(self, path):
+        return path in self._initialpaths
+
+    def gethookproxy(self, fspath: py.path.local):
+        return super()._gethookproxy(fspath)
+
+    def perform_collect(self, args=None, genitems=True):
+        hook = self.config.hook
+        try:
+            items = self._perform_collect(args, genitems)
+            self.config.pluginmanager.check_pending()
+            hook.pytest_collection_modifyitems(
+                session=self, config=self.config, items=items
+            )
+        finally:
+            hook.pytest_collection_finish(session=self)
+        self.testscollected = len(items)
+        return items
+
+    def _perform_collect(self, args, genitems):
+        if args is None:
+            args = self.config.args
+        self.trace("perform_collect", self, args)
+        self.trace.root.indent += 1
+        self._notfound = []
+        initialpaths = []  # type: List[py.path.local]
+        self._initial_parts = []  # type: List[Tuple[py.path.local, List[str]]]
+        self.items = items = []
+        for arg in args:
+            fspath, parts = self._parsearg(arg)
+            self._initial_parts.append((fspath, parts))
+            initialpaths.append(fspath)
+        self._initialpaths = frozenset(initialpaths)
+        rep = collect_one_node(self)
+        self.ihook.pytest_collectreport(report=rep)
+        self.trace.root.indent -= 1
+        if self._notfound:
+            errors = []
+            for arg, exc in self._notfound:
+                line = "(no name {!r} in any of {!r})".format(arg, exc.args[0])
+                errors.append("not found: {}\n{}".format(arg, line))
+            raise UsageError(*errors)
+        if not genitems:
+            return rep.result
+        else:
+            if rep.passed:
+                for node in rep.result:
+                    self.items.extend(self.genitems(node))
+            return items
+
+    def collect(self):
+        for fspath, parts in self._initial_parts:
+            self.trace("processing argument", (fspath, parts))
+            self.trace.root.indent += 1
+            try:
+                yield from self._collect(fspath, parts)
+            except NoMatch as exc:
+                report_arg = "::".join((str(fspath), *parts))
+                # we are inside a make_report hook so
+                # we cannot directly pass through the exception
+                self._notfound.append((report_arg, exc))
+
+            self.trace.root.indent -= 1
+        self._collection_node_cache1.clear()
+        self._collection_node_cache2.clear()
+        self._collection_node_cache3.clear()
+        self._collection_pkg_roots.clear()
+
+    def _collect(self, argpath, names):
+        from _pytest.python import Package
+
+        # Start with a Session root, and delve to argpath item (dir or file)
+        # and stack all Packages found on the way.
+        # No point in finding packages when collecting doctests
+        if not self.config.getoption("doctestmodules", False):
+            pm = self.config.pluginmanager
+            for parent in reversed(argpath.parts()):
+                if pm._confcutdir and pm._confcutdir.relto(parent):
+                    break
+
+                if parent.isdir():
+                    pkginit = parent.join("__init__.py")
+                    if pkginit.isfile():
+                        if pkginit not in self._collection_node_cache1:
+                            col = self._collectfile(pkginit, handle_dupes=False)
+                            if col:
+                                if isinstance(col[0], Package):
+                                    self._collection_pkg_roots[parent] = col[0]
+                                # always store a list in the cache, matchnodes expects it
+                                self._collection_node_cache1[col[0].fspath] = [col[0]]
+
+        # If it's a directory argument, recurse and look for any Subpackages.
+        # Let the Package collector deal with subnodes, don't collect here.
+        if argpath.check(dir=1):
+            assert not names, "invalid arg {!r}".format((argpath, names))
+
+            seen_dirs = set()
+            for path in argpath.visit(
+                fil=self._visit_filter, rec=self._recurse, bf=True, sort=True
+            ):
+                dirpath = path.dirpath()
+                if dirpath not in seen_dirs:
+                    # Collect packages first.
+                    seen_dirs.add(dirpath)
+                    pkginit = dirpath.join("__init__.py")
+                    if pkginit.exists():
+                        for x in self._collectfile(pkginit):
+                            yield x
+                            if isinstance(x, Package):
+                                self._collection_pkg_roots[dirpath] = x
+                if dirpath in self._collection_pkg_roots:
+                    # Do not collect packages here.
+                    continue
+
+                for x in self._collectfile(path):
+                    key = (type(x), x.fspath)
+                    if key in self._collection_node_cache2:
+                        yield self._collection_node_cache2[key]
+                    else:
+                        self._collection_node_cache2[key] = x
+                        yield x
+        else:
+            assert argpath.check(file=1)
+
+            if argpath in self._collection_node_cache1:
+                col = self._collection_node_cache1[argpath]
+            else:
+                collect_root = self._collection_pkg_roots.get(argpath.dirname, self)
+                col = collect_root._collectfile(argpath, handle_dupes=False)
+                if col:
+                    self._collection_node_cache1[argpath] = col
+            m = self.matchnodes(col, names)
+            # If __init__.py was the only file requested, then the matched node will be
+            # the corresponding Package, and the first yielded item will be the __init__
+            # Module itself, so just use that. If this special case isn't taken, then all
+            # the files in the package will be yielded.
+            if argpath.basename == "__init__.py":
+                try:
+                    yield next(m[0].collect())
+                except StopIteration:
+                    # The package collects nothing with only an __init__.py
+                    # file in it, which gets ignored by the default
+                    # "python_files" option.
+                    pass
+                return
+            yield from m
+
+    @staticmethod
+    def _visit_filter(f):
+        return f.check(file=1)
+
+    def _tryconvertpyarg(self, x):
+        """Convert a dotted module name to path."""
+        try:
+            spec = importlib.util.find_spec(x)
+        # AttributeError: looks like package module, but actually filename
+        # ImportError: module does not exist
+        # ValueError: not a module name
+        except (AttributeError, ImportError, ValueError):
+            return x
+        if spec is None or spec.origin in {None, "namespace"}:
+            return x
+        elif spec.submodule_search_locations:
+            return os.path.dirname(spec.origin)
+        else:
+            return spec.origin
+
+    def _parsearg(self, arg):
+        """ return (fspath, names) tuple after checking the file exists. """
+        strpath, *parts = str(arg).split("::")
+        if self.config.option.pyargs:
+            strpath = self._tryconvertpyarg(strpath)
+        relpath = strpath.replace("/", os.sep)
+        fspath = self.config.invocation_dir.join(relpath, abs=True)
+        if not fspath.check():
+            if self.config.option.pyargs:
+                raise UsageError(
+                    "file or package not found: " + arg + " (missing __init__.py?)"
+                )
+            raise UsageError("file not found: " + arg)
+        fspath = fspath.realpath()
+        return (fspath, parts)
+
+    def matchnodes(self, matching, names):
+        self.trace("matchnodes", matching, names)
+        self.trace.root.indent += 1
+        nodes = self._matchnodes(matching, names)
+        num = len(nodes)
+        self.trace("matchnodes finished -> ", num, "nodes")
+        self.trace.root.indent -= 1
+        if num == 0:
+            raise NoMatch(matching, names[:1])
+        return nodes
+
+    def _matchnodes(self, matching, names):
+        if not matching or not names:
+            return matching
+        name = names[0]
+        assert name
+        nextnames = names[1:]
+        resultnodes = []
+        for node in matching:
+            if isinstance(node, nodes.Item):
+                if not names:
+                    resultnodes.append(node)
+                continue
+            assert isinstance(node, nodes.Collector)
+            key = (type(node), node.nodeid)
+            if key in self._collection_node_cache3:
+                rep = self._collection_node_cache3[key]
+            else:
+                rep = collect_one_node(node)
+                self._collection_node_cache3[key] = rep
+            if rep.passed:
+                has_matched = False
+                for x in rep.result:
+                    # TODO: remove parametrized workaround once collection structure contains parametrization
+                    if x.name == name or x.name.split("[")[0] == name:
+                        resultnodes.extend(self.matchnodes([x], nextnames))
+                        has_matched = True
+                # XXX accept IDs that don't have "()" for class instances
+                if not has_matched and len(rep.result) == 1 and x.name == "()":
+                    nextnames.insert(0, name)
+                    resultnodes.extend(self.matchnodes([x], nextnames))
+            else:
+                # report collection failures here to avoid failing to run some test
+                # specified in the command line because the module could not be
+                # imported (#134)
+                node.ihook.pytest_collectreport(report=rep)
+        return resultnodes
+
+    def genitems(self, node):
+        self.trace("genitems", node)
+        if isinstance(node, nodes.Item):
+            node.ihook.pytest_itemcollected(item=node)
+            yield node
+        else:
+            assert isinstance(node, nodes.Collector)
+            rep = collect_one_node(node)
+            if rep.passed:
+                for subnode in rep.result:
+                    yield from self.genitems(subnode)
+            node.ihook.pytest_collectreport(report=rep)
diff --git a/contrib/python/pytest/py3/_pytest/mark/__init__.py b/contrib/python/pytest/py3/_pytest/mark/__init__.py
new file mode 100644
index 0000000000..dab0cf149f
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/mark/__init__.py
@@ -0,0 +1,168 @@
+""" generic mechanism for marking and selecting python functions. """
+from typing import Optional
+
+from .legacy import matchkeyword
+from .legacy import matchmark
+from .structures import EMPTY_PARAMETERSET_OPTION
+from .structures import get_empty_parameterset_mark
+from .structures import Mark
+from .structures import MARK_GEN
+from .structures import MarkDecorator
+from .structures import MarkGenerator
+from .structures import ParameterSet
+from _pytest.config import Config
+from _pytest.config import hookimpl
+from _pytest.config import UsageError
+from _pytest.store import StoreKey
+
+__all__ = ["Mark", "MarkDecorator", "MarkGenerator", "get_empty_parameterset_mark"]
+
+
+old_mark_config_key = StoreKey[Optional[Config]]()
+
+
+def param(*values, **kw):
+    """Specify a parameter in `pytest.mark.parametrize`_ calls or
+    :ref:`parametrized fixtures <fixture-parametrize-marks>`.
+
+    .. code-block:: python
+
+        @pytest.mark.parametrize("test_input,expected", [
+            ("3+5", 8),
+            pytest.param("6*9", 42, marks=pytest.mark.xfail),
+        ])
+        def test_eval(test_input, expected):
+            assert eval(test_input) == expected
+
+    :param values: variable args of the values of the parameter set, in order.
+    :keyword marks: a single mark or a list of marks to be applied to this parameter set.
+    :keyword str id: the id to attribute to this parameter set.
+    """
+    return ParameterSet.param(*values, **kw)
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("general")
+    group._addoption(
+        "-k",
+        action="store",
+        dest="keyword",
+        default="",
+        metavar="EXPRESSION",
+        help="only run tests which match the given substring expression. "
+        "An expression is a python evaluatable expression "
+        "where all names are substring-matched against test names "
+        "and their parent classes. Example: -k 'test_method or test_"
+        "other' matches all test functions and classes whose name "
+        "contains 'test_method' or 'test_other', while -k 'not test_method' "
+        "matches those that don't contain 'test_method' in their names. "
+        "-k 'not test_method and not test_other' will eliminate the matches. "
+        "Additionally keywords are matched to classes and functions "
+        "containing extra names in their 'extra_keyword_matches' set, "
+        "as well as functions which have names assigned directly to them. "
+        "The matching is case-insensitive.",
+    )
+
+    group._addoption(
+        "-m",
+        action="store",
+        dest="markexpr",
+        default="",
+        metavar="MARKEXPR",
+        help="only run tests matching given mark expression.  "
+        "example: -m 'mark1 and not mark2'.",
+    )
+
+    group.addoption(
+        "--markers",
+        action="store_true",
+        help="show markers (builtin, plugin and per-project ones).",
+    )
+
+    parser.addini("markers", "markers for test functions", "linelist")
+    parser.addini(EMPTY_PARAMETERSET_OPTION, "default marker for empty parametersets")
+
+
+@hookimpl(tryfirst=True)
+def pytest_cmdline_main(config):
+    import _pytest.config
+
+    if config.option.markers:
+        config._do_configure()
+        tw = _pytest.config.create_terminal_writer(config)
+        for line in config.getini("markers"):
+            parts = line.split(":", 1)
+            name = parts[0]
+            rest = parts[1] if len(parts) == 2 else ""
+            tw.write("@pytest.mark.%s:" % name, bold=True)
+            tw.line(rest)
+            tw.line()
+        config._ensure_unconfigure()
+        return 0
+
+
+def deselect_by_keyword(items, config):
+    keywordexpr = config.option.keyword.lstrip()
+    if not keywordexpr:
+        return
+
+    if keywordexpr.startswith("-"):
+        keywordexpr = "not " + keywordexpr[1:]
+    selectuntil = False
+    if keywordexpr[-1:] == ":":
+        selectuntil = True
+        keywordexpr = keywordexpr[:-1]
+
+    remaining = []
+    deselected = []
+    for colitem in items:
+        if keywordexpr and not matchkeyword(colitem, keywordexpr):
+            deselected.append(colitem)
+        else:
+            if selectuntil:
+                keywordexpr = None
+            remaining.append(colitem)
+
+    if deselected:
+        config.hook.pytest_deselected(items=deselected)
+        items[:] = remaining
+
+
+def deselect_by_mark(items, config):
+    matchexpr = config.option.markexpr
+    if not matchexpr:
+        return
+
+    remaining = []
+    deselected = []
+    for item in items:
+        if matchmark(item, matchexpr):
+            remaining.append(item)
+        else:
+            deselected.append(item)
+
+    if deselected:
+        config.hook.pytest_deselected(items=deselected)
+        items[:] = remaining
+
+
+def pytest_collection_modifyitems(items, config):
+    deselect_by_keyword(items, config)
+    deselect_by_mark(items, config)
+
+
+def pytest_configure(config):
+    config._store[old_mark_config_key] = MARK_GEN._config
+    MARK_GEN._config = config
+
+    empty_parameterset = config.getini(EMPTY_PARAMETERSET_OPTION)
+
+    if empty_parameterset not in ("skip", "xfail", "fail_at_collect", None, ""):
+        raise UsageError(
+            "{!s} must be one of skip, xfail or fail_at_collect"
+            " but it is {!r}".format(EMPTY_PARAMETERSET_OPTION, empty_parameterset)
+        )
+
+
+def pytest_unconfigure(config):
+    MARK_GEN._config = config._store.get(old_mark_config_key, None)
diff --git a/contrib/python/pytest/py3/_pytest/mark/evaluate.py b/contrib/python/pytest/py3/_pytest/mark/evaluate.py
new file mode 100644
index 0000000000..772baf31b6
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/mark/evaluate.py
@@ -0,0 +1,132 @@
+import os
+import platform
+import sys
+import traceback
+from typing import Any
+from typing import Dict
+
+from ..outcomes import fail
+from ..outcomes import TEST_OUTCOME
+from _pytest.config import Config
+from _pytest.store import StoreKey
+
+
+evalcache_key = StoreKey[Dict[str, Any]]()
+
+
+def cached_eval(config: Config, expr: str, d: Dict[str, object]) -> Any:
+    default = {}  # type: Dict[str, object]
+    evalcache = config._store.setdefault(evalcache_key, default)
+    try:
+        return evalcache[expr]
+    except KeyError:
+        import _pytest._code
+
+        exprcode = _pytest._code.compile(expr, mode="eval")
+        evalcache[expr] = x = eval(exprcode, d)
+        return x
+
+
+class MarkEvaluator:
+    def __init__(self, item, name):
+        self.item = item
+        self._marks = None
+        self._mark = None
+        self._mark_name = name
+
+    def __bool__(self):
+        # don't cache here to prevent staleness
+        return bool(self._get_marks())
+
+    __nonzero__ = __bool__
+
+    def wasvalid(self):
+        return not hasattr(self, "exc")
+
+    def _get_marks(self):
+        return list(self.item.iter_markers(name=self._mark_name))
+
+    def invalidraise(self, exc):
+        raises = self.get("raises")
+        if not raises:
+            return
+        return not isinstance(exc, raises)
+
+    def istrue(self):
+        try:
+            return self._istrue()
+        except TEST_OUTCOME:
+            self.exc = sys.exc_info()
+            if isinstance(self.exc[1], SyntaxError):
+                # TODO: Investigate why SyntaxError.offset is Optional, and if it can be None here.
+                assert self.exc[1].offset is not None
+                msg = [" " * (self.exc[1].offset + 4) + "^"]
+                msg.append("SyntaxError: invalid syntax")
+            else:
+                msg = traceback.format_exception_only(*self.exc[:2])
+            fail(
+                "Error evaluating %r expression\n"
+                "    %s\n"
+                "%s" % (self._mark_name, self.expr, "\n".join(msg)),
+                pytrace=False,
+            )
+
+    def _getglobals(self):
+        d = {"os": os, "sys": sys, "platform": platform, "config": self.item.config}
+        if hasattr(self.item, "obj"):
+            d.update(self.item.obj.__globals__)
+        return d
+
+    def _istrue(self):
+        if hasattr(self, "result"):
+            return self.result
+        self._marks = self._get_marks()
+
+        if self._marks:
+            self.result = False
+            for mark in self._marks:
+                self._mark = mark
+                if "condition" in mark.kwargs:
+                    args = (mark.kwargs["condition"],)
+                else:
+                    args = mark.args
+
+                for expr in args:
+                    self.expr = expr
+                    if isinstance(expr, str):
+                        d = self._getglobals()
+                        result = cached_eval(self.item.config, expr, d)
+                    else:
+                        if "reason" not in mark.kwargs:
+                            # XXX better be checked at collection time
+                            msg = (
+                                "you need to specify reason=STRING "
+                                "when using booleans as conditions."
+                            )
+                            fail(msg)
+                        result = bool(expr)
+                    if result:
+                        self.result = True
+                        self.reason = mark.kwargs.get("reason", None)
+                        self.expr = expr
+                        return self.result
+
+                if not args:
+                    self.result = True
+                    self.reason = mark.kwargs.get("reason", None)
+                    return self.result
+        return False
+
+    def get(self, attr, default=None):
+        if self._mark is None:
+            return default
+        return self._mark.kwargs.get(attr, default)
+
+    def getexplanation(self):
+        expl = getattr(self, "reason", None) or self.get("reason", None)
+        if not expl:
+            if not hasattr(self, "expr"):
+                return ""
+            else:
+                return "condition: " + str(self.expr)
+        return expl
diff --git a/contrib/python/pytest/py3/_pytest/mark/legacy.py b/contrib/python/pytest/py3/_pytest/mark/legacy.py
new file mode 100644
index 0000000000..3d7a194b61
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/mark/legacy.py
@@ -0,0 +1,116 @@
+"""
+this is a place where we put datastructures used by legacy apis
+we hope to remove
+"""
+import keyword
+from typing import Set
+
+import attr
+
+from _pytest.compat import TYPE_CHECKING
+from _pytest.config import UsageError
+
+if TYPE_CHECKING:
+    from _pytest.nodes import Item  # noqa: F401 (used in type string)
+
+
+@attr.s
+class MarkMapping:
+    """Provides a local mapping for markers where item access
+    resolves to True if the marker is present. """
+
+    own_mark_names = attr.ib()
+
+    @classmethod
+    def from_item(cls, item):
+        mark_names = {mark.name for mark in item.iter_markers()}
+        return cls(mark_names)
+
+    def __getitem__(self, name):
+        return name in self.own_mark_names
+
+
+@attr.s
+class KeywordMapping:
+    """Provides a local mapping for keywords.
+    Given a list of names, map any substring of one of these names to True.
+    """
+
+    _names = attr.ib(type=Set[str])
+
+    @classmethod
+    def from_item(cls, item: "Item") -> "KeywordMapping":
+        mapped_names = set()
+
+        # Add the names of the current item and any parent items
+        import pytest
+
+        for item in item.listchain():
+            if not isinstance(item, pytest.Instance):
+                mapped_names.add(item.name)
+
+        # Add the names added as extra keywords to current or parent items
+        mapped_names.update(item.listextrakeywords())
+
+        # Add the names attached to the current function through direct assignment
+        function_obj = getattr(item, "function", None)
+        if function_obj:
+            mapped_names.update(function_obj.__dict__)
+
+        # add the markers to the keywords as we no longer handle them correctly
+        mapped_names.update(mark.name for mark in item.iter_markers())
+
+        return cls(mapped_names)
+
+    def __getitem__(self, subname: str) -> bool:
+        """Return whether subname is included within stored names.
+
+        The string inclusion check is case-insensitive.
+
+        """
+        subname = subname.lower()
+        names = (name.lower() for name in self._names)
+
+        for name in names:
+            if subname in name:
+                return True
+        return False
+
+
+python_keywords_allowed_list = ["or", "and", "not"]
+
+
+def matchmark(colitem, markexpr):
+    """Tries to match on any marker names, attached to the given colitem."""
+    try:
+        return eval(markexpr, {}, MarkMapping.from_item(colitem))
+    except SyntaxError as e:
+        raise SyntaxError(str(e) + "\nMarker expression must be valid Python!")
+
+
+def matchkeyword(colitem, keywordexpr):
+    """Tries to match given keyword expression to given collector item.
+
+    Will match on the name of colitem, including the names of its parents.
+    Only matches names of items which are either a :class:`Class` or a
+    :class:`Function`.
+    Additionally, matches on names in the 'extra_keyword_matches' set of
+    any item, as well as names directly assigned to test functions.
+    """
+    mapping = KeywordMapping.from_item(colitem)
+    if " " not in keywordexpr:
+        # special case to allow for simple "-k pass" and "-k 1.3"
+        return mapping[keywordexpr]
+    elif keywordexpr.startswith("not ") and " " not in keywordexpr[4:]:
+        return not mapping[keywordexpr[4:]]
+    for kwd in keywordexpr.split():
+        if keyword.iskeyword(kwd) and kwd not in python_keywords_allowed_list:
+            raise UsageError(
+                "Python keyword '{}' not accepted in expressions passed to '-k'".format(
+                    kwd
+                )
+            )
+    try:
+        return eval(keywordexpr, {}, mapping)
+    except SyntaxError:
+        raise UsageError("Wrong expression passed to '-k': {}".format(keywordexpr))
diff --git a/contrib/python/pytest/py3/_pytest/mark/structures.py b/contrib/python/pytest/py3/_pytest/mark/structures.py
new file mode 100644
index 0000000000..50ad81baa6
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/mark/structures.py
@@ -0,0 +1,397 @@
+import inspect
+import warnings
+from collections import namedtuple
+from collections.abc import MutableMapping
+from typing import Iterable
+from typing import List
+from typing import Optional
+from typing import Set
+from typing import Union
+
+import attr
+
+from .._code.source import getfslineno
+from ..compat import ascii_escaped
+from ..compat import NOTSET
+from _pytest.outcomes import fail
+from _pytest.warning_types import PytestUnknownMarkWarning
+
+EMPTY_PARAMETERSET_OPTION = "empty_parameter_set_mark"
+
+
+def istestfunc(func):
+    return (
+        hasattr(func, "__call__")
+        and getattr(func, "__name__", "<lambda>") != "<lambda>"
+    )
+
+
+def get_empty_parameterset_mark(config, argnames, func):
+    from ..nodes import Collector
+
+    requested_mark = config.getini(EMPTY_PARAMETERSET_OPTION)
+    if requested_mark in ("", None, "skip"):
+        mark = MARK_GEN.skip
+    elif requested_mark == "xfail":
+        mark = MARK_GEN.xfail(run=False)
+    elif requested_mark == "fail_at_collect":
+        f_name = func.__name__
+        _, lineno = getfslineno(func)
+        raise Collector.CollectError(
+            "Empty parameter set in '%s' at line %d" % (f_name, lineno + 1)
+        )
+    else:
+        raise LookupError(requested_mark)
+    fs, lineno = getfslineno(func)
+    reason = "got empty parameter set %r, function %s at %s:%d" % (
+        argnames,
+        func.__name__,
+        fs,
+        lineno,
+    )
+    return mark(reason=reason)
+
+
+class ParameterSet(namedtuple("ParameterSet", "values, marks, id")):
+    @classmethod
+    def param(cls, *values, marks=(), id=None):
+        if isinstance(marks, MarkDecorator):
+            marks = (marks,)
+        else:
+            assert isinstance(marks, (tuple, list, set))
+
+        if id is not None:
+            if not isinstance(id, str):
+                raise TypeError(
+                    "Expected id to be a string, got {}: {!r}".format(type(id), id)
+                )
+            id = ascii_escaped(id)
+        return cls(values, marks, id)
+
+    @classmethod
+    def extract_from(cls, parameterset, force_tuple=False):
+        """
+        :param parameterset:
+            a legacy style parameterset that may or may not be a tuple,
+            and may or may not be wrapped into a mess of mark objects
+
+        :param force_tuple:
+            enforce tuple wrapping so single argument tuple values
+            don't get decomposed and break tests
+        """
+
+        if isinstance(parameterset, cls):
+            return parameterset
+        if force_tuple:
+            return cls.param(parameterset)
+        else:
+            return cls(parameterset, marks=[], id=None)
+
+    @staticmethod
+    def _parse_parametrize_args(argnames, argvalues, *args, **kwargs):
+        if not isinstance(argnames, (tuple, list)):
+            argnames = [x.strip() for x in argnames.split(",") if x.strip()]
+            force_tuple = len(argnames) == 1
+        else:
+            force_tuple = False
+        return argnames, force_tuple
+
+    @staticmethod
+    def _parse_parametrize_parameters(argvalues, force_tuple):
+        return [
+            ParameterSet.extract_from(x, force_tuple=force_tuple) for x in argvalues
+        ]
+
+    @classmethod
+    def _for_parametrize(cls, argnames, argvalues, func, config, function_definition):
+        argnames, force_tuple = cls._parse_parametrize_args(argnames, argvalues)
+        parameters = cls._parse_parametrize_parameters(argvalues, force_tuple)
+        del argvalues
+
+        if parameters:
+            # check all parameter sets have the correct number of values
+            for param in parameters:
+                if len(param.values) != len(argnames):
+                    msg = (
+                        '{nodeid}: in "parametrize" the number of names ({names_len}):\n'
+                        "  {names}\n"
+                        "must be equal to the number of values ({values_len}):\n"
+                        "  {values}"
+                    )
+                    fail(
+                        msg.format(
+                            nodeid=function_definition.nodeid,
+                            values=param.values,
+                            names=argnames,
+                            names_len=len(argnames),
+                            values_len=len(param.values),
+                        ),
+                        pytrace=False,
+                    )
+        else:
+            # empty parameter set (likely computed at runtime): create a single
+            # parameter set with NOTSET values, with the "empty parameter set" mark applied to it
+            mark = get_empty_parameterset_mark(config, argnames, func)
+            parameters.append(
+                ParameterSet(values=(NOTSET,) * len(argnames), marks=[mark], id=None)
+            )
+        return argnames, parameters
+
+
+@attr.s(frozen=True)
+class Mark:
+    #: name of the mark
+    name = attr.ib(type=str)
+    #: positional arguments of the mark decorator
+    args = attr.ib()  # List[object]
+    #: keyword arguments of the mark decorator
+    kwargs = attr.ib()  # Dict[str, object]
+
+    #: source Mark for ids with parametrize Marks
+    _param_ids_from = attr.ib(type=Optional["Mark"], default=None, repr=False)
+    #: resolved/generated ids with parametrize Marks
+    _param_ids_generated = attr.ib(type=Optional[List[str]], default=None, repr=False)
+
+    def _has_param_ids(self):
+        return "ids" in self.kwargs or len(self.args) >= 4
+
+    def combined_with(self, other: "Mark") -> "Mark":
+        """
+        :param other: the mark to combine with
+        :type other: Mark
+        :rtype: Mark
+
+        combines by appending args and merging the mappings
+        """
+        assert self.name == other.name
+
+        # Remember source of ids with parametrize Marks.
+        param_ids_from = None  # type: Optional[Mark]
+        if self.name == "parametrize":
+            if other._has_param_ids():
+                param_ids_from = other
+            elif self._has_param_ids():
+                param_ids_from = self
+
+        return Mark(
+            self.name,
+            self.args + other.args,
+            dict(self.kwargs, **other.kwargs),
+            param_ids_from=param_ids_from,
+        )
+
+
+@attr.s
+class MarkDecorator:
+    """ A decorator for test functions and test classes.  When applied
+    it will create :class:`Mark` objects which are often created like this::
+
+        mark1 = pytest.mark.NAME              # simple MarkDecorator
+        mark2 = pytest.mark.NAME(name1=value) # parametrized MarkDecorator
+
+    and can then be applied as decorators to test functions::
+
+        @mark2
+        def test_function():
+            pass
+
+    When a MarkDecorator instance is called it does the following:
+
+    1. If called with a single class as its only positional argument and no
+       additional keyword arguments, it attaches itself to the class so it
+       gets applied automatically to all test cases found in that class.
+    2. If called with a single function as its only positional argument and
+       no additional keyword arguments, it attaches a MarkInfo object to the
+       function, containing all the arguments already stored internally in
+       the MarkDecorator.
+    3. When called in any other case, it performs a 'fake construction' call,
+       i.e. it returns a new MarkDecorator instance with the original
+       MarkDecorator's content updated with the arguments passed to this
+       call.
+
+    Note: The rules above prevent MarkDecorator objects from storing only a
+    single function or class reference as their positional argument with no
+    additional keyword or positional arguments.
+
+    """
+
+    mark = attr.ib(validator=attr.validators.instance_of(Mark))
+
+    @property
+    def name(self):
+        """alias for mark.name"""
+        return self.mark.name
+
+    @property
+    def args(self):
+        """alias for mark.args"""
+        return self.mark.args
+
+    @property
+    def kwargs(self):
+        """alias for mark.kwargs"""
+        return self.mark.kwargs
+
+    @property
+    def markname(self):
+        return self.name  # for backward-compat (2.4.1 had this attr)
+
+    def __repr__(self):
+        return "<MarkDecorator {!r}>".format(self.mark)
+
+    def with_args(self, *args, **kwargs):
+        """ return a MarkDecorator with extra arguments added
+
+        unlike call this can be used even if the sole argument is a callable/class
+
+        :return: MarkDecorator
+        """
+
+        mark = Mark(self.name, args, kwargs)
+        return self.__class__(self.mark.combined_with(mark))
+
+    def __call__(self, *args, **kwargs):
+        """ if passed a single callable argument: decorate it with mark info.
+            otherwise add *args/**kwargs in-place to mark information. """
+        if args and not kwargs:
+            func = args[0]
+            is_class = inspect.isclass(func)
+            if len(args) == 1 and (istestfunc(func) or is_class):
+                store_mark(func, self.mark)
+                return func
+        return self.with_args(*args, **kwargs)
+
+
+def get_unpacked_marks(obj):
+    """
+    obtain the unpacked marks that are stored on an object
+    """
+    mark_list = getattr(obj, "pytestmark", [])
+    if not isinstance(mark_list, list):
+        mark_list = [mark_list]
+    return normalize_mark_list(mark_list)
+
+
+def normalize_mark_list(mark_list: Iterable[Union[Mark, MarkDecorator]]) -> List[Mark]:
+    """
+    normalizes marker decorating helpers to mark objects
+
+    :type mark_list: List[Union[Mark, Markdecorator]]
+    :rtype: List[Mark]
+    """
+    extracted = [
+        getattr(mark, "mark", mark) for mark in mark_list
+    ]  # unpack MarkDecorator
+    for mark in extracted:
+        if not isinstance(mark, Mark):
+            raise TypeError("got {!r} instead of Mark".format(mark))
+    return [x for x in extracted if isinstance(x, Mark)]
+
+
+def store_mark(obj, mark):
+    """store a Mark on an object
+    this is used to implement the Mark declarations/decorators correctly
+    """
+    assert isinstance(mark, Mark), mark
+    # always reassign name to avoid updating pytestmark
+    # in a reference that was only borrowed
+    obj.pytestmark = get_unpacked_marks(obj) + [mark]
+
+
+class MarkGenerator:
+    """ Factory for :class:`MarkDecorator` objects - exposed as
+    a ``pytest.mark`` singleton instance.  Example::
+
+         import pytest
+         @pytest.mark.slowtest
+         def test_function():
+            pass
+
+    will set a 'slowtest' :class:`MarkInfo` object
+    on the ``test_function`` object. """
+
+    _config = None
+    _markers = set()  # type: Set[str]
+
+    def __getattr__(self, name: str) -> MarkDecorator:
+        if name[0] == "_":
+            raise AttributeError("Marker name must NOT start with underscore")
+
+        if self._config is not None:
+            # We store a set of markers as a performance optimisation - if a mark
+            # name is in the set we definitely know it, but a mark may be known and
+            # not in the set.  We therefore start by updating the set!
+            if name not in self._markers:
+                for line in self._config.getini("markers"):
+                    # example lines: "skipif(condition): skip the given test if..."
+                    # or "hypothesis: tests which use Hypothesis", so to get the
+                    # marker name we split on both `:` and `(`.
+                    if line == "ya:external":
+                        marker = line
+                    else:
+                        marker = line.split(":")[0].split("(")[0].strip()
+                    self._markers.add(marker)
+
+            # If the name is not in the set of known marks after updating,
+            # then it really is time to issue a warning or an error.
+            if name not in self._markers:
+                if self._config.option.strict_markers:
+                    fail(
+                        "{!r} not found in `markers` configuration option".format(name),
+                        pytrace=False,
+                    )
+
+                # Raise a specific error for common misspellings of "parametrize".
+                if name in ["parameterize", "parametrise", "parameterise"]:
+                    __tracebackhide__ = True
+                    fail("Unknown '{}' mark, did you mean 'parametrize'?".format(name))
+
+                warnings.warn(
+                    "Unknown pytest.mark.%s - is this a typo?  You can register "
+                    "custom marks to avoid this warning - for details, see "
+                    "https://docs.pytest.org/en/latest/mark.html" % name,
+                    PytestUnknownMarkWarning,
+                    2,
+                )
+
+        return MarkDecorator(Mark(name, (), {}))
+
+
+MARK_GEN = MarkGenerator()
+
+
+class NodeKeywords(MutableMapping):
+    def __init__(self, node):
+        self.node = node
+        self.parent = node.parent
+        self._markers = {node.name: True}
+
+    def __getitem__(self, key):
+        try:
+            return self._markers[key]
+        except KeyError:
+            if self.parent is None:
+                raise
+            return self.parent.keywords[key]
+
+    def __setitem__(self, key, value):
+        self._markers[key] = value
+
+    def __delitem__(self, key):
+        raise ValueError("cannot delete key in keywords dict")
+
+    def __iter__(self):
+        seen = self._seen()
+        return iter(seen)
+
+    def _seen(self):
+        seen = set(self._markers)
+        if self.parent is not None:
+            seen.update(self.parent.keywords)
+        return seen
+
+    def __len__(self):
+        return len(self._seen())
+
+    def __repr__(self):
+        return "<NodeKeywords for node {}>".format(self.node)
diff --git a/contrib/python/pytest/py3/_pytest/monkeypatch.py b/contrib/python/pytest/py3/_pytest/monkeypatch.py
new file mode 100644
index 0000000000..ce1c0f6510
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/monkeypatch.py
@@ -0,0 +1,322 @@
+""" monkeypatching and mocking functionality.  """
+import os
+import re
+import sys
+import warnings
+from contextlib import contextmanager
+from typing import Generator
+
+import pytest
+from _pytest.fixtures import fixture
+from _pytest.pathlib import Path
+
+RE_IMPORT_ERROR_NAME = re.compile(r"^No module named (.*)$")
+
+
+@fixture
+def monkeypatch():
+    """The returned ``monkeypatch`` fixture provides these
+    helper methods to modify objects, dictionaries or os.environ::
+
+        monkeypatch.setattr(obj, name, value, raising=True)
+        monkeypatch.delattr(obj, name, raising=True)
+        monkeypatch.setitem(mapping, name, value)
+        monkeypatch.delitem(obj, name, raising=True)
+        monkeypatch.setenv(name, value, prepend=False)
+        monkeypatch.delenv(name, raising=True)
+        monkeypatch.syspath_prepend(path)
+        monkeypatch.chdir(path)
+
+    All modifications will be undone after the requesting
+    test function or fixture has finished. The ``raising``
+    parameter determines if a KeyError or AttributeError
+    will be raised if the set/deletion operation has no target.
+    """
+    mpatch = MonkeyPatch()
+    yield mpatch
+    mpatch.undo()
+
+
+def resolve(name):
+    # simplified from zope.dottedname
+    parts = name.split(".")
+
+    used = parts.pop(0)
+    found = __import__(used)
+    for part in parts:
+        used += "." + part
+        try:
+            found = getattr(found, part)
+        except AttributeError:
+            pass
+        else:
+            continue
+        # we use explicit un-nesting of the handling block in order
+        # to avoid nested exceptions on python 3
+        try:
+            __import__(used)
+        except ImportError as ex:
+            # str is used for py2 vs py3
+            expected = str(ex).split()[-1]
+            if expected == used:
+                raise
+            else:
+                raise ImportError("import error in {}: {}".format(used, ex))
+        found = annotated_getattr(found, part, used)
+    return found
+
+
+def annotated_getattr(obj, name, ann):
+    try:
+        obj = getattr(obj, name)
+    except AttributeError:
+        raise AttributeError(
+            "{!r} object at {} has no attribute {!r}".format(
+                type(obj).__name__, ann, name
+            )
+        )
+    return obj
+
+
+def derive_importpath(import_path, raising):
+    if not isinstance(import_path, str) or "." not in import_path:
+        raise TypeError(
+            "must be absolute import path string, not {!r}".format(import_path)
+        )
+    module, attr = import_path.rsplit(".", 1)
+    target = resolve(module)
+    if raising:
+        annotated_getattr(target, attr, ann=module)
+    return attr, target
+
+
+class Notset:
+    def __repr__(self):
+        return "<notset>"
+
+
+notset = Notset()
+
+
+class MonkeyPatch:
+    """ Object returned by the ``monkeypatch`` fixture keeping a record of setattr/item/env/syspath changes.
+    """
+
+    def __init__(self):
+        self._setattr = []
+        self._setitem = []
+        self._cwd = None
+        self._savesyspath = None
+
+    @contextmanager
+    def context(self) -> Generator["MonkeyPatch", None, None]:
+        """
+        Context manager that returns a new :class:`MonkeyPatch` object which
+        undoes any patching done inside the ``with`` block upon exit:
+
+        .. code-block:: python
+
+            import functools
+            def test_partial(monkeypatch):
+                with monkeypatch.context() as m:
+                    m.setattr(functools, "partial", 3)
+
+        Useful in situations where it is desired to undo some patches before the test ends,
+        such as mocking ``stdlib`` functions that might break pytest itself if mocked (for examples
+        of this see `#3290 <https://github.com/pytest-dev/pytest/issues/3290>`_.
+        """
+        m = MonkeyPatch()
+        try:
+            yield m
+        finally:
+            m.undo()
+
+    def setattr(self, target, name, value=notset, raising=True):
+        """ Set attribute value on target, memorizing the old value.
+        By default raise AttributeError if the attribute did not exist.
+
+        For convenience you can specify a string as ``target`` which
+        will be interpreted as a dotted import path, with the last part
+        being the attribute name.  Example:
+        ``monkeypatch.setattr("os.getcwd", lambda: "/")``
+        would set the ``getcwd`` function of the ``os`` module.
+
+        The ``raising`` value determines if the setattr should fail
+        if the attribute is not already present (defaults to True
+        which means it will raise).
+        """
+        __tracebackhide__ = True
+        import inspect
+
+        if value is notset:
+            if not isinstance(target, str):
+                raise TypeError(
+                    "use setattr(target, name, value) or "
+                    "setattr(target, value) with target being a dotted "
+                    "import string"
+                )
+            value = name
+            name, target = derive_importpath(target, raising)
+
+        oldval = getattr(target, name, notset)
+        if raising and oldval is notset:
+            raise AttributeError("{!r} has no attribute {!r}".format(target, name))
+
+        # avoid class descriptors like staticmethod/classmethod
+        if inspect.isclass(target):
+            oldval = target.__dict__.get(name, notset)
+        self._setattr.append((target, name, oldval))
+        setattr(target, name, value)
+
+    def delattr(self, target, name=notset, raising=True):
+        """ Delete attribute ``name`` from ``target``, by default raise
+        AttributeError it the attribute did not previously exist.
+
+        If no ``name`` is specified and ``target`` is a string
+        it will be interpreted as a dotted import path with the
+        last part being the attribute name.
+
+        If ``raising`` is set to False, no exception will be raised if the
+        attribute is missing.
+        """
+        __tracebackhide__ = True
+        import inspect
+
+        if name is notset:
+            if not isinstance(target, str):
+                raise TypeError(
+                    "use delattr(target, name) or "
+                    "delattr(target) with target being a dotted "
+                    "import string"
+                )
+            name, target = derive_importpath(target, raising)
+
+        if not hasattr(target, name):
+            if raising:
+                raise AttributeError(name)
+        else:
+            oldval = getattr(target, name, notset)
+            # Avoid class descriptors like staticmethod/classmethod.
+            if inspect.isclass(target):
+                oldval = target.__dict__.get(name, notset)
+            self._setattr.append((target, name, oldval))
+            delattr(target, name)
+
+    def setitem(self, dic, name, value):
+        """ Set dictionary entry ``name`` to value. """
+        self._setitem.append((dic, name, dic.get(name, notset)))
+        dic[name] = value
+
+    def delitem(self, dic, name, raising=True):
+        """ Delete ``name`` from dict. Raise KeyError if it doesn't exist.
+
+        If ``raising`` is set to False, no exception will be raised if the
+        key is missing.
+        """
+        if name not in dic:
+            if raising:
+                raise KeyError(name)
+        else:
+            self._setitem.append((dic, name, dic.get(name, notset)))
+            del dic[name]
+
+    def setenv(self, name, value, prepend=None):
+        """ Set environment variable ``name`` to ``value``.  If ``prepend``
+        is a character, read the current environment variable value
+        and prepend the ``value`` adjoined with the ``prepend`` character."""
+        if not isinstance(value, str):
+            warnings.warn(
+                pytest.PytestWarning(
+                    "Value of environment variable {name} type should be str, but got "
+                    "{value!r} (type: {type}); converted to str implicitly".format(
+                        name=name, value=value, type=type(value).__name__
+                    )
+                ),
+                stacklevel=2,
+            )
+            value = str(value)
+        if prepend and name in os.environ:
+            value = value + prepend + os.environ[name]
+        self.setitem(os.environ, name, value)
+
+    def delenv(self, name, raising=True):
+        """ Delete ``name`` from the environment. Raise KeyError if it does
+        not exist.
+
+        If ``raising`` is set to False, no exception will be raised if the
+        environment variable is missing.
+        """
+        self.delitem(os.environ, name, raising=raising)
+
+    def syspath_prepend(self, path):
+        """ Prepend ``path`` to ``sys.path`` list of import locations. """
+        from pkg_resources import fixup_namespace_packages
+
+        if self._savesyspath is None:
+            self._savesyspath = sys.path[:]
+        sys.path.insert(0, str(path))
+
+        # https://github.com/pypa/setuptools/blob/d8b901bc/docs/pkg_resources.txt#L162-L171
+        fixup_namespace_packages(str(path))
+
+        # A call to syspathinsert() usually means that the caller wants to
+        # import some dynamically created files, thus with python3 we
+        # invalidate its import caches.
+        # This is especially important when any namespace package is in use,
+        # since then the mtime based FileFinder cache (that gets created in
+        # this case already) gets not invalidated when writing the new files
+        # quickly afterwards.
+        from importlib import invalidate_caches
+
+        invalidate_caches()
+
+    def chdir(self, path):
+        """ Change the current working directory to the specified path.
+        Path can be a string or a py.path.local object.
+        """
+        if self._cwd is None:
+            self._cwd = os.getcwd()
+        if hasattr(path, "chdir"):
+            path.chdir()
+        elif isinstance(path, Path):
+            # modern python uses the fspath protocol here LEGACY
+            os.chdir(str(path))
+        else:
+            os.chdir(path)
+
+    def undo(self):
+        """ Undo previous changes.  This call consumes the
+        undo stack. Calling it a second time has no effect unless
+        you do more monkeypatching after the undo call.
+
+        There is generally no need to call `undo()`, since it is
+        called automatically during tear-down.
+
+        Note that the same `monkeypatch` fixture is used across a
+        single test function invocation. If `monkeypatch` is used both by
+        the test function itself and one of the test fixtures,
+        calling `undo()` will undo all of the changes made in
+        both functions.
+        """
+        for obj, name, value in reversed(self._setattr):
+            if value is not notset:
+                setattr(obj, name, value)
+            else:
+                delattr(obj, name)
+        self._setattr[:] = []
+        for dictionary, name, value in reversed(self._setitem):
+            if value is notset:
+                try:
+                    del dictionary[name]
+                except KeyError:
+                    pass  # was already deleted, so we have the desired state
+            else:
+                dictionary[name] = value
+        self._setitem[:] = []
+        if self._savesyspath is not None:
+            sys.path[:] = self._savesyspath
+            self._savesyspath = None
+
+        if self._cwd is not None:
+            os.chdir(self._cwd)
+            self._cwd = None
diff --git a/contrib/python/pytest/py3/_pytest/nodes.py b/contrib/python/pytest/py3/_pytest/nodes.py
new file mode 100644
index 0000000000..6f22a8daaa
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/nodes.py
@@ -0,0 +1,594 @@
+import os
+import warnings
+from functools import lru_cache
+from typing import Any
+from typing import Dict
+from typing import List
+from typing import Optional
+from typing import Set
+from typing import Tuple
+from typing import Union
+
+import py
+
+import _pytest._code
+from _pytest._code.code import ExceptionChainRepr
+from _pytest._code.code import ExceptionInfo
+from _pytest._code.code import ReprExceptionInfo
+from _pytest._code.source import getfslineno
+from _pytest.compat import cached_property
+from _pytest.compat import TYPE_CHECKING
+from _pytest.config import Config
+from _pytest.config import ConftestImportFailure
+from _pytest.config import PytestPluginManager
+from _pytest.deprecated import NODE_USE_FROM_PARENT
+from _pytest.fixtures import FixtureDef
+from _pytest.fixtures import FixtureLookupError
+from _pytest.fixtures import FixtureLookupErrorRepr
+from _pytest.mark.structures import Mark
+from _pytest.mark.structures import MarkDecorator
+from _pytest.mark.structures import NodeKeywords
+from _pytest.outcomes import fail
+from _pytest.pathlib import Path
+from _pytest.store import Store
+
+if TYPE_CHECKING:
+    # Imported here due to circular import.
+    from _pytest.main import Session  # noqa: F401
+
+SEP = "/"
+
+tracebackcutdir = py.path.local(_pytest.__file__).dirpath()
+
+
+@lru_cache(maxsize=None)
+def _splitnode(nodeid):
+    """Split a nodeid into constituent 'parts'.
+
+    Node IDs are strings, and can be things like:
+        ''
+        'testing/code'
+        'testing/code/test_excinfo.py'
+        'testing/code/test_excinfo.py::TestFormattedExcinfo'
+
+    Return values are lists e.g.
+        []
+        ['testing', 'code']
+        ['testing', 'code', 'test_excinfo.py']
+        ['testing', 'code', 'test_excinfo.py', 'TestFormattedExcinfo']
+    """
+    if nodeid == "":
+        # If there is no root node at all, return an empty list so the caller's logic can remain sane
+        return ()
+    parts = nodeid.split(SEP)
+    # Replace single last element 'test_foo.py::Bar' with multiple elements 'test_foo.py', 'Bar'
+    parts[-1:] = parts[-1].split("::")
+    # Convert parts into a tuple to avoid possible errors with caching of a mutable type
+    return tuple(parts)
+
+
+def ischildnode(baseid, nodeid):
+    """Return True if the nodeid is a child node of the baseid.
+
+    E.g. 'foo/bar::Baz' is a child of 'foo', 'foo/bar' and 'foo/bar::Baz', but not of 'foo/blorp'
+    """
+    base_parts = _splitnode(baseid)
+    node_parts = _splitnode(nodeid)
+    if len(node_parts) < len(base_parts):
+        return False
+    return node_parts[: len(base_parts)] == base_parts
+
+
+class NodeMeta(type):
+    def __call__(self, *k, **kw):
+        warnings.warn(NODE_USE_FROM_PARENT.format(name=self.__name__), stacklevel=2)
+        return super().__call__(*k, **kw)
+
+    def _create(self, *k, **kw):
+        return super().__call__(*k, **kw)
+
+
+class Node(metaclass=NodeMeta):
+    """ base class for Collector and Item the test collection tree.
+    Collector subclasses have children, Items are terminal nodes."""
+
+    def __init__(
+        self,
+        name: str,
+        parent: Optional["Node"] = None,
+        config: Optional[Config] = None,
+        session: Optional["Session"] = None,
+        fspath: Optional[py.path.local] = None,
+        nodeid: Optional[str] = None,
+    ) -> None:
+        #: a unique name within the scope of the parent node
+        self.name = name
+
+        #: the parent collector node.
+        self.parent = parent
+
+        #: the pytest config object
+        if config:
+            self.config = config
+        else:
+            if not parent:
+                raise TypeError("config or parent must be provided")
+            self.config = parent.config
+
+        #: the session this node is part of
+        if session:
+            self.session = session
+        else:
+            if not parent:
+                raise TypeError("session or parent must be provided")
+            self.session = parent.session
+
+        #: filesystem path where this node was collected from (can be None)
+        self.fspath = fspath or getattr(parent, "fspath", None)
+
+        #: keywords/markers collected from all scopes
+        self.keywords = NodeKeywords(self)
+
+        #: the marker objects belonging to this node
+        self.own_markers = []  # type: List[Mark]
+
+        #: allow adding of extra keywords to use for matching
+        self.extra_keyword_matches = set()  # type: Set[str]
+
+        # used for storing artificial fixturedefs for direct parametrization
+        self._name2pseudofixturedef = {}  # type: Dict[str, FixtureDef]
+
+        if nodeid is not None:
+            assert "::()" not in nodeid
+            self._nodeid = nodeid
+        else:
+            if not self.parent:
+                raise TypeError("nodeid or parent must be provided")
+            self._nodeid = self.parent.nodeid
+            if self.name != "()":
+                self._nodeid += "::" + self.name
+
+        # A place where plugins can store information on the node for their
+        # own use. Currently only intended for internal plugins.
+        self._store = Store()
+
+    @classmethod
+    def from_parent(cls, parent: "Node", **kw):
+        """
+        Public Constructor for Nodes
+
+        This indirection got introduced in order to enable removing
+        the fragile logic from the node constructors.
+
+        Subclasses can use ``super().from_parent(...)`` when overriding the construction
+
+        :param parent: the parent node of this test Node
+        """
+        if "config" in kw:
+            raise TypeError("config is not a valid argument for from_parent")
+        if "session" in kw:
+            raise TypeError("session is not a valid argument for from_parent")
+        return cls._create(parent=parent, **kw)
+
+    @property
+    def ihook(self):
+        """ fspath sensitive hook proxy used to call pytest hooks"""
+        return self.session.gethookproxy(self.fspath)
+
+    def __repr__(self):
+        return "<{} {}>".format(self.__class__.__name__, getattr(self, "name", None))
+
+    def warn(self, warning):
+        """Issue a warning for this item.
+
+        Warnings will be displayed after the test session, unless explicitly suppressed
+
+        :param Warning warning: the warning instance to issue. Must be a subclass of PytestWarning.
+
+        :raise ValueError: if ``warning`` instance is not a subclass of PytestWarning.
+
+        Example usage:
+
+        .. code-block:: python
+
+            node.warn(PytestWarning("some message"))
+
+        """
+        from _pytest.warning_types import PytestWarning
+
+        if not isinstance(warning, PytestWarning):
+            raise ValueError(
+                "warning must be an instance of PytestWarning or subclass, got {!r}".format(
+                    warning
+                )
+            )
+        path, lineno = get_fslocation_from_item(self)
+        warnings.warn_explicit(
+            warning,
+            category=None,
+            filename=str(path),
+            lineno=lineno + 1 if lineno is not None else None,
+        )
+
+    # methods for ordering nodes
+    @property
+    def nodeid(self):
+        """ a ::-separated string denoting its collection tree address. """
+        return self._nodeid
+
+    def __hash__(self):
+        return hash(self.nodeid)
+
+    def setup(self):
+        pass
+
+    def teardown(self):
+        pass
+
+    def listchain(self):
+        """ return list of all parent collectors up to self,
+            starting from root of collection tree. """
+        chain = []
+        item = self  # type: Optional[Node]
+        while item is not None:
+            chain.append(item)
+            item = item.parent
+        chain.reverse()
+        return chain
+
+    def add_marker(
+        self, marker: Union[str, MarkDecorator], append: bool = True
+    ) -> None:
+        """dynamically add a marker object to the node.
+
+        :type marker: ``str`` or ``pytest.mark.*``  object
+        :param marker:
+            ``append=True`` whether to append the marker,
+            if ``False`` insert at position ``0``.
+        """
+        from _pytest.mark import MARK_GEN
+
+        if isinstance(marker, MarkDecorator):
+            marker_ = marker
+        elif isinstance(marker, str):
+            marker_ = getattr(MARK_GEN, marker)
+        else:
+            raise ValueError("is not a string or pytest.mark.* Marker")
+        self.keywords[marker_.name] = marker
+        if append:
+            self.own_markers.append(marker_.mark)
+        else:
+            self.own_markers.insert(0, marker_.mark)
+
+    def iter_markers(self, name=None):
+        """
+        :param name: if given, filter the results by the name attribute
+
+        iterate over all markers of the node
+        """
+        return (x[1] for x in self.iter_markers_with_node(name=name))
+
+    def iter_markers_with_node(self, name=None):
+        """
+        :param name: if given, filter the results by the name attribute
+
+        iterate over all markers of the node
+        returns sequence of tuples (node, mark)
+        """
+        for node in reversed(self.listchain()):
+            for mark in node.own_markers:
+                if name is None or getattr(mark, "name", None) == name:
+                    yield node, mark
+
+    def get_closest_marker(self, name, default=None):
+        """return the first marker matching the name, from closest (for example function) to farther level (for example
+        module level).
+
+        :param default: fallback return value of no marker was found
+        :param name: name to filter by
+        """
+        return next(self.iter_markers(name=name), default)
+
+    def listextrakeywords(self):
+        """ Return a set of all extra keywords in self and any parents."""
+        extra_keywords = set()  # type: Set[str]
+        for item in self.listchain():
+            extra_keywords.update(item.extra_keyword_matches)
+        return extra_keywords
+
+    def listnames(self):
+        return [x.name for x in self.listchain()]
+
+    def addfinalizer(self, fin):
+        """ register a function to be called when this node is finalized.
+
+        This method can only be called when this node is active
+        in a setup chain, for example during self.setup().
+        """
+        self.session._setupstate.addfinalizer(fin, self)
+
+    def getparent(self, cls):
+        """ get the next parent node (including ourself)
+        which is an instance of the given class"""
+        current = self  # type: Optional[Node]
+        while current and not isinstance(current, cls):
+            current = current.parent
+        return current
+
+    def _prunetraceback(self, excinfo):
+        pass
+
+    def _repr_failure_py(
+        self, excinfo: ExceptionInfo[BaseException], style=None,
+    ) -> Union[str, ReprExceptionInfo, ExceptionChainRepr, FixtureLookupErrorRepr]:
+        if isinstance(excinfo.value, ConftestImportFailure):
+            excinfo = ExceptionInfo(excinfo.value.excinfo)
+        if isinstance(excinfo.value, fail.Exception):
+            if not excinfo.value.pytrace:
+                return str(excinfo.value)
+        if isinstance(excinfo.value, FixtureLookupError):
+            return excinfo.value.formatrepr()
+        if self.config.getoption("fulltrace", False):
+            style = "long"
+        else:
+            tb = _pytest._code.Traceback([excinfo.traceback[-1]])
+            self._prunetraceback(excinfo)
+            if len(excinfo.traceback) == 0:
+                excinfo.traceback = tb
+            if style == "auto":
+                style = "long"
+        # XXX should excinfo.getrepr record all data and toterminal() process it?
+        if style is None:
+            if self.config.getoption("tbstyle", "auto") == "short":
+                style = "short"
+            else:
+                style = "long"
+
+        if self.config.getoption("verbose", 0) > 1:
+            truncate_locals = False
+        else:
+            truncate_locals = True
+
+        # excinfo.getrepr() formats paths relative to the CWD if `abspath` is False.
+        # It is possible for a fixture/test to change the CWD while this code runs, which
+        # would then result in the user seeing confusing paths in the failure message.
+        # To fix this, if the CWD changed, always display the full absolute path.
+        # It will be better to just always display paths relative to invocation_dir, but
+        # this requires a lot of plumbing (#6428).
+        try:
+            abspath = Path(os.getcwd()) != Path(self.config.invocation_dir)
+        except OSError:
+            abspath = True
+
+        return excinfo.getrepr(
+            funcargs=True,
+            abspath=abspath,
+            showlocals=self.config.getoption("showlocals", False),
+            style=style,
+            tbfilter=False,  # pruned already, or in --fulltrace mode.
+            truncate_locals=truncate_locals,
+        )
+
+    def repr_failure(
+        self, excinfo, style=None
+    ) -> Union[str, ReprExceptionInfo, ExceptionChainRepr, FixtureLookupErrorRepr]:
+        return self._repr_failure_py(excinfo, style)
+
+
+def get_fslocation_from_item(
+    item: "Item",
+) -> Tuple[Union[str, py.path.local], Optional[int]]:
+    """Tries to extract the actual location from an item, depending on available attributes:
+
+    * "fslocation": a pair (path, lineno)
+    * "obj": a Python object that the item wraps.
+    * "fspath": just a path
+
+    :rtype: a tuple of (str|LocalPath, int) with filename and line number.
+    """
+    try:
+        return item.location[:2]
+    except AttributeError:
+        pass
+    obj = getattr(item, "obj", None)
+    if obj is not None:
+        return getfslineno(obj)
+    return getattr(item, "fspath", "unknown location"), -1
+
+
+class Collector(Node):
+    """ Collector instances create children through collect()
+        and thus iteratively build a tree.
+    """
+
+    class CollectError(Exception):
+        """ an error during collection, contains a custom message. """
+
+    def collect(self):
+        """ returns a list of children (items and collectors)
+            for this collection node.
+        """
+        raise NotImplementedError("abstract")
+
+    def repr_failure(self, excinfo):
+        """ represent a collection failure. """
+        if excinfo.errisinstance(self.CollectError) and not self.config.getoption(
+            "fulltrace", False
+        ):
+            exc = excinfo.value
+            return str(exc.args[0])
+
+        # Respect explicit tbstyle option, but default to "short"
+        # (_repr_failure_py uses "long" with "fulltrace" option always).
+        tbstyle = self.config.getoption("tbstyle", "auto")
+        if tbstyle == "auto":
+            tbstyle = "short"
+
+        return self._repr_failure_py(excinfo, style=tbstyle)
+
+    def _prunetraceback(self, excinfo):
+        if hasattr(self, "fspath"):
+            traceback = excinfo.traceback
+            ntraceback = traceback.cut(path=self.fspath)
+            if ntraceback == traceback:
+                ntraceback = ntraceback.cut(excludepath=tracebackcutdir)
+            excinfo.traceback = ntraceback.filter()
+
+
+def _check_initialpaths_for_relpath(session, fspath):
+    for initial_path in session._initialpaths:
+        if fspath.common(initial_path) == initial_path:
+            return fspath.relto(initial_path)
+
+
+class FSHookProxy:
+    def __init__(
+        self, fspath: py.path.local, pm: PytestPluginManager, remove_mods
+    ) -> None:
+        self.fspath = fspath
+        self.pm = pm
+        self.remove_mods = remove_mods
+
+    def __getattr__(self, name: str):
+        x = self.pm.subset_hook_caller(name, remove_plugins=self.remove_mods)
+        self.__dict__[name] = x
+        return x
+
+
+class FSCollector(Collector):
+    def __init__(
+        self, fspath: py.path.local, parent=None, config=None, session=None, nodeid=None
+    ) -> None:
+        name = fspath.basename
+        if parent is not None:
+            rel = fspath.relto(parent.fspath)
+            if rel:
+                name = rel
+            name = name.replace(os.sep, SEP)
+        self.fspath = fspath
+
+        session = session or parent.session
+
+        if nodeid is None:
+            nodeid = self.fspath.relto(session.config.rootdir)
+
+            if not nodeid:
+                nodeid = _check_initialpaths_for_relpath(session, fspath)
+            if nodeid and os.sep != SEP:
+                nodeid = nodeid.replace(os.sep, SEP)
+
+        super().__init__(name, parent, config, session, nodeid=nodeid, fspath=fspath)
+
+        self._norecursepatterns = self.config.getini("norecursedirs")
+
+    @classmethod
+    def from_parent(cls, parent, *, fspath, **kw):
+        """
+        The public constructor
+        """
+        return super().from_parent(parent=parent, fspath=fspath, **kw)
+
+    def _gethookproxy(self, fspath: py.path.local):
+        # check if we have the common case of running
+        # hooks with all conftest.py files
+        pm = self.config.pluginmanager
+        my_conftestmodules = pm._getconftestmodules(fspath)
+        remove_mods = pm._conftest_plugins.difference(my_conftestmodules)
+        if remove_mods:
+            # one or more conftests are not in use at this fspath
+            proxy = FSHookProxy(fspath, pm, remove_mods)
+        else:
+            # all plugins are active for this fspath
+            proxy = self.config.hook
+        return proxy
+
+    def _recurse(self, dirpath: py.path.local) -> bool:
+        if dirpath.basename == "__pycache__":
+            return False
+        ihook = self._gethookproxy(dirpath.dirpath())
+        if ihook.pytest_ignore_collect(path=dirpath, config=self.config):
+            return False
+        for pat in self._norecursepatterns:
+            if dirpath.check(fnmatch=pat):
+                return False
+        ihook = self._gethookproxy(dirpath)
+        ihook.pytest_collect_directory(path=dirpath, parent=self)
+        return True
+
+    def _collectfile(self, path, handle_dupes=True):
+        assert (
+            path.isfile()
+        ), "{!r} is not a file (isdir={!r}, exists={!r}, islink={!r})".format(
+            path, path.isdir(), path.exists(), path.islink()
+        )
+        ihook = self.gethookproxy(path)
+        if not self.isinitpath(path):
+            if ihook.pytest_ignore_collect(path=path, config=self.config):
+                return ()
+
+        if handle_dupes:
+            keepduplicates = self.config.getoption("keepduplicates")
+            if not keepduplicates:
+                duplicate_paths = self.config.pluginmanager._duplicatepaths
+                if path in duplicate_paths:
+                    return ()
+                else:
+                    duplicate_paths.add(path)
+
+        return ihook.pytest_collect_file(path=path, parent=self)
+
+
+class File(FSCollector):
+    """ base class for collecting tests from a file. """
+
+
+class Item(Node):
+    """ a basic test invocation item. Note that for a single function
+    there might be multiple test invocation items.
+    """
+
+    nextitem = None
+
+    def __init__(self, name, parent=None, config=None, session=None, nodeid=None):
+        super().__init__(name, parent, config, session, nodeid=nodeid)
+        self._report_sections = []  # type: List[Tuple[str, str, str]]
+
+        #: user properties is a list of tuples (name, value) that holds user
+        #: defined properties for this test.
+        self.user_properties = []  # type: List[Tuple[str, Any]]
+
+    def runtest(self) -> None:
+        raise NotImplementedError("runtest must be implemented by Item subclass")
+
+    def add_report_section(self, when: str, key: str, content: str) -> None:
+        """
+        Adds a new report section, similar to what's done internally to add stdout and
+        stderr captured output::
+
+            item.add_report_section("call", "stdout", "report section contents")
+
+        :param str when:
+            One of the possible capture states, ``"setup"``, ``"call"``, ``"teardown"``.
+        :param str key:
+            Name of the section, can be customized at will. Pytest uses ``"stdout"`` and
+            ``"stderr"`` internally.
+
+        :param str content:
+            The full contents as a string.
+        """
+        if content:
+            self._report_sections.append((when, key, content))
+
+    def reportinfo(self) -> Tuple[Union[py.path.local, str], Optional[int], str]:
+        return self.fspath, None, ""
+
+    @cached_property
+    def location(self) -> Tuple[str, Optional[int], str]:
+        location = self.reportinfo()
+        if isinstance(location[0], py.path.local):
+            fspath = location[0]
+        else:
+            fspath = py.path.local(location[0])
+        relfspath = self.session._node_location_to_relpath(fspath)
+        assert type(location[2]) is str
+        return (relfspath, location[1], location[2])
diff --git a/contrib/python/pytest/py3/_pytest/nose.py b/contrib/python/pytest/py3/_pytest/nose.py
new file mode 100644
index 0000000000..d6f3c2b224
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/nose.py
@@ -0,0 +1,38 @@
+""" run test suites written for nose. """
+from _pytest import python
+from _pytest import unittest
+from _pytest.config import hookimpl
+
+
+@hookimpl(trylast=True)
+def pytest_runtest_setup(item):
+    if is_potential_nosetest(item):
+        if not call_optional(item.obj, "setup"):
+            # call module level setup if there is no object level one
+            call_optional(item.parent.obj, "setup")
+        # XXX this implies we only call teardown when setup worked
+        item.session._setupstate.addfinalizer((lambda: teardown_nose(item)), item)
+
+
+def teardown_nose(item):
+    if is_potential_nosetest(item):
+        if not call_optional(item.obj, "teardown"):
+            call_optional(item.parent.obj, "teardown")
+
+
+def is_potential_nosetest(item):
+    # extra check needed since we do not do nose style setup/teardown
+    # on direct unittest style classes
+    return isinstance(item, python.Function) and not isinstance(
+        item, unittest.TestCaseFunction
+    )
+
+
+def call_optional(obj, name):
+    method = getattr(obj, name, None)
+    isfixture = hasattr(method, "_pytestfixturefunction")
+    if method is not None and not isfixture and callable(method):
+        # If there's any problems allow the exception to raise rather than
+        # silently ignoring them
+        method()
+        return True
diff --git a/contrib/python/pytest/py3/_pytest/outcomes.py b/contrib/python/pytest/py3/_pytest/outcomes.py
new file mode 100644
index 0000000000..bed73c94de
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/outcomes.py
@@ -0,0 +1,226 @@
+"""
+exception classes and constants handling test outcomes
+as well as functions creating them
+"""
+import sys
+from typing import Any
+from typing import Callable
+from typing import cast
+from typing import Optional
+from typing import TypeVar
+
+from packaging.version import Version
+
+TYPE_CHECKING = False  # avoid circular import through compat
+
+if TYPE_CHECKING:
+    from typing import NoReturn
+    from typing import Type  # noqa: F401 (Used in string type annotation.)
+    from typing_extensions import Protocol
+else:
+    # typing.Protocol is only available starting from Python 3.8. It is also
+    # available from typing_extensions, but we don't want a runtime dependency
+    # on that. So use a dummy runtime implementation.
+    from typing import Generic
+
+    Protocol = Generic
+
+
+class OutcomeException(BaseException):
+    """ OutcomeException and its subclass instances indicate and
+        contain info about test and collection outcomes.
+    """
+
+    def __init__(self, msg: Optional[str] = None, pytrace: bool = True) -> None:
+        if msg is not None and not isinstance(msg, str):
+            error_msg = (
+                "{} expected string as 'msg' parameter, got '{}' instead.\n"
+                "Perhaps you meant to use a mark?"
+            )
+            raise TypeError(error_msg.format(type(self).__name__, type(msg).__name__))
+        BaseException.__init__(self, msg)
+        self.msg = msg
+        self.pytrace = pytrace
+
+    def __repr__(self) -> str:
+        if self.msg:
+            return self.msg
+        return "<{} instance>".format(self.__class__.__name__)
+
+    __str__ = __repr__
+
+
+TEST_OUTCOME = (OutcomeException, Exception)
+
+
+class Skipped(OutcomeException):
+    # XXX hackish: on 3k we fake to live in the builtins
+    # in order to have Skipped exception printing shorter/nicer
+    __module__ = "builtins"
+
+    def __init__(
+        self,
+        msg: Optional[str] = None,
+        pytrace: bool = True,
+        allow_module_level: bool = False,
+    ) -> None:
+        OutcomeException.__init__(self, msg=msg, pytrace=pytrace)
+        self.allow_module_level = allow_module_level
+
+
+class Failed(OutcomeException):
+    """ raised from an explicit call to pytest.fail() """
+
+    __module__ = "builtins"
+
+
+class Exit(Exception):
+    """ raised for immediate program exits (no tracebacks/summaries)"""
+
+    def __init__(
+        self, msg: str = "unknown reason", returncode: Optional[int] = None
+    ) -> None:
+        self.msg = msg
+        self.returncode = returncode
+        super().__init__(msg)
+
+
+# Elaborate hack to work around https://github.com/python/mypy/issues/2087.
+# Ideally would just be `exit.Exception = Exit` etc.
+
+_F = TypeVar("_F", bound=Callable)
+_ET = TypeVar("_ET", bound="Type[BaseException]")
+
+
+class _WithException(Protocol[_F, _ET]):
+    Exception = None  # type: _ET
+    __call__ = None  # type: _F
+
+
+def _with_exception(exception_type: _ET) -> Callable[[_F], _WithException[_F, _ET]]:
+    def decorate(func: _F) -> _WithException[_F, _ET]:
+        func_with_exception = cast(_WithException[_F, _ET], func)
+        func_with_exception.Exception = exception_type
+        return func_with_exception
+
+    return decorate
+
+
+# exposed helper methods
+
+
+@_with_exception(Exit)
+def exit(msg: str, returncode: Optional[int] = None) -> "NoReturn":
+    """
+    Exit testing process.
+
+    :param str msg: message to display upon exit.
+    :param int returncode: return code to be used when exiting pytest.
+    """
+    __tracebackhide__ = True
+    raise Exit(msg, returncode)
+
+
+@_with_exception(Skipped)
+def skip(msg: str = "", *, allow_module_level: bool = False) -> "NoReturn":
+    """
+    Skip an executing test with the given message.
+
+    This function should be called only during testing (setup, call or teardown) or
+    during collection by using the ``allow_module_level`` flag.  This function can
+    be called in doctests as well.
+
+    :kwarg bool allow_module_level: allows this function to be called at
+        module level, skipping the rest of the module. Default to False.
+
+    .. note::
+        It is better to use the :ref:`pytest.mark.skipif ref` marker when possible to declare a test to be
+        skipped under certain conditions like mismatching platforms or
+        dependencies.
+        Similarly, use the ``# doctest: +SKIP`` directive (see `doctest.SKIP
+        <https://docs.python.org/3/library/doctest.html#doctest.SKIP>`_)
+        to skip a doctest statically.
+    """
+    __tracebackhide__ = True
+    raise Skipped(msg=msg, allow_module_level=allow_module_level)
+
+
+@_with_exception(Failed)
+def fail(msg: str = "", pytrace: bool = True) -> "NoReturn":
+    """
+    Explicitly fail an executing test with the given message.
+
+    :param str msg: the message to show the user as reason for the failure.
+    :param bool pytrace: if false the msg represents the full failure information and no
+        python traceback will be reported.
+    """
+    __tracebackhide__ = True
+    raise Failed(msg=msg, pytrace=pytrace)
+
+
+class XFailed(Failed):
+    """ raised from an explicit call to pytest.xfail() """
+
+
+@_with_exception(XFailed)
+def xfail(reason: str = "") -> "NoReturn":
+    """
+    Imperatively xfail an executing test or setup functions with the given reason.
+
+    This function should be called only during testing (setup, call or teardown).
+
+    .. note::
+        It is better to use the :ref:`pytest.mark.xfail ref` marker when possible to declare a test to be
+        xfailed under certain conditions like known bugs or missing features.
+    """
+    __tracebackhide__ = True
+    raise XFailed(reason)
+
+
+def importorskip(
+    modname: str, minversion: Optional[str] = None, reason: Optional[str] = None
+) -> Any:
+    """Imports and returns the requested module ``modname``, or skip the
+    current test if the module cannot be imported.
+
+    :param str modname: the name of the module to import
+    :param str minversion: if given, the imported module's ``__version__``
+        attribute must be at least this minimal version, otherwise the test is
+        still skipped.
+    :param str reason: if given, this reason is shown as the message when the
+        module cannot be imported.
+    :returns: The imported module. This should be assigned to its canonical
+        name.
+
+    Example::
+
+        docutils = pytest.importorskip("docutils")
+    """
+    import warnings
+
+    __tracebackhide__ = True
+    compile(modname, "", "eval")  # to catch syntaxerrors
+
+    with warnings.catch_warnings():
+        # make sure to ignore ImportWarnings that might happen because
+        # of existing directories with the same name we're trying to
+        # import but without a __init__.py file
+        warnings.simplefilter("ignore")
+        try:
+            __import__(modname)
+        except ImportError as exc:
+            if reason is None:
+                reason = "could not import {!r}: {}".format(modname, exc)
+            raise Skipped(reason, allow_module_level=True) from None
+    mod = sys.modules[modname]
+    if minversion is None:
+        return mod
+    verattr = getattr(mod, "__version__", None)
+    if minversion is not None:
+        if verattr is None or Version(verattr) < Version(minversion):
+            raise Skipped(
+                "module %r has __version__ %r, required is: %r"
+                % (modname, verattr, minversion),
+                allow_module_level=True,
+            )
+    return mod
diff --git a/contrib/python/pytest/py3/_pytest/pastebin.py b/contrib/python/pytest/py3/_pytest/pastebin.py
new file mode 100644
index 0000000000..3f4a7502d5
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/pastebin.py
@@ -0,0 +1,109 @@
+""" submit failure or test session information to a pastebin service. """
+import tempfile
+from typing import IO
+
+import pytest
+from _pytest.store import StoreKey
+
+
+pastebinfile_key = StoreKey[IO[bytes]]()
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("terminal reporting")
+    group._addoption(
+        "--pastebin",
+        metavar="mode",
+        action="store",
+        dest="pastebin",
+        default=None,
+        choices=["failed", "all"],
+        help="send failed|all info to bpaste.net pastebin service.",
+    )
+
+
+@pytest.hookimpl(trylast=True)
+def pytest_configure(config):
+    if config.option.pastebin == "all":
+        tr = config.pluginmanager.getplugin("terminalreporter")
+        # if no terminal reporter plugin is present, nothing we can do here;
+        # this can happen when this function executes in a slave node
+        # when using pytest-xdist, for example
+        if tr is not None:
+            # pastebin file will be utf-8 encoded binary file
+            config._store[pastebinfile_key] = tempfile.TemporaryFile("w+b")
+            oldwrite = tr._tw.write
+
+            def tee_write(s, **kwargs):
+                oldwrite(s, **kwargs)
+                if isinstance(s, str):
+                    s = s.encode("utf-8")
+                config._store[pastebinfile_key].write(s)
+
+            tr._tw.write = tee_write
+
+
+def pytest_unconfigure(config):
+    if pastebinfile_key in config._store:
+        pastebinfile = config._store[pastebinfile_key]
+        # get terminal contents and delete file
+        pastebinfile.seek(0)
+        sessionlog = pastebinfile.read()
+        pastebinfile.close()
+        del config._store[pastebinfile_key]
+        # undo our patching in the terminal reporter
+        tr = config.pluginmanager.getplugin("terminalreporter")
+        del tr._tw.__dict__["write"]
+        # write summary
+        tr.write_sep("=", "Sending information to Paste Service")
+        pastebinurl = create_new_paste(sessionlog)
+        tr.write_line("pastebin session-log: %s\n" % pastebinurl)
+
+
+def create_new_paste(contents):
+    """
+    Creates a new paste using bpaste.net service.
+
+    :contents: paste contents as utf-8 encoded bytes
+    :returns: url to the pasted contents or error message
+    """
+    import re
+    from urllib.request import urlopen
+    from urllib.parse import urlencode
+
+    params = {"code": contents, "lexer": "text", "expiry": "1week"}
+    url = "https://bpaste.net"
+    try:
+        response = (
+            urlopen(url, data=urlencode(params).encode("ascii")).read().decode("utf-8")
+        )
+    except OSError as exc_info:  # urllib errors
+        return "bad response: %s" % exc_info
+    m = re.search(r'href="/raw/(\w+)"', response)
+    if m:
+        return "{}/show/{}".format(url, m.group(1))
+    else:
+        return "bad response: invalid format ('" + response + "')"
+
+
+def pytest_terminal_summary(terminalreporter):
+    import _pytest.config
+
+    if terminalreporter.config.option.pastebin != "failed":
+        return
+    tr = terminalreporter
+    if "failed" in tr.stats:
+        terminalreporter.write_sep("=", "Sending information to Paste Service")
+        for rep in terminalreporter.stats.get("failed"):
+            try:
+                msg = rep.longrepr.reprtraceback.reprentries[-1].reprfileloc
+            except AttributeError:
+                msg = tr._getfailureheadline(rep)
+            tw = _pytest.config.create_terminal_writer(
+                terminalreporter.config, stringio=True
+            )
+            rep.toterminal(tw)
+            s = tw.stringio.getvalue()
+            assert len(s)
+            pastebinurl = create_new_paste(s)
+            tr.write_line("{} --> {}".format(msg, pastebinurl))
diff --git a/contrib/python/pytest/py3/_pytest/pathlib.py b/contrib/python/pytest/py3/_pytest/pathlib.py
new file mode 100644
index 0000000000..2f04b02d7a
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/pathlib.py
@@ -0,0 +1,399 @@
+import atexit
+import fnmatch
+import itertools
+import os
+import shutil
+import sys
+import uuid
+import warnings
+from functools import partial
+from os.path import expanduser
+from os.path import expandvars
+from os.path import isabs
+from os.path import sep
+from posixpath import sep as posix_sep
+from typing import Iterable
+from typing import Iterator
+from typing import Set
+from typing import TypeVar
+from typing import Union
+
+from _pytest.warning_types import PytestWarning
+
+if sys.version_info[:2] >= (3, 6):
+    from pathlib import Path, PurePath
+else:
+    from pathlib2 import Path, PurePath
+
+__all__ = ["Path", "PurePath"]
+
+
+LOCK_TIMEOUT = 60 * 60 * 3
+
+
+_AnyPurePath = TypeVar("_AnyPurePath", bound=PurePath)
+
+
+def get_lock_path(path: _AnyPurePath) -> _AnyPurePath:
+    return path.joinpath(".lock")
+
+
+def ensure_reset_dir(path: Path) -> None:
+    """
+    ensures the given path is an empty directory
+    """
+    if path.exists():
+        rm_rf(path)
+    path.mkdir()
+
+
+def on_rm_rf_error(func, path: str, exc, *, start_path: Path) -> bool:
+    """Handles known read-only errors during rmtree.
+
+    The returned value is used only by our own tests.
+    """
+    exctype, excvalue = exc[:2]
+
+    # another process removed the file in the middle of the "rm_rf" (xdist for example)
+    # more context: https://github.com/pytest-dev/pytest/issues/5974#issuecomment-543799018
+    if isinstance(excvalue, FileNotFoundError):
+        return False
+
+    if not isinstance(excvalue, PermissionError):
+        warnings.warn(
+            PytestWarning(
+                "(rm_rf) error removing {}\n{}: {}".format(path, exctype, excvalue)
+            )
+        )
+        return False
+
+    if func not in (os.rmdir, os.remove, os.unlink):
+        if func not in (os.open,):
+            warnings.warn(
+                PytestWarning(
+                    "(rm_rf) unknown function {} when removing {}:\n{}: {}".format(
+                        func, path, exctype, excvalue
+                    )
+                )
+            )
+        return False
+
+    # Chmod + retry.
+    import stat
+
+    def chmod_rw(p: str) -> None:
+        mode = os.stat(p).st_mode
+        os.chmod(p, mode | stat.S_IRUSR | stat.S_IWUSR)
+
+    # For files, we need to recursively go upwards in the directories to
+    # ensure they all are also writable.
+    p = Path(path)
+    if p.is_file():
+        for parent in p.parents:
+            chmod_rw(str(parent))
+            # stop when we reach the original path passed to rm_rf
+            if parent == start_path:
+                break
+    chmod_rw(str(path))
+
+    func(path)
+    return True
+
+
+def ensure_extended_length_path(path: Path) -> Path:
+    """Get the extended-length version of a path (Windows).
+
+    On Windows, by default, the maximum length of a path (MAX_PATH) is 260
+    characters, and operations on paths longer than that fail. But it is possible
+    to overcome this by converting the path to "extended-length" form before
+    performing the operation:
+    https://docs.microsoft.com/en-us/windows/win32/fileio/naming-a-file#maximum-path-length-limitation
+
+    On Windows, this function returns the extended-length absolute version of path.
+    On other platforms it returns path unchanged.
+    """
+    if sys.platform.startswith("win32"):
+        path = path.resolve()
+        path = Path(get_extended_length_path_str(str(path)))
+    return path
+
+
+def get_extended_length_path_str(path: str) -> str:
+    """Converts to extended length path as a str"""
+    long_path_prefix = "\\\\?\\"
+    unc_long_path_prefix = "\\\\?\\UNC\\"
+    if path.startswith((long_path_prefix, unc_long_path_prefix)):
+        return path
+    # UNC
+    if path.startswith("\\\\"):
+        return unc_long_path_prefix + path[2:]
+    return long_path_prefix + path
+
+
+def rm_rf(path: Path) -> None:
+    """Remove the path contents recursively, even if some elements
+    are read-only.
+    """
+    path = ensure_extended_length_path(path)
+    onerror = partial(on_rm_rf_error, start_path=path)
+    shutil.rmtree(str(path), onerror=onerror)
+
+
+def find_prefixed(root: Path, prefix: str) -> Iterator[Path]:
+    """finds all elements in root that begin with the prefix, case insensitive"""
+    l_prefix = prefix.lower()
+    for x in root.iterdir():
+        if x.name.lower().startswith(l_prefix):
+            yield x
+
+
+def extract_suffixes(iter: Iterable[PurePath], prefix: str) -> Iterator[str]:
+    """
+    :param iter: iterator over path names
+    :param prefix: expected prefix of the path names
+    :returns: the parts of the paths following the prefix
+    """
+    p_len = len(prefix)
+    for p in iter:
+        yield p.name[p_len:]
+
+
+def find_suffixes(root: Path, prefix: str) -> Iterator[str]:
+    """combines find_prefixes and extract_suffixes
+    """
+    return extract_suffixes(find_prefixed(root, prefix), prefix)
+
+
+def parse_num(maybe_num) -> int:
+    """parses number path suffixes, returns -1 on error"""
+    try:
+        return int(maybe_num)
+    except ValueError:
+        return -1
+
+
+def _force_symlink(
+    root: Path, target: Union[str, PurePath], link_to: Union[str, Path]
+) -> None:
+    """helper to create the current symlink
+
+    it's full of race conditions that are reasonably ok to ignore
+    for the context of best effort linking to the latest test run
+
+    the presumption being that in case of much parallelism
+    the inaccuracy is going to be acceptable
+    """
+    current_symlink = root.joinpath(target)
+    try:
+        current_symlink.unlink()
+    except OSError:
+        pass
+    try:
+        current_symlink.symlink_to(link_to)
+    except Exception:
+        pass
+
+
+def make_numbered_dir(root: Path, prefix: str) -> Path:
+    """create a directory with an increased number as suffix for the given prefix"""
+    for i in range(10):
+        # try up to 10 times to create the folder
+        max_existing = max(map(parse_num, find_suffixes(root, prefix)), default=-1)
+        new_number = max_existing + 1
+        new_path = root.joinpath("{}{}".format(prefix, new_number))
+        try:
+            new_path.mkdir()
+        except Exception:
+            pass
+        else:
+            _force_symlink(root, prefix + "current", new_path)
+            return new_path
+    else:
+        raise EnvironmentError(
+            "could not create numbered dir with prefix "
+            "{prefix} in {root} after 10 tries".format(prefix=prefix, root=root)
+        )
+
+
+def create_cleanup_lock(p: Path) -> Path:
+    """crates a lock to prevent premature folder cleanup"""
+    lock_path = get_lock_path(p)
+    try:
+        fd = os.open(str(lock_path), os.O_WRONLY | os.O_CREAT | os.O_EXCL, 0o644)
+    except FileExistsError as e:
+        raise EnvironmentError("cannot create lockfile in {path}".format(path=p)) from e
+    else:
+        pid = os.getpid()
+        spid = str(pid).encode()
+        os.write(fd, spid)
+        os.close(fd)
+        if not lock_path.is_file():
+            raise EnvironmentError("lock path got renamed after successful creation")
+        return lock_path
+
+
+def register_cleanup_lock_removal(lock_path: Path, register=atexit.register):
+    """registers a cleanup function for removing a lock, by default on atexit"""
+    pid = os.getpid()
+
+    def cleanup_on_exit(lock_path: Path = lock_path, original_pid: int = pid) -> None:
+        current_pid = os.getpid()
+        if current_pid != original_pid:
+            # fork
+            return
+        try:
+            lock_path.unlink()
+        except (OSError, IOError):
+            pass
+
+    return register(cleanup_on_exit)
+
+
+def maybe_delete_a_numbered_dir(path: Path) -> None:
+    """removes a numbered directory if its lock can be obtained and it does not seem to be in use"""
+    path = ensure_extended_length_path(path)
+    lock_path = None
+    try:
+        lock_path = create_cleanup_lock(path)
+        parent = path.parent
+
+        garbage = parent.joinpath("garbage-{}".format(uuid.uuid4()))
+        path.rename(garbage)
+        rm_rf(garbage)
+    except (OSError, EnvironmentError):
+        #  known races:
+        #  * other process did a cleanup at the same time
+        #  * deletable folder was found
+        #  * process cwd (Windows)
+        return
+    finally:
+        # if we created the lock, ensure we remove it even if we failed
+        # to properly remove the numbered dir
+        if lock_path is not None:
+            try:
+                lock_path.unlink()
+            except (OSError, IOError):
+                pass
+
+
+def ensure_deletable(path: Path, consider_lock_dead_if_created_before: float) -> bool:
+    """checks if a lock exists and breaks it if its considered dead"""
+    if path.is_symlink():
+        return False
+    lock = get_lock_path(path)
+    if not lock.exists():
+        return True
+    try:
+        lock_time = lock.stat().st_mtime
+    except Exception:
+        return False
+    else:
+        if lock_time < consider_lock_dead_if_created_before:
+            lock.unlink()
+            return True
+        else:
+            return False
+
+
+def try_cleanup(path: Path, consider_lock_dead_if_created_before: float) -> None:
+    """tries to cleanup a folder if we can ensure it's deletable"""
+    if ensure_deletable(path, consider_lock_dead_if_created_before):
+        maybe_delete_a_numbered_dir(path)
+
+
+def cleanup_candidates(root: Path, prefix: str, keep: int) -> Iterator[Path]:
+    """lists candidates for numbered directories to be removed - follows py.path"""
+    max_existing = max(map(parse_num, find_suffixes(root, prefix)), default=-1)
+    max_delete = max_existing - keep
+    paths = find_prefixed(root, prefix)
+    paths, paths2 = itertools.tee(paths)
+    numbers = map(parse_num, extract_suffixes(paths2, prefix))
+    for path, number in zip(paths, numbers):
+        if number <= max_delete:
+            yield path
+
+
+def cleanup_numbered_dir(
+    root: Path, prefix: str, keep: int, consider_lock_dead_if_created_before: float
+) -> None:
+    """cleanup for lock driven numbered directories"""
+    for path in cleanup_candidates(root, prefix, keep):
+        try_cleanup(path, consider_lock_dead_if_created_before)
+    for path in root.glob("garbage-*"):
+        try_cleanup(path, consider_lock_dead_if_created_before)
+
+
+def make_numbered_dir_with_cleanup(
+    root: Path, prefix: str, keep: int, lock_timeout: float
+) -> Path:
+    """creates a numbered dir with a cleanup lock and removes old ones"""
+    e = None
+    for i in range(10):
+        try:
+            p = make_numbered_dir(root, prefix)
+            lock_path = create_cleanup_lock(p)
+            register_cleanup_lock_removal(lock_path)
+        except Exception as exc:
+            e = exc
+        else:
+            consider_lock_dead_if_created_before = p.stat().st_mtime - lock_timeout
+            cleanup_numbered_dir(
+                root=root,
+                prefix=prefix,
+                keep=keep,
+                consider_lock_dead_if_created_before=consider_lock_dead_if_created_before,
+            )
+            return p
+    assert e is not None
+    raise e
+
+
+def resolve_from_str(input, root):
+    assert not isinstance(input, Path), "would break on py2"
+    root = Path(root)
+    input = expanduser(input)
+    input = expandvars(input)
+    if isabs(input):
+        return Path(input)
+    else:
+        return root.joinpath(input)
+
+
+def fnmatch_ex(pattern: str, path) -> bool:
+    """FNMatcher port from py.path.common which works with PurePath() instances.
+
+    The difference between this algorithm and PurePath.match() is that the latter matches "**" glob expressions
+    for each part of the path, while this algorithm uses the whole path instead.
+
+    For example:
+        "tests/foo/bar/doc/test_foo.py" matches pattern "tests/**/doc/test*.py" with this algorithm, but not with
+        PurePath.match().
+
+    This algorithm was ported to keep backward-compatibility with existing settings which assume paths match according
+    this logic.
+
+    References:
+    * https://bugs.python.org/issue29249
+    * https://bugs.python.org/issue34731
+    """
+    path = PurePath(path)
+    iswin32 = sys.platform.startswith("win")
+
+    if iswin32 and sep not in pattern and posix_sep in pattern:
+        # Running on Windows, the pattern has no Windows path separators,
+        # and the pattern has one or more Posix path separators. Replace
+        # the Posix path separators with the Windows path separator.
+        pattern = pattern.replace(posix_sep, sep)
+
+    if sep not in pattern:
+        name = path.name
+    else:
+        name = str(path)
+        if path.is_absolute() and not os.path.isabs(pattern):
+            pattern = "*{}{}".format(os.sep, pattern)
+    return fnmatch.fnmatch(name, pattern)
+
+
+def parts(s: str) -> Set[str]:
+    parts = s.split(sep)
+    return {sep.join(parts[: i + 1]) or sep for i in range(len(parts))}
diff --git a/contrib/python/pytest/py3/_pytest/pytester.py b/contrib/python/pytest/py3/_pytest/pytester.py
new file mode 100644
index 0000000000..9df3ed779d
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/pytester.py
@@ -0,0 +1,1521 @@
+"""(disabled by default) support for testing pytest and pytest plugins."""
+import collections.abc
+import gc
+import importlib
+import os
+import platform
+import re
+import subprocess
+import sys
+import time
+import traceback
+from fnmatch import fnmatch
+from io import StringIO
+from typing import Callable
+from typing import Dict
+from typing import Iterable
+from typing import List
+from typing import Optional
+from typing import Sequence
+from typing import Tuple
+from typing import Union
+from weakref import WeakKeyDictionary
+
+import py
+
+import pytest
+from _pytest._code import Source
+from _pytest.capture import MultiCapture
+from _pytest.capture import SysCapture
+from _pytest.compat import TYPE_CHECKING
+from _pytest.config import _PluggyPlugin
+from _pytest.config import ExitCode
+from _pytest.fixtures import FixtureRequest
+from _pytest.main import Session
+from _pytest.monkeypatch import MonkeyPatch
+from _pytest.nodes import Collector
+from _pytest.nodes import Item
+from _pytest.pathlib import Path
+from _pytest.python import Module
+from _pytest.reports import TestReport
+from _pytest.tmpdir import TempdirFactory
+
+if TYPE_CHECKING:
+    from typing import Type
+
+    import pexpect
+
+
+IGNORE_PAM = [  # filenames added when obtaining details about the current user
+    "/var/lib/sss/mc/passwd"
+]
+
+
+def pytest_addoption(parser):
+    parser.addoption(
+        "--lsof",
+        action="store_true",
+        dest="lsof",
+        default=False,
+        help="run FD checks if lsof is available",
+    )
+
+    parser.addoption(
+        "--runpytest",
+        default="inprocess",
+        dest="runpytest",
+        choices=("inprocess", "subprocess"),
+        help=(
+            "run pytest sub runs in tests using an 'inprocess' "
+            "or 'subprocess' (python -m main) method"
+        ),
+    )
+
+    parser.addini(
+        "pytester_example_dir", help="directory to take the pytester example files from"
+    )
+
+
+def pytest_configure(config):
+    if config.getvalue("lsof"):
+        checker = LsofFdLeakChecker()
+        if checker.matching_platform():
+            config.pluginmanager.register(checker)
+
+    config.addinivalue_line(
+        "markers",
+        "pytester_example_path(*path_segments): join the given path "
+        "segments to `pytester_example_dir` for this test.",
+    )
+
+
+class LsofFdLeakChecker:
+    def get_open_files(self):
+        out = self._exec_lsof()
+        open_files = self._parse_lsof_output(out)
+        return open_files
+
+    def _exec_lsof(self):
+        pid = os.getpid()
+        # py3: use subprocess.DEVNULL directly.
+        with open(os.devnull, "wb") as devnull:
+            return subprocess.check_output(
+                ("lsof", "-Ffn0", "-p", str(pid)), stderr=devnull
+            ).decode()
+
+    def _parse_lsof_output(self, out):
+        def isopen(line):
+            return line.startswith("f") and (
+                "deleted" not in line
+                and "mem" not in line
+                and "txt" not in line
+                and "cwd" not in line
+            )
+
+        open_files = []
+
+        for line in out.split("\n"):
+            if isopen(line):
+                fields = line.split("\0")
+                fd = fields[0][1:]
+                filename = fields[1][1:]
+                if filename in IGNORE_PAM:
+                    continue
+                if filename.startswith("/"):
+                    open_files.append((fd, filename))
+
+        return open_files
+
+    def matching_platform(self):
+        try:
+            subprocess.check_output(("lsof", "-v"))
+        except (OSError, subprocess.CalledProcessError):
+            return False
+        else:
+            return True
+
+    @pytest.hookimpl(hookwrapper=True, tryfirst=True)
+    def pytest_runtest_protocol(self, item):
+        lines1 = self.get_open_files()
+        yield
+        if hasattr(sys, "pypy_version_info"):
+            gc.collect()
+        lines2 = self.get_open_files()
+
+        new_fds = {t[0] for t in lines2} - {t[0] for t in lines1}
+        leaked_files = [t for t in lines2 if t[0] in new_fds]
+        if leaked_files:
+            error = []
+            error.append("***** %s FD leakage detected" % len(leaked_files))
+            error.extend([str(f) for f in leaked_files])
+            error.append("*** Before:")
+            error.extend([str(f) for f in lines1])
+            error.append("*** After:")
+            error.extend([str(f) for f in lines2])
+            error.append(error[0])
+            error.append("*** function %s:%s: %s " % item.location)
+            error.append("See issue #2366")
+            item.warn(pytest.PytestWarning("\n".join(error)))
+
+
+# used at least by pytest-xdist plugin
+
+
+@pytest.fixture
+def _pytest(request: FixtureRequest) -> "PytestArg":
+    """Return a helper which offers a gethookrecorder(hook) method which
+    returns a HookRecorder instance which helps to make assertions about called
+    hooks.
+
+    """
+    return PytestArg(request)
+
+
+class PytestArg:
+    def __init__(self, request: FixtureRequest) -> None:
+        self.request = request
+
+    def gethookrecorder(self, hook) -> "HookRecorder":
+        hookrecorder = HookRecorder(hook._pm)
+        self.request.addfinalizer(hookrecorder.finish_recording)
+        return hookrecorder
+
+
+def get_public_names(values):
+    """Only return names from iterator values without a leading underscore."""
+    return [x for x in values if x[0] != "_"]
+
+
+class ParsedCall:
+    def __init__(self, name, kwargs):
+        self.__dict__.update(kwargs)
+        self._name = name
+
+    def __repr__(self):
+        d = self.__dict__.copy()
+        del d["_name"]
+        return "<ParsedCall {!r}(**{!r})>".format(self._name, d)
+
+    if TYPE_CHECKING:
+        # The class has undetermined attributes, this tells mypy about it.
+        def __getattr__(self, key):
+            raise NotImplementedError()
+
+
+class HookRecorder:
+    """Record all hooks called in a plugin manager.
+
+    This wraps all the hook calls in the plugin manager, recording each call
+    before propagating the normal calls.
+
+    """
+
+    def __init__(self, pluginmanager) -> None:
+        self._pluginmanager = pluginmanager
+        self.calls = []  # type: List[ParsedCall]
+
+        def before(hook_name: str, hook_impls, kwargs) -> None:
+            self.calls.append(ParsedCall(hook_name, kwargs))
+
+        def after(outcome, hook_name: str, hook_impls, kwargs) -> None:
+            pass
+
+        self._undo_wrapping = pluginmanager.add_hookcall_monitoring(before, after)
+
+    def finish_recording(self) -> None:
+        self._undo_wrapping()
+
+    def getcalls(self, names: Union[str, Iterable[str]]) -> List[ParsedCall]:
+        if isinstance(names, str):
+            names = names.split()
+        return [call for call in self.calls if call._name in names]
+
+    def assert_contains(self, entries) -> None:
+        __tracebackhide__ = True
+        i = 0
+        entries = list(entries)
+        backlocals = sys._getframe(1).f_locals
+        while entries:
+            name, check = entries.pop(0)
+            for ind, call in enumerate(self.calls[i:]):
+                if call._name == name:
+                    print("NAMEMATCH", name, call)
+                    if eval(check, backlocals, call.__dict__):
+                        print("CHECKERMATCH", repr(check), "->", call)
+                    else:
+                        print("NOCHECKERMATCH", repr(check), "-", call)
+                        continue
+                    i += ind + 1
+                    break
+                print("NONAMEMATCH", name, "with", call)
+            else:
+                pytest.fail("could not find {!r} check {!r}".format(name, check))
+
+    def popcall(self, name: str) -> ParsedCall:
+        __tracebackhide__ = True
+        for i, call in enumerate(self.calls):
+            if call._name == name:
+                del self.calls[i]
+                return call
+        lines = ["could not find call {!r}, in:".format(name)]
+        lines.extend(["  %s" % x for x in self.calls])
+        pytest.fail("\n".join(lines))
+
+    def getcall(self, name: str) -> ParsedCall:
+        values = self.getcalls(name)
+        assert len(values) == 1, (name, values)
+        return values[0]
+
+    # functionality for test reports
+
+    def getreports(
+        self,
+        names: Union[
+            str, Iterable[str]
+        ] = "pytest_runtest_logreport pytest_collectreport",
+    ) -> List[TestReport]:
+        return [x.report for x in self.getcalls(names)]
+
+    def matchreport(
+        self,
+        inamepart: str = "",
+        names: Union[
+            str, Iterable[str]
+        ] = "pytest_runtest_logreport pytest_collectreport",
+        when=None,
+    ):
+        """return a testreport whose dotted import path matches"""
+        values = []
+        for rep in self.getreports(names=names):
+            if not when and rep.when != "call" and rep.passed:
+                # setup/teardown passing reports - let's ignore those
+                continue
+            if when and rep.when != when:
+                continue
+            if not inamepart or inamepart in rep.nodeid.split("::"):
+                values.append(rep)
+        if not values:
+            raise ValueError(
+                "could not find test report matching %r: "
+                "no test reports at all!" % (inamepart,)
+            )
+        if len(values) > 1:
+            raise ValueError(
+                "found 2 or more testreports matching {!r}: {}".format(
+                    inamepart, values
+                )
+            )
+        return values[0]
+
+    def getfailures(
+        self,
+        names: Union[
+            str, Iterable[str]
+        ] = "pytest_runtest_logreport pytest_collectreport",
+    ) -> List[TestReport]:
+        return [rep for rep in self.getreports(names) if rep.failed]
+
+    def getfailedcollections(self) -> List[TestReport]:
+        return self.getfailures("pytest_collectreport")
+
+    def listoutcomes(
+        self,
+    ) -> Tuple[List[TestReport], List[TestReport], List[TestReport]]:
+        passed = []
+        skipped = []
+        failed = []
+        for rep in self.getreports("pytest_collectreport pytest_runtest_logreport"):
+            if rep.passed:
+                if rep.when == "call":
+                    passed.append(rep)
+            elif rep.skipped:
+                skipped.append(rep)
+            else:
+                assert rep.failed, "Unexpected outcome: {!r}".format(rep)
+                failed.append(rep)
+        return passed, skipped, failed
+
+    def countoutcomes(self) -> List[int]:
+        return [len(x) for x in self.listoutcomes()]
+
+    def assertoutcome(self, passed: int = 0, skipped: int = 0, failed: int = 0) -> None:
+        __tracebackhide__ = True
+
+        outcomes = self.listoutcomes()
+        realpassed, realskipped, realfailed = outcomes
+        obtained = {
+            "passed": len(realpassed),
+            "skipped": len(realskipped),
+            "failed": len(realfailed),
+        }
+        expected = {"passed": passed, "skipped": skipped, "failed": failed}
+        assert obtained == expected, outcomes
+
+    def clear(self) -> None:
+        self.calls[:] = []
+
+
+@pytest.fixture
+def linecomp() -> "LineComp":
+    return LineComp()
+
+
+@pytest.fixture(name="LineMatcher")
+def LineMatcher_fixture(request: FixtureRequest) -> "Type[LineMatcher]":
+    return LineMatcher
+
+
+@pytest.fixture
+def testdir(request: FixtureRequest, tmpdir_factory) -> "Testdir":
+    return Testdir(request, tmpdir_factory)
+
+
+@pytest.fixture
+def _sys_snapshot():
+    snappaths = SysPathsSnapshot()
+    snapmods = SysModulesSnapshot()
+    yield
+    snapmods.restore()
+    snappaths.restore()
+
+
+@pytest.fixture
+def _config_for_test():
+    from _pytest.config import get_config
+
+    config = get_config()
+    yield config
+    config._ensure_unconfigure()  # cleanup, e.g. capman closing tmpfiles.
+
+
+# regex to match the session duration string in the summary: "74.34s"
+rex_session_duration = re.compile(r"\d+\.\d\ds")
+# regex to match all the counts and phrases in the summary line: "34 passed, 111 skipped"
+rex_outcome = re.compile(r"(\d+) (\w+)")
+
+
+class RunResult:
+    """The result of running a command.
+
+    Attributes:
+
+    :ivar ret: the return value
+    :ivar outlines: list of lines captured from stdout
+    :ivar errlines: list of lines captured from stderr
+    :ivar stdout: :py:class:`LineMatcher` of stdout, use ``stdout.str()`` to
+       reconstruct stdout or the commonly used ``stdout.fnmatch_lines()``
+       method
+    :ivar stderr: :py:class:`LineMatcher` of stderr
+    :ivar duration: duration in seconds
+    """
+
+    def __init__(
+        self,
+        ret: Union[int, ExitCode],
+        outlines: List[str],
+        errlines: List[str],
+        duration: float,
+    ) -> None:
+        try:
+            self.ret = pytest.ExitCode(ret)  # type: Union[int, ExitCode]
+        except ValueError:
+            self.ret = ret
+        self.outlines = outlines
+        self.errlines = errlines
+        self.stdout = LineMatcher(outlines)
+        self.stderr = LineMatcher(errlines)
+        self.duration = duration
+
+    def __repr__(self) -> str:
+        return (
+            "<RunResult ret=%s len(stdout.lines)=%d len(stderr.lines)=%d duration=%.2fs>"
+            % (self.ret, len(self.stdout.lines), len(self.stderr.lines), self.duration)
+        )
+
+    def parseoutcomes(self) -> Dict[str, int]:
+        """Return a dictionary of outcomestring->num from parsing the terminal
+        output that the test process produced.
+
+        """
+        for line in reversed(self.outlines):
+            if rex_session_duration.search(line):
+                outcomes = rex_outcome.findall(line)
+                ret = {noun: int(count) for (count, noun) in outcomes}
+                break
+        else:
+            raise ValueError("Pytest terminal summary report not found")
+        if "errors" in ret:
+            assert "error" not in ret
+            ret["error"] = ret.pop("errors")
+        return ret
+
+    def assert_outcomes(
+        self,
+        passed: int = 0,
+        skipped: int = 0,
+        failed: int = 0,
+        error: int = 0,
+        xpassed: int = 0,
+        xfailed: int = 0,
+    ) -> None:
+        """Assert that the specified outcomes appear with the respective
+        numbers (0 means it didn't occur) in the text output from a test run.
+        """
+        __tracebackhide__ = True
+
+        d = self.parseoutcomes()
+        obtained = {
+            "passed": d.get("passed", 0),
+            "skipped": d.get("skipped", 0),
+            "failed": d.get("failed", 0),
+            "error": d.get("error", 0),
+            "xpassed": d.get("xpassed", 0),
+            "xfailed": d.get("xfailed", 0),
+        }
+        expected = {
+            "passed": passed,
+            "skipped": skipped,
+            "failed": failed,
+            "error": error,
+            "xpassed": xpassed,
+            "xfailed": xfailed,
+        }
+        assert obtained == expected
+
+
+class CwdSnapshot:
+    def __init__(self) -> None:
+        self.__saved = os.getcwd()
+
+    def restore(self) -> None:
+        os.chdir(self.__saved)
+
+
+class SysModulesSnapshot:
+    def __init__(self, preserve: Optional[Callable[[str], bool]] = None):
+        self.__preserve = preserve
+        self.__saved = dict(sys.modules)
+
+    def restore(self) -> None:
+        if self.__preserve:
+            self.__saved.update(
+                (k, m) for k, m in sys.modules.items() if self.__preserve(k)
+            )
+        sys.modules.clear()
+        sys.modules.update(self.__saved)
+
+
+class SysPathsSnapshot:
+    def __init__(self) -> None:
+        self.__saved = list(sys.path), list(sys.meta_path)
+
+    def restore(self) -> None:
+        sys.path[:], sys.meta_path[:] = self.__saved
+
+
+class Testdir:
+    """Temporary test directory with tools to test/run pytest itself.
+
+    This is based on the ``tmpdir`` fixture but provides a number of methods
+    which aid with testing pytest itself.  Unless :py:meth:`chdir` is used all
+    methods will use :py:attr:`tmpdir` as their current working directory.
+
+    Attributes:
+
+    :ivar tmpdir: The :py:class:`py.path.local` instance of the temporary directory.
+
+    :ivar plugins: A list of plugins to use with :py:meth:`parseconfig` and
+       :py:meth:`runpytest`.  Initially this is an empty list but plugins can
+       be added to the list.  The type of items to add to the list depends on
+       the method using them so refer to them for details.
+
+    """
+
+    __test__ = False
+
+    CLOSE_STDIN = object
+
+    class TimeoutExpired(Exception):
+        pass
+
+    def __init__(self, request: FixtureRequest, tmpdir_factory: TempdirFactory) -> None:
+        self.request = request
+        self._mod_collections = (
+            WeakKeyDictionary()
+        )  # type: WeakKeyDictionary[Module, List[Union[Item, Collector]]]
+        if request.function:
+            name = request.function.__name__  # type: str
+        else:
+            name = request.node.name
+        self._name = name
+        self.tmpdir = tmpdir_factory.mktemp(name, numbered=True)
+        self.test_tmproot = tmpdir_factory.mktemp("tmp-" + name, numbered=True)
+        self.plugins = []  # type: List[Union[str, _PluggyPlugin]]
+        self._cwd_snapshot = CwdSnapshot()
+        self._sys_path_snapshot = SysPathsSnapshot()
+        self._sys_modules_snapshot = self.__take_sys_modules_snapshot()
+        self.chdir()
+        self.request.addfinalizer(self.finalize)
+        self._method = self.request.config.getoption("--runpytest")
+
+        mp = self.monkeypatch = MonkeyPatch()
+        mp.setenv("PYTEST_DEBUG_TEMPROOT", str(self.test_tmproot))
+        # Ensure no unexpected caching via tox.
+        mp.delenv("TOX_ENV_DIR", raising=False)
+        # Discard outer pytest options.
+        mp.delenv("PYTEST_ADDOPTS", raising=False)
+        # Ensure no user config is used.
+        tmphome = str(self.tmpdir)
+        mp.setenv("HOME", tmphome)
+        mp.setenv("USERPROFILE", tmphome)
+        # Do not use colors for inner runs by default.
+        mp.setenv("PY_COLORS", "0")
+
+    def __repr__(self):
+        return "<Testdir {!r}>".format(self.tmpdir)
+
+    def __str__(self):
+        return str(self.tmpdir)
+
+    def finalize(self):
+        """Clean up global state artifacts.
+
+        Some methods modify the global interpreter state and this tries to
+        clean this up.  It does not remove the temporary directory however so
+        it can be looked at after the test run has finished.
+
+        """
+        self._sys_modules_snapshot.restore()
+        self._sys_path_snapshot.restore()
+        self._cwd_snapshot.restore()
+        self.monkeypatch.undo()
+
+    def __take_sys_modules_snapshot(self):
+        # some zope modules used by twisted-related tests keep internal state
+        # and can't be deleted; we had some trouble in the past with
+        # `zope.interface` for example
+        def preserve_module(name):
+            return name.startswith("zope")
+
+        return SysModulesSnapshot(preserve=preserve_module)
+
+    def make_hook_recorder(self, pluginmanager):
+        """Create a new :py:class:`HookRecorder` for a PluginManager."""
+        pluginmanager.reprec = reprec = HookRecorder(pluginmanager)
+        self.request.addfinalizer(reprec.finish_recording)
+        return reprec
+
+    def chdir(self):
+        """Cd into the temporary directory.
+
+        This is done automatically upon instantiation.
+
+        """
+        self.tmpdir.chdir()
+
+    def _makefile(self, ext, lines, files, encoding="utf-8"):
+        items = list(files.items())
+
+        def to_text(s):
+            return s.decode(encoding) if isinstance(s, bytes) else str(s)
+
+        if lines:
+            source = "\n".join(to_text(x) for x in lines)
+            basename = self._name
+            items.insert(0, (basename, source))
+
+        ret = None
+        for basename, value in items:
+            p = self.tmpdir.join(basename).new(ext=ext)
+            p.dirpath().ensure_dir()
+            source = Source(value)
+            source = "\n".join(to_text(line) for line in source.lines)
+            p.write(source.strip().encode(encoding), "wb")
+            if ret is None:
+                ret = p
+        return ret
+
+    def makefile(self, ext, *args, **kwargs):
+        r"""Create new file(s) in the testdir.
+
+        :param str ext: The extension the file(s) should use, including the dot, e.g. `.py`.
+        :param list[str] args: All args will be treated as strings and joined using newlines.
+           The result will be written as contents to the file.  The name of the
+           file will be based on the test function requesting this fixture.
+        :param kwargs: Each keyword is the name of a file, while the value of it will
+           be written as contents of the file.
+
+        Examples:
+
+        .. code-block:: python
+
+            testdir.makefile(".txt", "line1", "line2")
+
+            testdir.makefile(".ini", pytest="[pytest]\naddopts=-rs\n")
+
+        """
+        return self._makefile(ext, args, kwargs)
+
+    def makeconftest(self, source):
+        """Write a contest.py file with 'source' as contents."""
+        return self.makepyfile(conftest=source)
+
+    def makeini(self, source):
+        """Write a tox.ini file with 'source' as contents."""
+        return self.makefile(".ini", tox=source)
+
+    def getinicfg(self, source):
+        """Return the pytest section from the tox.ini config file."""
+        p = self.makeini(source)
+        return py.iniconfig.IniConfig(p)["pytest"]
+
+    def makepyfile(self, *args, **kwargs):
+        """Shortcut for .makefile() with a .py extension."""
+        return self._makefile(".py", args, kwargs)
+
+    def maketxtfile(self, *args, **kwargs):
+        """Shortcut for .makefile() with a .txt extension."""
+        return self._makefile(".txt", args, kwargs)
+
+    def syspathinsert(self, path=None):
+        """Prepend a directory to sys.path, defaults to :py:attr:`tmpdir`.
+
+        This is undone automatically when this object dies at the end of each
+        test.
+        """
+        if path is None:
+            path = self.tmpdir
+
+        self.monkeypatch.syspath_prepend(str(path))
+
+    def mkdir(self, name):
+        """Create a new (sub)directory."""
+        return self.tmpdir.mkdir(name)
+
+    def mkpydir(self, name):
+        """Create a new python package.
+
+        This creates a (sub)directory with an empty ``__init__.py`` file so it
+        gets recognised as a python package.
+
+        """
+        p = self.mkdir(name)
+        p.ensure("__init__.py")
+        return p
+
+    def copy_example(self, name=None):
+        """Copy file from project's directory into the testdir.
+
+        :param str name: The name of the file to copy.
+        :return: path to the copied directory (inside ``self.tmpdir``).
+
+        """
+        import warnings
+        from _pytest.warning_types import PYTESTER_COPY_EXAMPLE
+
+        warnings.warn(PYTESTER_COPY_EXAMPLE, stacklevel=2)
+        example_dir = self.request.config.getini("pytester_example_dir")
+        if example_dir is None:
+            raise ValueError("pytester_example_dir is unset, can't copy examples")
+        example_dir = self.request.config.rootdir.join(example_dir)
+
+        for extra_element in self.request.node.iter_markers("pytester_example_path"):
+            assert extra_element.args
+            example_dir = example_dir.join(*extra_element.args)
+
+        if name is None:
+            func_name = self._name
+            maybe_dir = example_dir / func_name
+            maybe_file = example_dir / (func_name + ".py")
+
+            if maybe_dir.isdir():
+                example_path = maybe_dir
+            elif maybe_file.isfile():
+                example_path = maybe_file
+            else:
+                raise LookupError(
+                    "{} cant be found as module or package in {}".format(
+                        func_name, example_dir.bestrelpath(self.request.config.rootdir)
+                    )
+                )
+        else:
+            example_path = example_dir.join(name)
+
+        if example_path.isdir() and not example_path.join("__init__.py").isfile():
+            example_path.copy(self.tmpdir)
+            return self.tmpdir
+        elif example_path.isfile():
+            result = self.tmpdir.join(example_path.basename)
+            example_path.copy(result)
+            return result
+        else:
+            raise LookupError(
+                'example "{}" is not found as a file or directory'.format(example_path)
+            )
+
+    Session = Session
+
+    def getnode(self, config, arg):
+        """Return the collection node of a file.
+
+        :param config: :py:class:`_pytest.config.Config` instance, see
+           :py:meth:`parseconfig` and :py:meth:`parseconfigure` to create the
+           configuration
+
+        :param arg: a :py:class:`py.path.local` instance of the file
+
+        """
+        session = Session.from_config(config)
+        assert "::" not in str(arg)
+        p = py.path.local(arg)
+        config.hook.pytest_sessionstart(session=session)
+        res = session.perform_collect([str(p)], genitems=False)[0]
+        config.hook.pytest_sessionfinish(session=session, exitstatus=ExitCode.OK)
+        return res
+
+    def getpathnode(self, path):
+        """Return the collection node of a file.
+
+        This is like :py:meth:`getnode` but uses :py:meth:`parseconfigure` to
+        create the (configured) pytest Config instance.
+
+        :param path: a :py:class:`py.path.local` instance of the file
+
+        """
+        config = self.parseconfigure(path)
+        session = Session.from_config(config)
+        x = session.fspath.bestrelpath(path)
+        config.hook.pytest_sessionstart(session=session)
+        res = session.perform_collect([x], genitems=False)[0]
+        config.hook.pytest_sessionfinish(session=session, exitstatus=ExitCode.OK)
+        return res
+
+    def genitems(self, colitems):
+        """Generate all test items from a collection node.
+
+        This recurses into the collection node and returns a list of all the
+        test items contained within.
+
+        """
+        session = colitems[0].session
+        result = []
+        for colitem in colitems:
+            result.extend(session.genitems(colitem))
+        return result
+
+    def runitem(self, source):
+        """Run the "test_func" Item.
+
+        The calling test instance (class containing the test method) must
+        provide a ``.getrunner()`` method which should return a runner which
+        can run the test protocol for a single item, e.g.
+        :py:func:`_pytest.runner.runtestprotocol`.
+
+        """
+        # used from runner functional tests
+        item = self.getitem(source)
+        # the test class where we are called from wants to provide the runner
+        testclassinstance = self.request.instance
+        runner = testclassinstance.getrunner()
+        return runner(item)
+
+    def inline_runsource(self, source, *cmdlineargs):
+        """Run a test module in process using ``pytest.main()``.
+
+        This run writes "source" into a temporary file and runs
+        ``pytest.main()`` on it, returning a :py:class:`HookRecorder` instance
+        for the result.
+
+        :param source: the source code of the test module
+
+        :param cmdlineargs: any extra command line arguments to use
+
+        :return: :py:class:`HookRecorder` instance of the result
+
+        """
+        p = self.makepyfile(source)
+        values = list(cmdlineargs) + [p]
+        return self.inline_run(*values)
+
+    def inline_genitems(self, *args):
+        """Run ``pytest.main(['--collectonly'])`` in-process.
+
+        Runs the :py:func:`pytest.main` function to run all of pytest inside
+        the test process itself like :py:meth:`inline_run`, but returns a
+        tuple of the collected items and a :py:class:`HookRecorder` instance.
+
+        """
+        rec = self.inline_run("--collect-only", *args)
+        items = [x.item for x in rec.getcalls("pytest_itemcollected")]
+        return items, rec
+
+    def inline_run(self, *args, plugins=(), no_reraise_ctrlc: bool = False):
+        """Run ``pytest.main()`` in-process, returning a HookRecorder.
+
+        Runs the :py:func:`pytest.main` function to run all of pytest inside
+        the test process itself.  This means it can return a
+        :py:class:`HookRecorder` instance which gives more detailed results
+        from that run than can be done by matching stdout/stderr from
+        :py:meth:`runpytest`.
+
+        :param args: command line arguments to pass to :py:func:`pytest.main`
+
+        :kwarg plugins: extra plugin instances the ``pytest.main()`` instance should use.
+
+        :kwarg no_reraise_ctrlc: typically we reraise keyboard interrupts from the child run. If
+            True, the KeyboardInterrupt exception is captured.
+
+        :return: a :py:class:`HookRecorder` instance
+        """
+        # (maybe a cpython bug?) the importlib cache sometimes isn't updated
+        # properly between file creation and inline_run (especially if imports
+        # are interspersed with file creation)
+        importlib.invalidate_caches()
+
+        plugins = list(plugins)
+        finalizers = []
+        try:
+            # Any sys.module or sys.path changes done while running pytest
+            # inline should be reverted after the test run completes to avoid
+            # clashing with later inline tests run within the same pytest test,
+            # e.g. just because they use matching test module names.
+            finalizers.append(self.__take_sys_modules_snapshot().restore)
+            finalizers.append(SysPathsSnapshot().restore)
+
+            # Important note:
+            # - our tests should not leave any other references/registrations
+            #   laying around other than possibly loaded test modules
+            #   referenced from sys.modules, as nothing will clean those up
+            #   automatically
+
+            rec = []
+
+            class Collect:
+                def pytest_configure(x, config):
+                    rec.append(self.make_hook_recorder(config.pluginmanager))
+
+            plugins.append(Collect())
+            ret = pytest.main(list(args), plugins=plugins)
+            if len(rec) == 1:
+                reprec = rec.pop()
+            else:
+
+                class reprec:  # type: ignore
+                    pass
+
+            reprec.ret = ret
+
+            # typically we reraise keyboard interrupts from the child run
+            # because it's our user requesting interruption of the testing
+            if ret == ExitCode.INTERRUPTED and not no_reraise_ctrlc:
+                calls = reprec.getcalls("pytest_keyboard_interrupt")
+                if calls and calls[-1].excinfo.type == KeyboardInterrupt:
+                    raise KeyboardInterrupt()
+            return reprec
+        finally:
+            for finalizer in finalizers:
+                finalizer()
+
+    def runpytest_inprocess(self, *args, **kwargs) -> RunResult:
+        """Return result of running pytest in-process, providing a similar
+        interface to what self.runpytest() provides.
+        """
+        syspathinsert = kwargs.pop("syspathinsert", False)
+
+        if syspathinsert:
+            self.syspathinsert()
+        now = time.time()
+        capture = MultiCapture(Capture=SysCapture)
+        capture.start_capturing()
+        try:
+            try:
+                reprec = self.inline_run(*args, **kwargs)
+            except SystemExit as e:
+                ret = e.args[0]
+                try:
+                    ret = ExitCode(e.args[0])
+                except ValueError:
+                    pass
+
+                class reprec:  # type: ignore
+                    ret = ret
+
+            except Exception:
+                traceback.print_exc()
+
+                class reprec:  # type: ignore
+                    ret = ExitCode(3)
+
+        finally:
+            out, err = capture.readouterr()
+            capture.stop_capturing()
+            sys.stdout.write(out)
+            sys.stderr.write(err)
+
+        res = RunResult(
+            reprec.ret, out.splitlines(), err.splitlines(), time.time() - now
+        )
+        res.reprec = reprec  # type: ignore
+        return res
+
+    def runpytest(self, *args, **kwargs) -> RunResult:
+        """Run pytest inline or in a subprocess, depending on the command line
+        option "--runpytest" and return a :py:class:`RunResult`.
+
+        """
+        args = self._ensure_basetemp(args)
+        if self._method == "inprocess":
+            return self.runpytest_inprocess(*args, **kwargs)
+        elif self._method == "subprocess":
+            return self.runpytest_subprocess(*args, **kwargs)
+        raise RuntimeError("Unrecognized runpytest option: {}".format(self._method))
+
+    def _ensure_basetemp(self, args):
+        args = list(args)
+        for x in args:
+            if str(x).startswith("--basetemp"):
+                break
+        else:
+            args.append("--basetemp=%s" % self.tmpdir.dirpath("basetemp"))
+        return args
+
+    def parseconfig(self, *args):
+        """Return a new pytest Config instance from given commandline args.
+
+        This invokes the pytest bootstrapping code in _pytest.config to create
+        a new :py:class:`_pytest.core.PluginManager` and call the
+        pytest_cmdline_parse hook to create a new
+        :py:class:`_pytest.config.Config` instance.
+
+        If :py:attr:`plugins` has been populated they should be plugin modules
+        to be registered with the PluginManager.
+
+        """
+        args = self._ensure_basetemp(args)
+
+        import _pytest.config
+
+        config = _pytest.config._prepareconfig(args, self.plugins)
+        # we don't know what the test will do with this half-setup config
+        # object and thus we make sure it gets unconfigured properly in any
+        # case (otherwise capturing could still be active, for example)
+        self.request.addfinalizer(config._ensure_unconfigure)
+        return config
+
+    def parseconfigure(self, *args):
+        """Return a new pytest configured Config instance.
+
+        This returns a new :py:class:`_pytest.config.Config` instance like
+        :py:meth:`parseconfig`, but also calls the pytest_configure hook.
+        """
+        config = self.parseconfig(*args)
+        config._do_configure()
+        return config
+
+    def getitem(self, source, funcname="test_func"):
+        """Return the test item for a test function.
+
+        This writes the source to a python file and runs pytest's collection on
+        the resulting module, returning the test item for the requested
+        function name.
+
+        :param source: the module source
+
+        :param funcname: the name of the test function for which to return a
+            test item
+
+        """
+        items = self.getitems(source)
+        for item in items:
+            if item.name == funcname:
+                return item
+        assert 0, "{!r} item not found in module:\n{}\nitems: {}".format(
+            funcname, source, items
+        )
+
+    def getitems(self, source):
+        """Return all test items collected from the module.
+
+        This writes the source to a python file and runs pytest's collection on
+        the resulting module, returning all test items contained within.
+
+        """
+        modcol = self.getmodulecol(source)
+        return self.genitems([modcol])
+
+    def getmodulecol(self, source, configargs=(), withinit=False):
+        """Return the module collection node for ``source``.
+
+        This writes ``source`` to a file using :py:meth:`makepyfile` and then
+        runs the pytest collection on it, returning the collection node for the
+        test module.
+
+        :param source: the source code of the module to collect
+
+        :param configargs: any extra arguments to pass to
+            :py:meth:`parseconfigure`
+
+        :param withinit: whether to also write an ``__init__.py`` file to the
+            same directory to ensure it is a package
+
+        """
+        if isinstance(source, Path):
+            path = self.tmpdir.join(str(source))
+            assert not withinit, "not supported for paths"
+        else:
+            kw = {self._name: Source(source).strip()}
+            path = self.makepyfile(**kw)
+        if withinit:
+            self.makepyfile(__init__="#")
+        self.config = config = self.parseconfigure(path, *configargs)
+        return self.getnode(config, path)
+
+    def collect_by_name(
+        self, modcol: Module, name: str
+    ) -> Optional[Union[Item, Collector]]:
+        """Return the collection node for name from the module collection.
+
+        This will search a module collection node for a collection node
+        matching the given name.
+
+        :param modcol: a module collection node; see :py:meth:`getmodulecol`
+
+        :param name: the name of the node to return
+        """
+        if modcol not in self._mod_collections:
+            self._mod_collections[modcol] = list(modcol.collect())
+        for colitem in self._mod_collections[modcol]:
+            if colitem.name == name:
+                return colitem
+        return None
+
+    def popen(
+        self,
+        cmdargs,
+        stdout=subprocess.PIPE,
+        stderr=subprocess.PIPE,
+        stdin=CLOSE_STDIN,
+        **kw
+    ):
+        """Invoke subprocess.Popen.
+
+        This calls subprocess.Popen making sure the current working directory
+        is in the PYTHONPATH.
+
+        You probably want to use :py:meth:`run` instead.
+
+        """
+        env = os.environ.copy()
+        env["PYTHONPATH"] = os.pathsep.join(
+            filter(None, [os.getcwd(), env.get("PYTHONPATH", "")])
+        )
+        kw["env"] = env
+
+        if stdin is Testdir.CLOSE_STDIN:
+            kw["stdin"] = subprocess.PIPE
+        elif isinstance(stdin, bytes):
+            kw["stdin"] = subprocess.PIPE
+        else:
+            kw["stdin"] = stdin
+
+        popen = subprocess.Popen(cmdargs, stdout=stdout, stderr=stderr, **kw)
+        if stdin is Testdir.CLOSE_STDIN:
+            popen.stdin.close()
+        elif isinstance(stdin, bytes):
+            popen.stdin.write(stdin)
+
+        return popen
+
+    def run(self, *cmdargs, timeout=None, stdin=CLOSE_STDIN) -> RunResult:
+        """Run a command with arguments.
+
+        Run a process using subprocess.Popen saving the stdout and stderr.
+
+        :param args: the sequence of arguments to pass to `subprocess.Popen()`
+        :kwarg timeout: the period in seconds after which to timeout and raise
+            :py:class:`Testdir.TimeoutExpired`
+        :kwarg stdin: optional standard input.  Bytes are being send, closing
+            the pipe, otherwise it is passed through to ``popen``.
+            Defaults to ``CLOSE_STDIN``, which translates to using a pipe
+            (``subprocess.PIPE``) that gets closed.
+
+        Returns a :py:class:`RunResult`.
+
+        """
+        __tracebackhide__ = True
+
+        cmdargs = tuple(
+            str(arg) if isinstance(arg, py.path.local) else arg for arg in cmdargs
+        )
+        p1 = self.tmpdir.join("stdout")
+        p2 = self.tmpdir.join("stderr")
+        print("running:", *cmdargs)
+        print("     in:", py.path.local())
+        f1 = open(str(p1), "w", encoding="utf8")
+        f2 = open(str(p2), "w", encoding="utf8")
+        try:
+            now = time.time()
+            popen = self.popen(
+                cmdargs,
+                stdin=stdin,
+                stdout=f1,
+                stderr=f2,
+                close_fds=(sys.platform != "win32"),
+            )
+            if isinstance(stdin, bytes):
+                popen.stdin.close()
+
+            def handle_timeout():
+                __tracebackhide__ = True
+
+                timeout_message = (
+                    "{seconds} second timeout expired running:"
+                    " {command}".format(seconds=timeout, command=cmdargs)
+                )
+
+                popen.kill()
+                popen.wait()
+                raise self.TimeoutExpired(timeout_message)
+
+            if timeout is None:
+                ret = popen.wait()
+            else:
+                try:
+                    ret = popen.wait(timeout)
+                except subprocess.TimeoutExpired:
+                    handle_timeout()
+        finally:
+            f1.close()
+            f2.close()
+        f1 = open(str(p1), "r", encoding="utf8")
+        f2 = open(str(p2), "r", encoding="utf8")
+        try:
+            out = f1.read().splitlines()
+            err = f2.read().splitlines()
+        finally:
+            f1.close()
+            f2.close()
+        self._dump_lines(out, sys.stdout)
+        self._dump_lines(err, sys.stderr)
+        try:
+            ret = ExitCode(ret)
+        except ValueError:
+            pass
+        return RunResult(ret, out, err, time.time() - now)
+
+    def _dump_lines(self, lines, fp):
+        try:
+            for line in lines:
+                print(line, file=fp)
+        except UnicodeEncodeError:
+            print("couldn't print to {} because of encoding".format(fp))
+
+    def _getpytestargs(self):
+        return sys.executable, "-mpytest"
+
+    def runpython(self, script) -> RunResult:
+        """Run a python script using sys.executable as interpreter.
+
+        Returns a :py:class:`RunResult`.
+
+        """
+        return self.run(sys.executable, script)
+
+    def runpython_c(self, command):
+        """Run python -c "command", return a :py:class:`RunResult`."""
+        return self.run(sys.executable, "-c", command)
+
+    def runpytest_subprocess(self, *args, timeout=None) -> RunResult:
+        """Run pytest as a subprocess with given arguments.
+
+        Any plugins added to the :py:attr:`plugins` list will be added using the
+        ``-p`` command line option.  Additionally ``--basetemp`` is used to put
+        any temporary files and directories in a numbered directory prefixed
+        with "runpytest-" to not conflict with the normal numbered pytest
+        location for temporary files and directories.
+
+        :param args: the sequence of arguments to pass to the pytest subprocess
+        :param timeout: the period in seconds after which to timeout and raise
+            :py:class:`Testdir.TimeoutExpired`
+
+        Returns a :py:class:`RunResult`.
+        """
+        __tracebackhide__ = True
+        p = py.path.local.make_numbered_dir(
+            prefix="runpytest-", keep=None, rootdir=self.tmpdir
+        )
+        args = ("--basetemp=%s" % p,) + args
+        plugins = [x for x in self.plugins if isinstance(x, str)]
+        if plugins:
+            args = ("-p", plugins[0]) + args
+        args = self._getpytestargs() + args
+        return self.run(*args, timeout=timeout)
+
+    def spawn_pytest(
+        self, string: str, expect_timeout: float = 10.0
+    ) -> "pexpect.spawn":
+        """Run pytest using pexpect.
+
+        This makes sure to use the right pytest and sets up the temporary
+        directory locations.
+
+        The pexpect child is returned.
+
+        """
+        basetemp = self.tmpdir.mkdir("temp-pexpect")
+        invoke = " ".join(map(str, self._getpytestargs()))
+        cmd = "{} --basetemp={} {}".format(invoke, basetemp, string)
+        return self.spawn(cmd, expect_timeout=expect_timeout)
+
+    def spawn(self, cmd: str, expect_timeout: float = 10.0) -> "pexpect.spawn":
+        """Run a command using pexpect.
+
+        The pexpect child is returned.
+
+        """
+        pexpect = pytest.importorskip("pexpect", "3.0")
+        if hasattr(sys, "pypy_version_info") and "64" in platform.machine():
+            pytest.skip("pypy-64 bit not supported")
+        if not hasattr(pexpect, "spawn"):
+            pytest.skip("pexpect.spawn not available")
+        logfile = self.tmpdir.join("spawn.out").open("wb")
+
+        child = pexpect.spawn(cmd, logfile=logfile)
+        self.request.addfinalizer(logfile.close)
+        child.timeout = expect_timeout
+        return child
+
+
+class LineComp:
+    def __init__(self) -> None:
+        self.stringio = StringIO()
+        """:class:`python:io.StringIO()` instance used for input."""
+
+    def assert_contains_lines(self, lines2: Sequence[str]) -> None:
+        """Assert that ``lines2`` are contained (linearly) in :attr:`stringio`'s value.
+
+        Lines are matched using :func:`LineMatcher.fnmatch_lines`.
+        """
+        __tracebackhide__ = True
+        val = self.stringio.getvalue()
+        self.stringio.truncate(0)
+        self.stringio.seek(0)
+        lines1 = val.split("\n")
+        LineMatcher(lines1).fnmatch_lines(lines2)
+
+
+class LineMatcher:
+    """Flexible matching of text.
+
+    This is a convenience class to test large texts like the output of
+    commands.
+
+    The constructor takes a list of lines without their trailing newlines, i.e.
+    ``text.splitlines()``.
+    """
+
+    def __init__(self, lines: List[str]) -> None:
+        self.lines = lines
+        self._log_output = []  # type: List[str]
+
+    def _getlines(self, lines2: Union[str, Sequence[str], Source]) -> Sequence[str]:
+        if isinstance(lines2, str):
+            lines2 = Source(lines2)
+        if isinstance(lines2, Source):
+            lines2 = lines2.strip().lines
+        return lines2
+
+    def fnmatch_lines_random(self, lines2: Sequence[str]) -> None:
+        """Check lines exist in the output in any order (using :func:`python:fnmatch.fnmatch`).
+        """
+        __tracebackhide__ = True
+        self._match_lines_random(lines2, fnmatch)
+
+    def re_match_lines_random(self, lines2: Sequence[str]) -> None:
+        """Check lines exist in the output in any order (using :func:`python:re.match`).
+        """
+        __tracebackhide__ = True
+        self._match_lines_random(lines2, lambda name, pat: bool(re.match(pat, name)))
+
+    def _match_lines_random(
+        self, lines2: Sequence[str], match_func: Callable[[str, str], bool]
+    ) -> None:
+        __tracebackhide__ = True
+        lines2 = self._getlines(lines2)
+        for line in lines2:
+            for x in self.lines:
+                if line == x or match_func(x, line):
+                    self._log("matched: ", repr(line))
+                    break
+            else:
+                msg = "line %r not found in output" % line
+                self._log(msg)
+                self._fail(msg)
+
+    def get_lines_after(self, fnline: str) -> Sequence[str]:
+        """Return all lines following the given line in the text.
+
+        The given line can contain glob wildcards.
+        """
+        for i, line in enumerate(self.lines):
+            if fnline == line or fnmatch(line, fnline):
+                return self.lines[i + 1 :]
+        raise ValueError("line %r not found in output" % fnline)
+
+    def _log(self, *args) -> None:
+        self._log_output.append(" ".join(str(x) for x in args))
+
+    @property
+    def _log_text(self) -> str:
+        return "\n".join(self._log_output)
+
+    def fnmatch_lines(
+        self, lines2: Sequence[str], *, consecutive: bool = False
+    ) -> None:
+        """Check lines exist in the output (using :func:`python:fnmatch.fnmatch`).
+
+        The argument is a list of lines which have to match and can use glob
+        wildcards.  If they do not match a pytest.fail() is called.  The
+        matches and non-matches are also shown as part of the error message.
+
+        :param lines2: string patterns to match.
+        :param consecutive: match lines consecutive?
+        """
+        __tracebackhide__ = True
+        self._match_lines(lines2, fnmatch, "fnmatch", consecutive=consecutive)
+
+    def re_match_lines(
+        self, lines2: Sequence[str], *, consecutive: bool = False
+    ) -> None:
+        """Check lines exist in the output (using :func:`python:re.match`).
+
+        The argument is a list of lines which have to match using ``re.match``.
+        If they do not match a pytest.fail() is called.
+
+        The matches and non-matches are also shown as part of the error message.
+
+        :param lines2: string patterns to match.
+        :param consecutive: match lines consecutively?
+        """
+        __tracebackhide__ = True
+        self._match_lines(
+            lines2,
+            lambda name, pat: bool(re.match(pat, name)),
+            "re.match",
+            consecutive=consecutive,
+        )
+
+    def _match_lines(
+        self,
+        lines2: Sequence[str],
+        match_func: Callable[[str, str], bool],
+        match_nickname: str,
+        *,
+        consecutive: bool = False
+    ) -> None:
+        """Underlying implementation of ``fnmatch_lines`` and ``re_match_lines``.
+
+        :param list[str] lines2: list of string patterns to match. The actual
+            format depends on ``match_func``
+        :param match_func: a callable ``match_func(line, pattern)`` where line
+            is the captured line from stdout/stderr and pattern is the matching
+            pattern
+        :param str match_nickname: the nickname for the match function that
+            will be logged to stdout when a match occurs
+        :param consecutive: match lines consecutively?
+        """
+        if not isinstance(lines2, collections.abc.Sequence):
+            raise TypeError("invalid type for lines2: {}".format(type(lines2).__name__))
+        lines2 = self._getlines(lines2)
+        lines1 = self.lines[:]
+        nextline = None
+        extralines = []
+        __tracebackhide__ = True
+        wnick = len(match_nickname) + 1
+        started = False
+        for line in lines2:
+            nomatchprinted = False
+            while lines1:
+                nextline = lines1.pop(0)
+                if line == nextline:
+                    self._log("exact match:", repr(line))
+                    started = True
+                    break
+                elif match_func(nextline, line):
+                    self._log("%s:" % match_nickname, repr(line))
+                    self._log(
+                        "{:>{width}}".format("with:", width=wnick), repr(nextline)
+                    )
+                    started = True
+                    break
+                else:
+                    if consecutive and started:
+                        msg = "no consecutive match: {!r}".format(line)
+                        self._log(msg)
+                        self._log(
+                            "{:>{width}}".format("with:", width=wnick), repr(nextline)
+                        )
+                        self._fail(msg)
+                    if not nomatchprinted:
+                        self._log(
+                            "{:>{width}}".format("nomatch:", width=wnick), repr(line)
+                        )
+                        nomatchprinted = True
+                    self._log("{:>{width}}".format("and:", width=wnick), repr(nextline))
+                extralines.append(nextline)
+            else:
+                msg = "remains unmatched: {!r}".format(line)
+                self._log(msg)
+                self._fail(msg)
+        self._log_output = []
+
+    def no_fnmatch_line(self, pat: str) -> None:
+        """Ensure captured lines do not match the given pattern, using ``fnmatch.fnmatch``.
+
+        :param str pat: the pattern to match lines.
+        """
+        __tracebackhide__ = True
+        self._no_match_line(pat, fnmatch, "fnmatch")
+
+    def no_re_match_line(self, pat: str) -> None:
+        """Ensure captured lines do not match the given pattern, using ``re.match``.
+
+        :param str pat: the regular expression to match lines.
+        """
+        __tracebackhide__ = True
+        self._no_match_line(
+            pat, lambda name, pat: bool(re.match(pat, name)), "re.match"
+        )
+
+    def _no_match_line(
+        self, pat: str, match_func: Callable[[str, str], bool], match_nickname: str
+    ) -> None:
+        """Ensure captured lines does not have a the given pattern, using ``fnmatch.fnmatch``
+
+        :param str pat: the pattern to match lines
+        """
+        __tracebackhide__ = True
+        nomatch_printed = False
+        wnick = len(match_nickname) + 1
+        for line in self.lines:
+            if match_func(line, pat):
+                msg = "{}: {!r}".format(match_nickname, pat)
+                self._log(msg)
+                self._log("{:>{width}}".format("with:", width=wnick), repr(line))
+                self._fail(msg)
+            else:
+                if not nomatch_printed:
+                    self._log("{:>{width}}".format("nomatch:", width=wnick), repr(pat))
+                    nomatch_printed = True
+                self._log("{:>{width}}".format("and:", width=wnick), repr(line))
+        self._log_output = []
+
+    def _fail(self, msg: str) -> None:
+        __tracebackhide__ = True
+        log_text = self._log_text
+        self._log_output = []
+        pytest.fail(log_text)
+
+    def str(self) -> str:
+        """Return the entire original text."""
+        return "\n".join(self.lines)
diff --git a/contrib/python/pytest/py3/_pytest/python.py b/contrib/python/pytest/py3/_pytest/python.py
new file mode 100644
index 0000000000..0c1df99e36
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/python.py
@@ -0,0 +1,1550 @@
+""" Python test discovery, setup and run of test functions. """
+import enum
+import fnmatch
+import inspect
+import itertools
+import os
+import sys
+import typing
+import warnings
+from collections import Counter
+from collections import defaultdict
+from collections.abc import Sequence
+from functools import partial
+from typing import Callable
+from typing import Dict
+from typing import Iterable
+from typing import List
+from typing import Optional
+from typing import Tuple
+from typing import Union
+
+import py
+
+import _pytest
+from _pytest import fixtures
+from _pytest import nodes
+from _pytest._code import filter_traceback
+from _pytest._code.code import ExceptionInfo
+from _pytest._code.source import getfslineno
+from _pytest._io import TerminalWriter
+from _pytest._io.saferepr import saferepr
+from _pytest.compat import ascii_escaped
+from _pytest.compat import get_default_arg_names
+from _pytest.compat import get_real_func
+from _pytest.compat import getimfunc
+from _pytest.compat import getlocation
+from _pytest.compat import is_async_function
+from _pytest.compat import is_generator
+from _pytest.compat import NOTSET
+from _pytest.compat import REGEX_TYPE
+from _pytest.compat import safe_getattr
+from _pytest.compat import safe_isclass
+from _pytest.compat import STRING_TYPES
+from _pytest.config import Config
+from _pytest.config import hookimpl
+from _pytest.deprecated import FUNCARGNAMES
+from _pytest.fixtures import FuncFixtureInfo
+from _pytest.mark import MARK_GEN
+from _pytest.mark import ParameterSet
+from _pytest.mark.structures import get_unpacked_marks
+from _pytest.mark.structures import Mark
+from _pytest.mark.structures import normalize_mark_list
+from _pytest.outcomes import fail
+from _pytest.outcomes import skip
+from _pytest.pathlib import parts
+from _pytest.warning_types import PytestCollectionWarning
+from _pytest.warning_types import PytestUnhandledCoroutineWarning
+
+
+def pyobj_property(name):
+    def get(self):
+        node = self.getparent(getattr(__import__("pytest"), name))
+        if node is not None:
+            return node.obj
+
+    doc = "python {} object this node was collected from (can be None).".format(
+        name.lower()
+    )
+    return property(get, None, None, doc)
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("general")
+    group.addoption(
+        "--fixtures",
+        "--funcargs",
+        action="store_true",
+        dest="showfixtures",
+        default=False,
+        help="show available fixtures, sorted by plugin appearance "
+        "(fixtures with leading '_' are only shown with '-v')",
+    )
+    group.addoption(
+        "--fixtures-per-test",
+        action="store_true",
+        dest="show_fixtures_per_test",
+        default=False,
+        help="show fixtures per test",
+    )
+    parser.addini(
+        "python_files",
+        type="args",
+        # NOTE: default is also used in AssertionRewritingHook.
+        default=["test_*.py", "*_test.py"],
+        help="glob-style file patterns for Python test module discovery",
+    )
+    parser.addini(
+        "python_classes",
+        type="args",
+        default=["Test"],
+        help="prefixes or glob names for Python test class discovery",
+    )
+    parser.addini(
+        "python_functions",
+        type="args",
+        default=["test"],
+        help="prefixes or glob names for Python test function and method discovery",
+    )
+    parser.addini(
+        "disable_test_id_escaping_and_forfeit_all_rights_to_community_support",
+        type="bool",
+        default=False,
+        help="disable string escape non-ascii characters, might cause unwanted "
+        "side effects(use at your own risk)",
+    )
+
+    group.addoption(
+        "--import-mode",
+        default="prepend",
+        choices=["prepend", "append"],
+        dest="importmode",
+        help="prepend/append to sys.path when importing test modules, "
+        "default is to prepend.",
+    )
+
+
+def pytest_cmdline_main(config):
+    if config.option.showfixtures:
+        showfixtures(config)
+        return 0
+    if config.option.show_fixtures_per_test:
+        show_fixtures_per_test(config)
+        return 0
+
+
+def pytest_generate_tests(metafunc: "Metafunc") -> None:
+    for marker in metafunc.definition.iter_markers(name="parametrize"):
+        # TODO: Fix this type-ignore (overlapping kwargs).
+        metafunc.parametrize(*marker.args, **marker.kwargs, _param_mark=marker)  # type: ignore[misc] # noqa: F821
+
+
+def pytest_configure(config):
+    config.addinivalue_line(
+        "markers",
+        "parametrize(argnames, argvalues): call a test function multiple "
+        "times passing in different arguments in turn. argvalues generally "
+        "needs to be a list of values if argnames specifies only one name "
+        "or a list of tuples of values if argnames specifies multiple names. "
+        "Example: @parametrize('arg1', [1,2]) would lead to two calls of the "
+        "decorated test function, one with arg1=1 and another with arg1=2."
+        "see https://docs.pytest.org/en/latest/parametrize.html for more info "
+        "and examples.",
+    )
+    config.addinivalue_line(
+        "markers",
+        "usefixtures(fixturename1, fixturename2, ...): mark tests as needing "
+        "all of the specified fixtures. see "
+        "https://docs.pytest.org/en/latest/fixture.html#usefixtures ",
+    )
+
+
+def async_warn_and_skip(nodeid: str) -> None:
+    msg = "async def functions are not natively supported and have been skipped.\n"
+    msg += (
+        "You need to install a suitable plugin for your async framework, for example:\n"
+    )
+    msg += "  - pytest-asyncio\n"
+    msg += "  - pytest-trio\n"
+    msg += "  - pytest-tornasync\n"
+    msg += "  - pytest-twisted"
+    warnings.warn(PytestUnhandledCoroutineWarning(msg.format(nodeid)))
+    skip(msg="async def function and no async plugin installed (see warnings)")
+
+
+@hookimpl(trylast=True)
+def pytest_pyfunc_call(pyfuncitem: "Function"):
+    testfunction = pyfuncitem.obj
+    if is_async_function(testfunction):
+        async_warn_and_skip(pyfuncitem.nodeid)
+    funcargs = pyfuncitem.funcargs
+    testargs = {arg: funcargs[arg] for arg in pyfuncitem._fixtureinfo.argnames}
+    result = testfunction(**testargs)
+    if hasattr(result, "__await__") or hasattr(result, "__aiter__"):
+        async_warn_and_skip(pyfuncitem.nodeid)
+    return True
+
+
+def pytest_collect_file(path, parent):
+    ext = path.ext
+    if ext == ".py":
+        if not parent.session.isinitpath(path):
+            if not path_matches_patterns(
+                path, parent.config.getini("python_files") + ["__init__.py"]
+            ):
+                return
+        ihook = parent.session.gethookproxy(path)
+        return ihook.pytest_pycollect_makemodule(path=path, parent=parent)
+
+
+def path_matches_patterns(path, patterns):
+    """Returns True if the given py.path.local matches one of the patterns in the list of globs given"""
+    return any(path.fnmatch(pattern) for pattern in patterns)
+
+
+def pytest_pycollect_makemodule(path, parent):
+    if path.basename == "__init__.py":
+        return Package.from_parent(parent, fspath=path)
+    return Module.from_parent(parent, fspath=path)
+
+
+@hookimpl(hookwrapper=True)
+def pytest_pycollect_makeitem(collector, name, obj):
+    outcome = yield
+    res = outcome.get_result()
+    if res is not None:
+        return
+    # nothing was collected elsewhere, let's do it here
+    if safe_isclass(obj):
+        if collector.istestclass(obj, name):
+            outcome.force_result(Class.from_parent(collector, name=name, obj=obj))
+    elif collector.istestfunction(obj, name):
+        # mock seems to store unbound methods (issue473), normalize it
+        obj = getattr(obj, "__func__", obj)
+        # We need to try and unwrap the function if it's a functools.partial
+        # or a functools.wrapped.
+        # We mustn't if it's been wrapped with mock.patch (python 2 only)
+        if not (inspect.isfunction(obj) or inspect.isfunction(get_real_func(obj))):
+            filename, lineno = getfslineno(obj)
+            warnings.warn_explicit(
+                message=PytestCollectionWarning(
+                    "cannot collect %r because it is not a function." % name
+                ),
+                category=None,
+                filename=str(filename),
+                lineno=lineno + 1,
+            )
+        elif getattr(obj, "__test__", True):
+            if is_generator(obj):
+                res = Function.from_parent(collector, name=name)
+                reason = "yield tests were removed in pytest 4.0 - {name} will be ignored".format(
+                    name=name
+                )
+                res.add_marker(MARK_GEN.xfail(run=False, reason=reason))
+                res.warn(PytestCollectionWarning(reason))
+            else:
+                res = list(collector._genfunctions(name, obj))
+            outcome.force_result(res)
+
+
+class PyobjMixin:
+    module = pyobj_property("Module")
+    cls = pyobj_property("Class")
+    instance = pyobj_property("Instance")
+    _ALLOW_MARKERS = True
+
+    @property
+    def obj(self):
+        """Underlying Python object."""
+        obj = getattr(self, "_obj", None)
+        if obj is None:
+            self._obj = obj = self._getobj()
+            # XXX evil hack
+            # used to avoid Instance collector marker duplication
+            if self._ALLOW_MARKERS:
+                self.own_markers.extend(get_unpacked_marks(self.obj))
+        return obj
+
+    @obj.setter
+    def obj(self, value):
+        self._obj = value
+
+    def _getobj(self):
+        """Gets the underlying Python object. May be overwritten by subclasses."""
+        return getattr(self.parent.obj, self.name)
+
+    def getmodpath(self, stopatmodule=True, includemodule=False):
+        """ return python path relative to the containing module. """
+        chain = self.listchain()
+        chain.reverse()
+        parts = []
+        for node in chain:
+            if isinstance(node, Instance):
+                continue
+            name = node.name
+            if isinstance(node, Module):
+                name = os.path.splitext(name)[0]
+                if stopatmodule:
+                    if includemodule:
+                        parts.append(name)
+                    break
+            parts.append(name)
+        parts.reverse()
+        return ".".join(parts)
+
+    def reportinfo(self) -> Tuple[Union[py.path.local, str], int, str]:
+        # XXX caching?
+        obj = self.obj
+        compat_co_firstlineno = getattr(obj, "compat_co_firstlineno", None)
+        if isinstance(compat_co_firstlineno, int):
+            # nose compatibility
+            file_path = sys.modules[obj.__module__].__file__
+            if file_path.endswith(".pyc"):
+                file_path = file_path[:-1]
+            fspath = file_path  # type: Union[py.path.local, str]
+            lineno = compat_co_firstlineno
+        else:
+            fspath, lineno = getfslineno(obj)
+        modpath = self.getmodpath()
+        assert isinstance(lineno, int)
+        return fspath, lineno, modpath
+
+
+class PyCollector(PyobjMixin, nodes.Collector):
+    def funcnamefilter(self, name):
+        return self._matches_prefix_or_glob_option("python_functions", name)
+
+    def isnosetest(self, obj):
+        """ Look for the __test__ attribute, which is applied by the
+        @nose.tools.istest decorator
+        """
+        # We explicitly check for "is True" here to not mistakenly treat
+        # classes with a custom __getattr__ returning something truthy (like a
+        # function) as test classes.
+        return safe_getattr(obj, "__test__", False) is True
+
+    def classnamefilter(self, name):
+        return self._matches_prefix_or_glob_option("python_classes", name)
+
+    def istestfunction(self, obj, name):
+        if self.funcnamefilter(name) or self.isnosetest(obj):
+            if isinstance(obj, staticmethod):
+                # static methods need to be unwrapped
+                obj = safe_getattr(obj, "__func__", False)
+            return (
+                safe_getattr(obj, "__call__", False)
+                and fixtures.getfixturemarker(obj) is None
+            )
+        else:
+            return False
+
+    def istestclass(self, obj, name):
+        return self.classnamefilter(name) or self.isnosetest(obj)
+
+    def _matches_prefix_or_glob_option(self, option_name, name):
+        """
+        checks if the given name matches the prefix or glob-pattern defined
+        in ini configuration.
+        """
+        for option in self.config.getini(option_name):
+            if name.startswith(option):
+                return True
+            # check that name looks like a glob-string before calling fnmatch
+            # because this is called for every name in each collected module,
+            # and fnmatch is somewhat expensive to call
+            elif ("*" in option or "?" in option or "[" in option) and fnmatch.fnmatch(
+                name, option
+            ):
+                return True
+        return False
+
+    def collect(self):
+        if not getattr(self.obj, "__test__", True):
+            return []
+
+        # NB. we avoid random getattrs and peek in the __dict__ instead
+        # (XXX originally introduced from a PyPy need, still true?)
+        dicts = [getattr(self.obj, "__dict__", {})]
+        for basecls in inspect.getmro(self.obj.__class__):
+            dicts.append(basecls.__dict__)
+        seen = {}
+        values = []
+        for dic in dicts:
+            for name, obj in list(dic.items()):
+                if name in seen:
+                    continue
+                seen[name] = True
+                res = self._makeitem(name, obj)
+                if res is None:
+                    continue
+                if not isinstance(res, list):
+                    res = [res]
+                values.extend(res)
+
+        def sort_key(item):
+            fspath, lineno, _ = item.reportinfo()
+            return (str(fspath), lineno)
+
+        values.sort(key=sort_key)
+        return values
+
+    def _makeitem(self, name, obj):
+        # assert self.ihook.fspath == self.fspath, self
+        return self.ihook.pytest_pycollect_makeitem(collector=self, name=name, obj=obj)
+
+    def _genfunctions(self, name, funcobj):
+        module = self.getparent(Module).obj
+        clscol = self.getparent(Class)
+        cls = clscol and clscol.obj or None
+        fm = self.session._fixturemanager
+
+        definition = FunctionDefinition.from_parent(self, name=name, callobj=funcobj)
+        fixtureinfo = definition._fixtureinfo
+
+        metafunc = Metafunc(
+            definition, fixtureinfo, self.config, cls=cls, module=module
+        )
+        methods = []
+        if hasattr(module, "pytest_generate_tests"):
+            methods.append(module.pytest_generate_tests)
+        if hasattr(cls, "pytest_generate_tests"):
+            methods.append(cls().pytest_generate_tests)
+
+        self.ihook.pytest_generate_tests.call_extra(methods, dict(metafunc=metafunc))
+
+        if not metafunc._calls:
+            yield Function.from_parent(self, name=name, fixtureinfo=fixtureinfo)
+        else:
+            # add funcargs() as fixturedefs to fixtureinfo.arg2fixturedefs
+            fixtures.add_funcarg_pseudo_fixture_def(self, metafunc, fm)
+
+            # add_funcarg_pseudo_fixture_def may have shadowed some fixtures
+            # with direct parametrization, so make sure we update what the
+            # function really needs.
+            fixtureinfo.prune_dependency_tree()
+
+            for callspec in metafunc._calls:
+                subname = "{}[{}]".format(name, callspec.id)
+                yield Function.from_parent(
+                    self,
+                    name=subname,
+                    callspec=callspec,
+                    callobj=funcobj,
+                    fixtureinfo=fixtureinfo,
+                    keywords={callspec.id: True},
+                    originalname=name,
+                )
+
+
+class Module(nodes.File, PyCollector):
+    """ Collector for test classes and functions. """
+
+    def _getobj(self):
+        return self._importtestmodule()
+
+    def collect(self):
+        self._inject_setup_module_fixture()
+        self._inject_setup_function_fixture()
+        self.session._fixturemanager.parsefactories(self)
+        return super().collect()
+
+    def _inject_setup_module_fixture(self):
+        """Injects a hidden autouse, module scoped fixture into the collected module object
+        that invokes setUpModule/tearDownModule if either or both are available.
+
+        Using a fixture to invoke this methods ensures we play nicely and unsurprisingly with
+        other fixtures (#517).
+        """
+        setup_module = _get_first_non_fixture_func(
+            self.obj, ("setUpModule", "setup_module")
+        )
+        teardown_module = _get_first_non_fixture_func(
+            self.obj, ("tearDownModule", "teardown_module")
+        )
+
+        if setup_module is None and teardown_module is None:
+            return
+
+        @fixtures.fixture(autouse=True, scope="module")
+        def xunit_setup_module_fixture(request):
+            if setup_module is not None:
+                _call_with_optional_argument(setup_module, request.module)
+            yield
+            if teardown_module is not None:
+                _call_with_optional_argument(teardown_module, request.module)
+
+        self.obj.__pytest_setup_module = xunit_setup_module_fixture
+
+    def _inject_setup_function_fixture(self):
+        """Injects a hidden autouse, function scoped fixture into the collected module object
+        that invokes setup_function/teardown_function if either or both are available.
+
+        Using a fixture to invoke this methods ensures we play nicely and unsurprisingly with
+        other fixtures (#517).
+        """
+        setup_function = _get_first_non_fixture_func(self.obj, ("setup_function",))
+        teardown_function = _get_first_non_fixture_func(
+            self.obj, ("teardown_function",)
+        )
+        if setup_function is None and teardown_function is None:
+            return
+
+        @fixtures.fixture(autouse=True, scope="function")
+        def xunit_setup_function_fixture(request):
+            if request.instance is not None:
+                # in this case we are bound to an instance, so we need to let
+                # setup_method handle this
+                yield
+                return
+            if setup_function is not None:
+                _call_with_optional_argument(setup_function, request.function)
+            yield
+            if teardown_function is not None:
+                _call_with_optional_argument(teardown_function, request.function)
+
+        self.obj.__pytest_setup_function = xunit_setup_function_fixture
+
+    def _importtestmodule(self):
+        # we assume we are only called once per module
+        importmode = self.config.getoption("--import-mode")
+        try:
+            mod = self.fspath.pyimport(ensuresyspath=importmode)
+        except SyntaxError:
+            raise self.CollectError(ExceptionInfo.from_current().getrepr(style="short"))
+        except self.fspath.ImportMismatchError as e:
+            raise self.CollectError(
+                "import file mismatch:\n"
+                "imported module %r has this __file__ attribute:\n"
+                "  %s\n"
+                "which is not the same as the test file we want to collect:\n"
+                "  %s\n"
+                "HINT: remove __pycache__ / .pyc files and/or use a "
+                "unique basename for your test file modules" % e.args
+            )
+        except ImportError:
+            exc_info = ExceptionInfo.from_current()
+            if self.config.getoption("verbose") < 2:
+                exc_info.traceback = exc_info.traceback.filter(filter_traceback)
+            exc_repr = (
+                exc_info.getrepr(style="short")
+                if exc_info.traceback
+                else exc_info.exconly()
+            )
+            formatted_tb = str(exc_repr)
+            raise self.CollectError(
+                "ImportError while importing test module '{fspath}'.\n"
+                "Hint: make sure your test modules/packages have valid Python names.\n"
+                "Traceback:\n"
+                "{traceback}".format(fspath=self.fspath, traceback=formatted_tb)
+            )
+        except _pytest.runner.Skipped as e:
+            if e.allow_module_level:
+                raise
+            raise self.CollectError(
+                "Using pytest.skip outside of a test is not allowed. "
+                "To decorate a test function, use the @pytest.mark.skip "
+                "or @pytest.mark.skipif decorators instead, and to skip a "
+                "module use `pytestmark = pytest.mark.{skip,skipif}."
+            )
+        self.config.pluginmanager.consider_module(mod)
+        return mod
+
+
+class Package(Module):
+    def __init__(
+        self,
+        fspath: py.path.local,
+        parent: nodes.Collector,
+        # NOTE: following args are unused:
+        config=None,
+        session=None,
+        nodeid=None,
+    ) -> None:
+        # NOTE: could be just the following, but kept as-is for compat.
+        # nodes.FSCollector.__init__(self, fspath, parent=parent)
+        session = parent.session
+        nodes.FSCollector.__init__(
+            self, fspath, parent=parent, config=config, session=session, nodeid=nodeid
+        )
+
+        self.name = fspath.dirname
+
+    def setup(self):
+        # not using fixtures to call setup_module here because autouse fixtures
+        # from packages are not called automatically (#4085)
+        setup_module = _get_first_non_fixture_func(
+            self.obj, ("setUpModule", "setup_module")
+        )
+        if setup_module is not None:
+            _call_with_optional_argument(setup_module, self.obj)
+
+        teardown_module = _get_first_non_fixture_func(
+            self.obj, ("tearDownModule", "teardown_module")
+        )
+        if teardown_module is not None:
+            func = partial(_call_with_optional_argument, teardown_module, self.obj)
+            self.addfinalizer(func)
+
+    def gethookproxy(self, fspath: py.path.local):
+        return super()._gethookproxy(fspath)
+
+    def isinitpath(self, path):
+        return path in self.session._initialpaths
+
+    def collect(self):
+        this_path = self.fspath.dirpath()
+        init_module = this_path.join("__init__.py")
+        if init_module.check(file=1) and path_matches_patterns(
+            init_module, self.config.getini("python_files")
+        ):
+            yield Module.from_parent(self, fspath=init_module)
+        pkg_prefixes = set()
+        for path in this_path.visit(rec=self._recurse, bf=True, sort=True):
+            # We will visit our own __init__.py file, in which case we skip it.
+            is_file = path.isfile()
+            if is_file:
+                if path.basename == "__init__.py" and path.dirpath() == this_path:
+                    continue
+
+            parts_ = parts(path.strpath)
+            if any(
+                pkg_prefix in parts_ and pkg_prefix.join("__init__.py") != path
+                for pkg_prefix in pkg_prefixes
+            ):
+                continue
+
+            if is_file:
+                yield from self._collectfile(path)
+            elif not path.isdir():
+                # Broken symlink or invalid/missing file.
+                continue
+            elif path.join("__init__.py").check(file=1):
+                pkg_prefixes.add(path)
+
+
+def _call_with_optional_argument(func, arg):
+    """Call the given function with the given argument if func accepts one argument, otherwise
+    calls func without arguments"""
+    arg_count = func.__code__.co_argcount
+    if inspect.ismethod(func):
+        arg_count -= 1
+    if arg_count:
+        func(arg)
+    else:
+        func()
+
+
+def _get_first_non_fixture_func(obj, names):
+    """Return the attribute from the given object to be used as a setup/teardown
+    xunit-style function, but only if not marked as a fixture to
+    avoid calling it twice.
+    """
+    for name in names:
+        meth = getattr(obj, name, None)
+        if meth is not None and fixtures.getfixturemarker(meth) is None:
+            return meth
+
+
+class Class(PyCollector):
+    """ Collector for test methods. """
+
+    @classmethod
+    def from_parent(cls, parent, *, name, obj=None):
+        """
+        The public constructor
+        """
+        return super().from_parent(name=name, parent=parent)
+
+    def collect(self):
+        if not safe_getattr(self.obj, "__test__", True):
+            return []
+        if hasinit(self.obj):
+            self.warn(
+                PytestCollectionWarning(
+                    "cannot collect test class %r because it has a "
+                    "__init__ constructor (from: %s)"
+                    % (self.obj.__name__, self.parent.nodeid)
+                )
+            )
+            return []
+        elif hasnew(self.obj):
+            self.warn(
+                PytestCollectionWarning(
+                    "cannot collect test class %r because it has a "
+                    "__new__ constructor (from: %s)"
+                    % (self.obj.__name__, self.parent.nodeid)
+                )
+            )
+            return []
+
+        self._inject_setup_class_fixture()
+        self._inject_setup_method_fixture()
+
+        return [Instance.from_parent(self, name="()")]
+
+    def _inject_setup_class_fixture(self):
+        """Injects a hidden autouse, class scoped fixture into the collected class object
+        that invokes setup_class/teardown_class if either or both are available.
+
+        Using a fixture to invoke this methods ensures we play nicely and unsurprisingly with
+        other fixtures (#517).
+        """
+        setup_class = _get_first_non_fixture_func(self.obj, ("setup_class",))
+        teardown_class = getattr(self.obj, "teardown_class", None)
+        if setup_class is None and teardown_class is None:
+            return
+
+        @fixtures.fixture(autouse=True, scope="class")
+        def xunit_setup_class_fixture(cls):
+            if setup_class is not None:
+                func = getimfunc(setup_class)
+                _call_with_optional_argument(func, self.obj)
+            yield
+            if teardown_class is not None:
+                func = getimfunc(teardown_class)
+                _call_with_optional_argument(func, self.obj)
+
+        self.obj.__pytest_setup_class = xunit_setup_class_fixture
+
+    def _inject_setup_method_fixture(self):
+        """Injects a hidden autouse, function scoped fixture into the collected class object
+        that invokes setup_method/teardown_method if either or both are available.
+
+        Using a fixture to invoke this methods ensures we play nicely and unsurprisingly with
+        other fixtures (#517).
+        """
+        setup_method = _get_first_non_fixture_func(self.obj, ("setup_method",))
+        teardown_method = getattr(self.obj, "teardown_method", None)
+        if setup_method is None and teardown_method is None:
+            return
+
+        @fixtures.fixture(autouse=True, scope="function")
+        def xunit_setup_method_fixture(self, request):
+            method = request.function
+            if setup_method is not None:
+                func = getattr(self, "setup_method")
+                _call_with_optional_argument(func, method)
+            yield
+            if teardown_method is not None:
+                func = getattr(self, "teardown_method")
+                _call_with_optional_argument(func, method)
+
+        self.obj.__pytest_setup_method = xunit_setup_method_fixture
+
+
+class Instance(PyCollector):
+    _ALLOW_MARKERS = False  # hack, destroy later
+    # instances share the object with their parents in a way
+    # that duplicates markers instances if not taken out
+    # can be removed at node structure reorganization time
+
+    def _getobj(self):
+        return self.parent.obj()
+
+    def collect(self):
+        self.session._fixturemanager.parsefactories(self)
+        return super().collect()
+
+    def newinstance(self):
+        self.obj = self._getobj()
+        return self.obj
+
+
+def hasinit(obj):
+    init = getattr(obj, "__init__", None)
+    if init:
+        return init != object.__init__
+
+
+def hasnew(obj):
+    new = getattr(obj, "__new__", None)
+    if new:
+        return new != object.__new__
+
+
+class CallSpec2:
+    def __init__(self, metafunc):
+        self.metafunc = metafunc
+        self.funcargs = {}
+        self._idlist = []
+        self.params = {}
+        self._arg2scopenum = {}  # used for sorting parametrized resources
+        self.marks = []
+        self.indices = {}
+
+    def copy(self):
+        cs = CallSpec2(self.metafunc)
+        cs.funcargs.update(self.funcargs)
+        cs.params.update(self.params)
+        cs.marks.extend(self.marks)
+        cs.indices.update(self.indices)
+        cs._arg2scopenum.update(self._arg2scopenum)
+        cs._idlist = list(self._idlist)
+        return cs
+
+    def _checkargnotcontained(self, arg):
+        if arg in self.params or arg in self.funcargs:
+            raise ValueError("duplicate {!r}".format(arg))
+
+    def getparam(self, name):
+        try:
+            return self.params[name]
+        except KeyError:
+            raise ValueError(name)
+
+    @property
+    def id(self):
+        return "-".join(map(str, self._idlist))
+
+    def setmulti2(self, valtypes, argnames, valset, id, marks, scopenum, param_index):
+        for arg, val in zip(argnames, valset):
+            self._checkargnotcontained(arg)
+            valtype_for_arg = valtypes[arg]
+            getattr(self, valtype_for_arg)[arg] = val
+            self.indices[arg] = param_index
+            self._arg2scopenum[arg] = scopenum
+        self._idlist.append(id)
+        self.marks.extend(normalize_mark_list(marks))
+
+
+class Metafunc:
+    """
+    Metafunc objects are passed to the :func:`pytest_generate_tests <_pytest.hookspec.pytest_generate_tests>` hook.
+    They help to inspect a test function and to generate tests according to
+    test configuration or values specified in the class or module where a
+    test function is defined.
+    """
+
+    def __init__(
+        self,
+        definition: "FunctionDefinition",
+        fixtureinfo: fixtures.FuncFixtureInfo,
+        config: Config,
+        cls=None,
+        module=None,
+    ) -> None:
+        self.definition = definition
+
+        #: access to the :class:`_pytest.config.Config` object for the test session
+        self.config = config
+
+        #: the module object where the test function is defined in.
+        self.module = module
+
+        #: underlying python test function
+        self.function = definition.obj
+
+        #: set of fixture names required by the test function
+        self.fixturenames = fixtureinfo.names_closure
+
+        #: class object where the test function is defined in or ``None``.
+        self.cls = cls
+
+        self._calls = []  # type: List[CallSpec2]
+        self._arg2fixturedefs = fixtureinfo.name2fixturedefs
+
+    @property
+    def funcargnames(self):
+        """ alias attribute for ``fixturenames`` for pre-2.3 compatibility"""
+        warnings.warn(FUNCARGNAMES, stacklevel=2)
+        return self.fixturenames
+
+    def parametrize(
+        self,
+        argnames: Union[str, List[str], Tuple[str, ...]],
+        argvalues: Iterable[Union[ParameterSet, typing.Sequence[object], object]],
+        indirect: Union[bool, typing.Sequence[str]] = False,
+        ids: Optional[
+            Union[
+                Iterable[Union[None, str, float, int, bool]],
+                Callable[[object], Optional[object]],
+            ]
+        ] = None,
+        scope: "Optional[str]" = None,
+        *,
+        _param_mark: Optional[Mark] = None
+    ) -> None:
+        """ Add new invocations to the underlying test function using the list
+        of argvalues for the given argnames.  Parametrization is performed
+        during the collection phase.  If you need to setup expensive resources
+        see about setting indirect to do it rather at test setup time.
+
+        :arg argnames: a comma-separated string denoting one or more argument
+                       names, or a list/tuple of argument strings.
+
+        :arg argvalues: The list of argvalues determines how often a
+            test is invoked with different argument values.  If only one
+            argname was specified argvalues is a list of values.  If N
+            argnames were specified, argvalues must be a list of N-tuples,
+            where each tuple-element specifies a value for its respective
+            argname.
+
+        :arg indirect: The list of argnames or boolean. A list of arguments'
+            names (subset of argnames). If True the list contains all names from
+            the argnames. Each argvalue corresponding to an argname in this list will
+            be passed as request.param to its respective argname fixture
+            function so that it can perform more expensive setups during the
+            setup phase of a test rather than at collection time.
+
+        :arg ids: sequence of (or generator for) ids for ``argvalues``,
+              or a callable to return part of the id for each argvalue.
+
+            With sequences (and generators like ``itertools.count()``) the
+            returned ids should be of type ``string``, ``int``, ``float``,
+            ``bool``, or ``None``.
+            They are mapped to the corresponding index in ``argvalues``.
+            ``None`` means to use the auto-generated id.
+
+            If it is a callable it will be called for each entry in
+            ``argvalues``, and the return value is used as part of the
+            auto-generated id for the whole set (where parts are joined with
+            dashes ("-")).
+            This is useful to provide more specific ids for certain items, e.g.
+            dates.  Returning ``None`` will use an auto-generated id.
+
+            If no ids are provided they will be generated automatically from
+            the argvalues.
+
+        :arg scope: if specified it denotes the scope of the parameters.
+            The scope is used for grouping tests by parameter instances.
+            It will also override any fixture-function defined scope, allowing
+            to set a dynamic scope using test context or configuration.
+        """
+        from _pytest.fixtures import scope2index
+
+        argnames, parameters = ParameterSet._for_parametrize(
+            argnames,
+            argvalues,
+            self.function,
+            self.config,
+            function_definition=self.definition,
+        )
+        del argvalues
+
+        if "request" in argnames:
+            fail(
+                "'request' is a reserved name and cannot be used in @pytest.mark.parametrize",
+                pytrace=False,
+            )
+
+        if scope is None:
+            scope = _find_parametrized_scope(argnames, self._arg2fixturedefs, indirect)
+
+        self._validate_if_using_arg_names(argnames, indirect)
+
+        arg_values_types = self._resolve_arg_value_types(argnames, indirect)
+
+        # Use any already (possibly) generated ids with parametrize Marks.
+        if _param_mark and _param_mark._param_ids_from:
+            generated_ids = _param_mark._param_ids_from._param_ids_generated
+            if generated_ids is not None:
+                ids = generated_ids
+
+        ids = self._resolve_arg_ids(argnames, ids, parameters, item=self.definition)
+
+        # Store used (possibly generated) ids with parametrize Marks.
+        if _param_mark and _param_mark._param_ids_from and generated_ids is None:
+            object.__setattr__(_param_mark._param_ids_from, "_param_ids_generated", ids)
+
+        scopenum = scope2index(
+            scope, descr="parametrize() call in {}".format(self.function.__name__)
+        )
+
+        # create the new calls: if we are parametrize() multiple times (by applying the decorator
+        # more than once) then we accumulate those calls generating the cartesian product
+        # of all calls
+        newcalls = []
+        for callspec in self._calls or [CallSpec2(self)]:
+            for param_index, (param_id, param_set) in enumerate(zip(ids, parameters)):
+                newcallspec = callspec.copy()
+                newcallspec.setmulti2(
+                    arg_values_types,
+                    argnames,
+                    param_set.values,
+                    param_id,
+                    param_set.marks,
+                    scopenum,
+                    param_index,
+                )
+                newcalls.append(newcallspec)
+        self._calls = newcalls
+
+    def _resolve_arg_ids(
+        self,
+        argnames: typing.Sequence[str],
+        ids: Optional[
+            Union[
+                Iterable[Union[None, str, float, int, bool]],
+                Callable[[object], Optional[object]],
+            ]
+        ],
+        parameters: typing.Sequence[ParameterSet],
+        item,
+    ) -> List[str]:
+        """Resolves the actual ids for the given argnames, based on the ``ids`` parameter given
+        to ``parametrize``.
+
+        :param List[str] argnames: list of argument names passed to ``parametrize()``.
+        :param ids: the ids parameter of the parametrized call (see docs).
+        :param List[ParameterSet] parameters: the list of parameter values, same size as ``argnames``.
+        :param Item item: the item that generated this parametrized call.
+        :rtype: List[str]
+        :return: the list of ids for each argname given
+        """
+        if ids is None:
+            idfn = None
+            ids_ = None
+        elif callable(ids):
+            idfn = ids
+            ids_ = None
+        else:
+            idfn = None
+            ids_ = self._validate_ids(ids, parameters, self.function.__name__)
+        return idmaker(argnames, parameters, idfn, ids_, self.config, item=item)
+
+    def _validate_ids(
+        self,
+        ids: Iterable[Union[None, str, float, int, bool]],
+        parameters: typing.Sequence[ParameterSet],
+        func_name: str,
+    ) -> List[Union[None, str]]:
+        try:
+            num_ids = len(ids)  # type: ignore[arg-type] # noqa: F821
+        except TypeError:
+            try:
+                iter(ids)
+            except TypeError:
+                raise TypeError("ids must be a callable or an iterable")
+            num_ids = len(parameters)
+
+        # num_ids == 0 is a special case: https://github.com/pytest-dev/pytest/issues/1849
+        if num_ids != len(parameters) and num_ids != 0:
+            msg = "In {}: {} parameter sets specified, with different number of ids: {}"
+            fail(msg.format(func_name, len(parameters), num_ids), pytrace=False)
+
+        new_ids = []
+        for idx, id_value in enumerate(itertools.islice(ids, num_ids)):
+            if id_value is None or isinstance(id_value, str):
+                new_ids.append(id_value)
+            elif isinstance(id_value, (float, int, bool)):
+                new_ids.append(str(id_value))
+            else:
+                msg = "In {}: ids must be list of string/float/int/bool, found: {} (type: {!r}) at index {}"
+                fail(
+                    msg.format(func_name, saferepr(id_value), type(id_value), idx),
+                    pytrace=False,
+                )
+        return new_ids
+
+    def _resolve_arg_value_types(
+        self,
+        argnames: typing.Sequence[str],
+        indirect: Union[bool, typing.Sequence[str]],
+    ) -> Dict[str, str]:
+        """Resolves if each parametrized argument must be considered a parameter to a fixture or a "funcarg"
+        to the function, based on the ``indirect`` parameter of the parametrized() call.
+
+        :param List[str] argnames: list of argument names passed to ``parametrize()``.
+        :param indirect: same ``indirect`` parameter of ``parametrize()``.
+        :rtype: Dict[str, str]
+            A dict mapping each arg name to either:
+            * "params" if the argname should be the parameter of a fixture of the same name.
+            * "funcargs" if the argname should be a parameter to the parametrized test function.
+        """
+        if isinstance(indirect, bool):
+            valtypes = dict.fromkeys(argnames, "params" if indirect else "funcargs")
+        elif isinstance(indirect, Sequence):
+            valtypes = dict.fromkeys(argnames, "funcargs")
+            for arg in indirect:
+                if arg not in argnames:
+                    fail(
+                        "In {}: indirect fixture '{}' doesn't exist".format(
+                            self.function.__name__, arg
+                        ),
+                        pytrace=False,
+                    )
+                valtypes[arg] = "params"
+        else:
+            fail(
+                "In {func}: expected Sequence or boolean for indirect, got {type}".format(
+                    type=type(indirect).__name__, func=self.function.__name__
+                ),
+                pytrace=False,
+            )
+        return valtypes
+
+    def _validate_if_using_arg_names(
+        self,
+        argnames: typing.Sequence[str],
+        indirect: Union[bool, typing.Sequence[str]],
+    ) -> None:
+        """
+        Check if all argnames are being used, by default values, or directly/indirectly.
+
+        :param List[str] argnames: list of argument names passed to ``parametrize()``.
+        :param indirect: same ``indirect`` parameter of ``parametrize()``.
+        :raise ValueError: if validation fails.
+        """
+        default_arg_names = set(get_default_arg_names(self.function))
+        func_name = self.function.__name__
+        for arg in argnames:
+            if arg not in self.fixturenames:
+                if arg in default_arg_names:
+                    fail(
+                        "In {}: function already takes an argument '{}' with a default value".format(
+                            func_name, arg
+                        ),
+                        pytrace=False,
+                    )
+                else:
+                    if isinstance(indirect, Sequence):
+                        name = "fixture" if arg in indirect else "argument"
+                    else:
+                        name = "fixture" if indirect else "argument"
+                    fail(
+                        "In {}: function uses no {} '{}'".format(func_name, name, arg),
+                        pytrace=False,
+                    )
+
+
+def _find_parametrized_scope(argnames, arg2fixturedefs, indirect):
+    """Find the most appropriate scope for a parametrized call based on its arguments.
+
+    When there's at least one direct argument, always use "function" scope.
+
+    When a test function is parametrized and all its arguments are indirect
+    (e.g. fixtures), return the most narrow scope based on the fixtures used.
+
+    Related to issue #1832, based on code posted by @Kingdread.
+    """
+    from _pytest.fixtures import scopes
+
+    if isinstance(indirect, (list, tuple)):
+        all_arguments_are_fixtures = len(indirect) == len(argnames)
+    else:
+        all_arguments_are_fixtures = bool(indirect)
+
+    if all_arguments_are_fixtures:
+        fixturedefs = arg2fixturedefs or {}
+        used_scopes = [
+            fixturedef[0].scope
+            for name, fixturedef in fixturedefs.items()
+            if name in argnames
+        ]
+        if used_scopes:
+            # Takes the most narrow scope from used fixtures
+            for scope in reversed(scopes):
+                if scope in used_scopes:
+                    return scope
+
+    return "function"
+
+
+def _ascii_escaped_by_config(val: Union[str, bytes], config: Optional[Config]) -> str:
+    if config is None:
+        escape_option = False
+    else:
+        escape_option = config.getini(
+            "disable_test_id_escaping_and_forfeit_all_rights_to_community_support"
+        )
+    # TODO: If escaping is turned off and the user passes bytes,
+    #       will return a bytes. For now we ignore this but the
+    #       code *probably* doesn't handle this case.
+    return val if escape_option else ascii_escaped(val)  # type: ignore
+
+
+def _idval(
+    val: object,
+    argname: str,
+    idx: int,
+    idfn: Optional[Callable[[object], Optional[object]]],
+    item,
+    config: Optional[Config],
+) -> str:
+    if idfn:
+        try:
+            generated_id = idfn(val)
+            if generated_id is not None:
+                val = generated_id
+        except Exception as e:
+            msg = "{}: error raised while trying to determine id of parameter '{}' at position {}"
+            msg = msg.format(item.nodeid, argname, idx)
+            raise ValueError(msg) from e
+    elif config:
+        hook_id = config.hook.pytest_make_parametrize_id(
+            config=config, val=val, argname=argname
+        )  # type: Optional[str]
+        if hook_id:
+            return hook_id
+
+    if isinstance(val, STRING_TYPES):
+        return _ascii_escaped_by_config(val, config)
+    elif val is None or isinstance(val, (float, int, bool)):
+        return str(val)
+    elif isinstance(val, REGEX_TYPE):
+        return ascii_escaped(val.pattern)
+    elif isinstance(val, enum.Enum):
+        return str(val)
+    elif isinstance(getattr(val, "__name__", None), str):
+        # name of a class, function, module, etc.
+        name = getattr(val, "__name__")  # type: str
+        return name
+    return str(argname) + str(idx)
+
+
+def limit_idval(limit):
+    import functools
+
+    names = {}
+    limit -= 6
+    assert limit > 0
+
+    def decorator(func):
+        @functools.wraps(func)
+        def wrapper(*args, **kw):
+            idval = func(*args, **kw)
+            if len(idval) > limit:
+                prefix = idval[:limit]
+                # There might be same prefix for the different test cases - take item into account
+                name = "{}-{}".format(kw.get('item', ''), prefix)
+                idx = names.setdefault(name, -1) + 1
+                names[name] = idx
+                idval = "{}-{}".format(prefix, idx)
+            return idval
+
+        return wrapper
+
+    return decorator
+
+
+# XXX limit testnames in the name of sanity and readability
+@limit_idval(limit=500)
+def _idvalset(
+    idx: int,
+    parameterset: ParameterSet,
+    argnames: Iterable[str],
+    idfn: Optional[Callable[[object], Optional[object]]],
+    ids: Optional[List[Union[None, str]]],
+    item,
+    config: Optional[Config],
+):
+    if parameterset.id is not None:
+        return parameterset.id
+    id = None if ids is None or idx >= len(ids) else ids[idx]
+    if id is None:
+        this_id = [
+            _idval(val, argname, idx, idfn, item=item, config=config)
+            for val, argname in zip(parameterset.values, argnames)
+        ]
+        return "-".join(this_id)
+    else:
+        return _ascii_escaped_by_config(id, config)
+
+
+def idmaker(
+    argnames: Iterable[str],
+    parametersets: Iterable[ParameterSet],
+    idfn: Optional[Callable[[object], Optional[object]]] = None,
+    ids: Optional[List[Union[None, str]]] = None,
+    config: Optional[Config] = None,
+    item=None,
+) -> List[str]:
+    resolved_ids = [
+        _idvalset(valindex, parameterset, argnames, idfn, ids, config=config, item=item)
+        for valindex, parameterset in enumerate(parametersets)
+    ]
+
+    # All IDs must be unique!
+    unique_ids = set(resolved_ids)
+    if len(unique_ids) != len(resolved_ids):
+
+        # Record the number of occurrences of each test ID
+        test_id_counts = Counter(resolved_ids)
+
+        # Map the test ID to its next suffix
+        test_id_suffixes = defaultdict(int)  # type: Dict[str, int]
+
+        # Suffix non-unique IDs to make them unique
+        for index, test_id in enumerate(resolved_ids):
+            if test_id_counts[test_id] > 1:
+                resolved_ids[index] = "{}{}".format(test_id, test_id_suffixes[test_id])
+                test_id_suffixes[test_id] += 1
+
+    return resolved_ids
+
+
+def show_fixtures_per_test(config):
+    from _pytest.main import wrap_session
+
+    return wrap_session(config, _show_fixtures_per_test)
+
+
+def _show_fixtures_per_test(config, session):
+    import _pytest.config
+
+    session.perform_collect()
+    curdir = py.path.local()
+    tw = _pytest.config.create_terminal_writer(config)
+    verbose = config.getvalue("verbose")
+
+    def get_best_relpath(func):
+        loc = getlocation(func, curdir)
+        return curdir.bestrelpath(loc)
+
+    def write_fixture(fixture_def):
+        argname = fixture_def.argname
+        if verbose <= 0 and argname.startswith("_"):
+            return
+        if verbose > 0:
+            bestrel = get_best_relpath(fixture_def.func)
+            funcargspec = "{} -- {}".format(argname, bestrel)
+        else:
+            funcargspec = argname
+        tw.line(funcargspec, green=True)
+        fixture_doc = inspect.getdoc(fixture_def.func)
+        if fixture_doc:
+            write_docstring(tw, fixture_doc)
+        else:
+            tw.line("    no docstring available", red=True)
+
+    def write_item(item):
+        try:
+            info = item._fixtureinfo
+        except AttributeError:
+            # doctests items have no _fixtureinfo attribute
+            return
+        if not info.name2fixturedefs:
+            # this test item does not use any fixtures
+            return
+        tw.line()
+        tw.sep("-", "fixtures used by {}".format(item.name))
+        tw.sep("-", "({})".format(get_best_relpath(item.function)))
+        # dict key not used in loop but needed for sorting
+        for _, fixturedefs in sorted(info.name2fixturedefs.items()):
+            assert fixturedefs is not None
+            if not fixturedefs:
+                continue
+            # last item is expected to be the one used by the test item
+            write_fixture(fixturedefs[-1])
+
+    for session_item in session.items:
+        write_item(session_item)
+
+
+def showfixtures(config):
+    from _pytest.main import wrap_session
+
+    return wrap_session(config, _showfixtures_main)
+
+
+def _showfixtures_main(config, session):
+    import _pytest.config
+
+    session.perform_collect()
+    curdir = py.path.local()
+    tw = _pytest.config.create_terminal_writer(config)
+    verbose = config.getvalue("verbose")
+
+    fm = session._fixturemanager
+
+    available = []
+    seen = set()
+
+    for argname, fixturedefs in fm._arg2fixturedefs.items():
+        assert fixturedefs is not None
+        if not fixturedefs:
+            continue
+        for fixturedef in fixturedefs:
+            loc = getlocation(fixturedef.func, curdir)
+            if (fixturedef.argname, loc) in seen:
+                continue
+            seen.add((fixturedef.argname, loc))
+            available.append(
+                (
+                    len(fixturedef.baseid),
+                    fixturedef.func.__module__,
+                    curdir.bestrelpath(loc),
+                    fixturedef.argname,
+                    fixturedef,
+                )
+            )
+
+    available.sort()
+    currentmodule = None
+    for baseid, module, bestrel, argname, fixturedef in available:
+        if currentmodule != module:
+            if not module.startswith("_pytest."):
+                tw.line()
+                tw.sep("-", "fixtures defined from {}".format(module))
+                currentmodule = module
+        if verbose <= 0 and argname[0] == "_":
+            continue
+        tw.write(argname, green=True)
+        if fixturedef.scope != "function":
+            tw.write(" [%s scope]" % fixturedef.scope, cyan=True)
+        if verbose > 0:
+            tw.write(" -- %s" % bestrel, yellow=True)
+        tw.write("\n")
+        loc = getlocation(fixturedef.func, curdir)
+        doc = inspect.getdoc(fixturedef.func)
+        if doc:
+            write_docstring(tw, doc)
+        else:
+            tw.line("    {}: no docstring available".format(loc), red=True)
+        tw.line()
+
+
+def write_docstring(tw: TerminalWriter, doc: str, indent: str = "    ") -> None:
+    for line in doc.split("\n"):
+        tw.write(indent + line + "\n")
+
+
+class Function(PyobjMixin, nodes.Item):
+    """ a Function Item is responsible for setting up and executing a
+    Python test function.
+    """
+
+    # disable since functions handle it themselves
+    _ALLOW_MARKERS = False
+
+    def __init__(
+        self,
+        name,
+        parent,
+        args=None,
+        config=None,
+        callspec: Optional[CallSpec2] = None,
+        callobj=NOTSET,
+        keywords=None,
+        session=None,
+        fixtureinfo: Optional[FuncFixtureInfo] = None,
+        originalname=None,
+    ) -> None:
+        super().__init__(name, parent, config=config, session=session)
+        self._args = args
+        if callobj is not NOTSET:
+            self.obj = callobj
+
+        self.keywords.update(self.obj.__dict__)
+        self.own_markers.extend(get_unpacked_marks(self.obj))
+        if callspec:
+            self.callspec = callspec
+            # this is total hostile and a mess
+            # keywords are broken by design by now
+            # this will be redeemed later
+            for mark in callspec.marks:
+                # feel free to cry, this was broken for years before
+                # and keywords cant fix it per design
+                self.keywords[mark.name] = mark
+            self.own_markers.extend(normalize_mark_list(callspec.marks))
+        if keywords:
+            self.keywords.update(keywords)
+
+        # todo: this is a hell of a hack
+        # https://github.com/pytest-dev/pytest/issues/4569
+
+        self.keywords.update(
+            {
+                mark.name: True
+                for mark in self.iter_markers()
+                if mark.name not in self.keywords
+            }
+        )
+
+        if fixtureinfo is None:
+            fixtureinfo = self.session._fixturemanager.getfixtureinfo(
+                self, self.obj, self.cls, funcargs=True
+            )
+        self._fixtureinfo = fixtureinfo  # type: FuncFixtureInfo
+        self.fixturenames = fixtureinfo.names_closure
+        self._initrequest()
+
+        #: original function name, without any decorations (for example
+        #: parametrization adds a ``"[...]"`` suffix to function names).
+        #:
+        #: .. versionadded:: 3.0
+        self.originalname = originalname
+
+    @classmethod
+    def from_parent(cls, parent, **kw):  # todo: determine sound type limitations
+        """
+        The public  constructor
+        """
+        return super().from_parent(parent=parent, **kw)
+
+    def _initrequest(self):
+        self.funcargs = {}
+        self._request = fixtures.FixtureRequest(self)
+
+    @property
+    def function(self):
+        "underlying python 'function' object"
+        return getimfunc(self.obj)
+
+    def _getobj(self):
+        name = self.name
+        i = name.find("[")  # parametrization
+        if i != -1:
+            name = name[:i]
+        return getattr(self.parent.obj, name)
+
+    @property
+    def _pyfuncitem(self):
+        "(compatonly) for code expecting pytest-2.2 style request objects"
+        return self
+
+    @property
+    def funcargnames(self):
+        """ alias attribute for ``fixturenames`` for pre-2.3 compatibility"""
+        warnings.warn(FUNCARGNAMES, stacklevel=2)
+        return self.fixturenames
+
+    def runtest(self) -> None:
+        """ execute the underlying test function. """
+        self.ihook.pytest_pyfunc_call(pyfuncitem=self)
+
+    def setup(self) -> None:
+        if isinstance(self.parent, Instance):
+            self.parent.newinstance()
+            self.obj = self._getobj()
+        fixtures.fillfixtures(self)
+
+    def _prunetraceback(self, excinfo: ExceptionInfo) -> None:
+        if hasattr(self, "_obj") and not self.config.getoption("fulltrace", False):
+            code = _pytest._code.Code(get_real_func(self.obj))
+            path, firstlineno = code.path, code.firstlineno
+            traceback = excinfo.traceback
+            ntraceback = traceback.cut(path=path, firstlineno=firstlineno)
+            if ntraceback == traceback:
+                ntraceback = ntraceback.cut(path=path)
+                if ntraceback == traceback:
+                    ntraceback = ntraceback.filter(filter_traceback)
+                    if not ntraceback:
+                        ntraceback = traceback
+
+            excinfo.traceback = ntraceback.filter()
+            # issue364: mark all but first and last frames to
+            # only show a single-line message for each frame
+            if self.config.getoption("tbstyle", "auto") == "auto":
+                if len(excinfo.traceback) > 2:
+                    for entry in excinfo.traceback[1:-1]:
+                        entry.set_repr_style("short")
+
+    def repr_failure(self, excinfo, outerr=None):
+        assert outerr is None, "XXX outerr usage is deprecated"
+        style = self.config.getoption("tbstyle", "auto")
+        if style == "auto":
+            style = "long"
+        return self._repr_failure_py(excinfo, style=style)
+
+
+class FunctionDefinition(Function):
+    """
+    internal hack until we get actual definition nodes instead of the
+    crappy metafunc hack
+    """
+
+    def runtest(self) -> None:
+        raise RuntimeError("function definitions are not supposed to be used")
+
+    setup = runtest
diff --git a/contrib/python/pytest/py3/_pytest/python_api.py b/contrib/python/pytest/py3/_pytest/python_api.py
new file mode 100644
index 0000000000..df97181f4f
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/python_api.py
@@ -0,0 +1,751 @@
+import inspect
+import math
+import pprint
+from collections.abc import Iterable
+from collections.abc import Mapping
+from collections.abc import Sized
+from decimal import Decimal
+from itertools import filterfalse
+from numbers import Number
+from types import TracebackType
+from typing import Any
+from typing import Callable
+from typing import cast
+from typing import Generic
+from typing import Optional
+from typing import Pattern
+from typing import Tuple
+from typing import TypeVar
+from typing import Union
+
+from more_itertools.more import always_iterable
+
+import _pytest._code
+from _pytest.compat import overload
+from _pytest.compat import STRING_TYPES
+from _pytest.compat import TYPE_CHECKING
+from _pytest.outcomes import fail
+
+if TYPE_CHECKING:
+    from typing import Type  # noqa: F401 (used in type string)
+
+
+BASE_TYPE = (type, STRING_TYPES)
+
+
+def _non_numeric_type_error(value, at):
+    at_str = " at {}".format(at) if at else ""
+    return TypeError(
+        "cannot make approximate comparisons to non-numeric values: {!r} {}".format(
+            value, at_str
+        )
+    )
+
+
+# builtin pytest.approx helper
+
+
+class ApproxBase:
+    """
+    Provide shared utilities for making approximate comparisons between numbers
+    or sequences of numbers.
+    """
+
+    # Tell numpy to use our `__eq__` operator instead of its.
+    __array_ufunc__ = None
+    __array_priority__ = 100
+
+    def __init__(self, expected, rel=None, abs=None, nan_ok=False):
+        __tracebackhide__ = True
+        self.expected = expected
+        self.abs = abs
+        self.rel = rel
+        self.nan_ok = nan_ok
+        self._check_type()
+
+    def __repr__(self):
+        raise NotImplementedError
+
+    def __eq__(self, actual):
+        return all(
+            a == self._approx_scalar(x) for a, x in self._yield_comparisons(actual)
+        )
+
+    # Ignore type because of https://github.com/python/mypy/issues/4266.
+    __hash__ = None  # type: ignore
+
+    def __ne__(self, actual):
+        return not (actual == self)
+
+    def _approx_scalar(self, x):
+        return ApproxScalar(x, rel=self.rel, abs=self.abs, nan_ok=self.nan_ok)
+
+    def _yield_comparisons(self, actual):
+        """
+        Yield all the pairs of numbers to be compared.  This is used to
+        implement the `__eq__` method.
+        """
+        raise NotImplementedError
+
+    def _check_type(self):
+        """
+        Raise a TypeError if the expected value is not a valid type.
+        """
+        # This is only a concern if the expected value is a sequence.  In every
+        # other case, the approx() function ensures that the expected value has
+        # a numeric type.  For this reason, the default is to do nothing.  The
+        # classes that deal with sequences should reimplement this method to
+        # raise if there are any non-numeric elements in the sequence.
+        pass
+
+
+def _recursive_list_map(f, x):
+    if isinstance(x, list):
+        return list(_recursive_list_map(f, xi) for xi in x)
+    else:
+        return f(x)
+
+
+class ApproxNumpy(ApproxBase):
+    """
+    Perform approximate comparisons where the expected value is numpy array.
+    """
+
+    def __repr__(self):
+        list_scalars = _recursive_list_map(self._approx_scalar, self.expected.tolist())
+        return "approx({!r})".format(list_scalars)
+
+    def __eq__(self, actual):
+        import numpy as np
+
+        # self.expected is supposed to always be an array here
+
+        if not np.isscalar(actual):
+            try:
+                actual = np.asarray(actual)
+            except:  # noqa
+                raise TypeError("cannot compare '{}' to numpy.ndarray".format(actual))
+
+        if not np.isscalar(actual) and actual.shape != self.expected.shape:
+            return False
+
+        return ApproxBase.__eq__(self, actual)
+
+    def _yield_comparisons(self, actual):
+        import numpy as np
+
+        # `actual` can either be a numpy array or a scalar, it is treated in
+        # `__eq__` before being passed to `ApproxBase.__eq__`, which is the
+        # only method that calls this one.
+
+        if np.isscalar(actual):
+            for i in np.ndindex(self.expected.shape):
+                yield actual, self.expected[i].item()
+        else:
+            for i in np.ndindex(self.expected.shape):
+                yield actual[i].item(), self.expected[i].item()
+
+
+class ApproxMapping(ApproxBase):
+    """
+    Perform approximate comparisons where the expected value is a mapping with
+    numeric values (the keys can be anything).
+    """
+
+    def __repr__(self):
+        return "approx({!r})".format(
+            {k: self._approx_scalar(v) for k, v in self.expected.items()}
+        )
+
+    def __eq__(self, actual):
+        if set(actual.keys()) != set(self.expected.keys()):
+            return False
+
+        return ApproxBase.__eq__(self, actual)
+
+    def _yield_comparisons(self, actual):
+        for k in self.expected.keys():
+            yield actual[k], self.expected[k]
+
+    def _check_type(self):
+        __tracebackhide__ = True
+        for key, value in self.expected.items():
+            if isinstance(value, type(self.expected)):
+                msg = "pytest.approx() does not support nested dictionaries: key={!r} value={!r}\n  full mapping={}"
+                raise TypeError(msg.format(key, value, pprint.pformat(self.expected)))
+            elif not isinstance(value, Number):
+                raise _non_numeric_type_error(self.expected, at="key={!r}".format(key))
+
+
+class ApproxSequencelike(ApproxBase):
+    """
+    Perform approximate comparisons where the expected value is a sequence of
+    numbers.
+    """
+
+    def __repr__(self):
+        seq_type = type(self.expected)
+        if seq_type not in (tuple, list, set):
+            seq_type = list
+        return "approx({!r})".format(
+            seq_type(self._approx_scalar(x) for x in self.expected)
+        )
+
+    def __eq__(self, actual):
+        if len(actual) != len(self.expected):
+            return False
+        return ApproxBase.__eq__(self, actual)
+
+    def _yield_comparisons(self, actual):
+        return zip(actual, self.expected)
+
+    def _check_type(self):
+        __tracebackhide__ = True
+        for index, x in enumerate(self.expected):
+            if isinstance(x, type(self.expected)):
+                msg = "pytest.approx() does not support nested data structures: {!r} at index {}\n  full sequence: {}"
+                raise TypeError(msg.format(x, index, pprint.pformat(self.expected)))
+            elif not isinstance(x, Number):
+                raise _non_numeric_type_error(
+                    self.expected, at="index {}".format(index)
+                )
+
+
+class ApproxScalar(ApproxBase):
+    """
+    Perform approximate comparisons where the expected value is a single number.
+    """
+
+    # Using Real should be better than this Union, but not possible yet:
+    # https://github.com/python/typeshed/pull/3108
+    DEFAULT_ABSOLUTE_TOLERANCE = 1e-12  # type: Union[float, Decimal]
+    DEFAULT_RELATIVE_TOLERANCE = 1e-6  # type: Union[float, Decimal]
+
+    def __repr__(self):
+        """
+        Return a string communicating both the expected value and the tolerance
+        for the comparison being made, e.g. '1.0 ± 1e-6', '(3+4j) ± 5e-6 ∠ ±180°'.
+        """
+
+        # Infinities aren't compared using tolerances, so don't show a
+        # tolerance. Need to call abs to handle complex numbers, e.g. (inf + 1j)
+        if math.isinf(abs(self.expected)):
+            return str(self.expected)
+
+        # If a sensible tolerance can't be calculated, self.tolerance will
+        # raise a ValueError.  In this case, display '???'.
+        try:
+            vetted_tolerance = "{:.1e}".format(self.tolerance)
+            if isinstance(self.expected, complex) and not math.isinf(self.tolerance):
+                vetted_tolerance += " ∠ ±180°"
+        except ValueError:
+            vetted_tolerance = "???"
+
+        return "{} ± {}".format(self.expected, vetted_tolerance)
+
+    def __eq__(self, actual):
+        """
+        Return true if the given value is equal to the expected value within
+        the pre-specified tolerance.
+        """
+        if _is_numpy_array(actual):
+            # Call ``__eq__()`` manually to prevent infinite-recursion with
+            # numpy<1.13.  See #3748.
+            return all(self.__eq__(a) for a in actual.flat)
+
+        # Short-circuit exact equality.
+        if actual == self.expected:
+            return True
+
+        # Allow the user to control whether NaNs are considered equal to each
+        # other or not.  The abs() calls are for compatibility with complex
+        # numbers.
+        if math.isnan(abs(self.expected)):
+            return self.nan_ok and math.isnan(abs(actual))
+
+        # Infinity shouldn't be approximately equal to anything but itself, but
+        # if there's a relative tolerance, it will be infinite and infinity
+        # will seem approximately equal to everything.  The equal-to-itself
+        # case would have been short circuited above, so here we can just
+        # return false if the expected value is infinite.  The abs() call is
+        # for compatibility with complex numbers.
+        if math.isinf(abs(self.expected)):
+            return False
+
+        # Return true if the two numbers are within the tolerance.
+        return abs(self.expected - actual) <= self.tolerance
+
+    # Ignore type because of https://github.com/python/mypy/issues/4266.
+    __hash__ = None  # type: ignore
+
+    @property
+    def tolerance(self):
+        """
+        Return the tolerance for the comparison.  This could be either an
+        absolute tolerance or a relative tolerance, depending on what the user
+        specified or which would be larger.
+        """
+
+        def set_default(x, default):
+            return x if x is not None else default
+
+        # Figure out what the absolute tolerance should be.  ``self.abs`` is
+        # either None or a value specified by the user.
+        absolute_tolerance = set_default(self.abs, self.DEFAULT_ABSOLUTE_TOLERANCE)
+
+        if absolute_tolerance < 0:
+            raise ValueError(
+                "absolute tolerance can't be negative: {}".format(absolute_tolerance)
+            )
+        if math.isnan(absolute_tolerance):
+            raise ValueError("absolute tolerance can't be NaN.")
+
+        # If the user specified an absolute tolerance but not a relative one,
+        # just return the absolute tolerance.
+        if self.rel is None:
+            if self.abs is not None:
+                return absolute_tolerance
+
+        # Figure out what the relative tolerance should be.  ``self.rel`` is
+        # either None or a value specified by the user.  This is done after
+        # we've made sure the user didn't ask for an absolute tolerance only,
+        # because we don't want to raise errors about the relative tolerance if
+        # we aren't even going to use it.
+        relative_tolerance = set_default(
+            self.rel, self.DEFAULT_RELATIVE_TOLERANCE
+        ) * abs(self.expected)
+
+        if relative_tolerance < 0:
+            raise ValueError(
+                "relative tolerance can't be negative: {}".format(absolute_tolerance)
+            )
+        if math.isnan(relative_tolerance):
+            raise ValueError("relative tolerance can't be NaN.")
+
+        # Return the larger of the relative and absolute tolerances.
+        return max(relative_tolerance, absolute_tolerance)
+
+
+class ApproxDecimal(ApproxScalar):
+    """
+    Perform approximate comparisons where the expected value is a decimal.
+    """
+
+    DEFAULT_ABSOLUTE_TOLERANCE = Decimal("1e-12")
+    DEFAULT_RELATIVE_TOLERANCE = Decimal("1e-6")
+
+
+def approx(expected, rel=None, abs=None, nan_ok=False):
+    """
+    Assert that two numbers (or two sets of numbers) are equal to each other
+    within some tolerance.
+
+    Due to the `intricacies of floating-point arithmetic`__, numbers that we
+    would intuitively expect to be equal are not always so::
+
+        >>> 0.1 + 0.2 == 0.3
+        False
+
+    __ https://docs.python.org/3/tutorial/floatingpoint.html
+
+    This problem is commonly encountered when writing tests, e.g. when making
+    sure that floating-point values are what you expect them to be.  One way to
+    deal with this problem is to assert that two floating-point numbers are
+    equal to within some appropriate tolerance::
+
+        >>> abs((0.1 + 0.2) - 0.3) < 1e-6
+        True
+
+    However, comparisons like this are tedious to write and difficult to
+    understand.  Furthermore, absolute comparisons like the one above are
+    usually discouraged because there's no tolerance that works well for all
+    situations.  ``1e-6`` is good for numbers around ``1``, but too small for
+    very big numbers and too big for very small ones.  It's better to express
+    the tolerance as a fraction of the expected value, but relative comparisons
+    like that are even more difficult to write correctly and concisely.
+
+    The ``approx`` class performs floating-point comparisons using a syntax
+    that's as intuitive as possible::
+
+        >>> from pytest import approx
+        >>> 0.1 + 0.2 == approx(0.3)
+        True
+
+    The same syntax also works for sequences of numbers::
+
+        >>> (0.1 + 0.2, 0.2 + 0.4) == approx((0.3, 0.6))
+        True
+
+    Dictionary *values*::
+
+        >>> {'a': 0.1 + 0.2, 'b': 0.2 + 0.4} == approx({'a': 0.3, 'b': 0.6})
+        True
+
+    ``numpy`` arrays::
+
+        >>> import numpy as np                                                          # doctest: +SKIP
+        >>> np.array([0.1, 0.2]) + np.array([0.2, 0.4]) == approx(np.array([0.3, 0.6])) # doctest: +SKIP
+        True
+
+    And for a ``numpy`` array against a scalar::
+
+        >>> import numpy as np                                         # doctest: +SKIP
+        >>> np.array([0.1, 0.2]) + np.array([0.2, 0.1]) == approx(0.3) # doctest: +SKIP
+        True
+
+    By default, ``approx`` considers numbers within a relative tolerance of
+    ``1e-6`` (i.e. one part in a million) of its expected value to be equal.
+    This treatment would lead to surprising results if the expected value was
+    ``0.0``, because nothing but ``0.0`` itself is relatively close to ``0.0``.
+    To handle this case less surprisingly, ``approx`` also considers numbers
+    within an absolute tolerance of ``1e-12`` of its expected value to be
+    equal.  Infinity and NaN are special cases.  Infinity is only considered
+    equal to itself, regardless of the relative tolerance.  NaN is not
+    considered equal to anything by default, but you can make it be equal to
+    itself by setting the ``nan_ok`` argument to True.  (This is meant to
+    facilitate comparing arrays that use NaN to mean "no data".)
+
+    Both the relative and absolute tolerances can be changed by passing
+    arguments to the ``approx`` constructor::
+
+        >>> 1.0001 == approx(1)
+        False
+        >>> 1.0001 == approx(1, rel=1e-3)
+        True
+        >>> 1.0001 == approx(1, abs=1e-3)
+        True
+
+    If you specify ``abs`` but not ``rel``, the comparison will not consider
+    the relative tolerance at all.  In other words, two numbers that are within
+    the default relative tolerance of ``1e-6`` will still be considered unequal
+    if they exceed the specified absolute tolerance.  If you specify both
+    ``abs`` and ``rel``, the numbers will be considered equal if either
+    tolerance is met::
+
+        >>> 1 + 1e-8 == approx(1)
+        True
+        >>> 1 + 1e-8 == approx(1, abs=1e-12)
+        False
+        >>> 1 + 1e-8 == approx(1, rel=1e-6, abs=1e-12)
+        True
+
+    If you're thinking about using ``approx``, then you might want to know how
+    it compares to other good ways of comparing floating-point numbers.  All of
+    these algorithms are based on relative and absolute tolerances and should
+    agree for the most part, but they do have meaningful differences:
+
+    - ``math.isclose(a, b, rel_tol=1e-9, abs_tol=0.0)``:  True if the relative
+      tolerance is met w.r.t. either ``a`` or ``b`` or if the absolute
+      tolerance is met.  Because the relative tolerance is calculated w.r.t.
+      both ``a`` and ``b``, this test is symmetric (i.e.  neither ``a`` nor
+      ``b`` is a "reference value").  You have to specify an absolute tolerance
+      if you want to compare to ``0.0`` because there is no tolerance by
+      default.  Only available in python>=3.5.  `More information...`__
+
+      __ https://docs.python.org/3/library/math.html#math.isclose
+
+    - ``numpy.isclose(a, b, rtol=1e-5, atol=1e-8)``: True if the difference
+      between ``a`` and ``b`` is less that the sum of the relative tolerance
+      w.r.t. ``b`` and the absolute tolerance.  Because the relative tolerance
+      is only calculated w.r.t. ``b``, this test is asymmetric and you can
+      think of ``b`` as the reference value.  Support for comparing sequences
+      is provided by ``numpy.allclose``.  `More information...`__
+
+      __ http://docs.scipy.org/doc/numpy-1.10.0/reference/generated/numpy.isclose.html
+
+    - ``unittest.TestCase.assertAlmostEqual(a, b)``: True if ``a`` and ``b``
+      are within an absolute tolerance of ``1e-7``.  No relative tolerance is
+      considered and the absolute tolerance cannot be changed, so this function
+      is not appropriate for very large or very small numbers.  Also, it's only
+      available in subclasses of ``unittest.TestCase`` and it's ugly because it
+      doesn't follow PEP8.  `More information...`__
+
+      __ https://docs.python.org/3/library/unittest.html#unittest.TestCase.assertAlmostEqual
+
+    - ``a == pytest.approx(b, rel=1e-6, abs=1e-12)``: True if the relative
+      tolerance is met w.r.t. ``b`` or if the absolute tolerance is met.
+      Because the relative tolerance is only calculated w.r.t. ``b``, this test
+      is asymmetric and you can think of ``b`` as the reference value.  In the
+      special case that you explicitly specify an absolute tolerance but not a
+      relative tolerance, only the absolute tolerance is considered.
+
+    .. warning::
+
+       .. versionchanged:: 3.2
+
+       In order to avoid inconsistent behavior, ``TypeError`` is
+       raised for ``>``, ``>=``, ``<`` and ``<=`` comparisons.
+       The example below illustrates the problem::
+
+           assert approx(0.1) > 0.1 + 1e-10  # calls approx(0.1).__gt__(0.1 + 1e-10)
+           assert 0.1 + 1e-10 > approx(0.1)  # calls approx(0.1).__lt__(0.1 + 1e-10)
+
+       In the second example one expects ``approx(0.1).__le__(0.1 + 1e-10)``
+       to be called. But instead, ``approx(0.1).__lt__(0.1 + 1e-10)`` is used to
+       comparison. This is because the call hierarchy of rich comparisons
+       follows a fixed behavior. `More information...`__
+
+       __ https://docs.python.org/3/reference/datamodel.html#object.__ge__
+    """
+
+    # Delegate the comparison to a class that knows how to deal with the type
+    # of the expected value (e.g. int, float, list, dict, numpy.array, etc).
+    #
+    # The primary responsibility of these classes is to implement ``__eq__()``
+    # and ``__repr__()``.  The former is used to actually check if some
+    # "actual" value is equivalent to the given expected value within the
+    # allowed tolerance.  The latter is used to show the user the expected
+    # value and tolerance, in the case that a test failed.
+    #
+    # The actual logic for making approximate comparisons can be found in
+    # ApproxScalar, which is used to compare individual numbers.  All of the
+    # other Approx classes eventually delegate to this class.  The ApproxBase
+    # class provides some convenient methods and overloads, but isn't really
+    # essential.
+
+    __tracebackhide__ = True
+
+    if isinstance(expected, Decimal):
+        cls = ApproxDecimal
+    elif isinstance(expected, Number):
+        cls = ApproxScalar
+    elif isinstance(expected, Mapping):
+        cls = ApproxMapping
+    elif _is_numpy_array(expected):
+        cls = ApproxNumpy
+    elif (
+        isinstance(expected, Iterable)
+        and isinstance(expected, Sized)
+        and not isinstance(expected, STRING_TYPES)
+    ):
+        cls = ApproxSequencelike
+    else:
+        raise _non_numeric_type_error(expected, at=None)
+
+    return cls(expected, rel, abs, nan_ok)
+
+
+def _is_numpy_array(obj):
+    """
+    Return true if the given object is a numpy array.  Make a special effort to
+    avoid importing numpy unless it's really necessary.
+    """
+    import sys
+
+    np = sys.modules.get("numpy")
+    if np is not None:
+        return isinstance(obj, np.ndarray)
+    return False
+
+
+# builtin pytest.raises helper
+
+_E = TypeVar("_E", bound=BaseException)
+
+
+@overload
+def raises(
+    expected_exception: Union["Type[_E]", Tuple["Type[_E]", ...]],
+    *,
+    match: "Optional[Union[str, Pattern]]" = ...
+) -> "RaisesContext[_E]":
+    ...  # pragma: no cover
+
+
+@overload  # noqa: F811
+def raises(  # noqa: F811
+    expected_exception: Union["Type[_E]", Tuple["Type[_E]", ...]],
+    func: Callable,
+    *args: Any,
+    **kwargs: Any
+) -> _pytest._code.ExceptionInfo[_E]:
+    ...  # pragma: no cover
+
+
+def raises(  # noqa: F811
+    expected_exception: Union["Type[_E]", Tuple["Type[_E]", ...]],
+    *args: Any,
+    **kwargs: Any
+) -> Union["RaisesContext[_E]", _pytest._code.ExceptionInfo[_E]]:
+    r"""
+    Assert that a code block/function call raises ``expected_exception``
+    or raise a failure exception otherwise.
+
+    :kwparam match: if specified, a string containing a regular expression,
+        or a regular expression object, that is tested against the string
+        representation of the exception using ``re.search``. To match a literal
+        string that may contain `special characters`__, the pattern can
+        first be escaped with ``re.escape``.
+
+        (This is only used when ``pytest.raises`` is used as a context manager,
+        and passed through to the function otherwise.
+        When using ``pytest.raises`` as a function, you can use:
+        ``pytest.raises(Exc, func, match="passed on").match("my pattern")``.)
+
+        __ https://docs.python.org/3/library/re.html#regular-expression-syntax
+
+    .. currentmodule:: _pytest._code
+
+    Use ``pytest.raises`` as a context manager, which will capture the exception of the given
+    type::
+
+        >>> with raises(ZeroDivisionError):
+        ...    1/0
+
+    If the code block does not raise the expected exception (``ZeroDivisionError`` in the example
+    above), or no exception at all, the check will fail instead.
+
+    You can also use the keyword argument ``match`` to assert that the
+    exception matches a text or regex::
+
+        >>> with raises(ValueError, match='must be 0 or None'):
+        ...     raise ValueError("value must be 0 or None")
+
+        >>> with raises(ValueError, match=r'must be \d+$'):
+        ...     raise ValueError("value must be 42")
+
+    The context manager produces an :class:`ExceptionInfo` object which can be used to inspect the
+    details of the captured exception::
+
+        >>> with raises(ValueError) as exc_info:
+        ...     raise ValueError("value must be 42")
+        >>> assert exc_info.type is ValueError
+        >>> assert exc_info.value.args[0] == "value must be 42"
+
+    .. note::
+
+       When using ``pytest.raises`` as a context manager, it's worthwhile to
+       note that normal context manager rules apply and that the exception
+       raised *must* be the final line in the scope of the context manager.
+       Lines of code after that, within the scope of the context manager will
+       not be executed. For example::
+
+           >>> value = 15
+           >>> with raises(ValueError) as exc_info:
+           ...     if value > 10:
+           ...         raise ValueError("value must be <= 10")
+           ...     assert exc_info.type is ValueError  # this will not execute
+
+       Instead, the following approach must be taken (note the difference in
+       scope)::
+
+           >>> with raises(ValueError) as exc_info:
+           ...     if value > 10:
+           ...         raise ValueError("value must be <= 10")
+           ...
+           >>> assert exc_info.type is ValueError
+
+    **Using with** ``pytest.mark.parametrize``
+
+    When using :ref:`pytest.mark.parametrize ref`
+    it is possible to parametrize tests such that
+    some runs raise an exception and others do not.
+
+    See :ref:`parametrizing_conditional_raising` for an example.
+
+    **Legacy form**
+
+    It is possible to specify a callable by passing a to-be-called lambda::
+
+        >>> raises(ZeroDivisionError, lambda: 1/0)
+        <ExceptionInfo ...>
+
+    or you can specify an arbitrary callable with arguments::
+
+        >>> def f(x): return 1/x
+        ...
+        >>> raises(ZeroDivisionError, f, 0)
+        <ExceptionInfo ...>
+        >>> raises(ZeroDivisionError, f, x=0)
+        <ExceptionInfo ...>
+
+    The form above is fully supported but discouraged for new code because the
+    context manager form is regarded as more readable and less error-prone.
+
+    .. note::
+        Similar to caught exception objects in Python, explicitly clearing
+        local references to returned ``ExceptionInfo`` objects can
+        help the Python interpreter speed up its garbage collection.
+
+        Clearing those references breaks a reference cycle
+        (``ExceptionInfo`` --> caught exception --> frame stack raising
+        the exception --> current frame stack --> local variables -->
+        ``ExceptionInfo``) which makes Python keep all objects referenced
+        from that cycle (including all local variables in the current
+        frame) alive until the next cyclic garbage collection run.
+        More detailed information can be found in the official Python
+        documentation for :ref:`the try statement <python:try>`.
+    """
+    __tracebackhide__ = True
+    for exc in filterfalse(
+        inspect.isclass, always_iterable(expected_exception, BASE_TYPE)  # type: ignore[arg-type]  # noqa: F821
+    ):
+        msg = "exceptions must be derived from BaseException, not %s"
+        raise TypeError(msg % type(exc))
+
+    message = "DID NOT RAISE {}".format(expected_exception)
+
+    if not args:
+        match = kwargs.pop("match", None)
+        if kwargs:
+            msg = "Unexpected keyword arguments passed to pytest.raises: "
+            msg += ", ".join(sorted(kwargs))
+            msg += "\nUse context-manager form instead?"
+            raise TypeError(msg)
+        return RaisesContext(expected_exception, message, match)
+    else:
+        func = args[0]
+        if not callable(func):
+            raise TypeError(
+                "{!r} object (type: {}) must be callable".format(func, type(func))
+            )
+        try:
+            func(*args[1:], **kwargs)
+        except expected_exception as e:
+            # We just caught the exception - there is a traceback.
+            assert e.__traceback__ is not None
+            return _pytest._code.ExceptionInfo.from_exc_info(
+                (type(e), e, e.__traceback__)
+            )
+    fail(message)
+
+
+raises.Exception = fail.Exception  # type: ignore
+
+
+class RaisesContext(Generic[_E]):
+    def __init__(
+        self,
+        expected_exception: Union["Type[_E]", Tuple["Type[_E]", ...]],
+        message: str,
+        match_expr: Optional[Union[str, "Pattern"]] = None,
+    ) -> None:
+        self.expected_exception = expected_exception
+        self.message = message
+        self.match_expr = match_expr
+        self.excinfo = None  # type: Optional[_pytest._code.ExceptionInfo[_E]]
+
+    def __enter__(self) -> _pytest._code.ExceptionInfo[_E]:
+        self.excinfo = _pytest._code.ExceptionInfo.for_later()
+        return self.excinfo
+
+    def __exit__(
+        self,
+        exc_type: Optional["Type[BaseException]"],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> bool:
+        __tracebackhide__ = True
+        if exc_type is None:
+            fail(self.message)
+        assert self.excinfo is not None
+        if not issubclass(exc_type, self.expected_exception):
+            return False
+        # Cast to narrow the exception type now that it's verified.
+        exc_info = cast(
+            Tuple["Type[_E]", _E, TracebackType], (exc_type, exc_val, exc_tb)
+        )
+        self.excinfo.fill_unfilled(exc_info)
+        if self.match_expr is not None:
+            self.excinfo.match(self.match_expr)
+        return True
diff --git a/contrib/python/pytest/py3/_pytest/recwarn.py b/contrib/python/pytest/py3/_pytest/recwarn.py
new file mode 100644
index 0000000000..c57c94b1cb
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/recwarn.py
@@ -0,0 +1,264 @@
+""" recording warnings during test function execution. """
+import re
+import warnings
+from types import TracebackType
+from typing import Any
+from typing import Callable
+from typing import Iterator
+from typing import List
+from typing import Optional
+from typing import Pattern
+from typing import Tuple
+from typing import Union
+
+from _pytest.compat import overload
+from _pytest.compat import TYPE_CHECKING
+from _pytest.fixtures import yield_fixture
+from _pytest.outcomes import fail
+
+if TYPE_CHECKING:
+    from typing import Type
+
+
+@yield_fixture
+def recwarn():
+    """Return a :class:`WarningsRecorder` instance that records all warnings emitted by test functions.
+
+    See http://docs.python.org/library/warnings.html for information
+    on warning categories.
+    """
+    wrec = WarningsRecorder()
+    with wrec:
+        warnings.simplefilter("default")
+        yield wrec
+
+
+def deprecated_call(func=None, *args, **kwargs):
+    """context manager that can be used to ensure a block of code triggers a
+    ``DeprecationWarning`` or ``PendingDeprecationWarning``::
+
+        >>> import warnings
+        >>> def api_call_v2():
+        ...     warnings.warn('use v3 of this api', DeprecationWarning)
+        ...     return 200
+
+        >>> with deprecated_call():
+        ...    assert api_call_v2() == 200
+
+    ``deprecated_call`` can also be used by passing a function and ``*args`` and ``*kwargs``,
+    in which case it will ensure calling ``func(*args, **kwargs)`` produces one of the warnings
+    types above.
+    """
+    __tracebackhide__ = True
+    if func is not None:
+        args = (func,) + args
+    return warns((DeprecationWarning, PendingDeprecationWarning), *args, **kwargs)
+
+
+@overload
+def warns(
+    expected_warning: Optional[Union["Type[Warning]", Tuple["Type[Warning]", ...]]],
+    *,
+    match: "Optional[Union[str, Pattern]]" = ...
+) -> "WarningsChecker":
+    raise NotImplementedError()
+
+
+@overload  # noqa: F811
+def warns(  # noqa: F811
+    expected_warning: Optional[Union["Type[Warning]", Tuple["Type[Warning]", ...]]],
+    func: Callable,
+    *args: Any,
+    match: Optional[Union[str, "Pattern"]] = ...,
+    **kwargs: Any
+) -> Union[Any]:
+    raise NotImplementedError()
+
+
+def warns(  # noqa: F811
+    expected_warning: Optional[Union["Type[Warning]", Tuple["Type[Warning]", ...]]],
+    *args: Any,
+    match: Optional[Union[str, "Pattern"]] = None,
+    **kwargs: Any
+) -> Union["WarningsChecker", Any]:
+    r"""Assert that code raises a particular class of warning.
+
+    Specifically, the parameter ``expected_warning`` can be a warning class or
+    sequence of warning classes, and the inside the ``with`` block must issue a warning of that class or
+    classes.
+
+    This helper produces a list of :class:`warnings.WarningMessage` objects,
+    one for each warning raised.
+
+    This function can be used as a context manager, or any of the other ways
+    ``pytest.raises`` can be used::
+
+        >>> with warns(RuntimeWarning):
+        ...    warnings.warn("my warning", RuntimeWarning)
+
+    In the context manager form you may use the keyword argument ``match`` to assert
+    that the exception matches a text or regex::
+
+        >>> with warns(UserWarning, match='must be 0 or None'):
+        ...     warnings.warn("value must be 0 or None", UserWarning)
+
+        >>> with warns(UserWarning, match=r'must be \d+$'):
+        ...     warnings.warn("value must be 42", UserWarning)
+
+        >>> with warns(UserWarning, match=r'must be \d+$'):
+        ...     warnings.warn("this is not here", UserWarning)
+        Traceback (most recent call last):
+          ...
+        Failed: DID NOT WARN. No warnings of type ...UserWarning... was emitted...
+
+    """
+    __tracebackhide__ = True
+    if not args:
+        if kwargs:
+            msg = "Unexpected keyword arguments passed to pytest.warns: "
+            msg += ", ".join(sorted(kwargs))
+            msg += "\nUse context-manager form instead?"
+            raise TypeError(msg)
+        return WarningsChecker(expected_warning, match_expr=match)
+    else:
+        func = args[0]
+        if not callable(func):
+            raise TypeError(
+                "{!r} object (type: {}) must be callable".format(func, type(func))
+            )
+        with WarningsChecker(expected_warning):
+            return func(*args[1:], **kwargs)
+
+
+class WarningsRecorder(warnings.catch_warnings):
+    """A context manager to record raised warnings.
+
+    Adapted from `warnings.catch_warnings`.
+    """
+
+    def __init__(self):
+        super().__init__(record=True)
+        self._entered = False
+        self._list = []  # type: List[warnings._Record]
+
+    @property
+    def list(self) -> List["warnings._Record"]:
+        """The list of recorded warnings."""
+        return self._list
+
+    def __getitem__(self, i: int) -> "warnings._Record":
+        """Get a recorded warning by index."""
+        return self._list[i]
+
+    def __iter__(self) -> Iterator["warnings._Record"]:
+        """Iterate through the recorded warnings."""
+        return iter(self._list)
+
+    def __len__(self) -> int:
+        """The number of recorded warnings."""
+        return len(self._list)
+
+    def pop(self, cls: "Type[Warning]" = Warning) -> "warnings._Record":
+        """Pop the first recorded warning, raise exception if not exists."""
+        for i, w in enumerate(self._list):
+            if issubclass(w.category, cls):
+                return self._list.pop(i)
+        __tracebackhide__ = True
+        raise AssertionError("%r not found in warning list" % cls)
+
+    def clear(self) -> None:
+        """Clear the list of recorded warnings."""
+        self._list[:] = []
+
+    # Type ignored because it doesn't exactly warnings.catch_warnings.__enter__
+    # -- it returns a List but we only emulate one.
+    def __enter__(self) -> "WarningsRecorder":  # type: ignore
+        if self._entered:
+            __tracebackhide__ = True
+            raise RuntimeError("Cannot enter %r twice" % self)
+        _list = super().__enter__()
+        # record=True means it's None.
+        assert _list is not None
+        self._list = _list
+        warnings.simplefilter("always")
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional["Type[BaseException]"],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        if not self._entered:
+            __tracebackhide__ = True
+            raise RuntimeError("Cannot exit %r without entering first" % self)
+
+        super().__exit__(exc_type, exc_val, exc_tb)
+
+        # Built-in catch_warnings does not reset entered state so we do it
+        # manually here for this context manager to become reusable.
+        self._entered = False
+
+
+class WarningsChecker(WarningsRecorder):
+    def __init__(
+        self,
+        expected_warning: Optional[
+            Union["Type[Warning]", Tuple["Type[Warning]", ...]]
+        ] = None,
+        match_expr: Optional[Union[str, "Pattern"]] = None,
+    ) -> None:
+        super().__init__()
+
+        msg = "exceptions must be derived from Warning, not %s"
+        if expected_warning is None:
+            expected_warning_tup = None
+        elif isinstance(expected_warning, tuple):
+            for exc in expected_warning:
+                if not issubclass(exc, Warning):
+                    raise TypeError(msg % type(exc))
+            expected_warning_tup = expected_warning
+        elif issubclass(expected_warning, Warning):
+            expected_warning_tup = (expected_warning,)
+        else:
+            raise TypeError(msg % type(expected_warning))
+
+        self.expected_warning = expected_warning_tup
+        self.match_expr = match_expr
+
+    def __exit__(
+        self,
+        exc_type: Optional["Type[BaseException]"],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        super().__exit__(exc_type, exc_val, exc_tb)
+
+        __tracebackhide__ = True
+
+        # only check if we're not currently handling an exception
+        if exc_type is None and exc_val is None and exc_tb is None:
+            if self.expected_warning is not None:
+                if not any(issubclass(r.category, self.expected_warning) for r in self):
+                    __tracebackhide__ = True
+                    fail(
+                        "DID NOT WARN. No warnings of type {} was emitted. "
+                        "The list of emitted warnings is: {}.".format(
+                            self.expected_warning, [each.message for each in self]
+                        )
+                    )
+                elif self.match_expr is not None:
+                    for r in self:
+                        if issubclass(r.category, self.expected_warning):
+                            if re.compile(self.match_expr).search(str(r.message)):
+                                break
+                    else:
+                        fail(
+                            "DID NOT WARN. No warnings of type {} matching"
+                            " ('{}') was emitted. The list of emitted warnings"
+                            " is: {}.".format(
+                                self.expected_warning,
+                                self.match_expr,
+                                [each.message for each in self],
+                            )
+                        )
diff --git a/contrib/python/pytest/py3/_pytest/reports.py b/contrib/python/pytest/py3/_pytest/reports.py
new file mode 100644
index 0000000000..4fa465ea71
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/reports.py
@@ -0,0 +1,507 @@
+from io import StringIO
+from pprint import pprint
+from typing import Any
+from typing import List
+from typing import Optional
+from typing import Tuple
+from typing import Union
+
+import attr
+import py
+
+from _pytest._code.code import ExceptionChainRepr
+from _pytest._code.code import ExceptionInfo
+from _pytest._code.code import ReprEntry
+from _pytest._code.code import ReprEntryNative
+from _pytest._code.code import ReprExceptionInfo
+from _pytest._code.code import ReprFileLocation
+from _pytest._code.code import ReprFuncArgs
+from _pytest._code.code import ReprLocals
+from _pytest._code.code import ReprTraceback
+from _pytest._code.code import TerminalRepr
+from _pytest._io import TerminalWriter
+from _pytest.compat import TYPE_CHECKING
+from _pytest.nodes import Node
+from _pytest.outcomes import skip
+from _pytest.pathlib import Path
+
+
+def getslaveinfoline(node):
+    try:
+        return node._slaveinfocache
+    except AttributeError:
+        d = node.slaveinfo
+        ver = "%s.%s.%s" % d["version_info"][:3]
+        node._slaveinfocache = s = "[{}] {} -- Python {} {}".format(
+            d["id"], d["sysplatform"], ver, d["executable"]
+        )
+        return s
+
+
+class BaseReport:
+    when = None  # type: Optional[str]
+    location = None  # type: Optional[Tuple[str, Optional[int], str]]
+    longrepr = None
+    sections = []  # type: List[Tuple[str, str]]
+    nodeid = None  # type: str
+
+    def __init__(self, **kw: Any) -> None:
+        self.__dict__.update(kw)
+
+    if TYPE_CHECKING:
+        # Can have arbitrary fields given to __init__().
+        def __getattr__(self, key: str) -> Any:
+            raise NotImplementedError()
+
+    def toterminal(self, out) -> None:
+        if hasattr(self, "node"):
+            out.line(getslaveinfoline(self.node))  # type: ignore
+
+        longrepr = self.longrepr
+        if longrepr is None:
+            return
+
+        if hasattr(longrepr, "toterminal"):
+            longrepr.toterminal(out)
+        else:
+            try:
+                out.line(longrepr)
+            except UnicodeEncodeError:
+                out.line("<unprintable longrepr>")
+
+    def get_sections(self, prefix):
+        for name, content in self.sections:
+            if name.startswith(prefix):
+                yield prefix, content
+
+    @property
+    def longreprtext(self):
+        """
+        Read-only property that returns the full string representation
+        of ``longrepr``.
+
+        .. versionadded:: 3.0
+        """
+        tw = TerminalWriter(stringio=True)
+        tw.hasmarkup = False
+        self.toterminal(tw)
+        exc = tw.stringio.getvalue()
+        return exc.strip()
+
+    @property
+    def caplog(self):
+        """Return captured log lines, if log capturing is enabled
+
+        .. versionadded:: 3.5
+        """
+        return "\n".join(
+            content for (prefix, content) in self.get_sections("Captured log")
+        )
+
+    @property
+    def capstdout(self):
+        """Return captured text from stdout, if capturing is enabled
+
+        .. versionadded:: 3.0
+        """
+        return "".join(
+            content for (prefix, content) in self.get_sections("Captured stdout")
+        )
+
+    @property
+    def capstderr(self):
+        """Return captured text from stderr, if capturing is enabled
+
+        .. versionadded:: 3.0
+        """
+        return "".join(
+            content for (prefix, content) in self.get_sections("Captured stderr")
+        )
+
+    passed = property(lambda x: x.outcome == "passed")
+    failed = property(lambda x: x.outcome == "failed")
+    skipped = property(lambda x: x.outcome == "skipped")
+
+    @property
+    def fspath(self) -> str:
+        return self.nodeid.split("::")[0]
+
+    @property
+    def count_towards_summary(self):
+        """
+        **Experimental**
+
+        Returns True if this report should be counted towards the totals shown at the end of the
+        test session: "1 passed, 1 failure, etc".
+
+        .. note::
+
+            This function is considered **experimental**, so beware that it is subject to changes
+            even in patch releases.
+        """
+        return True
+
+    @property
+    def head_line(self):
+        """
+        **Experimental**
+
+        Returns the head line shown with longrepr output for this report, more commonly during
+        traceback representation during failures::
+
+            ________ Test.foo ________
+
+
+        In the example above, the head_line is "Test.foo".
+
+        .. note::
+
+            This function is considered **experimental**, so beware that it is subject to changes
+            even in patch releases.
+        """
+        if self.location is not None:
+            fspath, lineno, domain = self.location
+            return domain
+
+    def _get_verbose_word(self, config):
+        _category, _short, verbose = config.hook.pytest_report_teststatus(
+            report=self, config=config
+        )
+        return verbose
+
+    def _to_json(self):
+        """
+        This was originally the serialize_report() function from xdist (ca03269).
+
+        Returns the contents of this report as a dict of builtin entries, suitable for
+        serialization.
+
+        Experimental method.
+        """
+        return _report_to_json(self)
+
+    @classmethod
+    def _from_json(cls, reportdict):
+        """
+        This was originally the serialize_report() function from xdist (ca03269).
+
+        Factory method that returns either a TestReport or CollectReport, depending on the calling
+        class. It's the callers responsibility to know which class to pass here.
+
+        Experimental method.
+        """
+        kwargs = _report_kwargs_from_json(reportdict)
+        return cls(**kwargs)
+
+
+def _report_unserialization_failure(type_name, report_class, reportdict):
+    url = "https://github.com/pytest-dev/pytest/issues"
+    stream = StringIO()
+    pprint("-" * 100, stream=stream)
+    pprint("INTERNALERROR: Unknown entry type returned: %s" % type_name, stream=stream)
+    pprint("report_name: %s" % report_class, stream=stream)
+    pprint(reportdict, stream=stream)
+    pprint("Please report this bug at %s" % url, stream=stream)
+    pprint("-" * 100, stream=stream)
+    raise RuntimeError(stream.getvalue())
+
+
+class TestReport(BaseReport):
+    """ Basic test report object (also used for setup and teardown calls if
+    they fail).
+    """
+
+    __test__ = False
+
+    def __init__(
+        self,
+        nodeid,
+        location: Tuple[str, Optional[int], str],
+        keywords,
+        outcome,
+        longrepr,
+        when,
+        sections=(),
+        duration=0,
+        user_properties=None,
+        **extra
+    ) -> None:
+        #: normalized collection node id
+        self.nodeid = nodeid
+
+        #: a (filesystempath, lineno, domaininfo) tuple indicating the
+        #: actual location of a test item - it might be different from the
+        #: collected one e.g. if a method is inherited from a different module.
+        self.location = location  # type: Tuple[str, Optional[int], str]
+
+        #: a name -> value dictionary containing all keywords and
+        #: markers associated with a test invocation.
+        self.keywords = keywords
+
+        #: test outcome, always one of "passed", "failed", "skipped".
+        self.outcome = outcome
+
+        #: None or a failure representation.
+        self.longrepr = longrepr
+
+        #: one of 'setup', 'call', 'teardown' to indicate runtest phase.
+        self.when = when
+
+        #: user properties is a list of tuples (name, value) that holds user
+        #: defined properties of the test
+        self.user_properties = list(user_properties or [])
+
+        #: list of pairs ``(str, str)`` of extra information which needs to
+        #: marshallable. Used by pytest to add captured text
+        #: from ``stdout`` and ``stderr``, but may be used by other plugins
+        #: to add arbitrary information to reports.
+        self.sections = list(sections)
+
+        #: time it took to run just the test
+        self.duration = duration
+
+        self.__dict__.update(extra)
+
+    def __repr__(self):
+        return "<{} {!r} when={!r} outcome={!r}>".format(
+            self.__class__.__name__, self.nodeid, self.when, self.outcome
+        )
+
+    @classmethod
+    def from_item_and_call(cls, item, call) -> "TestReport":
+        """
+        Factory method to create and fill a TestReport with standard item and call info.
+        """
+        when = call.when
+        duration = call.stop - call.start
+        keywords = {x: 1 for x in item.keywords}
+        excinfo = call.excinfo
+        sections = []
+        if not call.excinfo:
+            outcome = "passed"
+            longrepr = None
+        else:
+            if not isinstance(excinfo, ExceptionInfo):
+                outcome = "failed"
+                longrepr = excinfo
+            elif excinfo.errisinstance(skip.Exception):
+                outcome = "skipped"
+                r = excinfo._getreprcrash()
+                longrepr = (str(r.path), r.lineno, r.message)
+            else:
+                outcome = "failed"
+                if call.when == "call":
+                    longrepr = item.repr_failure(excinfo)
+                else:  # exception in setup or teardown
+                    longrepr = item._repr_failure_py(
+                        excinfo, style=item.config.getoption("tbstyle", "auto")
+                    )
+        for rwhen, key, content in item._report_sections:
+            sections.append(("Captured {} {}".format(key, rwhen), content))
+        return cls(
+            item.nodeid,
+            item.location,
+            keywords,
+            outcome,
+            longrepr,
+            when,
+            sections,
+            duration,
+            user_properties=item.user_properties,
+        )
+
+
+class CollectReport(BaseReport):
+    when = "collect"
+
+    def __init__(
+        self, nodeid: str, outcome, longrepr, result: List[Node], sections=(), **extra
+    ) -> None:
+        self.nodeid = nodeid
+        self.outcome = outcome
+        self.longrepr = longrepr
+        self.result = result or []
+        self.sections = list(sections)
+        self.__dict__.update(extra)
+
+    @property
+    def location(self):
+        return (self.fspath, None, self.fspath)
+
+    def __repr__(self):
+        return "<CollectReport {!r} lenresult={} outcome={!r}>".format(
+            self.nodeid, len(self.result), self.outcome
+        )
+
+
+class CollectErrorRepr(TerminalRepr):
+    def __init__(self, msg):
+        self.longrepr = msg
+
+    def toterminal(self, out) -> None:
+        out.line(self.longrepr, red=True)
+
+
+def pytest_report_to_serializable(report):
+    if isinstance(report, (TestReport, CollectReport)):
+        data = report._to_json()
+        data["$report_type"] = report.__class__.__name__
+        return data
+
+
+def pytest_report_from_serializable(data):
+    if "$report_type" in data:
+        if data["$report_type"] == "TestReport":
+            return TestReport._from_json(data)
+        elif data["$report_type"] == "CollectReport":
+            return CollectReport._from_json(data)
+        assert False, "Unknown report_type unserialize data: {}".format(
+            data["$report_type"]
+        )
+
+
+def _report_to_json(report):
+    """
+    This was originally the serialize_report() function from xdist (ca03269).
+
+    Returns the contents of this report as a dict of builtin entries, suitable for
+    serialization.
+    """
+
+    def serialize_repr_entry(entry):
+        entry_data = {"type": type(entry).__name__, "data": attr.asdict(entry)}
+        for key, value in entry_data["data"].items():
+            if hasattr(value, "__dict__"):
+                entry_data["data"][key] = attr.asdict(value)
+        return entry_data
+
+    def serialize_repr_traceback(reprtraceback: ReprTraceback):
+        result = attr.asdict(reprtraceback)
+        result["reprentries"] = [
+            serialize_repr_entry(x) for x in reprtraceback.reprentries
+        ]
+        return result
+
+    def serialize_repr_crash(reprcrash: Optional[ReprFileLocation]):
+        if reprcrash is not None:
+            return attr.asdict(reprcrash)
+        else:
+            return None
+
+    def serialize_longrepr(rep):
+        result = {
+            "reprcrash": serialize_repr_crash(rep.longrepr.reprcrash),
+            "reprtraceback": serialize_repr_traceback(rep.longrepr.reprtraceback),
+            "sections": rep.longrepr.sections,
+        }
+        if isinstance(rep.longrepr, ExceptionChainRepr):
+            result["chain"] = []
+            for repr_traceback, repr_crash, description in rep.longrepr.chain:
+                result["chain"].append(
+                    (
+                        serialize_repr_traceback(repr_traceback),
+                        serialize_repr_crash(repr_crash),
+                        description,
+                    )
+                )
+        else:
+            result["chain"] = None
+        return result
+
+    d = report.__dict__.copy()
+    if hasattr(report.longrepr, "toterminal"):
+        if hasattr(report.longrepr, "reprtraceback") and hasattr(
+            report.longrepr, "reprcrash"
+        ):
+            d["longrepr"] = serialize_longrepr(report)
+        else:
+            d["longrepr"] = str(report.longrepr)
+    else:
+        d["longrepr"] = report.longrepr
+    for name in d:
+        if isinstance(d[name], (py.path.local, Path)):
+            d[name] = str(d[name])
+        elif name == "result":
+            d[name] = None  # for now
+    return d
+
+
+def _report_kwargs_from_json(reportdict):
+    """
+    This was originally the serialize_report() function from xdist (ca03269).
+
+    Returns **kwargs that can be used to construct a TestReport or CollectReport instance.
+    """
+
+    def deserialize_repr_entry(entry_data):
+        data = entry_data["data"]
+        entry_type = entry_data["type"]
+        if entry_type == "ReprEntry":
+            reprfuncargs = None
+            reprfileloc = None
+            reprlocals = None
+            if data["reprfuncargs"]:
+                reprfuncargs = ReprFuncArgs(**data["reprfuncargs"])
+            if data["reprfileloc"]:
+                reprfileloc = ReprFileLocation(**data["reprfileloc"])
+            if data["reprlocals"]:
+                reprlocals = ReprLocals(data["reprlocals"]["lines"])
+
+            reprentry = ReprEntry(
+                lines=data["lines"],
+                reprfuncargs=reprfuncargs,
+                reprlocals=reprlocals,
+                reprfileloc=reprfileloc,
+                style=data["style"],
+            )  # type: Union[ReprEntry, ReprEntryNative]
+        elif entry_type == "ReprEntryNative":
+            reprentry = ReprEntryNative(data["lines"])
+        else:
+            _report_unserialization_failure(entry_type, TestReport, reportdict)
+        return reprentry
+
+    def deserialize_repr_traceback(repr_traceback_dict):
+        repr_traceback_dict["reprentries"] = [
+            deserialize_repr_entry(x) for x in repr_traceback_dict["reprentries"]
+        ]
+        return ReprTraceback(**repr_traceback_dict)
+
+    def deserialize_repr_crash(repr_crash_dict: Optional[dict]):
+        if repr_crash_dict is not None:
+            return ReprFileLocation(**repr_crash_dict)
+        else:
+            return None
+
+    if (
+        reportdict["longrepr"]
+        and "reprcrash" in reportdict["longrepr"]
+        and "reprtraceback" in reportdict["longrepr"]
+    ):
+
+        reprtraceback = deserialize_repr_traceback(
+            reportdict["longrepr"]["reprtraceback"]
+        )
+        reprcrash = deserialize_repr_crash(reportdict["longrepr"]["reprcrash"])
+        if reportdict["longrepr"]["chain"]:
+            chain = []
+            for repr_traceback_data, repr_crash_data, description in reportdict[
+                "longrepr"
+            ]["chain"]:
+                chain.append(
+                    (
+                        deserialize_repr_traceback(repr_traceback_data),
+                        deserialize_repr_crash(repr_crash_data),
+                        description,
+                    )
+                )
+            exception_info = ExceptionChainRepr(
+                chain
+            )  # type: Union[ExceptionChainRepr,ReprExceptionInfo]
+        else:
+            exception_info = ReprExceptionInfo(reprtraceback, reprcrash)
+
+        for section in reportdict["longrepr"]["sections"]:
+            exception_info.addsection(*section)
+        reportdict["longrepr"] = exception_info
+
+    return reportdict
diff --git a/contrib/python/pytest/py3/_pytest/resultlog.py b/contrib/python/pytest/py3/_pytest/resultlog.py
new file mode 100644
index 0000000000..3cfa9e0e96
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/resultlog.py
@@ -0,0 +1,102 @@
+""" log machine-parseable test session result information in a plain
+text file.
+"""
+import os
+
+import py
+
+from _pytest.store import StoreKey
+
+
+resultlog_key = StoreKey["ResultLog"]()
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("terminal reporting", "resultlog plugin options")
+    group.addoption(
+        "--resultlog",
+        "--result-log",
+        action="store",
+        metavar="path",
+        default=None,
+        help="DEPRECATED path for machine-readable result log.",
+    )
+
+
+def pytest_configure(config):
+    resultlog = config.option.resultlog
+    # prevent opening resultlog on slave nodes (xdist)
+    if resultlog and not hasattr(config, "slaveinput"):
+        dirname = os.path.dirname(os.path.abspath(resultlog))
+        if not os.path.isdir(dirname):
+            os.makedirs(dirname)
+        logfile = open(resultlog, "w", 1)  # line buffered
+        config._store[resultlog_key] = ResultLog(config, logfile)
+        config.pluginmanager.register(config._store[resultlog_key])
+
+        from _pytest.deprecated import RESULT_LOG
+        from _pytest.warnings import _issue_warning_captured
+
+        _issue_warning_captured(RESULT_LOG, config.hook, stacklevel=2)
+
+
+def pytest_unconfigure(config):
+    resultlog = config._store.get(resultlog_key, None)
+    if resultlog:
+        resultlog.logfile.close()
+        del config._store[resultlog_key]
+        config.pluginmanager.unregister(resultlog)
+
+
+class ResultLog:
+    def __init__(self, config, logfile):
+        self.config = config
+        self.logfile = logfile  # preferably line buffered
+
+    def write_log_entry(self, testpath, lettercode, longrepr):
+        print("{} {}".format(lettercode, testpath), file=self.logfile)
+        for line in longrepr.splitlines():
+            print(" %s" % line, file=self.logfile)
+
+    def log_outcome(self, report, lettercode, longrepr):
+        testpath = getattr(report, "nodeid", None)
+        if testpath is None:
+            testpath = report.fspath
+        self.write_log_entry(testpath, lettercode, longrepr)
+
+    def pytest_runtest_logreport(self, report):
+        if report.when != "call" and report.passed:
+            return
+        res = self.config.hook.pytest_report_teststatus(
+            report=report, config=self.config
+        )
+        code = res[1]
+        if code == "x":
+            longrepr = str(report.longrepr)
+        elif code == "X":
+            longrepr = ""
+        elif report.passed:
+            longrepr = ""
+        elif report.skipped:
+            longrepr = str(report.longrepr[2])
+        else:
+            longrepr = str(report.longrepr)
+        self.log_outcome(report, code, longrepr)
+
+    def pytest_collectreport(self, report):
+        if not report.passed:
+            if report.failed:
+                code = "F"
+                longrepr = str(report.longrepr)
+            else:
+                assert report.skipped
+                code = "S"
+                longrepr = "%s:%d: %s" % report.longrepr
+            self.log_outcome(report, code, longrepr)
+
+    def pytest_internalerror(self, excrepr):
+        reprcrash = getattr(excrepr, "reprcrash", None)
+        path = getattr(reprcrash, "path", None)
+        if path is None:
+            path = "cwd:%s" % py.path.local()
+        self.write_log_entry(path, "!", str(excrepr))
diff --git a/contrib/python/pytest/py3/_pytest/runner.py b/contrib/python/pytest/py3/_pytest/runner.py
new file mode 100644
index 0000000000..412ea44a87
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/runner.py
@@ -0,0 +1,386 @@
+""" basic collect and runtest protocol implementations """
+import bdb
+import os
+import sys
+from time import time
+from typing import Callable
+from typing import Dict
+from typing import List
+from typing import Optional
+from typing import Tuple
+
+import attr
+
+from .reports import CollectErrorRepr
+from .reports import CollectReport
+from .reports import TestReport
+from _pytest._code.code import ExceptionChainRepr
+from _pytest._code.code import ExceptionInfo
+from _pytest.compat import TYPE_CHECKING
+from _pytest.nodes import Collector
+from _pytest.nodes import Node
+from _pytest.outcomes import Exit
+from _pytest.outcomes import Skipped
+from _pytest.outcomes import TEST_OUTCOME
+
+if TYPE_CHECKING:
+    from typing import Type
+    from typing_extensions import Literal
+
+#
+# pytest plugin hooks
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("terminal reporting", "reporting", after="general")
+    group.addoption(
+        "--durations",
+        action="store",
+        type=int,
+        default=None,
+        metavar="N",
+        help="show N slowest setup/test durations (N=0 for all).",
+    )
+
+
+def pytest_terminal_summary(terminalreporter):
+    durations = terminalreporter.config.option.durations
+    verbose = terminalreporter.config.getvalue("verbose")
+    if durations is None:
+        return
+    tr = terminalreporter
+    dlist = []
+    for replist in tr.stats.values():
+        for rep in replist:
+            if hasattr(rep, "duration"):
+                dlist.append(rep)
+    if not dlist:
+        return
+    dlist.sort(key=lambda x: x.duration)
+    dlist.reverse()
+    if not durations:
+        tr.write_sep("=", "slowest test durations")
+    else:
+        tr.write_sep("=", "slowest %s test durations" % durations)
+        dlist = dlist[:durations]
+
+    for rep in dlist:
+        if verbose < 2 and rep.duration < 0.005:
+            tr.write_line("")
+            tr.write_line("(0.00 durations hidden.  Use -vv to show these durations.)")
+            break
+        tr.write_line("{:02.2f}s {:<8} {}".format(rep.duration, rep.when, rep.nodeid))
+
+
+def pytest_sessionstart(session):
+    session._setupstate = SetupState()
+
+
+def pytest_sessionfinish(session):
+    session._setupstate.teardown_all()
+
+
+def pytest_runtest_protocol(item, nextitem):
+    item.ihook.pytest_runtest_logstart(nodeid=item.nodeid, location=item.location)
+    runtestprotocol(item, nextitem=nextitem)
+    item.ihook.pytest_runtest_logfinish(nodeid=item.nodeid, location=item.location)
+    return True
+
+
+def runtestprotocol(item, log=True, nextitem=None):
+    hasrequest = hasattr(item, "_request")
+    if hasrequest and not item._request:
+        item._initrequest()
+    rep = call_and_report(item, "setup", log)
+    reports = [rep]
+    if rep.passed:
+        if item.config.getoption("setupshow", False):
+            show_test_item(item)
+        if not item.config.getoption("setuponly", False):
+            reports.append(call_and_report(item, "call", log))
+    reports.append(call_and_report(item, "teardown", log, nextitem=nextitem))
+    # after all teardown hooks have been called
+    # want funcargs and request info to go away
+    if hasrequest:
+        item._request = False
+        item.funcargs = None
+    return reports
+
+
+def show_test_item(item):
+    """Show test function, parameters and the fixtures of the test item."""
+    tw = item.config.get_terminal_writer()
+    tw.line()
+    tw.write(" " * 8)
+    tw.write(item.nodeid)
+    used_fixtures = sorted(getattr(item, "fixturenames", []))
+    if used_fixtures:
+        tw.write(" (fixtures used: {})".format(", ".join(used_fixtures)))
+
+
+def pytest_runtest_setup(item):
+    _update_current_test_var(item, "setup")
+    item.session._setupstate.prepare(item)
+
+
+def pytest_runtest_call(item):
+    _update_current_test_var(item, "call")
+    try:
+        del sys.last_type
+        del sys.last_value
+        del sys.last_traceback
+    except AttributeError:
+        pass
+    try:
+        item.runtest()
+    except Exception as e:
+        # Store trace info to allow postmortem debugging
+        sys.last_type = type(e)
+        sys.last_value = e
+        assert e.__traceback__ is not None
+        # Skip *this* frame
+        sys.last_traceback = e.__traceback__.tb_next
+        raise e
+
+
+def pytest_runtest_teardown(item, nextitem):
+    _update_current_test_var(item, "teardown")
+    item.session._setupstate.teardown_exact(item, nextitem)
+    _update_current_test_var(item, None)
+
+
+def _update_current_test_var(item, when):
+    """
+    Update PYTEST_CURRENT_TEST to reflect the current item and stage.
+
+    If ``when`` is None, delete PYTEST_CURRENT_TEST from the environment.
+    """
+    var_name = "PYTEST_CURRENT_TEST"
+    if when:
+        value = "{} ({})".format(item.nodeid, when)
+        # don't allow null bytes on environment variables (see #2644, #2957)
+        value = value.replace("\x00", "(null)")
+        os.environ[var_name] = value
+    else:
+        os.environ.pop(var_name)
+
+
+def pytest_report_teststatus(report):
+    if report.when in ("setup", "teardown"):
+        if report.failed:
+            #      category, shortletter, verbose-word
+            return "error", "E", "ERROR"
+        elif report.skipped:
+            return "skipped", "s", "SKIPPED"
+        else:
+            return "", "", ""
+
+
+#
+# Implementation
+
+
+def call_and_report(
+    item, when: "Literal['setup', 'call', 'teardown']", log=True, **kwds
+):
+    call = call_runtest_hook(item, when, **kwds)
+    hook = item.ihook
+    report = hook.pytest_runtest_makereport(item=item, call=call)
+    if log:
+        hook.pytest_runtest_logreport(report=report)
+    if check_interactive_exception(call, report):
+        hook.pytest_exception_interact(node=item, call=call, report=report)
+    return report
+
+
+def check_interactive_exception(call, report):
+    return call.excinfo and not (
+        hasattr(report, "wasxfail")
+        or call.excinfo.errisinstance(Skipped)
+        or call.excinfo.errisinstance(bdb.BdbQuit)
+    )
+
+
+def call_runtest_hook(item, when: "Literal['setup', 'call', 'teardown']", **kwds):
+    if when == "setup":
+        ihook = item.ihook.pytest_runtest_setup
+    elif when == "call":
+        ihook = item.ihook.pytest_runtest_call
+    elif when == "teardown":
+        ihook = item.ihook.pytest_runtest_teardown
+    else:
+        assert False, "Unhandled runtest hook case: {}".format(when)
+    reraise = (Exit,)  # type: Tuple[Type[BaseException], ...]
+    if not item.config.getoption("usepdb", False):
+        reraise += (KeyboardInterrupt,)
+    return CallInfo.from_call(
+        lambda: ihook(item=item, **kwds), when=when, reraise=reraise
+    )
+
+
+@attr.s(repr=False)
+class CallInfo:
+    """ Result/Exception info a function invocation. """
+
+    _result = attr.ib()
+    excinfo = attr.ib(type=Optional[ExceptionInfo])
+    start = attr.ib()
+    stop = attr.ib()
+    when = attr.ib()
+
+    @property
+    def result(self):
+        if self.excinfo is not None:
+            raise AttributeError("{!r} has no valid result".format(self))
+        return self._result
+
+    @classmethod
+    def from_call(cls, func, when, reraise=None) -> "CallInfo":
+        #: context of invocation: one of "setup", "call",
+        #: "teardown", "memocollect"
+        start = time()
+        excinfo = None
+        try:
+            result = func()
+        except:  # noqa
+            excinfo = ExceptionInfo.from_current()
+            if reraise is not None and excinfo.errisinstance(reraise):
+                raise
+            result = None
+        stop = time()
+        return cls(start=start, stop=stop, when=when, result=result, excinfo=excinfo)
+
+    def __repr__(self):
+        if self.excinfo is None:
+            return "<CallInfo when={!r} result: {!r}>".format(self.when, self._result)
+        return "<CallInfo when={!r} excinfo={!r}>".format(self.when, self.excinfo)
+
+
+def pytest_runtest_makereport(item, call):
+    return TestReport.from_item_and_call(item, call)
+
+
+def pytest_make_collect_report(collector: Collector) -> CollectReport:
+    call = CallInfo.from_call(lambda: list(collector.collect()), "collect")
+    longrepr = None
+    if not call.excinfo:
+        outcome = "passed"
+    else:
+        skip_exceptions = [Skipped]
+        unittest = sys.modules.get("unittest")
+        if unittest is not None:
+            # Type ignored because unittest is loaded dynamically.
+            skip_exceptions.append(unittest.SkipTest)  # type: ignore
+        if call.excinfo.errisinstance(tuple(skip_exceptions)):
+            outcome = "skipped"
+            r_ = collector._repr_failure_py(call.excinfo, "line")
+            assert isinstance(r_, ExceptionChainRepr), repr(r_)
+            r = r_.reprcrash
+            assert r
+            longrepr = (str(r.path), r.lineno, r.message)
+        else:
+            outcome = "failed"
+            errorinfo = collector.repr_failure(call.excinfo)
+            if not hasattr(errorinfo, "toterminal"):
+                errorinfo = CollectErrorRepr(errorinfo)
+            longrepr = errorinfo
+    rep = CollectReport(
+        collector.nodeid, outcome, longrepr, getattr(call, "result", None)
+    )
+    rep.call = call  # type: ignore # see collect_one_node
+    return rep
+
+
+class SetupState:
+    """ shared state for setting up/tearing down test items or collectors. """
+
+    def __init__(self):
+        self.stack = []  # type: List[Node]
+        self._finalizers = {}  # type: Dict[Node, List[Callable[[], None]]]
+
+    def addfinalizer(self, finalizer, colitem):
+        """ attach a finalizer to the given colitem. """
+        assert colitem and not isinstance(colitem, tuple)
+        assert callable(finalizer)
+        # assert colitem in self.stack  # some unit tests don't setup stack :/
+        self._finalizers.setdefault(colitem, []).append(finalizer)
+
+    def _pop_and_teardown(self):
+        colitem = self.stack.pop()
+        self._teardown_with_finalization(colitem)
+
+    def _callfinalizers(self, colitem):
+        finalizers = self._finalizers.pop(colitem, None)
+        exc = None
+        while finalizers:
+            fin = finalizers.pop()
+            try:
+                fin()
+            except TEST_OUTCOME as e:
+                # XXX Only first exception will be seen by user,
+                #     ideally all should be reported.
+                if exc is None:
+                    exc = e
+        if exc:
+            raise exc
+
+    def _teardown_with_finalization(self, colitem):
+        self._callfinalizers(colitem)
+        colitem.teardown()
+        for colitem in self._finalizers:
+            assert colitem in self.stack
+
+    def teardown_all(self):
+        while self.stack:
+            self._pop_and_teardown()
+        for key in list(self._finalizers):
+            self._teardown_with_finalization(key)
+        assert not self._finalizers
+
+    def teardown_exact(self, item, nextitem):
+        needed_collectors = nextitem and nextitem.listchain() or []
+        self._teardown_towards(needed_collectors)
+
+    def _teardown_towards(self, needed_collectors):
+        exc = None
+        while self.stack:
+            if self.stack == needed_collectors[: len(self.stack)]:
+                break
+            try:
+                self._pop_and_teardown()
+            except TEST_OUTCOME as e:
+                # XXX Only first exception will be seen by user,
+                #     ideally all should be reported.
+                if exc is None:
+                    exc = e
+        if exc:
+            raise exc
+
+    def prepare(self, colitem):
+        """ setup objects along the collector chain to the test-method
+            and teardown previously setup objects."""
+        needed_collectors = colitem.listchain()
+        self._teardown_towards(needed_collectors)
+
+        # check if the last collection node has raised an error
+        for col in self.stack:
+            if hasattr(col, "_prepare_exc"):
+                exc = col._prepare_exc
+                raise exc
+        for col in needed_collectors[len(self.stack) :]:
+            self.stack.append(col)
+            try:
+                col.setup()
+            except TEST_OUTCOME as e:
+                col._prepare_exc = e
+                raise e
+
+
+def collect_one_node(collector):
+    ihook = collector.ihook
+    ihook.pytest_collectstart(collector=collector)
+    rep = ihook.pytest_make_collect_report(collector=collector)
+    call = rep.__dict__.pop("call", None)
+    if call and check_interactive_exception(call, rep):
+        ihook.pytest_exception_interact(node=collector, call=call, report=rep)
+    return rep
diff --git a/contrib/python/pytest/py3/_pytest/setuponly.py b/contrib/python/pytest/py3/_pytest/setuponly.py
new file mode 100644
index 0000000000..aa5a95ff92
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/setuponly.py
@@ -0,0 +1,78 @@
+import pytest
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("debugconfig")
+    group.addoption(
+        "--setuponly",
+        "--setup-only",
+        action="store_true",
+        help="only setup fixtures, do not execute tests.",
+    )
+    group.addoption(
+        "--setupshow",
+        "--setup-show",
+        action="store_true",
+        help="show setup of fixtures while executing tests.",
+    )
+
+
+@pytest.hookimpl(hookwrapper=True)
+def pytest_fixture_setup(fixturedef, request):
+    yield
+    if request.config.option.setupshow:
+        if hasattr(request, "param"):
+            # Save the fixture parameter so ._show_fixture_action() can
+            # display it now and during the teardown (in .finish()).
+            if fixturedef.ids:
+                if callable(fixturedef.ids):
+                    fixturedef.cached_param = fixturedef.ids(request.param)
+                else:
+                    fixturedef.cached_param = fixturedef.ids[request.param_index]
+            else:
+                fixturedef.cached_param = request.param
+        _show_fixture_action(fixturedef, "SETUP")
+
+
+def pytest_fixture_post_finalizer(fixturedef) -> None:
+    if fixturedef.cached_result is not None:
+        config = fixturedef._fixturemanager.config
+        if config.option.setupshow:
+            _show_fixture_action(fixturedef, "TEARDOWN")
+            if hasattr(fixturedef, "cached_param"):
+                del fixturedef.cached_param
+
+
+def _show_fixture_action(fixturedef, msg):
+    config = fixturedef._fixturemanager.config
+    capman = config.pluginmanager.getplugin("capturemanager")
+    if capman:
+        capman.suspend_global_capture()
+
+    tw = config.get_terminal_writer()
+    tw.line()
+    tw.write(" " * 2 * fixturedef.scopenum)
+    tw.write(
+        "{step} {scope} {fixture}".format(
+            step=msg.ljust(8),  # align the output to TEARDOWN
+            scope=fixturedef.scope[0].upper(),
+            fixture=fixturedef.argname,
+        )
+    )
+
+    if msg == "SETUP":
+        deps = sorted(arg for arg in fixturedef.argnames if arg != "request")
+        if deps:
+            tw.write(" (fixtures used: {})".format(", ".join(deps)))
+
+    if hasattr(fixturedef, "cached_param"):
+        tw.write("[{}]".format(fixturedef.cached_param))
+
+    if capman:
+        capman.resume_global_capture()
+
+
+@pytest.hookimpl(tryfirst=True)
+def pytest_cmdline_main(config):
+    if config.option.setuponly:
+        config.option.setupshow = True
diff --git a/contrib/python/pytest/py3/_pytest/setupplan.py b/contrib/python/pytest/py3/_pytest/setupplan.py
new file mode 100644
index 0000000000..6fdd3aed06
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/setupplan.py
@@ -0,0 +1,28 @@
+import pytest
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("debugconfig")
+    group.addoption(
+        "--setupplan",
+        "--setup-plan",
+        action="store_true",
+        help="show what fixtures and tests would be executed but "
+        "don't execute anything.",
+    )
+
+
+@pytest.hookimpl(tryfirst=True)
+def pytest_fixture_setup(fixturedef, request):
+    # Will return a dummy fixture if the setuponly option is provided.
+    if request.config.option.setupplan:
+        my_cache_key = fixturedef.cache_key(request)
+        fixturedef.cached_result = (None, my_cache_key, None)
+        return fixturedef.cached_result
+
+
+@pytest.hookimpl(tryfirst=True)
+def pytest_cmdline_main(config):
+    if config.option.setupplan:
+        config.option.setuponly = True
+        config.option.setupshow = True
diff --git a/contrib/python/pytest/py3/_pytest/skipping.py b/contrib/python/pytest/py3/_pytest/skipping.py
new file mode 100644
index 0000000000..fe8742c667
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/skipping.py
@@ -0,0 +1,183 @@
+""" support for skip/xfail functions and markers. """
+from _pytest.config import hookimpl
+from _pytest.mark.evaluate import MarkEvaluator
+from _pytest.outcomes import fail
+from _pytest.outcomes import skip
+from _pytest.outcomes import xfail
+from _pytest.store import StoreKey
+
+
+skipped_by_mark_key = StoreKey[bool]()
+evalxfail_key = StoreKey[MarkEvaluator]()
+unexpectedsuccess_key = StoreKey[str]()
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("general")
+    group.addoption(
+        "--runxfail",
+        action="store_true",
+        dest="runxfail",
+        default=False,
+        help="report the results of xfail tests as if they were not marked",
+    )
+
+    parser.addini(
+        "xfail_strict",
+        "default for the strict parameter of xfail "
+        "markers when not given explicitly (default: False)",
+        default=False,
+        type="bool",
+    )
+
+
+def pytest_configure(config):
+    if config.option.runxfail:
+        # yay a hack
+        import pytest
+
+        old = pytest.xfail
+        config._cleanup.append(lambda: setattr(pytest, "xfail", old))
+
+        def nop(*args, **kwargs):
+            pass
+
+        nop.Exception = xfail.Exception
+        setattr(pytest, "xfail", nop)
+
+    config.addinivalue_line(
+        "markers",
+        "skip(reason=None): skip the given test function with an optional reason. "
+        'Example: skip(reason="no way of currently testing this") skips the '
+        "test.",
+    )
+    config.addinivalue_line(
+        "markers",
+        "skipif(condition): skip the given test function if eval(condition) "
+        "results in a True value.  Evaluation happens within the "
+        "module global context. Example: skipif('sys.platform == \"win32\"') "
+        "skips the test if we are on the win32 platform. see "
+        "https://docs.pytest.org/en/latest/skipping.html",
+    )
+    config.addinivalue_line(
+        "markers",
+        "xfail(condition, reason=None, run=True, raises=None, strict=False): "
+        "mark the test function as an expected failure if eval(condition) "
+        "has a True value. Optionally specify a reason for better reporting "
+        "and run=False if you don't even want to execute the test function. "
+        "If only specific exception(s) are expected, you can list them in "
+        "raises, and if the test fails in other ways, it will be reported as "
+        "a true failure. See https://docs.pytest.org/en/latest/skipping.html",
+    )
+
+
+@hookimpl(tryfirst=True)
+def pytest_runtest_setup(item):
+    # Check if skip or skipif are specified as pytest marks
+    item._store[skipped_by_mark_key] = False
+    eval_skipif = MarkEvaluator(item, "skipif")
+    if eval_skipif.istrue():
+        item._store[skipped_by_mark_key] = True
+        skip(eval_skipif.getexplanation())
+
+    for skip_info in item.iter_markers(name="skip"):
+        item._store[skipped_by_mark_key] = True
+        if "reason" in skip_info.kwargs:
+            skip(skip_info.kwargs["reason"])
+        elif skip_info.args:
+            skip(skip_info.args[0])
+        else:
+            skip("unconditional skip")
+
+    item._store[evalxfail_key] = MarkEvaluator(item, "xfail")
+    check_xfail_no_run(item)
+
+
+@hookimpl(hookwrapper=True)
+def pytest_pyfunc_call(pyfuncitem):
+    check_xfail_no_run(pyfuncitem)
+    outcome = yield
+    passed = outcome.excinfo is None
+    if passed:
+        check_strict_xfail(pyfuncitem)
+
+
+def check_xfail_no_run(item):
+    """check xfail(run=False)"""
+    if not item.config.option.runxfail:
+        evalxfail = item._store[evalxfail_key]
+        if evalxfail.istrue():
+            if not evalxfail.get("run", True):
+                xfail("[NOTRUN] " + evalxfail.getexplanation())
+
+
+def check_strict_xfail(pyfuncitem):
+    """check xfail(strict=True) for the given PASSING test"""
+    evalxfail = pyfuncitem._store[evalxfail_key]
+    if evalxfail.istrue():
+        strict_default = pyfuncitem.config.getini("xfail_strict")
+        is_strict_xfail = evalxfail.get("strict", strict_default)
+        if is_strict_xfail:
+            del pyfuncitem._store[evalxfail_key]
+            explanation = evalxfail.getexplanation()
+            fail("[XPASS(strict)] " + explanation, pytrace=False)
+
+
+@hookimpl(hookwrapper=True)
+def pytest_runtest_makereport(item, call):
+    outcome = yield
+    rep = outcome.get_result()
+    evalxfail = item._store.get(evalxfail_key, None)
+    # unittest special case, see setting of unexpectedsuccess_key
+    if unexpectedsuccess_key in item._store and rep.when == "call":
+        reason = item._store[unexpectedsuccess_key]
+        if reason:
+            rep.longrepr = "Unexpected success: {}".format(reason)
+        else:
+            rep.longrepr = "Unexpected success"
+        rep.outcome = "failed"
+
+    elif item.config.option.runxfail:
+        pass  # don't interfere
+    elif call.excinfo and call.excinfo.errisinstance(xfail.Exception):
+        rep.wasxfail = "reason: " + call.excinfo.value.msg
+        rep.outcome = "skipped"
+    elif evalxfail and not rep.skipped and evalxfail.wasvalid() and evalxfail.istrue():
+        if call.excinfo:
+            if evalxfail.invalidraise(call.excinfo.value):
+                rep.outcome = "failed"
+            else:
+                rep.outcome = "skipped"
+                rep.wasxfail = evalxfail.getexplanation()
+        elif call.when == "call":
+            strict_default = item.config.getini("xfail_strict")
+            is_strict_xfail = evalxfail.get("strict", strict_default)
+            explanation = evalxfail.getexplanation()
+            if is_strict_xfail:
+                rep.outcome = "failed"
+                rep.longrepr = "[XPASS(strict)] {}".format(explanation)
+            else:
+                rep.outcome = "passed"
+                rep.wasxfail = explanation
+    elif (
+        item._store.get(skipped_by_mark_key, True)
+        and rep.skipped
+        and type(rep.longrepr) is tuple
+    ):
+        # skipped by mark.skipif; change the location of the failure
+        # to point to the item definition, otherwise it will display
+        # the location of where the skip exception was raised within pytest
+        _, _, reason = rep.longrepr
+        filename, line = item.location[:2]
+        rep.longrepr = filename, line + 1, reason
+
+
+# called by terminalreporter progress reporting
+
+
+def pytest_report_teststatus(report):
+    if hasattr(report, "wasxfail"):
+        if report.skipped:
+            return "xfailed", "x", "XFAIL"
+        elif report.passed:
+            return "xpassed", "X", "XPASS"
diff --git a/contrib/python/pytest/py3/_pytest/stepwise.py b/contrib/python/pytest/py3/_pytest/stepwise.py
new file mode 100644
index 0000000000..6fa21cd1c6
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/stepwise.py
@@ -0,0 +1,108 @@
+import pytest
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("general")
+    group.addoption(
+        "--sw",
+        "--stepwise",
+        action="store_true",
+        dest="stepwise",
+        help="exit on test failure and continue from last failing test next time",
+    )
+    group.addoption(
+        "--stepwise-skip",
+        action="store_true",
+        dest="stepwise_skip",
+        help="ignore the first failing test but stop on the next failing test",
+    )
+
+
+@pytest.hookimpl
+def pytest_configure(config):
+    config.pluginmanager.register(StepwisePlugin(config), "stepwiseplugin")
+
+
+class StepwisePlugin:
+    def __init__(self, config):
+        self.config = config
+        self.active = config.getvalue("stepwise")
+        self.session = None
+        self.report_status = ""
+
+        if self.active:
+            self.lastfailed = config.cache.get("cache/stepwise", None)
+            self.skip = config.getvalue("stepwise_skip")
+
+    def pytest_sessionstart(self, session):
+        self.session = session
+
+    def pytest_collection_modifyitems(self, session, config, items):
+        if not self.active:
+            return
+        if not self.lastfailed:
+            self.report_status = "no previously failed tests, not skipping."
+            return
+
+        already_passed = []
+        found = False
+
+        # Make a list of all tests that have been run before the last failing one.
+        for item in items:
+            if item.nodeid == self.lastfailed:
+                found = True
+                break
+            else:
+                already_passed.append(item)
+
+        # If the previously failed test was not found among the test items,
+        # do not skip any tests.
+        if not found:
+            self.report_status = "previously failed test not found, not skipping."
+            already_passed = []
+        else:
+            self.report_status = "skipping {} already passed items.".format(
+                len(already_passed)
+            )
+
+        for item in already_passed:
+            items.remove(item)
+
+        config.hook.pytest_deselected(items=already_passed)
+
+    def pytest_runtest_logreport(self, report):
+        if not self.active:
+            return
+
+        if report.failed:
+            if self.skip:
+                # Remove test from the failed ones (if it exists) and unset the skip option
+                # to make sure the following tests will not be skipped.
+                if report.nodeid == self.lastfailed:
+                    self.lastfailed = None
+
+                self.skip = False
+            else:
+                # Mark test as the last failing and interrupt the test session.
+                self.lastfailed = report.nodeid
+                self.session.shouldstop = (
+                    "Test failed, continuing from this test next run."
+                )
+
+        else:
+            # If the test was actually run and did pass.
+            if report.when == "call":
+                # Remove test from the failed ones, if exists.
+                if report.nodeid == self.lastfailed:
+                    self.lastfailed = None
+
+    def pytest_report_collectionfinish(self):
+        if self.active and self.config.getoption("verbose") >= 0 and self.report_status:
+            return "stepwise: %s" % self.report_status
+
+    def pytest_sessionfinish(self, session):
+        if self.active:
+            self.config.cache.set("cache/stepwise", self.lastfailed)
+        else:
+            # Clear the list of failing tests if the plugin is not active.
+            self.config.cache.set("cache/stepwise", [])
diff --git a/contrib/python/pytest/py3/_pytest/store.py b/contrib/python/pytest/py3/_pytest/store.py
new file mode 100644
index 0000000000..eed50d103a
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/store.py
@@ -0,0 +1,125 @@
+from typing import Any
+from typing import cast
+from typing import Dict
+from typing import Generic
+from typing import TypeVar
+from typing import Union
+
+
+__all__ = ["Store", "StoreKey"]
+
+
+T = TypeVar("T")
+D = TypeVar("D")
+
+
+class StoreKey(Generic[T]):
+    """StoreKey is an object used as a key to a Store.
+
+    A StoreKey is associated with the type T of the value of the key.
+
+    A StoreKey is unique and cannot conflict with another key.
+    """
+
+    __slots__ = ()
+
+
+class Store:
+    """Store is a type-safe heterogenous mutable mapping that
+    allows keys and value types to be defined separately from
+    where it is defined.
+
+    Usually you will be given an object which has a ``Store``:
+
+    .. code-block:: python
+
+        store: Store = some_object.store
+
+    If a module wants to store data in this Store, it creates StoreKeys
+    for its keys (at the module level):
+
+    .. code-block:: python
+
+        some_str_key = StoreKey[str]()
+        some_bool_key = StoreKey[bool]()
+
+    To store information:
+
+    .. code-block:: python
+
+        # Value type must match the key.
+        store[some_str_key] = "value"
+        store[some_bool_key] = True
+
+    To retrieve the information:
+
+    .. code-block:: python
+
+        # The static type of some_str is str.
+        some_str = store[some_str_key]
+        # The static type of some_bool is bool.
+        some_bool = store[some_bool_key]
+
+    Why use this?
+    -------------
+
+    Problem: module Internal defines an object. Module External, which
+    module Internal doesn't know about, receives the object and wants to
+    attach information to it, to be retrieved later given the object.
+
+    Bad solution 1: Module External assigns private attributes directly on
+    the object. This doesn't work well because the type checker doesn't
+    know about these attributes and it complains about undefined attributes.
+
+    Bad solution 2: module Internal adds a ``Dict[str, Any]`` attribute to
+    the object. Module External stores its data in private keys of this dict.
+    This doesn't work well because retrieved values are untyped.
+
+    Good solution: module Internal adds a ``Store`` to the object. Module
+    External mints StoreKeys for its own keys. Module External stores and
+    retrieves its data using its keys.
+    """
+
+    __slots__ = ("_store",)
+
+    def __init__(self) -> None:
+        self._store = {}  # type: Dict[StoreKey[Any], object]
+
+    def __setitem__(self, key: StoreKey[T], value: T) -> None:
+        """Set a value for key."""
+        self._store[key] = value
+
+    def __getitem__(self, key: StoreKey[T]) -> T:
+        """Get the value for key.
+
+        Raises KeyError if the key wasn't set before.
+        """
+        return cast(T, self._store[key])
+
+    def get(self, key: StoreKey[T], default: D) -> Union[T, D]:
+        """Get the value for key, or return default if the key wasn't set
+        before."""
+        try:
+            return self[key]
+        except KeyError:
+            return default
+
+    def setdefault(self, key: StoreKey[T], default: T) -> T:
+        """Return the value of key if already set, otherwise set the value
+        of key to default and return default."""
+        try:
+            return self[key]
+        except KeyError:
+            self[key] = default
+            return default
+
+    def __delitem__(self, key: StoreKey[T]) -> None:
+        """Delete the value for key.
+
+        Raises KeyError if the key wasn't set before.
+        """
+        del self._store[key]
+
+    def __contains__(self, key: StoreKey[T]) -> bool:
+        """Returns whether key was set."""
+        return key in self._store
diff --git a/contrib/python/pytest/py3/_pytest/terminal.py b/contrib/python/pytest/py3/_pytest/terminal.py
new file mode 100644
index 0000000000..812afd258b
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/terminal.py
@@ -0,0 +1,1221 @@
+""" terminal reporting of the full testing process.
+
+This is a good source for looking at the various reporting hooks.
+"""
+import argparse
+import collections
+import datetime
+import platform
+import sys
+import time
+import warnings
+from functools import partial
+from typing import Any
+from typing import Callable
+from typing import Dict
+from typing import List
+from typing import Mapping
+from typing import Optional
+from typing import Set
+from typing import Tuple
+
+import attr
+import pluggy
+import py
+from more_itertools import collapse
+
+import pytest
+from _pytest import nodes
+from _pytest._io import TerminalWriter
+from _pytest.config import Config
+from _pytest.config import ExitCode
+from _pytest.deprecated import TERMINALWRITER_WRITER
+from _pytest.main import Session
+from _pytest.reports import CollectReport
+from _pytest.reports import TestReport
+
+REPORT_COLLECTING_RESOLUTION = 0.5
+
+KNOWN_TYPES = (
+    "failed",
+    "passed",
+    "skipped",
+    "deselected",
+    "xfailed",
+    "xpassed",
+    "warnings",
+    "error",
+)
+
+_REPORTCHARS_DEFAULT = "fE"
+
+
+class MoreQuietAction(argparse.Action):
+    """
+    a modified copy of the argparse count action which counts down and updates
+    the legacy quiet attribute at the same time
+
+    used to unify verbosity handling
+    """
+
+    def __init__(self, option_strings, dest, default=None, required=False, help=None):
+        super().__init__(
+            option_strings=option_strings,
+            dest=dest,
+            nargs=0,
+            default=default,
+            required=required,
+            help=help,
+        )
+
+    def __call__(self, parser, namespace, values, option_string=None):
+        new_count = getattr(namespace, self.dest, 0) - 1
+        setattr(namespace, self.dest, new_count)
+        # todo Deprecate config.quiet
+        namespace.quiet = getattr(namespace, "quiet", 0) + 1
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("terminal reporting", "reporting", after="general")
+    group._addoption(
+        "-v",
+        "--verbose",
+        action="count",
+        default=0,
+        dest="verbose",
+        help="increase verbosity.",
+    )
+    group._addoption(
+        "-q",
+        "--quiet",
+        action=MoreQuietAction,
+        default=0,
+        dest="verbose",
+        help="decrease verbosity.",
+    )
+    group._addoption(
+        "--verbosity",
+        dest="verbose",
+        type=int,
+        default=0,
+        help="set verbosity. Default is 0.",
+    )
+    group._addoption(
+        "-r",
+        action="store",
+        dest="reportchars",
+        default=_REPORTCHARS_DEFAULT,
+        metavar="chars",
+        help="show extra test summary info as specified by chars: (f)ailed, "
+        "(E)rror, (s)kipped, (x)failed, (X)passed, "
+        "(p)assed, (P)assed with output, (a)ll except passed (p/P), or (A)ll. "
+        "(w)arnings are enabled by default (see --disable-warnings), "
+        "'N' can be used to reset the list. (default: 'fE').",
+    )
+    group._addoption(
+        "--disable-warnings",
+        "--disable-pytest-warnings",
+        default=False,
+        dest="disable_warnings",
+        action="store_true",
+        help="disable warnings summary",
+    )
+    group._addoption(
+        "-l",
+        "--showlocals",
+        action="store_true",
+        dest="showlocals",
+        default=False,
+        help="show locals in tracebacks (disabled by default).",
+    )
+    group._addoption(
+        "--tb",
+        metavar="style",
+        action="store",
+        dest="tbstyle",
+        default="auto",
+        choices=["auto", "long", "short", "no", "line", "native"],
+        help="traceback print mode (auto/long/short/line/native/no).",
+    )
+    group._addoption(
+        "--show-capture",
+        action="store",
+        dest="showcapture",
+        choices=["no", "stdout", "stderr", "log", "all"],
+        default="all",
+        help="Controls how captured stdout/stderr/log is shown on failed tests. "
+        "Default is 'all'.",
+    )
+    group._addoption(
+        "--fulltrace",
+        "--full-trace",
+        action="store_true",
+        default=False,
+        help="don't cut any tracebacks (default is to cut).",
+    )
+    group._addoption(
+        "--color",
+        metavar="color",
+        action="store",
+        dest="color",
+        default="auto",
+        choices=["yes", "no", "auto"],
+        help="color terminal output (yes/no/auto).",
+    )
+
+    parser.addini(
+        "console_output_style",
+        help='console output: "classic", or with additional progress information ("progress" (percentage) | "count").',
+        default="progress",
+    )
+
+
+def pytest_configure(config: Config) -> None:
+    reporter = TerminalReporter(config, sys.stdout)
+    config.pluginmanager.register(reporter, "terminalreporter")
+    if config.option.debug or config.option.traceconfig:
+
+        def mywriter(tags, args):
+            msg = " ".join(map(str, args))
+            reporter.write_line("[traceconfig] " + msg)
+
+        config.trace.root.setprocessor("pytest:config", mywriter)
+
+
+def getreportopt(config: Config) -> str:
+    reportchars = config.option.reportchars
+
+    old_aliases = {"F", "S"}
+    reportopts = ""
+    for char in reportchars:
+        if char in old_aliases:
+            char = char.lower()
+        if char == "a":
+            reportopts = "sxXEf"
+        elif char == "A":
+            reportopts = "PpsxXEf"
+        elif char == "N":
+            reportopts = ""
+        elif char not in reportopts:
+            reportopts += char
+
+    if not config.option.disable_warnings and "w" not in reportopts:
+        reportopts = "w" + reportopts
+    elif config.option.disable_warnings and "w" in reportopts:
+        reportopts = reportopts.replace("w", "")
+
+    return reportopts
+
+
+@pytest.hookimpl(trylast=True)  # after _pytest.runner
+def pytest_report_teststatus(report: TestReport) -> Tuple[str, str, str]:
+    letter = "F"
+    if report.passed:
+        letter = "."
+    elif report.skipped:
+        letter = "s"
+
+    outcome = report.outcome
+    if report.when in ("collect", "setup", "teardown") and outcome == "failed":
+        outcome = "error"
+        letter = "E"
+
+    return outcome, letter, outcome.upper()
+
+
+@attr.s
+class WarningReport:
+    """
+    Simple structure to hold warnings information captured by ``pytest_warning_captured``.
+
+    :ivar str message: user friendly message about the warning
+    :ivar str|None nodeid: node id that generated the warning (see ``get_location``).
+    :ivar tuple|py.path.local fslocation:
+        file system location of the source of the warning (see ``get_location``).
+    """
+
+    message = attr.ib(type=str)
+    nodeid = attr.ib(type=Optional[str], default=None)
+    fslocation = attr.ib(default=None)
+    count_towards_summary = True
+
+    def get_location(self, config):
+        """
+        Returns the more user-friendly information about the location
+        of a warning, or None.
+        """
+        if self.nodeid:
+            return self.nodeid
+        if self.fslocation:
+            if isinstance(self.fslocation, tuple) and len(self.fslocation) >= 2:
+                filename, linenum = self.fslocation[:2]
+                relpath = py.path.local(filename).relto(config.invocation_dir)
+                if not relpath:
+                    relpath = str(filename)
+                return "{}:{}".format(relpath, linenum)
+            else:
+                return str(self.fslocation)
+        return None
+
+
+class TerminalReporter:
+    def __init__(self, config: Config, file=None) -> None:
+        import _pytest.config
+
+        self.config = config
+        self._numcollected = 0
+        self._session = None  # type: Optional[Session]
+        self._showfspath = None
+
+        self.stats = {}  # type: Dict[str, List[Any]]
+        self._main_color = None  # type: Optional[str]
+        self._known_types = None  # type: Optional[List]
+        self.startdir = config.invocation_dir
+        if file is None:
+            file = sys.stdout
+        self._tw = _pytest.config.create_terminal_writer(config, file)
+        self._screen_width = self._tw.fullwidth
+        self.currentfspath = None  # type: Any
+        self.reportchars = getreportopt(config)
+        self.hasmarkup = self._tw.hasmarkup
+        self.isatty = file.isatty()
+        self._progress_nodeids_reported = set()  # type: Set[str]
+        self._show_progress_info = self._determine_show_progress_info()
+        self._collect_report_last_write = None  # type: Optional[float]
+
+    @property
+    def writer(self) -> TerminalWriter:
+        warnings.warn(TERMINALWRITER_WRITER, stacklevel=2)
+        return self._tw
+
+    @writer.setter
+    def writer(self, value: TerminalWriter):
+        warnings.warn(TERMINALWRITER_WRITER, stacklevel=2)
+        self._tw = value
+
+    def _determine_show_progress_info(self):
+        """Return True if we should display progress information based on the current config"""
+        # do not show progress if we are not capturing output (#3038)
+        if self.config.getoption("capture", "no") == "no":
+            return False
+        # do not show progress if we are showing fixture setup/teardown
+        if self.config.getoption("setupshow", False):
+            return False
+        cfg = self.config.getini("console_output_style")
+        if cfg in ("progress", "count"):
+            return cfg
+        return False
+
+    @property
+    def verbosity(self):
+        return self.config.option.verbose
+
+    @property
+    def showheader(self):
+        return self.verbosity >= 0
+
+    @property
+    def showfspath(self):
+        if self._showfspath is None:
+            return self.verbosity >= 0
+        return self._showfspath
+
+    @showfspath.setter
+    def showfspath(self, value):
+        self._showfspath = value
+
+    @property
+    def showlongtestinfo(self):
+        return self.verbosity > 0
+
+    def hasopt(self, char):
+        char = {"xfailed": "x", "skipped": "s"}.get(char, char)
+        return char in self.reportchars
+
+    def write_fspath_result(self, nodeid, res, **markup):
+        fspath = self.config.rootdir.join(nodeid.split("::")[0])
+        # NOTE: explicitly check for None to work around py bug, and for less
+        # overhead in general (https://github.com/pytest-dev/py/pull/207).
+        if self.currentfspath is None or fspath != self.currentfspath:
+            if self.currentfspath is not None and self._show_progress_info:
+                self._write_progress_information_filling_space()
+            self.currentfspath = fspath
+            fspath = self.startdir.bestrelpath(fspath)
+            self._tw.line()
+            self._tw.write(fspath + " ")
+        self._tw.write(res, **markup)
+
+    def write_ensure_prefix(self, prefix, extra="", **kwargs):
+        if self.currentfspath != prefix:
+            self._tw.line()
+            self.currentfspath = prefix
+            self._tw.write(prefix)
+        if extra:
+            self._tw.write(extra, **kwargs)
+            self.currentfspath = -2
+
+    def ensure_newline(self):
+        if self.currentfspath:
+            self._tw.line()
+            self.currentfspath = None
+
+    def write(self, content, **markup):
+        self._tw.write(content, **markup)
+
+    def write_line(self, line, **markup):
+        if not isinstance(line, str):
+            line = str(line, errors="replace")
+        self.ensure_newline()
+        self._tw.line(line, **markup)
+
+    def rewrite(self, line, **markup):
+        """
+        Rewinds the terminal cursor to the beginning and writes the given line.
+
+        :kwarg erase: if True, will also add spaces until the full terminal width to ensure
+            previous lines are properly erased.
+
+        The rest of the keyword arguments are markup instructions.
+        """
+        erase = markup.pop("erase", False)
+        if erase:
+            fill_count = self._tw.fullwidth - len(line) - 1
+            fill = " " * fill_count
+        else:
+            fill = ""
+        line = str(line)
+        self._tw.write("\r" + line + fill, **markup)
+
+    def write_sep(self, sep, title=None, **markup):
+        self.ensure_newline()
+        self._tw.sep(sep, title, **markup)
+
+    def section(self, title, sep="=", **kw):
+        self._tw.sep(sep, title, **kw)
+
+    def line(self, msg, **kw):
+        self._tw.line(msg, **kw)
+
+    def _add_stats(self, category: str, items: List) -> None:
+        set_main_color = category not in self.stats
+        self.stats.setdefault(category, []).extend(items[:])
+        if set_main_color:
+            self._set_main_color()
+
+    def pytest_internalerror(self, excrepr):
+        for line in str(excrepr).split("\n"):
+            self.write_line("INTERNALERROR> " + line)
+        return 1
+
+    def pytest_warning_captured(self, warning_message, item):
+        # from _pytest.nodes import get_fslocation_from_item
+        from _pytest.warnings import warning_record_to_str
+
+        fslocation = warning_message.filename, warning_message.lineno
+        message = warning_record_to_str(warning_message)
+
+        nodeid = item.nodeid if item is not None else ""
+        warning_report = WarningReport(
+            fslocation=fslocation, message=message, nodeid=nodeid
+        )
+        self._add_stats("warnings", [warning_report])
+
+    def pytest_plugin_registered(self, plugin):
+        if self.config.option.traceconfig:
+            msg = "PLUGIN registered: {}".format(plugin)
+            # XXX this event may happen during setup/teardown time
+            #     which unfortunately captures our output here
+            #     which garbles our output if we use self.write_line
+            self.write_line(msg)
+
+    def pytest_deselected(self, items):
+        self._add_stats("deselected", items)
+
+    def pytest_runtest_logstart(self, nodeid, location):
+        # ensure that the path is printed before the
+        # 1st test of a module starts running
+        if self.showlongtestinfo:
+            line = self._locationline(nodeid, *location)
+            self.write_ensure_prefix(line, "")
+        elif self.showfspath:
+            fsid = nodeid.split("::")[0]
+            self.write_fspath_result(fsid, "")
+
+    def pytest_runtest_logreport(self, report: TestReport) -> None:
+        self._tests_ran = True
+        rep = report
+        res = self.config.hook.pytest_report_teststatus(report=rep, config=self.config)
+        category, letter, word = res
+        if isinstance(word, tuple):
+            word, markup = word
+        else:
+            markup = None
+        self._add_stats(category, [rep])
+        if not letter and not word:
+            # probably passed setup/teardown
+            return
+        running_xdist = hasattr(rep, "node")
+        if markup is None:
+            was_xfail = hasattr(report, "wasxfail")
+            if rep.passed and not was_xfail:
+                markup = {"green": True}
+            elif rep.passed and was_xfail:
+                markup = {"yellow": True}
+            elif rep.failed:
+                markup = {"red": True}
+            elif rep.skipped:
+                markup = {"yellow": True}
+            else:
+                markup = {}
+        if self.verbosity <= 0:
+            if not running_xdist and self.showfspath:
+                self.write_fspath_result(rep.nodeid, letter, **markup)
+            else:
+                self._tw.write(letter, **markup)
+        else:
+            self._progress_nodeids_reported.add(rep.nodeid)
+            line = self._locationline(rep.nodeid, *rep.location)
+            if not running_xdist:
+                self.write_ensure_prefix(line, word, **markup)
+                if self._show_progress_info:
+                    self._write_progress_information_filling_space()
+            else:
+                self.ensure_newline()
+                self._tw.write("[%s]" % rep.node.gateway.id)  # type: ignore
+                if self._show_progress_info:
+                    self._tw.write(
+                        self._get_progress_information_message() + " ", cyan=True
+                    )
+                else:
+                    self._tw.write(" ")
+                self._tw.write(word, **markup)
+                self._tw.write(" " + line)
+                self.currentfspath = -2
+
+    @property
+    def _is_last_item(self):
+        return len(self._progress_nodeids_reported) == self._session.testscollected
+
+    def pytest_runtest_logfinish(self, nodeid):
+        assert self._session
+        if self.verbosity <= 0 and self._show_progress_info:
+            if self._show_progress_info == "count":
+                num_tests = self._session.testscollected
+                progress_length = len(" [{}/{}]".format(str(num_tests), str(num_tests)))
+            else:
+                progress_length = len(" [100%]")
+
+            self._progress_nodeids_reported.add(nodeid)
+
+            if self._is_last_item:
+                self._write_progress_information_filling_space()
+            else:
+                main_color, _ = self._get_main_color()
+                w = self._width_of_current_line
+                past_edge = w + progress_length + 1 >= self._screen_width
+                if past_edge:
+                    msg = self._get_progress_information_message()
+                    self._tw.write(msg + "\n", **{main_color: True})
+
+    def _get_progress_information_message(self) -> str:
+        assert self._session
+        collected = self._session.testscollected
+        if self._show_progress_info == "count":
+            if collected:
+                progress = self._progress_nodeids_reported
+                counter_format = "{{:{}d}}".format(len(str(collected)))
+                format_string = " [{}/{{}}]".format(counter_format)
+                return format_string.format(len(progress), collected)
+            return " [ {} / {} ]".format(collected, collected)
+        else:
+            if collected:
+                return " [{:3d}%]".format(
+                    len(self._progress_nodeids_reported) * 100 // collected
+                )
+            return " [100%]"
+
+    def _write_progress_information_filling_space(self):
+        color, _ = self._get_main_color()
+        msg = self._get_progress_information_message()
+        w = self._width_of_current_line
+        fill = self._tw.fullwidth - w - 1
+        self.write(msg.rjust(fill), **{color: True})
+
+    @property
+    def _width_of_current_line(self):
+        """Return the width of current line, using the superior implementation of py-1.6 when available"""
+        try:
+            return self._tw.width_of_current_line
+        except AttributeError:
+            # py < 1.6.0
+            return self._tw.chars_on_current_line
+
+    def pytest_collection(self) -> None:
+        if self.isatty:
+            if self.config.option.verbose >= 0:
+                self.write("collecting ... ", bold=True)
+                self._collect_report_last_write = time.time()
+        elif self.config.option.verbose >= 1:
+            self.write("collecting ... ", bold=True)
+
+    def pytest_collectreport(self, report: CollectReport) -> None:
+        if report.failed:
+            self._add_stats("error", [report])
+        elif report.skipped:
+            self._add_stats("skipped", [report])
+        items = [x for x in report.result if isinstance(x, pytest.Item)]
+        self._numcollected += len(items)
+        if self.isatty:
+            self.report_collect()
+
+    def report_collect(self, final=False):
+        if self.config.option.verbose < 0:
+            return
+
+        if not final:
+            # Only write "collecting" report every 0.5s.
+            t = time.time()
+            if (
+                self._collect_report_last_write is not None
+                and self._collect_report_last_write > t - REPORT_COLLECTING_RESOLUTION
+            ):
+                return
+            self._collect_report_last_write = t
+
+        errors = len(self.stats.get("error", []))
+        skipped = len(self.stats.get("skipped", []))
+        deselected = len(self.stats.get("deselected", []))
+        selected = self._numcollected - errors - skipped - deselected
+        if final:
+            line = "collected "
+        else:
+            line = "collecting "
+        line += (
+            str(self._numcollected) + " item" + ("" if self._numcollected == 1 else "s")
+        )
+        if errors:
+            line += " / %d error%s" % (errors, "s" if errors != 1 else "")
+        if deselected:
+            line += " / %d deselected" % deselected
+        if skipped:
+            line += " / %d skipped" % skipped
+        if self._numcollected > selected > 0:
+            line += " / %d selected" % selected
+        if self.isatty:
+            self.rewrite(line, bold=True, erase=True)
+            if final:
+                self.write("\n")
+        else:
+            self.write_line(line)
+
+    @pytest.hookimpl(trylast=True)
+    def pytest_sessionstart(self, session: Session) -> None:
+        self._session = session
+        self._sessionstarttime = time.time()
+        if not self.showheader:
+            return
+        self.write_sep("=", "test session starts", bold=True)
+        verinfo = platform.python_version()
+        msg = "platform {} -- Python {}".format(sys.platform, verinfo)
+        pypy_version_info = getattr(sys, "pypy_version_info", None)
+        if pypy_version_info:
+            verinfo = ".".join(map(str, pypy_version_info[:3]))
+            msg += "[pypy-{}-{}]".format(verinfo, pypy_version_info[3])
+        msg += ", pytest-{}, py-{}, pluggy-{}".format(
+            pytest.__version__, py.__version__, pluggy.__version__
+        )
+        if (
+            self.verbosity > 0
+            or self.config.option.debug
+            or getattr(self.config.option, "pastebin", None)
+        ):
+            msg += " -- " + str(sys.executable)
+        self.write_line(msg)
+        lines = self.config.hook.pytest_report_header(
+            config=self.config, startdir=self.startdir
+        )
+        self._write_report_lines_from_hooks(lines)
+
+    def _write_report_lines_from_hooks(self, lines):
+        lines.reverse()
+        for line in collapse(lines):
+            self.write_line(line)
+
+    def pytest_report_header(self, config):
+        line = "rootdir: %s" % config.rootdir
+
+        if config.inifile:
+            line += ", inifile: " + config.rootdir.bestrelpath(config.inifile)
+
+        testpaths = config.getini("testpaths")
+        if testpaths and config.args == testpaths:
+            rel_paths = [config.rootdir.bestrelpath(x) for x in testpaths]
+            line += ", testpaths: {}".format(", ".join(rel_paths))
+        result = [line]
+
+        plugininfo = config.pluginmanager.list_plugin_distinfo()
+        if plugininfo:
+            result.append("plugins: %s" % ", ".join(_plugin_nameversions(plugininfo)))
+        return result
+
+    def pytest_collection_finish(self, session):
+        self.report_collect(True)
+
+        if self.config.getoption("collectonly"):
+            self._printcollecteditems(session.items)
+
+        lines = self.config.hook.pytest_report_collectionfinish(
+            config=self.config, startdir=self.startdir, items=session.items
+        )
+        self._write_report_lines_from_hooks(lines)
+
+        if self.config.getoption("collectonly"):
+            failed = self.stats.get("failed")
+            if failed:
+                self._tw.sep("!", "collection failures")
+                for rep in failed:
+                    rep.toterminal(self._tw)
+
+    def _printcollecteditems(self, items):
+        # to print out items and their parent collectors
+        # we take care to leave out Instances aka ()
+        # because later versions are going to get rid of them anyway
+        if self.config.option.verbose < 0:
+            if self.config.option.verbose < -1:
+                counts = {}  # type: Dict[str, int]
+                for item in items:
+                    name = item.nodeid.split("::", 1)[0]
+                    counts[name] = counts.get(name, 0) + 1
+                for name, count in sorted(counts.items()):
+                    self._tw.line("%s: %d" % (name, count))
+            else:
+                for item in items:
+                    self._tw.line(item.nodeid)
+            return
+        stack = []
+        indent = ""
+        for item in items:
+            needed_collectors = item.listchain()[1:]  # strip root node
+            while stack:
+                if stack == needed_collectors[: len(stack)]:
+                    break
+                stack.pop()
+            for col in needed_collectors[len(stack) :]:
+                stack.append(col)
+                if col.name == "()":  # Skip Instances.
+                    continue
+                indent = (len(stack) - 1) * "  "
+                self._tw.line("{}{}".format(indent, col))
+                if self.config.option.verbose >= 1:
+                    if hasattr(col, "_obj") and col._obj.__doc__:
+                        for line in col._obj.__doc__.strip().splitlines():
+                            self._tw.line("{}{}".format(indent + "  ", line.strip()))
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_sessionfinish(self, session: Session, exitstatus: ExitCode):
+        outcome = yield
+        outcome.get_result()
+        self._tw.line("")
+        summary_exit_codes = (
+            ExitCode.OK,
+            ExitCode.TESTS_FAILED,
+            ExitCode.INTERRUPTED,
+            ExitCode.USAGE_ERROR,
+            ExitCode.NO_TESTS_COLLECTED,
+        )
+        if exitstatus in summary_exit_codes:
+            self.config.hook.pytest_terminal_summary(
+                terminalreporter=self, exitstatus=exitstatus, config=self.config
+            )
+        if session.shouldfail:
+            self.write_sep("!", session.shouldfail, red=True)
+        if exitstatus == ExitCode.INTERRUPTED:
+            self._report_keyboardinterrupt()
+            del self._keyboardinterrupt_memo
+        elif session.shouldstop:
+            self.write_sep("!", session.shouldstop, red=True)
+        self.summary_stats()
+
+    @pytest.hookimpl(hookwrapper=True)
+    def pytest_terminal_summary(self):
+        self.summary_errors()
+        self.summary_failures()
+        self.summary_warnings()
+        self.summary_passes()
+        yield
+        self.short_test_summary()
+        # Display any extra warnings from teardown here (if any).
+        self.summary_warnings()
+
+    def pytest_keyboard_interrupt(self, excinfo):
+        self._keyboardinterrupt_memo = excinfo.getrepr(funcargs=True)
+
+    def pytest_unconfigure(self):
+        if hasattr(self, "_keyboardinterrupt_memo"):
+            self._report_keyboardinterrupt()
+
+    def _report_keyboardinterrupt(self):
+        excrepr = self._keyboardinterrupt_memo
+        msg = excrepr.reprcrash.message
+        self.write_sep("!", msg)
+        if "KeyboardInterrupt" in msg:
+            if self.config.option.fulltrace:
+                excrepr.toterminal(self._tw)
+            else:
+                excrepr.reprcrash.toterminal(self._tw)
+                self._tw.line(
+                    "(to show a full traceback on KeyboardInterrupt use --full-trace)",
+                    yellow=True,
+                )
+
+    def _locationline(self, nodeid, fspath, lineno, domain):
+        def mkrel(nodeid):
+            line = self.config.cwd_relative_nodeid(nodeid)
+            if domain and line.endswith(domain):
+                line = line[: -len(domain)]
+                values = domain.split("[")
+                values[0] = values[0].replace(".", "::")  # don't replace '.' in params
+                line += "[".join(values)
+            return line
+
+        # collect_fspath comes from testid which has a "/"-normalized path
+
+        if fspath:
+            res = mkrel(nodeid)
+            if self.verbosity >= 2 and nodeid.split("::")[0] != fspath.replace(
+                "\\", nodes.SEP
+            ):
+                res += " <- " + self.startdir.bestrelpath(fspath)
+        else:
+            res = "[location]"
+        return res + " "
+
+    def _getfailureheadline(self, rep):
+        head_line = rep.head_line
+        if head_line:
+            return head_line
+        return "test session"  # XXX?
+
+    def _getcrashline(self, rep):
+        try:
+            return str(rep.longrepr.reprcrash)
+        except AttributeError:
+            try:
+                return str(rep.longrepr)[:50]
+            except AttributeError:
+                return ""
+
+    #
+    # summaries for sessionfinish
+    #
+    def getreports(self, name):
+        values = []
+        for x in self.stats.get(name, []):
+            if not hasattr(x, "_pdbshown"):
+                values.append(x)
+        return values
+
+    def summary_warnings(self):
+        if self.hasopt("w"):
+            all_warnings = self.stats.get(
+                "warnings"
+            )  # type: Optional[List[WarningReport]]
+            if not all_warnings:
+                return
+
+            final = hasattr(self, "_already_displayed_warnings")
+            if final:
+                warning_reports = all_warnings[self._already_displayed_warnings :]
+            else:
+                warning_reports = all_warnings
+            self._already_displayed_warnings = len(warning_reports)
+            if not warning_reports:
+                return
+
+            reports_grouped_by_message = (
+                collections.OrderedDict()
+            )  # type: collections.OrderedDict[str, List[WarningReport]]
+            for wr in warning_reports:
+                reports_grouped_by_message.setdefault(wr.message, []).append(wr)
+
+            def collapsed_location_report(reports: List[WarningReport]):
+                locations = []
+                for w in warning_reports:
+                    location = w.get_location(self.config)
+                    if location:
+                        locations.append(location)
+
+                if len(locations) < 10:
+                    return "\n".join(map(str, locations))
+
+                counts_by_filename = collections.Counter(
+                    str(loc).split("::", 1)[0] for loc in locations
+                )
+                return "\n".join(
+                    "{0}: {1} test{2} with warning{2}".format(
+                        k, v, "s" if v > 1 else ""
+                    )
+                    for k, v in counts_by_filename.items()
+                )
+
+            title = "warnings summary (final)" if final else "warnings summary"
+            self.write_sep("=", title, yellow=True, bold=False)
+            for message, warning_reports in reports_grouped_by_message.items():
+                maybe_location = collapsed_location_report(warning_reports)
+                if maybe_location:
+                    self._tw.line(maybe_location)
+                    lines = message.splitlines()
+                    indented = "\n".join("  " + x for x in lines)
+                    message = indented.rstrip()
+                else:
+                    message = message.rstrip()
+                self._tw.line(message)
+                self._tw.line()
+            self._tw.line("-- Docs: https://docs.pytest.org/en/latest/warnings.html")
+
+    def summary_passes(self):
+        if self.config.option.tbstyle != "no":
+            if self.hasopt("P"):
+                reports = self.getreports("passed")
+                if not reports:
+                    return
+                self.write_sep("=", "PASSES")
+                for rep in reports:
+                    if rep.sections:
+                        msg = self._getfailureheadline(rep)
+                        self.write_sep("_", msg, green=True, bold=True)
+                        self._outrep_summary(rep)
+                    self._handle_teardown_sections(rep.nodeid)
+
+    def _get_teardown_reports(self, nodeid: str) -> List[TestReport]:
+        return [
+            report
+            for report in self.getreports("")
+            if report.when == "teardown" and report.nodeid == nodeid
+        ]
+
+    def _handle_teardown_sections(self, nodeid: str) -> None:
+        for report in self._get_teardown_reports(nodeid):
+            self.print_teardown_sections(report)
+
+    def print_teardown_sections(self, rep: TestReport) -> None:
+        showcapture = self.config.option.showcapture
+        if showcapture == "no":
+            return
+        for secname, content in rep.sections:
+            if showcapture != "all" and showcapture not in secname:
+                continue
+            if "teardown" in secname:
+                self._tw.sep("-", secname)
+                if content[-1:] == "\n":
+                    content = content[:-1]
+                self._tw.line(content)
+
+    def summary_failures(self):
+        if self.config.option.tbstyle != "no":
+            reports = self.getreports("failed")
+            if not reports:
+                return
+            self.write_sep("=", "FAILURES")
+            if self.config.option.tbstyle == "line":
+                for rep in reports:
+                    line = self._getcrashline(rep)
+                    self.write_line(line)
+            else:
+                for rep in reports:
+                    msg = self._getfailureheadline(rep)
+                    self.write_sep("_", msg, red=True, bold=True)
+                    self._outrep_summary(rep)
+                    self._handle_teardown_sections(rep.nodeid)
+
+    def summary_errors(self):
+        if self.config.option.tbstyle != "no":
+            reports = self.getreports("error")
+            if not reports:
+                return
+            self.write_sep("=", "ERRORS")
+            for rep in self.stats["error"]:
+                msg = self._getfailureheadline(rep)
+                if rep.when == "collect":
+                    msg = "ERROR collecting " + msg
+                else:
+                    msg = "ERROR at {} of {}".format(rep.when, msg)
+                self.write_sep("_", msg, red=True, bold=True)
+                self._outrep_summary(rep)
+
+    def _outrep_summary(self, rep):
+        rep.toterminal(self._tw)
+        showcapture = self.config.option.showcapture
+        if showcapture == "no":
+            return
+        for secname, content in rep.sections:
+            if showcapture != "all" and showcapture not in secname:
+                continue
+            self._tw.sep("-", secname)
+            if content[-1:] == "\n":
+                content = content[:-1]
+            self._tw.line(content)
+
+    def summary_stats(self):
+        if self.verbosity < -1:
+            return
+
+        session_duration = time.time() - self._sessionstarttime
+        (parts, main_color) = self.build_summary_stats_line()
+        line_parts = []
+
+        display_sep = self.verbosity >= 0
+        if display_sep:
+            fullwidth = self._tw.fullwidth
+        for text, markup in parts:
+            with_markup = self._tw.markup(text, **markup)
+            if display_sep:
+                fullwidth += len(with_markup) - len(text)
+            line_parts.append(with_markup)
+        msg = ", ".join(line_parts)
+
+        main_markup = {main_color: True}
+        duration = " in {}".format(format_session_duration(session_duration))
+        duration_with_markup = self._tw.markup(duration, **main_markup)
+        if display_sep:
+            fullwidth += len(duration_with_markup) - len(duration)
+        msg += duration_with_markup
+
+        if display_sep:
+            markup_for_end_sep = self._tw.markup("", **main_markup)
+            if markup_for_end_sep.endswith("\x1b[0m"):
+                markup_for_end_sep = markup_for_end_sep[:-4]
+            fullwidth += len(markup_for_end_sep)
+            msg += markup_for_end_sep
+
+        if display_sep:
+            self.write_sep("=", msg, fullwidth=fullwidth, **main_markup)
+        else:
+            self.write_line(msg, **main_markup)
+
+    def short_test_summary(self) -> None:
+        if not self.reportchars:
+            return
+
+        def show_simple(stat, lines: List[str]) -> None:
+            failed = self.stats.get(stat, [])
+            if not failed:
+                return
+            termwidth = self._tw.fullwidth
+            config = self.config
+            for rep in failed:
+                line = _get_line_with_reprcrash_message(config, rep, termwidth)
+                lines.append(line)
+
+        def show_xfailed(lines: List[str]) -> None:
+            xfailed = self.stats.get("xfailed", [])
+            for rep in xfailed:
+                verbose_word = rep._get_verbose_word(self.config)
+                pos = _get_pos(self.config, rep)
+                lines.append("{} {}".format(verbose_word, pos))
+                reason = rep.wasxfail
+                if reason:
+                    lines.append("  " + str(reason))
+
+        def show_xpassed(lines: List[str]) -> None:
+            xpassed = self.stats.get("xpassed", [])
+            for rep in xpassed:
+                verbose_word = rep._get_verbose_word(self.config)
+                pos = _get_pos(self.config, rep)
+                reason = rep.wasxfail
+                lines.append("{} {} {}".format(verbose_word, pos, reason))
+
+        def show_skipped(lines: List[str]) -> None:
+            skipped = self.stats.get("skipped", [])
+            fskips = _folded_skips(skipped) if skipped else []
+            if not fskips:
+                return
+            verbose_word = skipped[0]._get_verbose_word(self.config)
+            for num, fspath, lineno, reason in fskips:
+                if reason.startswith("Skipped: "):
+                    reason = reason[9:]
+                if lineno is not None:
+                    lines.append(
+                        "%s [%d] %s:%d: %s"
+                        % (verbose_word, num, fspath, lineno, reason)
+                    )
+                else:
+                    lines.append("%s [%d] %s: %s" % (verbose_word, num, fspath, reason))
+
+        REPORTCHAR_ACTIONS = {
+            "x": show_xfailed,
+            "X": show_xpassed,
+            "f": partial(show_simple, "failed"),
+            "s": show_skipped,
+            "p": partial(show_simple, "passed"),
+            "E": partial(show_simple, "error"),
+        }  # type: Mapping[str, Callable[[List[str]], None]]
+
+        lines = []  # type: List[str]
+        for char in self.reportchars:
+            action = REPORTCHAR_ACTIONS.get(char)
+            if action:  # skipping e.g. "P" (passed with output) here.
+                action(lines)
+
+        if lines:
+            self.write_sep("=", "short test summary info")
+            for line in lines:
+                self.write_line(line)
+
+    def _get_main_color(self) -> Tuple[str, List[str]]:
+        if self._main_color is None or self._known_types is None or self._is_last_item:
+            self._set_main_color()
+            assert self._main_color
+            assert self._known_types
+        return self._main_color, self._known_types
+
+    def _determine_main_color(self, unknown_type_seen: bool) -> str:
+        stats = self.stats
+        if "failed" in stats or "error" in stats:
+            main_color = "red"
+        elif "warnings" in stats or "xpassed" in stats or unknown_type_seen:
+            main_color = "yellow"
+        elif "passed" in stats or not self._is_last_item:
+            main_color = "green"
+        else:
+            main_color = "yellow"
+        return main_color
+
+    def _set_main_color(self) -> None:
+        unknown_types = []  # type: List[str]
+        for found_type in self.stats.keys():
+            if found_type:  # setup/teardown reports have an empty key, ignore them
+                if found_type not in KNOWN_TYPES and found_type not in unknown_types:
+                    unknown_types.append(found_type)
+        self._known_types = list(KNOWN_TYPES) + unknown_types
+        self._main_color = self._determine_main_color(bool(unknown_types))
+
+    def build_summary_stats_line(self) -> Tuple[List[Tuple[str, Dict[str, bool]]], str]:
+        main_color, known_types = self._get_main_color()
+
+        parts = []
+        for key in known_types:
+            reports = self.stats.get(key, None)
+            if reports:
+                count = sum(
+                    1 for rep in reports if getattr(rep, "count_towards_summary", True)
+                )
+                color = _color_for_type.get(key, _color_for_type_default)
+                markup = {color: True, "bold": color == main_color}
+                parts.append(("%d %s" % _make_plural(count, key), markup))
+
+        if not parts:
+            parts = [("no tests ran", {_color_for_type_default: True})]
+
+        return parts, main_color
+
+
+def _get_pos(config, rep):
+    nodeid = config.cwd_relative_nodeid(rep.nodeid)
+    return nodeid
+
+
+def _get_line_with_reprcrash_message(config, rep, termwidth):
+    """Get summary line for a report, trying to add reprcrash message."""
+    from wcwidth import wcswidth
+
+    verbose_word = rep._get_verbose_word(config)
+    pos = _get_pos(config, rep)
+
+    line = "{} {}".format(verbose_word, pos)
+    len_line = wcswidth(line)
+    ellipsis, len_ellipsis = "...", 3
+    if len_line > termwidth - len_ellipsis:
+        # No space for an additional message.
+        return line
+
+    try:
+        msg = rep.longrepr.reprcrash.message
+    except AttributeError:
+        pass
+    else:
+        # Only use the first line.
+        i = msg.find("\n")
+        if i != -1:
+            msg = msg[:i]
+        len_msg = wcswidth(msg)
+
+        sep, len_sep = " - ", 3
+        max_len_msg = termwidth - len_line - len_sep
+        if max_len_msg >= len_ellipsis:
+            if len_msg > max_len_msg:
+                max_len_msg -= len_ellipsis
+                msg = msg[:max_len_msg]
+                while wcswidth(msg) > max_len_msg:
+                    msg = msg[:-1]
+                msg += ellipsis
+            line += sep + msg
+    return line
+
+
+def _folded_skips(skipped):
+    d = {}
+    for event in skipped:
+        key = event.longrepr
+        assert len(key) == 3, (event, key)
+        keywords = getattr(event, "keywords", {})
+        # folding reports with global pytestmark variable
+        # this is workaround, because for now we cannot identify the scope of a skip marker
+        # TODO: revisit after marks scope would be fixed
+        if (
+            event.when == "setup"
+            and "skip" in keywords
+            and "pytestmark" not in keywords
+        ):
+            key = (key[0], None, key[2])
+        d.setdefault(key, []).append(event)
+    values = []
+    for key, events in d.items():
+        values.append((len(events),) + key)
+    return values
+
+
+_color_for_type = {
+    "failed": "red",
+    "error": "red",
+    "warnings": "yellow",
+    "passed": "green",
+}
+_color_for_type_default = "yellow"
+
+
+def _make_plural(count, noun):
+    # No need to pluralize words such as `failed` or `passed`.
+    if noun not in ["error", "warnings"]:
+        return count, noun
+
+    # The `warnings` key is plural. To avoid API breakage, we keep it that way but
+    # set it to singular here so we can determine plurality in the same way as we do
+    # for `error`.
+    noun = noun.replace("warnings", "warning")
+
+    return count, noun + "s" if count != 1 else noun
+
+
+def _plugin_nameversions(plugininfo) -> List[str]:
+    values = []  # type: List[str]
+    for plugin, dist in plugininfo:
+        # gets us name and version!
+        name = "{dist.project_name}-{dist.version}".format(dist=dist)
+        # questionable convenience, but it keeps things short
+        if name.startswith("pytest-"):
+            name = name[7:]
+        # we decided to print python package names
+        # they can have more than one plugin
+        if name not in values:
+            values.append(name)
+    return values
+
+
+def format_session_duration(seconds: float) -> str:
+    """Format the given seconds in a human readable manner to show in the final summary"""
+    if seconds < 60:
+        return "{:.2f}s".format(seconds)
+    else:
+        dt = datetime.timedelta(seconds=int(seconds))
+        return "{:.2f}s ({})".format(seconds, dt)
diff --git a/contrib/python/pytest/py3/_pytest/tmpdir.py b/contrib/python/pytest/py3/_pytest/tmpdir.py
new file mode 100644
index 0000000000..85c5b83810
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/tmpdir.py
@@ -0,0 +1,203 @@
+""" support for providing temporary directories to test functions.  """
+import os
+import re
+import tempfile
+from typing import Optional
+
+import attr
+import py
+
+import pytest
+from .pathlib import ensure_reset_dir
+from .pathlib import LOCK_TIMEOUT
+from .pathlib import make_numbered_dir
+from .pathlib import make_numbered_dir_with_cleanup
+from .pathlib import Path
+from _pytest.fixtures import FixtureRequest
+from _pytest.monkeypatch import MonkeyPatch
+
+
+@attr.s
+class TempPathFactory:
+    """Factory for temporary directories under the common base temp directory.
+
+    The base directory can be configured using the ``--basetemp`` option."""
+
+    _given_basetemp = attr.ib(
+        type=Path,
+        # using os.path.abspath() to get absolute path instead of resolve() as it
+        # does not work the same in all platforms (see #4427)
+        # Path.absolute() exists, but it is not public (see https://bugs.python.org/issue25012)
+        # Ignore type because of https://github.com/python/mypy/issues/6172.
+        converter=attr.converters.optional(
+            lambda p: Path(os.path.abspath(str(p)))  # type: ignore
+        ),
+    )
+    _trace = attr.ib()
+    _basetemp = attr.ib(type=Optional[Path], default=None)
+
+    @classmethod
+    def from_config(cls, config) -> "TempPathFactory":
+        """
+        :param config: a pytest configuration
+        """
+        return cls(
+            given_basetemp=config.option.basetemp, trace=config.trace.get("tmpdir")
+        )
+
+    def _ensure_relative_to_basetemp(self, basename: str):
+        basename = os.path.normpath(basename)
+        if (self.getbasetemp() / basename).resolve().parent != self.getbasetemp():
+            raise ValueError(
+                "{} is not a normalized and relative path".format(basename)
+            )
+        return basename
+
+    def mktemp(self, basename: str, numbered: bool = True) -> Path:
+        """Creates a new temporary directory managed by the factory.
+
+        :param basename:
+            Directory base name, must be a relative path.
+
+        :param numbered:
+            If True, ensure the directory is unique by adding a number
+            prefix greater than any existing one: ``basename="foo"`` and ``numbered=True``
+            means that this function will create directories named ``"foo-0"``,
+            ``"foo-1"``, ``"foo-2"`` and so on.
+
+        :return:
+            The path to the new directory.
+        """
+        basename = self._ensure_relative_to_basetemp(basename)
+        if not numbered:
+            p = self.getbasetemp().joinpath(basename)
+            p.mkdir()
+        else:
+            p = make_numbered_dir(root=self.getbasetemp(), prefix=basename)
+            self._trace("mktemp", p)
+        return p
+
+    def getbasetemp(self) -> Path:
+        """ return base temporary directory. """
+        if self._basetemp is not None:
+            return self._basetemp
+
+        if self._given_basetemp is not None:
+            basetemp = self._given_basetemp
+            ensure_reset_dir(basetemp)
+            basetemp = basetemp.resolve()
+        else:
+            from_env = os.environ.get("PYTEST_DEBUG_TEMPROOT")
+            temproot = Path(from_env or tempfile.gettempdir()).resolve()
+            user = get_user() or "unknown"
+            # use a sub-directory in the temproot to speed-up
+            # make_numbered_dir() call
+            rootdir = temproot.joinpath("pytest-of-{}".format(user))
+            rootdir.mkdir(exist_ok=True)
+            basetemp = make_numbered_dir_with_cleanup(
+                prefix="pytest-", root=rootdir, keep=3, lock_timeout=LOCK_TIMEOUT
+            )
+        assert basetemp is not None, basetemp
+        self._basetemp = t = basetemp
+        self._trace("new basetemp", t)
+        return t
+
+
+@attr.s
+class TempdirFactory:
+    """
+    backward comptibility wrapper that implements
+    :class:``py.path.local`` for :class:``TempPathFactory``
+    """
+
+    _tmppath_factory = attr.ib(type=TempPathFactory)
+
+    def mktemp(self, basename: str, numbered: bool = True) -> py.path.local:
+        """
+        Same as :meth:`TempPathFactory.mkdir`, but returns a ``py.path.local`` object.
+        """
+        return py.path.local(self._tmppath_factory.mktemp(basename, numbered).resolve())
+
+    def getbasetemp(self):
+        """backward compat wrapper for ``_tmppath_factory.getbasetemp``"""
+        return py.path.local(self._tmppath_factory.getbasetemp().resolve())
+
+
+def get_user() -> Optional[str]:
+    """Return the current user name, or None if getuser() does not work
+    in the current environment (see #1010).
+    """
+    import getpass
+
+    try:
+        return getpass.getuser()
+    except (ImportError, KeyError):
+        return None
+
+
+def pytest_configure(config) -> None:
+    """Create a TempdirFactory and attach it to the config object.
+
+    This is to comply with existing plugins which expect the handler to be
+    available at pytest_configure time, but ideally should be moved entirely
+    to the tmpdir_factory session fixture.
+    """
+    mp = MonkeyPatch()
+    tmppath_handler = TempPathFactory.from_config(config)
+    t = TempdirFactory(tmppath_handler)
+    config._cleanup.append(mp.undo)
+    mp.setattr(config, "_tmp_path_factory", tmppath_handler, raising=False)
+    mp.setattr(config, "_tmpdirhandler", t, raising=False)
+
+
+@pytest.fixture(scope="session")
+def tmpdir_factory(request: FixtureRequest) -> TempdirFactory:
+    """Return a :class:`_pytest.tmpdir.TempdirFactory` instance for the test session.
+    """
+    # Set dynamically by pytest_configure() above.
+    return request.config._tmpdirhandler  # type: ignore
+
+
+@pytest.fixture(scope="session")
+def tmp_path_factory(request: FixtureRequest) -> TempPathFactory:
+    """Return a :class:`_pytest.tmpdir.TempPathFactory` instance for the test session.
+    """
+    # Set dynamically by pytest_configure() above.
+    return request.config._tmp_path_factory  # type: ignore
+
+
+def _mk_tmp(request: FixtureRequest, factory: TempPathFactory) -> Path:
+    name = request.node.name
+    name = re.sub(r"[\W]", "_", name)
+    MAXVAL = 30
+    name = name[:MAXVAL]
+    return factory.mktemp(name, numbered=True)
+
+
+@pytest.fixture
+def tmpdir(tmp_path):
+    """Return a temporary directory path object
+    which is unique to each test function invocation,
+    created as a sub directory of the base temporary
+    directory.  The returned object is a `py.path.local`_
+    path object.
+
+    .. _`py.path.local`: https://py.readthedocs.io/en/latest/path.html
+    """
+    return py.path.local(tmp_path)
+
+
+@pytest.fixture
+def tmp_path(request: FixtureRequest, tmp_path_factory: TempPathFactory) -> Path:
+    """Return a temporary directory path object
+    which is unique to each test function invocation,
+    created as a sub directory of the base temporary
+    directory.  The returned object is a :class:`pathlib.Path`
+    object.
+
+    .. note::
+
+        in python < 3.6 this is a pathlib2.Path
+    """
+
+    return _mk_tmp(request, tmp_path_factory)
diff --git a/contrib/python/pytest/py3/_pytest/unittest.py b/contrib/python/pytest/py3/_pytest/unittest.py
new file mode 100644
index 0000000000..36158c62d2
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/unittest.py
@@ -0,0 +1,308 @@
+""" discovery and running of std-library "unittest" style tests. """
+import sys
+import traceback
+
+import _pytest._code
+import pytest
+from _pytest.compat import getimfunc
+from _pytest.compat import is_async_function
+from _pytest.config import hookimpl
+from _pytest.outcomes import exit
+from _pytest.outcomes import fail
+from _pytest.outcomes import skip
+from _pytest.outcomes import xfail
+from _pytest.python import Class
+from _pytest.python import Function
+from _pytest.runner import CallInfo
+from _pytest.skipping import skipped_by_mark_key
+from _pytest.skipping import unexpectedsuccess_key
+
+
+def pytest_pycollect_makeitem(collector, name, obj):
+    # has unittest been imported and is obj a subclass of its TestCase?
+    try:
+        if not issubclass(obj, sys.modules["unittest"].TestCase):
+            return
+    except Exception:
+        return
+    # yes, so let's collect it
+    return UnitTestCase.from_parent(collector, name=name, obj=obj)
+
+
+class UnitTestCase(Class):
+    # marker for fixturemanger.getfixtureinfo()
+    # to declare that our children do not support funcargs
+    nofuncargs = True
+
+    def collect(self):
+        from unittest import TestLoader
+
+        cls = self.obj
+        if not getattr(cls, "__test__", True):
+            return
+
+        skipped = _is_skipped(cls)
+        if not skipped:
+            self._inject_setup_teardown_fixtures(cls)
+            self._inject_setup_class_fixture()
+
+        self.session._fixturemanager.parsefactories(self, unittest=True)
+        loader = TestLoader()
+        foundsomething = False
+        for name in loader.getTestCaseNames(self.obj):
+            x = getattr(self.obj, name)
+            if not getattr(x, "__test__", True):
+                continue
+            funcobj = getimfunc(x)
+            yield TestCaseFunction.from_parent(self, name=name, callobj=funcobj)
+            foundsomething = True
+
+        if not foundsomething:
+            runtest = getattr(self.obj, "runTest", None)
+            if runtest is not None:
+                ut = sys.modules.get("twisted.trial.unittest", None)
+                if ut is None or runtest != ut.TestCase.runTest:
+                    # TODO: callobj consistency
+                    yield TestCaseFunction.from_parent(self, name="runTest")
+
+    def _inject_setup_teardown_fixtures(self, cls):
+        """Injects a hidden auto-use fixture to invoke setUpClass/setup_method and corresponding
+        teardown functions (#517)"""
+        class_fixture = _make_xunit_fixture(
+            cls, "setUpClass", "tearDownClass", scope="class", pass_self=False
+        )
+        if class_fixture:
+            cls.__pytest_class_setup = class_fixture
+
+        method_fixture = _make_xunit_fixture(
+            cls, "setup_method", "teardown_method", scope="function", pass_self=True
+        )
+        if method_fixture:
+            cls.__pytest_method_setup = method_fixture
+
+
+def _make_xunit_fixture(obj, setup_name, teardown_name, scope, pass_self):
+    setup = getattr(obj, setup_name, None)
+    teardown = getattr(obj, teardown_name, None)
+    if setup is None and teardown is None:
+        return None
+
+    @pytest.fixture(scope=scope, autouse=True)
+    def fixture(self, request):
+        if _is_skipped(self):
+            reason = self.__unittest_skip_why__
+            pytest.skip(reason)
+        if setup is not None:
+            if pass_self:
+                setup(self, request.function)
+            else:
+                setup()
+        yield
+        if teardown is not None:
+            if pass_self:
+                teardown(self, request.function)
+            else:
+                teardown()
+
+    return fixture
+
+
+class TestCaseFunction(Function):
+    nofuncargs = True
+    _excinfo = None
+    _testcase = None
+
+    def setup(self):
+        # a bound method to be called during teardown() if set (see 'runtest()')
+        self._explicit_tearDown = None
+        self._testcase = self.parent.obj(self.name)
+        self._obj = getattr(self._testcase, self.name)
+        if hasattr(self, "_request"):
+            self._request._fillfixtures()
+
+    def teardown(self):
+        if self._explicit_tearDown is not None:
+            self._explicit_tearDown()
+            self._explicit_tearDown = None
+        self._testcase = None
+        self._obj = None
+
+    def startTest(self, testcase):
+        pass
+
+    def _addexcinfo(self, rawexcinfo):
+        # unwrap potential exception info (see twisted trial support below)
+        rawexcinfo = getattr(rawexcinfo, "_rawexcinfo", rawexcinfo)
+        try:
+            excinfo = _pytest._code.ExceptionInfo(rawexcinfo)
+            # invoke the attributes to trigger storing the traceback
+            # trial causes some issue there
+            excinfo.value
+            excinfo.traceback
+        except TypeError:
+            try:
+                try:
+                    values = traceback.format_exception(*rawexcinfo)
+                    values.insert(
+                        0,
+                        "NOTE: Incompatible Exception Representation, "
+                        "displaying natively:\n\n",
+                    )
+                    fail("".join(values), pytrace=False)
+                except (fail.Exception, KeyboardInterrupt):
+                    raise
+                except:  # noqa
+                    fail(
+                        "ERROR: Unknown Incompatible Exception "
+                        "representation:\n%r" % (rawexcinfo,),
+                        pytrace=False,
+                    )
+            except KeyboardInterrupt:
+                raise
+            except fail.Exception:
+                excinfo = _pytest._code.ExceptionInfo.from_current()
+        self.__dict__.setdefault("_excinfo", []).append(excinfo)
+
+    def addError(self, testcase, rawexcinfo):
+        try:
+            if isinstance(rawexcinfo[1], exit.Exception):
+                exit(rawexcinfo[1].msg)
+        except TypeError:
+            pass
+        self._addexcinfo(rawexcinfo)
+
+    def addFailure(self, testcase, rawexcinfo):
+        self._addexcinfo(rawexcinfo)
+
+    def addSkip(self, testcase, reason):
+        try:
+            skip(reason)
+        except skip.Exception:
+            self._store[skipped_by_mark_key] = True
+            self._addexcinfo(sys.exc_info())
+
+    def addExpectedFailure(self, testcase, rawexcinfo, reason=""):
+        try:
+            xfail(str(reason))
+        except xfail.Exception:
+            self._addexcinfo(sys.exc_info())
+
+    def addUnexpectedSuccess(self, testcase, reason=""):
+        self._store[unexpectedsuccess_key] = reason
+
+    def addSuccess(self, testcase):
+        pass
+
+    def stopTest(self, testcase):
+        pass
+
+    def _expecting_failure(self, test_method) -> bool:
+        """Return True if the given unittest method (or the entire class) is marked
+        with @expectedFailure"""
+        expecting_failure_method = getattr(
+            test_method, "__unittest_expecting_failure__", False
+        )
+        expecting_failure_class = getattr(self, "__unittest_expecting_failure__", False)
+        return bool(expecting_failure_class or expecting_failure_method)
+
+    def runtest(self):
+        from _pytest.debugging import maybe_wrap_pytest_function_for_tracing
+
+        maybe_wrap_pytest_function_for_tracing(self)
+
+        # let the unittest framework handle async functions
+        if is_async_function(self.obj):
+            self._testcase(self)
+        else:
+            # when --pdb is given, we want to postpone calling tearDown() otherwise
+            # when entering the pdb prompt, tearDown() would have probably cleaned up
+            # instance variables, which makes it difficult to debug
+            # arguably we could always postpone tearDown(), but this changes the moment where the
+            # TestCase instance interacts with the results object, so better to only do it
+            # when absolutely needed
+            if self.config.getoption("usepdb") and not _is_skipped(self.obj):
+                self._explicit_tearDown = self._testcase.tearDown
+                setattr(self._testcase, "tearDown", lambda *args: None)
+
+            # we need to update the actual bound method with self.obj, because
+            # wrap_pytest_function_for_tracing replaces self.obj by a wrapper
+            setattr(self._testcase, self.name, self.obj)
+            try:
+                self._testcase(result=self)
+            finally:
+                delattr(self._testcase, self.name)
+
+    def _prunetraceback(self, excinfo):
+        Function._prunetraceback(self, excinfo)
+        traceback = excinfo.traceback.filter(
+            lambda x: not x.frame.f_globals.get("__unittest")
+        )
+        if traceback:
+            excinfo.traceback = traceback
+
+
+@hookimpl(tryfirst=True)
+def pytest_runtest_makereport(item, call):
+    if isinstance(item, TestCaseFunction):
+        if item._excinfo:
+            call.excinfo = item._excinfo.pop(0)
+            try:
+                del call.result
+            except AttributeError:
+                pass
+
+    unittest = sys.modules.get("unittest")
+    if unittest and call.excinfo and call.excinfo.errisinstance(unittest.SkipTest):
+        # let's substitute the excinfo with a pytest.skip one
+        call2 = CallInfo.from_call(
+            lambda: pytest.skip(str(call.excinfo.value)), call.when
+        )
+        call.excinfo = call2.excinfo
+
+
+# twisted trial support
+
+
+@hookimpl(hookwrapper=True)
+def pytest_runtest_protocol(item):
+    if isinstance(item, TestCaseFunction) and "twisted.trial.unittest" in sys.modules:
+        ut = sys.modules["twisted.python.failure"]
+        Failure__init__ = ut.Failure.__init__
+        check_testcase_implements_trial_reporter()
+
+        def excstore(
+            self, exc_value=None, exc_type=None, exc_tb=None, captureVars=None
+        ):
+            if exc_value is None:
+                self._rawexcinfo = sys.exc_info()
+            else:
+                if exc_type is None:
+                    exc_type = type(exc_value)
+                self._rawexcinfo = (exc_type, exc_value, exc_tb)
+            try:
+                Failure__init__(
+                    self, exc_value, exc_type, exc_tb, captureVars=captureVars
+                )
+            except TypeError:
+                Failure__init__(self, exc_value, exc_type, exc_tb)
+
+        ut.Failure.__init__ = excstore
+        yield
+        ut.Failure.__init__ = Failure__init__
+    else:
+        yield
+
+
+def check_testcase_implements_trial_reporter(done=[]):
+    if done:
+        return
+    from zope.interface import classImplements
+    from twisted.trial.itrial import IReporter
+
+    classImplements(TestCaseFunction, IReporter)
+    done.append(1)
+
+
+def _is_skipped(obj) -> bool:
+    """Return True if the given object has been marked with @unittest.skip"""
+    return bool(getattr(obj, "__unittest_skip__", False))
diff --git a/contrib/python/pytest/py3/_pytest/warning_types.py b/contrib/python/pytest/py3/_pytest/warning_types.py
new file mode 100644
index 0000000000..2e03c578c0
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/warning_types.py
@@ -0,0 +1,133 @@
+from typing import Any
+from typing import Generic
+from typing import TypeVar
+
+import attr
+
+from _pytest.compat import TYPE_CHECKING
+
+if TYPE_CHECKING:
+    from typing import Type  # noqa: F401 (used in type string)
+
+
+class PytestWarning(UserWarning):
+    """
+    Bases: :class:`UserWarning`.
+
+    Base class for all warnings emitted by pytest.
+    """
+
+    __module__ = "pytest"
+
+
+class PytestAssertRewriteWarning(PytestWarning):
+    """
+    Bases: :class:`PytestWarning`.
+
+    Warning emitted by the pytest assert rewrite module.
+    """
+
+    __module__ = "pytest"
+
+
+class PytestCacheWarning(PytestWarning):
+    """
+    Bases: :class:`PytestWarning`.
+
+    Warning emitted by the cache plugin in various situations.
+    """
+
+    __module__ = "pytest"
+
+
+class PytestConfigWarning(PytestWarning):
+    """
+    Bases: :class:`PytestWarning`.
+
+    Warning emitted for configuration issues.
+    """
+
+    __module__ = "pytest"
+
+
+class PytestCollectionWarning(PytestWarning):
+    """
+    Bases: :class:`PytestWarning`.
+
+    Warning emitted when pytest is not able to collect a file or symbol in a module.
+    """
+
+    __module__ = "pytest"
+
+
+class PytestDeprecationWarning(PytestWarning, DeprecationWarning):
+    """
+    Bases: :class:`pytest.PytestWarning`, :class:`DeprecationWarning`.
+
+    Warning class for features that will be removed in a future version.
+    """
+
+    __module__ = "pytest"
+
+
+class PytestExperimentalApiWarning(PytestWarning, FutureWarning):
+    """
+    Bases: :class:`pytest.PytestWarning`, :class:`FutureWarning`.
+
+    Warning category used to denote experiments in pytest. Use sparingly as the API might change or even be
+    removed completely in future version
+    """
+
+    __module__ = "pytest"
+
+    @classmethod
+    def simple(cls, apiname: str) -> "PytestExperimentalApiWarning":
+        return cls(
+            "{apiname} is an experimental api that may change over time".format(
+                apiname=apiname
+            )
+        )
+
+
+class PytestUnhandledCoroutineWarning(PytestWarning):
+    """
+    Bases: :class:`PytestWarning`.
+
+    Warning emitted when pytest encounters a test function which is a coroutine,
+    but it was not handled by any async-aware plugin. Coroutine test functions
+    are not natively supported.
+    """
+
+    __module__ = "pytest"
+
+
+class PytestUnknownMarkWarning(PytestWarning):
+    """
+    Bases: :class:`PytestWarning`.
+
+    Warning emitted on use of unknown markers.
+    See https://docs.pytest.org/en/latest/mark.html for details.
+    """
+
+    __module__ = "pytest"
+
+
+_W = TypeVar("_W", bound=PytestWarning)
+
+
+@attr.s
+class UnformattedWarning(Generic[_W]):
+    """Used to hold warnings that need to format their message at runtime, as opposed to a direct message.
+
+    Using this class avoids to keep all the warning types and messages in this module, avoiding misuse.
+    """
+
+    category = attr.ib(type="Type[_W]")
+    template = attr.ib(type=str)
+
+    def format(self, **kwargs: Any) -> _W:
+        """Returns an instance of the warning category, formatted with given kwargs"""
+        return self.category(self.template.format(**kwargs))
+
+
+PYTESTER_COPY_EXAMPLE = PytestExperimentalApiWarning.simple("testdir.copy_example")
diff --git a/contrib/python/pytest/py3/_pytest/warnings.py b/contrib/python/pytest/py3/_pytest/warnings.py
new file mode 100644
index 0000000000..2a4d189d57
--- /dev/null
+++ b/contrib/python/pytest/py3/_pytest/warnings.py
@@ -0,0 +1,169 @@
+import sys
+import warnings
+from contextlib import contextmanager
+from typing import Generator
+
+import pytest
+from _pytest.main import Session
+
+
+def _setoption(wmod, arg):
+    """
+    Copy of the warning._setoption function but does not escape arguments.
+    """
+    parts = arg.split(":")
+    if len(parts) > 5:
+        raise wmod._OptionError("too many fields (max 5): {!r}".format(arg))
+    while len(parts) < 5:
+        parts.append("")
+    action, message, category, module, lineno = [s.strip() for s in parts]
+    action = wmod._getaction(action)
+    category = wmod._getcategory(category)
+    if lineno:
+        try:
+            lineno = int(lineno)
+            if lineno < 0:
+                raise ValueError
+        except (ValueError, OverflowError):
+            raise wmod._OptionError("invalid lineno {!r}".format(lineno))
+    else:
+        lineno = 0
+    wmod.filterwarnings(action, message, category, module, lineno)
+
+
+def pytest_addoption(parser):
+    group = parser.getgroup("pytest-warnings")
+    group.addoption(
+        "-W",
+        "--pythonwarnings",
+        action="append",
+        help="set which warnings to report, see -W option of python itself.",
+    )
+    parser.addini(
+        "filterwarnings",
+        type="linelist",
+        help="Each line specifies a pattern for "
+        "warnings.filterwarnings. "
+        "Processed after -W/--pythonwarnings.",
+    )
+
+
+def pytest_configure(config):
+    config.addinivalue_line(
+        "markers",
+        "filterwarnings(warning): add a warning filter to the given test. "
+        "see https://docs.pytest.org/en/latest/warnings.html#pytest-mark-filterwarnings ",
+    )
+
+
+@contextmanager
+def catch_warnings_for_item(config, ihook, when, item):
+    """
+    Context manager that catches warnings generated in the contained execution block.
+
+    ``item`` can be None if we are not in the context of an item execution.
+
+    Each warning captured triggers the ``pytest_warning_captured`` hook.
+    """
+    cmdline_filters = config.getoption("pythonwarnings") or []
+    inifilters = config.getini("filterwarnings")
+    with warnings.catch_warnings(record=True) as log:
+        # mypy can't infer that record=True means log is not None; help it.
+        assert log is not None
+
+        if not sys.warnoptions:
+            # if user is not explicitly configuring warning filters, show deprecation warnings by default (#2908)
+            warnings.filterwarnings("always", category=DeprecationWarning)
+            warnings.filterwarnings("always", category=PendingDeprecationWarning)
+
+        # filters should have this precedence: mark, cmdline options, ini
+        # filters should be applied in the inverse order of precedence
+        for arg in inifilters:
+            _setoption(warnings, arg)
+
+        for arg in cmdline_filters:
+            warnings._setoption(arg)
+
+        if item is not None:
+            for mark in item.iter_markers(name="filterwarnings"):
+                for arg in mark.args:
+                    _setoption(warnings, arg)
+
+        yield
+
+        for warning_message in log:
+            ihook.pytest_warning_captured.call_historic(
+                kwargs=dict(warning_message=warning_message, when=when, item=item)
+            )
+
+
+def warning_record_to_str(warning_message):
+    """Convert a warnings.WarningMessage to a string."""
+    warn_msg = warning_message.message
+    msg = warnings.formatwarning(
+        warn_msg,
+        warning_message.category,
+        warning_message.filename,
+        warning_message.lineno,
+        warning_message.line,
+    )
+    return msg
+
+
+@pytest.hookimpl(hookwrapper=True, tryfirst=True)
+def pytest_runtest_protocol(item):
+    with catch_warnings_for_item(
+        config=item.config, ihook=item.ihook, when="runtest", item=item
+    ):
+        yield
+
+
+@pytest.hookimpl(hookwrapper=True, tryfirst=True)
+def pytest_collection(session: Session) -> Generator[None, None, None]:
+    config = session.config
+    with catch_warnings_for_item(
+        config=config, ihook=config.hook, when="collect", item=None
+    ):
+        yield
+
+
+@pytest.hookimpl(hookwrapper=True)
+def pytest_terminal_summary(terminalreporter):
+    config = terminalreporter.config
+    with catch_warnings_for_item(
+        config=config, ihook=config.hook, when="config", item=None
+    ):
+        yield
+
+
+@pytest.hookimpl(hookwrapper=True)
+def pytest_sessionfinish(session):
+    config = session.config
+    with catch_warnings_for_item(
+        config=config, ihook=config.hook, when="config", item=None
+    ):
+        yield
+
+
+def _issue_warning_captured(warning, hook, stacklevel):
+    """
+    This function should be used instead of calling ``warnings.warn`` directly when we are in the "configure" stage:
+    at this point the actual options might not have been set, so we manually trigger the pytest_warning_captured
+    hook so we can display these warnings in the terminal. This is a hack until we can sort out #2891.
+
+    :param warning: the warning instance.
+    :param hook: the hook caller
+    :param stacklevel: stacklevel forwarded to warnings.warn
+    """
+    with warnings.catch_warnings(record=True) as records:
+        warnings.simplefilter("always", type(warning))
+        warnings.warn(warning, stacklevel=stacklevel)
+    # Mypy can't infer that record=True means records is not None; help it.
+    assert records is not None
+    frame = sys._getframe(stacklevel - 1)
+    location = frame.f_code.co_filename, frame.f_lineno, frame.f_code.co_name
+    hook.pytest_warning_captured.call_historic(
+        kwargs=dict(
+            warning_message=records[0], when="config", item=None, location=location
+        )
+    )
diff --git a/contrib/python/pytest/py3/patches/03-limit-id.patch b/contrib/python/pytest/py3/patches/03-limit-id.patch
new file mode 100644
index 0000000000..ba1c199517
--- /dev/null
+++ b/contrib/python/pytest/py3/patches/03-limit-id.patch
@@ -0,0 +1,36 @@
+--- contrib/python/pytest/py3/_pytest/python.py	(index)
++++ contrib/python/pytest/py3/_pytest/python.py	(working tree)
+@@ -1192,6 +1192,33 @@ def _idval(val, argname, idx, idfn, item, config):
+     return str(argname) + str(idx)
+ 
+ 
++def limit_idval(limit):
++    import functools
++
++    names = {}
++    limit -= 6
++    assert limit > 0
++
++    def decorator(func):
++        @functools.wraps(func)
++        def wrapper(*args, **kw):
++            idval = func(*args, **kw)
++            if len(idval) > limit:
++                prefix = idval[:limit]
++                # There might be same prefix for the different test cases - take item into account
++                name = "{}-{}".format(kw.get('item', ''), prefix)
++                idx = names.setdefault(name, -1) + 1
++                names[name] = idx
++                idval = "{}-{}".format(prefix, idx)
++            return idval
++
++        return wrapper
++
++    return decorator
++
++
++# XXX limit testnames in the name of sanity and readability
++@limit_idval(limit=500)
+ def _idvalset(
+     idx: int,
+     parameterset: ParameterSet,
diff --git a/contrib/python/pytest/py3/patches/04-support-cyrillic-id.patch b/contrib/python/pytest/py3/patches/04-support-cyrillic-id.patch
new file mode 100644
index 0000000000..c45fd08282
--- /dev/null
+++ b/contrib/python/pytest/py3/patches/04-support-cyrillic-id.patch
@@ -0,0 +1,11 @@
+--- contrib/python/pytest/py3/_pytest/compat.py	(index)
++++ contrib/python/pytest/py3/_pytest/compat.py	(working tree)
+@@ -255,7 +255,7 @@ if _PY3:
+     if isinstance(val, bytes):
+         ret = _bytes_to_ascii(val)
+     else:
+-        ret = val.encode("unicode_escape").decode("ascii")
++        ret = val
+     return _translate_non_printable(ret)
+ 
+ 
diff --git a/contrib/python/pytest/py3/patches/05-support-readline.patch b/contrib/python/pytest/py3/patches/05-support-readline.patch
new file mode 100644
index 0000000000..11d6b94f0d
--- /dev/null
+++ b/contrib/python/pytest/py3/patches/05-support-readline.patch
@@ -0,0 +1,69 @@
+--- contrib/python/pytest/py3/_pytest/debugging.py	(index)
++++ contrib/python/pytest/py3/_pytest/debugging.py	(working tree)
+@@ -1,6 +1,7 @@ from __future__ import absolute_import
+ """ interactive debugging with PDB, the Python Debugger. """
+ import argparse
+ import functools
++import os
+ import sys
+ 
+ from _pytest import outcomes
+@@ -9,6 +10,42 @@ from _pytest import outcomes
+ from _pytest.config.exceptions import UsageError
+ 
+ 
++def import_readline():
++    try:
++        import readline
++    except ImportError:
++        sys.path.append('/usr/lib/python2.7/lib-dynload')
++
++    try:
++        import readline
++    except ImportError as e:
++        print('can not import readline:', e)
++
++        import subprocess
++        try:
++            subprocess.check_call('stty icrnl'.split())
++        except OSError as e:
++            print('can not restore Enter, use Control+J:', e)
++
++
++def tty():
++    if os.isatty(1):
++        return
++
++    fd = os.open('/dev/tty', os.O_RDWR)
++    os.dup2(fd, 0)
++    os.dup2(fd, 1)
++    os.dup2(fd, 2)
++    os.close(fd)
++
++    old_sys_path = sys.path
++    sys.path = list(sys.path)
++    try:
++        import_readline()
++    finally:
++        sys.path = old_sys_path
++
++
+ def _validate_usepdb_cls(value):
+     """Validate syntax of --pdbcls option."""
+     try:
+@@ -250,6 +287,7 @@ class pytestPDB(object):
+     @classmethod
+     def set_trace(cls, *args, **kwargs) -> None:
+         """Invoke debugging via ``Pdb.set_trace``, dropping any IO capturing."""
++        tty()
+         frame = sys._getframe().f_back
+         _pdb = cls._init_pdb("set_trace", *args, **kwargs)
+         _pdb.set_trace(frame)
+@@ -292,6 +330,7 @@ class PdbInvoke(object):
+             out, err = capman.read_global_capture()
+             sys.stdout.write(out)
+             sys.stdout.write(err)
++        tty()
+         _enter_pdb(node, call.excinfo, report)
+ 
+      def pytest_internalerror(self, excrepr, excinfo):
diff --git a/contrib/python/pytest/py3/patches/06-support-ya-markers.patch b/contrib/python/pytest/py3/patches/06-support-ya-markers.patch
new file mode 100644
index 0000000000..373d89c866
--- /dev/null
+++ b/contrib/python/pytest/py3/patches/06-support-ya-markers.patch
@@ -0,0 +1,14 @@
+--- contrib/python/pytest/py3/_pytest/mark/structures.py	(index)
++++ contrib/python/pytest/py3/_pytest/mark/structures.py	(working tree)
+@@ -326,7 +326,10 @@ class MarkGenerator(object):
+                     # example lines: "skipif(condition): skip the given test if..."
+                     # or "hypothesis: tests which use Hypothesis", so to get the
+                     # marker name we split on both `:` and `(`.
+-                    marker = line.split(":")[0].split("(")[0].strip()
++                    if line == "ya:external":
++                        marker = line
++                    else:
++                        marker = line.split(":")[0].split("(")[0].strip()
+                     self._markers.add(marker)
+ 
+             # If the name is not in the set of known marks after updating,
diff --git a/contrib/python/pytest/py3/patches/07-disable-translate-non-printable.patch b/contrib/python/pytest/py3/patches/07-disable-translate-non-printable.patch
new file mode 100644
index 0000000000..1d0b80c6d4
--- /dev/null
+++ b/contrib/python/pytest/py3/patches/07-disable-translate-non-printable.patch
@@ -0,0 +1,11 @@
+--- contrib/python/pytest/py3/_pytest/compat.py	(index)
++++ contrib/python/pytest/py3/_pytest/compat.py	(working tree)
+@@ -256,7 +256,7 @@ if _PY3:
+         ret = _bytes_to_ascii(val)
+     else:
+         ret = val
+-    return _translate_non_printable(ret)
++    return ret
+ 
+ 
+ @attr.s
diff --git a/contrib/python/pytest/py3/patches/08-fix-win-peerdir.patch b/contrib/python/pytest/py3/patches/08-fix-win-peerdir.patch
new file mode 100644
index 0000000000..d6a56ef6e0
--- /dev/null
+++ b/contrib/python/pytest/py3/patches/08-fix-win-peerdir.patch
@@ -0,0 +1,15 @@
+--- contrib/python/pytest/py3/ya.make	(index)
++++ contrib/python/pytest/py3/ya.make	(working tree)
+@@ -15,6 +15,12 @@ PEERDIR(
+     contrib/python/wcwidth
+ )
+ 
++IF (OS_WINDOWS)
++    PEERDIR(
++        contrib/python/atomicwrites
++    )
++ENDIF()
++
+ NO_LINT()
+ 
+ NO_CHECK_IMPORTS(
diff --git a/contrib/python/pytest/py3/pytest/__init__.py b/contrib/python/pytest/py3/pytest/__init__.py
new file mode 100644
index 0000000000..33bc3d0fbe
--- /dev/null
+++ b/contrib/python/pytest/py3/pytest/__init__.py
@@ -0,0 +1,99 @@
+# PYTHON_ARGCOMPLETE_OK
+"""
+pytest: unit and functional testing with Python.
+"""
+from _pytest import __version__
+from _pytest.assertion import register_assert_rewrite
+from _pytest.compat import _setup_collect_fakemodule
+from _pytest.config import cmdline
+from _pytest.config import ExitCode
+from _pytest.config import hookimpl
+from _pytest.config import hookspec
+from _pytest.config import main
+from _pytest.config import UsageError
+from _pytest.debugging import pytestPDB as __pytestPDB
+from _pytest.fixtures import fillfixtures as _fillfuncargs
+from _pytest.fixtures import fixture
+from _pytest.fixtures import yield_fixture
+from _pytest.freeze_support import freeze_includes
+from _pytest.main import Session
+from _pytest.mark import MARK_GEN as mark
+from _pytest.mark import param
+from _pytest.nodes import Collector
+from _pytest.nodes import File
+from _pytest.nodes import Item
+from _pytest.outcomes import exit
+from _pytest.outcomes import fail
+from _pytest.outcomes import importorskip
+from _pytest.outcomes import skip
+from _pytest.outcomes import xfail
+from _pytest.python import Class
+from _pytest.python import Function
+from _pytest.python import Instance
+from _pytest.python import Module
+from _pytest.python import Package
+from _pytest.python_api import approx
+from _pytest.python_api import raises
+from _pytest.recwarn import deprecated_call
+from _pytest.recwarn import warns
+from _pytest.warning_types import PytestAssertRewriteWarning
+from _pytest.warning_types import PytestCacheWarning
+from _pytest.warning_types import PytestCollectionWarning
+from _pytest.warning_types import PytestConfigWarning
+from _pytest.warning_types import PytestDeprecationWarning
+from _pytest.warning_types import PytestExperimentalApiWarning
+from _pytest.warning_types import PytestUnhandledCoroutineWarning
+from _pytest.warning_types import PytestUnknownMarkWarning
+from _pytest.warning_types import PytestWarning
+
+
+set_trace = __pytestPDB.set_trace
+
+__all__ = [
+    "__version__",
+    "_fillfuncargs",
+    "approx",
+    "Class",
+    "cmdline",
+    "Collector",
+    "deprecated_call",
+    "exit",
+    "ExitCode",
+    "fail",
+    "File",
+    "fixture",
+    "freeze_includes",
+    "Function",
+    "hookimpl",
+    "hookspec",
+    "importorskip",
+    "Instance",
+    "Item",
+    "main",
+    "mark",
+    "Module",
+    "Package",
+    "param",
+    "PytestAssertRewriteWarning",
+    "PytestCacheWarning",
+    "PytestCollectionWarning",
+    "PytestConfigWarning",
+    "PytestDeprecationWarning",
+    "PytestExperimentalApiWarning",
+    "PytestUnhandledCoroutineWarning",
+    "PytestUnknownMarkWarning",
+    "PytestWarning",
+    "raises",
+    "register_assert_rewrite",
+    "Session",
+    "set_trace",
+    "skip",
+    "UsageError",
+    "warns",
+    "xfail",
+    "yield_fixture",
+]
+
+
+_setup_collect_fakemodule()
+del _setup_collect_fakemodule
diff --git a/contrib/python/pytest/py3/pytest/__main__.py b/contrib/python/pytest/py3/pytest/__main__.py
new file mode 100644
index 0000000000..01b2f6ccfe
--- /dev/null
+++ b/contrib/python/pytest/py3/pytest/__main__.py
@@ -0,0 +1,7 @@
+"""
+pytest entry point
+"""
+import pytest
+
+if __name__ == "__main__":
+    raise SystemExit(pytest.main())
diff --git a/contrib/python/pytest/py3/ya.make b/contrib/python/pytest/py3/ya.make
new file mode 100644
index 0000000000..88de1914cb
--- /dev/null
+++ b/contrib/python/pytest/py3/ya.make
@@ -0,0 +1,101 @@
+PY3_LIBRARY()
+
+OWNER(dmitko g:python-contrib)
+
+VERSION(5.4.3)
+
+LICENSE(MIT)
+
+PEERDIR(
+    contrib/python/attrs
+    contrib/python/more-itertools
+    contrib/python/packaging
+    contrib/python/pluggy
+    contrib/python/py
+    contrib/python/wcwidth
+)
+
+IF (OS_WINDOWS)
+    PEERDIR(
+        contrib/python/atomicwrites
+    )
+ENDIF()
+
+NO_LINT()
+
+NO_CHECK_IMPORTS(
+    __tests__.*  # all test modules get imported when tests are run
+    _pytest.*
+)
+
+PY_SRCS(
+    TOP_LEVEL
+    _pytest/__init__.py
+    _pytest/_argcomplete.py
+    _pytest/_code/__init__.py
+    _pytest/_code/code.py
+    _pytest/_code/source.py
+    _pytest/_io/__init__.py
+    _pytest/_io/saferepr.py
+    _pytest/_version.py
+    _pytest/assertion/__init__.py
+    _pytest/assertion/rewrite.py
+    _pytest/assertion/truncate.py
+    _pytest/assertion/util.py
+    _pytest/cacheprovider.py
+    _pytest/capture.py
+    _pytest/compat.py
+    _pytest/config/__init__.py
+    _pytest/config/argparsing.py
+    _pytest/config/exceptions.py
+    _pytest/config/findpaths.py
+    _pytest/debugging.py
+    _pytest/deprecated.py
+    _pytest/doctest.py
+    _pytest/faulthandler.py
+    _pytest/fixtures.py
+    _pytest/freeze_support.py
+    _pytest/helpconfig.py
+    _pytest/hookspec.py
+    _pytest/junitxml.py
+    _pytest/logging.py
+    _pytest/main.py
+    _pytest/mark/__init__.py
+    _pytest/mark/evaluate.py
+    _pytest/mark/legacy.py
+    _pytest/mark/structures.py
+    _pytest/monkeypatch.py
+    _pytest/nodes.py
+    _pytest/nose.py
+    _pytest/outcomes.py
+    _pytest/pastebin.py
+    _pytest/pathlib.py
+    _pytest/pytester.py
+    _pytest/python.py
+    _pytest/python_api.py
+    _pytest/recwarn.py
+    _pytest/reports.py
+    _pytest/resultlog.py
+    _pytest/runner.py
+    _pytest/setuponly.py
+    _pytest/setupplan.py
+    _pytest/skipping.py
+    _pytest/stepwise.py
+    _pytest/store.py
+    _pytest/terminal.py
+    _pytest/tmpdir.py
+    _pytest/unittest.py
+    _pytest/warning_types.py
+    _pytest/warnings.py
+    pytest/__init__.py
+    pytest/__main__.py
+)
+
+RESOURCE_FILES(
+    PREFIX contrib/python/pytest/py3/
+    .dist-info/METADATA
+    .dist-info/entry_points.txt
+    .dist-info/top_level.txt
+)
+
+END()