diff options
author | Devtools Arcadia <arcadia-devtools@yandex-team.ru> | 2022-02-07 18:08:42 +0300 |
---|---|---|
committer | Devtools Arcadia <arcadia-devtools@mous.vla.yp-c.yandex.net> | 2022-02-07 18:08:42 +0300 |
commit | 1110808a9d39d4b808aef724c861a2e1a38d2a69 (patch) | |
tree | e26c9fed0de5d9873cce7e00bc214573dc2195b7 /contrib/python/pytest | |
download | ydb-1110808a9d39d4b808aef724c861a2e1a38d2a69.tar.gz |
intermediate changes
ref:cde9a383711a11544ce7e107a78147fb96cc4029
Diffstat (limited to 'contrib/python/pytest')
145 files changed, 47495 insertions, 0 deletions
diff --git a/contrib/python/pytest/py2/.dist-info/METADATA b/contrib/python/pytest/py2/.dist-info/METADATA new file mode 100644 index 00000000000..251bfce1eef --- /dev/null +++ b/contrib/python/pytest/py2/.dist-info/METADATA @@ -0,0 +1,195 @@ +Metadata-Version: 2.1 +Name: pytest +Version: 4.6.11 +Summary: pytest: simple powerful testing with Python +Home-page: https://docs.pytest.org/en/latest/ +Author: Holger Krekel, Bruno Oliveira, Ronny Pfannschmidt, Floris Bruynooghe, Brianna Laugher, Florian Bruhin and others +License: MIT license +Project-URL: Source, https://github.com/pytest-dev/pytest +Project-URL: Tracker, https://github.com/pytest-dev/pytest/issues +Keywords: test,unittest +Platform: unix +Platform: linux +Platform: osx +Platform: cygwin +Platform: win32 +Classifier: Development Status :: 6 - Mature +Classifier: Intended Audience :: Developers +Classifier: License :: OSI Approved :: MIT License +Classifier: Operating System :: POSIX +Classifier: Operating System :: Microsoft :: Windows +Classifier: Operating System :: MacOS :: MacOS X +Classifier: Topic :: Software Development :: Testing +Classifier: Topic :: Software Development :: Libraries +Classifier: Topic :: Utilities +Classifier: Programming Language :: Python :: 2 +Classifier: Programming Language :: Python :: 2.7 +Classifier: Programming Language :: Python :: 3 +Classifier: Programming Language :: Python :: 3.4 +Classifier: Programming Language :: Python :: 3.5 +Classifier: Programming Language :: Python :: 3.6 +Classifier: Programming Language :: Python :: 3.7 +Classifier: Programming Language :: Python :: 3.8 +Classifier: Programming Language :: Python :: 3.9 +Requires-Python: !=3.0.*,!=3.1.*,!=3.2.*,!=3.3.*,>=2.7 +Requires-Dist: py (>=1.5.0) +Requires-Dist: six (>=1.10.0) +Requires-Dist: packaging +Requires-Dist: attrs (>=17.4.0) +Requires-Dist: atomicwrites (>=1.0) +Requires-Dist: pluggy (<1.0,>=0.12) +Requires-Dist: wcwidth +Requires-Dist: funcsigs (>=1.0) ; python_version < "3.0" +Requires-Dist: pathlib2 (>=2.2.0) ; python_version < "3.6" +Requires-Dist: importlib-metadata (>=0.12) ; python_version < "3.8" +Requires-Dist: more-itertools (<6.0.0,>=4.0.0) ; python_version <= "2.7" +Requires-Dist: more-itertools (>=4.0.0) ; python_version > "2.7" +Requires-Dist: colorama ; sys_platform == "win32" and python_version != "3.4" +Requires-Dist: colorama (<=0.4.1) ; sys_platform == "win32" and python_version == "3.4" +Provides-Extra: testing +Requires-Dist: argcomplete ; extra == 'testing' +Requires-Dist: hypothesis (>=3.56) ; extra == 'testing' +Requires-Dist: nose ; extra == 'testing' +Requires-Dist: requests ; extra == 'testing' +Requires-Dist: mock ; (python_version == "2.7") and extra == 'testing' + +.. image:: https://docs.pytest.org/en/latest/_static/pytest1.png + :target: https://docs.pytest.org/en/latest/ + :align: center + :alt: pytest + + +------ + +.. image:: https://img.shields.io/pypi/v/pytest.svg + :target: https://pypi.org/project/pytest/ + +.. image:: https://img.shields.io/conda/vn/conda-forge/pytest.svg + :target: https://anaconda.org/conda-forge/pytest + +.. image:: https://img.shields.io/pypi/pyversions/pytest.svg + :target: https://pypi.org/project/pytest/ + +.. image:: https://codecov.io/gh/pytest-dev/pytest/branch/master/graph/badge.svg + :target: https://codecov.io/gh/pytest-dev/pytest + :alt: Code coverage Status + +.. image:: https://travis-ci.org/pytest-dev/pytest.svg?branch=master + :target: https://travis-ci.org/pytest-dev/pytest + +.. image:: https://dev.azure.com/pytest-dev/pytest/_apis/build/status/pytest-CI?branchName=master + :target: https://dev.azure.com/pytest-dev/pytest + +.. image:: https://img.shields.io/badge/code%20style-black-000000.svg + :target: https://github.com/python/black + +.. image:: https://www.codetriage.com/pytest-dev/pytest/badges/users.svg + :target: https://www.codetriage.com/pytest-dev/pytest + +The ``pytest`` framework makes it easy to write small tests, yet +scales to support complex functional testing for applications and libraries. + +An example of a simple test: + +.. code-block:: python + + # content of test_sample.py + def inc(x): + return x + 1 + + + def test_answer(): + assert inc(3) == 5 + + +To execute it:: + + $ pytest + ============================= test session starts ============================= + collected 1 items + + test_sample.py F + + ================================== FAILURES =================================== + _________________________________ test_answer _________________________________ + + def test_answer(): + > assert inc(3) == 5 + E assert 4 == 5 + E + where 4 = inc(3) + + test_sample.py:5: AssertionError + ========================== 1 failed in 0.04 seconds =========================== + + +Due to ``pytest``'s detailed assertion introspection, only plain ``assert`` statements are used. See `getting-started <https://docs.pytest.org/en/latest/getting-started.html#our-first-test-run>`_ for more examples. + + +Features +-------- + +- Detailed info on failing `assert statements <https://docs.pytest.org/en/latest/assert.html>`_ (no need to remember ``self.assert*`` names); + +- `Auto-discovery + <https://docs.pytest.org/en/latest/goodpractices.html#python-test-discovery>`_ + of test modules and functions; + +- `Modular fixtures <https://docs.pytest.org/en/latest/fixture.html>`_ for + managing small or parametrized long-lived test resources; + +- Can run `unittest <https://docs.pytest.org/en/latest/unittest.html>`_ (or trial), + `nose <https://docs.pytest.org/en/latest/nose.html>`_ test suites out of the box; + +- Python 2.7, Python 3.4+, PyPy 2.3, Jython 2.5 (untested); + +- Rich plugin architecture, with over 315+ `external plugins <http://plugincompat.herokuapp.com>`_ and thriving community; + + +Documentation +------------- + +For full documentation, including installation, tutorials and PDF documents, please see https://docs.pytest.org/en/latest/. + + +Bugs/Requests +------------- + +Please use the `GitHub issue tracker <https://github.com/pytest-dev/pytest/issues>`_ to submit bugs or request features. + + +Changelog +--------- + +Consult the `Changelog <https://docs.pytest.org/en/latest/changelog.html>`__ page for fixes and enhancements of each version. + + +Support pytest +-------------- + +You can support pytest by obtaining a `Tideflift subscription`_. + +Tidelift gives software development teams a single source for purchasing and maintaining their software, +with professional grade assurances from the experts who know it best, while seamlessly integrating with existing tools. + + +.. _`Tideflift subscription`: https://tidelift.com/subscription/pkg/pypi-pytest?utm_source=pypi-pytest&utm_medium=referral&utm_campaign=readme + + +Security +^^^^^^^^ + +pytest has never been associated with a security vunerability, but in any case, to report a +security vulnerability please use the `Tidelift security contact <https://tidelift.com/security>`_. +Tidelift will coordinate the fix and disclosure. + + +License +------- + +Copyright Holger Krekel and others, 2004-2020. + +Distributed under the terms of the `MIT`_ license, pytest is free and open source software. + +.. _`MIT`: https://github.com/pytest-dev/pytest/blob/master/LICENSE + + diff --git a/contrib/python/pytest/py2/.dist-info/entry_points.txt b/contrib/python/pytest/py2/.dist-info/entry_points.txt new file mode 100644 index 00000000000..d8e4fd298fe --- /dev/null +++ b/contrib/python/pytest/py2/.dist-info/entry_points.txt @@ -0,0 +1,4 @@ +[console_scripts] +py.test = pytest:main +pytest = pytest:main + diff --git a/contrib/python/pytest/py2/.dist-info/top_level.txt b/contrib/python/pytest/py2/.dist-info/top_level.txt new file mode 100644 index 00000000000..e94857af964 --- /dev/null +++ b/contrib/python/pytest/py2/.dist-info/top_level.txt @@ -0,0 +1,2 @@ +_pytest +pytest diff --git a/contrib/python/pytest/py2/AUTHORS b/contrib/python/pytest/py2/AUTHORS new file mode 100644 index 00000000000..80fce539294 --- /dev/null +++ b/contrib/python/pytest/py2/AUTHORS @@ -0,0 +1,263 @@ +Holger Krekel, holger at merlinux eu +merlinux GmbH, Germany, office at merlinux eu + +Contributors include:: + +Aaron Coleman +Abdeali JK +Abhijeet Kasurde +Adam Johnson +Adam Uhlir +Ahn Ki-Wook +Akiomi Kamakura +Alan Velasco +Alexander Johnson +Alexei Kozlenok +Allan Feldman +Aly Sivji +Anatoly Bubenkoff +Anders Hovmöller +Andras Mitzki +Andras Tim +Andrea Cimatoribus +Andreas Zeidler +Andrey Paramonov +Andrzej Ostrowski +Andy Freeland +Anthon van der Neut +Anthony Shaw +Anthony Sottile +Anton Lodder +Antony Lee +Arel Cordero +Armin Rigo +Aron Coyle +Aron Curzon +Aviral Verma +Aviv Palivoda +Barney Gale +Ben Webb +Benjamin Peterson +Bernard Pratz +Bob Ippolito +Brian Dorsey +Brian Maissy +Brian Okken +Brianna Laugher +Bruno Oliveira +Cal Leeming +Carl Friedrich Bolz +Carlos Jenkins +Ceridwen +Charles Cloud +Charnjit SiNGH (CCSJ) +Chris Lamb +Christian Boelsen +Christian Fetzer +Christian Theunert +Christian Tismer +Christopher Gilling +Christopher Dignam +Claudio Madotto +CrazyMerlyn +Cyrus Maden +Damian Skrzypczak +Dhiren Serai +Daniel Grana +Daniel Hahler +Daniel Nuri +Daniel Wandschneider +Danielle Jenkins +Dave Hunt +David Díaz-Barquero +David Mohr +David Szotten +David Vierra +Daw-Ran Liou +Denis Kirisov +Diego Russo +Dmitry Dygalo +Dmitry Pribysh +Duncan Betts +Edison Gustavo Muenz +Edoardo Batini +Eduardo Schettino +Eli Boyarski +Elizaveta Shashkova +Endre Galaczi +Eric Hunsberger +Eric Siegerman +Erik M. Bray +Evan Kepner +Fabien Zarifian +Fabio Zadrozny +Feng Ma +Fernando Mezzabotta Rey +Florian Bruhin +Floris Bruynooghe +Gabriel Reis +George Kussumoto +Georgy Dyuldin +Graham Horler +Greg Price +Grig Gheorghiu +Grigorii Eremeev (budulianin) +Guido Wesdorp +Guoqiang Zhang +Harald Armin Massa +Henk-Jaap Wagenaar +Hugo van Kemenade +Hui Wang (coldnight) +Ian Bicking +Ian Lesperance +Ilya Konstantinov +Ionuț Turturică +Iwan Briquemont +Jaap Broekhuizen +Jan Balster +Janne Vanhala +Jason R. Coombs +Javier Domingo Cansino +Javier Romero +Jeff Rackauckas +Jeff Widman +Jenni Rinker +John Eddie Ayson +John Towler +Jon Sonesen +Jonas Obrist +Jordan Guymon +Jordan Moldow +Jordan Speicher +Joseph Hunkeler +Joshua Bronson +Jurko Gospodnetić +Justyna Janczyszyn +Kale Kundert +Katarzyna Jachim +Katerina Koukiou +Kevin Cox +Kevin J. Foley +Kodi B. Arfer +Kostis Anagnostopoulos +Kristoffer Nordström +Kyle Altendorf +Lawrence Mitchell +Lee Kamentsky +Lev Maximov +Llandy Riveron Del Risco +Loic Esteve +Lukas Bednar +Luke Murphy +Maciek Fijalkowski +Maho +Maik Figura +Mandeep Bhutani +Manuel Krebber +Marc Schlaich +Marcelo Duarte Trevisani +Marcin Bachry +Mark Abramowitz +Markus Unterwaditzer +Martijn Faassen +Martin Altmayer +Martin K. Scherer +Martin Prusse +Mathieu Clabaut +Matt Bachmann +Matt Duck +Matt Williams +Matthias Hafner +Maxim Filipenko +mbyt +Michael Aquilina +Michael Birtwell +Michael Droettboom +Michael Seifert +Michal Wajszczuk +Mihai Capotă +Mike Hoyle (hoylemd) +Mike Lundy +Miro Hrončok +Nathaniel Waisbrot +Ned Batchelder +Neven Mundar +Nicholas Devenish +Nicholas Murphy +Niclas Olofsson +Nicolas Delaby +Nikolay Kondratyev +Oleg Pidsadnyi +Oleg Sushchenko +Oliver Bestwalter +Omar Kohl +Omer Hadari +Ondřej Súkup +Oscar Benjamin +Patrick Hayes +Paweł Adamczak +Pedro Algarvio +Pieter Mulder +Piotr Banaszkiewicz +Pulkit Goyal +Punyashloka Biswal +Quentin Pradet +Ralf Schmitt +Ran Benita +Raphael Castaneda +Raphael Pierzina +Raquel Alegre +Ravi Chandra +Roberto Polli +Roland Puntaier +Romain Dorgueil +Roman Bolshakov +Ronny Pfannschmidt +Ross Lawley +Russel Winder +Ryan Wooden +Samuel Dion-Girardeau +Samuel Searles-Bryant +Samuele Pedroni +Sankt Petersbug +Segev Finer +Serhii Mozghovyi +Simon Gomizelj +Skylar Downes +Srinivas Reddy Thatiparthy +Stefan Farmbauer +Stefan Zimmermann +Stefano Taschini +Steffen Allner +Stephan Obermann +Sven-Hendrik Haase +Tadek Teleżyński +Takafumi Arakaki +Tarcisio Fischer +Tareq Alayan +Ted Xiao +Thomas Grainger +Thomas Hisch +Tim Strazny +Tom Dalton +Tom Viner +Tomer Keren +Trevor Bekolay +Tyler Goodlet +Tzu-ping Chung +Vasily Kuznetsov +Victor Maryama +Victor Uriarte +Vidar T. Fauske +Virgil Dupras +Vitaly Lashmanov +Vlad Dragos +Volodymyr Piskun +Wil Cooley +William Lee +Wim Glenn +Wouter van Ackooy +Xuan Luong +Xuecong Liao +Zac Hatfield-Dodds +Zoltán Máté diff --git a/contrib/python/pytest/py2/LICENSE b/contrib/python/pytest/py2/LICENSE new file mode 100644 index 00000000000..d14fb7ff4b3 --- /dev/null +++ b/contrib/python/pytest/py2/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2004-2020 Holger Krekel and others + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/contrib/python/pytest/py2/README.rst b/contrib/python/pytest/py2/README.rst new file mode 100644 index 00000000000..69408978703 --- /dev/null +++ b/contrib/python/pytest/py2/README.rst @@ -0,0 +1,138 @@ +.. image:: https://docs.pytest.org/en/latest/_static/pytest1.png + :target: https://docs.pytest.org/en/latest/ + :align: center + :alt: pytest + + +------ + +.. image:: https://img.shields.io/pypi/v/pytest.svg + :target: https://pypi.org/project/pytest/ + +.. image:: https://img.shields.io/conda/vn/conda-forge/pytest.svg + :target: https://anaconda.org/conda-forge/pytest + +.. image:: https://img.shields.io/pypi/pyversions/pytest.svg + :target: https://pypi.org/project/pytest/ + +.. image:: https://codecov.io/gh/pytest-dev/pytest/branch/master/graph/badge.svg + :target: https://codecov.io/gh/pytest-dev/pytest + :alt: Code coverage Status + +.. image:: https://travis-ci.org/pytest-dev/pytest.svg?branch=master + :target: https://travis-ci.org/pytest-dev/pytest + +.. image:: https://dev.azure.com/pytest-dev/pytest/_apis/build/status/pytest-CI?branchName=master + :target: https://dev.azure.com/pytest-dev/pytest + +.. image:: https://img.shields.io/badge/code%20style-black-000000.svg + :target: https://github.com/python/black + +.. image:: https://www.codetriage.com/pytest-dev/pytest/badges/users.svg + :target: https://www.codetriage.com/pytest-dev/pytest + +The ``pytest`` framework makes it easy to write small tests, yet +scales to support complex functional testing for applications and libraries. + +An example of a simple test: + +.. code-block:: python + + # content of test_sample.py + def inc(x): + return x + 1 + + + def test_answer(): + assert inc(3) == 5 + + +To execute it:: + + $ pytest + ============================= test session starts ============================= + collected 1 items + + test_sample.py F + + ================================== FAILURES =================================== + _________________________________ test_answer _________________________________ + + def test_answer(): + > assert inc(3) == 5 + E assert 4 == 5 + E + where 4 = inc(3) + + test_sample.py:5: AssertionError + ========================== 1 failed in 0.04 seconds =========================== + + +Due to ``pytest``'s detailed assertion introspection, only plain ``assert`` statements are used. See `getting-started <https://docs.pytest.org/en/latest/getting-started.html#our-first-test-run>`_ for more examples. + + +Features +-------- + +- Detailed info on failing `assert statements <https://docs.pytest.org/en/latest/assert.html>`_ (no need to remember ``self.assert*`` names); + +- `Auto-discovery + <https://docs.pytest.org/en/latest/goodpractices.html#python-test-discovery>`_ + of test modules and functions; + +- `Modular fixtures <https://docs.pytest.org/en/latest/fixture.html>`_ for + managing small or parametrized long-lived test resources; + +- Can run `unittest <https://docs.pytest.org/en/latest/unittest.html>`_ (or trial), + `nose <https://docs.pytest.org/en/latest/nose.html>`_ test suites out of the box; + +- Python 2.7, Python 3.4+, PyPy 2.3, Jython 2.5 (untested); + +- Rich plugin architecture, with over 315+ `external plugins <http://plugincompat.herokuapp.com>`_ and thriving community; + + +Documentation +------------- + +For full documentation, including installation, tutorials and PDF documents, please see https://docs.pytest.org/en/latest/. + + +Bugs/Requests +------------- + +Please use the `GitHub issue tracker <https://github.com/pytest-dev/pytest/issues>`_ to submit bugs or request features. + + +Changelog +--------- + +Consult the `Changelog <https://docs.pytest.org/en/latest/changelog.html>`__ page for fixes and enhancements of each version. + + +Support pytest +-------------- + +You can support pytest by obtaining a `Tideflift subscription`_. + +Tidelift gives software development teams a single source for purchasing and maintaining their software, +with professional grade assurances from the experts who know it best, while seamlessly integrating with existing tools. + + +.. _`Tideflift subscription`: https://tidelift.com/subscription/pkg/pypi-pytest?utm_source=pypi-pytest&utm_medium=referral&utm_campaign=readme + + +Security +^^^^^^^^ + +pytest has never been associated with a security vunerability, but in any case, to report a +security vulnerability please use the `Tidelift security contact <https://tidelift.com/security>`_. +Tidelift will coordinate the fix and disclosure. + + +License +------- + +Copyright Holger Krekel and others, 2004-2020. + +Distributed under the terms of the `MIT`_ license, pytest is free and open source software. + +.. _`MIT`: https://github.com/pytest-dev/pytest/blob/master/LICENSE diff --git a/contrib/python/pytest/py2/_pytest/__init__.py b/contrib/python/pytest/py2/_pytest/__init__.py new file mode 100644 index 00000000000..17cc20b615a --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/__init__.py @@ -0,0 +1,9 @@ +# -*- coding: utf-8 -*- +__all__ = ["__version__"] + +try: + from ._version import version as __version__ +except ImportError: + # broken installation, we don't even try + # unknown only works because we do poor mans version compare + __version__ = "unknown" diff --git a/contrib/python/pytest/py2/_pytest/_argcomplete.py b/contrib/python/pytest/py2/_pytest/_argcomplete.py new file mode 100644 index 00000000000..c6cf1d8fddd --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/_argcomplete.py @@ -0,0 +1,110 @@ +# -*- coding: utf-8 -*- +"""allow bash-completion for argparse with argcomplete if installed +needs argcomplete>=0.5.6 for python 3.2/3.3 (older versions fail +to find the magic string, so _ARGCOMPLETE env. var is never set, and +this does not need special code. + +Function try_argcomplete(parser) should be called directly before +the call to ArgumentParser.parse_args(). + +The filescompleter is what you normally would use on the positional +arguments specification, in order to get "dirname/" after "dirn<TAB>" +instead of the default "dirname ": + + optparser.add_argument(Config._file_or_dir, nargs='*' + ).completer=filescompleter + +Other, application specific, completers should go in the file +doing the add_argument calls as they need to be specified as .completer +attributes as well. (If argcomplete is not installed, the function the +attribute points to will not be used). + +SPEEDUP +======= +The generic argcomplete script for bash-completion +(/etc/bash_completion.d/python-argcomplete.sh ) +uses a python program to determine startup script generated by pip. +You can speed up completion somewhat by changing this script to include + # PYTHON_ARGCOMPLETE_OK +so the the python-argcomplete-check-easy-install-script does not +need to be called to find the entry point of the code and see if that is +marked with PYTHON_ARGCOMPLETE_OK + +INSTALL/DEBUGGING +================= +To include this support in another application that has setup.py generated +scripts: +- add the line: + # PYTHON_ARGCOMPLETE_OK + near the top of the main python entry point +- include in the file calling parse_args(): + from _argcomplete import try_argcomplete, filescompleter + , call try_argcomplete just before parse_args(), and optionally add + filescompleter to the positional arguments' add_argument() +If things do not work right away: +- switch on argcomplete debugging with (also helpful when doing custom + completers): + export _ARC_DEBUG=1 +- run: + python-argcomplete-check-easy-install-script $(which appname) + echo $? + will echo 0 if the magic line has been found, 1 if not +- sometimes it helps to find early on errors using: + _ARGCOMPLETE=1 _ARC_DEBUG=1 appname + which should throw a KeyError: 'COMPLINE' (which is properly set by the + global argcomplete script). +""" +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import os +import sys +from glob import glob + + +class FastFilesCompleter(object): + "Fast file completer class" + + def __init__(self, directories=True): + self.directories = directories + + def __call__(self, prefix, **kwargs): + """only called on non option completions""" + if os.path.sep in prefix[1:]: + prefix_dir = len(os.path.dirname(prefix) + os.path.sep) + else: + prefix_dir = 0 + completion = [] + globbed = [] + if "*" not in prefix and "?" not in prefix: + # we are on unix, otherwise no bash + if not prefix or prefix[-1] == os.path.sep: + globbed.extend(glob(prefix + ".*")) + prefix += "*" + globbed.extend(glob(prefix)) + for x in sorted(globbed): + if os.path.isdir(x): + x += "/" + # append stripping the prefix (like bash, not like compgen) + completion.append(x[prefix_dir:]) + return completion + + +if os.environ.get("_ARGCOMPLETE"): + try: + import argcomplete.completers + except ImportError: + sys.exit(-1) + filescompleter = FastFilesCompleter() + + def try_argcomplete(parser): + argcomplete.autocomplete(parser, always_complete_options=False) + + +else: + + def try_argcomplete(parser): + pass + + filescompleter = None diff --git a/contrib/python/pytest/py2/_pytest/_code/__init__.py b/contrib/python/pytest/py2/_pytest/_code/__init__.py new file mode 100644 index 00000000000..1394b2b10e6 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/_code/__init__.py @@ -0,0 +1,15 @@ +# -*- coding: utf-8 -*- +""" python inspection/code generation API """ +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +from .code import Code # noqa +from .code import ExceptionInfo # noqa +from .code import filter_traceback # noqa +from .code import Frame # noqa +from .code import getrawcode # noqa +from .code import Traceback # noqa +from .source import compile_ as compile # noqa +from .source import getfslineno # noqa +from .source import Source # noqa diff --git a/contrib/python/pytest/py2/_pytest/_code/_py2traceback.py b/contrib/python/pytest/py2/_pytest/_code/_py2traceback.py new file mode 100644 index 00000000000..faacc02166e --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/_code/_py2traceback.py @@ -0,0 +1,95 @@ +# -*- coding: utf-8 -*- +# copied from python-2.7.3's traceback.py +# CHANGES: +# - some_str is replaced, trying to create unicode strings +# +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function +from __future__ import unicode_literals + +import types + +from six import text_type + + +def format_exception_only(etype, value): + """Format the exception part of a traceback. + + The arguments are the exception type and value such as given by + sys.last_type and sys.last_value. The return value is a list of + strings, each ending in a newline. + + Normally, the list contains a single string; however, for + SyntaxError exceptions, it contains several lines that (when + printed) display detailed information about where the syntax + error occurred. + + The message indicating which exception occurred is always the last + string in the list. + + """ + + # An instance should not have a meaningful value parameter, but + # sometimes does, particularly for string exceptions, such as + # >>> raise string1, string2 # deprecated + # + # Clear these out first because issubtype(string1, SyntaxError) + # would throw another exception and mask the original problem. + if ( + isinstance(etype, BaseException) + or isinstance(etype, types.InstanceType) + or etype is None + or type(etype) is str + ): + return [_format_final_exc_line(etype, value)] + + stype = etype.__name__ + + if not issubclass(etype, SyntaxError): + return [_format_final_exc_line(stype, value)] + + # It was a syntax error; show exactly where the problem was found. + lines = [] + try: + msg, (filename, lineno, offset, badline) = value.args + except Exception: + pass + else: + filename = filename or "<string>" + lines.append(' File "{}", line {}\n'.format(filename, lineno)) + if badline is not None: + if isinstance(badline, bytes): # python 2 only + badline = badline.decode("utf-8", "replace") + lines.append(" {}\n".format(badline.strip())) + if offset is not None: + caretspace = badline.rstrip("\n")[:offset].lstrip() + # non-space whitespace (likes tabs) must be kept for alignment + caretspace = ((c.isspace() and c or " ") for c in caretspace) + # only three spaces to account for offset1 == pos 0 + lines.append(" {}^\n".format("".join(caretspace))) + value = msg + + lines.append(_format_final_exc_line(stype, value)) + return lines + + +def _format_final_exc_line(etype, value): + """Return a list of a single line -- normal case for format_exception_only""" + valuestr = _some_str(value) + if value is None or not valuestr: + line = "{}\n".format(etype) + else: + line = "{}: {}\n".format(etype, valuestr) + return line + + +def _some_str(value): + try: + return text_type(value) + except Exception: + try: + return bytes(value).decode("UTF-8", "replace") + except Exception: + pass + return "<unprintable {} object>".format(type(value).__name__) diff --git a/contrib/python/pytest/py2/_pytest/_code/code.py b/contrib/python/pytest/py2/_pytest/_code/code.py new file mode 100644 index 00000000000..175d6fda01d --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/_code/code.py @@ -0,0 +1,1093 @@ +# -*- coding: utf-8 -*- +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import inspect +import re +import sys +import traceback +from inspect import CO_VARARGS +from inspect import CO_VARKEYWORDS +from weakref import ref + +import attr +import pluggy +import py +from six import text_type + +import _pytest +from _pytest._io.saferepr import safeformat +from _pytest._io.saferepr import saferepr +from _pytest.compat import _PY2 +from _pytest.compat import _PY3 +from _pytest.compat import PY35 +from _pytest.compat import safe_str + +if _PY3: + from traceback import format_exception_only +else: + from ._py2traceback import format_exception_only + + +class Code(object): + """ wrapper around Python code objects """ + + def __init__(self, rawcode): + if not hasattr(rawcode, "co_filename"): + rawcode = getrawcode(rawcode) + try: + self.filename = rawcode.co_filename + self.firstlineno = rawcode.co_firstlineno - 1 + self.name = rawcode.co_name + except AttributeError: + raise TypeError("not a code object: %r" % (rawcode,)) + self.raw = rawcode + + def __eq__(self, other): + return self.raw == other.raw + + __hash__ = None + + def __ne__(self, other): + return not self == other + + @property + def path(self): + """ return a path object pointing to source code (note that it + might not point to an actually existing file). """ + try: + p = py.path.local(self.raw.co_filename) + # maybe don't try this checking + if not p.check(): + raise OSError("py.path check failed.") + except OSError: + # XXX maybe try harder like the weird logic + # in the standard lib [linecache.updatecache] does? + p = self.raw.co_filename + + return p + + @property + def fullsource(self): + """ return a _pytest._code.Source object for the full source file of the code + """ + from _pytest._code import source + + full, _ = source.findsource(self.raw) + return full + + def source(self): + """ return a _pytest._code.Source object for the code object's source only + """ + # return source only for that part of code + import _pytest._code + + return _pytest._code.Source(self.raw) + + def getargs(self, var=False): + """ return a tuple with the argument names for the code object + + if 'var' is set True also return the names of the variable and + keyword arguments when present + """ + # handfull shortcut for getting args + raw = self.raw + argcount = raw.co_argcount + if var: + argcount += raw.co_flags & CO_VARARGS + argcount += raw.co_flags & CO_VARKEYWORDS + return raw.co_varnames[:argcount] + + +class Frame(object): + """Wrapper around a Python frame holding f_locals and f_globals + in which expressions can be evaluated.""" + + def __init__(self, frame): + self.lineno = frame.f_lineno - 1 + self.f_globals = frame.f_globals + self.f_locals = frame.f_locals + self.raw = frame + self.code = Code(frame.f_code) + + @property + def statement(self): + """ statement this frame is at """ + import _pytest._code + + if self.code.fullsource is None: + return _pytest._code.Source("") + return self.code.fullsource.getstatement(self.lineno) + + def eval(self, code, **vars): + """ evaluate 'code' in the frame + + 'vars' are optional additional local variables + + returns the result of the evaluation + """ + f_locals = self.f_locals.copy() + f_locals.update(vars) + return eval(code, self.f_globals, f_locals) + + def exec_(self, code, **vars): + """ exec 'code' in the frame + + 'vars' are optiona; additional local variables + """ + f_locals = self.f_locals.copy() + f_locals.update(vars) + exec(code, self.f_globals, f_locals) + + def repr(self, object): + """ return a 'safe' (non-recursive, one-line) string repr for 'object' + """ + return saferepr(object) + + def is_true(self, object): + return object + + def getargs(self, var=False): + """ return a list of tuples (name, value) for all arguments + + if 'var' is set True also include the variable and keyword + arguments when present + """ + retval = [] + for arg in self.code.getargs(var): + try: + retval.append((arg, self.f_locals[arg])) + except KeyError: + pass # this can occur when using Psyco + return retval + + +class TracebackEntry(object): + """ a single entry in a traceback """ + + _repr_style = None + exprinfo = None + + def __init__(self, rawentry, excinfo=None): + self._excinfo = excinfo + self._rawentry = rawentry + self.lineno = rawentry.tb_lineno - 1 + + def set_repr_style(self, mode): + assert mode in ("short", "long") + self._repr_style = mode + + @property + def frame(self): + import _pytest._code + + return _pytest._code.Frame(self._rawentry.tb_frame) + + @property + def relline(self): + return self.lineno - self.frame.code.firstlineno + + def __repr__(self): + return "<TracebackEntry %s:%d>" % (self.frame.code.path, self.lineno + 1) + + @property + def statement(self): + """ _pytest._code.Source object for the current statement """ + source = self.frame.code.fullsource + return source.getstatement(self.lineno) + + @property + def path(self): + """ path to the source code """ + return self.frame.code.path + + def getlocals(self): + return self.frame.f_locals + + locals = property(getlocals, None, None, "locals of underlaying frame") + + def getfirstlinesource(self): + # on Jython this firstlineno can be -1 apparently + return max(self.frame.code.firstlineno, 0) + + def getsource(self, astcache=None): + """ return failing source code. """ + # we use the passed in astcache to not reparse asttrees + # within exception info printing + from _pytest._code.source import getstatementrange_ast + + source = self.frame.code.fullsource + if source is None: + return None + key = astnode = None + if astcache is not None: + key = self.frame.code.path + if key is not None: + astnode = astcache.get(key, None) + start = self.getfirstlinesource() + try: + astnode, _, end = getstatementrange_ast( + self.lineno, source, astnode=astnode + ) + except SyntaxError: + end = self.lineno + 1 + else: + if key is not None: + astcache[key] = astnode + return source[start:end] + + source = property(getsource) + + def ishidden(self): + """ return True if the current frame has a var __tracebackhide__ + resolving to True. + + If __tracebackhide__ is a callable, it gets called with the + ExceptionInfo instance and can decide whether to hide the traceback. + + mostly for internal use + """ + f = self.frame + tbh = f.f_locals.get( + "__tracebackhide__", f.f_globals.get("__tracebackhide__", False) + ) + if tbh and callable(tbh): + return tbh(None if self._excinfo is None else self._excinfo()) + return tbh + + def __str__(self): + try: + fn = str(self.path) + except py.error.Error: + fn = "???" + name = self.frame.code.name + try: + line = str(self.statement).lstrip() + except KeyboardInterrupt: + raise + except: # noqa + line = "???" + return " File %r:%d in %s\n %s\n" % (fn, self.lineno + 1, name, line) + + def name(self): + return self.frame.code.raw.co_name + + name = property(name, None, None, "co_name of underlaying code") + + +class Traceback(list): + """ Traceback objects encapsulate and offer higher level + access to Traceback entries. + """ + + Entry = TracebackEntry + + def __init__(self, tb, excinfo=None): + """ initialize from given python traceback object and ExceptionInfo """ + self._excinfo = excinfo + if hasattr(tb, "tb_next"): + + def f(cur): + while cur is not None: + yield self.Entry(cur, excinfo=excinfo) + cur = cur.tb_next + + list.__init__(self, f(tb)) + else: + list.__init__(self, tb) + + def cut(self, path=None, lineno=None, firstlineno=None, excludepath=None): + """ return a Traceback instance wrapping part of this Traceback + + by provding any combination of path, lineno and firstlineno, the + first frame to start the to-be-returned traceback is determined + + this allows cutting the first part of a Traceback instance e.g. + for formatting reasons (removing some uninteresting bits that deal + with handling of the exception/traceback) + """ + for x in self: + code = x.frame.code + codepath = code.path + if ( + (path is None or codepath == path) + and ( + excludepath is None + or not hasattr(codepath, "relto") + or not codepath.relto(excludepath) + ) + and (lineno is None or x.lineno == lineno) + and (firstlineno is None or x.frame.code.firstlineno == firstlineno) + ): + return Traceback(x._rawentry, self._excinfo) + return self + + def __getitem__(self, key): + val = super(Traceback, self).__getitem__(key) + if isinstance(key, type(slice(0))): + val = self.__class__(val) + return val + + def filter(self, fn=lambda x: not x.ishidden()): + """ return a Traceback instance with certain items removed + + fn is a function that gets a single argument, a TracebackEntry + instance, and should return True when the item should be added + to the Traceback, False when not + + by default this removes all the TracebackEntries which are hidden + (see ishidden() above) + """ + return Traceback(filter(fn, self), self._excinfo) + + def getcrashentry(self): + """ return last non-hidden traceback entry that lead + to the exception of a traceback. + """ + for i in range(-1, -len(self) - 1, -1): + entry = self[i] + if not entry.ishidden(): + return entry + return self[-1] + + def recursionindex(self): + """ return the index of the frame/TracebackEntry where recursion + originates if appropriate, None if no recursion occurred + """ + cache = {} + for i, entry in enumerate(self): + # id for the code.raw is needed to work around + # the strange metaprogramming in the decorator lib from pypi + # which generates code objects that have hash/value equality + # XXX needs a test + key = entry.frame.code.path, id(entry.frame.code.raw), entry.lineno + # print "checking for recursion at", key + values = cache.setdefault(key, []) + if values: + f = entry.frame + loc = f.f_locals + for otherloc in values: + if f.is_true( + f.eval( + co_equal, + __recursioncache_locals_1=loc, + __recursioncache_locals_2=otherloc, + ) + ): + return i + values.append(entry.frame.f_locals) + return None + + +co_equal = compile( + "__recursioncache_locals_1 == __recursioncache_locals_2", "?", "eval" +) + + +@attr.s(repr=False) +class ExceptionInfo(object): + """ wraps sys.exc_info() objects and offers + help for navigating the traceback. + """ + + _assert_start_repr = ( + "AssertionError(u'assert " if _PY2 else "AssertionError('assert " + ) + + _excinfo = attr.ib() + _striptext = attr.ib(default="") + _traceback = attr.ib(default=None) + + @classmethod + def from_current(cls, exprinfo=None): + """returns an ExceptionInfo matching the current traceback + + .. warning:: + + Experimental API + + + :param exprinfo: a text string helping to determine if we should + strip ``AssertionError`` from the output, defaults + to the exception message/``__str__()`` + """ + tup = sys.exc_info() + assert tup[0] is not None, "no current exception" + _striptext = "" + if exprinfo is None and isinstance(tup[1], AssertionError): + exprinfo = getattr(tup[1], "msg", None) + if exprinfo is None: + exprinfo = saferepr(tup[1]) + if exprinfo and exprinfo.startswith(cls._assert_start_repr): + _striptext = "AssertionError: " + + return cls(tup, _striptext) + + @classmethod + def for_later(cls): + """return an unfilled ExceptionInfo + """ + return cls(None) + + @property + def type(self): + """the exception class""" + return self._excinfo[0] + + @property + def value(self): + """the exception value""" + return self._excinfo[1] + + @property + def tb(self): + """the exception raw traceback""" + return self._excinfo[2] + + @property + def typename(self): + """the type name of the exception""" + return self.type.__name__ + + @property + def traceback(self): + """the traceback""" + if self._traceback is None: + self._traceback = Traceback(self.tb, excinfo=ref(self)) + return self._traceback + + @traceback.setter + def traceback(self, value): + self._traceback = value + + def __repr__(self): + if self._excinfo is None: + return "<ExceptionInfo for raises contextmanager>" + return "<ExceptionInfo %s tblen=%d>" % (self.typename, len(self.traceback)) + + def exconly(self, tryshort=False): + """ return the exception as a string + + when 'tryshort' resolves to True, and the exception is a + _pytest._code._AssertionError, only the actual exception part of + the exception representation is returned (so 'AssertionError: ' is + removed from the beginning) + """ + lines = format_exception_only(self.type, self.value) + text = "".join(lines) + text = text.rstrip() + if tryshort: + if text.startswith(self._striptext): + text = text[len(self._striptext) :] + return text + + def errisinstance(self, exc): + """ return True if the exception is an instance of exc """ + return isinstance(self.value, exc) + + def _getreprcrash(self): + exconly = self.exconly(tryshort=True) + entry = self.traceback.getcrashentry() + path, lineno = entry.frame.code.raw.co_filename, entry.lineno + return ReprFileLocation(path, lineno + 1, exconly) + + def getrepr( + self, + showlocals=False, + style="long", + abspath=False, + tbfilter=True, + funcargs=False, + truncate_locals=True, + chain=True, + ): + """ + Return str()able representation of this exception info. + + :param bool showlocals: + Show locals per traceback entry. + Ignored if ``style=="native"``. + + :param str style: long|short|no|native traceback style + + :param bool abspath: + If paths should be changed to absolute or left unchanged. + + :param bool tbfilter: + Hide entries that contain a local variable ``__tracebackhide__==True``. + Ignored if ``style=="native"``. + + :param bool funcargs: + Show fixtures ("funcargs" for legacy purposes) per traceback entry. + + :param bool truncate_locals: + With ``showlocals==True``, make sure locals can be safely represented as strings. + + :param bool chain: if chained exceptions in Python 3 should be shown. + + .. versionchanged:: 3.9 + + Added the ``chain`` parameter. + """ + if style == "native": + return ReprExceptionInfo( + ReprTracebackNative( + traceback.format_exception( + self.type, self.value, self.traceback[0]._rawentry + ) + ), + self._getreprcrash(), + ) + + fmt = FormattedExcinfo( + showlocals=showlocals, + style=style, + abspath=abspath, + tbfilter=tbfilter, + funcargs=funcargs, + truncate_locals=truncate_locals, + chain=chain, + ) + return fmt.repr_excinfo(self) + + def __str__(self): + if self._excinfo is None: + return repr(self) + entry = self.traceback[-1] + loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly()) + return str(loc) + + def __unicode__(self): + entry = self.traceback[-1] + loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly()) + return text_type(loc) + + def match(self, regexp): + """ + Check whether the regular expression 'regexp' is found in the string + representation of the exception using ``re.search``. If it matches + then True is returned (so that it is possible to write + ``assert excinfo.match()``). If it doesn't match an AssertionError is + raised. + """ + __tracebackhide__ = True + value = ( + text_type(self.value) if isinstance(regexp, text_type) else str(self.value) + ) + if not re.search(regexp, value): + raise AssertionError( + u"Pattern {!r} not found in {!r}".format(regexp, value) + ) + return True + + +@attr.s +class FormattedExcinfo(object): + """ presenting information about failing Functions and Generators. """ + + # for traceback entries + flow_marker = ">" + fail_marker = "E" + + showlocals = attr.ib(default=False) + style = attr.ib(default="long") + abspath = attr.ib(default=True) + tbfilter = attr.ib(default=True) + funcargs = attr.ib(default=False) + truncate_locals = attr.ib(default=True) + chain = attr.ib(default=True) + astcache = attr.ib(default=attr.Factory(dict), init=False, repr=False) + + def _getindent(self, source): + # figure out indent for given source + try: + s = str(source.getstatement(len(source) - 1)) + except KeyboardInterrupt: + raise + except: # noqa + try: + s = str(source[-1]) + except KeyboardInterrupt: + raise + except: # noqa + return 0 + return 4 + (len(s) - len(s.lstrip())) + + def _getentrysource(self, entry): + source = entry.getsource(self.astcache) + if source is not None: + source = source.deindent() + return source + + def repr_args(self, entry): + if self.funcargs: + args = [] + for argname, argvalue in entry.frame.getargs(var=True): + args.append((argname, saferepr(argvalue))) + return ReprFuncArgs(args) + + def get_source(self, source, line_index=-1, excinfo=None, short=False): + """ return formatted and marked up source lines. """ + import _pytest._code + + lines = [] + if source is None or line_index >= len(source.lines): + source = _pytest._code.Source("???") + line_index = 0 + if line_index < 0: + line_index += len(source) + space_prefix = " " + if short: + lines.append(space_prefix + source.lines[line_index].strip()) + else: + for line in source.lines[:line_index]: + lines.append(space_prefix + line) + lines.append(self.flow_marker + " " + source.lines[line_index]) + for line in source.lines[line_index + 1 :]: + lines.append(space_prefix + line) + if excinfo is not None: + indent = 4 if short else self._getindent(source) + lines.extend(self.get_exconly(excinfo, indent=indent, markall=True)) + return lines + + def get_exconly(self, excinfo, indent=4, markall=False): + lines = [] + indent = " " * indent + # get the real exception information out + exlines = excinfo.exconly(tryshort=True).split("\n") + failindent = self.fail_marker + indent[1:] + for line in exlines: + lines.append(failindent + line) + if not markall: + failindent = indent + return lines + + def repr_locals(self, locals): + if self.showlocals: + lines = [] + keys = [loc for loc in locals if loc[0] != "@"] + keys.sort() + for name in keys: + value = locals[name] + if name == "__builtins__": + lines.append("__builtins__ = <builtins>") + else: + # This formatting could all be handled by the + # _repr() function, which is only reprlib.Repr in + # disguise, so is very configurable. + if self.truncate_locals: + str_repr = saferepr(value) + else: + str_repr = safeformat(value) + # if len(str_repr) < 70 or not isinstance(value, + # (list, tuple, dict)): + lines.append("%-10s = %s" % (name, str_repr)) + # else: + # self._line("%-10s =\\" % (name,)) + # # XXX + # pprint.pprint(value, stream=self.excinfowriter) + return ReprLocals(lines) + + def repr_traceback_entry(self, entry, excinfo=None): + import _pytest._code + + source = self._getentrysource(entry) + if source is None: + source = _pytest._code.Source("???") + line_index = 0 + else: + # entry.getfirstlinesource() can be -1, should be 0 on jython + line_index = entry.lineno - max(entry.getfirstlinesource(), 0) + + lines = [] + style = entry._repr_style + if style is None: + style = self.style + if style in ("short", "long"): + short = style == "short" + reprargs = self.repr_args(entry) if not short else None + s = self.get_source(source, line_index, excinfo, short=short) + lines.extend(s) + if short: + message = "in %s" % (entry.name) + else: + message = excinfo and excinfo.typename or "" + path = self._makepath(entry.path) + filelocrepr = ReprFileLocation(path, entry.lineno + 1, message) + localsrepr = None + if not short: + localsrepr = self.repr_locals(entry.locals) + return ReprEntry(lines, reprargs, localsrepr, filelocrepr, style) + if excinfo: + lines.extend(self.get_exconly(excinfo, indent=4)) + return ReprEntry(lines, None, None, None, style) + + def _makepath(self, path): + if not self.abspath: + try: + np = py.path.local().bestrelpath(path) + except OSError: + return path + if len(np) < len(str(path)): + path = np + return path + + def repr_traceback(self, excinfo): + traceback = excinfo.traceback + if self.tbfilter: + traceback = traceback.filter() + + if is_recursion_error(excinfo): + traceback, extraline = self._truncate_recursive_traceback(traceback) + else: + extraline = None + + last = traceback[-1] + entries = [] + for index, entry in enumerate(traceback): + einfo = (last == entry) and excinfo or None + reprentry = self.repr_traceback_entry(entry, einfo) + entries.append(reprentry) + return ReprTraceback(entries, extraline, style=self.style) + + def _truncate_recursive_traceback(self, traceback): + """ + Truncate the given recursive traceback trying to find the starting point + of the recursion. + + The detection is done by going through each traceback entry and finding the + point in which the locals of the frame are equal to the locals of a previous frame (see ``recursionindex()``. + + Handle the situation where the recursion process might raise an exception (for example + comparing numpy arrays using equality raises a TypeError), in which case we do our best to + warn the user of the error and show a limited traceback. + """ + try: + recursionindex = traceback.recursionindex() + except Exception as e: + max_frames = 10 + extraline = ( + "!!! Recursion error detected, but an error occurred locating the origin of recursion.\n" + " The following exception happened when comparing locals in the stack frame:\n" + " {exc_type}: {exc_msg}\n" + " Displaying first and last {max_frames} stack frames out of {total}." + ).format( + exc_type=type(e).__name__, + exc_msg=safe_str(e), + max_frames=max_frames, + total=len(traceback), + ) + traceback = traceback[:max_frames] + traceback[-max_frames:] + else: + if recursionindex is not None: + extraline = "!!! Recursion detected (same locals & position)" + traceback = traceback[: recursionindex + 1] + else: + extraline = None + + return traceback, extraline + + def repr_excinfo(self, excinfo): + if _PY2: + reprtraceback = self.repr_traceback(excinfo) + reprcrash = excinfo._getreprcrash() + + return ReprExceptionInfo(reprtraceback, reprcrash) + else: + repr_chain = [] + e = excinfo.value + descr = None + seen = set() + while e is not None and id(e) not in seen: + seen.add(id(e)) + if excinfo: + reprtraceback = self.repr_traceback(excinfo) + reprcrash = excinfo._getreprcrash() + else: + # fallback to native repr if the exception doesn't have a traceback: + # ExceptionInfo objects require a full traceback to work + reprtraceback = ReprTracebackNative( + traceback.format_exception(type(e), e, None) + ) + reprcrash = None + + repr_chain += [(reprtraceback, reprcrash, descr)] + if e.__cause__ is not None and self.chain: + e = e.__cause__ + excinfo = ( + ExceptionInfo((type(e), e, e.__traceback__)) + if e.__traceback__ + else None + ) + descr = "The above exception was the direct cause of the following exception:" + elif ( + e.__context__ is not None + and not e.__suppress_context__ + and self.chain + ): + e = e.__context__ + excinfo = ( + ExceptionInfo((type(e), e, e.__traceback__)) + if e.__traceback__ + else None + ) + descr = "During handling of the above exception, another exception occurred:" + else: + e = None + repr_chain.reverse() + return ExceptionChainRepr(repr_chain) + + +class TerminalRepr(object): + def __str__(self): + s = self.__unicode__() + if _PY2: + s = s.encode("utf-8") + return s + + def __unicode__(self): + # FYI this is called from pytest-xdist's serialization of exception + # information. + io = py.io.TextIO() + tw = py.io.TerminalWriter(file=io) + self.toterminal(tw) + return io.getvalue().strip() + + def __repr__(self): + return "<%s instance at %0x>" % (self.__class__, id(self)) + + +class ExceptionRepr(TerminalRepr): + def __init__(self): + self.sections = [] + + def addsection(self, name, content, sep="-"): + self.sections.append((name, content, sep)) + + def toterminal(self, tw): + for name, content, sep in self.sections: + tw.sep(sep, name) + tw.line(content) + + +class ExceptionChainRepr(ExceptionRepr): + def __init__(self, chain): + super(ExceptionChainRepr, self).__init__() + self.chain = chain + # reprcrash and reprtraceback of the outermost (the newest) exception + # in the chain + self.reprtraceback = chain[-1][0] + self.reprcrash = chain[-1][1] + + def toterminal(self, tw): + for element in self.chain: + element[0].toterminal(tw) + if element[2] is not None: + tw.line("") + tw.line(element[2], yellow=True) + super(ExceptionChainRepr, self).toterminal(tw) + + +class ReprExceptionInfo(ExceptionRepr): + def __init__(self, reprtraceback, reprcrash): + super(ReprExceptionInfo, self).__init__() + self.reprtraceback = reprtraceback + self.reprcrash = reprcrash + + def toterminal(self, tw): + self.reprtraceback.toterminal(tw) + super(ReprExceptionInfo, self).toterminal(tw) + + +class ReprTraceback(TerminalRepr): + entrysep = "_ " + + def __init__(self, reprentries, extraline, style): + self.reprentries = reprentries + self.extraline = extraline + self.style = style + + def toterminal(self, tw): + # the entries might have different styles + for i, entry in enumerate(self.reprentries): + if entry.style == "long": + tw.line("") + entry.toterminal(tw) + if i < len(self.reprentries) - 1: + next_entry = self.reprentries[i + 1] + if ( + entry.style == "long" + or entry.style == "short" + and next_entry.style == "long" + ): + tw.sep(self.entrysep) + + if self.extraline: + tw.line(self.extraline) + + +class ReprTracebackNative(ReprTraceback): + def __init__(self, tblines): + self.style = "native" + self.reprentries = [ReprEntryNative(tblines)] + self.extraline = None + + +class ReprEntryNative(TerminalRepr): + style = "native" + + def __init__(self, tblines): + self.lines = tblines + + def toterminal(self, tw): + tw.write("".join(self.lines)) + + +class ReprEntry(TerminalRepr): + def __init__(self, lines, reprfuncargs, reprlocals, filelocrepr, style): + self.lines = lines + self.reprfuncargs = reprfuncargs + self.reprlocals = reprlocals + self.reprfileloc = filelocrepr + self.style = style + + def toterminal(self, tw): + if self.style == "short": + self.reprfileloc.toterminal(tw) + for line in self.lines: + red = line.startswith("E ") + tw.line(line, bold=True, red=red) + # tw.line("") + return + if self.reprfuncargs: + self.reprfuncargs.toterminal(tw) + for line in self.lines: + red = line.startswith("E ") + tw.line(line, bold=True, red=red) + if self.reprlocals: + tw.line("") + self.reprlocals.toterminal(tw) + if self.reprfileloc: + if self.lines: + tw.line("") + self.reprfileloc.toterminal(tw) + + def __str__(self): + return "%s\n%s\n%s" % ("\n".join(self.lines), self.reprlocals, self.reprfileloc) + + +class ReprFileLocation(TerminalRepr): + def __init__(self, path, lineno, message): + self.path = str(path) + self.lineno = lineno + self.message = message + + def toterminal(self, tw): + # filename and lineno output for each entry, + # using an output format that most editors unterstand + msg = self.message + i = msg.find("\n") + if i != -1: + msg = msg[:i] + tw.write(self.path, bold=True, red=True) + tw.line(":%s: %s" % (self.lineno, msg)) + + +class ReprLocals(TerminalRepr): + def __init__(self, lines): + self.lines = lines + + def toterminal(self, tw): + for line in self.lines: + tw.line(line) + + +class ReprFuncArgs(TerminalRepr): + def __init__(self, args): + self.args = args + + def toterminal(self, tw): + if self.args: + linesofar = "" + for name, value in self.args: + ns = "%s = %s" % (safe_str(name), safe_str(value)) + if len(ns) + len(linesofar) + 2 > tw.fullwidth: + if linesofar: + tw.line(linesofar) + linesofar = ns + else: + if linesofar: + linesofar += ", " + ns + else: + linesofar = ns + if linesofar: + tw.line(linesofar) + tw.line("") + + +def getrawcode(obj, trycall=True): + """ return code object for given function. """ + try: + return obj.__code__ + except AttributeError: + obj = getattr(obj, "im_func", obj) + obj = getattr(obj, "func_code", obj) + obj = getattr(obj, "f_code", obj) + obj = getattr(obj, "__code__", obj) + if trycall and not hasattr(obj, "co_firstlineno"): + if hasattr(obj, "__call__") and not inspect.isclass(obj): + x = getrawcode(obj.__call__, trycall=False) + if hasattr(x, "co_firstlineno"): + return x + return obj + + +if PY35: # RecursionError introduced in 3.5 + + def is_recursion_error(excinfo): + return excinfo.errisinstance(RecursionError) # noqa + + +else: + + def is_recursion_error(excinfo): + if not excinfo.errisinstance(RuntimeError): + return False + try: + return "maximum recursion depth exceeded" in str(excinfo.value) + except UnicodeError: + return False + + +# relative paths that we use to filter traceback entries from appearing to the user; +# see filter_traceback +# note: if we need to add more paths than what we have now we should probably use a list +# for better maintenance + +_PLUGGY_DIR = py.path.local(pluggy.__file__.rstrip("oc")) +# pluggy is either a package or a single module depending on the version +if _PLUGGY_DIR.basename == "__init__.py": + _PLUGGY_DIR = _PLUGGY_DIR.dirpath() +_PYTEST_DIR = py.path.local(_pytest.__file__).dirpath() +_PY_DIR = py.path.local(py.__file__).dirpath() + + +def filter_traceback(entry): + """Return True if a TracebackEntry instance should be removed from tracebacks: + * dynamically generated code (no code to show up for it); + * internal traceback from pytest or its internal libraries, py and pluggy. + """ + # entry.path might sometimes return a str object when the entry + # points to dynamically generated code + # see https://bitbucket.org/pytest-dev/py/issues/71 + raw_filename = entry.frame.code.raw.co_filename + is_generated = "<" in raw_filename and ">" in raw_filename + if is_generated: + return False + # entry.path might point to a non-existing file, in which case it will + # also return a str object. see #1133 + p = py.path.local(entry.path) + return ( + not p.relto(_PLUGGY_DIR) and not p.relto(_PYTEST_DIR) and not p.relto(_PY_DIR) + ) diff --git a/contrib/python/pytest/py2/_pytest/_code/source.py b/contrib/python/pytest/py2/_pytest/_code/source.py new file mode 100644 index 00000000000..b35e97b9cec --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/_code/source.py @@ -0,0 +1,324 @@ +# -*- coding: utf-8 -*- +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import ast +import inspect +import linecache +import sys +import textwrap +import tokenize +import warnings +from ast import PyCF_ONLY_AST as _AST_FLAG +from bisect import bisect_right + +import py +import six + + +class Source(object): + """ an immutable object holding a source code fragment, + possibly deindenting it. + """ + + _compilecounter = 0 + + def __init__(self, *parts, **kwargs): + self.lines = lines = [] + de = kwargs.get("deindent", True) + for part in parts: + if not part: + partlines = [] + elif isinstance(part, Source): + partlines = part.lines + elif isinstance(part, (tuple, list)): + partlines = [x.rstrip("\n") for x in part] + elif isinstance(part, six.string_types): + partlines = part.split("\n") + else: + partlines = getsource(part, deindent=de).lines + if de: + partlines = deindent(partlines) + lines.extend(partlines) + + def __eq__(self, other): + try: + return self.lines == other.lines + except AttributeError: + if isinstance(other, str): + return str(self) == other + return False + + __hash__ = None + + def __getitem__(self, key): + if isinstance(key, int): + return self.lines[key] + else: + if key.step not in (None, 1): + raise IndexError("cannot slice a Source with a step") + newsource = Source() + newsource.lines = self.lines[key.start : key.stop] + return newsource + + def __len__(self): + return len(self.lines) + + def strip(self): + """ return new source object with trailing + and leading blank lines removed. + """ + start, end = 0, len(self) + while start < end and not self.lines[start].strip(): + start += 1 + while end > start and not self.lines[end - 1].strip(): + end -= 1 + source = Source() + source.lines[:] = self.lines[start:end] + return source + + def putaround(self, before="", after="", indent=" " * 4): + """ return a copy of the source object with + 'before' and 'after' wrapped around it. + """ + before = Source(before) + after = Source(after) + newsource = Source() + lines = [(indent + line) for line in self.lines] + newsource.lines = before.lines + lines + after.lines + return newsource + + def indent(self, indent=" " * 4): + """ return a copy of the source object with + all lines indented by the given indent-string. + """ + newsource = Source() + newsource.lines = [(indent + line) for line in self.lines] + return newsource + + def getstatement(self, lineno): + """ return Source statement which contains the + given linenumber (counted from 0). + """ + start, end = self.getstatementrange(lineno) + return self[start:end] + + def getstatementrange(self, lineno): + """ return (start, end) tuple which spans the minimal + statement region which containing the given lineno. + """ + if not (0 <= lineno < len(self)): + raise IndexError("lineno out of range") + ast, start, end = getstatementrange_ast(lineno, self) + return start, end + + def deindent(self): + """return a new source object deindented.""" + newsource = Source() + newsource.lines[:] = deindent(self.lines) + return newsource + + def isparseable(self, deindent=True): + """ return True if source is parseable, heuristically + deindenting it by default. + """ + if deindent: + source = str(self.deindent()) + else: + source = str(self) + try: + ast.parse(source) + except (SyntaxError, ValueError, TypeError): + return False + else: + return True + + def __str__(self): + return "\n".join(self.lines) + + def compile( + self, filename=None, mode="exec", flag=0, dont_inherit=0, _genframe=None + ): + """ return compiled code object. if filename is None + invent an artificial filename which displays + the source/line position of the caller frame. + """ + if not filename or py.path.local(filename).check(file=0): + if _genframe is None: + _genframe = sys._getframe(1) # the caller + fn, lineno = _genframe.f_code.co_filename, _genframe.f_lineno + base = "<%d-codegen " % self._compilecounter + self.__class__._compilecounter += 1 + if not filename: + filename = base + "%s:%d>" % (fn, lineno) + else: + filename = base + "%r %s:%d>" % (filename, fn, lineno) + source = "\n".join(self.lines) + "\n" + try: + co = compile(source, filename, mode, flag) + except SyntaxError: + ex = sys.exc_info()[1] + # re-represent syntax errors from parsing python strings + msglines = self.lines[: ex.lineno] + if ex.offset: + msglines.append(" " * ex.offset + "^") + msglines.append("(code was compiled probably from here: %s)" % filename) + newex = SyntaxError("\n".join(msglines)) + newex.offset = ex.offset + newex.lineno = ex.lineno + newex.text = ex.text + raise newex + else: + if flag & _AST_FLAG: + return co + lines = [(x + "\n") for x in self.lines] + linecache.cache[filename] = (1, None, lines, filename) + return co + + +# +# public API shortcut functions +# + + +def compile_(source, filename=None, mode="exec", flags=0, dont_inherit=0): + """ compile the given source to a raw code object, + and maintain an internal cache which allows later + retrieval of the source code for the code object + and any recursively created code objects. + """ + if isinstance(source, ast.AST): + # XXX should Source support having AST? + return compile(source, filename, mode, flags, dont_inherit) + _genframe = sys._getframe(1) # the caller + s = Source(source) + co = s.compile(filename, mode, flags, _genframe=_genframe) + return co + + +def getfslineno(obj): + """ Return source location (path, lineno) for the given object. + If the source cannot be determined return ("", -1). + + The line number is 0-based. + """ + from .code import Code + + try: + code = Code(obj) + except TypeError: + try: + fn = inspect.getsourcefile(obj) or inspect.getfile(obj) + except TypeError: + return "", -1 + + fspath = fn and py.path.local(fn) or None + lineno = -1 + if fspath: + try: + _, lineno = findsource(obj) + except IOError: + pass + else: + fspath = code.path + lineno = code.firstlineno + assert isinstance(lineno, int) + return fspath, lineno + + +# +# helper functions +# + + +def findsource(obj): + try: + sourcelines, lineno = inspect.findsource(obj) + except Exception: + return None, -1 + source = Source() + source.lines = [line.rstrip() for line in sourcelines] + return source, lineno + + +def getsource(obj, **kwargs): + from .code import getrawcode + + obj = getrawcode(obj) + try: + strsrc = inspect.getsource(obj) + except IndentationError: + strsrc = '"Buggy python version consider upgrading, cannot get source"' + assert isinstance(strsrc, str) + return Source(strsrc, **kwargs) + + +def deindent(lines): + return textwrap.dedent("\n".join(lines)).splitlines() + + +def get_statement_startend2(lineno, node): + import ast + + # flatten all statements and except handlers into one lineno-list + # AST's line numbers start indexing at 1 + values = [] + for x in ast.walk(node): + if isinstance(x, (ast.stmt, ast.ExceptHandler)): + values.append(x.lineno - 1) + for name in ("finalbody", "orelse"): + val = getattr(x, name, None) + if val: + # treat the finally/orelse part as its own statement + values.append(val[0].lineno - 1 - 1) + values.sort() + insert_index = bisect_right(values, lineno) + start = values[insert_index - 1] + if insert_index >= len(values): + end = None + else: + end = values[insert_index] + return start, end + + +def getstatementrange_ast(lineno, source, assertion=False, astnode=None): + if astnode is None: + content = str(source) + # See #4260: + # don't produce duplicate warnings when compiling source to find ast + with warnings.catch_warnings(): + warnings.simplefilter("ignore") + astnode = compile(content, "source", "exec", _AST_FLAG) + + start, end = get_statement_startend2(lineno, astnode) + # we need to correct the end: + # - ast-parsing strips comments + # - there might be empty lines + # - we might have lesser indented code blocks at the end + if end is None: + end = len(source.lines) + + if end > start + 1: + # make sure we don't span differently indented code blocks + # by using the BlockFinder helper used which inspect.getsource() uses itself + block_finder = inspect.BlockFinder() + # if we start with an indented line, put blockfinder to "started" mode + block_finder.started = source.lines[start][0].isspace() + it = ((x + "\n") for x in source.lines[start:end]) + try: + for tok in tokenize.generate_tokens(lambda: next(it)): + block_finder.tokeneater(*tok) + except (inspect.EndOfBlock, IndentationError): + end = block_finder.last + start + except Exception: + pass + + # the end might still point to a comment or empty line, correct it + while end: + line = source.lines[end - 1].lstrip() + if line.startswith("#") or not line: + end -= 1 + else: + break + return astnode, start, end diff --git a/contrib/python/pytest/py2/_pytest/_io/__init__.py b/contrib/python/pytest/py2/_pytest/_io/__init__.py new file mode 100644 index 00000000000..e69de29bb2d --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/_io/__init__.py diff --git a/contrib/python/pytest/py2/_pytest/_io/saferepr.py b/contrib/python/pytest/py2/_pytest/_io/saferepr.py new file mode 100644 index 00000000000..9b412dccad9 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/_io/saferepr.py @@ -0,0 +1,83 @@ +# -*- coding: utf-8 -*- +import pprint + +from six.moves import reprlib + + +def _call_and_format_exception(call, x, *args): + try: + # Try the vanilla repr and make sure that the result is a string + return call(x, *args) + except Exception as exc: + exc_name = type(exc).__name__ + try: + exc_info = str(exc) + except Exception: + exc_info = "unknown" + return '<[%s("%s") raised in repr()] %s object at 0x%x>' % ( + exc_name, + exc_info, + x.__class__.__name__, + id(x), + ) + + +class SafeRepr(reprlib.Repr): + """subclass of repr.Repr that limits the resulting size of repr() + and includes information on exceptions raised during the call. + """ + + def repr(self, x): + return self._callhelper(reprlib.Repr.repr, self, x) + + def repr_unicode(self, x, level): + # Strictly speaking wrong on narrow builds + def repr(u): + if "'" not in u: + return u"'%s'" % u + elif '"' not in u: + return u'"%s"' % u + else: + return u"'%s'" % u.replace("'", r"\'") + + s = repr(x[: self.maxstring]) + if len(s) > self.maxstring: + i = max(0, (self.maxstring - 3) // 2) + j = max(0, self.maxstring - 3 - i) + s = repr(x[:i] + x[len(x) - j :]) + s = s[:i] + "..." + s[len(s) - j :] + return s + + def repr_instance(self, x, level): + return self._callhelper(repr, x) + + def _callhelper(self, call, x, *args): + s = _call_and_format_exception(call, x, *args) + if len(s) > self.maxsize: + i = max(0, (self.maxsize - 3) // 2) + j = max(0, self.maxsize - 3 - i) + s = s[:i] + "..." + s[len(s) - j :] + return s + + +def safeformat(obj): + """return a pretty printed string for the given object. + Failing __repr__ functions of user instances will be represented + with a short exception info. + """ + return _call_and_format_exception(pprint.pformat, obj) + + +def saferepr(obj, maxsize=240): + """return a size-limited safe repr-string for the given object. + Failing __repr__ functions of user instances will be represented + with a short exception info and 'saferepr' generally takes + care to never raise exceptions itself. This function is a wrapper + around the Repr/reprlib functionality of the standard 2.6 lib. + """ + # review exception handling + srepr = SafeRepr() + srepr.maxstring = maxsize + srepr.maxsize = maxsize + srepr.maxother = 160 + return srepr.repr(obj) diff --git a/contrib/python/pytest/py2/_pytest/_version.py b/contrib/python/pytest/py2/_pytest/_version.py new file mode 100644 index 00000000000..3d587586fcc --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/_version.py @@ -0,0 +1,4 @@ +# coding: utf-8 +# file generated by setuptools_scm +# don't change, don't track in version control +version = '4.6.11' diff --git a/contrib/python/pytest/py2/_pytest/assertion/__init__.py b/contrib/python/pytest/py2/_pytest/assertion/__init__.py new file mode 100644 index 00000000000..6b6abb863a3 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/assertion/__init__.py @@ -0,0 +1,156 @@ +# -*- coding: utf-8 -*- +""" +support for presenting detailed information in failing assertions. +""" +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import sys + +import six + +from _pytest.assertion import rewrite +from _pytest.assertion import truncate +from _pytest.assertion import util + + +def pytest_addoption(parser): + group = parser.getgroup("debugconfig") + group.addoption( + "--assert", + action="store", + dest="assertmode", + choices=("rewrite", "plain"), + default="rewrite", + metavar="MODE", + help="""Control assertion debugging tools. 'plain' + performs no assertion debugging. 'rewrite' + (the default) rewrites assert statements in + test modules on import to provide assert + expression information.""", + ) + + +def register_assert_rewrite(*names): + """Register one or more module names to be rewritten on import. + + This function will make sure that this module or all modules inside + the package will get their assert statements rewritten. + Thus you should make sure to call this before the module is + actually imported, usually in your __init__.py if you are a plugin + using a package. + + :raise TypeError: if the given module names are not strings. + """ + for name in names: + if not isinstance(name, str): + msg = "expected module names as *args, got {0} instead" + raise TypeError(msg.format(repr(names))) + for hook in sys.meta_path: + if isinstance(hook, rewrite.AssertionRewritingHook): + importhook = hook + break + else: + importhook = DummyRewriteHook() + importhook.mark_rewrite(*names) + + +class DummyRewriteHook(object): + """A no-op import hook for when rewriting is disabled.""" + + def mark_rewrite(self, *names): + pass + + +class AssertionState(object): + """State for the assertion plugin.""" + + def __init__(self, config, mode): + self.mode = mode + self.trace = config.trace.root.get("assertion") + self.hook = None + + +def install_importhook(config): + """Try to install the rewrite hook, raise SystemError if it fails.""" + # Jython has an AST bug that make the assertion rewriting hook malfunction. + if sys.platform.startswith("java"): + raise SystemError("rewrite not supported") + + config._assertstate = AssertionState(config, "rewrite") + config._assertstate.hook = hook = rewrite.AssertionRewritingHook(config) + sys.meta_path.insert(0, hook) + config._assertstate.trace("installed rewrite import hook") + + def undo(): + hook = config._assertstate.hook + if hook is not None and hook in sys.meta_path: + sys.meta_path.remove(hook) + + config.add_cleanup(undo) + return hook + + +def pytest_collection(session): + # this hook is only called when test modules are collected + # so for example not in the master process of pytest-xdist + # (which does not collect test modules) + assertstate = getattr(session.config, "_assertstate", None) + if assertstate: + if assertstate.hook is not None: + assertstate.hook.set_session(session) + + +def pytest_runtest_setup(item): + """Setup the pytest_assertrepr_compare hook + + The newinterpret and rewrite modules will use util._reprcompare if + it exists to use custom reporting via the + pytest_assertrepr_compare hook. This sets up this custom + comparison for the test. + """ + + def callbinrepr(op, left, right): + """Call the pytest_assertrepr_compare hook and prepare the result + + This uses the first result from the hook and then ensures the + following: + * Overly verbose explanations are truncated unless configured otherwise + (eg. if running in verbose mode). + * Embedded newlines are escaped to help util.format_explanation() + later. + * If the rewrite mode is used embedded %-characters are replaced + to protect later % formatting. + + The result can be formatted by util.format_explanation() for + pretty printing. + """ + hook_result = item.ihook.pytest_assertrepr_compare( + config=item.config, op=op, left=left, right=right + ) + for new_expl in hook_result: + if new_expl: + new_expl = truncate.truncate_if_required(new_expl, item) + new_expl = [line.replace("\n", "\\n") for line in new_expl] + res = six.text_type("\n~").join(new_expl) + if item.config.getvalue("assertmode") == "rewrite": + res = res.replace("%", "%%") + return res + + util._reprcompare = callbinrepr + + +def pytest_runtest_teardown(item): + util._reprcompare = None + + +def pytest_sessionfinish(session): + assertstate = getattr(session.config, "_assertstate", None) + if assertstate: + if assertstate.hook is not None: + assertstate.hook.set_session(None) + + +# Expose this plugin's implementation for the pytest_assertrepr_compare hook +pytest_assertrepr_compare = util.assertrepr_compare diff --git a/contrib/python/pytest/py2/_pytest/assertion/rewrite.py b/contrib/python/pytest/py2/_pytest/assertion/rewrite.py new file mode 100644 index 00000000000..6cfd81a32f5 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/assertion/rewrite.py @@ -0,0 +1,1072 @@ +# -*- coding: utf-8 -*- +"""Rewrite assertion AST to produce nice error messages""" +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import warnings +warnings.filterwarnings("ignore", category=DeprecationWarning, module="_pytest.assertion.rewrite") + +import ast +import errno +import imp +import itertools +import marshal +import os +import re +import string +import struct +import sys +import types + +import atomicwrites +import py +import six + +from _pytest._io.saferepr import saferepr +from _pytest.assertion import util +from _pytest.assertion.util import ( # noqa: F401 + format_explanation as _format_explanation, +) +from _pytest.compat import spec_from_file_location +from _pytest.pathlib import fnmatch_ex +from _pytest.pathlib import PurePath + +# pytest caches rewritten pycs in __pycache__. +if hasattr(imp, "get_tag"): + PYTEST_TAG = imp.get_tag() + "-PYTEST" +else: + if hasattr(sys, "pypy_version_info"): + impl = "pypy" + elif sys.platform == "java": + impl = "jython" + else: + impl = "cpython" + ver = sys.version_info + PYTEST_TAG = "%s-%s%s-PYTEST" % (impl, ver[0], ver[1]) + del ver, impl + +PYC_EXT = ".py" + (__debug__ and "c" or "o") +PYC_TAIL = "." + PYTEST_TAG + PYC_EXT + +ASCII_IS_DEFAULT_ENCODING = sys.version_info[0] < 3 + +if sys.version_info >= (3, 5): + ast_Call = ast.Call +else: + + def ast_Call(a, b, c): + return ast.Call(a, b, c, None, None) + + +class AssertionRewritingHook(object): + """PEP302 Import hook which rewrites asserts.""" + + def __init__(self, config): + self.config = config + try: + self.fnpats = config.getini("python_files") + except ValueError: + self.fnpats = ["test_*.py", "*_test.py"] + self.session = None + self.modules = {} + self._rewritten_names = set() + self._must_rewrite = set() + # flag to guard against trying to rewrite a pyc file while we are already writing another pyc file, + # which might result in infinite recursion (#3506) + self._writing_pyc = False + self._basenames_to_check_rewrite = {"conftest"} + self._marked_for_rewrite_cache = {} + self._session_paths_checked = False + + def set_session(self, session): + self.session = session + self._session_paths_checked = False + + def _imp_find_module(self, name, path=None): + """Indirection so we can mock calls to find_module originated from the hook during testing""" + return imp.find_module(name, path) + + def find_module(self, name, path=None): + if self._writing_pyc: + return None + state = self.config._assertstate + if self._early_rewrite_bailout(name, state): + return None + state.trace("find_module called for: %s" % name) + names = name.rsplit(".", 1) + lastname = names[-1] + pth = None + if path is not None: + # Starting with Python 3.3, path is a _NamespacePath(), which + # causes problems if not converted to list. + path = list(path) + if len(path) == 1: + pth = path[0] + if pth is None: + try: + fd, fn, desc = self._imp_find_module(lastname, path) + except ImportError: + return None + if fd is not None: + fd.close() + tp = desc[2] + if tp == imp.PY_COMPILED: + if hasattr(imp, "source_from_cache"): + try: + fn = imp.source_from_cache(fn) + except ValueError: + # Python 3 doesn't like orphaned but still-importable + # .pyc files. + fn = fn[:-1] + else: + fn = fn[:-1] + elif tp != imp.PY_SOURCE: + # Don't know what this is. + return None + else: + fn = os.path.join(pth, name.rpartition(".")[2] + ".py") + + fn_pypath = py.path.local(fn) + if not self._should_rewrite(name, fn_pypath, state): + return None + + self._rewritten_names.add(name) + + # The requested module looks like a test file, so rewrite it. This is + # the most magical part of the process: load the source, rewrite the + # asserts, and load the rewritten source. We also cache the rewritten + # module code in a special pyc. We must be aware of the possibility of + # concurrent pytest processes rewriting and loading pycs. To avoid + # tricky race conditions, we maintain the following invariant: The + # cached pyc is always a complete, valid pyc. Operations on it must be + # atomic. POSIX's atomic rename comes in handy. + write = not sys.dont_write_bytecode + cache_dir = os.path.join(fn_pypath.dirname, "__pycache__") + if write: + try: + os.mkdir(cache_dir) + except OSError: + e = sys.exc_info()[1].errno + if e == errno.EEXIST: + # Either the __pycache__ directory already exists (the + # common case) or it's blocked by a non-dir node. In the + # latter case, we'll ignore it in _write_pyc. + pass + elif e in [errno.ENOENT, errno.ENOTDIR]: + # One of the path components was not a directory, likely + # because we're in a zip file. + write = False + elif e in [errno.EACCES, errno.EROFS, errno.EPERM]: + state.trace("read only directory: %r" % fn_pypath.dirname) + write = False + else: + raise + cache_name = fn_pypath.basename[:-3] + PYC_TAIL + pyc = os.path.join(cache_dir, cache_name) + # Notice that even if we're in a read-only directory, I'm going + # to check for a cached pyc. This may not be optimal... + co = _read_pyc(fn_pypath, pyc, state.trace) + if co is None: + state.trace("rewriting %r" % (fn,)) + source_stat, co = _rewrite_test(self.config, fn_pypath) + if co is None: + # Probably a SyntaxError in the test. + return None + if write: + self._writing_pyc = True + try: + _write_pyc(state, co, source_stat, pyc) + finally: + self._writing_pyc = False + else: + state.trace("found cached rewritten pyc for %r" % (fn,)) + self.modules[name] = co, pyc + return self + + def _early_rewrite_bailout(self, name, state): + """ + This is a fast way to get out of rewriting modules. Profiling has + shown that the call to imp.find_module (inside of the find_module + from this class) is a major slowdown, so, this method tries to + filter what we're sure won't be rewritten before getting to it. + """ + if self.session is not None and not self._session_paths_checked: + self._session_paths_checked = True + for path in self.session._initialpaths: + # Make something as c:/projects/my_project/path.py -> + # ['c:', 'projects', 'my_project', 'path.py'] + parts = str(path).split(os.path.sep) + # add 'path' to basenames to be checked. + self._basenames_to_check_rewrite.add(os.path.splitext(parts[-1])[0]) + + # Note: conftest already by default in _basenames_to_check_rewrite. + parts = name.split(".") + if parts[-1] in self._basenames_to_check_rewrite: + return False + + # For matching the name it must be as if it was a filename. + path = PurePath(os.path.sep.join(parts) + ".py") + + for pat in self.fnpats: + # if the pattern contains subdirectories ("tests/**.py" for example) we can't bail out based + # on the name alone because we need to match against the full path + if os.path.dirname(pat): + return False + if fnmatch_ex(pat, path): + return False + + if self._is_marked_for_rewrite(name, state): + return False + + state.trace("early skip of rewriting module: %s" % (name,)) + return True + + def _should_rewrite(self, name, fn_pypath, state): + # always rewrite conftest files + fn = str(fn_pypath) + if fn_pypath.basename == "conftest.py": + state.trace("rewriting conftest file: %r" % (fn,)) + return True + + if self.session is not None: + if self.session.isinitpath(fn): + state.trace("matched test file (was specified on cmdline): %r" % (fn,)) + return True + + # modules not passed explicitly on the command line are only + # rewritten if they match the naming convention for test files + for pat in self.fnpats: + if fn_pypath.fnmatch(pat): + state.trace("matched test file %r" % (fn,)) + return True + + return self._is_marked_for_rewrite(name, state) + + def _is_marked_for_rewrite(self, name, state): + try: + return self._marked_for_rewrite_cache[name] + except KeyError: + for marked in self._must_rewrite: + if name == marked or name.startswith(marked + "."): + state.trace("matched marked file %r (from %r)" % (name, marked)) + self._marked_for_rewrite_cache[name] = True + return True + + self._marked_for_rewrite_cache[name] = False + return False + + def mark_rewrite(self, *names): + """Mark import names as needing to be rewritten. + + The named module or package as well as any nested modules will + be rewritten on import. + """ + already_imported = ( + set(names).intersection(sys.modules).difference(self._rewritten_names) + ) + for name in already_imported: + if not AssertionRewriter.is_rewrite_disabled( + sys.modules[name].__doc__ or "" + ): + self._warn_already_imported(name) + self._must_rewrite.update(names) + self._marked_for_rewrite_cache.clear() + + def _warn_already_imported(self, name): + from _pytest.warning_types import PytestAssertRewriteWarning + from _pytest.warnings import _issue_warning_captured + + _issue_warning_captured( + PytestAssertRewriteWarning( + "Module already imported so cannot be rewritten: %s" % name + ), + self.config.hook, + stacklevel=5, + ) + + def load_module(self, name): + co, pyc = self.modules.pop(name) + if name in sys.modules: + # If there is an existing module object named 'fullname' in + # sys.modules, the loader must use that existing module. (Otherwise, + # the reload() builtin will not work correctly.) + mod = sys.modules[name] + else: + # I wish I could just call imp.load_compiled here, but __file__ has to + # be set properly. In Python 3.2+, this all would be handled correctly + # by load_compiled. + mod = sys.modules[name] = imp.new_module(name) + try: + mod.__file__ = co.co_filename + # Normally, this attribute is 3.2+. + mod.__cached__ = pyc + mod.__loader__ = self + # Normally, this attribute is 3.4+ + mod.__spec__ = spec_from_file_location(name, co.co_filename, loader=self) + exec(co, mod.__dict__) + except: # noqa + if name in sys.modules: + del sys.modules[name] + raise + return sys.modules[name] + + def is_package(self, name): + try: + fd, fn, desc = self._imp_find_module(name) + except ImportError: + return False + if fd is not None: + fd.close() + tp = desc[2] + return tp == imp.PKG_DIRECTORY + + def get_data(self, pathname): + """Optional PEP302 get_data API. + """ + with open(pathname, "rb") as f: + return f.read() + + +def _write_pyc(state, co, source_stat, pyc): + # Technically, we don't have to have the same pyc format as + # (C)Python, since these "pycs" should never be seen by builtin + # import. However, there's little reason deviate, and I hope + # sometime to be able to use imp.load_compiled to load them. (See + # the comment in load_module above.) + try: + with atomicwrites.atomic_write(pyc, mode="wb", overwrite=True) as fp: + fp.write(imp.get_magic()) + # as of now, bytecode header expects 32-bit numbers for size and mtime (#4903) + mtime = int(source_stat.mtime) & 0xFFFFFFFF + size = source_stat.size & 0xFFFFFFFF + # "<LL" stands for 2 unsigned longs, little-ending + fp.write(struct.pack("<LL", mtime, size)) + fp.write(marshal.dumps(co)) + except EnvironmentError as e: + state.trace("error writing pyc file at %s: errno=%s" % (pyc, e.errno)) + # we ignore any failure to write the cache file + # there are many reasons, permission-denied, __pycache__ being a + # file etc. + return False + return True + + +RN = "\r\n".encode("utf-8") +N = "\n".encode("utf-8") + +cookie_re = re.compile(r"^[ \t\f]*#.*coding[:=][ \t]*[-\w.]+") +BOM_UTF8 = "\xef\xbb\xbf" + + +def _rewrite_test(config, fn): + """Try to read and rewrite *fn* and return the code object.""" + state = config._assertstate + try: + stat = fn.stat() + source = fn.read("rb") + except EnvironmentError: + return None, None + if ASCII_IS_DEFAULT_ENCODING: + # ASCII is the default encoding in Python 2. Without a coding + # declaration, Python 2 will complain about any bytes in the file + # outside the ASCII range. Sadly, this behavior does not extend to + # compile() or ast.parse(), which prefer to interpret the bytes as + # latin-1. (At least they properly handle explicit coding cookies.) To + # preserve this error behavior, we could force ast.parse() to use ASCII + # as the encoding by inserting a coding cookie. Unfortunately, that + # messes up line numbers. Thus, we have to check ourselves if anything + # is outside the ASCII range in the case no encoding is explicitly + # declared. For more context, see issue #269. Yay for Python 3 which + # gets this right. + end1 = source.find("\n") + end2 = source.find("\n", end1 + 1) + if ( + not source.startswith(BOM_UTF8) + and cookie_re.match(source[0:end1]) is None + and cookie_re.match(source[end1 + 1 : end2]) is None + ): + if hasattr(state, "_indecode"): + # encodings imported us again, so don't rewrite. + return None, None + state._indecode = True + try: + try: + source.decode("ascii") + except UnicodeDecodeError: + # Let it fail in real import. + return None, None + finally: + del state._indecode + try: + tree = ast.parse(source, filename=fn.strpath) + except SyntaxError: + # Let this pop up again in the real import. + state.trace("failed to parse: %r" % (fn,)) + return None, None + rewrite_asserts(tree, fn, config) + try: + co = compile(tree, fn.strpath, "exec", dont_inherit=True) + except SyntaxError: + # It's possible that this error is from some bug in the + # assertion rewriting, but I don't know of a fast way to tell. + state.trace("failed to compile: %r" % (fn,)) + return None, None + return stat, co + + +def _read_pyc(source, pyc, trace=lambda x: None): + """Possibly read a pytest pyc containing rewritten code. + + Return rewritten code if successful or None if not. + """ + try: + fp = open(pyc, "rb") + except IOError: + return None + with fp: + try: + mtime = int(source.mtime()) + size = source.size() + data = fp.read(12) + except EnvironmentError as e: + trace("_read_pyc(%s): EnvironmentError %s" % (source, e)) + return None + # Check for invalid or out of date pyc file. + if ( + len(data) != 12 + or data[:4] != imp.get_magic() + or struct.unpack("<LL", data[4:]) != (mtime & 0xFFFFFFFF, size & 0xFFFFFFFF) + ): + trace("_read_pyc(%s): invalid or out of date pyc" % source) + return None + try: + co = marshal.load(fp) + except Exception as e: + trace("_read_pyc(%s): marshal.load error %s" % (source, e)) + return None + if not isinstance(co, types.CodeType): + trace("_read_pyc(%s): not a code object" % source) + return None + return co + + +def rewrite_asserts(mod, module_path=None, config=None): + """Rewrite the assert statements in mod.""" + AssertionRewriter(module_path, config).run(mod) + + +def _saferepr(obj): + """Get a safe repr of an object for assertion error messages. + + The assertion formatting (util.format_explanation()) requires + newlines to be escaped since they are a special character for it. + Normally assertion.util.format_explanation() does this but for a + custom repr it is possible to contain one of the special escape + sequences, especially '\n{' and '\n}' are likely to be present in + JSON reprs. + + """ + r = saferepr(obj) + # only occurs in python2.x, repr must return text in python3+ + if isinstance(r, bytes): + # Represent unprintable bytes as `\x##` + r = u"".join( + u"\\x{:x}".format(ord(c)) if c not in string.printable else c.decode() + for c in r + ) + return r.replace(u"\n", u"\\n") + + +def _format_assertmsg(obj): + """Format the custom assertion message given. + + For strings this simply replaces newlines with '\n~' so that + util.format_explanation() will preserve them instead of escaping + newlines. For other objects saferepr() is used first. + + """ + # reprlib appears to have a bug which means that if a string + # contains a newline it gets escaped, however if an object has a + # .__repr__() which contains newlines it does not get escaped. + # However in either case we want to preserve the newline. + replaces = [(u"\n", u"\n~"), (u"%", u"%%")] + if not isinstance(obj, six.string_types): + obj = saferepr(obj) + replaces.append((u"\\n", u"\n~")) + + if isinstance(obj, bytes): + replaces = [(r1.encode(), r2.encode()) for r1, r2 in replaces] + + for r1, r2 in replaces: + obj = obj.replace(r1, r2) + + return obj + + +def _should_repr_global_name(obj): + if callable(obj): + return False + + try: + return not hasattr(obj, "__name__") + except Exception: + return True + + +def _format_boolop(explanations, is_or): + explanation = "(" + (is_or and " or " or " and ").join(explanations) + ")" + if isinstance(explanation, six.text_type): + return explanation.replace(u"%", u"%%") + else: + return explanation.replace(b"%", b"%%") + + +def _call_reprcompare(ops, results, expls, each_obj): + for i, res, expl in zip(range(len(ops)), results, expls): + try: + done = not res + except Exception: + done = True + if done: + break + if util._reprcompare is not None: + custom = util._reprcompare(ops[i], each_obj[i], each_obj[i + 1]) + if custom is not None: + return custom + return expl + + +unary_map = {ast.Not: "not %s", ast.Invert: "~%s", ast.USub: "-%s", ast.UAdd: "+%s"} + +binop_map = { + ast.BitOr: "|", + ast.BitXor: "^", + ast.BitAnd: "&", + ast.LShift: "<<", + ast.RShift: ">>", + ast.Add: "+", + ast.Sub: "-", + ast.Mult: "*", + ast.Div: "/", + ast.FloorDiv: "//", + ast.Mod: "%%", # escaped for string formatting + ast.Eq: "==", + ast.NotEq: "!=", + ast.Lt: "<", + ast.LtE: "<=", + ast.Gt: ">", + ast.GtE: ">=", + ast.Pow: "**", + ast.Is: "is", + ast.IsNot: "is not", + ast.In: "in", + ast.NotIn: "not in", +} +# Python 3.5+ compatibility +try: + binop_map[ast.MatMult] = "@" +except AttributeError: + pass + +# Python 3.4+ compatibility +if hasattr(ast, "NameConstant"): + _NameConstant = ast.NameConstant +else: + + def _NameConstant(c): + return ast.Name(str(c), ast.Load()) + + +def set_location(node, lineno, col_offset): + """Set node location information recursively.""" + + def _fix(node, lineno, col_offset): + if "lineno" in node._attributes: + node.lineno = lineno + if "col_offset" in node._attributes: + node.col_offset = col_offset + for child in ast.iter_child_nodes(node): + _fix(child, lineno, col_offset) + + _fix(node, lineno, col_offset) + return node + + +class AssertionRewriter(ast.NodeVisitor): + """Assertion rewriting implementation. + + The main entrypoint is to call .run() with an ast.Module instance, + this will then find all the assert statements and rewrite them to + provide intermediate values and a detailed assertion error. See + http://pybites.blogspot.be/2011/07/behind-scenes-of-pytests-new-assertion.html + for an overview of how this works. + + The entry point here is .run() which will iterate over all the + statements in an ast.Module and for each ast.Assert statement it + finds call .visit() with it. Then .visit_Assert() takes over and + is responsible for creating new ast statements to replace the + original assert statement: it rewrites the test of an assertion + to provide intermediate values and replace it with an if statement + which raises an assertion error with a detailed explanation in + case the expression is false. + + For this .visit_Assert() uses the visitor pattern to visit all the + AST nodes of the ast.Assert.test field, each visit call returning + an AST node and the corresponding explanation string. During this + state is kept in several instance attributes: + + :statements: All the AST statements which will replace the assert + statement. + + :variables: This is populated by .variable() with each variable + used by the statements so that they can all be set to None at + the end of the statements. + + :variable_counter: Counter to create new unique variables needed + by statements. Variables are created using .variable() and + have the form of "@py_assert0". + + :on_failure: The AST statements which will be executed if the + assertion test fails. This is the code which will construct + the failure message and raises the AssertionError. + + :explanation_specifiers: A dict filled by .explanation_param() + with %-formatting placeholders and their corresponding + expressions to use in the building of an assertion message. + This is used by .pop_format_context() to build a message. + + :stack: A stack of the explanation_specifiers dicts maintained by + .push_format_context() and .pop_format_context() which allows + to build another %-formatted string while already building one. + + This state is reset on every new assert statement visited and used + by the other visitors. + + """ + + def __init__(self, module_path, config): + super(AssertionRewriter, self).__init__() + self.module_path = module_path + self.config = config + + def run(self, mod): + """Find all assert statements in *mod* and rewrite them.""" + if not mod.body: + # Nothing to do. + return + # Insert some special imports at the top of the module but after any + # docstrings and __future__ imports. + aliases = [ + ast.alias(six.moves.builtins.__name__, "@py_builtins"), + ast.alias("_pytest.assertion.rewrite", "@pytest_ar"), + ] + doc = getattr(mod, "docstring", None) + expect_docstring = doc is None + if doc is not None and self.is_rewrite_disabled(doc): + return + pos = 0 + lineno = 1 + for item in mod.body: + if ( + expect_docstring + and isinstance(item, ast.Expr) + and isinstance(item.value, ast.Str) + ): + doc = item.value.s + if self.is_rewrite_disabled(doc): + return + expect_docstring = False + elif ( + not isinstance(item, ast.ImportFrom) + or item.level > 0 + or item.module != "__future__" + ): + lineno = item.lineno + break + pos += 1 + else: + lineno = item.lineno + imports = [ + ast.Import([alias], lineno=lineno, col_offset=0) for alias in aliases + ] + mod.body[pos:pos] = imports + # Collect asserts. + nodes = [mod] + while nodes: + node = nodes.pop() + for name, field in ast.iter_fields(node): + if isinstance(field, list): + new = [] + for i, child in enumerate(field): + if isinstance(child, ast.Assert): + # Transform assert. + new.extend(self.visit(child)) + else: + new.append(child) + if isinstance(child, ast.AST): + nodes.append(child) + setattr(node, name, new) + elif ( + isinstance(field, ast.AST) + # Don't recurse into expressions as they can't contain + # asserts. + and not isinstance(field, ast.expr) + ): + nodes.append(field) + + @staticmethod + def is_rewrite_disabled(docstring): + return "PYTEST_DONT_REWRITE" in docstring + + def variable(self): + """Get a new variable.""" + # Use a character invalid in python identifiers to avoid clashing. + name = "@py_assert" + str(next(self.variable_counter)) + self.variables.append(name) + return name + + def assign(self, expr): + """Give *expr* a name.""" + name = self.variable() + self.statements.append(ast.Assign([ast.Name(name, ast.Store())], expr)) + return ast.Name(name, ast.Load()) + + def display(self, expr): + """Call saferepr on the expression.""" + return self.helper("_saferepr", expr) + + def helper(self, name, *args): + """Call a helper in this module.""" + py_name = ast.Name("@pytest_ar", ast.Load()) + attr = ast.Attribute(py_name, name, ast.Load()) + return ast_Call(attr, list(args), []) + + def builtin(self, name): + """Return the builtin called *name*.""" + builtin_name = ast.Name("@py_builtins", ast.Load()) + return ast.Attribute(builtin_name, name, ast.Load()) + + def explanation_param(self, expr): + """Return a new named %-formatting placeholder for expr. + + This creates a %-formatting placeholder for expr in the + current formatting context, e.g. ``%(py0)s``. The placeholder + and expr are placed in the current format context so that it + can be used on the next call to .pop_format_context(). + + """ + specifier = "py" + str(next(self.variable_counter)) + self.explanation_specifiers[specifier] = expr + return "%(" + specifier + ")s" + + def push_format_context(self): + """Create a new formatting context. + + The format context is used for when an explanation wants to + have a variable value formatted in the assertion message. In + this case the value required can be added using + .explanation_param(). Finally .pop_format_context() is used + to format a string of %-formatted values as added by + .explanation_param(). + + """ + self.explanation_specifiers = {} + self.stack.append(self.explanation_specifiers) + + def pop_format_context(self, expl_expr): + """Format the %-formatted string with current format context. + + The expl_expr should be an ast.Str instance constructed from + the %-placeholders created by .explanation_param(). This will + add the required code to format said string to .on_failure and + return the ast.Name instance of the formatted string. + + """ + current = self.stack.pop() + if self.stack: + self.explanation_specifiers = self.stack[-1] + keys = [ast.Str(key) for key in current.keys()] + format_dict = ast.Dict(keys, list(current.values())) + form = ast.BinOp(expl_expr, ast.Mod(), format_dict) + name = "@py_format" + str(next(self.variable_counter)) + self.on_failure.append(ast.Assign([ast.Name(name, ast.Store())], form)) + return ast.Name(name, ast.Load()) + + def generic_visit(self, node): + """Handle expressions we don't have custom code for.""" + assert isinstance(node, ast.expr) + res = self.assign(node) + return res, self.explanation_param(self.display(res)) + + def visit_Assert(self, assert_): + """Return the AST statements to replace the ast.Assert instance. + + This rewrites the test of an assertion to provide + intermediate values and replace it with an if statement which + raises an assertion error with a detailed explanation in case + the expression is false. + + """ + if isinstance(assert_.test, ast.Tuple) and len(assert_.test.elts) >= 1: + from _pytest.warning_types import PytestAssertRewriteWarning + import warnings + + warnings.warn_explicit( + PytestAssertRewriteWarning( + "assertion is always true, perhaps remove parentheses?" + ), + category=None, + filename=str(self.module_path), + lineno=assert_.lineno, + ) + + self.statements = [] + self.variables = [] + self.variable_counter = itertools.count() + self.stack = [] + self.on_failure = [] + self.push_format_context() + # Rewrite assert into a bunch of statements. + top_condition, explanation = self.visit(assert_.test) + # If in a test module, check if directly asserting None, in order to warn [Issue #3191] + if self.module_path is not None: + self.statements.append( + self.warn_about_none_ast( + top_condition, module_path=self.module_path, lineno=assert_.lineno + ) + ) + # Create failure message. + body = self.on_failure + negation = ast.UnaryOp(ast.Not(), top_condition) + self.statements.append(ast.If(negation, body, [])) + if assert_.msg: + assertmsg = self.helper("_format_assertmsg", assert_.msg) + explanation = "\n>assert " + explanation + else: + assertmsg = ast.Str("") + explanation = "assert " + explanation + template = ast.BinOp(assertmsg, ast.Add(), ast.Str(explanation)) + msg = self.pop_format_context(template) + fmt = self.helper("_format_explanation", msg) + err_name = ast.Name("AssertionError", ast.Load()) + exc = ast_Call(err_name, [fmt], []) + if sys.version_info[0] >= 3: + raise_ = ast.Raise(exc, None) + else: + raise_ = ast.Raise(exc, None, None) + body.append(raise_) + # Clear temporary variables by setting them to None. + if self.variables: + variables = [ast.Name(name, ast.Store()) for name in self.variables] + clear = ast.Assign(variables, _NameConstant(None)) + self.statements.append(clear) + # Fix line numbers. + for stmt in self.statements: + set_location(stmt, assert_.lineno, assert_.col_offset) + return self.statements + + def warn_about_none_ast(self, node, module_path, lineno): + """ + Returns an AST issuing a warning if the value of node is `None`. + This is used to warn the user when asserting a function that asserts + internally already. + See issue #3191 for more details. + """ + + # Using parse because it is different between py2 and py3. + AST_NONE = ast.parse("None").body[0].value + val_is_none = ast.Compare(node, [ast.Is()], [AST_NONE]) + send_warning = ast.parse( + """ +from _pytest.warning_types import PytestAssertRewriteWarning +from warnings import warn_explicit +warn_explicit( + PytestAssertRewriteWarning('asserting the value None, please use "assert is None"'), + category=None, + filename={filename!r}, + lineno={lineno}, +) + """.format( + filename=module_path.strpath, lineno=lineno + ) + ).body + return ast.If(val_is_none, send_warning, []) + + def visit_Name(self, name): + # Display the repr of the name if it's a local variable or + # _should_repr_global_name() thinks it's acceptable. + locs = ast_Call(self.builtin("locals"), [], []) + inlocs = ast.Compare(ast.Str(name.id), [ast.In()], [locs]) + dorepr = self.helper("_should_repr_global_name", name) + test = ast.BoolOp(ast.Or(), [inlocs, dorepr]) + expr = ast.IfExp(test, self.display(name), ast.Str(name.id)) + return name, self.explanation_param(expr) + + def visit_BoolOp(self, boolop): + res_var = self.variable() + expl_list = self.assign(ast.List([], ast.Load())) + app = ast.Attribute(expl_list, "append", ast.Load()) + is_or = int(isinstance(boolop.op, ast.Or)) + body = save = self.statements + fail_save = self.on_failure + levels = len(boolop.values) - 1 + self.push_format_context() + # Process each operand, short-circuting if needed. + for i, v in enumerate(boolop.values): + if i: + fail_inner = [] + # cond is set in a prior loop iteration below + self.on_failure.append(ast.If(cond, fail_inner, [])) # noqa + self.on_failure = fail_inner + self.push_format_context() + res, expl = self.visit(v) + body.append(ast.Assign([ast.Name(res_var, ast.Store())], res)) + expl_format = self.pop_format_context(ast.Str(expl)) + call = ast_Call(app, [expl_format], []) + self.on_failure.append(ast.Expr(call)) + if i < levels: + cond = res + if is_or: + cond = ast.UnaryOp(ast.Not(), cond) + inner = [] + self.statements.append(ast.If(cond, inner, [])) + self.statements = body = inner + self.statements = save + self.on_failure = fail_save + expl_template = self.helper("_format_boolop", expl_list, ast.Num(is_or)) + expl = self.pop_format_context(expl_template) + return ast.Name(res_var, ast.Load()), self.explanation_param(expl) + + def visit_UnaryOp(self, unary): + pattern = unary_map[unary.op.__class__] + operand_res, operand_expl = self.visit(unary.operand) + res = self.assign(ast.UnaryOp(unary.op, operand_res)) + return res, pattern % (operand_expl,) + + def visit_BinOp(self, binop): + symbol = binop_map[binop.op.__class__] + left_expr, left_expl = self.visit(binop.left) + right_expr, right_expl = self.visit(binop.right) + explanation = "(%s %s %s)" % (left_expl, symbol, right_expl) + res = self.assign(ast.BinOp(left_expr, binop.op, right_expr)) + return res, explanation + + def visit_Call_35(self, call): + """ + visit `ast.Call` nodes on Python3.5 and after + """ + new_func, func_expl = self.visit(call.func) + arg_expls = [] + new_args = [] + new_kwargs = [] + for arg in call.args: + res, expl = self.visit(arg) + arg_expls.append(expl) + new_args.append(res) + for keyword in call.keywords: + res, expl = self.visit(keyword.value) + new_kwargs.append(ast.keyword(keyword.arg, res)) + if keyword.arg: + arg_expls.append(keyword.arg + "=" + expl) + else: # **args have `arg` keywords with an .arg of None + arg_expls.append("**" + expl) + + expl = "%s(%s)" % (func_expl, ", ".join(arg_expls)) + new_call = ast.Call(new_func, new_args, new_kwargs) + res = self.assign(new_call) + res_expl = self.explanation_param(self.display(res)) + outer_expl = "%s\n{%s = %s\n}" % (res_expl, res_expl, expl) + return res, outer_expl + + def visit_Starred(self, starred): + # From Python 3.5, a Starred node can appear in a function call + res, expl = self.visit(starred.value) + new_starred = ast.Starred(res, starred.ctx) + return new_starred, "*" + expl + + def visit_Call_legacy(self, call): + """ + visit `ast.Call nodes on 3.4 and below` + """ + new_func, func_expl = self.visit(call.func) + arg_expls = [] + new_args = [] + new_kwargs = [] + new_star = new_kwarg = None + for arg in call.args: + res, expl = self.visit(arg) + new_args.append(res) + arg_expls.append(expl) + for keyword in call.keywords: + res, expl = self.visit(keyword.value) + new_kwargs.append(ast.keyword(keyword.arg, res)) + arg_expls.append(keyword.arg + "=" + expl) + if call.starargs: + new_star, expl = self.visit(call.starargs) + arg_expls.append("*" + expl) + if call.kwargs: + new_kwarg, expl = self.visit(call.kwargs) + arg_expls.append("**" + expl) + expl = "%s(%s)" % (func_expl, ", ".join(arg_expls)) + new_call = ast.Call(new_func, new_args, new_kwargs, new_star, new_kwarg) + res = self.assign(new_call) + res_expl = self.explanation_param(self.display(res)) + outer_expl = "%s\n{%s = %s\n}" % (res_expl, res_expl, expl) + return res, outer_expl + + # ast.Call signature changed on 3.5, + # conditionally change which methods is named + # visit_Call depending on Python version + if sys.version_info >= (3, 5): + visit_Call = visit_Call_35 + else: + visit_Call = visit_Call_legacy + + def visit_Attribute(self, attr): + if not isinstance(attr.ctx, ast.Load): + return self.generic_visit(attr) + value, value_expl = self.visit(attr.value) + res = self.assign(ast.Attribute(value, attr.attr, ast.Load())) + res_expl = self.explanation_param(self.display(res)) + pat = "%s\n{%s = %s.%s\n}" + expl = pat % (res_expl, res_expl, value_expl, attr.attr) + return res, expl + + def visit_Compare(self, comp): + self.push_format_context() + left_res, left_expl = self.visit(comp.left) + if isinstance(comp.left, (ast.Compare, ast.BoolOp)): + left_expl = "({})".format(left_expl) + res_variables = [self.variable() for i in range(len(comp.ops))] + load_names = [ast.Name(v, ast.Load()) for v in res_variables] + store_names = [ast.Name(v, ast.Store()) for v in res_variables] + it = zip(range(len(comp.ops)), comp.ops, comp.comparators) + expls = [] + syms = [] + results = [left_res] + for i, op, next_operand in it: + next_res, next_expl = self.visit(next_operand) + if isinstance(next_operand, (ast.Compare, ast.BoolOp)): + next_expl = "({})".format(next_expl) + results.append(next_res) + sym = binop_map[op.__class__] + syms.append(ast.Str(sym)) + expl = "%s %s %s" % (left_expl, sym, next_expl) + expls.append(ast.Str(expl)) + res_expr = ast.Compare(left_res, [op], [next_res]) + self.statements.append(ast.Assign([store_names[i]], res_expr)) + left_res, left_expl = next_res, next_expl + # Use pytest.assertion.util._reprcompare if that's available. + expl_call = self.helper( + "_call_reprcompare", + ast.Tuple(syms, ast.Load()), + ast.Tuple(load_names, ast.Load()), + ast.Tuple(expls, ast.Load()), + ast.Tuple(results, ast.Load()), + ) + if len(comp.ops) > 1: + res = ast.BoolOp(ast.And(), load_names) + else: + res = load_names[0] + return res, self.explanation_param(self.pop_format_context(expl_call)) diff --git a/contrib/python/pytest/py2/_pytest/assertion/truncate.py b/contrib/python/pytest/py2/_pytest/assertion/truncate.py new file mode 100644 index 00000000000..525896ea9ad --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/assertion/truncate.py @@ -0,0 +1,102 @@ +# -*- coding: utf-8 -*- +""" +Utilities for truncating assertion output. + +Current default behaviour is to truncate assertion explanations at +~8 terminal lines, unless running in "-vv" mode or running on CI. +""" +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import os + +import six + +DEFAULT_MAX_LINES = 8 +DEFAULT_MAX_CHARS = 8 * 80 +USAGE_MSG = "use '-vv' to show" + + +def truncate_if_required(explanation, item, max_length=None): + """ + Truncate this assertion explanation if the given test item is eligible. + """ + if _should_truncate_item(item): + return _truncate_explanation(explanation) + return explanation + + +def _should_truncate_item(item): + """ + Whether or not this test item is eligible for truncation. + """ + verbose = item.config.option.verbose + return verbose < 2 and not _running_on_ci() + + +def _running_on_ci(): + """Check if we're currently running on a CI system.""" + env_vars = ["CI", "BUILD_NUMBER"] + return any(var in os.environ for var in env_vars) + + +def _truncate_explanation(input_lines, max_lines=None, max_chars=None): + """ + Truncate given list of strings that makes up the assertion explanation. + + Truncates to either 8 lines, or 640 characters - whichever the input reaches + first. The remaining lines will be replaced by a usage message. + """ + + if max_lines is None: + max_lines = DEFAULT_MAX_LINES + if max_chars is None: + max_chars = DEFAULT_MAX_CHARS + + # Check if truncation required + input_char_count = len("".join(input_lines)) + if len(input_lines) <= max_lines and input_char_count <= max_chars: + return input_lines + + # Truncate first to max_lines, and then truncate to max_chars if max_chars + # is exceeded. + truncated_explanation = input_lines[:max_lines] + truncated_explanation = _truncate_by_char_count(truncated_explanation, max_chars) + + # Add ellipsis to final line + truncated_explanation[-1] = truncated_explanation[-1] + "..." + + # Append useful message to explanation + truncated_line_count = len(input_lines) - len(truncated_explanation) + truncated_line_count += 1 # Account for the part-truncated final line + msg = "...Full output truncated" + if truncated_line_count == 1: + msg += " ({} line hidden)".format(truncated_line_count) + else: + msg += " ({} lines hidden)".format(truncated_line_count) + msg += ", {}".format(USAGE_MSG) + truncated_explanation.extend([six.text_type(""), six.text_type(msg)]) + return truncated_explanation + + +def _truncate_by_char_count(input_lines, max_chars): + # Check if truncation required + if len("".join(input_lines)) <= max_chars: + return input_lines + + # Find point at which input length exceeds total allowed length + iterated_char_count = 0 + for iterated_index, input_line in enumerate(input_lines): + if iterated_char_count + len(input_line) > max_chars: + break + iterated_char_count += len(input_line) + + # Create truncated explanation with modified final line + truncated_result = input_lines[:iterated_index] + final_line = input_lines[iterated_index] + if final_line: + final_line_truncate_point = max_chars - iterated_char_count + final_line = final_line[:final_line_truncate_point] + truncated_result.append(final_line) + return truncated_result diff --git a/contrib/python/pytest/py2/_pytest/assertion/util.py b/contrib/python/pytest/py2/_pytest/assertion/util.py new file mode 100644 index 00000000000..c382f1c6091 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/assertion/util.py @@ -0,0 +1,421 @@ +# -*- coding: utf-8 -*- +"""Utilities for assertion debugging""" +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import pprint + +import six + +import _pytest._code +from ..compat import Sequence +from _pytest import outcomes +from _pytest._io.saferepr import saferepr +from _pytest.compat import ATTRS_EQ_FIELD + +# The _reprcompare attribute on the util module is used by the new assertion +# interpretation code and assertion rewriter to detect this plugin was +# loaded and in turn call the hooks defined here as part of the +# DebugInterpreter. +_reprcompare = None + + +# the re-encoding is needed for python2 repr +# with non-ascii characters (see issue 877 and 1379) +def ecu(s): + if isinstance(s, bytes): + return s.decode("UTF-8", "replace") + else: + return s + + +def format_explanation(explanation): + """This formats an explanation + + Normally all embedded newlines are escaped, however there are + three exceptions: \n{, \n} and \n~. The first two are intended + cover nested explanations, see function and attribute explanations + for examples (.visit_Call(), visit_Attribute()). The last one is + for when one explanation needs to span multiple lines, e.g. when + displaying diffs. + """ + explanation = ecu(explanation) + lines = _split_explanation(explanation) + result = _format_lines(lines) + return u"\n".join(result) + + +def _split_explanation(explanation): + """Return a list of individual lines in the explanation + + This will return a list of lines split on '\n{', '\n}' and '\n~'. + Any other newlines will be escaped and appear in the line as the + literal '\n' characters. + """ + raw_lines = (explanation or u"").split("\n") + lines = [raw_lines[0]] + for values in raw_lines[1:]: + if values and values[0] in ["{", "}", "~", ">"]: + lines.append(values) + else: + lines[-1] += "\\n" + values + return lines + + +def _format_lines(lines): + """Format the individual lines + + This will replace the '{', '}' and '~' characters of our mini + formatting language with the proper 'where ...', 'and ...' and ' + + ...' text, taking care of indentation along the way. + + Return a list of formatted lines. + """ + result = lines[:1] + stack = [0] + stackcnt = [0] + for line in lines[1:]: + if line.startswith("{"): + if stackcnt[-1]: + s = u"and " + else: + s = u"where " + stack.append(len(result)) + stackcnt[-1] += 1 + stackcnt.append(0) + result.append(u" +" + u" " * (len(stack) - 1) + s + line[1:]) + elif line.startswith("}"): + stack.pop() + stackcnt.pop() + result[stack[-1]] += line[1:] + else: + assert line[0] in ["~", ">"] + stack[-1] += 1 + indent = len(stack) if line.startswith("~") else len(stack) - 1 + result.append(u" " * indent + line[1:]) + assert len(stack) == 1 + return result + + +# Provide basestring in python3 +try: + basestring = basestring +except NameError: + basestring = str + + +def issequence(x): + return isinstance(x, Sequence) and not isinstance(x, basestring) + + +def istext(x): + return isinstance(x, basestring) + + +def isdict(x): + return isinstance(x, dict) + + +def isset(x): + return isinstance(x, (set, frozenset)) + + +def isdatacls(obj): + return getattr(obj, "__dataclass_fields__", None) is not None + + +def isattrs(obj): + return getattr(obj, "__attrs_attrs__", None) is not None + + +def isiterable(obj): + try: + iter(obj) + return not istext(obj) + except TypeError: + return False + + +def assertrepr_compare(config, op, left, right): + """Return specialised explanations for some operators/operands""" + width = 80 - 15 - len(op) - 2 # 15 chars indentation, 1 space around op + left_repr = saferepr(left, maxsize=int(width // 2)) + right_repr = saferepr(right, maxsize=width - len(left_repr)) + + summary = u"%s %s %s" % (ecu(left_repr), op, ecu(right_repr)) + + verbose = config.getoption("verbose") + explanation = None + try: + if op == "==": + if istext(left) and istext(right): + explanation = _diff_text(left, right, verbose) + else: + if issequence(left) and issequence(right): + explanation = _compare_eq_sequence(left, right, verbose) + elif isset(left) and isset(right): + explanation = _compare_eq_set(left, right, verbose) + elif isdict(left) and isdict(right): + explanation = _compare_eq_dict(left, right, verbose) + elif type(left) == type(right) and (isdatacls(left) or isattrs(left)): + type_fn = (isdatacls, isattrs) + explanation = _compare_eq_cls(left, right, verbose, type_fn) + elif verbose > 0: + explanation = _compare_eq_verbose(left, right) + if isiterable(left) and isiterable(right): + expl = _compare_eq_iterable(left, right, verbose) + if explanation is not None: + explanation.extend(expl) + else: + explanation = expl + elif op == "not in": + if istext(left) and istext(right): + explanation = _notin_text(left, right, verbose) + except outcomes.Exit: + raise + except Exception: + explanation = [ + u"(pytest_assertion plugin: representation of details failed. " + u"Probably an object has a faulty __repr__.)", + six.text_type(_pytest._code.ExceptionInfo.from_current()), + ] + + if not explanation: + return None + + return [summary] + explanation + + +def _diff_text(left, right, verbose=0): + """Return the explanation for the diff between text or bytes. + + Unless --verbose is used this will skip leading and trailing + characters which are identical to keep the diff minimal. + + If the input are bytes they will be safely converted to text. + """ + from difflib import ndiff + + explanation = [] + + def escape_for_readable_diff(binary_text): + """ + Ensures that the internal string is always valid unicode, converting any bytes safely to valid unicode. + This is done using repr() which then needs post-processing to fix the encompassing quotes and un-escape + newlines and carriage returns (#429). + """ + r = six.text_type(repr(binary_text)[1:-1]) + r = r.replace(r"\n", "\n") + r = r.replace(r"\r", "\r") + return r + + if isinstance(left, bytes): + left = escape_for_readable_diff(left) + if isinstance(right, bytes): + right = escape_for_readable_diff(right) + if verbose < 1: + i = 0 # just in case left or right has zero length + for i in range(min(len(left), len(right))): + if left[i] != right[i]: + break + if i > 42: + i -= 10 # Provide some context + explanation = [ + u"Skipping %s identical leading characters in diff, use -v to show" % i + ] + left = left[i:] + right = right[i:] + if len(left) == len(right): + for i in range(len(left)): + if left[-i] != right[-i]: + break + if i > 42: + i -= 10 # Provide some context + explanation += [ + u"Skipping {} identical trailing " + u"characters in diff, use -v to show".format(i) + ] + left = left[:-i] + right = right[:-i] + keepends = True + if left.isspace() or right.isspace(): + left = repr(str(left)) + right = repr(str(right)) + explanation += [u"Strings contain only whitespace, escaping them using repr()"] + explanation += [ + line.strip("\n") + for line in ndiff(left.splitlines(keepends), right.splitlines(keepends)) + ] + return explanation + + +def _compare_eq_verbose(left, right): + keepends = True + left_lines = repr(left).splitlines(keepends) + right_lines = repr(right).splitlines(keepends) + + explanation = [] + explanation += [u"-" + line for line in left_lines] + explanation += [u"+" + line for line in right_lines] + + return explanation + + +def _compare_eq_iterable(left, right, verbose=0): + if not verbose: + return [u"Use -v to get the full diff"] + # dynamic import to speedup pytest + import difflib + + try: + left_formatting = pprint.pformat(left).splitlines() + right_formatting = pprint.pformat(right).splitlines() + explanation = [u"Full diff:"] + except Exception: + # hack: PrettyPrinter.pformat() in python 2 fails when formatting items that can't be sorted(), ie, calling + # sorted() on a list would raise. See issue #718. + # As a workaround, the full diff is generated by using the repr() string of each item of each container. + left_formatting = sorted(repr(x) for x in left) + right_formatting = sorted(repr(x) for x in right) + explanation = [u"Full diff (fallback to calling repr on each item):"] + explanation.extend( + line.strip() for line in difflib.ndiff(left_formatting, right_formatting) + ) + return explanation + + +def _compare_eq_sequence(left, right, verbose=0): + explanation = [] + len_left = len(left) + len_right = len(right) + for i in range(min(len_left, len_right)): + if left[i] != right[i]: + explanation += [u"At index %s diff: %r != %r" % (i, left[i], right[i])] + break + len_diff = len_left - len_right + + if len_diff: + if len_diff > 0: + dir_with_more = "Left" + extra = saferepr(left[len_right]) + else: + len_diff = 0 - len_diff + dir_with_more = "Right" + extra = saferepr(right[len_left]) + + if len_diff == 1: + explanation += [u"%s contains one more item: %s" % (dir_with_more, extra)] + else: + explanation += [ + u"%s contains %d more items, first extra item: %s" + % (dir_with_more, len_diff, extra) + ] + return explanation + + +def _compare_eq_set(left, right, verbose=0): + explanation = [] + diff_left = left - right + diff_right = right - left + if diff_left: + explanation.append(u"Extra items in the left set:") + for item in diff_left: + explanation.append(saferepr(item)) + if diff_right: + explanation.append(u"Extra items in the right set:") + for item in diff_right: + explanation.append(saferepr(item)) + return explanation + + +def _compare_eq_dict(left, right, verbose=0): + explanation = [] + set_left = set(left) + set_right = set(right) + common = set_left.intersection(set_right) + same = {k: left[k] for k in common if left[k] == right[k]} + if same and verbose < 2: + explanation += [u"Omitting %s identical items, use -vv to show" % len(same)] + elif same: + explanation += [u"Common items:"] + explanation += pprint.pformat(same).splitlines() + diff = {k for k in common if left[k] != right[k]} + if diff: + explanation += [u"Differing items:"] + for k in diff: + explanation += [saferepr({k: left[k]}) + " != " + saferepr({k: right[k]})] + extra_left = set_left - set_right + len_extra_left = len(extra_left) + if len_extra_left: + explanation.append( + u"Left contains %d more item%s:" + % (len_extra_left, "" if len_extra_left == 1 else "s") + ) + explanation.extend( + pprint.pformat({k: left[k] for k in extra_left}).splitlines() + ) + extra_right = set_right - set_left + len_extra_right = len(extra_right) + if len_extra_right: + explanation.append( + u"Right contains %d more item%s:" + % (len_extra_right, "" if len_extra_right == 1 else "s") + ) + explanation.extend( + pprint.pformat({k: right[k] for k in extra_right}).splitlines() + ) + return explanation + + +def _compare_eq_cls(left, right, verbose, type_fns): + isdatacls, isattrs = type_fns + if isdatacls(left): + all_fields = left.__dataclass_fields__ + fields_to_check = [field for field, info in all_fields.items() if info.compare] + elif isattrs(left): + all_fields = left.__attrs_attrs__ + fields_to_check = [ + field.name for field in all_fields if getattr(field, ATTRS_EQ_FIELD) + ] + + same = [] + diff = [] + for field in fields_to_check: + if getattr(left, field) == getattr(right, field): + same.append(field) + else: + diff.append(field) + + explanation = [] + if same and verbose < 2: + explanation.append(u"Omitting %s identical items, use -vv to show" % len(same)) + elif same: + explanation += [u"Matching attributes:"] + explanation += pprint.pformat(same).splitlines() + if diff: + explanation += [u"Differing attributes:"] + for field in diff: + explanation += [ + (u"%s: %r != %r") % (field, getattr(left, field), getattr(right, field)) + ] + return explanation + + +def _notin_text(term, text, verbose=0): + index = text.find(term) + head = text[:index] + tail = text[index + len(term) :] + correct_text = head + tail + diff = _diff_text(correct_text, text, verbose) + newdiff = [u"%s is contained here:" % saferepr(term, maxsize=42)] + for line in diff: + if line.startswith(u"Skipping"): + continue + if line.startswith(u"- "): + continue + if line.startswith(u"+ "): + newdiff.append(u" " + line[2:]) + else: + newdiff.append(line) + return newdiff diff --git a/contrib/python/pytest/py2/_pytest/cacheprovider.py b/contrib/python/pytest/py2/_pytest/cacheprovider.py new file mode 100644 index 00000000000..f5c55454849 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/cacheprovider.py @@ -0,0 +1,438 @@ +# -*- coding: utf-8 -*- +""" +merged implementation of the cache provider + +the name cache was not chosen to ensure pluggy automatically +ignores the external pytest-cache +""" +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import json +import os +from collections import OrderedDict + +import attr +import py +import six + +import pytest +from .compat import _PY2 as PY2 +from .pathlib import Path +from .pathlib import resolve_from_str +from .pathlib import rm_rf + +README_CONTENT = u"""\ +# pytest cache directory # + +This directory contains data from the pytest's cache plugin, +which provides the `--lf` and `--ff` options, as well as the `cache` fixture. + +**Do not** commit this to version control. + +See [the docs](https://docs.pytest.org/en/latest/cache.html) for more information. +""" + +CACHEDIR_TAG_CONTENT = b"""\ +Signature: 8a477f597d28d172789f06886806bc55 +# This file is a cache directory tag created by pytest. +# For information about cache directory tags, see: +# http://www.bford.info/cachedir/spec.html +""" + + +@attr.s +class Cache(object): + _cachedir = attr.ib(repr=False) + _config = attr.ib(repr=False) + + @classmethod + def for_config(cls, config): + cachedir = cls.cache_dir_from_config(config) + if config.getoption("cacheclear") and cachedir.exists(): + rm_rf(cachedir) + cachedir.mkdir() + return cls(cachedir, config) + + @staticmethod + def cache_dir_from_config(config): + return resolve_from_str(config.getini("cache_dir"), config.rootdir) + + def warn(self, fmt, **args): + from _pytest.warnings import _issue_warning_captured + from _pytest.warning_types import PytestCacheWarning + + _issue_warning_captured( + PytestCacheWarning(fmt.format(**args) if args else fmt), + self._config.hook, + stacklevel=3, + ) + + def makedir(self, name): + """ return a directory path object with the given name. If the + directory does not yet exist, it will be created. You can use it + to manage files likes e. g. store/retrieve database + dumps across test sessions. + + :param name: must be a string not containing a ``/`` separator. + Make sure the name contains your plugin or application + identifiers to prevent clashes with other cache users. + """ + name = Path(name) + if len(name.parts) > 1: + raise ValueError("name is not allowed to contain path separators") + res = self._cachedir.joinpath("d", name) + res.mkdir(exist_ok=True, parents=True) + return py.path.local(res) + + def _getvaluepath(self, key): + return self._cachedir.joinpath("v", Path(key)) + + def get(self, key, default): + """ return cached value for the given key. If no value + was yet cached or the value cannot be read, the specified + default is returned. + + :param key: must be a ``/`` separated value. Usually the first + name is the name of your plugin or your application. + :param default: must be provided in case of a cache-miss or + invalid cache values. + + """ + path = self._getvaluepath(key) + try: + with path.open("r") as f: + return json.load(f) + except (ValueError, IOError, OSError): + return default + + def set(self, key, value): + """ save value for the given key. + + :param key: must be a ``/`` separated value. Usually the first + name is the name of your plugin or your application. + :param value: must be of any combination of basic + python types, including nested types + like e. g. lists of dictionaries. + """ + path = self._getvaluepath(key) + try: + if path.parent.is_dir(): + cache_dir_exists_already = True + else: + cache_dir_exists_already = self._cachedir.exists() + path.parent.mkdir(exist_ok=True, parents=True) + except (IOError, OSError): + self.warn("could not create cache path {path}", path=path) + return + if not cache_dir_exists_already: + self._ensure_supporting_files() + try: + f = path.open("wb" if PY2 else "w") + except (IOError, OSError): + self.warn("cache could not write path {path}", path=path) + else: + with f: + json.dump(value, f, indent=2, sort_keys=True) + + def _ensure_supporting_files(self): + """Create supporting files in the cache dir that are not really part of the cache.""" + readme_path = self._cachedir / "README.md" + readme_path.write_text(README_CONTENT) + + gitignore_path = self._cachedir.joinpath(".gitignore") + msg = u"# Created by pytest automatically.\n*" + gitignore_path.write_text(msg, encoding="UTF-8") + + cachedir_tag_path = self._cachedir.joinpath("CACHEDIR.TAG") + cachedir_tag_path.write_bytes(CACHEDIR_TAG_CONTENT) + + +class LFPlugin(object): + """ Plugin which implements the --lf (run last-failing) option """ + + def __init__(self, config): + self.config = config + active_keys = "lf", "failedfirst" + self.active = any(config.getoption(key) for key in active_keys) + self.lastfailed = config.cache.get("cache/lastfailed", {}) + self._previously_failed_count = None + self._report_status = None + self._skipped_files = 0 # count skipped files during collection due to --lf + + def last_failed_paths(self): + """Returns a set with all Paths()s of the previously failed nodeids (cached). + """ + try: + return self._last_failed_paths + except AttributeError: + rootpath = Path(self.config.rootdir) + result = {rootpath / nodeid.split("::")[0] for nodeid in self.lastfailed} + result = {x for x in result if x.exists()} + self._last_failed_paths = result + return result + + def pytest_ignore_collect(self, path): + """ + Ignore this file path if we are in --lf mode and it is not in the list of + previously failed files. + """ + if self.active and self.config.getoption("lf") and path.isfile(): + last_failed_paths = self.last_failed_paths() + if last_failed_paths: + skip_it = Path(path) not in self.last_failed_paths() + if skip_it: + self._skipped_files += 1 + return skip_it + + def pytest_report_collectionfinish(self): + if self.active and self.config.getoption("verbose") >= 0: + return "run-last-failure: %s" % self._report_status + + def pytest_runtest_logreport(self, report): + if (report.when == "call" and report.passed) or report.skipped: + self.lastfailed.pop(report.nodeid, None) + elif report.failed: + self.lastfailed[report.nodeid] = True + + def pytest_collectreport(self, report): + passed = report.outcome in ("passed", "skipped") + if passed: + if report.nodeid in self.lastfailed: + self.lastfailed.pop(report.nodeid) + self.lastfailed.update((item.nodeid, True) for item in report.result) + else: + self.lastfailed[report.nodeid] = True + + def pytest_collection_modifyitems(self, session, config, items): + if not self.active: + return + + if self.lastfailed: + previously_failed = [] + previously_passed = [] + for item in items: + if item.nodeid in self.lastfailed: + previously_failed.append(item) + else: + previously_passed.append(item) + self._previously_failed_count = len(previously_failed) + + if not previously_failed: + # Running a subset of all tests with recorded failures + # only outside of it. + self._report_status = "%d known failures not in selected tests" % ( + len(self.lastfailed), + ) + else: + if self.config.getoption("lf"): + items[:] = previously_failed + config.hook.pytest_deselected(items=previously_passed) + else: # --failedfirst + items[:] = previously_failed + previously_passed + + noun = "failure" if self._previously_failed_count == 1 else "failures" + suffix = " first" if self.config.getoption("failedfirst") else "" + self._report_status = "rerun previous {count} {noun}{suffix}".format( + count=self._previously_failed_count, suffix=suffix, noun=noun + ) + + if self._skipped_files > 0: + files_noun = "file" if self._skipped_files == 1 else "files" + self._report_status += " (skipped {files} {files_noun})".format( + files=self._skipped_files, files_noun=files_noun + ) + else: + self._report_status = "no previously failed tests, " + if self.config.getoption("last_failed_no_failures") == "none": + self._report_status += "deselecting all items." + config.hook.pytest_deselected(items=items) + items[:] = [] + else: + self._report_status += "not deselecting items." + + def pytest_sessionfinish(self, session): + config = self.config + if config.getoption("cacheshow") or hasattr(config, "slaveinput"): + return + + saved_lastfailed = config.cache.get("cache/lastfailed", {}) + if saved_lastfailed != self.lastfailed: + config.cache.set("cache/lastfailed", self.lastfailed) + + +class NFPlugin(object): + """ Plugin which implements the --nf (run new-first) option """ + + def __init__(self, config): + self.config = config + self.active = config.option.newfirst + self.cached_nodeids = config.cache.get("cache/nodeids", []) + + def pytest_collection_modifyitems(self, session, config, items): + if self.active: + new_items = OrderedDict() + other_items = OrderedDict() + for item in items: + if item.nodeid not in self.cached_nodeids: + new_items[item.nodeid] = item + else: + other_items[item.nodeid] = item + + items[:] = self._get_increasing_order( + six.itervalues(new_items) + ) + self._get_increasing_order(six.itervalues(other_items)) + self.cached_nodeids = [x.nodeid for x in items if isinstance(x, pytest.Item)] + + def _get_increasing_order(self, items): + return sorted(items, key=lambda item: item.fspath.mtime(), reverse=True) + + def pytest_sessionfinish(self, session): + config = self.config + if config.getoption("cacheshow") or hasattr(config, "slaveinput"): + return + + config.cache.set("cache/nodeids", self.cached_nodeids) + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group.addoption( + "--lf", + "--last-failed", + action="store_true", + dest="lf", + help="rerun only the tests that failed " + "at the last run (or all if none failed)", + ) + group.addoption( + "--ff", + "--failed-first", + action="store_true", + dest="failedfirst", + help="run all tests but run the last failures first. " + "This may re-order tests and thus lead to " + "repeated fixture setup/teardown", + ) + group.addoption( + "--nf", + "--new-first", + action="store_true", + dest="newfirst", + help="run tests from new files first, then the rest of the tests " + "sorted by file mtime", + ) + group.addoption( + "--cache-show", + action="append", + nargs="?", + dest="cacheshow", + help=( + "show cache contents, don't perform collection or tests. " + "Optional argument: glob (default: '*')." + ), + ) + group.addoption( + "--cache-clear", + action="store_true", + dest="cacheclear", + help="remove all cache contents at start of test run.", + ) + cache_dir_default = ".pytest_cache" + if "TOX_ENV_DIR" in os.environ: + cache_dir_default = os.path.join(os.environ["TOX_ENV_DIR"], cache_dir_default) + parser.addini("cache_dir", default=cache_dir_default, help="cache directory path.") + group.addoption( + "--lfnf", + "--last-failed-no-failures", + action="store", + dest="last_failed_no_failures", + choices=("all", "none"), + default="all", + help="which tests to run with no previously (known) failures.", + ) + + +def pytest_cmdline_main(config): + if config.option.cacheshow: + from _pytest.main import wrap_session + + return wrap_session(config, cacheshow) + + +@pytest.hookimpl(tryfirst=True) +def pytest_configure(config): + config.cache = Cache.for_config(config) + config.pluginmanager.register(LFPlugin(config), "lfplugin") + config.pluginmanager.register(NFPlugin(config), "nfplugin") + + +@pytest.fixture +def cache(request): + """ + Return a cache object that can persist state between testing sessions. + + cache.get(key, default) + cache.set(key, value) + + Keys must be a ``/`` separated value, where the first part is usually the + name of your plugin or application to avoid clashes with other cache users. + + Values can be any object handled by the json stdlib module. + """ + return request.config.cache + + +def pytest_report_header(config): + """Display cachedir with --cache-show and if non-default.""" + if config.option.verbose > 0 or config.getini("cache_dir") != ".pytest_cache": + cachedir = config.cache._cachedir + # TODO: evaluate generating upward relative paths + # starting with .., ../.. if sensible + + try: + displaypath = cachedir.relative_to(config.rootdir) + except ValueError: + displaypath = cachedir + return "cachedir: {}".format(displaypath) + + +def cacheshow(config, session): + from pprint import pformat + + tw = py.io.TerminalWriter() + tw.line("cachedir: " + str(config.cache._cachedir)) + if not config.cache._cachedir.is_dir(): + tw.line("cache is empty") + return 0 + + glob = config.option.cacheshow[0] + if glob is None: + glob = "*" + + dummy = object() + basedir = config.cache._cachedir + vdir = basedir / "v" + tw.sep("-", "cache values for %r" % glob) + for valpath in sorted(x for x in vdir.rglob(glob) if x.is_file()): + key = valpath.relative_to(vdir) + val = config.cache.get(key, dummy) + if val is dummy: + tw.line("%s contains unreadable content, will be ignored" % key) + else: + tw.line("%s contains:" % key) + for line in pformat(val).splitlines(): + tw.line(" " + line) + + ddir = basedir / "d" + if ddir.is_dir(): + contents = sorted(ddir.rglob(glob)) + tw.sep("-", "cache directories for %r" % glob) + for p in contents: + # if p.check(dir=1): + # print("%s/" % p.relto(basedir)) + if p.is_file(): + key = p.relative_to(basedir) + tw.line("{} is a file of length {:d}".format(key, p.stat().st_size)) + return 0 diff --git a/contrib/python/pytest/py2/_pytest/capture.py b/contrib/python/pytest/py2/_pytest/capture.py new file mode 100644 index 00000000000..68c17772f39 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/capture.py @@ -0,0 +1,850 @@ +# -*- coding: utf-8 -*- +""" +per-test stdout/stderr capturing mechanism. + +""" +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import collections +import contextlib +import io +import os +import sys +from io import UnsupportedOperation +from tempfile import TemporaryFile + +import six + +import pytest +from _pytest.compat import _PY3 +from _pytest.compat import CaptureIO + +patchsysdict = {0: "stdin", 1: "stdout", 2: "stderr"} + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group._addoption( + "--capture", + action="store", + default="fd" if hasattr(os, "dup") else "sys", + metavar="method", + choices=["fd", "sys", "no"], + help="per-test capturing method: one of fd|sys|no.", + ) + group._addoption( + "-s", + action="store_const", + const="no", + dest="capture", + help="shortcut for --capture=no.", + ) + + +@pytest.hookimpl(hookwrapper=True) +def pytest_load_initial_conftests(early_config, parser, args): + ns = early_config.known_args_namespace + if ns.capture == "fd": + _py36_windowsconsoleio_workaround(sys.stdout) + _colorama_workaround() + _readline_workaround() + pluginmanager = early_config.pluginmanager + capman = CaptureManager(ns.capture) + pluginmanager.register(capman, "capturemanager") + + # make sure that capturemanager is properly reset at final shutdown + early_config.add_cleanup(capman.stop_global_capturing) + + # finally trigger conftest loading but while capturing (issue93) + capman.start_global_capturing() + outcome = yield + capman.suspend_global_capture() + if outcome.excinfo is not None: + out, err = capman.read_global_capture() + sys.stdout.write(out) + sys.stderr.write(err) + + +class CaptureManager(object): + """ + Capture plugin, manages that the appropriate capture method is enabled/disabled during collection and each + test phase (setup, call, teardown). After each of those points, the captured output is obtained and + attached to the collection/runtest report. + + There are two levels of capture: + * global: which is enabled by default and can be suppressed by the ``-s`` option. This is always enabled/disabled + during collection and each test phase. + * fixture: when a test function or one of its fixture depend on the ``capsys`` or ``capfd`` fixtures. In this + case special handling is needed to ensure the fixtures take precedence over the global capture. + """ + + def __init__(self, method): + self._method = method + self._global_capturing = None + self._current_item = None + + def __repr__(self): + return "<CaptureManager _method=%r _global_capturing=%r _current_item=%r>" % ( + self._method, + self._global_capturing, + self._current_item, + ) + + def _getcapture(self, method): + if method == "fd": + return MultiCapture(out=True, err=True, Capture=FDCapture) + elif method == "sys": + return MultiCapture(out=True, err=True, Capture=SysCapture) + elif method == "no": + return MultiCapture(out=False, err=False, in_=False) + raise ValueError("unknown capturing method: %r" % method) # pragma: no cover + + def is_capturing(self): + if self.is_globally_capturing(): + return "global" + capture_fixture = getattr(self._current_item, "_capture_fixture", None) + if capture_fixture is not None: + return ( + "fixture %s" % self._current_item._capture_fixture.request.fixturename + ) + return False + + # Global capturing control + + def is_globally_capturing(self): + return self._method != "no" + + def start_global_capturing(self): + assert self._global_capturing is None + self._global_capturing = self._getcapture(self._method) + self._global_capturing.start_capturing() + + def stop_global_capturing(self): + if self._global_capturing is not None: + self._global_capturing.pop_outerr_to_orig() + self._global_capturing.stop_capturing() + self._global_capturing = None + + def resume_global_capture(self): + # During teardown of the python process, and on rare occasions, capture + # attributes can be `None` while trying to resume global capture. + if self._global_capturing is not None: + self._global_capturing.resume_capturing() + + def suspend_global_capture(self, in_=False): + cap = getattr(self, "_global_capturing", None) + if cap is not None: + cap.suspend_capturing(in_=in_) + + def suspend(self, in_=False): + # Need to undo local capsys-et-al if it exists before disabling global capture. + self.suspend_fixture(self._current_item) + self.suspend_global_capture(in_) + + def resume(self): + self.resume_global_capture() + self.resume_fixture(self._current_item) + + def read_global_capture(self): + return self._global_capturing.readouterr() + + # Fixture Control (it's just forwarding, think about removing this later) + + def activate_fixture(self, item): + """If the current item is using ``capsys`` or ``capfd``, activate them so they take precedence over + the global capture. + """ + fixture = getattr(item, "_capture_fixture", None) + if fixture is not None: + fixture._start() + + def deactivate_fixture(self, item): + """Deactivates the ``capsys`` or ``capfd`` fixture of this item, if any.""" + fixture = getattr(item, "_capture_fixture", None) + if fixture is not None: + fixture.close() + + def suspend_fixture(self, item): + fixture = getattr(item, "_capture_fixture", None) + if fixture is not None: + fixture._suspend() + + def resume_fixture(self, item): + fixture = getattr(item, "_capture_fixture", None) + if fixture is not None: + fixture._resume() + + # Helper context managers + + @contextlib.contextmanager + def global_and_fixture_disabled(self): + """Context manager to temporarily disable global and current fixture capturing.""" + self.suspend() + try: + yield + finally: + self.resume() + + @contextlib.contextmanager + def item_capture(self, when, item): + self.resume_global_capture() + self.activate_fixture(item) + try: + yield + finally: + self.deactivate_fixture(item) + self.suspend_global_capture(in_=False) + + out, err = self.read_global_capture() + item.add_report_section(when, "stdout", out) + item.add_report_section(when, "stderr", err) + + # Hooks + + @pytest.hookimpl(hookwrapper=True) + def pytest_make_collect_report(self, collector): + if isinstance(collector, pytest.File): + self.resume_global_capture() + outcome = yield + self.suspend_global_capture() + out, err = self.read_global_capture() + rep = outcome.get_result() + if out: + rep.sections.append(("Captured stdout", out)) + if err: + rep.sections.append(("Captured stderr", err)) + else: + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_protocol(self, item): + self._current_item = item + yield + self._current_item = None + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_setup(self, item): + with self.item_capture("setup", item): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_call(self, item): + with self.item_capture("call", item): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_teardown(self, item): + with self.item_capture("teardown", item): + yield + + @pytest.hookimpl(tryfirst=True) + def pytest_keyboard_interrupt(self, excinfo): + self.stop_global_capturing() + + @pytest.hookimpl(tryfirst=True) + def pytest_internalerror(self, excinfo): + self.stop_global_capturing() + + +capture_fixtures = {"capfd", "capfdbinary", "capsys", "capsysbinary"} + + +def _ensure_only_one_capture_fixture(request, name): + fixtures = set(request.fixturenames) & capture_fixtures - {name} + if fixtures: + fixtures = sorted(fixtures) + fixtures = fixtures[0] if len(fixtures) == 1 else fixtures + raise request.raiseerror( + "cannot use {} and {} at the same time".format(fixtures, name) + ) + + +@pytest.fixture +def capsys(request): + """Enable text capturing of writes to ``sys.stdout`` and ``sys.stderr``. + + The captured output is made available via ``capsys.readouterr()`` method + calls, which return a ``(out, err)`` namedtuple. + ``out`` and ``err`` will be ``text`` objects. + """ + _ensure_only_one_capture_fixture(request, "capsys") + with _install_capture_fixture_on_item(request, SysCapture) as fixture: + yield fixture + + +@pytest.fixture +def capsysbinary(request): + """Enable bytes capturing of writes to ``sys.stdout`` and ``sys.stderr``. + + The captured output is made available via ``capsysbinary.readouterr()`` + method calls, which return a ``(out, err)`` namedtuple. + ``out`` and ``err`` will be ``bytes`` objects. + """ + _ensure_only_one_capture_fixture(request, "capsysbinary") + # Currently, the implementation uses the python3 specific `.buffer` + # property of CaptureIO. + if sys.version_info < (3,): + raise request.raiseerror("capsysbinary is only supported on Python 3") + with _install_capture_fixture_on_item(request, SysCaptureBinary) as fixture: + yield fixture + + +@pytest.fixture +def capfd(request): + """Enable text capturing of writes to file descriptors ``1`` and ``2``. + + The captured output is made available via ``capfd.readouterr()`` method + calls, which return a ``(out, err)`` namedtuple. + ``out`` and ``err`` will be ``text`` objects. + """ + _ensure_only_one_capture_fixture(request, "capfd") + if not hasattr(os, "dup"): + pytest.skip( + "capfd fixture needs os.dup function which is not available in this system" + ) + with _install_capture_fixture_on_item(request, FDCapture) as fixture: + yield fixture + + +@pytest.fixture +def capfdbinary(request): + """Enable bytes capturing of writes to file descriptors ``1`` and ``2``. + + The captured output is made available via ``capfd.readouterr()`` method + calls, which return a ``(out, err)`` namedtuple. + ``out`` and ``err`` will be ``byte`` objects. + """ + _ensure_only_one_capture_fixture(request, "capfdbinary") + if not hasattr(os, "dup"): + pytest.skip( + "capfdbinary fixture needs os.dup function which is not available in this system" + ) + with _install_capture_fixture_on_item(request, FDCaptureBinary) as fixture: + yield fixture + + +@contextlib.contextmanager +def _install_capture_fixture_on_item(request, capture_class): + """ + Context manager which creates a ``CaptureFixture`` instance and "installs" it on + the item/node of the given request. Used by ``capsys`` and ``capfd``. + + The CaptureFixture is added as attribute of the item because it needs to accessed + by ``CaptureManager`` during its ``pytest_runtest_*`` hooks. + """ + request.node._capture_fixture = fixture = CaptureFixture(capture_class, request) + capmanager = request.config.pluginmanager.getplugin("capturemanager") + # Need to active this fixture right away in case it is being used by another fixture (setup phase). + # If this fixture is being used only by a test function (call phase), then we wouldn't need this + # activation, but it doesn't hurt. + capmanager.activate_fixture(request.node) + yield fixture + fixture.close() + del request.node._capture_fixture + + +class CaptureFixture(object): + """ + Object returned by :py:func:`capsys`, :py:func:`capsysbinary`, :py:func:`capfd` and :py:func:`capfdbinary` + fixtures. + """ + + def __init__(self, captureclass, request): + self.captureclass = captureclass + self.request = request + self._capture = None + self._captured_out = self.captureclass.EMPTY_BUFFER + self._captured_err = self.captureclass.EMPTY_BUFFER + + def _start(self): + if self._capture is None: + self._capture = MultiCapture( + out=True, err=True, in_=False, Capture=self.captureclass + ) + self._capture.start_capturing() + + def close(self): + if self._capture is not None: + out, err = self._capture.pop_outerr_to_orig() + self._captured_out += out + self._captured_err += err + self._capture.stop_capturing() + self._capture = None + + def readouterr(self): + """Read and return the captured output so far, resetting the internal buffer. + + :return: captured content as a namedtuple with ``out`` and ``err`` string attributes + """ + captured_out, captured_err = self._captured_out, self._captured_err + if self._capture is not None: + out, err = self._capture.readouterr() + captured_out += out + captured_err += err + self._captured_out = self.captureclass.EMPTY_BUFFER + self._captured_err = self.captureclass.EMPTY_BUFFER + return CaptureResult(captured_out, captured_err) + + def _suspend(self): + """Suspends this fixture's own capturing temporarily.""" + if self._capture is not None: + self._capture.suspend_capturing() + + def _resume(self): + """Resumes this fixture's own capturing temporarily.""" + if self._capture is not None: + self._capture.resume_capturing() + + @contextlib.contextmanager + def disabled(self): + """Temporarily disables capture while inside the 'with' block.""" + capmanager = self.request.config.pluginmanager.getplugin("capturemanager") + with capmanager.global_and_fixture_disabled(): + yield + + +def safe_text_dupfile(f, mode, default_encoding="UTF8"): + """ return an open text file object that's a duplicate of f on the + FD-level if possible. + """ + encoding = getattr(f, "encoding", None) + try: + fd = f.fileno() + except Exception: + if "b" not in getattr(f, "mode", "") and hasattr(f, "encoding"): + # we seem to have a text stream, let's just use it + return f + else: + newfd = os.dup(fd) + if "b" not in mode: + mode += "b" + f = os.fdopen(newfd, mode, 0) # no buffering + return EncodedFile(f, encoding or default_encoding) + + +class EncodedFile(object): + errors = "strict" # possibly needed by py3 code (issue555) + + def __init__(self, buffer, encoding): + self.buffer = buffer + self.encoding = encoding + + def write(self, obj): + if isinstance(obj, six.text_type): + obj = obj.encode(self.encoding, "replace") + elif _PY3: + raise TypeError( + "write() argument must be str, not {}".format(type(obj).__name__) + ) + self.buffer.write(obj) + + def writelines(self, linelist): + data = "".join(linelist) + self.write(data) + + @property + def name(self): + """Ensure that file.name is a string.""" + return repr(self.buffer) + + @property + def mode(self): + return self.buffer.mode.replace("b", "") + + def __getattr__(self, name): + return getattr(object.__getattribute__(self, "buffer"), name) + + +CaptureResult = collections.namedtuple("CaptureResult", ["out", "err"]) + + +class MultiCapture(object): + out = err = in_ = None + _state = None + + def __init__(self, out=True, err=True, in_=True, Capture=None): + if in_: + self.in_ = Capture(0) + if out: + self.out = Capture(1) + if err: + self.err = Capture(2) + + def __repr__(self): + return "<MultiCapture out=%r err=%r in_=%r _state=%r _in_suspended=%r>" % ( + self.out, + self.err, + self.in_, + self._state, + getattr(self, "_in_suspended", "<UNSET>"), + ) + + def start_capturing(self): + self._state = "started" + if self.in_: + self.in_.start() + if self.out: + self.out.start() + if self.err: + self.err.start() + + def pop_outerr_to_orig(self): + """ pop current snapshot out/err capture and flush to orig streams. """ + out, err = self.readouterr() + if out: + self.out.writeorg(out) + if err: + self.err.writeorg(err) + return out, err + + def suspend_capturing(self, in_=False): + self._state = "suspended" + if self.out: + self.out.suspend() + if self.err: + self.err.suspend() + if in_ and self.in_: + self.in_.suspend() + self._in_suspended = True + + def resume_capturing(self): + self._state = "resumed" + if self.out: + self.out.resume() + if self.err: + self.err.resume() + if hasattr(self, "_in_suspended"): + self.in_.resume() + del self._in_suspended + + def stop_capturing(self): + """ stop capturing and reset capturing streams """ + if self._state == "stopped": + raise ValueError("was already stopped") + self._state = "stopped" + if self.out: + self.out.done() + if self.err: + self.err.done() + if self.in_: + self.in_.done() + + def readouterr(self): + """ return snapshot unicode value of stdout/stderr capturings. """ + return CaptureResult( + self.out.snap() if self.out is not None else "", + self.err.snap() if self.err is not None else "", + ) + + +class NoCapture(object): + EMPTY_BUFFER = None + __init__ = start = done = suspend = resume = lambda *args: None + + +class FDCaptureBinary(object): + """Capture IO to/from a given os-level filedescriptor. + + snap() produces `bytes` + """ + + EMPTY_BUFFER = b"" + _state = None + + def __init__(self, targetfd, tmpfile=None): + self.targetfd = targetfd + try: + self.targetfd_save = os.dup(self.targetfd) + except OSError: + self.start = lambda: None + self.done = lambda: None + else: + if targetfd == 0: + assert not tmpfile, "cannot set tmpfile with stdin" + tmpfile = open(os.devnull, "r") + self.syscapture = SysCapture(targetfd) + else: + if tmpfile is None: + f = TemporaryFile() + with f: + tmpfile = safe_text_dupfile(f, mode="wb+") + if targetfd in patchsysdict: + self.syscapture = SysCapture(targetfd, tmpfile) + else: + self.syscapture = NoCapture() + self.tmpfile = tmpfile + self.tmpfile_fd = tmpfile.fileno() + + def __repr__(self): + return "<FDCapture %s oldfd=%s _state=%r>" % ( + self.targetfd, + getattr(self, "targetfd_save", None), + self._state, + ) + + def start(self): + """ Start capturing on targetfd using memorized tmpfile. """ + try: + os.fstat(self.targetfd_save) + except (AttributeError, OSError): + raise ValueError("saved filedescriptor not valid anymore") + os.dup2(self.tmpfile_fd, self.targetfd) + self.syscapture.start() + self._state = "started" + + def snap(self): + self.tmpfile.seek(0) + res = self.tmpfile.read() + self.tmpfile.seek(0) + self.tmpfile.truncate() + return res + + def done(self): + """ stop capturing, restore streams, return original capture file, + seeked to position zero. """ + targetfd_save = self.__dict__.pop("targetfd_save") + os.dup2(targetfd_save, self.targetfd) + os.close(targetfd_save) + self.syscapture.done() + _attempt_to_close_capture_file(self.tmpfile) + self._state = "done" + + def suspend(self): + self.syscapture.suspend() + os.dup2(self.targetfd_save, self.targetfd) + self._state = "suspended" + + def resume(self): + self.syscapture.resume() + os.dup2(self.tmpfile_fd, self.targetfd) + self._state = "resumed" + + def writeorg(self, data): + """ write to original file descriptor. """ + if isinstance(data, six.text_type): + data = data.encode("utf8") # XXX use encoding of original stream + os.write(self.targetfd_save, data) + + +class FDCapture(FDCaptureBinary): + """Capture IO to/from a given os-level filedescriptor. + + snap() produces text + """ + + EMPTY_BUFFER = str() + + def snap(self): + res = super(FDCapture, self).snap() + enc = getattr(self.tmpfile, "encoding", None) + if enc and isinstance(res, bytes): + res = six.text_type(res, enc, "replace") + return res + + +class SysCapture(object): + + EMPTY_BUFFER = str() + _state = None + + def __init__(self, fd, tmpfile=None): + name = patchsysdict[fd] + self._old = getattr(sys, name) + self.name = name + if tmpfile is None: + if name == "stdin": + tmpfile = DontReadFromInput() + else: + tmpfile = CaptureIO() + self.tmpfile = tmpfile + + def __repr__(self): + return "<SysCapture %s _old=%r, tmpfile=%r _state=%r>" % ( + self.name, + self._old, + self.tmpfile, + self._state, + ) + + def start(self): + setattr(sys, self.name, self.tmpfile) + self._state = "started" + + def snap(self): + res = self.tmpfile.getvalue() + self.tmpfile.seek(0) + self.tmpfile.truncate() + return res + + def done(self): + setattr(sys, self.name, self._old) + del self._old + _attempt_to_close_capture_file(self.tmpfile) + self._state = "done" + + def suspend(self): + setattr(sys, self.name, self._old) + self._state = "suspended" + + def resume(self): + setattr(sys, self.name, self.tmpfile) + self._state = "resumed" + + def writeorg(self, data): + self._old.write(data) + self._old.flush() + + +class SysCaptureBinary(SysCapture): + EMPTY_BUFFER = b"" + + def snap(self): + res = self.tmpfile.buffer.getvalue() + self.tmpfile.seek(0) + self.tmpfile.truncate() + return res + + +class DontReadFromInput(six.Iterator): + """Temporary stub class. Ideally when stdin is accessed, the + capturing should be turned off, with possibly all data captured + so far sent to the screen. This should be configurable, though, + because in automated test runs it is better to crash than + hang indefinitely. + """ + + encoding = None + + def read(self, *args): + raise IOError("reading from stdin while output is captured") + + readline = read + readlines = read + __next__ = read + + def __iter__(self): + return self + + def fileno(self): + raise UnsupportedOperation("redirected stdin is pseudofile, has no fileno()") + + def isatty(self): + return False + + def close(self): + pass + + @property + def buffer(self): + if sys.version_info >= (3, 0): + return self + else: + raise AttributeError("redirected stdin has no attribute buffer") + + +def _colorama_workaround(): + """ + Ensure colorama is imported so that it attaches to the correct stdio + handles on Windows. + + colorama uses the terminal on import time. So if something does the + first import of colorama while I/O capture is active, colorama will + fail in various ways. + """ + if sys.platform.startswith("win32"): + try: + import colorama # noqa: F401 + except ImportError: + pass + + +def _readline_workaround(): + """ + Ensure readline is imported so that it attaches to the correct stdio + handles on Windows. + + Pdb uses readline support where available--when not running from the Python + prompt, the readline module is not imported until running the pdb REPL. If + running pytest with the --pdb option this means the readline module is not + imported until after I/O capture has been started. + + This is a problem for pyreadline, which is often used to implement readline + support on Windows, as it does not attach to the correct handles for stdout + and/or stdin if they have been redirected by the FDCapture mechanism. This + workaround ensures that readline is imported before I/O capture is setup so + that it can attach to the actual stdin/out for the console. + + See https://github.com/pytest-dev/pytest/pull/1281 + """ + if sys.platform.startswith("win32"): + try: + import readline # noqa: F401 + except ImportError: + pass + + +def _py36_windowsconsoleio_workaround(stream): + """ + Python 3.6 implemented unicode console handling for Windows. This works + by reading/writing to the raw console handle using + ``{Read,Write}ConsoleW``. + + The problem is that we are going to ``dup2`` over the stdio file + descriptors when doing ``FDCapture`` and this will ``CloseHandle`` the + handles used by Python to write to the console. Though there is still some + weirdness and the console handle seems to only be closed randomly and not + on the first call to ``CloseHandle``, or maybe it gets reopened with the + same handle value when we suspend capturing. + + The workaround in this case will reopen stdio with a different fd which + also means a different handle by replicating the logic in + "Py_lifecycle.c:initstdio/create_stdio". + + :param stream: in practice ``sys.stdout`` or ``sys.stderr``, but given + here as parameter for unittesting purposes. + + See https://github.com/pytest-dev/py/issues/103 + """ + if not sys.platform.startswith("win32") or sys.version_info[:2] < (3, 6): + return + + # bail out if ``stream`` doesn't seem like a proper ``io`` stream (#2666) + if not hasattr(stream, "buffer"): + return + + buffered = hasattr(stream.buffer, "raw") + raw_stdout = stream.buffer.raw if buffered else stream.buffer + + if not isinstance(raw_stdout, io._WindowsConsoleIO): + return + + def _reopen_stdio(f, mode): + if not buffered and mode[0] == "w": + buffering = 0 + else: + buffering = -1 + + return io.TextIOWrapper( + open(os.dup(f.fileno()), mode, buffering), + f.encoding, + f.errors, + f.newlines, + f.line_buffering, + ) + + sys.stdin = _reopen_stdio(sys.stdin, "rb") + sys.stdout = _reopen_stdio(sys.stdout, "wb") + sys.stderr = _reopen_stdio(sys.stderr, "wb") + + +def _attempt_to_close_capture_file(f): + """Suppress IOError when closing the temporary file used for capturing streams in py27 (#2370)""" + if six.PY2: + try: + f.close() + except IOError: + pass + else: + f.close() diff --git a/contrib/python/pytest/py2/_pytest/compat.py b/contrib/python/pytest/py2/_pytest/compat.py new file mode 100644 index 00000000000..e5c3b84667e --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/compat.py @@ -0,0 +1,473 @@ +# -*- coding: utf-8 -*- +""" +python version compatibility code +""" +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import codecs +import functools +import inspect +import re +import sys +from contextlib import contextmanager + +import attr +import py +import six +from six import text_type + +import _pytest +from _pytest._io.saferepr import saferepr +from _pytest.outcomes import fail +from _pytest.outcomes import TEST_OUTCOME + +try: + import enum +except ImportError: # pragma: no cover + # Only available in Python 3.4+ or as a backport + enum = None + +_PY3 = sys.version_info > (3, 0) +_PY2 = not _PY3 + + +if _PY3: + from inspect import signature, Parameter as Parameter +else: + from funcsigs import signature, Parameter as Parameter + +NOTSET = object() + +PY35 = sys.version_info[:2] >= (3, 5) +PY36 = sys.version_info[:2] >= (3, 6) +MODULE_NOT_FOUND_ERROR = "ModuleNotFoundError" if PY36 else "ImportError" + + +if _PY3: + from collections.abc import MutableMapping as MappingMixin + from collections.abc import Iterable, Mapping, Sequence, Sized +else: + # those raise DeprecationWarnings in Python >=3.7 + from collections import MutableMapping as MappingMixin # noqa + from collections import Iterable, Mapping, Sequence, Sized # noqa + + +if sys.version_info >= (3, 4): + from importlib.util import spec_from_file_location +else: + + def spec_from_file_location(*_, **__): + return None + + +if sys.version_info >= (3, 8): + from importlib import metadata as importlib_metadata # noqa +else: + import importlib_metadata # noqa + + +def _format_args(func): + return str(signature(func)) + + +isfunction = inspect.isfunction +isclass = inspect.isclass +# used to work around a python2 exception info leak +exc_clear = getattr(sys, "exc_clear", lambda: None) +# The type of re.compile objects is not exposed in Python. +REGEX_TYPE = type(re.compile("")) + + +def is_generator(func): + genfunc = inspect.isgeneratorfunction(func) + return genfunc and not iscoroutinefunction(func) + + +def iscoroutinefunction(func): + """Return True if func is a decorated coroutine function. + + Note: copied and modified from Python 3.5's builtin couroutines.py to avoid import asyncio directly, + which in turns also initializes the "logging" module as side-effect (see issue #8). + """ + return getattr(func, "_is_coroutine", False) or ( + hasattr(inspect, "iscoroutinefunction") and inspect.iscoroutinefunction(func) + ) + + +def getlocation(function, curdir): + function = get_real_func(function) + fn = py.path.local(inspect.getfile(function)) + lineno = function.__code__.co_firstlineno + if fn.relto(curdir): + fn = fn.relto(curdir) + return "%s:%d" % (fn, lineno + 1) + + +def num_mock_patch_args(function): + """ return number of arguments used up by mock arguments (if any) """ + patchings = getattr(function, "patchings", None) + if not patchings: + return 0 + mock_modules = [sys.modules.get("mock"), sys.modules.get("unittest.mock")] + if any(mock_modules): + sentinels = [m.DEFAULT for m in mock_modules if m is not None] + return len( + [p for p in patchings if not p.attribute_name and p.new in sentinels] + ) + return len(patchings) + + +def getfuncargnames(function, is_method=False, cls=None): + """Returns the names of a function's mandatory arguments. + + This should return the names of all function arguments that: + * Aren't bound to an instance or type as in instance or class methods. + * Don't have default values. + * Aren't bound with functools.partial. + * Aren't replaced with mocks. + + The is_method and cls arguments indicate that the function should + be treated as a bound method even though it's not unless, only in + the case of cls, the function is a static method. + + @RonnyPfannschmidt: This function should be refactored when we + revisit fixtures. The fixture mechanism should ask the node for + the fixture names, and not try to obtain directly from the + function object well after collection has occurred. + + """ + # The parameters attribute of a Signature object contains an + # ordered mapping of parameter names to Parameter instances. This + # creates a tuple of the names of the parameters that don't have + # defaults. + try: + parameters = signature(function).parameters + except (ValueError, TypeError) as e: + fail( + "Could not determine arguments of {!r}: {}".format(function, e), + pytrace=False, + ) + + arg_names = tuple( + p.name + for p in parameters.values() + if ( + p.kind is Parameter.POSITIONAL_OR_KEYWORD + or p.kind is Parameter.KEYWORD_ONLY + ) + and p.default is Parameter.empty + ) + # If this function should be treated as a bound method even though + # it's passed as an unbound method or function, remove the first + # parameter name. + if is_method or ( + cls and not isinstance(cls.__dict__.get(function.__name__, None), staticmethod) + ): + arg_names = arg_names[1:] + # Remove any names that will be replaced with mocks. + if hasattr(function, "__wrapped__"): + arg_names = arg_names[num_mock_patch_args(function) :] + return arg_names + + +@contextmanager +def dummy_context_manager(): + """Context manager that does nothing, useful in situations where you might need an actual context manager or not + depending on some condition. Using this allow to keep the same code""" + yield + + +def get_default_arg_names(function): + # Note: this code intentionally mirrors the code at the beginning of getfuncargnames, + # to get the arguments which were excluded from its result because they had default values + return tuple( + p.name + for p in signature(function).parameters.values() + if p.kind in (Parameter.POSITIONAL_OR_KEYWORD, Parameter.KEYWORD_ONLY) + and p.default is not Parameter.empty + ) + + +_non_printable_ascii_translate_table = { + i: u"\\x{:02x}".format(i) for i in range(128) if i not in range(32, 127) +} +_non_printable_ascii_translate_table.update( + {ord("\t"): u"\\t", ord("\r"): u"\\r", ord("\n"): u"\\n"} +) + + +def _translate_non_printable(s): + return s.translate(_non_printable_ascii_translate_table) + + +if _PY3: + STRING_TYPES = bytes, str + UNICODE_TYPES = six.text_type + + if PY35: + + def _bytes_to_ascii(val): + return val.decode("ascii", "backslashreplace") + + else: + + def _bytes_to_ascii(val): + if val: + # source: http://goo.gl/bGsnwC + encoded_bytes, _ = codecs.escape_encode(val) + return encoded_bytes.decode("ascii") + else: + # empty bytes crashes codecs.escape_encode (#1087) + return "" + + def ascii_escaped(val): + """If val is pure ascii, returns it as a str(). Otherwise, escapes + bytes objects into a sequence of escaped bytes: + + b'\xc3\xb4\xc5\xd6' -> u'\\xc3\\xb4\\xc5\\xd6' + + and escapes unicode objects into a sequence of escaped unicode + ids, e.g.: + + '4\\nV\\U00043efa\\x0eMXWB\\x1e\\u3028\\u15fd\\xcd\\U0007d944' + + note: + the obvious "v.decode('unicode-escape')" will return + valid utf-8 unicode if it finds them in bytes, but we + want to return escaped bytes for any byte, even if they match + a utf-8 string. + + """ + if isinstance(val, bytes): + ret = _bytes_to_ascii(val) + else: + ret = val + return ret + + +else: + STRING_TYPES = six.string_types + UNICODE_TYPES = six.text_type + + def ascii_escaped(val): + """In py2 bytes and str are the same type, so return if it's a bytes + object, return it unchanged if it is a full ascii string, + otherwise escape it into its binary form. + + If it's a unicode string, change the unicode characters into + unicode escapes. + + """ + if isinstance(val, bytes): + try: + ret = val.decode("utf-8") + except UnicodeDecodeError: + ret = val.decode("utf-8", "ignore") + else: + ret = val.encode("utf-8", "replace").decode("utf-8") + return ret + + +class _PytestWrapper(object): + """Dummy wrapper around a function object for internal use only. + + Used to correctly unwrap the underlying function object + when we are creating fixtures, because we wrap the function object ourselves with a decorator + to issue warnings when the fixture function is called directly. + """ + + def __init__(self, obj): + self.obj = obj + + +def get_real_func(obj): + """ gets the real function object of the (possibly) wrapped object by + functools.wraps or functools.partial. + """ + start_obj = obj + for i in range(100): + # __pytest_wrapped__ is set by @pytest.fixture when wrapping the fixture function + # to trigger a warning if it gets called directly instead of by pytest: we don't + # want to unwrap further than this otherwise we lose useful wrappings like @mock.patch (#3774) + new_obj = getattr(obj, "__pytest_wrapped__", None) + if isinstance(new_obj, _PytestWrapper): + obj = new_obj.obj + break + new_obj = getattr(obj, "__wrapped__", None) + if new_obj is None: + break + obj = new_obj + else: + raise ValueError( + ("could not find real function of {start}\nstopped at {current}").format( + start=saferepr(start_obj), current=saferepr(obj) + ) + ) + if isinstance(obj, functools.partial): + obj = obj.func + return obj + + +def get_real_method(obj, holder): + """ + Attempts to obtain the real function object that might be wrapping ``obj``, while at the same time + returning a bound method to ``holder`` if the original object was a bound method. + """ + try: + is_method = hasattr(obj, "__func__") + obj = get_real_func(obj) + except Exception: + return obj + if is_method and hasattr(obj, "__get__") and callable(obj.__get__): + obj = obj.__get__(holder) + return obj + + +def getfslineno(obj): + # xxx let decorators etc specify a sane ordering + obj = get_real_func(obj) + if hasattr(obj, "place_as"): + obj = obj.place_as + fslineno = _pytest._code.getfslineno(obj) + assert isinstance(fslineno[1], int), obj + return fslineno + + +def getimfunc(func): + try: + return func.__func__ + except AttributeError: + return func + + +def safe_getattr(object, name, default): + """ Like getattr but return default upon any Exception or any OutcomeException. + + Attribute access can potentially fail for 'evil' Python objects. + See issue #214. + It catches OutcomeException because of #2490 (issue #580), new outcomes are derived from BaseException + instead of Exception (for more details check #2707) + """ + try: + return getattr(object, name, default) + except TEST_OUTCOME: + return default + + +def safe_isclass(obj): + """Ignore any exception via isinstance on Python 3.""" + try: + return isclass(obj) + except Exception: + return False + + +def _is_unittest_unexpected_success_a_failure(): + """Return if the test suite should fail if an @expectedFailure unittest test PASSES. + + From https://docs.python.org/3/library/unittest.html?highlight=unittest#unittest.TestResult.wasSuccessful: + Changed in version 3.4: Returns False if there were any + unexpectedSuccesses from tests marked with the expectedFailure() decorator. + """ + return sys.version_info >= (3, 4) + + +if _PY3: + + def safe_str(v): + """returns v as string""" + try: + return str(v) + except UnicodeEncodeError: + return str(v, encoding="utf-8") + + +else: + + def safe_str(v): + """returns v as string, converting to utf-8 if necessary""" + try: + return str(v) + except UnicodeError: + if not isinstance(v, text_type): + v = text_type(v) + errors = "replace" + return v.encode("utf-8", errors) + + +COLLECT_FAKEMODULE_ATTRIBUTES = ( + "Collector", + "Module", + "Function", + "Instance", + "Session", + "Item", + "Class", + "File", + "_fillfuncargs", +) + + +def _setup_collect_fakemodule(): + from types import ModuleType + import pytest + + pytest.collect = ModuleType("pytest.collect") + pytest.collect.__all__ = [] # used for setns + for attribute in COLLECT_FAKEMODULE_ATTRIBUTES: + setattr(pytest.collect, attribute, getattr(pytest, attribute)) + + +if _PY2: + # Without this the test_dupfile_on_textio will fail, otherwise CaptureIO could directly inherit from StringIO. + from py.io import TextIO + + class CaptureIO(TextIO): + @property + def encoding(self): + return getattr(self, "_encoding", "UTF-8") + + +else: + import io + + class CaptureIO(io.TextIOWrapper): + def __init__(self): + super(CaptureIO, self).__init__( + io.BytesIO(), encoding="UTF-8", newline="", write_through=True + ) + + def getvalue(self): + return self.buffer.getvalue().decode("UTF-8") + + +class FuncargnamesCompatAttr(object): + """ helper class so that Metafunc, Function and FixtureRequest + don't need to each define the "funcargnames" compatibility attribute. + """ + + @property + def funcargnames(self): + """ alias attribute for ``fixturenames`` for pre-2.3 compatibility""" + return self.fixturenames + + +if six.PY2: + + def lru_cache(*_, **__): + def dec(fn): + return fn + + return dec + + +else: + from functools import lru_cache # noqa: F401 + + +if getattr(attr, "__version_info__", ()) >= (19, 2): + ATTRS_EQ_FIELD = "eq" +else: + ATTRS_EQ_FIELD = "cmp" diff --git a/contrib/python/pytest/py2/_pytest/config/__init__.py b/contrib/python/pytest/py2/_pytest/config/__init__.py new file mode 100644 index 00000000000..0737ff9d51c --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/config/__init__.py @@ -0,0 +1,1203 @@ +# -*- coding: utf-8 -*- +""" command line options, ini-file and conftest.py processing. """ +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import argparse +import copy +import inspect +import os +import shlex +import sys +import types +import warnings + +import attr +import py +import six +from packaging.version import Version +from pluggy import HookimplMarker +from pluggy import HookspecMarker +from pluggy import PluginManager + +import _pytest._code +import _pytest.assertion +import _pytest.hookspec # the extension point definitions +from .exceptions import PrintHelp +from .exceptions import UsageError +from .findpaths import determine_setup +from .findpaths import exists +from _pytest import deprecated +from _pytest._code import ExceptionInfo +from _pytest._code import filter_traceback +from _pytest.compat import importlib_metadata +from _pytest.compat import lru_cache +from _pytest.compat import safe_str +from _pytest.outcomes import fail +from _pytest.outcomes import Skipped +from _pytest.pathlib import Path +from _pytest.warning_types import PytestConfigWarning + +hookimpl = HookimplMarker("pytest") +hookspec = HookspecMarker("pytest") + + +class ConftestImportFailure(Exception): + def __init__(self, path, excinfo): + Exception.__init__(self, path, excinfo) + self.path = path + self.excinfo = excinfo + + +def main(args=None, plugins=None): + """ return exit code, after performing an in-process test run. + + :arg args: list of command line arguments. + + :arg plugins: list of plugin objects to be auto-registered during + initialization. + """ + from _pytest.main import EXIT_USAGEERROR + + try: + try: + config = _prepareconfig(args, plugins) + except ConftestImportFailure as e: + exc_info = ExceptionInfo(e.excinfo) + tw = py.io.TerminalWriter(sys.stderr) + tw.line( + "ImportError while loading conftest '{e.path}'.".format(e=e), red=True + ) + exc_info.traceback = exc_info.traceback.filter(filter_traceback) + exc_repr = ( + exc_info.getrepr(style="short", chain=False) + if exc_info.traceback + else exc_info.exconly() + ) + formatted_tb = safe_str(exc_repr) + for line in formatted_tb.splitlines(): + tw.line(line.rstrip(), red=True) + return 4 + else: + try: + return config.hook.pytest_cmdline_main(config=config) + finally: + config._ensure_unconfigure() + except UsageError as e: + tw = py.io.TerminalWriter(sys.stderr) + for msg in e.args: + tw.line("ERROR: {}\n".format(msg), red=True) + return EXIT_USAGEERROR + + +class cmdline(object): # compatibility namespace + main = staticmethod(main) + + +def filename_arg(path, optname): + """ Argparse type validator for filename arguments. + + :path: path of filename + :optname: name of the option + """ + if os.path.isdir(path): + raise UsageError("{} must be a filename, given: {}".format(optname, path)) + return path + + +def directory_arg(path, optname): + """Argparse type validator for directory arguments. + + :path: path of directory + :optname: name of the option + """ + if not os.path.isdir(path): + raise UsageError("{} must be a directory, given: {}".format(optname, path)) + return path + + +# Plugins that cannot be disabled via "-p no:X" currently. +essential_plugins = ( + "mark", + "main", + "runner", + "fixtures", + "helpconfig", # Provides -p. +) + +default_plugins = essential_plugins + ( + "python", + "terminal", + "debugging", + "unittest", + "capture", + "skipping", + "tmpdir", + "monkeypatch", + "recwarn", + "pastebin", + "nose", + "assertion", + "junitxml", + "resultlog", + "doctest", + "cacheprovider", + "freeze_support", + "setuponly", + "setupplan", + "stepwise", + "warnings", + "logging", + "reports", +) + +builtin_plugins = set(default_plugins) +builtin_plugins.add("pytester") + + +def get_config(args=None, plugins=None): + # subsequent calls to main will create a fresh instance + pluginmanager = PytestPluginManager() + config = Config( + pluginmanager, + invocation_params=Config.InvocationParams( + args=args, plugins=plugins, dir=Path().resolve() + ), + ) + + if args is not None: + # Handle any "-p no:plugin" args. + pluginmanager.consider_preparse(args) + + for spec in default_plugins: + pluginmanager.import_plugin(spec) + return config + + +def get_plugin_manager(): + """ + Obtain a new instance of the + :py:class:`_pytest.config.PytestPluginManager`, with default plugins + already loaded. + + This function can be used by integration with other tools, like hooking + into pytest to run tests into an IDE. + """ + return get_config().pluginmanager + + +def _prepareconfig(args=None, plugins=None): + warning = None + if args is None: + args = sys.argv[1:] + elif isinstance(args, py.path.local): + args = [str(args)] + elif not isinstance(args, (tuple, list)): + msg = "`args` parameter expected to be a list or tuple of strings, got: {!r} (type: {})" + raise TypeError(msg.format(args, type(args))) + + config = get_config(args, plugins) + pluginmanager = config.pluginmanager + try: + if plugins: + for plugin in plugins: + if isinstance(plugin, six.string_types): + pluginmanager.consider_pluginarg(plugin) + else: + pluginmanager.register(plugin) + if warning: + from _pytest.warnings import _issue_warning_captured + + _issue_warning_captured(warning, hook=config.hook, stacklevel=4) + return pluginmanager.hook.pytest_cmdline_parse( + pluginmanager=pluginmanager, args=args + ) + except BaseException: + config._ensure_unconfigure() + raise + + +class PytestPluginManager(PluginManager): + """ + Overwrites :py:class:`pluggy.PluginManager <pluggy.PluginManager>` to add pytest-specific + functionality: + + * loading plugins from the command line, ``PYTEST_PLUGINS`` env variable and + ``pytest_plugins`` global variables found in plugins being loaded; + * ``conftest.py`` loading during start-up; + """ + + def __init__(self): + super(PytestPluginManager, self).__init__("pytest") + self._conftest_plugins = set() + + # state related to local conftest plugins + self._dirpath2confmods = {} + self._conftestpath2mod = {} + self._confcutdir = None + self._noconftest = False + self._duplicatepaths = set() + + self.add_hookspecs(_pytest.hookspec) + self.register(self) + if os.environ.get("PYTEST_DEBUG"): + err = sys.stderr + encoding = getattr(err, "encoding", "utf8") + try: + err = py.io.dupfile(err, encoding=encoding) + except Exception: + pass + self.trace.root.setwriter(err.write) + self.enable_tracing() + + # Config._consider_importhook will set a real object if required. + self.rewrite_hook = _pytest.assertion.DummyRewriteHook() + # Used to know when we are importing conftests after the pytest_configure stage + self._configured = False + + def addhooks(self, module_or_class): + """ + .. deprecated:: 2.8 + + Use :py:meth:`pluggy.PluginManager.add_hookspecs <PluginManager.add_hookspecs>` + instead. + """ + warnings.warn(deprecated.PLUGIN_MANAGER_ADDHOOKS, stacklevel=2) + return self.add_hookspecs(module_or_class) + + def parse_hookimpl_opts(self, plugin, name): + # pytest hooks are always prefixed with pytest_ + # so we avoid accessing possibly non-readable attributes + # (see issue #1073) + if not name.startswith("pytest_"): + return + # ignore names which can not be hooks + if name == "pytest_plugins": + return + + method = getattr(plugin, name) + opts = super(PytestPluginManager, self).parse_hookimpl_opts(plugin, name) + + # consider only actual functions for hooks (#3775) + if not inspect.isroutine(method): + return + + # collect unmarked hooks as long as they have the `pytest_' prefix + if opts is None and name.startswith("pytest_"): + opts = {} + if opts is not None: + # TODO: DeprecationWarning, people should use hookimpl + # https://github.com/pytest-dev/pytest/issues/4562 + known_marks = {m.name for m in getattr(method, "pytestmark", [])} + + for name in ("tryfirst", "trylast", "optionalhook", "hookwrapper"): + opts.setdefault(name, hasattr(method, name) or name in known_marks) + return opts + + def parse_hookspec_opts(self, module_or_class, name): + opts = super(PytestPluginManager, self).parse_hookspec_opts( + module_or_class, name + ) + if opts is None: + method = getattr(module_or_class, name) + + if name.startswith("pytest_"): + # todo: deprecate hookspec hacks + # https://github.com/pytest-dev/pytest/issues/4562 + known_marks = {m.name for m in getattr(method, "pytestmark", [])} + opts = { + "firstresult": hasattr(method, "firstresult") + or "firstresult" in known_marks, + "historic": hasattr(method, "historic") + or "historic" in known_marks, + } + return opts + + def register(self, plugin, name=None): + if name in ["pytest_catchlog", "pytest_capturelog"]: + warnings.warn( + PytestConfigWarning( + "{} plugin has been merged into the core, " + "please remove it from your requirements.".format( + name.replace("_", "-") + ) + ) + ) + return + ret = super(PytestPluginManager, self).register(plugin, name) + if ret: + self.hook.pytest_plugin_registered.call_historic( + kwargs=dict(plugin=plugin, manager=self) + ) + + if isinstance(plugin, types.ModuleType): + self.consider_module(plugin) + return ret + + def getplugin(self, name): + # support deprecated naming because plugins (xdist e.g.) use it + return self.get_plugin(name) + + def hasplugin(self, name): + """Return True if the plugin with the given name is registered.""" + return bool(self.get_plugin(name)) + + def pytest_configure(self, config): + # XXX now that the pluginmanager exposes hookimpl(tryfirst...) + # we should remove tryfirst/trylast as markers + config.addinivalue_line( + "markers", + "tryfirst: mark a hook implementation function such that the " + "plugin machinery will try to call it first/as early as possible.", + ) + config.addinivalue_line( + "markers", + "trylast: mark a hook implementation function such that the " + "plugin machinery will try to call it last/as late as possible.", + ) + self._configured = True + + # + # internal API for local conftest plugin handling + # + def _set_initial_conftests(self, namespace): + """ load initial conftest files given a preparsed "namespace". + As conftest files may add their own command line options + which have arguments ('--my-opt somepath') we might get some + false positives. All builtin and 3rd party plugins will have + been loaded, however, so common options will not confuse our logic + here. + """ + current = py.path.local() + self._confcutdir = ( + current.join(namespace.confcutdir, abs=True) + if namespace.confcutdir + else None + ) + self._noconftest = namespace.noconftest + self._using_pyargs = namespace.pyargs + testpaths = namespace.file_or_dir + foundanchor = False + for path in testpaths: + path = str(path) + # remove node-id syntax + i = path.find("::") + if i != -1: + path = path[:i] + anchor = current.join(path, abs=1) + if exists(anchor): # we found some file object + self._try_load_conftest(anchor) + foundanchor = True + if not foundanchor: + self._try_load_conftest(current) + + def _try_load_conftest(self, anchor): + self._getconftestmodules(anchor) + # let's also consider test* subdirs + if anchor.check(dir=1): + for x in anchor.listdir("test*"): + if x.check(dir=1): + self._getconftestmodules(x) + + @lru_cache(maxsize=128) + def _getconftestmodules(self, path): + if self._noconftest: + return [] + + if path.isfile(): + directory = path.dirpath() + else: + directory = path + + if six.PY2: # py2 is not using lru_cache. + try: + return self._dirpath2confmods[directory] + except KeyError: + pass + + # XXX these days we may rather want to use config.rootdir + # and allow users to opt into looking into the rootdir parent + # directories instead of requiring to specify confcutdir + clist = [] + for parent in directory.realpath().parts(): + if self._confcutdir and self._confcutdir.relto(parent): + continue + conftestpath = parent.join("conftest.py") + if conftestpath.isfile(): + # Use realpath to avoid loading the same conftest twice + # with build systems that create build directories containing + # symlinks to actual files. + mod = self._importconftest(conftestpath.realpath()) + clist.append(mod) + self._dirpath2confmods[directory] = clist + return clist + + def _rget_with_confmod(self, name, path): + modules = self._getconftestmodules(path) + for mod in reversed(modules): + try: + return mod, getattr(mod, name) + except AttributeError: + continue + raise KeyError(name) + + def _importconftest(self, conftestpath): + try: + return self._conftestpath2mod[conftestpath] + except KeyError: + pkgpath = conftestpath.pypkgpath() + if pkgpath is None: + _ensure_removed_sysmodule(conftestpath.purebasename) + try: + mod = conftestpath.pyimport() + if ( + hasattr(mod, "pytest_plugins") + and self._configured + and not self._using_pyargs + ): + from _pytest.deprecated import ( + PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST, + ) + + fail( + PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST.format( + conftestpath, self._confcutdir + ), + pytrace=False, + ) + except Exception: + raise ConftestImportFailure(conftestpath, sys.exc_info()) + + self._conftest_plugins.add(mod) + self._conftestpath2mod[conftestpath] = mod + dirpath = conftestpath.dirpath() + if dirpath in self._dirpath2confmods: + for path, mods in self._dirpath2confmods.items(): + if path and path.relto(dirpath) or path == dirpath: + assert mod not in mods + mods.append(mod) + self.trace("loaded conftestmodule %r" % (mod)) + self.consider_conftest(mod) + return mod + + # + # API for bootstrapping plugin loading + # + # + + def consider_preparse(self, args): + i = 0 + n = len(args) + while i < n: + opt = args[i] + i += 1 + if isinstance(opt, six.string_types): + if opt == "-p": + try: + parg = args[i] + except IndexError: + return + i += 1 + elif opt.startswith("-p"): + parg = opt[2:] + else: + continue + self.consider_pluginarg(parg) + + def consider_pluginarg(self, arg): + if arg.startswith("no:"): + name = arg[3:] + if name in essential_plugins: + raise UsageError("plugin %s cannot be disabled" % name) + + # PR #4304 : remove stepwise if cacheprovider is blocked + if name == "cacheprovider": + self.set_blocked("stepwise") + self.set_blocked("pytest_stepwise") + + self.set_blocked(name) + if not name.startswith("pytest_"): + self.set_blocked("pytest_" + name) + else: + name = arg + # Unblock the plugin. None indicates that it has been blocked. + # There is no interface with pluggy for this. + if self._name2plugin.get(name, -1) is None: + del self._name2plugin[name] + if not name.startswith("pytest_"): + if self._name2plugin.get("pytest_" + name, -1) is None: + del self._name2plugin["pytest_" + name] + self.import_plugin(arg, consider_entry_points=True) + + def consider_conftest(self, conftestmodule): + self.register(conftestmodule, name=conftestmodule.__file__) + + def consider_env(self): + self._import_plugin_specs(os.environ.get("PYTEST_PLUGINS")) + + def consider_module(self, mod): + self._import_plugin_specs(getattr(mod, "pytest_plugins", [])) + + def _import_plugin_specs(self, spec): + plugins = _get_plugin_specs_as_list(spec) + for import_spec in plugins: + self.import_plugin(import_spec) + + def import_plugin(self, modname, consider_entry_points=False): + """ + Imports a plugin with ``modname``. If ``consider_entry_points`` is True, entry point + names are also considered to find a plugin. + """ + # most often modname refers to builtin modules, e.g. "pytester", + # "terminal" or "capture". Those plugins are registered under their + # basename for historic purposes but must be imported with the + # _pytest prefix. + assert isinstance(modname, six.string_types), ( + "module name as text required, got %r" % modname + ) + modname = str(modname) + if self.is_blocked(modname) or self.get_plugin(modname) is not None: + return + + importspec = "_pytest." + modname if modname in builtin_plugins else modname + self.rewrite_hook.mark_rewrite(importspec) + + if consider_entry_points: + loaded = self.load_setuptools_entrypoints("pytest11", name=modname) + if loaded: + return + + try: + __import__(importspec) + except ImportError as e: + new_exc_message = 'Error importing plugin "%s": %s' % ( + modname, + safe_str(e.args[0]), + ) + new_exc = ImportError(new_exc_message) + tb = sys.exc_info()[2] + + six.reraise(ImportError, new_exc, tb) + + except Skipped as e: + from _pytest.warnings import _issue_warning_captured + + _issue_warning_captured( + PytestConfigWarning("skipped plugin %r: %s" % (modname, e.msg)), + self.hook, + stacklevel=1, + ) + else: + mod = sys.modules[importspec] + self.register(mod, modname) + + +def _get_plugin_specs_as_list(specs): + """ + Parses a list of "plugin specs" and returns a list of plugin names. + + Plugin specs can be given as a list of strings separated by "," or already as a list/tuple in + which case it is returned as a list. Specs can also be `None` in which case an + empty list is returned. + """ + if specs is not None and not isinstance(specs, types.ModuleType): + if isinstance(specs, six.string_types): + specs = specs.split(",") if specs else [] + if not isinstance(specs, (list, tuple)): + raise UsageError( + "Plugin specs must be a ','-separated string or a " + "list/tuple of strings for plugin names. Given: %r" % specs + ) + return list(specs) + return [] + + +def _ensure_removed_sysmodule(modname): + try: + del sys.modules[modname] + except KeyError: + pass + + +class Notset(object): + def __repr__(self): + return "<NOTSET>" + + +notset = Notset() + + +def _iter_rewritable_modules(package_files): + """ + Given an iterable of file names in a source distribution, return the "names" that should + be marked for assertion rewrite (for example the package "pytest_mock/__init__.py" should + be added as "pytest_mock" in the assertion rewrite mechanism. + + This function has to deal with dist-info based distributions and egg based distributions + (which are still very much in use for "editable" installs). + + Here are the file names as seen in a dist-info based distribution: + + pytest_mock/__init__.py + pytest_mock/_version.py + pytest_mock/plugin.py + pytest_mock.egg-info/PKG-INFO + + Here are the file names as seen in an egg based distribution: + + src/pytest_mock/__init__.py + src/pytest_mock/_version.py + src/pytest_mock/plugin.py + src/pytest_mock.egg-info/PKG-INFO + LICENSE + setup.py + + We have to take in account those two distribution flavors in order to determine which + names should be considered for assertion rewriting. + + More information: + https://github.com/pytest-dev/pytest-mock/issues/167 + """ + package_files = list(package_files) + seen_some = False + for fn in package_files: + is_simple_module = "/" not in fn and fn.endswith(".py") + is_package = fn.count("/") == 1 and fn.endswith("__init__.py") + if is_simple_module: + module_name, _ = os.path.splitext(fn) + # we ignore "setup.py" at the root of the distribution + if module_name != "setup": + seen_some = True + yield module_name + elif is_package: + package_name = os.path.dirname(fn) + seen_some = True + yield package_name + + if not seen_some: + # at this point we did not find any packages or modules suitable for assertion + # rewriting, so we try again by stripping the first path component (to account for + # "src" based source trees for example) + # this approach lets us have the common case continue to be fast, as egg-distributions + # are rarer + new_package_files = [] + for fn in package_files: + parts = fn.split("/") + new_fn = "/".join(parts[1:]) + if new_fn: + new_package_files.append(new_fn) + if new_package_files: + for _module in _iter_rewritable_modules(new_package_files): + yield _module + + +class Config(object): + """ + Access to configuration values, pluginmanager and plugin hooks. + + :ivar PytestPluginManager pluginmanager: the plugin manager handles plugin registration and hook invocation. + + :ivar argparse.Namespace option: access to command line option as attributes. + + :ivar InvocationParams invocation_params: + + Object containing the parameters regarding the ``pytest.main`` + invocation. + Contains the followinig read-only attributes: + * ``args``: list of command-line arguments as passed to ``pytest.main()``. + * ``plugins``: list of extra plugins, might be None + * ``dir``: directory where ``pytest.main()`` was invoked from. + """ + + @attr.s(frozen=True) + class InvocationParams(object): + """Holds parameters passed during ``pytest.main()`` + + .. note:: + + Currently the environment variable PYTEST_ADDOPTS is also handled by + pytest implicitly, not being part of the invocation. + + Plugins accessing ``InvocationParams`` must be aware of that. + """ + + args = attr.ib() + plugins = attr.ib() + dir = attr.ib() + + def __init__(self, pluginmanager, invocation_params=None, *args): + from .argparsing import Parser, FILE_OR_DIR + + if invocation_params is None: + invocation_params = self.InvocationParams( + args=(), plugins=None, dir=Path().resolve() + ) + + #: access to command line option as attributes. + #: (deprecated), use :py:func:`getoption() <_pytest.config.Config.getoption>` instead + self.option = argparse.Namespace() + + self.invocation_params = invocation_params + + _a = FILE_OR_DIR + self._parser = Parser( + usage="%%(prog)s [options] [%s] [%s] [...]" % (_a, _a), + processopt=self._processopt, + ) + #: a pluginmanager instance + self.pluginmanager = pluginmanager + self.trace = self.pluginmanager.trace.root.get("config") + self.hook = self.pluginmanager.hook + self._inicache = {} + self._override_ini = () + self._opt2dest = {} + self._cleanup = [] + self.pluginmanager.register(self, "pytestconfig") + self._configured = False + self.hook.pytest_addoption.call_historic(kwargs=dict(parser=self._parser)) + + @property + def invocation_dir(self): + """Backward compatibility""" + return py.path.local(str(self.invocation_params.dir)) + + def add_cleanup(self, func): + """ Add a function to be called when the config object gets out of + use (usually coninciding with pytest_unconfigure).""" + self._cleanup.append(func) + + def _do_configure(self): + assert not self._configured + self._configured = True + self.hook.pytest_configure.call_historic(kwargs=dict(config=self)) + + def _ensure_unconfigure(self): + if self._configured: + self._configured = False + self.hook.pytest_unconfigure(config=self) + self.hook.pytest_configure._call_history = [] + while self._cleanup: + fin = self._cleanup.pop() + fin() + + def get_terminal_writer(self): + return self.pluginmanager.get_plugin("terminalreporter")._tw + + def pytest_cmdline_parse(self, pluginmanager, args): + try: + self.parse(args) + except UsageError: + + # Handle --version and --help here in a minimal fashion. + # This gets done via helpconfig normally, but its + # pytest_cmdline_main is not called in case of errors. + if getattr(self.option, "version", False) or "--version" in args: + from _pytest.helpconfig import showversion + + showversion(self) + elif ( + getattr(self.option, "help", False) or "--help" in args or "-h" in args + ): + self._parser._getparser().print_help() + sys.stdout.write( + "\nNOTE: displaying only minimal help due to UsageError.\n\n" + ) + + raise + + return self + + def notify_exception(self, excinfo, option=None): + if option and getattr(option, "fulltrace", False): + style = "long" + else: + style = "native" + excrepr = excinfo.getrepr( + funcargs=True, showlocals=getattr(option, "showlocals", False), style=style + ) + res = self.hook.pytest_internalerror(excrepr=excrepr, excinfo=excinfo) + if not any(res): + for line in str(excrepr).split("\n"): + sys.stderr.write("INTERNALERROR> %s\n" % line) + sys.stderr.flush() + + def cwd_relative_nodeid(self, nodeid): + # nodeid's are relative to the rootpath, compute relative to cwd + if self.invocation_dir != self.rootdir: + fullpath = self.rootdir.join(nodeid) + nodeid = self.invocation_dir.bestrelpath(fullpath) + return nodeid + + @classmethod + def fromdictargs(cls, option_dict, args): + """ constructor useable for subprocesses. """ + config = get_config(args) + config.option.__dict__.update(option_dict) + config.parse(args, addopts=False) + for x in config.option.plugins: + config.pluginmanager.consider_pluginarg(x) + return config + + def _processopt(self, opt): + for name in opt._short_opts + opt._long_opts: + self._opt2dest[name] = opt.dest + + if hasattr(opt, "default") and opt.dest: + if not hasattr(self.option, opt.dest): + setattr(self.option, opt.dest, opt.default) + + @hookimpl(trylast=True) + def pytest_load_initial_conftests(self, early_config): + self.pluginmanager._set_initial_conftests(early_config.known_args_namespace) + + def _initini(self, args): + ns, unknown_args = self._parser.parse_known_and_unknown_args( + args, namespace=copy.copy(self.option) + ) + r = determine_setup( + ns.inifilename, + ns.file_or_dir + unknown_args, + rootdir_cmd_arg=ns.rootdir or None, + config=self, + ) + self.rootdir, self.inifile, self.inicfg = r + self._parser.extra_info["rootdir"] = self.rootdir + self._parser.extra_info["inifile"] = self.inifile + self._parser.addini("addopts", "extra command line options", "args") + self._parser.addini("minversion", "minimally required pytest version") + self._override_ini = ns.override_ini or () + + def _consider_importhook(self, args): + """Install the PEP 302 import hook if using assertion rewriting. + + Needs to parse the --assert=<mode> option from the commandline + and find all the installed plugins to mark them for rewriting + by the importhook. + """ + ns, unknown_args = self._parser.parse_known_and_unknown_args(args) + mode = getattr(ns, "assertmode", "plain") + if mode == "rewrite": + try: + hook = _pytest.assertion.install_importhook(self) + except SystemError: + mode = "plain" + else: + self._mark_plugins_for_rewrite(hook) + _warn_about_missing_assertion(mode) + + def _mark_plugins_for_rewrite(self, hook): + """ + Given an importhook, mark for rewrite any top-level + modules or packages in the distribution package for + all pytest plugins. + """ + self.pluginmanager.rewrite_hook = hook + + if os.environ.get("PYTEST_DISABLE_PLUGIN_AUTOLOAD"): + # We don't autoload from setuptools entry points, no need to continue. + return + + package_files = ( + str(file) + for dist in importlib_metadata.distributions() + if any(ep.group == "pytest11" for ep in dist.entry_points) + for file in dist.files or [] + ) + + for name in _iter_rewritable_modules(package_files): + hook.mark_rewrite(name) + + def _validate_args(self, args, via): + """Validate known args.""" + self._parser._config_source_hint = via + try: + self._parser.parse_known_and_unknown_args( + args, namespace=copy.copy(self.option) + ) + finally: + del self._parser._config_source_hint + + return args + + def _preparse(self, args, addopts=True): + if addopts: + env_addopts = os.environ.get("PYTEST_ADDOPTS", "") + if len(env_addopts): + args[:] = ( + self._validate_args(shlex.split(env_addopts), "via PYTEST_ADDOPTS") + + args + ) + self._initini(args) + if addopts: + args[:] = ( + self._validate_args(self.getini("addopts"), "via addopts config") + args + ) + + self._checkversion() + self._consider_importhook(args) + self.pluginmanager.consider_preparse(args) + if not os.environ.get("PYTEST_DISABLE_PLUGIN_AUTOLOAD"): + # Don't autoload from setuptools entry point. Only explicitly specified + # plugins are going to be loaded. + self.pluginmanager.load_setuptools_entrypoints("pytest11") + self.pluginmanager.consider_env() + self.known_args_namespace = ns = self._parser.parse_known_args( + args, namespace=copy.copy(self.option) + ) + if self.known_args_namespace.confcutdir is None and self.inifile: + confcutdir = py.path.local(self.inifile).dirname + self.known_args_namespace.confcutdir = confcutdir + try: + self.hook.pytest_load_initial_conftests( + early_config=self, args=args, parser=self._parser + ) + except ConftestImportFailure: + e = sys.exc_info()[1] + if ns.help or ns.version: + # we don't want to prevent --help/--version to work + # so just let is pass and print a warning at the end + from _pytest.warnings import _issue_warning_captured + + _issue_warning_captured( + PytestConfigWarning( + "could not load initial conftests: {}".format(e.path) + ), + self.hook, + stacklevel=2, + ) + else: + raise + + def _checkversion(self): + import pytest + + minver = self.inicfg.get("minversion", None) + if minver: + if Version(minver) > Version(pytest.__version__): + raise pytest.UsageError( + "%s:%d: requires pytest-%s, actual pytest-%s'" + % ( + self.inicfg.config.path, + self.inicfg.lineof("minversion"), + minver, + pytest.__version__, + ) + ) + + def parse(self, args, addopts=True): + # parse given cmdline arguments into this config object. + assert not hasattr( + self, "args" + ), "can only parse cmdline args at most once per Config object" + self._origargs = args + self.hook.pytest_addhooks.call_historic( + kwargs=dict(pluginmanager=self.pluginmanager) + ) + self._preparse(args, addopts=addopts) + # XXX deprecated hook: + self.hook.pytest_cmdline_preparse(config=self, args=args) + self._parser.after_preparse = True + try: + args = self._parser.parse_setoption( + args, self.option, namespace=self.option + ) + if not args: + if self.invocation_dir == self.rootdir: + args = self.getini("testpaths") + if not args: + args = [str(self.invocation_dir)] + self.args = args + except PrintHelp: + pass + + def addinivalue_line(self, name, line): + """ add a line to an ini-file option. The option must have been + declared but might not yet be set in which case the line becomes the + the first line in its value. """ + x = self.getini(name) + assert isinstance(x, list) + x.append(line) # modifies the cached list inline + + def getini(self, name): + """ return configuration value from an :ref:`ini file <inifiles>`. If the + specified name hasn't been registered through a prior + :py:func:`parser.addini <_pytest.config.Parser.addini>` + call (usually from a plugin), a ValueError is raised. """ + try: + return self._inicache[name] + except KeyError: + self._inicache[name] = val = self._getini(name) + return val + + def _getini(self, name): + try: + description, type, default = self._parser._inidict[name] + except KeyError: + raise ValueError("unknown configuration value: %r" % (name,)) + value = self._get_override_ini_value(name) + if value is None: + try: + value = self.inicfg[name] + except KeyError: + if default is not None: + return default + if type is None: + return "" + return [] + if type == "pathlist": + dp = py.path.local(self.inicfg.config.path).dirpath() + values = [] + for relpath in shlex.split(value): + values.append(dp.join(relpath, abs=True)) + return values + elif type == "args": + return shlex.split(value) + elif type == "linelist": + return [t for t in map(lambda x: x.strip(), value.split("\n")) if t] + elif type == "bool": + return bool(_strtobool(value.strip())) + else: + assert type is None + return value + + def _getconftest_pathlist(self, name, path): + try: + mod, relroots = self.pluginmanager._rget_with_confmod(name, path) + except KeyError: + return None + modpath = py.path.local(mod.__file__).dirpath() + values = [] + for relroot in relroots: + if not isinstance(relroot, py.path.local): + relroot = relroot.replace("/", py.path.local.sep) + relroot = modpath.join(relroot, abs=True) + values.append(relroot) + return values + + def _get_override_ini_value(self, name): + value = None + # override_ini is a list of "ini=value" options + # always use the last item if multiple values are set for same ini-name, + # e.g. -o foo=bar1 -o foo=bar2 will set foo to bar2 + for ini_config in self._override_ini: + try: + key, user_ini_value = ini_config.split("=", 1) + except ValueError: + raise UsageError("-o/--override-ini expects option=value style.") + else: + if key == name: + value = user_ini_value + return value + + def getoption(self, name, default=notset, skip=False): + """ return command line option value. + + :arg name: name of the option. You may also specify + the literal ``--OPT`` option instead of the "dest" option name. + :arg default: default value if no option of that name exists. + :arg skip: if True raise pytest.skip if option does not exists + or has a None value. + """ + name = self._opt2dest.get(name, name) + try: + val = getattr(self.option, name) + if val is None and skip: + raise AttributeError(name) + return val + except AttributeError: + if default is not notset: + return default + if skip: + import pytest + + pytest.skip("no %r option found" % (name,)) + raise ValueError("no option named %r" % (name,)) + + def getvalue(self, name, path=None): + """ (deprecated, use getoption()) """ + return self.getoption(name) + + def getvalueorskip(self, name, path=None): + """ (deprecated, use getoption(skip=True)) """ + return self.getoption(name, skip=True) + + +def _assertion_supported(): + try: + assert False + except AssertionError: + return True + else: + return False + + +def _warn_about_missing_assertion(mode): + if not _assertion_supported(): + if mode == "plain": + sys.stderr.write( + "WARNING: ASSERTIONS ARE NOT EXECUTED" + " and FAILING TESTS WILL PASS. Are you" + " using python -O?" + ) + else: + sys.stderr.write( + "WARNING: assertions not in test modules or" + " plugins will be ignored" + " because assert statements are not executed " + "by the underlying Python interpreter " + "(are you using python -O?)\n" + ) + + +def setns(obj, dic): + import pytest + + for name, value in dic.items(): + if isinstance(value, dict): + mod = getattr(obj, name, None) + if mod is None: + modname = "pytest.%s" % name + mod = types.ModuleType(modname) + sys.modules[modname] = mod + mod.__all__ = [] + setattr(obj, name, mod) + obj.__all__.append(name) + setns(mod, value) + else: + setattr(obj, name, value) + obj.__all__.append(name) + # if obj != pytest: + # pytest.__all__.append(name) + setattr(pytest, name, value) + + +def create_terminal_writer(config, *args, **kwargs): + """Create a TerminalWriter instance configured according to the options + in the config object. Every code which requires a TerminalWriter object + and has access to a config object should use this function. + """ + tw = py.io.TerminalWriter(*args, **kwargs) + if config.option.color == "yes": + tw.hasmarkup = True + if config.option.color == "no": + tw.hasmarkup = False + return tw + + +def _strtobool(val): + """Convert a string representation of truth to true (1) or false (0). + + True values are 'y', 'yes', 't', 'true', 'on', and '1'; false values + are 'n', 'no', 'f', 'false', 'off', and '0'. Raises ValueError if + 'val' is anything else. + + .. note:: copied from distutils.util + """ + val = val.lower() + if val in ("y", "yes", "t", "true", "on", "1"): + return 1 + elif val in ("n", "no", "f", "false", "off", "0"): + return 0 + else: + raise ValueError("invalid truth value %r" % (val,)) diff --git a/contrib/python/pytest/py2/_pytest/config/argparsing.py b/contrib/python/pytest/py2/_pytest/config/argparsing.py new file mode 100644 index 00000000000..37fb772db99 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/config/argparsing.py @@ -0,0 +1,410 @@ +# -*- coding: utf-8 -*- +import argparse +import warnings + +import py +import six + +from _pytest.config.exceptions import UsageError + +FILE_OR_DIR = "file_or_dir" + + +class Parser(object): + """ Parser for command line arguments and ini-file values. + + :ivar extra_info: dict of generic param -> value to display in case + there's an error processing the command line arguments. + """ + + prog = None + + def __init__(self, usage=None, processopt=None): + self._anonymous = OptionGroup("custom options", parser=self) + self._groups = [] + self._processopt = processopt + self._usage = usage + self._inidict = {} + self._ininames = [] + self.extra_info = {} + + def processoption(self, option): + if self._processopt: + if option.dest: + self._processopt(option) + + def getgroup(self, name, description="", after=None): + """ get (or create) a named option Group. + + :name: name of the option group. + :description: long description for --help output. + :after: name of other group, used for ordering --help output. + + The returned group object has an ``addoption`` method with the same + signature as :py:func:`parser.addoption + <_pytest.config.Parser.addoption>` but will be shown in the + respective group in the output of ``pytest. --help``. + """ + for group in self._groups: + if group.name == name: + return group + group = OptionGroup(name, description, parser=self) + i = 0 + for i, grp in enumerate(self._groups): + if grp.name == after: + break + self._groups.insert(i + 1, group) + return group + + def addoption(self, *opts, **attrs): + """ register a command line option. + + :opts: option names, can be short or long options. + :attrs: same attributes which the ``add_option()`` function of the + `argparse library + <http://docs.python.org/2/library/argparse.html>`_ + accepts. + + After command line parsing options are available on the pytest config + object via ``config.option.NAME`` where ``NAME`` is usually set + by passing a ``dest`` attribute, for example + ``addoption("--long", dest="NAME", ...)``. + """ + self._anonymous.addoption(*opts, **attrs) + + def parse(self, args, namespace=None): + from _pytest._argcomplete import try_argcomplete + + self.optparser = self._getparser() + try_argcomplete(self.optparser) + args = [str(x) if isinstance(x, py.path.local) else x for x in args] + return self.optparser.parse_args(args, namespace=namespace) + + def _getparser(self): + from _pytest._argcomplete import filescompleter + + optparser = MyOptionParser(self, self.extra_info, prog=self.prog) + groups = self._groups + [self._anonymous] + for group in groups: + if group.options: + desc = group.description or group.name + arggroup = optparser.add_argument_group(desc) + for option in group.options: + n = option.names() + a = option.attrs() + arggroup.add_argument(*n, **a) + # bash like autocompletion for dirs (appending '/') + optparser.add_argument(FILE_OR_DIR, nargs="*").completer = filescompleter + return optparser + + def parse_setoption(self, args, option, namespace=None): + parsedoption = self.parse(args, namespace=namespace) + for name, value in parsedoption.__dict__.items(): + setattr(option, name, value) + return getattr(parsedoption, FILE_OR_DIR) + + def parse_known_args(self, args, namespace=None): + """parses and returns a namespace object with known arguments at this + point. + """ + return self.parse_known_and_unknown_args(args, namespace=namespace)[0] + + def parse_known_and_unknown_args(self, args, namespace=None): + """parses and returns a namespace object with known arguments, and + the remaining arguments unknown at this point. + """ + optparser = self._getparser() + args = [str(x) if isinstance(x, py.path.local) else x for x in args] + return optparser.parse_known_args(args, namespace=namespace) + + def addini(self, name, help, type=None, default=None): + """ register an ini-file option. + + :name: name of the ini-variable + :type: type of the variable, can be ``pathlist``, ``args``, ``linelist`` + or ``bool``. + :default: default value if no ini-file option exists but is queried. + + The value of ini-variables can be retrieved via a call to + :py:func:`config.getini(name) <_pytest.config.Config.getini>`. + """ + assert type in (None, "pathlist", "args", "linelist", "bool") + self._inidict[name] = (help, type, default) + self._ininames.append(name) + + +class ArgumentError(Exception): + """ + Raised if an Argument instance is created with invalid or + inconsistent arguments. + """ + + def __init__(self, msg, option): + self.msg = msg + self.option_id = str(option) + + def __str__(self): + if self.option_id: + return "option %s: %s" % (self.option_id, self.msg) + else: + return self.msg + + +class Argument(object): + """class that mimics the necessary behaviour of optparse.Option + + it's currently a least effort implementation + and ignoring choices and integer prefixes + https://docs.python.org/3/library/optparse.html#optparse-standard-option-types + """ + + _typ_map = {"int": int, "string": str, "float": float, "complex": complex} + + def __init__(self, *names, **attrs): + """store parms in private vars for use in add_argument""" + self._attrs = attrs + self._short_opts = [] + self._long_opts = [] + self.dest = attrs.get("dest") + if "%default" in (attrs.get("help") or ""): + warnings.warn( + 'pytest now uses argparse. "%default" should be' + ' changed to "%(default)s" ', + DeprecationWarning, + stacklevel=3, + ) + try: + typ = attrs["type"] + except KeyError: + pass + else: + # this might raise a keyerror as well, don't want to catch that + if isinstance(typ, six.string_types): + if typ == "choice": + warnings.warn( + "`type` argument to addoption() is the string %r." + " For choices this is optional and can be omitted, " + " but when supplied should be a type (for example `str` or `int`)." + " (options: %s)" % (typ, names), + DeprecationWarning, + stacklevel=4, + ) + # argparse expects a type here take it from + # the type of the first element + attrs["type"] = type(attrs["choices"][0]) + else: + warnings.warn( + "`type` argument to addoption() is the string %r, " + " but when supplied should be a type (for example `str` or `int`)." + " (options: %s)" % (typ, names), + DeprecationWarning, + stacklevel=4, + ) + attrs["type"] = Argument._typ_map[typ] + # used in test_parseopt -> test_parse_defaultgetter + self.type = attrs["type"] + else: + self.type = typ + try: + # attribute existence is tested in Config._processopt + self.default = attrs["default"] + except KeyError: + pass + self._set_opt_strings(names) + if not self.dest: + if self._long_opts: + self.dest = self._long_opts[0][2:].replace("-", "_") + else: + try: + self.dest = self._short_opts[0][1:] + except IndexError: + raise ArgumentError("need a long or short option", self) + + def names(self): + return self._short_opts + self._long_opts + + def attrs(self): + # update any attributes set by processopt + attrs = "default dest help".split() + if self.dest: + attrs.append(self.dest) + for attr in attrs: + try: + self._attrs[attr] = getattr(self, attr) + except AttributeError: + pass + if self._attrs.get("help"): + a = self._attrs["help"] + a = a.replace("%default", "%(default)s") + # a = a.replace('%prog', '%(prog)s') + self._attrs["help"] = a + return self._attrs + + def _set_opt_strings(self, opts): + """directly from optparse + + might not be necessary as this is passed to argparse later on""" + for opt in opts: + if len(opt) < 2: + raise ArgumentError( + "invalid option string %r: " + "must be at least two characters long" % opt, + self, + ) + elif len(opt) == 2: + if not (opt[0] == "-" and opt[1] != "-"): + raise ArgumentError( + "invalid short option string %r: " + "must be of the form -x, (x any non-dash char)" % opt, + self, + ) + self._short_opts.append(opt) + else: + if not (opt[0:2] == "--" and opt[2] != "-"): + raise ArgumentError( + "invalid long option string %r: " + "must start with --, followed by non-dash" % opt, + self, + ) + self._long_opts.append(opt) + + def __repr__(self): + args = [] + if self._short_opts: + args += ["_short_opts: " + repr(self._short_opts)] + if self._long_opts: + args += ["_long_opts: " + repr(self._long_opts)] + args += ["dest: " + repr(self.dest)] + if hasattr(self, "type"): + args += ["type: " + repr(self.type)] + if hasattr(self, "default"): + args += ["default: " + repr(self.default)] + return "Argument({})".format(", ".join(args)) + + +class OptionGroup(object): + def __init__(self, name, description="", parser=None): + self.name = name + self.description = description + self.options = [] + self.parser = parser + + def addoption(self, *optnames, **attrs): + """ add an option to this group. + + if a shortened version of a long option is specified it will + be suppressed in the help. addoption('--twowords', '--two-words') + results in help showing '--two-words' only, but --twowords gets + accepted **and** the automatic destination is in args.twowords + """ + conflict = set(optnames).intersection( + name for opt in self.options for name in opt.names() + ) + if conflict: + raise ValueError("option names %s already added" % conflict) + option = Argument(*optnames, **attrs) + self._addoption_instance(option, shortupper=False) + + def _addoption(self, *optnames, **attrs): + option = Argument(*optnames, **attrs) + self._addoption_instance(option, shortupper=True) + + def _addoption_instance(self, option, shortupper=False): + if not shortupper: + for opt in option._short_opts: + if opt[0] == "-" and opt[1].islower(): + raise ValueError("lowercase shortoptions reserved") + if self.parser: + self.parser.processoption(option) + self.options.append(option) + + +class MyOptionParser(argparse.ArgumentParser): + def __init__(self, parser, extra_info=None, prog=None): + if not extra_info: + extra_info = {} + self._parser = parser + argparse.ArgumentParser.__init__( + self, + prog=prog, + usage=parser._usage, + add_help=False, + formatter_class=DropShorterLongHelpFormatter, + ) + # extra_info is a dict of (param -> value) to display if there's + # an usage error to provide more contextual information to the user + self.extra_info = extra_info + + def error(self, message): + """Transform argparse error message into UsageError.""" + msg = "%s: error: %s" % (self.prog, message) + + if hasattr(self._parser, "_config_source_hint"): + msg = "%s (%s)" % (msg, self._parser._config_source_hint) + + raise UsageError(self.format_usage() + msg) + + def parse_args(self, args=None, namespace=None): + """allow splitting of positional arguments""" + args, argv = self.parse_known_args(args, namespace) + if argv: + for arg in argv: + if arg and arg[0] == "-": + lines = ["unrecognized arguments: %s" % (" ".join(argv))] + for k, v in sorted(self.extra_info.items()): + lines.append(" %s: %s" % (k, v)) + self.error("\n".join(lines)) + getattr(args, FILE_OR_DIR).extend(argv) + return args + + +class DropShorterLongHelpFormatter(argparse.HelpFormatter): + """shorten help for long options that differ only in extra hyphens + + - collapse **long** options that are the same except for extra hyphens + - special action attribute map_long_option allows surpressing additional + long options + - shortcut if there are only two options and one of them is a short one + - cache result on action object as this is called at least 2 times + """ + + def _format_action_invocation(self, action): + orgstr = argparse.HelpFormatter._format_action_invocation(self, action) + if orgstr and orgstr[0] != "-": # only optional arguments + return orgstr + res = getattr(action, "_formatted_action_invocation", None) + if res: + return res + options = orgstr.split(", ") + if len(options) == 2 and (len(options[0]) == 2 or len(options[1]) == 2): + # a shortcut for '-h, --help' or '--abc', '-a' + action._formatted_action_invocation = orgstr + return orgstr + return_list = [] + option_map = getattr(action, "map_long_option", {}) + if option_map is None: + option_map = {} + short_long = {} + for option in options: + if len(option) == 2 or option[2] == " ": + continue + if not option.startswith("--"): + raise ArgumentError( + 'long optional argument without "--": [%s]' % (option), self + ) + xxoption = option[2:] + if xxoption.split()[0] not in option_map: + shortened = xxoption.replace("-", "") + if shortened not in short_long or len(short_long[shortened]) < len( + xxoption + ): + short_long[shortened] = xxoption + # now short_long has been filled out to the longest with dashes + # **and** we keep the right option ordering from add_argument + for option in options: + if len(option) == 2 or option[2] == " ": + return_list.append(option) + if option[2:] == short_long.get(option.replace("-", "")): + return_list.append(option.replace(" ", "=", 1)) + action._formatted_action_invocation = ", ".join(return_list) + return action._formatted_action_invocation diff --git a/contrib/python/pytest/py2/_pytest/config/exceptions.py b/contrib/python/pytest/py2/_pytest/config/exceptions.py new file mode 100644 index 00000000000..bf58fde5dbf --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/config/exceptions.py @@ -0,0 +1,10 @@ +# -*- coding: utf-8 -*- +class UsageError(Exception): + """ error in pytest usage or invocation""" + + +class PrintHelp(Exception): + """Raised when pytest should print it's help to skip the rest of the + argument parsing and validation.""" + + pass diff --git a/contrib/python/pytest/py2/_pytest/config/findpaths.py b/contrib/python/pytest/py2/_pytest/config/findpaths.py new file mode 100644 index 00000000000..e6779b289bc --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/config/findpaths.py @@ -0,0 +1,153 @@ +# -*- coding: utf-8 -*- +import os + +import py + +from .exceptions import UsageError +from _pytest.outcomes import fail + + +def exists(path, ignore=EnvironmentError): + try: + return path.check() + except ignore: + return False + + +def getcfg(args, config=None): + """ + Search the list of arguments for a valid ini-file for pytest, + and return a tuple of (rootdir, inifile, cfg-dict). + + note: config is optional and used only to issue warnings explicitly (#2891). + """ + from _pytest.deprecated import CFG_PYTEST_SECTION + + inibasenames = ["pytest.ini", "tox.ini", "setup.cfg"] + args = [x for x in args if not str(x).startswith("-")] + if not args: + args = [py.path.local()] + for arg in args: + arg = py.path.local(arg) + for base in arg.parts(reverse=True): + for inibasename in inibasenames: + p = base.join(inibasename) + if exists(p): + try: + iniconfig = py.iniconfig.IniConfig(p) + except py.iniconfig.ParseError as exc: + raise UsageError(str(exc)) + + if ( + inibasename == "setup.cfg" + and "tool:pytest" in iniconfig.sections + ): + return base, p, iniconfig["tool:pytest"] + elif "pytest" in iniconfig.sections: + if inibasename == "setup.cfg" and config is not None: + + fail( + CFG_PYTEST_SECTION.format(filename=inibasename), + pytrace=False, + ) + return base, p, iniconfig["pytest"] + elif inibasename == "pytest.ini": + # allowed to be empty + return base, p, {} + return None, None, None + + +def get_common_ancestor(paths): + common_ancestor = None + for path in paths: + if not path.exists(): + continue + if common_ancestor is None: + common_ancestor = path + else: + if path.relto(common_ancestor) or path == common_ancestor: + continue + elif common_ancestor.relto(path): + common_ancestor = path + else: + shared = path.common(common_ancestor) + if shared is not None: + common_ancestor = shared + if common_ancestor is None: + common_ancestor = py.path.local() + elif common_ancestor.isfile(): + common_ancestor = common_ancestor.dirpath() + return common_ancestor + + +def get_dirs_from_args(args): + def is_option(x): + return str(x).startswith("-") + + def get_file_part_from_node_id(x): + return str(x).split("::")[0] + + def get_dir_from_path(path): + if path.isdir(): + return path + return py.path.local(path.dirname) + + # These look like paths but may not exist + possible_paths = ( + py.path.local(get_file_part_from_node_id(arg)) + for arg in args + if not is_option(arg) + ) + + return [get_dir_from_path(path) for path in possible_paths if path.exists()] + + +def determine_setup(inifile, args, rootdir_cmd_arg=None, config=None): + dirs = get_dirs_from_args(args) + if inifile: + iniconfig = py.iniconfig.IniConfig(inifile) + is_cfg_file = str(inifile).endswith(".cfg") + sections = ["tool:pytest", "pytest"] if is_cfg_file else ["pytest"] + for section in sections: + try: + inicfg = iniconfig[section] + if is_cfg_file and section == "pytest" and config is not None: + from _pytest.deprecated import CFG_PYTEST_SECTION + + fail( + CFG_PYTEST_SECTION.format(filename=str(inifile)), pytrace=False + ) + break + except KeyError: + inicfg = None + if rootdir_cmd_arg is None: + rootdir = get_common_ancestor(dirs) + else: + ancestor = get_common_ancestor(dirs) + rootdir, inifile, inicfg = getcfg([ancestor], config=config) + if rootdir is None and rootdir_cmd_arg is None: + for possible_rootdir in ancestor.parts(reverse=True): + if possible_rootdir.join("setup.py").exists(): + rootdir = possible_rootdir + break + else: + if dirs != [ancestor]: + rootdir, inifile, inicfg = getcfg(dirs, config=config) + if rootdir is None: + if config is not None: + cwd = config.invocation_dir + else: + cwd = py.path.local() + rootdir = get_common_ancestor([cwd, ancestor]) + is_fs_root = os.path.splitdrive(str(rootdir))[1] == "/" + if is_fs_root: + rootdir = ancestor + if rootdir_cmd_arg: + rootdir = py.path.local(os.path.expandvars(rootdir_cmd_arg)) + if not rootdir.isdir(): + raise UsageError( + "Directory '{}' not found. Check your '--rootdir' option.".format( + rootdir + ) + ) + return rootdir, inifile, inicfg or {} diff --git a/contrib/python/pytest/py2/_pytest/debugging.py b/contrib/python/pytest/py2/_pytest/debugging.py new file mode 100644 index 00000000000..bc114c8683f --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/debugging.py @@ -0,0 +1,373 @@ +# -*- coding: utf-8 -*- +""" interactive debugging with PDB, the Python Debugger. """ +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import os +import argparse +import pdb +import sys +from doctest import UnexpectedException + +from _pytest import outcomes +from _pytest.config import hookimpl +from _pytest.config.exceptions import UsageError + + +def import_readline(): + try: + import readline + except ImportError: + sys.path.append('/usr/lib/python2.7/lib-dynload') + + try: + import readline + except ImportError as e: + print('can not import readline:', e) + + import subprocess + try: + subprocess.check_call('stty icrnl'.split()) + except OSError as e: + print('can not restore Enter, use Control+J:', e) + + +def tty(): + if os.isatty(1): + return + + fd = os.open('/dev/tty', os.O_RDWR) + os.dup2(fd, 0) + os.dup2(fd, 1) + os.dup2(fd, 2) + os.close(fd) + + old_sys_path = sys.path + sys.path = list(sys.path) + try: + import_readline() + finally: + sys.path = old_sys_path + + +def _validate_usepdb_cls(value): + """Validate syntax of --pdbcls option.""" + try: + modname, classname = value.split(":") + except ValueError: + raise argparse.ArgumentTypeError( + "{!r} is not in the format 'modname:classname'".format(value) + ) + return (modname, classname) + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group._addoption( + "--pdb", + dest="usepdb", + action="store_true", + help="start the interactive Python debugger on errors or KeyboardInterrupt.", + ) + group._addoption( + "--pdbcls", + dest="usepdb_cls", + metavar="modulename:classname", + type=_validate_usepdb_cls, + help="start a custom interactive Python debugger on errors. " + "For example: --pdbcls=IPython.terminal.debugger:TerminalPdb", + ) + group._addoption( + "--trace", + dest="trace", + action="store_true", + help="Immediately break when running each test.", + ) + + +def pytest_configure(config): + if config.getvalue("trace"): + config.pluginmanager.register(PdbTrace(), "pdbtrace") + if config.getvalue("usepdb"): + config.pluginmanager.register(PdbInvoke(), "pdbinvoke") + + pytestPDB._saved.append( + (pdb.set_trace, pytestPDB._pluginmanager, pytestPDB._config) + ) + pdb.set_trace = pytestPDB.set_trace + pytestPDB._pluginmanager = config.pluginmanager + pytestPDB._config = config + + # NOTE: not using pytest_unconfigure, since it might get called although + # pytest_configure was not (if another plugin raises UsageError). + def fin(): + ( + pdb.set_trace, + pytestPDB._pluginmanager, + pytestPDB._config, + ) = pytestPDB._saved.pop() + + config._cleanup.append(fin) + + +class pytestPDB(object): + """ Pseudo PDB that defers to the real pdb. """ + + _pluginmanager = None + _config = None + _saved = [] + _recursive_debug = 0 + _wrapped_pdb_cls = None + + @classmethod + def _is_capturing(cls, capman): + if capman: + return capman.is_capturing() + return False + + @classmethod + def _import_pdb_cls(cls, capman): + if not cls._config: + # Happens when using pytest.set_trace outside of a test. + return pdb.Pdb + + usepdb_cls = cls._config.getvalue("usepdb_cls") + + if cls._wrapped_pdb_cls and cls._wrapped_pdb_cls[0] == usepdb_cls: + return cls._wrapped_pdb_cls[1] + + if usepdb_cls: + modname, classname = usepdb_cls + + try: + __import__(modname) + mod = sys.modules[modname] + + # Handle --pdbcls=pdb:pdb.Pdb (useful e.g. with pdbpp). + parts = classname.split(".") + pdb_cls = getattr(mod, parts[0]) + for part in parts[1:]: + pdb_cls = getattr(pdb_cls, part) + except Exception as exc: + value = ":".join((modname, classname)) + raise UsageError( + "--pdbcls: could not import {!r}: {}".format(value, exc) + ) + else: + pdb_cls = pdb.Pdb + + wrapped_cls = cls._get_pdb_wrapper_class(pdb_cls, capman) + cls._wrapped_pdb_cls = (usepdb_cls, wrapped_cls) + return wrapped_cls + + @classmethod + def _get_pdb_wrapper_class(cls, pdb_cls, capman): + import _pytest.config + + class PytestPdbWrapper(pdb_cls, object): + _pytest_capman = capman + _continued = False + + def do_debug(self, arg): + cls._recursive_debug += 1 + ret = super(PytestPdbWrapper, self).do_debug(arg) + cls._recursive_debug -= 1 + return ret + + def do_continue(self, arg): + ret = super(PytestPdbWrapper, self).do_continue(arg) + if cls._recursive_debug == 0: + tw = _pytest.config.create_terminal_writer(cls._config) + tw.line() + + capman = self._pytest_capman + capturing = pytestPDB._is_capturing(capman) + if capturing: + if capturing == "global": + tw.sep(">", "PDB continue (IO-capturing resumed)") + else: + tw.sep( + ">", + "PDB continue (IO-capturing resumed for %s)" + % capturing, + ) + capman.resume() + else: + tw.sep(">", "PDB continue") + cls._pluginmanager.hook.pytest_leave_pdb(config=cls._config, pdb=self) + self._continued = True + return ret + + do_c = do_cont = do_continue + + def do_quit(self, arg): + """Raise Exit outcome when quit command is used in pdb. + + This is a bit of a hack - it would be better if BdbQuit + could be handled, but this would require to wrap the + whole pytest run, and adjust the report etc. + """ + ret = super(PytestPdbWrapper, self).do_quit(arg) + + if cls._recursive_debug == 0: + outcomes.exit("Quitting debugger") + + return ret + + do_q = do_quit + do_exit = do_quit + + def setup(self, f, tb): + """Suspend on setup(). + + Needed after do_continue resumed, and entering another + breakpoint again. + """ + ret = super(PytestPdbWrapper, self).setup(f, tb) + if not ret and self._continued: + # pdb.setup() returns True if the command wants to exit + # from the interaction: do not suspend capturing then. + if self._pytest_capman: + self._pytest_capman.suspend_global_capture(in_=True) + return ret + + def get_stack(self, f, t): + stack, i = super(PytestPdbWrapper, self).get_stack(f, t) + if f is None: + # Find last non-hidden frame. + i = max(0, len(stack) - 1) + while i and stack[i][0].f_locals.get("__tracebackhide__", False): + i -= 1 + return stack, i + + return PytestPdbWrapper + + @classmethod + def _init_pdb(cls, method, *args, **kwargs): + """ Initialize PDB debugging, dropping any IO capturing. """ + import _pytest.config + + if cls._pluginmanager is not None: + capman = cls._pluginmanager.getplugin("capturemanager") + else: + capman = None + if capman: + capman.suspend(in_=True) + + if cls._config: + tw = _pytest.config.create_terminal_writer(cls._config) + tw.line() + + if cls._recursive_debug == 0: + # Handle header similar to pdb.set_trace in py37+. + header = kwargs.pop("header", None) + if header is not None: + tw.sep(">", header) + else: + capturing = cls._is_capturing(capman) + if capturing == "global": + tw.sep(">", "PDB %s (IO-capturing turned off)" % (method,)) + elif capturing: + tw.sep( + ">", + "PDB %s (IO-capturing turned off for %s)" + % (method, capturing), + ) + else: + tw.sep(">", "PDB %s" % (method,)) + + _pdb = cls._import_pdb_cls(capman)(**kwargs) + + if cls._pluginmanager: + cls._pluginmanager.hook.pytest_enter_pdb(config=cls._config, pdb=_pdb) + return _pdb + + @classmethod + def set_trace(cls, *args, **kwargs): + """Invoke debugging via ``Pdb.set_trace``, dropping any IO capturing.""" + tty() + frame = sys._getframe().f_back + _pdb = cls._init_pdb("set_trace", *args, **kwargs) + _pdb.set_trace(frame) + + +class PdbInvoke(object): + def pytest_exception_interact(self, node, call, report): + capman = node.config.pluginmanager.getplugin("capturemanager") + if capman: + capman.suspend_global_capture(in_=True) + out, err = capman.read_global_capture() + sys.stdout.write(out) + sys.stdout.write(err) + tty() + _enter_pdb(node, call.excinfo, report) + + def pytest_internalerror(self, excrepr, excinfo): + tb = _postmortem_traceback(excinfo) + post_mortem(tb) + + +class PdbTrace(object): + @hookimpl(hookwrapper=True) + def pytest_pyfunc_call(self, pyfuncitem): + _test_pytest_function(pyfuncitem) + yield + + +def _test_pytest_function(pyfuncitem): + _pdb = pytestPDB._init_pdb("runcall") + testfunction = pyfuncitem.obj + pyfuncitem.obj = _pdb.runcall + if "func" in pyfuncitem._fixtureinfo.argnames: # pragma: no branch + raise ValueError("--trace can't be used with a fixture named func!") + pyfuncitem.funcargs["func"] = testfunction + new_list = list(pyfuncitem._fixtureinfo.argnames) + new_list.append("func") + pyfuncitem._fixtureinfo.argnames = tuple(new_list) + + +def _enter_pdb(node, excinfo, rep): + # XXX we re-use the TerminalReporter's terminalwriter + # because this seems to avoid some encoding related troubles + # for not completely clear reasons. + tw = node.config.pluginmanager.getplugin("terminalreporter")._tw + tw.line() + + showcapture = node.config.option.showcapture + + for sectionname, content in ( + ("stdout", rep.capstdout), + ("stderr", rep.capstderr), + ("log", rep.caplog), + ): + if showcapture in (sectionname, "all") and content: + tw.sep(">", "captured " + sectionname) + if content[-1:] == "\n": + content = content[:-1] + tw.line(content) + + tw.sep(">", "traceback") + rep.toterminal(tw) + tw.sep(">", "entering PDB") + tb = _postmortem_traceback(excinfo) + rep._pdbshown = True + post_mortem(tb) + return rep + + +def _postmortem_traceback(excinfo): + if isinstance(excinfo.value, UnexpectedException): + # A doctest.UnexpectedException is not useful for post_mortem. + # Use the underlying exception instead: + return excinfo.value.exc_info[2] + else: + return excinfo._excinfo[2] + + +def post_mortem(t): + p = pytestPDB._init_pdb("post_mortem") + p.reset() + p.interaction(None, t) + if p.quitting: + outcomes.exit("Quitting debugger") diff --git a/contrib/python/pytest/py2/_pytest/deprecated.py b/contrib/python/pytest/py2/_pytest/deprecated.py new file mode 100644 index 00000000000..12394aca3f5 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/deprecated.py @@ -0,0 +1,96 @@ +# -*- coding: utf-8 -*- +""" +This module contains deprecation messages and bits of code used elsewhere in the codebase +that is planned to be removed in the next pytest release. + +Keeping it in a central location makes it easy to track what is deprecated and should +be removed when the time comes. + +All constants defined in this module should be either PytestWarning instances or UnformattedWarning +in case of warnings which need to format their messages. +""" +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +from _pytest.warning_types import PytestDeprecationWarning +from _pytest.warning_types import RemovedInPytest4Warning +from _pytest.warning_types import UnformattedWarning + +YIELD_TESTS = "yield tests were removed in pytest 4.0 - {name} will be ignored" + + +FIXTURE_FUNCTION_CALL = ( + 'Fixture "{name}" called directly. Fixtures are not meant to be called directly,\n' + "but are created automatically when test functions request them as parameters.\n" + "See https://docs.pytest.org/en/latest/fixture.html for more information about fixtures, and\n" + "https://docs.pytest.org/en/latest/deprecations.html#calling-fixtures-directly about how to update your code." +) + +FIXTURE_NAMED_REQUEST = PytestDeprecationWarning( + "'request' is a reserved name for fixtures and will raise an error in future versions" +) + +CFG_PYTEST_SECTION = "[pytest] section in {filename} files is no longer supported, change to [tool:pytest] instead." + +GETFUNCARGVALUE = RemovedInPytest4Warning( + "getfuncargvalue is deprecated, use getfixturevalue" +) + +RAISES_MESSAGE_PARAMETER = PytestDeprecationWarning( + "The 'message' parameter is deprecated.\n" + "(did you mean to use `match='some regex'` to check the exception message?)\n" + "Please see:\n" + " https://docs.pytest.org/en/4.6-maintenance/deprecations.html#message-parameter-of-pytest-raises" +) + +RESULT_LOG = PytestDeprecationWarning( + "--result-log is deprecated and scheduled for removal in pytest 5.0.\n" + "See https://docs.pytest.org/en/latest/deprecations.html#result-log-result-log for more information." +) + +RAISES_EXEC = PytestDeprecationWarning( + "raises(..., 'code(as_a_string)') is deprecated, use the context manager form or use `exec()` directly\n\n" + "See https://docs.pytest.org/en/latest/deprecations.html#raises-warns-exec" +) +WARNS_EXEC = PytestDeprecationWarning( + "warns(..., 'code(as_a_string)') is deprecated, use the context manager form or use `exec()` directly.\n\n" + "See https://docs.pytest.org/en/latest/deprecations.html#raises-warns-exec" +) + +PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST = ( + "Defining 'pytest_plugins' in a non-top-level conftest is no longer supported " + "because it affects the entire directory tree in a non-explicit way.\n" + " {}\n" + "Please move it to a top level conftest file at the rootdir:\n" + " {}\n" + "For more information, visit:\n" + " https://docs.pytest.org/en/latest/deprecations.html#pytest-plugins-in-non-top-level-conftest-files" +) + +PYTEST_CONFIG_GLOBAL = PytestDeprecationWarning( + "the `pytest.config` global is deprecated. Please use `request.config` " + "or `pytest_configure` (if you're a pytest plugin) instead." +) + +PYTEST_ENSURETEMP = RemovedInPytest4Warning( + "pytest/tmpdir_factory.ensuretemp is deprecated, \n" + "please use the tmp_path fixture or tmp_path_factory.mktemp" +) + +PYTEST_LOGWARNING = PytestDeprecationWarning( + "pytest_logwarning is deprecated, no longer being called, and will be removed soon\n" + "please use pytest_warning_captured instead" +) + +PYTEST_WARNS_UNKNOWN_KWARGS = UnformattedWarning( + PytestDeprecationWarning, + "pytest.warns() got unexpected keyword arguments: {args!r}.\n" + "This will be an error in future versions.", +) + +PYTEST_PARAM_UNKNOWN_KWARGS = UnformattedWarning( + PytestDeprecationWarning, + "pytest.param() got unexpected keyword arguments: {args!r}.\n" + "This will be an error in future versions.", +) diff --git a/contrib/python/pytest/py2/_pytest/doctest.py b/contrib/python/pytest/py2/_pytest/doctest.py new file mode 100644 index 00000000000..659d24aeebc --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/doctest.py @@ -0,0 +1,583 @@ +# -*- coding: utf-8 -*- +""" discover and run doctests in modules and test files.""" +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import inspect +import platform +import sys +import traceback +import warnings +from contextlib import contextmanager + +import pytest +from _pytest._code.code import ExceptionInfo +from _pytest._code.code import ReprFileLocation +from _pytest._code.code import TerminalRepr +from _pytest.compat import safe_getattr +from _pytest.fixtures import FixtureRequest +from _pytest.outcomes import Skipped +from _pytest.warning_types import PytestWarning + +DOCTEST_REPORT_CHOICE_NONE = "none" +DOCTEST_REPORT_CHOICE_CDIFF = "cdiff" +DOCTEST_REPORT_CHOICE_NDIFF = "ndiff" +DOCTEST_REPORT_CHOICE_UDIFF = "udiff" +DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE = "only_first_failure" + +DOCTEST_REPORT_CHOICES = ( + DOCTEST_REPORT_CHOICE_NONE, + DOCTEST_REPORT_CHOICE_CDIFF, + DOCTEST_REPORT_CHOICE_NDIFF, + DOCTEST_REPORT_CHOICE_UDIFF, + DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE, +) + +# Lazy definition of runner class +RUNNER_CLASS = None + + +def pytest_addoption(parser): + parser.addini( + "doctest_optionflags", + "option flags for doctests", + type="args", + default=["ELLIPSIS"], + ) + parser.addini( + "doctest_encoding", "encoding used for doctest files", default="utf-8" + ) + group = parser.getgroup("collect") + group.addoption( + "--doctest-modules", + action="store_true", + default=False, + help="run doctests in all .py modules", + dest="doctestmodules", + ) + group.addoption( + "--doctest-report", + type=str.lower, + default="udiff", + help="choose another output format for diffs on doctest failure", + choices=DOCTEST_REPORT_CHOICES, + dest="doctestreport", + ) + group.addoption( + "--doctest-glob", + action="append", + default=[], + metavar="pat", + help="doctests file matching pattern, default: test*.txt", + dest="doctestglob", + ) + group.addoption( + "--doctest-ignore-import-errors", + action="store_true", + default=False, + help="ignore doctest ImportErrors", + dest="doctest_ignore_import_errors", + ) + group.addoption( + "--doctest-continue-on-failure", + action="store_true", + default=False, + help="for a given doctest, continue to run after the first failure", + dest="doctest_continue_on_failure", + ) + + +def pytest_collect_file(path, parent): + config = parent.config + if path.ext == ".py": + if config.option.doctestmodules and not _is_setup_py(config, path, parent): + return DoctestModule(path, parent) + elif _is_doctest(config, path, parent): + return DoctestTextfile(path, parent) + + +def _is_setup_py(config, path, parent): + if path.basename != "setup.py": + return False + contents = path.read() + return "setuptools" in contents or "distutils" in contents + + +def _is_doctest(config, path, parent): + if path.ext in (".txt", ".rst") and parent.session.isinitpath(path): + return True + globs = config.getoption("doctestglob") or ["test*.txt"] + for glob in globs: + if path.check(fnmatch=glob): + return True + return False + + +class ReprFailDoctest(TerminalRepr): + def __init__(self, reprlocation_lines): + # List of (reprlocation, lines) tuples + self.reprlocation_lines = reprlocation_lines + + def toterminal(self, tw): + for reprlocation, lines in self.reprlocation_lines: + for line in lines: + tw.line(line) + reprlocation.toterminal(tw) + + +class MultipleDoctestFailures(Exception): + def __init__(self, failures): + super(MultipleDoctestFailures, self).__init__() + self.failures = failures + + +def _init_runner_class(): + import doctest + + class PytestDoctestRunner(doctest.DebugRunner): + """ + Runner to collect failures. Note that the out variable in this case is + a list instead of a stdout-like object + """ + + def __init__( + self, checker=None, verbose=None, optionflags=0, continue_on_failure=True + ): + doctest.DebugRunner.__init__( + self, checker=checker, verbose=verbose, optionflags=optionflags + ) + self.continue_on_failure = continue_on_failure + + def report_failure(self, out, test, example, got): + failure = doctest.DocTestFailure(test, example, got) + if self.continue_on_failure: + out.append(failure) + else: + raise failure + + def report_unexpected_exception(self, out, test, example, exc_info): + if isinstance(exc_info[1], Skipped): + raise exc_info[1] + failure = doctest.UnexpectedException(test, example, exc_info) + if self.continue_on_failure: + out.append(failure) + else: + raise failure + + return PytestDoctestRunner + + +def _get_runner(checker=None, verbose=None, optionflags=0, continue_on_failure=True): + # We need this in order to do a lazy import on doctest + global RUNNER_CLASS + if RUNNER_CLASS is None: + RUNNER_CLASS = _init_runner_class() + return RUNNER_CLASS( + checker=checker, + verbose=verbose, + optionflags=optionflags, + continue_on_failure=continue_on_failure, + ) + + +class DoctestItem(pytest.Item): + def __init__(self, name, parent, runner=None, dtest=None): + super(DoctestItem, self).__init__(name, parent) + self.runner = runner + self.dtest = dtest + self.obj = None + self.fixture_request = None + + def setup(self): + if self.dtest is not None: + self.fixture_request = _setup_fixtures(self) + globs = dict(getfixture=self.fixture_request.getfixturevalue) + for name, value in self.fixture_request.getfixturevalue( + "doctest_namespace" + ).items(): + globs[name] = value + self.dtest.globs.update(globs) + + def runtest(self): + _check_all_skipped(self.dtest) + self._disable_output_capturing_for_darwin() + failures = [] + self.runner.run(self.dtest, out=failures) + if failures: + raise MultipleDoctestFailures(failures) + + def _disable_output_capturing_for_darwin(self): + """ + Disable output capturing. Otherwise, stdout is lost to doctest (#985) + """ + if platform.system() != "Darwin": + return + capman = self.config.pluginmanager.getplugin("capturemanager") + if capman: + capman.suspend_global_capture(in_=True) + out, err = capman.read_global_capture() + sys.stdout.write(out) + sys.stderr.write(err) + + def repr_failure(self, excinfo): + import doctest + + failures = None + if excinfo.errisinstance((doctest.DocTestFailure, doctest.UnexpectedException)): + failures = [excinfo.value] + elif excinfo.errisinstance(MultipleDoctestFailures): + failures = excinfo.value.failures + + if failures is not None: + reprlocation_lines = [] + for failure in failures: + example = failure.example + test = failure.test + filename = test.filename + if test.lineno is None: + lineno = None + else: + lineno = test.lineno + example.lineno + 1 + message = type(failure).__name__ + reprlocation = ReprFileLocation(filename, lineno, message) + checker = _get_checker() + report_choice = _get_report_choice( + self.config.getoption("doctestreport") + ) + if lineno is not None: + lines = failure.test.docstring.splitlines(False) + # add line numbers to the left of the error message + lines = [ + "%03d %s" % (i + test.lineno + 1, x) + for (i, x) in enumerate(lines) + ] + # trim docstring error lines to 10 + lines = lines[max(example.lineno - 9, 0) : example.lineno + 1] + else: + lines = [ + "EXAMPLE LOCATION UNKNOWN, not showing all tests of that example" + ] + indent = ">>>" + for line in example.source.splitlines(): + lines.append("??? %s %s" % (indent, line)) + indent = "..." + if isinstance(failure, doctest.DocTestFailure): + lines += checker.output_difference( + example, failure.got, report_choice + ).split("\n") + else: + inner_excinfo = ExceptionInfo(failure.exc_info) + lines += ["UNEXPECTED EXCEPTION: %s" % repr(inner_excinfo.value)] + lines += traceback.format_exception(*failure.exc_info) + reprlocation_lines.append((reprlocation, lines)) + return ReprFailDoctest(reprlocation_lines) + else: + return super(DoctestItem, self).repr_failure(excinfo) + + def reportinfo(self): + return self.fspath, self.dtest.lineno, "[doctest] %s" % self.name + + +def _get_flag_lookup(): + import doctest + + return dict( + DONT_ACCEPT_TRUE_FOR_1=doctest.DONT_ACCEPT_TRUE_FOR_1, + DONT_ACCEPT_BLANKLINE=doctest.DONT_ACCEPT_BLANKLINE, + NORMALIZE_WHITESPACE=doctest.NORMALIZE_WHITESPACE, + ELLIPSIS=doctest.ELLIPSIS, + IGNORE_EXCEPTION_DETAIL=doctest.IGNORE_EXCEPTION_DETAIL, + COMPARISON_FLAGS=doctest.COMPARISON_FLAGS, + ALLOW_UNICODE=_get_allow_unicode_flag(), + ALLOW_BYTES=_get_allow_bytes_flag(), + ) + + +def get_optionflags(parent): + optionflags_str = parent.config.getini("doctest_optionflags") + flag_lookup_table = _get_flag_lookup() + flag_acc = 0 + for flag in optionflags_str: + flag_acc |= flag_lookup_table[flag] + return flag_acc + + +def _get_continue_on_failure(config): + continue_on_failure = config.getvalue("doctest_continue_on_failure") + if continue_on_failure: + # We need to turn off this if we use pdb since we should stop at + # the first failure + if config.getvalue("usepdb"): + continue_on_failure = False + return continue_on_failure + + +class DoctestTextfile(pytest.Module): + obj = None + + def collect(self): + import doctest + + # inspired by doctest.testfile; ideally we would use it directly, + # but it doesn't support passing a custom checker + encoding = self.config.getini("doctest_encoding") + text = self.fspath.read_text(encoding) + filename = str(self.fspath) + name = self.fspath.basename + globs = {"__name__": "__main__"} + + optionflags = get_optionflags(self) + + runner = _get_runner( + verbose=0, + optionflags=optionflags, + checker=_get_checker(), + continue_on_failure=_get_continue_on_failure(self.config), + ) + _fix_spoof_python2(runner, encoding) + + parser = doctest.DocTestParser() + test = parser.get_doctest(text, globs, name, filename, 0) + if test.examples: + yield DoctestItem(test.name, self, runner, test) + + +def _check_all_skipped(test): + """raises pytest.skip() if all examples in the given DocTest have the SKIP + option set. + """ + import doctest + + all_skipped = all(x.options.get(doctest.SKIP, False) for x in test.examples) + if all_skipped: + pytest.skip("all tests skipped by +SKIP option") + + +def _is_mocked(obj): + """ + returns if a object is possibly a mock object by checking the existence of a highly improbable attribute + """ + return ( + safe_getattr(obj, "pytest_mock_example_attribute_that_shouldnt_exist", None) + is not None + ) + + +@contextmanager +def _patch_unwrap_mock_aware(): + """ + contextmanager which replaces ``inspect.unwrap`` with a version + that's aware of mock objects and doesn't recurse on them + """ + real_unwrap = getattr(inspect, "unwrap", None) + if real_unwrap is None: + yield + else: + + def _mock_aware_unwrap(obj, stop=None): + try: + if stop is None or stop is _is_mocked: + return real_unwrap(obj, stop=_is_mocked) + return real_unwrap(obj, stop=lambda obj: _is_mocked(obj) or stop(obj)) + except Exception as e: + warnings.warn( + "Got %r when unwrapping %r. This is usually caused " + "by a violation of Python's object protocol; see e.g. " + "https://github.com/pytest-dev/pytest/issues/5080" % (e, obj), + PytestWarning, + ) + raise + + inspect.unwrap = _mock_aware_unwrap + try: + yield + finally: + inspect.unwrap = real_unwrap + + +class DoctestModule(pytest.Module): + def collect(self): + import doctest + + class MockAwareDocTestFinder(doctest.DocTestFinder): + """ + a hackish doctest finder that overrides stdlib internals to fix a stdlib bug + + https://github.com/pytest-dev/pytest/issues/3456 + https://bugs.python.org/issue25532 + """ + + def _find(self, tests, obj, name, module, source_lines, globs, seen): + if _is_mocked(obj): + return + with _patch_unwrap_mock_aware(): + + doctest.DocTestFinder._find( + self, tests, obj, name, module, source_lines, globs, seen + ) + + if self.fspath.basename == "conftest.py": + module = self.config.pluginmanager._importconftest(self.fspath) + else: + try: + module = self.fspath.pyimport() + except ImportError: + if self.config.getvalue("doctest_ignore_import_errors"): + pytest.skip("unable to import module %r" % self.fspath) + else: + raise + # uses internal doctest module parsing mechanism + finder = MockAwareDocTestFinder() + optionflags = get_optionflags(self) + runner = _get_runner( + verbose=0, + optionflags=optionflags, + checker=_get_checker(), + continue_on_failure=_get_continue_on_failure(self.config), + ) + + for test in finder.find(module, module.__name__): + if test.examples: # skip empty doctests + yield DoctestItem(test.name, self, runner, test) + + +def _setup_fixtures(doctest_item): + """ + Used by DoctestTextfile and DoctestItem to setup fixture information. + """ + + def func(): + pass + + doctest_item.funcargs = {} + fm = doctest_item.session._fixturemanager + doctest_item._fixtureinfo = fm.getfixtureinfo( + node=doctest_item, func=func, cls=None, funcargs=False + ) + fixture_request = FixtureRequest(doctest_item) + fixture_request._fillfixtures() + return fixture_request + + +def _get_checker(): + """ + Returns a doctest.OutputChecker subclass that takes in account the + ALLOW_UNICODE option to ignore u'' prefixes in strings and ALLOW_BYTES + to strip b'' prefixes. + Useful when the same doctest should run in Python 2 and Python 3. + + An inner class is used to avoid importing "doctest" at the module + level. + """ + if hasattr(_get_checker, "LiteralsOutputChecker"): + return _get_checker.LiteralsOutputChecker() + + import doctest + import re + + class LiteralsOutputChecker(doctest.OutputChecker): + """ + Copied from doctest_nose_plugin.py from the nltk project: + https://github.com/nltk/nltk + + Further extended to also support byte literals. + """ + + _unicode_literal_re = re.compile(r"(\W|^)[uU]([rR]?[\'\"])", re.UNICODE) + _bytes_literal_re = re.compile(r"(\W|^)[bB]([rR]?[\'\"])", re.UNICODE) + + def check_output(self, want, got, optionflags): + res = doctest.OutputChecker.check_output(self, want, got, optionflags) + if res: + return True + + allow_unicode = optionflags & _get_allow_unicode_flag() + allow_bytes = optionflags & _get_allow_bytes_flag() + if not allow_unicode and not allow_bytes: + return False + + else: # pragma: no cover + + def remove_prefixes(regex, txt): + return re.sub(regex, r"\1\2", txt) + + if allow_unicode: + want = remove_prefixes(self._unicode_literal_re, want) + got = remove_prefixes(self._unicode_literal_re, got) + if allow_bytes: + want = remove_prefixes(self._bytes_literal_re, want) + got = remove_prefixes(self._bytes_literal_re, got) + res = doctest.OutputChecker.check_output(self, want, got, optionflags) + return res + + _get_checker.LiteralsOutputChecker = LiteralsOutputChecker + return _get_checker.LiteralsOutputChecker() + + +def _get_allow_unicode_flag(): + """ + Registers and returns the ALLOW_UNICODE flag. + """ + import doctest + + return doctest.register_optionflag("ALLOW_UNICODE") + + +def _get_allow_bytes_flag(): + """ + Registers and returns the ALLOW_BYTES flag. + """ + import doctest + + return doctest.register_optionflag("ALLOW_BYTES") + + +def _get_report_choice(key): + """ + This function returns the actual `doctest` module flag value, we want to do it as late as possible to avoid + importing `doctest` and all its dependencies when parsing options, as it adds overhead and breaks tests. + """ + import doctest + + return { + DOCTEST_REPORT_CHOICE_UDIFF: doctest.REPORT_UDIFF, + DOCTEST_REPORT_CHOICE_CDIFF: doctest.REPORT_CDIFF, + DOCTEST_REPORT_CHOICE_NDIFF: doctest.REPORT_NDIFF, + DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE: doctest.REPORT_ONLY_FIRST_FAILURE, + DOCTEST_REPORT_CHOICE_NONE: 0, + }[key] + + +def _fix_spoof_python2(runner, encoding): + """ + Installs a "SpoofOut" into the given DebugRunner so it properly deals with unicode output. This + should patch only doctests for text files because they don't have a way to declare their + encoding. Doctests in docstrings from Python modules don't have the same problem given that + Python already decoded the strings. + + This fixes the problem related in issue #2434. + """ + from _pytest.compat import _PY2 + + if not _PY2: + return + + from doctest import _SpoofOut + + class UnicodeSpoof(_SpoofOut): + def getvalue(self): + result = _SpoofOut.getvalue(self) + if encoding and isinstance(result, bytes): + result = result.decode(encoding) + return result + + runner._fakeout = UnicodeSpoof() + + +@pytest.fixture(scope="session") +def doctest_namespace(): + """ + Fixture that returns a :py:class:`dict` that will be injected into the namespace of doctests. + """ + return dict() diff --git a/contrib/python/pytest/py2/_pytest/fixtures.py b/contrib/python/pytest/py2/_pytest/fixtures.py new file mode 100644 index 00000000000..280a48608b6 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/fixtures.py @@ -0,0 +1,1356 @@ +# -*- coding: utf-8 -*- +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import functools +import inspect +import itertools +import sys +import warnings +from collections import defaultdict +from collections import deque +from collections import OrderedDict + +import attr +import py +import six + +import _pytest +from _pytest import nodes +from _pytest._code.code import FormattedExcinfo +from _pytest._code.code import TerminalRepr +from _pytest.compat import _format_args +from _pytest.compat import _PytestWrapper +from _pytest.compat import exc_clear +from _pytest.compat import FuncargnamesCompatAttr +from _pytest.compat import get_real_func +from _pytest.compat import get_real_method +from _pytest.compat import getfslineno +from _pytest.compat import getfuncargnames +from _pytest.compat import getimfunc +from _pytest.compat import getlocation +from _pytest.compat import is_generator +from _pytest.compat import isclass +from _pytest.compat import NOTSET +from _pytest.compat import safe_getattr +from _pytest.deprecated import FIXTURE_FUNCTION_CALL +from _pytest.deprecated import FIXTURE_NAMED_REQUEST +from _pytest.outcomes import fail +from _pytest.outcomes import TEST_OUTCOME + + +@attr.s(frozen=True) +class PseudoFixtureDef(object): + cached_result = attr.ib() + scope = attr.ib() + + +def pytest_sessionstart(session): + import _pytest.python + import _pytest.nodes + + scopename2class.update( + { + "package": _pytest.python.Package, + "class": _pytest.python.Class, + "module": _pytest.python.Module, + "function": _pytest.nodes.Item, + "session": _pytest.main.Session, + } + ) + session._fixturemanager = FixtureManager(session) + + +scopename2class = {} + + +scope2props = dict(session=()) +scope2props["package"] = ("fspath",) +scope2props["module"] = ("fspath", "module") +scope2props["class"] = scope2props["module"] + ("cls",) +scope2props["instance"] = scope2props["class"] + ("instance",) +scope2props["function"] = scope2props["instance"] + ("function", "keywords") + + +def scopeproperty(name=None, doc=None): + def decoratescope(func): + scopename = name or func.__name__ + + def provide(self): + if func.__name__ in scope2props[self.scope]: + return func(self) + raise AttributeError( + "%s not available in %s-scoped context" % (scopename, self.scope) + ) + + return property(provide, None, None, func.__doc__) + + return decoratescope + + +def get_scope_package(node, fixturedef): + import pytest + + cls = pytest.Package + current = node + fixture_package_name = "%s/%s" % (fixturedef.baseid, "__init__.py") + while current and ( + type(current) is not cls or fixture_package_name != current.nodeid + ): + current = current.parent + if current is None: + return node.session + return current + + +def get_scope_node(node, scope): + cls = scopename2class.get(scope) + if cls is None: + raise ValueError("unknown scope") + return node.getparent(cls) + + +def add_funcarg_pseudo_fixture_def(collector, metafunc, fixturemanager): + # this function will transform all collected calls to a functions + # if they use direct funcargs (i.e. direct parametrization) + # because we want later test execution to be able to rely on + # an existing FixtureDef structure for all arguments. + # XXX we can probably avoid this algorithm if we modify CallSpec2 + # to directly care for creating the fixturedefs within its methods. + if not metafunc._calls[0].funcargs: + return # this function call does not have direct parametrization + # collect funcargs of all callspecs into a list of values + arg2params = {} + arg2scope = {} + for callspec in metafunc._calls: + for argname, argvalue in callspec.funcargs.items(): + assert argname not in callspec.params + callspec.params[argname] = argvalue + arg2params_list = arg2params.setdefault(argname, []) + callspec.indices[argname] = len(arg2params_list) + arg2params_list.append(argvalue) + if argname not in arg2scope: + scopenum = callspec._arg2scopenum.get(argname, scopenum_function) + arg2scope[argname] = scopes[scopenum] + callspec.funcargs.clear() + + # register artificial FixtureDef's so that later at test execution + # time we can rely on a proper FixtureDef to exist for fixture setup. + arg2fixturedefs = metafunc._arg2fixturedefs + for argname, valuelist in arg2params.items(): + # if we have a scope that is higher than function we need + # to make sure we only ever create an according fixturedef on + # a per-scope basis. We thus store and cache the fixturedef on the + # node related to the scope. + scope = arg2scope[argname] + node = None + if scope != "function": + node = get_scope_node(collector, scope) + if node is None: + assert scope == "class" and isinstance(collector, _pytest.python.Module) + # use module-level collector for class-scope (for now) + node = collector + if node and argname in node._name2pseudofixturedef: + arg2fixturedefs[argname] = [node._name2pseudofixturedef[argname]] + else: + fixturedef = FixtureDef( + fixturemanager, + "", + argname, + get_direct_param_fixture_func, + arg2scope[argname], + valuelist, + False, + False, + ) + arg2fixturedefs[argname] = [fixturedef] + if node is not None: + node._name2pseudofixturedef[argname] = fixturedef + + +def getfixturemarker(obj): + """ return fixturemarker or None if it doesn't exist or raised + exceptions.""" + try: + return getattr(obj, "_pytestfixturefunction", None) + except TEST_OUTCOME: + # some objects raise errors like request (from flask import request) + # we don't expect them to be fixture functions + return None + + +def get_parametrized_fixture_keys(item, scopenum): + """ return list of keys for all parametrized arguments which match + the specified scope. """ + assert scopenum < scopenum_function # function + try: + cs = item.callspec + except AttributeError: + pass + else: + # cs.indices.items() is random order of argnames. Need to + # sort this so that different calls to + # get_parametrized_fixture_keys will be deterministic. + for argname, param_index in sorted(cs.indices.items()): + if cs._arg2scopenum[argname] != scopenum: + continue + if scopenum == 0: # session + key = (argname, param_index) + elif scopenum == 1: # package + key = (argname, param_index, item.fspath.dirpath()) + elif scopenum == 2: # module + key = (argname, param_index, item.fspath) + elif scopenum == 3: # class + key = (argname, param_index, item.fspath, item.cls) + yield key + + +# algorithm for sorting on a per-parametrized resource setup basis +# it is called for scopenum==0 (session) first and performs sorting +# down to the lower scopes such as to minimize number of "high scope" +# setups and teardowns + + +def reorder_items(items): + argkeys_cache = {} + items_by_argkey = {} + for scopenum in range(0, scopenum_function): + argkeys_cache[scopenum] = d = {} + items_by_argkey[scopenum] = item_d = defaultdict(deque) + for item in items: + keys = OrderedDict.fromkeys(get_parametrized_fixture_keys(item, scopenum)) + if keys: + d[item] = keys + for key in keys: + item_d[key].append(item) + items = OrderedDict.fromkeys(items) + return list(reorder_items_atscope(items, argkeys_cache, items_by_argkey, 0)) + + +def fix_cache_order(item, argkeys_cache, items_by_argkey): + for scopenum in range(0, scopenum_function): + for key in argkeys_cache[scopenum].get(item, []): + items_by_argkey[scopenum][key].appendleft(item) + + +def reorder_items_atscope(items, argkeys_cache, items_by_argkey, scopenum): + if scopenum >= scopenum_function or len(items) < 3: + return items + ignore = set() + items_deque = deque(items) + items_done = OrderedDict() + scoped_items_by_argkey = items_by_argkey[scopenum] + scoped_argkeys_cache = argkeys_cache[scopenum] + while items_deque: + no_argkey_group = OrderedDict() + slicing_argkey = None + while items_deque: + item = items_deque.popleft() + if item in items_done or item in no_argkey_group: + continue + argkeys = OrderedDict.fromkeys( + k for k in scoped_argkeys_cache.get(item, []) if k not in ignore + ) + if not argkeys: + no_argkey_group[item] = None + else: + slicing_argkey, _ = argkeys.popitem() + # we don't have to remove relevant items from later in the deque because they'll just be ignored + matching_items = [ + i for i in scoped_items_by_argkey[slicing_argkey] if i in items + ] + for i in reversed(matching_items): + fix_cache_order(i, argkeys_cache, items_by_argkey) + items_deque.appendleft(i) + break + if no_argkey_group: + no_argkey_group = reorder_items_atscope( + no_argkey_group, argkeys_cache, items_by_argkey, scopenum + 1 + ) + for item in no_argkey_group: + items_done[item] = None + ignore.add(slicing_argkey) + return items_done + + +def fillfixtures(function): + """ fill missing funcargs for a test function. """ + try: + request = function._request + except AttributeError: + # XXX this special code path is only expected to execute + # with the oejskit plugin. It uses classes with funcargs + # and we thus have to work a bit to allow this. + fm = function.session._fixturemanager + fi = fm.getfixtureinfo(function.parent, function.obj, None) + function._fixtureinfo = fi + request = function._request = FixtureRequest(function) + request._fillfixtures() + # prune out funcargs for jstests + newfuncargs = {} + for name in fi.argnames: + newfuncargs[name] = function.funcargs[name] + function.funcargs = newfuncargs + else: + request._fillfixtures() + + +def get_direct_param_fixture_func(request): + return request.param + + +@attr.s(slots=True) +class FuncFixtureInfo(object): + # original function argument names + argnames = attr.ib(type=tuple) + # argnames that function immediately requires. These include argnames + + # fixture names specified via usefixtures and via autouse=True in fixture + # definitions. + initialnames = attr.ib(type=tuple) + names_closure = attr.ib() # List[str] + name2fixturedefs = attr.ib() # List[str, List[FixtureDef]] + + def prune_dependency_tree(self): + """Recompute names_closure from initialnames and name2fixturedefs + + Can only reduce names_closure, which means that the new closure will + always be a subset of the old one. The order is preserved. + + This method is needed because direct parametrization may shadow some + of the fixtures that were included in the originally built dependency + tree. In this way the dependency tree can get pruned, and the closure + of argnames may get reduced. + """ + closure = set() + working_set = set(self.initialnames) + while working_set: + argname = working_set.pop() + # argname may be smth not included in the original names_closure, + # in which case we ignore it. This currently happens with pseudo + # FixtureDefs which wrap 'get_direct_param_fixture_func(request)'. + # So they introduce the new dependency 'request' which might have + # been missing in the original tree (closure). + if argname not in closure and argname in self.names_closure: + closure.add(argname) + if argname in self.name2fixturedefs: + working_set.update(self.name2fixturedefs[argname][-1].argnames) + + self.names_closure[:] = sorted(closure, key=self.names_closure.index) + + +class FixtureRequest(FuncargnamesCompatAttr): + """ A request for a fixture from a test or fixture function. + + A request object gives access to the requesting test context + and has an optional ``param`` attribute in case + the fixture is parametrized indirectly. + """ + + def __init__(self, pyfuncitem): + self._pyfuncitem = pyfuncitem + #: fixture for which this request is being performed + self.fixturename = None + #: Scope string, one of "function", "class", "module", "session" + self.scope = "function" + self._fixture_defs = {} # argname -> FixtureDef + fixtureinfo = pyfuncitem._fixtureinfo + self._arg2fixturedefs = fixtureinfo.name2fixturedefs.copy() + self._arg2index = {} + self._fixturemanager = pyfuncitem.session._fixturemanager + + @property + def fixturenames(self): + """names of all active fixtures in this request""" + result = list(self._pyfuncitem._fixtureinfo.names_closure) + result.extend(set(self._fixture_defs).difference(result)) + return result + + @property + def node(self): + """ underlying collection node (depends on current request scope)""" + return self._getscopeitem(self.scope) + + def _getnextfixturedef(self, argname): + fixturedefs = self._arg2fixturedefs.get(argname, None) + if fixturedefs is None: + # we arrive here because of a dynamic call to + # getfixturevalue(argname) usage which was naturally + # not known at parsing/collection time + parentid = self._pyfuncitem.parent.nodeid + fixturedefs = self._fixturemanager.getfixturedefs(argname, parentid) + self._arg2fixturedefs[argname] = fixturedefs + # fixturedefs list is immutable so we maintain a decreasing index + index = self._arg2index.get(argname, 0) - 1 + if fixturedefs is None or (-index > len(fixturedefs)): + raise FixtureLookupError(argname, self) + self._arg2index[argname] = index + return fixturedefs[index] + + @property + def config(self): + """ the pytest config object associated with this request. """ + return self._pyfuncitem.config + + @scopeproperty() + def function(self): + """ test function object if the request has a per-function scope. """ + return self._pyfuncitem.obj + + @scopeproperty("class") + def cls(self): + """ class (can be None) where the test function was collected. """ + clscol = self._pyfuncitem.getparent(_pytest.python.Class) + if clscol: + return clscol.obj + + @property + def instance(self): + """ instance (can be None) on which test function was collected. """ + # unittest support hack, see _pytest.unittest.TestCaseFunction + try: + return self._pyfuncitem._testcase + except AttributeError: + function = getattr(self, "function", None) + return getattr(function, "__self__", None) + + @scopeproperty() + def module(self): + """ python module object where the test function was collected. """ + return self._pyfuncitem.getparent(_pytest.python.Module).obj + + @scopeproperty() + def fspath(self): + """ the file system path of the test module which collected this test. """ + return self._pyfuncitem.fspath + + @property + def keywords(self): + """ keywords/markers dictionary for the underlying node. """ + return self.node.keywords + + @property + def session(self): + """ pytest session object. """ + return self._pyfuncitem.session + + def addfinalizer(self, finalizer): + """ add finalizer/teardown function to be called after the + last test within the requesting test context finished + execution. """ + # XXX usually this method is shadowed by fixturedef specific ones + self._addfinalizer(finalizer, scope=self.scope) + + def _addfinalizer(self, finalizer, scope): + colitem = self._getscopeitem(scope) + self._pyfuncitem.session._setupstate.addfinalizer( + finalizer=finalizer, colitem=colitem + ) + + def applymarker(self, marker): + """ Apply a marker to a single test function invocation. + This method is useful if you don't want to have a keyword/marker + on all function invocations. + + :arg marker: a :py:class:`_pytest.mark.MarkDecorator` object + created by a call to ``pytest.mark.NAME(...)``. + """ + self.node.add_marker(marker) + + def raiseerror(self, msg): + """ raise a FixtureLookupError with the given message. """ + raise self._fixturemanager.FixtureLookupError(None, self, msg) + + def _fillfixtures(self): + item = self._pyfuncitem + fixturenames = getattr(item, "fixturenames", self.fixturenames) + for argname in fixturenames: + if argname not in item.funcargs: + item.funcargs[argname] = self.getfixturevalue(argname) + + def getfixturevalue(self, argname): + """ Dynamically run a named fixture function. + + Declaring fixtures via function argument is recommended where possible. + But if you can only decide whether to use another fixture at test + setup time, you may use this function to retrieve it inside a fixture + or test function body. + """ + return self._get_active_fixturedef(argname).cached_result[0] + + def getfuncargvalue(self, argname): + """ Deprecated, use getfixturevalue. """ + from _pytest import deprecated + + warnings.warn(deprecated.GETFUNCARGVALUE, stacklevel=2) + return self.getfixturevalue(argname) + + def _get_active_fixturedef(self, argname): + try: + return self._fixture_defs[argname] + except KeyError: + try: + fixturedef = self._getnextfixturedef(argname) + except FixtureLookupError: + if argname == "request": + cached_result = (self, [0], None) + scope = "function" + return PseudoFixtureDef(cached_result, scope) + raise + # remove indent to prevent the python3 exception + # from leaking into the call + self._compute_fixture_value(fixturedef) + self._fixture_defs[argname] = fixturedef + return fixturedef + + def _get_fixturestack(self): + current = self + values = [] + while 1: + fixturedef = getattr(current, "_fixturedef", None) + if fixturedef is None: + values.reverse() + return values + values.append(fixturedef) + current = current._parent_request + + def _compute_fixture_value(self, fixturedef): + """ + Creates a SubRequest based on "self" and calls the execute method of the given fixturedef object. This will + force the FixtureDef object to throw away any previous results and compute a new fixture value, which + will be stored into the FixtureDef object itself. + + :param FixtureDef fixturedef: + """ + # prepare a subrequest object before calling fixture function + # (latter managed by fixturedef) + argname = fixturedef.argname + funcitem = self._pyfuncitem + scope = fixturedef.scope + try: + param = funcitem.callspec.getparam(argname) + except (AttributeError, ValueError): + param = NOTSET + param_index = 0 + has_params = fixturedef.params is not None + fixtures_not_supported = getattr(funcitem, "nofuncargs", False) + if has_params and fixtures_not_supported: + msg = ( + "{name} does not support fixtures, maybe unittest.TestCase subclass?\n" + "Node id: {nodeid}\n" + "Function type: {typename}" + ).format( + name=funcitem.name, + nodeid=funcitem.nodeid, + typename=type(funcitem).__name__, + ) + fail(msg, pytrace=False) + if has_params: + frame = inspect.stack()[3] + frameinfo = inspect.getframeinfo(frame[0]) + source_path = frameinfo.filename + source_lineno = frameinfo.lineno + source_path = py.path.local(source_path) + if source_path.relto(funcitem.config.rootdir): + source_path = source_path.relto(funcitem.config.rootdir) + msg = ( + "The requested fixture has no parameter defined for test:\n" + " {}\n\n" + "Requested fixture '{}' defined in:\n{}" + "\n\nRequested here:\n{}:{}".format( + funcitem.nodeid, + fixturedef.argname, + getlocation(fixturedef.func, funcitem.config.rootdir), + source_path, + source_lineno, + ) + ) + fail(msg, pytrace=False) + else: + param_index = funcitem.callspec.indices[argname] + # if a parametrize invocation set a scope it will override + # the static scope defined with the fixture function + paramscopenum = funcitem.callspec._arg2scopenum.get(argname) + if paramscopenum is not None: + scope = scopes[paramscopenum] + + subrequest = SubRequest(self, scope, param, param_index, fixturedef) + + # check if a higher-level scoped fixture accesses a lower level one + subrequest._check_scope(argname, self.scope, scope) + + # clear sys.exc_info before invoking the fixture (python bug?) + # if it's not explicitly cleared it will leak into the call + exc_clear() + try: + # call the fixture function + fixturedef.execute(request=subrequest) + finally: + self._schedule_finalizers(fixturedef, subrequest) + + def _schedule_finalizers(self, fixturedef, subrequest): + # if fixture function failed it might have registered finalizers + self.session._setupstate.addfinalizer( + functools.partial(fixturedef.finish, request=subrequest), subrequest.node + ) + + def _check_scope(self, argname, invoking_scope, requested_scope): + if argname == "request": + return + if scopemismatch(invoking_scope, requested_scope): + # try to report something helpful + lines = self._factorytraceback() + fail( + "ScopeMismatch: You tried to access the %r scoped " + "fixture %r with a %r scoped request object, " + "involved factories\n%s" + % ((requested_scope, argname, invoking_scope, "\n".join(lines))), + pytrace=False, + ) + + def _factorytraceback(self): + lines = [] + for fixturedef in self._get_fixturestack(): + factory = fixturedef.func + fs, lineno = getfslineno(factory) + p = self._pyfuncitem.session.fspath.bestrelpath(fs) + args = _format_args(factory) + lines.append("%s:%d: def %s%s" % (p, lineno + 1, factory.__name__, args)) + return lines + + def _getscopeitem(self, scope): + if scope == "function": + # this might also be a non-function Item despite its attribute name + return self._pyfuncitem + if scope == "package": + node = get_scope_package(self._pyfuncitem, self._fixturedef) + else: + node = get_scope_node(self._pyfuncitem, scope) + if node is None and scope == "class": + # fallback to function item itself + node = self._pyfuncitem + assert node, 'Could not obtain a node for scope "{}" for function {!r}'.format( + scope, self._pyfuncitem + ) + return node + + def __repr__(self): + return "<FixtureRequest for %r>" % (self.node) + + +class SubRequest(FixtureRequest): + """ a sub request for handling getting a fixture from a + test function/fixture. """ + + def __init__(self, request, scope, param, param_index, fixturedef): + self._parent_request = request + self.fixturename = fixturedef.argname + if param is not NOTSET: + self.param = param + self.param_index = param_index + self.scope = scope + self._fixturedef = fixturedef + self._pyfuncitem = request._pyfuncitem + self._fixture_defs = request._fixture_defs + self._arg2fixturedefs = request._arg2fixturedefs + self._arg2index = request._arg2index + self._fixturemanager = request._fixturemanager + + def __repr__(self): + return "<SubRequest %r for %r>" % (self.fixturename, self._pyfuncitem) + + def addfinalizer(self, finalizer): + self._fixturedef.addfinalizer(finalizer) + + def _schedule_finalizers(self, fixturedef, subrequest): + # if the executing fixturedef was not explicitly requested in the argument list (via + # getfixturevalue inside the fixture call) then ensure this fixture def will be finished + # first + if fixturedef.argname not in self.funcargnames: + fixturedef.addfinalizer( + functools.partial(self._fixturedef.finish, request=self) + ) + super(SubRequest, self)._schedule_finalizers(fixturedef, subrequest) + + +scopes = "session package module class function".split() +scopenum_function = scopes.index("function") + + +def scopemismatch(currentscope, newscope): + return scopes.index(newscope) > scopes.index(currentscope) + + +def scope2index(scope, descr, where=None): + """Look up the index of ``scope`` and raise a descriptive value error + if not defined. + """ + try: + return scopes.index(scope) + except ValueError: + fail( + "{} {}got an unexpected scope value '{}'".format( + descr, "from {} ".format(where) if where else "", scope + ), + pytrace=False, + ) + + +class FixtureLookupError(LookupError): + """ could not return a requested Fixture (missing or invalid). """ + + def __init__(self, argname, request, msg=None): + self.argname = argname + self.request = request + self.fixturestack = request._get_fixturestack() + self.msg = msg + + def formatrepr(self): + tblines = [] + addline = tblines.append + stack = [self.request._pyfuncitem.obj] + stack.extend(map(lambda x: x.func, self.fixturestack)) + msg = self.msg + if msg is not None: + # the last fixture raise an error, let's present + # it at the requesting side + stack = stack[:-1] + for function in stack: + fspath, lineno = getfslineno(function) + try: + lines, _ = inspect.getsourcelines(get_real_func(function)) + except (IOError, IndexError, TypeError): + error_msg = "file %s, line %s: source code not available" + addline(error_msg % (fspath, lineno + 1)) + else: + addline("file %s, line %s" % (fspath, lineno + 1)) + for i, line in enumerate(lines): + line = line.rstrip() + addline(" " + line) + if line.lstrip().startswith("def"): + break + + if msg is None: + fm = self.request._fixturemanager + available = set() + parentid = self.request._pyfuncitem.parent.nodeid + for name, fixturedefs in fm._arg2fixturedefs.items(): + faclist = list(fm._matchfactories(fixturedefs, parentid)) + if faclist: + available.add(name) + if self.argname in available: + msg = " recursive dependency involving fixture '{}' detected".format( + self.argname + ) + else: + msg = "fixture '{}' not found".format(self.argname) + msg += "\n available fixtures: {}".format(", ".join(sorted(available))) + msg += "\n use 'pytest --fixtures [testpath]' for help on them." + + return FixtureLookupErrorRepr(fspath, lineno, tblines, msg, self.argname) + + +class FixtureLookupErrorRepr(TerminalRepr): + def __init__(self, filename, firstlineno, tblines, errorstring, argname): + self.tblines = tblines + self.errorstring = errorstring + self.filename = filename + self.firstlineno = firstlineno + self.argname = argname + + def toterminal(self, tw): + # tw.line("FixtureLookupError: %s" %(self.argname), red=True) + for tbline in self.tblines: + tw.line(tbline.rstrip()) + lines = self.errorstring.split("\n") + if lines: + tw.line( + "{} {}".format(FormattedExcinfo.fail_marker, lines[0].strip()), + red=True, + ) + for line in lines[1:]: + tw.line( + "{} {}".format(FormattedExcinfo.flow_marker, line.strip()), + red=True, + ) + tw.line() + tw.line("%s:%d" % (self.filename, self.firstlineno + 1)) + + +def fail_fixturefunc(fixturefunc, msg): + fs, lineno = getfslineno(fixturefunc) + location = "%s:%s" % (fs, lineno + 1) + source = _pytest._code.Source(fixturefunc) + fail(msg + ":\n\n" + str(source.indent()) + "\n" + location, pytrace=False) + + +def call_fixture_func(fixturefunc, request, kwargs): + yieldctx = is_generator(fixturefunc) + if yieldctx: + it = fixturefunc(**kwargs) + res = next(it) + finalizer = functools.partial(_teardown_yield_fixture, fixturefunc, it) + request.addfinalizer(finalizer) + else: + res = fixturefunc(**kwargs) + return res + + +def _teardown_yield_fixture(fixturefunc, it): + """Executes the teardown of a fixture function by advancing the iterator after the + yield and ensure the iteration ends (if not it means there is more than one yield in the function)""" + try: + next(it) + except StopIteration: + pass + else: + fail_fixturefunc( + fixturefunc, "yield_fixture function has more than one 'yield'" + ) + + +class FixtureDef(object): + """ A container for a factory definition. """ + + def __init__( + self, + fixturemanager, + baseid, + argname, + func, + scope, + params, + unittest=False, + ids=None, + ): + self._fixturemanager = fixturemanager + self.baseid = baseid or "" + self.has_location = baseid is not None + self.func = func + self.argname = argname + self.scope = scope + self.scopenum = scope2index( + scope or "function", + descr="Fixture '{}'".format(func.__name__), + where=baseid, + ) + self.params = params + self.argnames = getfuncargnames(func, is_method=unittest) + self.unittest = unittest + self.ids = ids + self._finalizers = [] + + def addfinalizer(self, finalizer): + self._finalizers.append(finalizer) + + def finish(self, request): + exceptions = [] + try: + while self._finalizers: + try: + func = self._finalizers.pop() + func() + except: # noqa + exceptions.append(sys.exc_info()) + if exceptions: + e = exceptions[0] + # Ensure to not keep frame references through traceback. + del exceptions + six.reraise(*e) + finally: + hook = self._fixturemanager.session.gethookproxy(request.node.fspath) + hook.pytest_fixture_post_finalizer(fixturedef=self, request=request) + # even if finalization fails, we invalidate + # the cached fixture value and remove + # all finalizers because they may be bound methods which will + # keep instances alive + if hasattr(self, "cached_result"): + del self.cached_result + self._finalizers = [] + + def execute(self, request): + # get required arguments and register our own finish() + # with their finalization + for argname in self.argnames: + fixturedef = request._get_active_fixturedef(argname) + if argname != "request": + fixturedef.addfinalizer(functools.partial(self.finish, request=request)) + + my_cache_key = request.param_index + cached_result = getattr(self, "cached_result", None) + if cached_result is not None: + result, cache_key, err = cached_result + if my_cache_key == cache_key: + if err is not None: + six.reraise(*err) + else: + return result + # we have a previous but differently parametrized fixture instance + # so we need to tear it down before creating a new one + self.finish(request) + assert not hasattr(self, "cached_result") + + hook = self._fixturemanager.session.gethookproxy(request.node.fspath) + return hook.pytest_fixture_setup(fixturedef=self, request=request) + + def __repr__(self): + return "<FixtureDef argname=%r scope=%r baseid=%r>" % ( + self.argname, + self.scope, + self.baseid, + ) + + +def resolve_fixture_function(fixturedef, request): + """Gets the actual callable that can be called to obtain the fixture value, dealing with unittest-specific + instances and bound methods. + """ + fixturefunc = fixturedef.func + if fixturedef.unittest: + if request.instance is not None: + # bind the unbound method to the TestCase instance + fixturefunc = fixturedef.func.__get__(request.instance) + else: + # the fixture function needs to be bound to the actual + # request.instance so that code working with "fixturedef" behaves + # as expected. + if request.instance is not None: + fixturefunc = getimfunc(fixturedef.func) + if fixturefunc != fixturedef.func: + fixturefunc = fixturefunc.__get__(request.instance) + return fixturefunc + + +def pytest_fixture_setup(fixturedef, request): + """ Execution of fixture setup. """ + kwargs = {} + for argname in fixturedef.argnames: + fixdef = request._get_active_fixturedef(argname) + result, arg_cache_key, exc = fixdef.cached_result + request._check_scope(argname, request.scope, fixdef.scope) + kwargs[argname] = result + + fixturefunc = resolve_fixture_function(fixturedef, request) + my_cache_key = request.param_index + try: + result = call_fixture_func(fixturefunc, request, kwargs) + except TEST_OUTCOME: + fixturedef.cached_result = (None, my_cache_key, sys.exc_info()) + raise + fixturedef.cached_result = (result, my_cache_key, None) + return result + + +def _ensure_immutable_ids(ids): + if ids is None: + return + if callable(ids): + return ids + return tuple(ids) + + +def wrap_function_to_error_out_if_called_directly(function, fixture_marker): + """Wrap the given fixture function so we can raise an error about it being called directly, + instead of used as an argument in a test function. + """ + message = FIXTURE_FUNCTION_CALL.format( + name=fixture_marker.name or function.__name__ + ) + + @six.wraps(function) + def result(*args, **kwargs): + fail(message, pytrace=False) + + # keep reference to the original function in our own custom attribute so we don't unwrap + # further than this point and lose useful wrappings like @mock.patch (#3774) + result.__pytest_wrapped__ = _PytestWrapper(function) + + return result + + +@attr.s(frozen=True) +class FixtureFunctionMarker(object): + scope = attr.ib() + params = attr.ib(converter=attr.converters.optional(tuple)) + autouse = attr.ib(default=False) + ids = attr.ib(default=None, converter=_ensure_immutable_ids) + name = attr.ib(default=None) + + def __call__(self, function): + if isclass(function): + raise ValueError("class fixtures not supported (maybe in the future)") + + if getattr(function, "_pytestfixturefunction", False): + raise ValueError( + "fixture is being applied more than once to the same function" + ) + + function = wrap_function_to_error_out_if_called_directly(function, self) + + name = self.name or function.__name__ + if name == "request": + warnings.warn(FIXTURE_NAMED_REQUEST) + function._pytestfixturefunction = self + return function + + +def fixture(scope="function", params=None, autouse=False, ids=None, name=None): + """Decorator to mark a fixture factory function. + + This decorator can be used, with or without parameters, to define a + fixture function. + + The name of the fixture function can later be referenced to cause its + invocation ahead of running tests: test + modules or classes can use the ``pytest.mark.usefixtures(fixturename)`` + marker. + + Test functions can directly use fixture names as input + arguments in which case the fixture instance returned from the fixture + function will be injected. + + Fixtures can provide their values to test functions using ``return`` or ``yield`` + statements. When using ``yield`` the code block after the ``yield`` statement is executed + as teardown code regardless of the test outcome, and must yield exactly once. + + :arg scope: the scope for which this fixture is shared, one of + ``"function"`` (default), ``"class"``, ``"module"``, + ``"package"`` or ``"session"``. + + ``"package"`` is considered **experimental** at this time. + + :arg params: an optional list of parameters which will cause multiple + invocations of the fixture function and all of the tests + using it. + The current parameter is available in ``request.param``. + + :arg autouse: if True, the fixture func is activated for all tests that + can see it. If False (the default) then an explicit + reference is needed to activate the fixture. + + :arg ids: list of string ids each corresponding to the params + so that they are part of the test id. If no ids are provided + they will be generated automatically from the params. + + :arg name: the name of the fixture. This defaults to the name of the + decorated function. If a fixture is used in the same module in + which it is defined, the function name of the fixture will be + shadowed by the function arg that requests the fixture; one way + to resolve this is to name the decorated function + ``fixture_<fixturename>`` and then use + ``@pytest.fixture(name='<fixturename>')``. + """ + if callable(scope) and params is None and autouse is False: + # direct decoration + return FixtureFunctionMarker("function", params, autouse, name=name)(scope) + if params is not None and not isinstance(params, (list, tuple)): + params = list(params) + return FixtureFunctionMarker(scope, params, autouse, ids=ids, name=name) + + +def yield_fixture(scope="function", params=None, autouse=False, ids=None, name=None): + """ (return a) decorator to mark a yield-fixture factory function. + + .. deprecated:: 3.0 + Use :py:func:`pytest.fixture` directly instead. + """ + return fixture(scope=scope, params=params, autouse=autouse, ids=ids, name=name) + + +defaultfuncargprefixmarker = fixture() + + +@fixture(scope="session") +def pytestconfig(request): + """Session-scoped fixture that returns the :class:`_pytest.config.Config` object. + + Example:: + + def test_foo(pytestconfig): + if pytestconfig.getoption("verbose") > 0: + ... + + """ + return request.config + + +def pytest_addoption(parser): + parser.addini( + "usefixtures", + type="args", + default=[], + help="list of default fixtures to be used with this project", + ) + + +class FixtureManager(object): + """ + pytest fixtures definitions and information is stored and managed + from this class. + + During collection fm.parsefactories() is called multiple times to parse + fixture function definitions into FixtureDef objects and internal + data structures. + + During collection of test functions, metafunc-mechanics instantiate + a FuncFixtureInfo object which is cached per node/func-name. + This FuncFixtureInfo object is later retrieved by Function nodes + which themselves offer a fixturenames attribute. + + The FuncFixtureInfo object holds information about fixtures and FixtureDefs + relevant for a particular function. An initial list of fixtures is + assembled like this: + + - ini-defined usefixtures + - autouse-marked fixtures along the collection chain up from the function + - usefixtures markers at module/class/function level + - test function funcargs + + Subsequently the funcfixtureinfo.fixturenames attribute is computed + as the closure of the fixtures needed to setup the initial fixtures, + i. e. fixtures needed by fixture functions themselves are appended + to the fixturenames list. + + Upon the test-setup phases all fixturenames are instantiated, retrieved + by a lookup of their FuncFixtureInfo. + """ + + FixtureLookupError = FixtureLookupError + FixtureLookupErrorRepr = FixtureLookupErrorRepr + + def __init__(self, session): + self.session = session + self.config = session.config + self._arg2fixturedefs = {} + self._holderobjseen = set() + self._arg2finish = {} + self._nodeid_and_autousenames = [("", self.config.getini("usefixtures"))] + session.config.pluginmanager.register(self, "funcmanage") + + def _get_direct_parametrize_args(self, node): + """This function returns all the direct parametrization + arguments of a node, so we don't mistake them for fixtures + + Check https://github.com/pytest-dev/pytest/issues/5036 + + This things are done later as well when dealing with parametrization + so this could be improved + """ + from _pytest.mark import ParameterSet + + parametrize_argnames = [] + for marker in node.iter_markers(name="parametrize"): + if not marker.kwargs.get("indirect", False): + p_argnames, _ = ParameterSet._parse_parametrize_args( + *marker.args, **marker.kwargs + ) + parametrize_argnames.extend(p_argnames) + + return parametrize_argnames + + def getfixtureinfo(self, node, func, cls, funcargs=True): + if funcargs and not getattr(node, "nofuncargs", False): + argnames = getfuncargnames(func, cls=cls) + else: + argnames = () + + usefixtures = itertools.chain.from_iterable( + mark.args for mark in node.iter_markers(name="usefixtures") + ) + initialnames = tuple(usefixtures) + argnames + fm = node.session._fixturemanager + initialnames, names_closure, arg2fixturedefs = fm.getfixtureclosure( + initialnames, node, ignore_args=self._get_direct_parametrize_args(node) + ) + return FuncFixtureInfo(argnames, initialnames, names_closure, arg2fixturedefs) + + def pytest_plugin_registered(self, plugin): + nodeid = None + try: + p = py.path.local(plugin.__file__).realpath() + except AttributeError: + pass + else: + # construct the base nodeid which is later used to check + # what fixtures are visible for particular tests (as denoted + # by their test id) + if p.basename.startswith("conftest.py"): + nodeid = p.dirpath().relto(self.config.rootdir) + if p.sep != nodes.SEP: + nodeid = nodeid.replace(p.sep, nodes.SEP) + + self.parsefactories(plugin, nodeid) + + def _getautousenames(self, nodeid): + """ return a tuple of fixture names to be used. """ + autousenames = [] + for baseid, basenames in self._nodeid_and_autousenames: + if nodeid.startswith(baseid): + if baseid: + i = len(baseid) + nextchar = nodeid[i : i + 1] + if nextchar and nextchar not in ":/": + continue + autousenames.extend(basenames) + return autousenames + + def getfixtureclosure(self, fixturenames, parentnode, ignore_args=()): + # collect the closure of all fixtures , starting with the given + # fixturenames as the initial set. As we have to visit all + # factory definitions anyway, we also return an arg2fixturedefs + # mapping so that the caller can reuse it and does not have + # to re-discover fixturedefs again for each fixturename + # (discovering matching fixtures for a given name/node is expensive) + + parentid = parentnode.nodeid + fixturenames_closure = self._getautousenames(parentid) + + def merge(otherlist): + for arg in otherlist: + if arg not in fixturenames_closure: + fixturenames_closure.append(arg) + + merge(fixturenames) + + # at this point, fixturenames_closure contains what we call "initialnames", + # which is a set of fixturenames the function immediately requests. We + # need to return it as well, so save this. + initialnames = tuple(fixturenames_closure) + + arg2fixturedefs = {} + lastlen = -1 + while lastlen != len(fixturenames_closure): + lastlen = len(fixturenames_closure) + for argname in fixturenames_closure: + if argname in ignore_args: + continue + if argname in arg2fixturedefs: + continue + fixturedefs = self.getfixturedefs(argname, parentid) + if fixturedefs: + arg2fixturedefs[argname] = fixturedefs + merge(fixturedefs[-1].argnames) + + def sort_by_scope(arg_name): + try: + fixturedefs = arg2fixturedefs[arg_name] + except KeyError: + return scopes.index("function") + else: + return fixturedefs[-1].scopenum + + fixturenames_closure.sort(key=sort_by_scope) + return initialnames, fixturenames_closure, arg2fixturedefs + + def pytest_generate_tests(self, metafunc): + for argname in metafunc.fixturenames: + faclist = metafunc._arg2fixturedefs.get(argname) + if faclist: + fixturedef = faclist[-1] + if fixturedef.params is not None: + markers = list(metafunc.definition.iter_markers("parametrize")) + for parametrize_mark in markers: + if "argnames" in parametrize_mark.kwargs: + argnames = parametrize_mark.kwargs["argnames"] + else: + argnames = parametrize_mark.args[0] + + if not isinstance(argnames, (tuple, list)): + argnames = [ + x.strip() for x in argnames.split(",") if x.strip() + ] + if argname in argnames: + break + else: + metafunc.parametrize( + argname, + fixturedef.params, + indirect=True, + scope=fixturedef.scope, + ids=fixturedef.ids, + ) + else: + continue # will raise FixtureLookupError at setup time + + def pytest_collection_modifyitems(self, items): + # separate parametrized setups + items[:] = reorder_items(items) + + def parsefactories(self, node_or_obj, nodeid=NOTSET, unittest=False): + if nodeid is not NOTSET: + holderobj = node_or_obj + else: + holderobj = node_or_obj.obj + nodeid = node_or_obj.nodeid + if holderobj in self._holderobjseen: + return + + self._holderobjseen.add(holderobj) + autousenames = [] + for name in dir(holderobj): + # The attribute can be an arbitrary descriptor, so the attribute + # access below can raise. safe_getatt() ignores such exceptions. + obj = safe_getattr(holderobj, name, None) + marker = getfixturemarker(obj) + if not isinstance(marker, FixtureFunctionMarker): + # magic globals with __getattr__ might have got us a wrong + # fixture attribute + continue + + if marker.name: + name = marker.name + + # during fixture definition we wrap the original fixture function + # to issue a warning if called directly, so here we unwrap it in order to not emit the warning + # when pytest itself calls the fixture function + if six.PY2 and unittest: + # hack on Python 2 because of the unbound methods + obj = get_real_func(obj) + else: + obj = get_real_method(obj, holderobj) + + fixture_def = FixtureDef( + self, + nodeid, + name, + obj, + marker.scope, + marker.params, + unittest=unittest, + ids=marker.ids, + ) + + faclist = self._arg2fixturedefs.setdefault(name, []) + if fixture_def.has_location: + faclist.append(fixture_def) + else: + # fixturedefs with no location are at the front + # so this inserts the current fixturedef after the + # existing fixturedefs from external plugins but + # before the fixturedefs provided in conftests. + i = len([f for f in faclist if not f.has_location]) + faclist.insert(i, fixture_def) + if marker.autouse: + autousenames.append(name) + + if autousenames: + self._nodeid_and_autousenames.append((nodeid or "", autousenames)) + + def getfixturedefs(self, argname, nodeid): + """ + Gets a list of fixtures which are applicable to the given node id. + + :param str argname: name of the fixture to search for + :param str nodeid: full node id of the requesting test. + :return: list[FixtureDef] + """ + try: + fixturedefs = self._arg2fixturedefs[argname] + except KeyError: + return None + return tuple(self._matchfactories(fixturedefs, nodeid)) + + def _matchfactories(self, fixturedefs, nodeid): + for fixturedef in fixturedefs: + if nodes.ischildnode(fixturedef.baseid, nodeid): + yield fixturedef diff --git a/contrib/python/pytest/py2/_pytest/freeze_support.py b/contrib/python/pytest/py2/_pytest/freeze_support.py new file mode 100644 index 00000000000..aeeec2a56b4 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/freeze_support.py @@ -0,0 +1,48 @@ +# -*- coding: utf-8 -*- +""" +Provides a function to report all internal modules for using freezing tools +pytest +""" +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + + +def freeze_includes(): + """ + Returns a list of module names used by pytest that should be + included by cx_freeze. + """ + import py + import _pytest + + result = list(_iter_all_modules(py)) + result += list(_iter_all_modules(_pytest)) + return result + + +def _iter_all_modules(package, prefix=""): + """ + Iterates over the names of all modules that can be found in the given + package, recursively. + Example: + _iter_all_modules(_pytest) -> + ['_pytest.assertion.newinterpret', + '_pytest.capture', + '_pytest.core', + ... + ] + """ + import os + import pkgutil + + if type(package) is not str: + path, prefix = package.__path__[0], package.__name__ + "." + else: + path = package + for _, name, is_package in pkgutil.iter_modules([path]): + if is_package: + for m in _iter_all_modules(os.path.join(path, name), prefix=name + "."): + yield prefix + m + else: + yield prefix + name diff --git a/contrib/python/pytest/py2/_pytest/helpconfig.py b/contrib/python/pytest/py2/_pytest/helpconfig.py new file mode 100644 index 00000000000..56811601608 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/helpconfig.py @@ -0,0 +1,247 @@ +# -*- coding: utf-8 -*- +""" version info, help messages, tracing configuration. """ +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import os +import sys +from argparse import Action + +import py + +import pytest +from _pytest.config import PrintHelp + + +class HelpAction(Action): + """This is an argparse Action that will raise an exception in + order to skip the rest of the argument parsing when --help is passed. + This prevents argparse from quitting due to missing required arguments + when any are defined, for example by ``pytest_addoption``. + This is similar to the way that the builtin argparse --help option is + implemented by raising SystemExit. + """ + + def __init__(self, option_strings, dest=None, default=False, help=None): + super(HelpAction, self).__init__( + option_strings=option_strings, + dest=dest, + const=True, + default=default, + nargs=0, + help=help, + ) + + def __call__(self, parser, namespace, values, option_string=None): + setattr(namespace, self.dest, self.const) + + # We should only skip the rest of the parsing after preparse is done + if getattr(parser._parser, "after_preparse", False): + raise PrintHelp + + +def pytest_addoption(parser): + group = parser.getgroup("debugconfig") + group.addoption( + "--version", + action="store_true", + help="display pytest lib version and import information.", + ) + group._addoption( + "-h", + "--help", + action=HelpAction, + dest="help", + help="show help message and configuration info", + ) + group._addoption( + "-p", + action="append", + dest="plugins", + default=[], + metavar="name", + help="early-load given plugin module name or entry point (multi-allowed). " + "To avoid loading of plugins, use the `no:` prefix, e.g. " + "`no:doctest`.", + ) + group.addoption( + "--traceconfig", + "--trace-config", + action="store_true", + default=False, + help="trace considerations of conftest.py files.", + ), + group.addoption( + "--debug", + action="store_true", + dest="debug", + default=False, + help="store internal tracing debug information in 'pytestdebug.log'.", + ) + group._addoption( + "-o", + "--override-ini", + dest="override_ini", + action="append", + help='override ini option with "option=value" style, e.g. `-o xfail_strict=True -o cache_dir=cache`.', + ) + + +@pytest.hookimpl(hookwrapper=True) +def pytest_cmdline_parse(): + outcome = yield + config = outcome.get_result() + if config.option.debug: + path = os.path.abspath("pytestdebug.log") + debugfile = open(path, "w") + debugfile.write( + "versions pytest-%s, py-%s, " + "python-%s\ncwd=%s\nargs=%s\n\n" + % ( + pytest.__version__, + py.__version__, + ".".join(map(str, sys.version_info)), + os.getcwd(), + config._origargs, + ) + ) + config.trace.root.setwriter(debugfile.write) + undo_tracing = config.pluginmanager.enable_tracing() + sys.stderr.write("writing pytestdebug information to %s\n" % path) + + def unset_tracing(): + debugfile.close() + sys.stderr.write("wrote pytestdebug information to %s\n" % debugfile.name) + config.trace.root.setwriter(None) + undo_tracing() + + config.add_cleanup(unset_tracing) + + +def showversion(config): + p = py.path.local(pytest.__file__) + sys.stderr.write( + "This is pytest version %s, imported from %s\n" % (pytest.__version__, p) + ) + plugininfo = getpluginversioninfo(config) + if plugininfo: + for line in plugininfo: + sys.stderr.write(line + "\n") + + +def pytest_cmdline_main(config): + if config.option.version: + showversion(config) + return 0 + elif config.option.help: + config._do_configure() + showhelp(config) + config._ensure_unconfigure() + return 0 + + +def showhelp(config): + import textwrap + + reporter = config.pluginmanager.get_plugin("terminalreporter") + tw = reporter._tw + tw.write(config._parser.optparser.format_help()) + tw.line() + tw.line( + "[pytest] ini-options in the first pytest.ini|tox.ini|setup.cfg file found:" + ) + tw.line() + + columns = tw.fullwidth # costly call + indent_len = 24 # based on argparse's max_help_position=24 + indent = " " * indent_len + for name in config._parser._ininames: + help, type, default = config._parser._inidict[name] + if type is None: + type = "string" + spec = "%s (%s):" % (name, type) + tw.write(" %s" % spec) + spec_len = len(spec) + if spec_len > (indent_len - 3): + # Display help starting at a new line. + tw.line() + helplines = textwrap.wrap( + help, + columns, + initial_indent=indent, + subsequent_indent=indent, + break_on_hyphens=False, + ) + + for line in helplines: + tw.line(line) + else: + # Display help starting after the spec, following lines indented. + tw.write(" " * (indent_len - spec_len - 2)) + wrapped = textwrap.wrap(help, columns - indent_len, break_on_hyphens=False) + + tw.line(wrapped[0]) + for line in wrapped[1:]: + tw.line(indent + line) + + tw.line() + tw.line("environment variables:") + vars = [ + ("PYTEST_ADDOPTS", "extra command line options"), + ("PYTEST_PLUGINS", "comma-separated plugins to load during startup"), + ("PYTEST_DISABLE_PLUGIN_AUTOLOAD", "set to disable plugin auto-loading"), + ("PYTEST_DEBUG", "set to enable debug tracing of pytest's internals"), + ] + for name, help in vars: + tw.line(" %-24s %s" % (name, help)) + tw.line() + tw.line() + + tw.line("to see available markers type: pytest --markers") + tw.line("to see available fixtures type: pytest --fixtures") + tw.line( + "(shown according to specified file_or_dir or current dir " + "if not specified; fixtures with leading '_' are only shown " + "with the '-v' option" + ) + + for warningreport in reporter.stats.get("warnings", []): + tw.line("warning : " + warningreport.message, red=True) + return + + +conftest_options = [("pytest_plugins", "list of plugin names to load")] + + +def getpluginversioninfo(config): + lines = [] + plugininfo = config.pluginmanager.list_plugin_distinfo() + if plugininfo: + lines.append("setuptools registered plugins:") + for plugin, dist in plugininfo: + loc = getattr(plugin, "__file__", repr(plugin)) + content = "%s-%s at %s" % (dist.project_name, dist.version, loc) + lines.append(" " + content) + return lines + + +def pytest_report_header(config): + lines = [] + if config.option.debug or config.option.traceconfig: + lines.append("using: pytest-%s pylib-%s" % (pytest.__version__, py.__version__)) + + verinfo = getpluginversioninfo(config) + if verinfo: + lines.extend(verinfo) + + if config.option.traceconfig: + lines.append("active plugins:") + items = config.pluginmanager.list_name_plugin() + for name, plugin in items: + if hasattr(plugin, "__file__"): + r = plugin.__file__ + else: + r = repr(plugin) + lines.append(" %-20s: %s" % (name, r)) + return lines diff --git a/contrib/python/pytest/py2/_pytest/hookspec.py b/contrib/python/pytest/py2/_pytest/hookspec.py new file mode 100644 index 00000000000..7ab6154b176 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/hookspec.py @@ -0,0 +1,639 @@ +# -*- coding: utf-8 -*- +""" hook specifications for pytest plugins, invoked from main.py and builtin plugins. """ +from pluggy import HookspecMarker + +from _pytest.deprecated import PYTEST_LOGWARNING + +hookspec = HookspecMarker("pytest") + +# ------------------------------------------------------------------------- +# Initialization hooks called for every plugin +# ------------------------------------------------------------------------- + + +@hookspec(historic=True) +def pytest_addhooks(pluginmanager): + """called at plugin registration time to allow adding new hooks via a call to + ``pluginmanager.add_hookspecs(module_or_class, prefix)``. + + + :param _pytest.config.PytestPluginManager pluginmanager: pytest plugin manager + + .. note:: + This hook is incompatible with ``hookwrapper=True``. + """ + + +@hookspec(historic=True) +def pytest_plugin_registered(plugin, manager): + """ a new pytest plugin got registered. + + :param plugin: the plugin module or instance + :param _pytest.config.PytestPluginManager manager: pytest plugin manager + + .. note:: + This hook is incompatible with ``hookwrapper=True``. + """ + + +@hookspec(historic=True) +def pytest_addoption(parser): + """register argparse-style options and ini-style config values, + called once at the beginning of a test run. + + .. note:: + + This function should be implemented only in plugins or ``conftest.py`` + files situated at the tests root directory due to how pytest + :ref:`discovers plugins during startup <pluginorder>`. + + :arg _pytest.config.Parser parser: To add command line options, call + :py:func:`parser.addoption(...) <_pytest.config.Parser.addoption>`. + To add ini-file values call :py:func:`parser.addini(...) + <_pytest.config.Parser.addini>`. + + Options can later be accessed through the + :py:class:`config <_pytest.config.Config>` object, respectively: + + - :py:func:`config.getoption(name) <_pytest.config.Config.getoption>` to + retrieve the value of a command line option. + + - :py:func:`config.getini(name) <_pytest.config.Config.getini>` to retrieve + a value read from an ini-style file. + + The config object is passed around on many internal objects via the ``.config`` + attribute or can be retrieved as the ``pytestconfig`` fixture. + + .. note:: + This hook is incompatible with ``hookwrapper=True``. + """ + + +@hookspec(historic=True) +def pytest_configure(config): + """ + Allows plugins and conftest files to perform initial configuration. + + This hook is called for every plugin and initial conftest file + after command line options have been parsed. + + After that, the hook is called for other conftest files as they are + imported. + + .. note:: + This hook is incompatible with ``hookwrapper=True``. + + :arg _pytest.config.Config config: pytest config object + """ + + +# ------------------------------------------------------------------------- +# Bootstrapping hooks called for plugins registered early enough: +# internal and 3rd party plugins. +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_cmdline_parse(pluginmanager, args): + """return initialized config object, parsing the specified args. + + Stops at first non-None result, see :ref:`firstresult` + + .. note:: + This hook will only be called for plugin classes passed to the ``plugins`` arg when using `pytest.main`_ to + perform an in-process test run. + + :param _pytest.config.PytestPluginManager pluginmanager: pytest plugin manager + :param list[str] args: list of arguments passed on the command line + """ + + +def pytest_cmdline_preparse(config, args): + """(**Deprecated**) modify command line arguments before option parsing. + + This hook is considered deprecated and will be removed in a future pytest version. Consider + using :func:`pytest_load_initial_conftests` instead. + + .. note:: + This hook will not be called for ``conftest.py`` files, only for setuptools plugins. + + :param _pytest.config.Config config: pytest config object + :param list[str] args: list of arguments passed on the command line + """ + + +@hookspec(firstresult=True) +def pytest_cmdline_main(config): + """ called for performing the main command line action. The default + implementation will invoke the configure hooks and runtest_mainloop. + + .. note:: + This hook will not be called for ``conftest.py`` files, only for setuptools plugins. + + Stops at first non-None result, see :ref:`firstresult` + + :param _pytest.config.Config config: pytest config object + """ + + +def pytest_load_initial_conftests(early_config, parser, args): + """ implements the loading of initial conftest files ahead + of command line option parsing. + + .. note:: + This hook will not be called for ``conftest.py`` files, only for setuptools plugins. + + :param _pytest.config.Config early_config: pytest config object + :param list[str] args: list of arguments passed on the command line + :param _pytest.config.Parser parser: to add command line options + """ + + +# ------------------------------------------------------------------------- +# collection hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_collection(session): + """Perform the collection protocol for the given session. + + Stops at first non-None result, see :ref:`firstresult`. + + :param _pytest.main.Session session: the pytest session object + """ + + +def pytest_collection_modifyitems(session, config, items): + """ called after collection has been performed, may filter or re-order + the items in-place. + + :param _pytest.main.Session session: the pytest session object + :param _pytest.config.Config config: pytest config object + :param List[_pytest.nodes.Item] items: list of item objects + """ + + +def pytest_collection_finish(session): + """ called after collection has been performed and modified. + + :param _pytest.main.Session session: the pytest session object + """ + + +@hookspec(firstresult=True) +def pytest_ignore_collect(path, config): + """ return True to prevent considering this path for collection. + This hook is consulted for all files and directories prior to calling + more specific hooks. + + Stops at first non-None result, see :ref:`firstresult` + + :param path: a :py:class:`py.path.local` - the path to analyze + :param _pytest.config.Config config: pytest config object + """ + + +@hookspec(firstresult=True) +def pytest_collect_directory(path, parent): + """ called before traversing a directory for collection files. + + Stops at first non-None result, see :ref:`firstresult` + + :param path: a :py:class:`py.path.local` - the path to analyze + """ + + +def pytest_collect_file(path, parent): + """ return collection Node or None for the given path. Any new node + needs to have the specified ``parent`` as a parent. + + :param path: a :py:class:`py.path.local` - the path to collect + """ + + +# logging hooks for collection + + +def pytest_collectstart(collector): + """ collector starts collecting. """ + + +def pytest_itemcollected(item): + """ we just collected a test item. """ + + +def pytest_collectreport(report): + """ collector finished collecting. """ + + +def pytest_deselected(items): + """ called for test items deselected, e.g. by keyword. """ + + +@hookspec(firstresult=True) +def pytest_make_collect_report(collector): + """ perform ``collector.collect()`` and return a CollectReport. + + Stops at first non-None result, see :ref:`firstresult` """ + + +# ------------------------------------------------------------------------- +# Python test function related hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_pycollect_makemodule(path, parent): + """ return a Module collector or None for the given path. + This hook will be called for each matching test module path. + The pytest_collect_file hook needs to be used if you want to + create test modules for files that do not match as a test module. + + Stops at first non-None result, see :ref:`firstresult` + + :param path: a :py:class:`py.path.local` - the path of module to collect + """ + + +@hookspec(firstresult=True) +def pytest_pycollect_makeitem(collector, name, obj): + """ return custom item/collector for a python object in a module, or None. + + Stops at first non-None result, see :ref:`firstresult` """ + + +@hookspec(firstresult=True) +def pytest_pyfunc_call(pyfuncitem): + """ call underlying test function. + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_generate_tests(metafunc): + """ generate (multiple) parametrized calls to a test function.""" + + +@hookspec(firstresult=True) +def pytest_make_parametrize_id(config, val, argname): + """Return a user-friendly string representation of the given ``val`` that will be used + by @pytest.mark.parametrize calls. Return None if the hook doesn't know about ``val``. + The parameter name is available as ``argname``, if required. + + Stops at first non-None result, see :ref:`firstresult` + + :param _pytest.config.Config config: pytest config object + :param val: the parametrized value + :param str argname: the automatic parameter name produced by pytest + """ + + +# ------------------------------------------------------------------------- +# generic runtest related hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_runtestloop(session): + """ called for performing the main runtest loop + (after collection finished). + + Stops at first non-None result, see :ref:`firstresult` + + :param _pytest.main.Session session: the pytest session object + """ + + +def pytest_itemstart(item, node): + """(**Deprecated**) use pytest_runtest_logstart. """ + + +@hookspec(firstresult=True) +def pytest_runtest_protocol(item, nextitem): + """ implements the runtest_setup/call/teardown protocol for + the given test item, including capturing exceptions and calling + reporting hooks. + + :arg item: test item for which the runtest protocol is performed. + + :arg nextitem: the scheduled-to-be-next test item (or None if this + is the end my friend). This argument is passed on to + :py:func:`pytest_runtest_teardown`. + + :return boolean: True if no further hook implementations should be invoked. + + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_runtest_logstart(nodeid, location): + """ signal the start of running a single test item. + + This hook will be called **before** :func:`pytest_runtest_setup`, :func:`pytest_runtest_call` and + :func:`pytest_runtest_teardown` hooks. + + :param str nodeid: full id of the item + :param location: a triple of ``(filename, linenum, testname)`` + """ + + +def pytest_runtest_logfinish(nodeid, location): + """ signal the complete finish of running a single test item. + + This hook will be called **after** :func:`pytest_runtest_setup`, :func:`pytest_runtest_call` and + :func:`pytest_runtest_teardown` hooks. + + :param str nodeid: full id of the item + :param location: a triple of ``(filename, linenum, testname)`` + """ + + +def pytest_runtest_setup(item): + """ called before ``pytest_runtest_call(item)``. """ + + +def pytest_runtest_call(item): + """ called to execute the test ``item``. """ + + +def pytest_runtest_teardown(item, nextitem): + """ called after ``pytest_runtest_call``. + + :arg nextitem: the scheduled-to-be-next test item (None if no further + test item is scheduled). This argument can be used to + perform exact teardowns, i.e. calling just enough finalizers + so that nextitem only needs to call setup-functions. + """ + + +@hookspec(firstresult=True) +def pytest_runtest_makereport(item, call): + """ return a :py:class:`_pytest.runner.TestReport` object + for the given :py:class:`pytest.Item <_pytest.main.Item>` and + :py:class:`_pytest.runner.CallInfo`. + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_runtest_logreport(report): + """ process a test setup/call/teardown report relating to + the respective phase of executing a test. """ + + +@hookspec(firstresult=True) +def pytest_report_to_serializable(config, report): + """ + .. warning:: + This hook is experimental and subject to change between pytest releases, even + bug fixes. + + The intent is for this to be used by plugins maintained by the core-devs, such + as ``pytest-xdist``, ``pytest-subtests``, and as a replacement for the internal + 'resultlog' plugin. + + In the future it might become part of the public hook API. + + Serializes the given report object into a data structure suitable for sending + over the wire, e.g. converted to JSON. + """ + + +@hookspec(firstresult=True) +def pytest_report_from_serializable(config, data): + """ + .. warning:: + This hook is experimental and subject to change between pytest releases, even + bug fixes. + + The intent is for this to be used by plugins maintained by the core-devs, such + as ``pytest-xdist``, ``pytest-subtests``, and as a replacement for the internal + 'resultlog' plugin. + + In the future it might become part of the public hook API. + + Restores a report object previously serialized with pytest_report_to_serializable(). + """ + + +# ------------------------------------------------------------------------- +# Fixture related hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_fixture_setup(fixturedef, request): + """ performs fixture setup execution. + + :return: The return value of the call to the fixture function + + Stops at first non-None result, see :ref:`firstresult` + + .. note:: + If the fixture function returns None, other implementations of + this hook function will continue to be called, according to the + behavior of the :ref:`firstresult` option. + """ + + +def pytest_fixture_post_finalizer(fixturedef, request): + """ called after fixture teardown, but before the cache is cleared so + the fixture result cache ``fixturedef.cached_result`` can + still be accessed.""" + + +# ------------------------------------------------------------------------- +# test session related hooks +# ------------------------------------------------------------------------- + + +def pytest_sessionstart(session): + """ called after the ``Session`` object has been created and before performing collection + and entering the run test loop. + + :param _pytest.main.Session session: the pytest session object + """ + + +def pytest_sessionfinish(session, exitstatus): + """ called after whole test run finished, right before returning the exit status to the system. + + :param _pytest.main.Session session: the pytest session object + :param int exitstatus: the status which pytest will return to the system + """ + + +def pytest_unconfigure(config): + """ called before test process is exited. + + :param _pytest.config.Config config: pytest config object + """ + + +# ------------------------------------------------------------------------- +# hooks for customizing the assert methods +# ------------------------------------------------------------------------- + + +def pytest_assertrepr_compare(config, op, left, right): + """return explanation for comparisons in failing assert expressions. + + Return None for no custom explanation, otherwise return a list + of strings. The strings will be joined by newlines but any newlines + *in* a string will be escaped. Note that all but the first line will + be indented slightly, the intention is for the first line to be a summary. + + :param _pytest.config.Config config: pytest config object + """ + + +# ------------------------------------------------------------------------- +# hooks for influencing reporting (invoked from _pytest_terminal) +# ------------------------------------------------------------------------- + + +def pytest_report_header(config, startdir): + """ return a string or list of strings to be displayed as header info for terminal reporting. + + :param _pytest.config.Config config: pytest config object + :param startdir: py.path object with the starting dir + + .. note:: + + This function should be implemented only in plugins or ``conftest.py`` + files situated at the tests root directory due to how pytest + :ref:`discovers plugins during startup <pluginorder>`. + """ + + +def pytest_report_collectionfinish(config, startdir, items): + """ + .. versionadded:: 3.2 + + return a string or list of strings to be displayed after collection has finished successfully. + + This strings will be displayed after the standard "collected X items" message. + + :param _pytest.config.Config config: pytest config object + :param startdir: py.path object with the starting dir + :param items: list of pytest items that are going to be executed; this list should not be modified. + """ + + +@hookspec(firstresult=True) +def pytest_report_teststatus(report, config): + """ return result-category, shortletter and verbose word for reporting. + + :param _pytest.config.Config config: pytest config object + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_terminal_summary(terminalreporter, exitstatus, config): + """Add a section to terminal summary reporting. + + :param _pytest.terminal.TerminalReporter terminalreporter: the internal terminal reporter object + :param int exitstatus: the exit status that will be reported back to the OS + :param _pytest.config.Config config: pytest config object + + .. versionadded:: 4.2 + The ``config`` parameter. + """ + + +@hookspec(historic=True, warn_on_impl=PYTEST_LOGWARNING) +def pytest_logwarning(message, code, nodeid, fslocation): + """ + .. deprecated:: 3.8 + + This hook is will stop working in a future release. + + pytest no longer triggers this hook, but the + terminal writer still implements it to display warnings issued by + :meth:`_pytest.config.Config.warn` and :meth:`_pytest.nodes.Node.warn`. Calling those functions will be + an error in future releases. + + process a warning specified by a message, a code string, + a nodeid and fslocation (both of which may be None + if the warning is not tied to a particular node/location). + + .. note:: + This hook is incompatible with ``hookwrapper=True``. + """ + + +@hookspec(historic=True) +def pytest_warning_captured(warning_message, when, item): + """ + Process a warning captured by the internal pytest warnings plugin. + + :param warnings.WarningMessage warning_message: + The captured warning. This is the same object produced by :py:func:`warnings.catch_warnings`, and contains + the same attributes as the parameters of :py:func:`warnings.showwarning`. + + :param str when: + Indicates when the warning was captured. Possible values: + + * ``"config"``: during pytest configuration/initialization stage. + * ``"collect"``: during test collection. + * ``"runtest"``: during test execution. + + :param pytest.Item|None item: + **DEPRECATED**: This parameter is incompatible with ``pytest-xdist``, and will always receive ``None`` + in a future release. + + The item being executed if ``when`` is ``"runtest"``, otherwise ``None``. + """ + + +# ------------------------------------------------------------------------- +# doctest hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_doctest_prepare_content(content): + """ return processed content for a given doctest + + Stops at first non-None result, see :ref:`firstresult` """ + + +# ------------------------------------------------------------------------- +# error handling and internal debugging hooks +# ------------------------------------------------------------------------- + + +def pytest_internalerror(excrepr, excinfo): + """ called for internal errors. """ + + +def pytest_keyboard_interrupt(excinfo): + """ called for keyboard interrupt. """ + + +def pytest_exception_interact(node, call, report): + """called when an exception was raised which can potentially be + interactively handled. + + This hook is only called if an exception was raised + that is not an internal exception like ``skip.Exception``. + """ + + +def pytest_enter_pdb(config, pdb): + """ called upon pdb.set_trace(), can be used by plugins to take special + action just before the python debugger enters in interactive mode. + + :param _pytest.config.Config config: pytest config object + :param pdb.Pdb pdb: Pdb instance + """ + + +def pytest_leave_pdb(config, pdb): + """ called when leaving pdb (e.g. with continue after pdb.set_trace()). + + Can be used by plugins to take special action just after the python + debugger leaves interactive mode. + + :param _pytest.config.Config config: pytest config object + :param pdb.Pdb pdb: Pdb instance + """ diff --git a/contrib/python/pytest/py2/_pytest/junitxml.py b/contrib/python/pytest/py2/_pytest/junitxml.py new file mode 100644 index 00000000000..853dcb77449 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/junitxml.py @@ -0,0 +1,707 @@ +# -*- coding: utf-8 -*- +""" + report test results in JUnit-XML format, + for use with Jenkins and build integration servers. + + +Based on initial code from Ross Lawley. + +Output conforms to https://github.com/jenkinsci/xunit-plugin/blob/master/ +src/main/resources/org/jenkinsci/plugins/xunit/types/model/xsd/junit-10.xsd +""" +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import functools +import os +import platform +import re +import sys +import time +from datetime import datetime + +import py +import six + +import pytest +from _pytest import nodes +from _pytest.config import filename_arg + +# Python 2.X and 3.X compatibility +if sys.version_info[0] < 3: + from codecs import open + + +class Junit(py.xml.Namespace): + pass + + +# We need to get the subset of the invalid unicode ranges according to +# XML 1.0 which are valid in this python build. Hence we calculate +# this dynamically instead of hardcoding it. The spec range of valid +# chars is: Char ::= #x9 | #xA | #xD | [#x20-#xD7FF] | [#xE000-#xFFFD] +# | [#x10000-#x10FFFF] +_legal_chars = (0x09, 0x0A, 0x0D) +_legal_ranges = ((0x20, 0x7E), (0x80, 0xD7FF), (0xE000, 0xFFFD), (0x10000, 0x10FFFF)) +_legal_xml_re = [ + u"%s-%s" % (six.unichr(low), six.unichr(high)) + for (low, high) in _legal_ranges + if low < sys.maxunicode +] +_legal_xml_re = [six.unichr(x) for x in _legal_chars] + _legal_xml_re +illegal_xml_re = re.compile(u"[^%s]" % u"".join(_legal_xml_re)) +del _legal_chars +del _legal_ranges +del _legal_xml_re + +_py_ext_re = re.compile(r"\.py$") + + +def bin_xml_escape(arg): + def repl(matchobj): + i = ord(matchobj.group()) + if i <= 0xFF: + return u"#x%02X" % i + else: + return u"#x%04X" % i + + return py.xml.raw(illegal_xml_re.sub(repl, py.xml.escape(arg))) + + +def merge_family(left, right): + result = {} + for kl, vl in left.items(): + for kr, vr in right.items(): + if not isinstance(vl, list): + raise TypeError(type(vl)) + result[kl] = vl + vr + left.update(result) + + +families = {} +families["_base"] = {"testcase": ["classname", "name"]} +families["_base_legacy"] = {"testcase": ["file", "line", "url"]} + +# xUnit 1.x inherits legacy attributes +families["xunit1"] = families["_base"].copy() +merge_family(families["xunit1"], families["_base_legacy"]) + +# xUnit 2.x uses strict base attributes +families["xunit2"] = families["_base"] + + +class _NodeReporter(object): + def __init__(self, nodeid, xml): + self.id = nodeid + self.xml = xml + self.add_stats = self.xml.add_stats + self.family = self.xml.family + self.duration = 0 + self.properties = [] + self.nodes = [] + self.testcase = None + self.attrs = {} + + def append(self, node): + self.xml.add_stats(type(node).__name__) + self.nodes.append(node) + + def add_property(self, name, value): + self.properties.append((str(name), bin_xml_escape(value))) + + def add_attribute(self, name, value): + self.attrs[str(name)] = bin_xml_escape(value) + + def make_properties_node(self): + """Return a Junit node containing custom properties, if any. + """ + if self.properties: + return Junit.properties( + [ + Junit.property(name=name, value=value) + for name, value in self.properties + ] + ) + return "" + + def record_testreport(self, testreport): + assert not self.testcase + names = mangle_test_address(testreport.nodeid) + existing_attrs = self.attrs + classnames = names[:-1] + if self.xml.prefix: + classnames.insert(0, self.xml.prefix) + attrs = { + "classname": ".".join(classnames), + "name": bin_xml_escape(names[-1]), + "file": testreport.location[0], + } + if testreport.location[1] is not None: + attrs["line"] = testreport.location[1] + if hasattr(testreport, "url"): + attrs["url"] = testreport.url + self.attrs = attrs + self.attrs.update(existing_attrs) # restore any user-defined attributes + + # Preserve legacy testcase behavior + if self.family == "xunit1": + return + + # Filter out attributes not permitted by this test family. + # Including custom attributes because they are not valid here. + temp_attrs = {} + for key in self.attrs.keys(): + if key in families[self.family]["testcase"]: + temp_attrs[key] = self.attrs[key] + self.attrs = temp_attrs + + def to_xml(self): + testcase = Junit.testcase(time="%.3f" % self.duration, **self.attrs) + testcase.append(self.make_properties_node()) + for node in self.nodes: + testcase.append(node) + return testcase + + def _add_simple(self, kind, message, data=None): + data = bin_xml_escape(data) + node = kind(data, message=message) + self.append(node) + + def write_captured_output(self, report): + if not self.xml.log_passing_tests and report.passed: + return + + content_out = report.capstdout + content_log = report.caplog + content_err = report.capstderr + + if content_log or content_out: + if content_log and self.xml.logging == "system-out": + if content_out: + # syncing stdout and the log-output is not done yet. It's + # probably not worth the effort. Therefore, first the captured + # stdout is shown and then the captured logs. + content = "\n".join( + [ + " Captured Stdout ".center(80, "-"), + content_out, + "", + " Captured Log ".center(80, "-"), + content_log, + ] + ) + else: + content = content_log + else: + content = content_out + + if content: + tag = getattr(Junit, "system-out") + self.append(tag(bin_xml_escape(content))) + + if content_log or content_err: + if content_log and self.xml.logging == "system-err": + if content_err: + content = "\n".join( + [ + " Captured Stderr ".center(80, "-"), + content_err, + "", + " Captured Log ".center(80, "-"), + content_log, + ] + ) + else: + content = content_log + else: + content = content_err + + if content: + tag = getattr(Junit, "system-err") + self.append(tag(bin_xml_escape(content))) + + def append_pass(self, report): + self.add_stats("passed") + + def append_failure(self, report): + # msg = str(report.longrepr.reprtraceback.extraline) + if hasattr(report, "wasxfail"): + self._add_simple(Junit.skipped, "xfail-marked test passes unexpectedly") + else: + if hasattr(report.longrepr, "reprcrash"): + message = report.longrepr.reprcrash.message + elif isinstance(report.longrepr, six.string_types): + message = report.longrepr + else: + message = str(report.longrepr) + message = bin_xml_escape(message) + fail = Junit.failure(message=message) + fail.append(bin_xml_escape(report.longrepr)) + self.append(fail) + + def append_collect_error(self, report): + # msg = str(report.longrepr.reprtraceback.extraline) + self.append( + Junit.error(bin_xml_escape(report.longrepr), message="collection failure") + ) + + def append_collect_skipped(self, report): + self._add_simple(Junit.skipped, "collection skipped", report.longrepr) + + def append_error(self, report): + if report.when == "teardown": + msg = "test teardown failure" + else: + msg = "test setup failure" + self._add_simple(Junit.error, msg, report.longrepr) + + def append_skipped(self, report): + if hasattr(report, "wasxfail"): + xfailreason = report.wasxfail + if xfailreason.startswith("reason: "): + xfailreason = xfailreason[8:] + self.append( + Junit.skipped( + "", type="pytest.xfail", message=bin_xml_escape(xfailreason) + ) + ) + else: + filename, lineno, skipreason = report.longrepr + if skipreason.startswith("Skipped: "): + skipreason = skipreason[9:] + details = "%s:%s: %s" % (filename, lineno, skipreason) + + self.append( + Junit.skipped( + bin_xml_escape(details), + type="pytest.skip", + message=bin_xml_escape(skipreason), + ) + ) + self.write_captured_output(report) + + def finalize(self): + data = self.to_xml().unicode(indent=0) + self.__dict__.clear() + self.to_xml = lambda: py.xml.raw(data) + + +def _warn_incompatibility_with_xunit2(request, fixture_name): + """Emits a PytestWarning about the given fixture being incompatible with newer xunit revisions""" + from _pytest.warning_types import PytestWarning + + xml = getattr(request.config, "_xml", None) + if xml is not None and xml.family not in ("xunit1", "legacy"): + request.node.warn( + PytestWarning( + "{fixture_name} is incompatible with junit_family '{family}' (use 'legacy' or 'xunit1')".format( + fixture_name=fixture_name, family=xml.family + ) + ) + ) + + +@pytest.fixture +def record_property(request): + """Add an extra properties the calling test. + User properties become part of the test report and are available to the + configured reporters, like JUnit XML. + The fixture is callable with ``(name, value)``, with value being automatically + xml-encoded. + + Example:: + + def test_function(record_property): + record_property("example_key", 1) + """ + _warn_incompatibility_with_xunit2(request, "record_property") + + def append_property(name, value): + request.node.user_properties.append((name, value)) + + return append_property + + +@pytest.fixture +def record_xml_attribute(request): + """Add extra xml attributes to the tag for the calling test. + The fixture is callable with ``(name, value)``, with value being + automatically xml-encoded + """ + from _pytest.warning_types import PytestExperimentalApiWarning + + request.node.warn( + PytestExperimentalApiWarning("record_xml_attribute is an experimental feature") + ) + + _warn_incompatibility_with_xunit2(request, "record_xml_attribute") + + # Declare noop + def add_attr_noop(name, value): + pass + + attr_func = add_attr_noop + + xml = getattr(request.config, "_xml", None) + if xml is not None: + node_reporter = xml.node_reporter(request.node.nodeid) + attr_func = node_reporter.add_attribute + + return attr_func + + +def _check_record_param_type(param, v): + """Used by record_testsuite_property to check that the given parameter name is of the proper + type""" + __tracebackhide__ = True + if not isinstance(v, six.string_types): + msg = "{param} parameter needs to be a string, but {g} given" + raise TypeError(msg.format(param=param, g=type(v).__name__)) + + +@pytest.fixture(scope="session") +def record_testsuite_property(request): + """ + Records a new ``<property>`` tag as child of the root ``<testsuite>``. This is suitable to + writing global information regarding the entire test suite, and is compatible with ``xunit2`` JUnit family. + + This is a ``session``-scoped fixture which is called with ``(name, value)``. Example: + + .. code-block:: python + + def test_foo(record_testsuite_property): + record_testsuite_property("ARCH", "PPC") + record_testsuite_property("STORAGE_TYPE", "CEPH") + + ``name`` must be a string, ``value`` will be converted to a string and properly xml-escaped. + """ + + __tracebackhide__ = True + + def record_func(name, value): + """noop function in case --junitxml was not passed in the command-line""" + __tracebackhide__ = True + _check_record_param_type("name", name) + + xml = getattr(request.config, "_xml", None) + if xml is not None: + record_func = xml.add_global_property # noqa + return record_func + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting") + group.addoption( + "--junitxml", + "--junit-xml", + action="store", + dest="xmlpath", + metavar="path", + type=functools.partial(filename_arg, optname="--junitxml"), + default=None, + help="create junit-xml style report file at given path.", + ) + group.addoption( + "--junitprefix", + "--junit-prefix", + action="store", + metavar="str", + default=None, + help="prepend prefix to classnames in junit-xml output", + ) + parser.addini( + "junit_suite_name", "Test suite name for JUnit report", default="pytest" + ) + parser.addini( + "junit_logging", + "Write captured log messages to JUnit report: " + "one of no|system-out|system-err", + default="no", + ) # choices=['no', 'stdout', 'stderr']) + parser.addini( + "junit_log_passing_tests", + "Capture log information for passing tests to JUnit report: ", + type="bool", + default=True, + ) + parser.addini( + "junit_duration_report", + "Duration time to report: one of total|call", + default="total", + ) # choices=['total', 'call']) + parser.addini( + "junit_family", + "Emit XML for schema: one of legacy|xunit1|xunit2", + default="xunit1", + ) + + +def pytest_configure(config): + xmlpath = config.option.xmlpath + # prevent opening xmllog on slave nodes (xdist) + if xmlpath and not hasattr(config, "slaveinput"): + config._xml = LogXML( + xmlpath, + config.option.junitprefix, + config.getini("junit_suite_name"), + config.getini("junit_logging"), + config.getini("junit_duration_report"), + config.getini("junit_family"), + config.getini("junit_log_passing_tests"), + ) + config.pluginmanager.register(config._xml) + + +def pytest_unconfigure(config): + xml = getattr(config, "_xml", None) + if xml: + del config._xml + config.pluginmanager.unregister(xml) + + +def mangle_test_address(address): + path, possible_open_bracket, params = address.partition("[") + names = path.split("::") + try: + names.remove("()") + except ValueError: + pass + # convert file path to dotted path + names[0] = names[0].replace(nodes.SEP, ".") + names[0] = _py_ext_re.sub("", names[0]) + # put any params back + names[-1] += possible_open_bracket + params + return names + + +class LogXML(object): + def __init__( + self, + logfile, + prefix, + suite_name="pytest", + logging="no", + report_duration="total", + family="xunit1", + log_passing_tests=True, + ): + logfile = os.path.expanduser(os.path.expandvars(logfile)) + self.logfile = os.path.normpath(os.path.abspath(logfile)) + self.prefix = prefix + self.suite_name = suite_name + self.logging = logging + self.log_passing_tests = log_passing_tests + self.report_duration = report_duration + self.family = family + self.stats = dict.fromkeys(["error", "passed", "failure", "skipped"], 0) + self.node_reporters = {} # nodeid -> _NodeReporter + self.node_reporters_ordered = [] + self.global_properties = [] + + # List of reports that failed on call but teardown is pending. + self.open_reports = [] + self.cnt_double_fail_tests = 0 + + # Replaces convenience family with real family + if self.family == "legacy": + self.family = "xunit1" + + def finalize(self, report): + nodeid = getattr(report, "nodeid", report) + # local hack to handle xdist report order + slavenode = getattr(report, "node", None) + reporter = self.node_reporters.pop((nodeid, slavenode)) + if reporter is not None: + reporter.finalize() + + def node_reporter(self, report): + nodeid = getattr(report, "nodeid", report) + # local hack to handle xdist report order + slavenode = getattr(report, "node", None) + + key = nodeid, slavenode + + if key in self.node_reporters: + # TODO: breasks for --dist=each + return self.node_reporters[key] + + reporter = _NodeReporter(nodeid, self) + + self.node_reporters[key] = reporter + self.node_reporters_ordered.append(reporter) + + return reporter + + def add_stats(self, key): + if key in self.stats: + self.stats[key] += 1 + + def _opentestcase(self, report): + reporter = self.node_reporter(report) + reporter.record_testreport(report) + return reporter + + def pytest_runtest_logreport(self, report): + """handle a setup/call/teardown report, generating the appropriate + xml tags as necessary. + + note: due to plugins like xdist, this hook may be called in interlaced + order with reports from other nodes. for example: + + usual call order: + -> setup node1 + -> call node1 + -> teardown node1 + -> setup node2 + -> call node2 + -> teardown node2 + + possible call order in xdist: + -> setup node1 + -> call node1 + -> setup node2 + -> call node2 + -> teardown node2 + -> teardown node1 + """ + close_report = None + if report.passed: + if report.when == "call": # ignore setup/teardown + reporter = self._opentestcase(report) + reporter.append_pass(report) + elif report.failed: + if report.when == "teardown": + # The following vars are needed when xdist plugin is used + report_wid = getattr(report, "worker_id", None) + report_ii = getattr(report, "item_index", None) + close_report = next( + ( + rep + for rep in self.open_reports + if ( + rep.nodeid == report.nodeid + and getattr(rep, "item_index", None) == report_ii + and getattr(rep, "worker_id", None) == report_wid + ) + ), + None, + ) + if close_report: + # We need to open new testcase in case we have failure in + # call and error in teardown in order to follow junit + # schema + self.finalize(close_report) + self.cnt_double_fail_tests += 1 + reporter = self._opentestcase(report) + if report.when == "call": + reporter.append_failure(report) + self.open_reports.append(report) + if not self.log_passing_tests: + reporter.write_captured_output(report) + else: + reporter.append_error(report) + elif report.skipped: + reporter = self._opentestcase(report) + reporter.append_skipped(report) + self.update_testcase_duration(report) + if report.when == "teardown": + reporter = self._opentestcase(report) + reporter.write_captured_output(report) + + for propname, propvalue in report.user_properties: + reporter.add_property(propname, propvalue) + + self.finalize(report) + report_wid = getattr(report, "worker_id", None) + report_ii = getattr(report, "item_index", None) + close_report = next( + ( + rep + for rep in self.open_reports + if ( + rep.nodeid == report.nodeid + and getattr(rep, "item_index", None) == report_ii + and getattr(rep, "worker_id", None) == report_wid + ) + ), + None, + ) + if close_report: + self.open_reports.remove(close_report) + + def update_testcase_duration(self, report): + """accumulates total duration for nodeid from given report and updates + the Junit.testcase with the new total if already created. + """ + if self.report_duration == "total" or report.when == self.report_duration: + reporter = self.node_reporter(report) + reporter.duration += getattr(report, "duration", 0.0) + + def pytest_collectreport(self, report): + if not report.passed: + reporter = self._opentestcase(report) + if report.failed: + reporter.append_collect_error(report) + else: + reporter.append_collect_skipped(report) + + def pytest_internalerror(self, excrepr): + reporter = self.node_reporter("internal") + reporter.attrs.update(classname="pytest", name="internal") + reporter._add_simple(Junit.error, "internal error", excrepr) + + def pytest_sessionstart(self): + self.suite_start_time = time.time() + + def pytest_sessionfinish(self): + dirname = os.path.dirname(os.path.abspath(self.logfile)) + if not os.path.isdir(dirname): + os.makedirs(dirname) + logfile = open(self.logfile, "w", encoding="utf-8") + suite_stop_time = time.time() + suite_time_delta = suite_stop_time - self.suite_start_time + + numtests = ( + self.stats["passed"] + + self.stats["failure"] + + self.stats["skipped"] + + self.stats["error"] + - self.cnt_double_fail_tests + ) + logfile.write('<?xml version="1.0" encoding="utf-8"?>') + + suite_node = Junit.testsuite( + self._get_global_properties_node(), + [x.to_xml() for x in self.node_reporters_ordered], + name=self.suite_name, + errors=self.stats["error"], + failures=self.stats["failure"], + skipped=self.stats["skipped"], + tests=numtests, + time="%.3f" % suite_time_delta, + timestamp=datetime.fromtimestamp(self.suite_start_time).isoformat(), + hostname=platform.node(), + ) + logfile.write(Junit.testsuites([suite_node]).unicode(indent=0)) + logfile.close() + + def pytest_terminal_summary(self, terminalreporter): + terminalreporter.write_sep("-", "generated xml file: %s" % (self.logfile)) + + def add_global_property(self, name, value): + __tracebackhide__ = True + _check_record_param_type("name", name) + self.global_properties.append((name, bin_xml_escape(value))) + + def _get_global_properties_node(self): + """Return a Junit node containing custom properties, if any. + """ + if self.global_properties: + return Junit.properties( + [ + Junit.property(name=name, value=value) + for name, value in self.global_properties + ] + ) + return "" diff --git a/contrib/python/pytest/py2/_pytest/logging.py b/contrib/python/pytest/py2/_pytest/logging.py new file mode 100644 index 00000000000..2400737ee4e --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/logging.py @@ -0,0 +1,708 @@ +# -*- coding: utf-8 -*- +""" Access and control log capturing. """ +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import logging +import re +from contextlib import contextmanager + +import py +import six + +import pytest +from _pytest.compat import dummy_context_manager +from _pytest.config import create_terminal_writer +from _pytest.pathlib import Path + +DEFAULT_LOG_FORMAT = "%(levelname)-8s %(name)s:%(filename)s:%(lineno)d %(message)s" +DEFAULT_LOG_DATE_FORMAT = "%H:%M:%S" +_ANSI_ESCAPE_SEQ = re.compile(r"\x1b\[[\d;]+m") + + +def _remove_ansi_escape_sequences(text): + return _ANSI_ESCAPE_SEQ.sub("", text) + + +class ColoredLevelFormatter(logging.Formatter): + """ + Colorize the %(levelname)..s part of the log format passed to __init__. + """ + + LOGLEVEL_COLOROPTS = { + logging.CRITICAL: {"red"}, + logging.ERROR: {"red", "bold"}, + logging.WARNING: {"yellow"}, + logging.WARN: {"yellow"}, + logging.INFO: {"green"}, + logging.DEBUG: {"purple"}, + logging.NOTSET: set(), + } + LEVELNAME_FMT_REGEX = re.compile(r"%\(levelname\)([+-]?\d*s)") + + def __init__(self, terminalwriter, *args, **kwargs): + super(ColoredLevelFormatter, self).__init__(*args, **kwargs) + if six.PY2: + self._original_fmt = self._fmt + else: + self._original_fmt = self._style._fmt + self._level_to_fmt_mapping = {} + + levelname_fmt_match = self.LEVELNAME_FMT_REGEX.search(self._fmt) + if not levelname_fmt_match: + return + levelname_fmt = levelname_fmt_match.group() + + for level, color_opts in self.LOGLEVEL_COLOROPTS.items(): + formatted_levelname = levelname_fmt % { + "levelname": logging.getLevelName(level) + } + + # add ANSI escape sequences around the formatted levelname + color_kwargs = {name: True for name in color_opts} + colorized_formatted_levelname = terminalwriter.markup( + formatted_levelname, **color_kwargs + ) + self._level_to_fmt_mapping[level] = self.LEVELNAME_FMT_REGEX.sub( + colorized_formatted_levelname, self._fmt + ) + + def format(self, record): + fmt = self._level_to_fmt_mapping.get(record.levelno, self._original_fmt) + if six.PY2: + self._fmt = fmt + else: + self._style._fmt = fmt + return super(ColoredLevelFormatter, self).format(record) + + +if not six.PY2: + # Formatter classes don't support format styles in PY2 + + class PercentStyleMultiline(logging.PercentStyle): + """A logging style with special support for multiline messages. + + If the message of a record consists of multiple lines, this style + formats the message as if each line were logged separately. + """ + + @staticmethod + def _update_message(record_dict, message): + tmp = record_dict.copy() + tmp["message"] = message + return tmp + + def format(self, record): + if "\n" in record.message: + lines = record.message.splitlines() + formatted = self._fmt % self._update_message(record.__dict__, lines[0]) + # TODO optimize this by introducing an option that tells the + # logging framework that the indentation doesn't + # change. This allows to compute the indentation only once. + indentation = _remove_ansi_escape_sequences(formatted).find(lines[0]) + lines[0] = formatted + return ("\n" + " " * indentation).join(lines) + else: + return self._fmt % record.__dict__ + + +def get_option_ini(config, *names): + for name in names: + ret = config.getoption(name) # 'default' arg won't work as expected + if ret is None: + ret = config.getini(name) + if ret: + return ret + + +def pytest_addoption(parser): + """Add options to control log capturing.""" + group = parser.getgroup("logging") + + def add_option_ini(option, dest, default=None, type=None, **kwargs): + parser.addini( + dest, default=default, type=type, help="default value for " + option + ) + group.addoption(option, dest=dest, **kwargs) + + add_option_ini( + "--no-print-logs", + dest="log_print", + action="store_const", + const=False, + default=True, + type="bool", + help="disable printing caught logs on failed tests.", + ) + add_option_ini( + "--log-level", + dest="log_level", + default=None, + help="logging level used by the logging module", + ) + add_option_ini( + "--log-format", + dest="log_format", + default=DEFAULT_LOG_FORMAT, + help="log format as used by the logging module.", + ) + add_option_ini( + "--log-date-format", + dest="log_date_format", + default=DEFAULT_LOG_DATE_FORMAT, + help="log date format as used by the logging module.", + ) + parser.addini( + "log_cli", + default=False, + type="bool", + help='enable log display during test run (also known as "live logging").', + ) + add_option_ini( + "--log-cli-level", dest="log_cli_level", default=None, help="cli logging level." + ) + add_option_ini( + "--log-cli-format", + dest="log_cli_format", + default=None, + help="log format as used by the logging module.", + ) + add_option_ini( + "--log-cli-date-format", + dest="log_cli_date_format", + default=None, + help="log date format as used by the logging module.", + ) + add_option_ini( + "--log-file", + dest="log_file", + default=None, + help="path to a file when logging will be written to.", + ) + add_option_ini( + "--log-file-level", + dest="log_file_level", + default=None, + help="log file logging level.", + ) + add_option_ini( + "--log-file-format", + dest="log_file_format", + default=DEFAULT_LOG_FORMAT, + help="log format as used by the logging module.", + ) + add_option_ini( + "--log-file-date-format", + dest="log_file_date_format", + default=DEFAULT_LOG_DATE_FORMAT, + help="log date format as used by the logging module.", + ) + + +@contextmanager +def catching_logs(handler, formatter=None, level=None): + """Context manager that prepares the whole logging machinery properly.""" + root_logger = logging.getLogger() + + if formatter is not None: + handler.setFormatter(formatter) + if level is not None: + handler.setLevel(level) + + # Adding the same handler twice would confuse logging system. + # Just don't do that. + add_new_handler = handler not in root_logger.handlers + + if add_new_handler: + root_logger.addHandler(handler) + if level is not None: + orig_level = root_logger.level + root_logger.setLevel(min(orig_level, level)) + try: + yield handler + finally: + if level is not None: + root_logger.setLevel(orig_level) + if add_new_handler: + root_logger.removeHandler(handler) + + +class LogCaptureHandler(logging.StreamHandler): + """A logging handler that stores log records and the log text.""" + + def __init__(self): + """Creates a new log handler.""" + logging.StreamHandler.__init__(self, py.io.TextIO()) + self.records = [] + + def emit(self, record): + """Keep the log records in a list in addition to the log text.""" + self.records.append(record) + logging.StreamHandler.emit(self, record) + + def reset(self): + self.records = [] + self.stream = py.io.TextIO() + + +class LogCaptureFixture(object): + """Provides access and control of log capturing.""" + + def __init__(self, item): + """Creates a new funcarg.""" + self._item = item + # dict of log name -> log level + self._initial_log_levels = {} # Dict[str, int] + + def _finalize(self): + """Finalizes the fixture. + + This restores the log levels changed by :meth:`set_level`. + """ + # restore log levels + for logger_name, level in self._initial_log_levels.items(): + logger = logging.getLogger(logger_name) + logger.setLevel(level) + + @property + def handler(self): + """ + :rtype: LogCaptureHandler + """ + return self._item.catch_log_handler + + def get_records(self, when): + """ + Get the logging records for one of the possible test phases. + + :param str when: + Which test phase to obtain the records from. Valid values are: "setup", "call" and "teardown". + + :rtype: List[logging.LogRecord] + :return: the list of captured records at the given stage + + .. versionadded:: 3.4 + """ + handler = self._item.catch_log_handlers.get(when) + if handler: + return handler.records + else: + return [] + + @property + def text(self): + """Returns the formatted log text.""" + return _remove_ansi_escape_sequences(self.handler.stream.getvalue()) + + @property + def records(self): + """Returns the list of log records.""" + return self.handler.records + + @property + def record_tuples(self): + """Returns a list of a stripped down version of log records intended + for use in assertion comparison. + + The format of the tuple is: + + (logger_name, log_level, message) + """ + return [(r.name, r.levelno, r.getMessage()) for r in self.records] + + @property + def messages(self): + """Returns a list of format-interpolated log messages. + + Unlike 'records', which contains the format string and parameters for interpolation, log messages in this list + are all interpolated. + Unlike 'text', which contains the output from the handler, log messages in this list are unadorned with + levels, timestamps, etc, making exact comparisons more reliable. + + Note that traceback or stack info (from :func:`logging.exception` or the `exc_info` or `stack_info` arguments + to the logging functions) is not included, as this is added by the formatter in the handler. + + .. versionadded:: 3.7 + """ + return [r.getMessage() for r in self.records] + + def clear(self): + """Reset the list of log records and the captured log text.""" + self.handler.reset() + + def set_level(self, level, logger=None): + """Sets the level for capturing of logs. The level will be restored to its previous value at the end of + the test. + + :param int level: the logger to level. + :param str logger: the logger to update the level. If not given, the root logger level is updated. + + .. versionchanged:: 3.4 + The levels of the loggers changed by this function will be restored to their initial values at the + end of the test. + """ + logger_name = logger + logger = logging.getLogger(logger_name) + # save the original log-level to restore it during teardown + self._initial_log_levels.setdefault(logger_name, logger.level) + logger.setLevel(level) + + @contextmanager + def at_level(self, level, logger=None): + """Context manager that sets the level for capturing of logs. After the end of the 'with' statement the + level is restored to its original value. + + :param int level: the logger to level. + :param str logger: the logger to update the level. If not given, the root logger level is updated. + """ + logger = logging.getLogger(logger) + orig_level = logger.level + logger.setLevel(level) + try: + yield + finally: + logger.setLevel(orig_level) + + +@pytest.fixture +def caplog(request): + """Access and control log capturing. + + Captured logs are available through the following properties/methods:: + + * caplog.text -> string containing formatted log output + * caplog.records -> list of logging.LogRecord instances + * caplog.record_tuples -> list of (logger_name, level, message) tuples + * caplog.clear() -> clear captured records and formatted log output string + """ + result = LogCaptureFixture(request.node) + yield result + result._finalize() + + +def get_actual_log_level(config, *setting_names): + """Return the actual logging level.""" + + for setting_name in setting_names: + log_level = config.getoption(setting_name) + if log_level is None: + log_level = config.getini(setting_name) + if log_level: + break + else: + return + + if isinstance(log_level, six.string_types): + log_level = log_level.upper() + try: + return int(getattr(logging, log_level, log_level)) + except ValueError: + # Python logging does not recognise this as a logging level + raise pytest.UsageError( + "'{}' is not recognized as a logging level name for " + "'{}'. Please consider passing the " + "logging level num instead.".format(log_level, setting_name) + ) + + +# run after terminalreporter/capturemanager are configured +@pytest.hookimpl(trylast=True) +def pytest_configure(config): + config.pluginmanager.register(LoggingPlugin(config), "logging-plugin") + + +class LoggingPlugin(object): + """Attaches to the logging module and captures log messages for each test. + """ + + def __init__(self, config): + """Creates a new plugin to capture log messages. + + The formatter can be safely shared across all handlers so + create a single one for the entire test session here. + """ + self._config = config + + self.print_logs = get_option_ini(config, "log_print") + self.formatter = self._create_formatter( + get_option_ini(config, "log_format"), + get_option_ini(config, "log_date_format"), + ) + self.log_level = get_actual_log_level(config, "log_level") + + self.log_file_level = get_actual_log_level(config, "log_file_level") + self.log_file_format = get_option_ini(config, "log_file_format", "log_format") + self.log_file_date_format = get_option_ini( + config, "log_file_date_format", "log_date_format" + ) + self.log_file_formatter = logging.Formatter( + self.log_file_format, datefmt=self.log_file_date_format + ) + + log_file = get_option_ini(config, "log_file") + if log_file: + self.log_file_handler = logging.FileHandler( + log_file, mode="w", encoding="UTF-8" + ) + self.log_file_handler.setFormatter(self.log_file_formatter) + else: + self.log_file_handler = None + + self.log_cli_handler = None + + self.live_logs_context = lambda: dummy_context_manager() + # Note that the lambda for the live_logs_context is needed because + # live_logs_context can otherwise not be entered multiple times due + # to limitations of contextlib.contextmanager. + + if self._log_cli_enabled(): + self._setup_cli_logging() + + def _create_formatter(self, log_format, log_date_format): + # color option doesn't exist if terminal plugin is disabled + color = getattr(self._config.option, "color", "no") + if color != "no" and ColoredLevelFormatter.LEVELNAME_FMT_REGEX.search( + log_format + ): + formatter = ColoredLevelFormatter( + create_terminal_writer(self._config), log_format, log_date_format + ) + else: + formatter = logging.Formatter(log_format, log_date_format) + + if not six.PY2: + formatter._style = PercentStyleMultiline(formatter._style._fmt) + return formatter + + def _setup_cli_logging(self): + config = self._config + terminal_reporter = config.pluginmanager.get_plugin("terminalreporter") + if terminal_reporter is None: + # terminal reporter is disabled e.g. by pytest-xdist. + return + + capture_manager = config.pluginmanager.get_plugin("capturemanager") + # if capturemanager plugin is disabled, live logging still works. + log_cli_handler = _LiveLoggingStreamHandler(terminal_reporter, capture_manager) + + log_cli_formatter = self._create_formatter( + get_option_ini(config, "log_cli_format", "log_format"), + get_option_ini(config, "log_cli_date_format", "log_date_format"), + ) + + log_cli_level = get_actual_log_level(config, "log_cli_level", "log_level") + self.log_cli_handler = log_cli_handler + self.live_logs_context = lambda: catching_logs( + log_cli_handler, formatter=log_cli_formatter, level=log_cli_level + ) + + def set_log_path(self, fname): + """Public method, which can set filename parameter for + Logging.FileHandler(). Also creates parent directory if + it does not exist. + + .. warning:: + Please considered as an experimental API. + """ + fname = Path(fname) + + if not fname.is_absolute(): + fname = Path(self._config.rootdir, fname) + + if not fname.parent.exists(): + fname.parent.mkdir(exist_ok=True, parents=True) + + self.log_file_handler = logging.FileHandler( + str(fname), mode="w", encoding="UTF-8" + ) + self.log_file_handler.setFormatter(self.log_file_formatter) + + def _log_cli_enabled(self): + """Return True if log_cli should be considered enabled, either explicitly + or because --log-cli-level was given in the command-line. + """ + return self._config.getoption( + "--log-cli-level" + ) is not None or self._config.getini("log_cli") + + @pytest.hookimpl(hookwrapper=True, tryfirst=True) + def pytest_collection(self): + with self.live_logs_context(): + if self.log_cli_handler: + self.log_cli_handler.set_when("collection") + + if self.log_file_handler is not None: + with catching_logs(self.log_file_handler, level=self.log_file_level): + yield + else: + yield + + @contextmanager + def _runtest_for(self, item, when): + with self._runtest_for_main(item, when): + if self.log_file_handler is not None: + with catching_logs(self.log_file_handler, level=self.log_file_level): + yield + else: + yield + + @contextmanager + def _runtest_for_main(self, item, when): + """Implements the internals of pytest_runtest_xxx() hook.""" + with catching_logs( + LogCaptureHandler(), formatter=self.formatter, level=self.log_level + ) as log_handler: + if self.log_cli_handler: + self.log_cli_handler.set_when(when) + + if item is None: + yield # run the test + return + + if not hasattr(item, "catch_log_handlers"): + item.catch_log_handlers = {} + item.catch_log_handlers[when] = log_handler + item.catch_log_handler = log_handler + try: + yield # run test + finally: + if when == "teardown": + del item.catch_log_handler + del item.catch_log_handlers + + if self.print_logs: + # Add a captured log section to the report. + log = log_handler.stream.getvalue().strip() + item.add_report_section(when, "log", log) + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_setup(self, item): + with self._runtest_for(item, "setup"): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_call(self, item): + with self._runtest_for(item, "call"): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_teardown(self, item): + with self._runtest_for(item, "teardown"): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_logstart(self): + if self.log_cli_handler: + self.log_cli_handler.reset() + with self._runtest_for(None, "start"): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_logfinish(self): + with self._runtest_for(None, "finish"): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_logreport(self): + with self._runtest_for(None, "logreport"): + yield + + @pytest.hookimpl(hookwrapper=True, tryfirst=True) + def pytest_sessionfinish(self): + with self.live_logs_context(): + if self.log_cli_handler: + self.log_cli_handler.set_when("sessionfinish") + if self.log_file_handler is not None: + try: + with catching_logs( + self.log_file_handler, level=self.log_file_level + ): + yield + finally: + # Close the FileHandler explicitly. + # (logging.shutdown might have lost the weakref?!) + self.log_file_handler.close() + else: + yield + + @pytest.hookimpl(hookwrapper=True, tryfirst=True) + def pytest_sessionstart(self): + with self.live_logs_context(): + if self.log_cli_handler: + self.log_cli_handler.set_when("sessionstart") + if self.log_file_handler is not None: + with catching_logs(self.log_file_handler, level=self.log_file_level): + yield + else: + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtestloop(self, session): + """Runs all collected test items.""" + + if session.config.option.collectonly: + yield + return + + if self._log_cli_enabled() and self._config.getoption("verbose") < 1: + # setting verbose flag is needed to avoid messy test progress output + self._config.option.verbose = 1 + + with self.live_logs_context(): + if self.log_file_handler is not None: + with catching_logs(self.log_file_handler, level=self.log_file_level): + yield # run all the tests + else: + yield # run all the tests + + +class _LiveLoggingStreamHandler(logging.StreamHandler): + """ + Custom StreamHandler used by the live logging feature: it will write a newline before the first log message + in each test. + + During live logging we must also explicitly disable stdout/stderr capturing otherwise it will get captured + and won't appear in the terminal. + """ + + def __init__(self, terminal_reporter, capture_manager): + """ + :param _pytest.terminal.TerminalReporter terminal_reporter: + :param _pytest.capture.CaptureManager capture_manager: + """ + logging.StreamHandler.__init__(self, stream=terminal_reporter) + self.capture_manager = capture_manager + self.reset() + self.set_when(None) + self._test_outcome_written = False + + def reset(self): + """Reset the handler; should be called before the start of each test""" + self._first_record_emitted = False + + def set_when(self, when): + """Prepares for the given test phase (setup/call/teardown)""" + self._when = when + self._section_name_shown = False + if when == "start": + self._test_outcome_written = False + + def emit(self, record): + ctx_manager = ( + self.capture_manager.global_and_fixture_disabled() + if self.capture_manager + else dummy_context_manager() + ) + with ctx_manager: + if not self._first_record_emitted: + self.stream.write("\n") + self._first_record_emitted = True + elif self._when in ("teardown", "finish"): + if not self._test_outcome_written: + self._test_outcome_written = True + self.stream.write("\n") + if not self._section_name_shown and self._when: + self.stream.section("live log " + self._when, sep="-", bold=True) + self._section_name_shown = True + logging.StreamHandler.emit(self, record) diff --git a/contrib/python/pytest/py2/_pytest/main.py b/contrib/python/pytest/py2/_pytest/main.py new file mode 100644 index 00000000000..a9d310cb62d --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/main.py @@ -0,0 +1,780 @@ +# -*- coding: utf-8 -*- +""" core implementation of testing process: init, session, runtest loop. """ +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import contextlib +import fnmatch +import functools +import os +import pkgutil +import sys +import warnings + +import attr +import py +import six + +import _pytest._code +from _pytest import nodes +from _pytest.config import directory_arg +from _pytest.config import hookimpl +from _pytest.config import UsageError +from _pytest.deprecated import PYTEST_CONFIG_GLOBAL +from _pytest.outcomes import exit +from _pytest.runner import collect_one_node + +# exitcodes for the command line +EXIT_OK = 0 +EXIT_TESTSFAILED = 1 +EXIT_INTERRUPTED = 2 +EXIT_INTERNALERROR = 3 +EXIT_USAGEERROR = 4 +EXIT_NOTESTSCOLLECTED = 5 + + +def pytest_addoption(parser): + parser.addini( + "norecursedirs", + "directory patterns to avoid for recursion", + type="args", + default=[".*", "build", "dist", "CVS", "_darcs", "{arch}", "*.egg", "venv"], + ) + parser.addini( + "testpaths", + "directories to search for tests when no files or directories are given in the " + "command line.", + type="args", + default=[], + ) + group = parser.getgroup("general", "running and selection options") + group._addoption( + "-x", + "--exitfirst", + action="store_const", + dest="maxfail", + const=1, + help="exit instantly on first error or failed test.", + ), + group._addoption( + "--maxfail", + metavar="num", + action="store", + type=int, + dest="maxfail", + default=0, + help="exit after first num failures or errors.", + ) + group._addoption( + "--strict-markers", + "--strict", + action="store_true", + help="markers not registered in the `markers` section of the configuration file raise errors.", + ) + group._addoption( + "-c", + metavar="file", + type=str, + dest="inifilename", + help="load configuration from `file` instead of trying to locate one of the implicit " + "configuration files.", + ) + group._addoption( + "--continue-on-collection-errors", + action="store_true", + default=False, + dest="continue_on_collection_errors", + help="Force test execution even if collection errors occur.", + ) + group._addoption( + "--rootdir", + action="store", + dest="rootdir", + help="Define root directory for tests. Can be relative path: 'root_dir', './root_dir', " + "'root_dir/another_dir/'; absolute path: '/home/user/root_dir'; path with variables: " + "'$HOME/root_dir'.", + ) + + group = parser.getgroup("collect", "collection") + group.addoption( + "--collectonly", + "--collect-only", + action="store_true", + help="only collect tests, don't execute them.", + ), + group.addoption( + "--pyargs", + action="store_true", + help="try to interpret all arguments as python packages.", + ) + group.addoption( + "--ignore", + action="append", + metavar="path", + help="ignore path during collection (multi-allowed).", + ) + group.addoption( + "--ignore-glob", + action="append", + metavar="path", + help="ignore path pattern during collection (multi-allowed).", + ) + group.addoption( + "--deselect", + action="append", + metavar="nodeid_prefix", + help="deselect item during collection (multi-allowed).", + ) + # when changing this to --conf-cut-dir, config.py Conftest.setinitial + # needs upgrading as well + group.addoption( + "--confcutdir", + dest="confcutdir", + default=None, + metavar="dir", + type=functools.partial(directory_arg, optname="--confcutdir"), + help="only load conftest.py's relative to specified dir.", + ) + group.addoption( + "--noconftest", + action="store_true", + dest="noconftest", + default=False, + help="Don't load any conftest.py files.", + ) + group.addoption( + "--keepduplicates", + "--keep-duplicates", + action="store_true", + dest="keepduplicates", + default=False, + help="Keep duplicate tests.", + ) + group.addoption( + "--collect-in-virtualenv", + action="store_true", + dest="collect_in_virtualenv", + default=False, + help="Don't ignore tests in a local virtualenv directory", + ) + + group = parser.getgroup("debugconfig", "test session debugging and configuration") + group.addoption( + "--basetemp", + dest="basetemp", + default=None, + metavar="dir", + help=( + "base temporary directory for this test run." + "(warning: this directory is removed if it exists)" + ), + ) + + +class _ConfigDeprecated(object): + def __init__(self, config): + self.__dict__["_config"] = config + + def __getattr__(self, attr): + warnings.warn(PYTEST_CONFIG_GLOBAL, stacklevel=2) + return getattr(self._config, attr) + + def __setattr__(self, attr, val): + warnings.warn(PYTEST_CONFIG_GLOBAL, stacklevel=2) + return setattr(self._config, attr, val) + + def __repr__(self): + return "{}({!r})".format(type(self).__name__, self._config) + + +def pytest_configure(config): + __import__("pytest").config = _ConfigDeprecated(config) # compatibility + + +def wrap_session(config, doit): + """Skeleton command line program""" + session = Session(config) + session.exitstatus = EXIT_OK + initstate = 0 + try: + try: + config._do_configure() + initstate = 1 + config.hook.pytest_sessionstart(session=session) + initstate = 2 + session.exitstatus = doit(config, session) or 0 + except UsageError: + session.exitstatus = EXIT_USAGEERROR + raise + except Failed: + session.exitstatus = EXIT_TESTSFAILED + except (KeyboardInterrupt, exit.Exception): + excinfo = _pytest._code.ExceptionInfo.from_current() + exitstatus = EXIT_INTERRUPTED + if isinstance(excinfo.value, exit.Exception): + if excinfo.value.returncode is not None: + exitstatus = excinfo.value.returncode + if initstate < 2: + sys.stderr.write( + "{}: {}\n".format(excinfo.typename, excinfo.value.msg) + ) + config.hook.pytest_keyboard_interrupt(excinfo=excinfo) + session.exitstatus = exitstatus + except: # noqa + excinfo = _pytest._code.ExceptionInfo.from_current() + config.notify_exception(excinfo, config.option) + session.exitstatus = EXIT_INTERNALERROR + if excinfo.errisinstance(SystemExit): + sys.stderr.write("mainloop: caught unexpected SystemExit!\n") + + finally: + excinfo = None # Explicitly break reference cycle. + session.startdir.chdir() + if initstate >= 2: + config.hook.pytest_sessionfinish( + session=session, exitstatus=session.exitstatus + ) + config._ensure_unconfigure() + return session.exitstatus + + +def pytest_cmdline_main(config): + return wrap_session(config, _main) + + +def _main(config, session): + """ default command line protocol for initialization, session, + running tests and reporting. """ + config.hook.pytest_collection(session=session) + config.hook.pytest_runtestloop(session=session) + + if session.testsfailed: + return EXIT_TESTSFAILED + elif session.testscollected == 0: + return EXIT_NOTESTSCOLLECTED + + +def pytest_collection(session): + return session.perform_collect() + + +def pytest_runtestloop(session): + if session.testsfailed and not session.config.option.continue_on_collection_errors: + raise session.Interrupted("%d errors during collection" % session.testsfailed) + + if session.config.option.collectonly: + return True + + for i, item in enumerate(session.items): + nextitem = session.items[i + 1] if i + 1 < len(session.items) else None + item.config.hook.pytest_runtest_protocol(item=item, nextitem=nextitem) + if session.shouldfail: + raise session.Failed(session.shouldfail) + if session.shouldstop: + raise session.Interrupted(session.shouldstop) + return True + + +def _in_venv(path): + """Attempts to detect if ``path`` is the root of a Virtual Environment by + checking for the existence of the appropriate activate script""" + bindir = path.join("Scripts" if sys.platform.startswith("win") else "bin") + if not bindir.isdir(): + return False + activates = ( + "activate", + "activate.csh", + "activate.fish", + "Activate", + "Activate.bat", + "Activate.ps1", + ) + return any([fname.basename in activates for fname in bindir.listdir()]) + + +def pytest_ignore_collect(path, config): + ignore_paths = config._getconftest_pathlist("collect_ignore", path=path.dirpath()) + ignore_paths = ignore_paths or [] + excludeopt = config.getoption("ignore") + if excludeopt: + ignore_paths.extend([py.path.local(x) for x in excludeopt]) + + if py.path.local(path) in ignore_paths: + return True + + ignore_globs = config._getconftest_pathlist( + "collect_ignore_glob", path=path.dirpath() + ) + ignore_globs = ignore_globs or [] + excludeglobopt = config.getoption("ignore_glob") + if excludeglobopt: + ignore_globs.extend([py.path.local(x) for x in excludeglobopt]) + + if any( + fnmatch.fnmatch(six.text_type(path), six.text_type(glob)) + for glob in ignore_globs + ): + return True + + allow_in_venv = config.getoption("collect_in_virtualenv") + if not allow_in_venv and _in_venv(path): + return True + + return False + + +def pytest_collection_modifyitems(items, config): + deselect_prefixes = tuple(config.getoption("deselect") or []) + if not deselect_prefixes: + return + + remaining = [] + deselected = [] + for colitem in items: + if colitem.nodeid.startswith(deselect_prefixes): + deselected.append(colitem) + else: + remaining.append(colitem) + + if deselected: + config.hook.pytest_deselected(items=deselected) + items[:] = remaining + + +@contextlib.contextmanager +def _patched_find_module(): + """Patch bug in pkgutil.ImpImporter.find_module + + When using pkgutil.find_loader on python<3.4 it removes symlinks + from the path due to a call to os.path.realpath. This is not consistent + with actually doing the import (in these versions, pkgutil and __import__ + did not share the same underlying code). This can break conftest + discovery for pytest where symlinks are involved. + + The only supported python<3.4 by pytest is python 2.7. + """ + if six.PY2: # python 3.4+ uses importlib instead + + def find_module_patched(self, fullname, path=None): + # Note: we ignore 'path' argument since it is only used via meta_path + subname = fullname.split(".")[-1] + if subname != fullname and self.path is None: + return None + if self.path is None: + path = None + else: + # original: path = [os.path.realpath(self.path)] + path = [self.path] + try: + file, filename, etc = pkgutil.imp.find_module(subname, path) + except ImportError: + return None + return pkgutil.ImpLoader(fullname, file, filename, etc) + + old_find_module = pkgutil.ImpImporter.find_module + pkgutil.ImpImporter.find_module = find_module_patched + try: + yield + finally: + pkgutil.ImpImporter.find_module = old_find_module + else: + yield + + +class FSHookProxy(object): + def __init__(self, fspath, pm, remove_mods): + self.fspath = fspath + self.pm = pm + self.remove_mods = remove_mods + + def __getattr__(self, name): + x = self.pm.subset_hook_caller(name, remove_plugins=self.remove_mods) + self.__dict__[name] = x + return x + + +class NoMatch(Exception): + """ raised if matching cannot locate a matching names. """ + + +class Interrupted(KeyboardInterrupt): + """ signals an interrupted test run. """ + + __module__ = "builtins" # for py3 + + +class Failed(Exception): + """ signals a stop as failed test run. """ + + +@attr.s +class _bestrelpath_cache(dict): + path = attr.ib() + + def __missing__(self, path): + r = self.path.bestrelpath(path) + self[path] = r + return r + + +class Session(nodes.FSCollector): + Interrupted = Interrupted + Failed = Failed + + def __init__(self, config): + nodes.FSCollector.__init__( + self, config.rootdir, parent=None, config=config, session=self, nodeid="" + ) + self.testsfailed = 0 + self.testscollected = 0 + self.shouldstop = False + self.shouldfail = False + self.trace = config.trace.root.get("collection") + self._norecursepatterns = config.getini("norecursedirs") + self.startdir = config.invocation_dir + self._initialpaths = frozenset() + # Keep track of any collected nodes in here, so we don't duplicate fixtures + self._node_cache = {} + self._bestrelpathcache = _bestrelpath_cache(config.rootdir) + # Dirnames of pkgs with dunder-init files. + self._pkg_roots = {} + + self.config.pluginmanager.register(self, name="session") + + def __repr__(self): + return "<%s %s exitstatus=%r testsfailed=%d testscollected=%d>" % ( + self.__class__.__name__, + self.name, + getattr(self, "exitstatus", "<UNSET>"), + self.testsfailed, + self.testscollected, + ) + + def _node_location_to_relpath(self, node_path): + # bestrelpath is a quite slow function + return self._bestrelpathcache[node_path] + + @hookimpl(tryfirst=True) + def pytest_collectstart(self): + if self.shouldfail: + raise self.Failed(self.shouldfail) + if self.shouldstop: + raise self.Interrupted(self.shouldstop) + + @hookimpl(tryfirst=True) + def pytest_runtest_logreport(self, report): + if report.failed and not hasattr(report, "wasxfail"): + self.testsfailed += 1 + maxfail = self.config.getvalue("maxfail") + if maxfail and self.testsfailed >= maxfail: + self.shouldfail = "stopping after %d failures" % (self.testsfailed) + + pytest_collectreport = pytest_runtest_logreport + + def isinitpath(self, path): + return path in self._initialpaths + + def gethookproxy(self, fspath): + # check if we have the common case of running + # hooks with all conftest.py files + pm = self.config.pluginmanager + my_conftestmodules = pm._getconftestmodules(fspath) + remove_mods = pm._conftest_plugins.difference(my_conftestmodules) + if remove_mods: + # one or more conftests are not in use at this fspath + proxy = FSHookProxy(fspath, pm, remove_mods) + else: + # all plugis are active for this fspath + proxy = self.config.hook + return proxy + + def perform_collect(self, args=None, genitems=True): + hook = self.config.hook + try: + items = self._perform_collect(args, genitems) + self.config.pluginmanager.check_pending() + hook.pytest_collection_modifyitems( + session=self, config=self.config, items=items + ) + finally: + hook.pytest_collection_finish(session=self) + self.testscollected = len(items) + return items + + def _perform_collect(self, args, genitems): + if args is None: + args = self.config.args + self.trace("perform_collect", self, args) + self.trace.root.indent += 1 + self._notfound = [] + initialpaths = [] + self._initialparts = [] + self.items = items = [] + for arg in args: + parts = self._parsearg(arg) + self._initialparts.append(parts) + initialpaths.append(parts[0]) + self._initialpaths = frozenset(initialpaths) + rep = collect_one_node(self) + self.ihook.pytest_collectreport(report=rep) + self.trace.root.indent -= 1 + if self._notfound: + errors = [] + for arg, exc in self._notfound: + line = "(no name %r in any of %r)" % (arg, exc.args[0]) + errors.append("not found: %s\n%s" % (arg, line)) + # XXX: test this + raise UsageError(*errors) + if not genitems: + return rep.result + else: + if rep.passed: + for node in rep.result: + self.items.extend(self.genitems(node)) + return items + + def collect(self): + for initialpart in self._initialparts: + arg = "::".join(map(str, initialpart)) + self.trace("processing argument", arg) + self.trace.root.indent += 1 + try: + for x in self._collect(arg): + yield x + except NoMatch: + # we are inside a make_report hook so + # we cannot directly pass through the exception + self._notfound.append((arg, sys.exc_info()[1])) + + self.trace.root.indent -= 1 + + def _collect(self, arg): + from _pytest.python import Package + + names = self._parsearg(arg) + argpath = names.pop(0) + + # Start with a Session root, and delve to argpath item (dir or file) + # and stack all Packages found on the way. + # No point in finding packages when collecting doctests + if not self.config.getoption("doctestmodules", False): + pm = self.config.pluginmanager + for parent in reversed(argpath.parts()): + if pm._confcutdir and pm._confcutdir.relto(parent): + break + + if parent.isdir(): + pkginit = parent.join("__init__.py") + if pkginit.isfile(): + if pkginit not in self._node_cache: + col = self._collectfile(pkginit, handle_dupes=False) + if col: + if isinstance(col[0], Package): + self._pkg_roots[parent] = col[0] + # always store a list in the cache, matchnodes expects it + self._node_cache[col[0].fspath] = [col[0]] + + # If it's a directory argument, recurse and look for any Subpackages. + # Let the Package collector deal with subnodes, don't collect here. + if argpath.check(dir=1): + assert not names, "invalid arg %r" % (arg,) + + seen_dirs = set() + for path in argpath.visit( + fil=self._visit_filter, rec=self._recurse, bf=True, sort=True + ): + dirpath = path.dirpath() + if dirpath not in seen_dirs: + # Collect packages first. + seen_dirs.add(dirpath) + pkginit = dirpath.join("__init__.py") + if pkginit.exists(): + for x in self._collectfile(pkginit): + yield x + if isinstance(x, Package): + self._pkg_roots[dirpath] = x + if dirpath in self._pkg_roots: + # Do not collect packages here. + continue + + for x in self._collectfile(path): + key = (type(x), x.fspath) + if key in self._node_cache: + yield self._node_cache[key] + else: + self._node_cache[key] = x + yield x + else: + assert argpath.check(file=1) + + if argpath in self._node_cache: + col = self._node_cache[argpath] + else: + collect_root = self._pkg_roots.get(argpath.dirname, self) + col = collect_root._collectfile(argpath, handle_dupes=False) + if col: + self._node_cache[argpath] = col + m = self.matchnodes(col, names) + # If __init__.py was the only file requested, then the matched node will be + # the corresponding Package, and the first yielded item will be the __init__ + # Module itself, so just use that. If this special case isn't taken, then all + # the files in the package will be yielded. + if argpath.basename == "__init__.py": + try: + yield next(m[0].collect()) + except StopIteration: + # The package collects nothing with only an __init__.py + # file in it, which gets ignored by the default + # "python_files" option. + pass + return + for y in m: + yield y + + def _collectfile(self, path, handle_dupes=True): + assert path.isfile(), "%r is not a file (isdir=%r, exists=%r, islink=%r)" % ( + path, + path.isdir(), + path.exists(), + path.islink(), + ) + ihook = self.gethookproxy(path) + if not self.isinitpath(path): + if ihook.pytest_ignore_collect(path=path, config=self.config): + return () + + if handle_dupes: + keepduplicates = self.config.getoption("keepduplicates") + if not keepduplicates: + duplicate_paths = self.config.pluginmanager._duplicatepaths + if path in duplicate_paths: + return () + else: + duplicate_paths.add(path) + + return ihook.pytest_collect_file(path=path, parent=self) + + def _recurse(self, dirpath): + if dirpath.basename == "__pycache__": + return False + ihook = self.gethookproxy(dirpath.dirpath()) + if ihook.pytest_ignore_collect(path=dirpath, config=self.config): + return False + for pat in self._norecursepatterns: + if dirpath.check(fnmatch=pat): + return False + ihook = self.gethookproxy(dirpath) + ihook.pytest_collect_directory(path=dirpath, parent=self) + return True + + if six.PY2: + + @staticmethod + def _visit_filter(f): + return f.check(file=1) and not f.strpath.endswith("*.pyc") + + else: + + @staticmethod + def _visit_filter(f): + return f.check(file=1) + + def _tryconvertpyarg(self, x): + """Convert a dotted module name to path.""" + try: + with _patched_find_module(): + loader = pkgutil.find_loader(x) + except ImportError: + return x + if loader is None: + return x + # This method is sometimes invoked when AssertionRewritingHook, which + # does not define a get_filename method, is already in place: + try: + with _patched_find_module(): + path = loader.get_filename(x) + except AttributeError: + # Retrieve path from AssertionRewritingHook: + path = loader.modules[x][0].co_filename + if loader.is_package(x): + path = os.path.dirname(path) + return path + + def _parsearg(self, arg): + """ return (fspath, names) tuple after checking the file exists. """ + parts = str(arg).split("::") + if self.config.option.pyargs: + parts[0] = self._tryconvertpyarg(parts[0]) + relpath = parts[0].replace("/", os.sep) + path = self.config.invocation_dir.join(relpath, abs=True) + if not path.check(): + if self.config.option.pyargs: + raise UsageError( + "file or package not found: " + arg + " (missing __init__.py?)" + ) + raise UsageError("file not found: " + arg) + parts[0] = path.realpath() + return parts + + def matchnodes(self, matching, names): + self.trace("matchnodes", matching, names) + self.trace.root.indent += 1 + nodes = self._matchnodes(matching, names) + num = len(nodes) + self.trace("matchnodes finished -> ", num, "nodes") + self.trace.root.indent -= 1 + if num == 0: + raise NoMatch(matching, names[:1]) + return nodes + + def _matchnodes(self, matching, names): + if not matching or not names: + return matching + name = names[0] + assert name + nextnames = names[1:] + resultnodes = [] + for node in matching: + if isinstance(node, nodes.Item): + if not names: + resultnodes.append(node) + continue + assert isinstance(node, nodes.Collector) + key = (type(node), node.nodeid) + if key in self._node_cache: + rep = self._node_cache[key] + else: + rep = collect_one_node(node) + self._node_cache[key] = rep + if rep.passed: + has_matched = False + for x in rep.result: + # TODO: remove parametrized workaround once collection structure contains parametrization + if x.name == name or x.name.split("[")[0] == name: + resultnodes.extend(self.matchnodes([x], nextnames)) + has_matched = True + # XXX accept IDs that don't have "()" for class instances + if not has_matched and len(rep.result) == 1 and x.name == "()": + nextnames.insert(0, name) + resultnodes.extend(self.matchnodes([x], nextnames)) + else: + # report collection failures here to avoid failing to run some test + # specified in the command line because the module could not be + # imported (#134) + node.ihook.pytest_collectreport(report=rep) + return resultnodes + + def genitems(self, node): + self.trace("genitems", node) + if isinstance(node, nodes.Item): + node.ihook.pytest_itemcollected(item=node) + yield node + else: + assert isinstance(node, nodes.Collector) + rep = collect_one_node(node) + if rep.passed: + for subnode in rep.result: + for x in self.genitems(subnode): + yield x + node.ihook.pytest_collectreport(report=rep) diff --git a/contrib/python/pytest/py2/_pytest/mark/__init__.py b/contrib/python/pytest/py2/_pytest/mark/__init__.py new file mode 100644 index 00000000000..6bc22fe27da --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/mark/__init__.py @@ -0,0 +1,166 @@ +# -*- coding: utf-8 -*- +""" generic mechanism for marking and selecting python functions. """ +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +from .legacy import matchkeyword +from .legacy import matchmark +from .structures import EMPTY_PARAMETERSET_OPTION +from .structures import get_empty_parameterset_mark +from .structures import Mark +from .structures import MARK_GEN +from .structures import MarkDecorator +from .structures import MarkGenerator +from .structures import ParameterSet +from _pytest.config import UsageError + +__all__ = ["Mark", "MarkDecorator", "MarkGenerator", "get_empty_parameterset_mark"] + + +def param(*values, **kw): + """Specify a parameter in `pytest.mark.parametrize`_ calls or + :ref:`parametrized fixtures <fixture-parametrize-marks>`. + + .. code-block:: python + + @pytest.mark.parametrize("test_input,expected", [ + ("3+5", 8), + pytest.param("6*9", 42, marks=pytest.mark.xfail), + ]) + def test_eval(test_input, expected): + assert eval(test_input) == expected + + :param values: variable args of the values of the parameter set, in order. + :keyword marks: a single mark or a list of marks to be applied to this parameter set. + :keyword str id: the id to attribute to this parameter set. + """ + return ParameterSet.param(*values, **kw) + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group._addoption( + "-k", + action="store", + dest="keyword", + default="", + metavar="EXPRESSION", + help="only run tests which match the given substring expression. " + "An expression is a python evaluatable expression " + "where all names are substring-matched against test names " + "and their parent classes. Example: -k 'test_method or test_" + "other' matches all test functions and classes whose name " + "contains 'test_method' or 'test_other', while -k 'not test_method' " + "matches those that don't contain 'test_method' in their names. " + "-k 'not test_method and not test_other' will eliminate the matches. " + "Additionally keywords are matched to classes and functions " + "containing extra names in their 'extra_keyword_matches' set, " + "as well as functions which have names assigned directly to them.", + ) + + group._addoption( + "-m", + action="store", + dest="markexpr", + default="", + metavar="MARKEXPR", + help="only run tests matching given mark expression. " + "example: -m 'mark1 and not mark2'.", + ) + + group.addoption( + "--markers", + action="store_true", + help="show markers (builtin, plugin and per-project ones).", + ) + + parser.addini("markers", "markers for test functions", "linelist") + parser.addini(EMPTY_PARAMETERSET_OPTION, "default marker for empty parametersets") + + +def pytest_cmdline_main(config): + import _pytest.config + + if config.option.markers: + config._do_configure() + tw = _pytest.config.create_terminal_writer(config) + for line in config.getini("markers"): + parts = line.split(":", 1) + name = parts[0] + rest = parts[1] if len(parts) == 2 else "" + tw.write("@pytest.mark.%s:" % name, bold=True) + tw.line(rest) + tw.line() + config._ensure_unconfigure() + return 0 + + +pytest_cmdline_main.tryfirst = True + + +def deselect_by_keyword(items, config): + keywordexpr = config.option.keyword.lstrip() + if not keywordexpr: + return + + if keywordexpr.startswith("-"): + keywordexpr = "not " + keywordexpr[1:] + selectuntil = False + if keywordexpr[-1:] == ":": + selectuntil = True + keywordexpr = keywordexpr[:-1] + + remaining = [] + deselected = [] + for colitem in items: + if keywordexpr and not matchkeyword(colitem, keywordexpr): + deselected.append(colitem) + else: + if selectuntil: + keywordexpr = None + remaining.append(colitem) + + if deselected: + config.hook.pytest_deselected(items=deselected) + items[:] = remaining + + +def deselect_by_mark(items, config): + matchexpr = config.option.markexpr + if not matchexpr: + return + + remaining = [] + deselected = [] + for item in items: + if matchmark(item, matchexpr): + remaining.append(item) + else: + deselected.append(item) + + if deselected: + config.hook.pytest_deselected(items=deselected) + items[:] = remaining + + +def pytest_collection_modifyitems(items, config): + deselect_by_keyword(items, config) + deselect_by_mark(items, config) + + +def pytest_configure(config): + config._old_mark_config = MARK_GEN._config + MARK_GEN._config = config + + empty_parameterset = config.getini(EMPTY_PARAMETERSET_OPTION) + + if empty_parameterset not in ("skip", "xfail", "fail_at_collect", None, ""): + raise UsageError( + "{!s} must be one of skip, xfail or fail_at_collect" + " but it is {!r}".format(EMPTY_PARAMETERSET_OPTION, empty_parameterset) + ) + + +def pytest_unconfigure(config): + MARK_GEN._config = getattr(config, "_old_mark_config", None) diff --git a/contrib/python/pytest/py2/_pytest/mark/evaluate.py b/contrib/python/pytest/py2/_pytest/mark/evaluate.py new file mode 100644 index 00000000000..506546e253a --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/mark/evaluate.py @@ -0,0 +1,126 @@ +# -*- coding: utf-8 -*- +import os +import platform +import sys +import traceback + +import six + +from ..outcomes import fail +from ..outcomes import TEST_OUTCOME + + +def cached_eval(config, expr, d): + if not hasattr(config, "_evalcache"): + config._evalcache = {} + try: + return config._evalcache[expr] + except KeyError: + import _pytest._code + + exprcode = _pytest._code.compile(expr, mode="eval") + config._evalcache[expr] = x = eval(exprcode, d) + return x + + +class MarkEvaluator(object): + def __init__(self, item, name): + self.item = item + self._marks = None + self._mark = None + self._mark_name = name + + def __bool__(self): + # dont cache here to prevent staleness + return bool(self._get_marks()) + + __nonzero__ = __bool__ + + def wasvalid(self): + return not hasattr(self, "exc") + + def _get_marks(self): + return list(self.item.iter_markers(name=self._mark_name)) + + def invalidraise(self, exc): + raises = self.get("raises") + if not raises: + return + return not isinstance(exc, raises) + + def istrue(self): + try: + return self._istrue() + except TEST_OUTCOME: + self.exc = sys.exc_info() + if isinstance(self.exc[1], SyntaxError): + msg = [" " * (self.exc[1].offset + 4) + "^"] + msg.append("SyntaxError: invalid syntax") + else: + msg = traceback.format_exception_only(*self.exc[:2]) + fail( + "Error evaluating %r expression\n" + " %s\n" + "%s" % (self._mark_name, self.expr, "\n".join(msg)), + pytrace=False, + ) + + def _getglobals(self): + d = {"os": os, "sys": sys, "platform": platform, "config": self.item.config} + if hasattr(self.item, "obj"): + d.update(self.item.obj.__globals__) + return d + + def _istrue(self): + if hasattr(self, "result"): + return self.result + self._marks = self._get_marks() + + if self._marks: + self.result = False + for mark in self._marks: + self._mark = mark + if "condition" in mark.kwargs: + args = (mark.kwargs["condition"],) + else: + args = mark.args + + for expr in args: + self.expr = expr + if isinstance(expr, six.string_types): + d = self._getglobals() + result = cached_eval(self.item.config, expr, d) + else: + if "reason" not in mark.kwargs: + # XXX better be checked at collection time + msg = ( + "you need to specify reason=STRING " + "when using booleans as conditions." + ) + fail(msg) + result = bool(expr) + if result: + self.result = True + self.reason = mark.kwargs.get("reason", None) + self.expr = expr + return self.result + + if not args: + self.result = True + self.reason = mark.kwargs.get("reason", None) + return self.result + return False + + def get(self, attr, default=None): + if self._mark is None: + return default + return self._mark.kwargs.get(attr, default) + + def getexplanation(self): + expl = getattr(self, "reason", None) or self.get("reason", None) + if not expl: + if not hasattr(self, "expr"): + return "" + else: + return "condition: " + str(self.expr) + return expl diff --git a/contrib/python/pytest/py2/_pytest/mark/legacy.py b/contrib/python/pytest/py2/_pytest/mark/legacy.py new file mode 100644 index 00000000000..c56482f14d0 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/mark/legacy.py @@ -0,0 +1,103 @@ +# -*- coding: utf-8 -*- +""" +this is a place where we put datastructures used by legacy apis +we hope ot remove +""" +import keyword + +import attr + +from _pytest.config import UsageError + + +@attr.s +class MarkMapping(object): + """Provides a local mapping for markers where item access + resolves to True if the marker is present. """ + + own_mark_names = attr.ib() + + @classmethod + def from_item(cls, item): + mark_names = {mark.name for mark in item.iter_markers()} + return cls(mark_names) + + def __getitem__(self, name): + return name in self.own_mark_names + + +class KeywordMapping(object): + """Provides a local mapping for keywords. + Given a list of names, map any substring of one of these names to True. + """ + + def __init__(self, names): + self._names = names + + @classmethod + def from_item(cls, item): + mapped_names = set() + + # Add the names of the current item and any parent items + import pytest + + for item in item.listchain(): + if not isinstance(item, pytest.Instance): + mapped_names.add(item.name) + + # Add the names added as extra keywords to current or parent items + mapped_names.update(item.listextrakeywords()) + + # Add the names attached to the current function through direct assignment + if hasattr(item, "function"): + mapped_names.update(item.function.__dict__) + + # add the markers to the keywords as we no longer handle them correctly + mapped_names.update(mark.name for mark in item.iter_markers()) + + return cls(mapped_names) + + def __getitem__(self, subname): + for name in self._names: + if subname in name: + return True + return False + + +python_keywords_allowed_list = ["or", "and", "not"] + + +def matchmark(colitem, markexpr): + """Tries to match on any marker names, attached to the given colitem.""" + try: + return eval(markexpr, {}, MarkMapping.from_item(colitem)) + except SyntaxError as e: + raise SyntaxError(str(e) + "\nMarker expression must be valid Python!") + + +def matchkeyword(colitem, keywordexpr): + """Tries to match given keyword expression to given collector item. + + Will match on the name of colitem, including the names of its parents. + Only matches names of items which are either a :class:`Class` or a + :class:`Function`. + Additionally, matches on names in the 'extra_keyword_matches' set of + any item, as well as names directly assigned to test functions. + """ + mapping = KeywordMapping.from_item(colitem) + if " " not in keywordexpr: + # special case to allow for simple "-k pass" and "-k 1.3" + return mapping[keywordexpr] + elif keywordexpr.startswith("not ") and " " not in keywordexpr[4:]: + return not mapping[keywordexpr[4:]] + for kwd in keywordexpr.split(): + if keyword.iskeyword(kwd) and kwd not in python_keywords_allowed_list: + raise UsageError( + "Python keyword '{}' not accepted in expressions passed to '-k'".format( + kwd + ) + ) + try: + return eval(keywordexpr, {}, mapping) + except SyntaxError: + raise UsageError("Wrong expression passed to '-k': {}".format(keywordexpr)) diff --git a/contrib/python/pytest/py2/_pytest/mark/structures.py b/contrib/python/pytest/py2/_pytest/mark/structures.py new file mode 100644 index 00000000000..aaebe927be7 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/mark/structures.py @@ -0,0 +1,413 @@ +# -*- coding: utf-8 -*- +import inspect +import warnings +from collections import namedtuple +from operator import attrgetter + +import attr +import six + +from ..compat import ascii_escaped +from ..compat import ATTRS_EQ_FIELD +from ..compat import getfslineno +from ..compat import MappingMixin +from ..compat import NOTSET +from _pytest.deprecated import PYTEST_PARAM_UNKNOWN_KWARGS +from _pytest.outcomes import fail +from _pytest.warning_types import PytestUnknownMarkWarning + +EMPTY_PARAMETERSET_OPTION = "empty_parameter_set_mark" + + +def alias(name, warning=None): + getter = attrgetter(name) + + def warned(self): + warnings.warn(warning, stacklevel=2) + return getter(self) + + return property(getter if warning is None else warned, doc="alias for " + name) + + +def istestfunc(func): + return ( + hasattr(func, "__call__") + and getattr(func, "__name__", "<lambda>") != "<lambda>" + ) + + +def get_empty_parameterset_mark(config, argnames, func): + from ..nodes import Collector + + requested_mark = config.getini(EMPTY_PARAMETERSET_OPTION) + if requested_mark in ("", None, "skip"): + mark = MARK_GEN.skip + elif requested_mark == "xfail": + mark = MARK_GEN.xfail(run=False) + elif requested_mark == "fail_at_collect": + f_name = func.__name__ + _, lineno = getfslineno(func) + raise Collector.CollectError( + "Empty parameter set in '%s' at line %d" % (f_name, lineno + 1) + ) + else: + raise LookupError(requested_mark) + fs, lineno = getfslineno(func) + reason = "got empty parameter set %r, function %s at %s:%d" % ( + argnames, + func.__name__, + fs, + lineno, + ) + return mark(reason=reason) + + +class ParameterSet(namedtuple("ParameterSet", "values, marks, id")): + @classmethod + def param(cls, *values, **kwargs): + marks = kwargs.pop("marks", ()) + if isinstance(marks, MarkDecorator): + marks = (marks,) + else: + assert isinstance(marks, (tuple, list, set)) + + id_ = kwargs.pop("id", None) + if id_ is not None: + if not isinstance(id_, six.string_types): + raise TypeError( + "Expected id to be a string, got {}: {!r}".format(type(id_), id_) + ) + id_ = ascii_escaped(id_) + + if kwargs: + warnings.warn( + PYTEST_PARAM_UNKNOWN_KWARGS.format(args=sorted(kwargs)), stacklevel=3 + ) + return cls(values, marks, id_) + + @classmethod + def extract_from(cls, parameterset, force_tuple=False): + """ + :param parameterset: + a legacy style parameterset that may or may not be a tuple, + and may or may not be wrapped into a mess of mark objects + + :param force_tuple: + enforce tuple wrapping so single argument tuple values + don't get decomposed and break tests + """ + + if isinstance(parameterset, cls): + return parameterset + if force_tuple: + return cls.param(parameterset) + else: + return cls(parameterset, marks=[], id=None) + + @staticmethod + def _parse_parametrize_args(argnames, argvalues, *args, **kwargs): + if not isinstance(argnames, (tuple, list)): + argnames = [x.strip() for x in argnames.split(",") if x.strip()] + force_tuple = len(argnames) == 1 + else: + force_tuple = False + return argnames, force_tuple + + @staticmethod + def _parse_parametrize_parameters(argvalues, force_tuple): + return [ + ParameterSet.extract_from(x, force_tuple=force_tuple) for x in argvalues + ] + + @classmethod + def _for_parametrize(cls, argnames, argvalues, func, config, function_definition): + argnames, force_tuple = cls._parse_parametrize_args(argnames, argvalues) + parameters = cls._parse_parametrize_parameters(argvalues, force_tuple) + del argvalues + + if parameters: + # check all parameter sets have the correct number of values + for param in parameters: + if len(param.values) != len(argnames): + msg = ( + '{nodeid}: in "parametrize" the number of names ({names_len}):\n' + " {names}\n" + "must be equal to the number of values ({values_len}):\n" + " {values}" + ) + fail( + msg.format( + nodeid=function_definition.nodeid, + values=param.values, + names=argnames, + names_len=len(argnames), + values_len=len(param.values), + ), + pytrace=False, + ) + else: + # empty parameter set (likely computed at runtime): create a single + # parameter set with NOTSET values, with the "empty parameter set" mark applied to it + mark = get_empty_parameterset_mark(config, argnames, func) + parameters.append( + ParameterSet(values=(NOTSET,) * len(argnames), marks=[mark], id=None) + ) + return argnames, parameters + + +@attr.s(frozen=True) +class Mark(object): + #: name of the mark + name = attr.ib(type=str) + #: positional arguments of the mark decorator + args = attr.ib() # List[object] + #: keyword arguments of the mark decorator + kwargs = attr.ib() # Dict[str, object] + + def combined_with(self, other): + """ + :param other: the mark to combine with + :type other: Mark + :rtype: Mark + + combines by appending args and merging the mappings + """ + assert self.name == other.name + return Mark( + self.name, self.args + other.args, dict(self.kwargs, **other.kwargs) + ) + + +@attr.s +class MarkDecorator(object): + """ A decorator for test functions and test classes. When applied + it will create :class:`MarkInfo` objects which may be + :ref:`retrieved by hooks as item keywords <excontrolskip>`. + MarkDecorator instances are often created like this:: + + mark1 = pytest.mark.NAME # simple MarkDecorator + mark2 = pytest.mark.NAME(name1=value) # parametrized MarkDecorator + + and can then be applied as decorators to test functions:: + + @mark2 + def test_function(): + pass + + When a MarkDecorator instance is called it does the following: + 1. If called with a single class as its only positional argument and no + additional keyword arguments, it attaches itself to the class so it + gets applied automatically to all test cases found in that class. + 2. If called with a single function as its only positional argument and + no additional keyword arguments, it attaches a MarkInfo object to the + function, containing all the arguments already stored internally in + the MarkDecorator. + 3. When called in any other case, it performs a 'fake construction' call, + i.e. it returns a new MarkDecorator instance with the original + MarkDecorator's content updated with the arguments passed to this + call. + + Note: The rules above prevent MarkDecorator objects from storing only a + single function or class reference as their positional argument with no + additional keyword or positional arguments. + + """ + + mark = attr.ib(validator=attr.validators.instance_of(Mark)) + + name = alias("mark.name") + args = alias("mark.args") + kwargs = alias("mark.kwargs") + + @property + def markname(self): + return self.name # for backward-compat (2.4.1 had this attr) + + def __eq__(self, other): + return self.mark == other.mark if isinstance(other, MarkDecorator) else False + + def __repr__(self): + return "<MarkDecorator %r>" % (self.mark,) + + def with_args(self, *args, **kwargs): + """ return a MarkDecorator with extra arguments added + + unlike call this can be used even if the sole argument is a callable/class + + :return: MarkDecorator + """ + + mark = Mark(self.name, args, kwargs) + return self.__class__(self.mark.combined_with(mark)) + + def __call__(self, *args, **kwargs): + """ if passed a single callable argument: decorate it with mark info. + otherwise add *args/**kwargs in-place to mark information. """ + if args and not kwargs: + func = args[0] + is_class = inspect.isclass(func) + if len(args) == 1 and (istestfunc(func) or is_class): + store_mark(func, self.mark) + return func + return self.with_args(*args, **kwargs) + + +def get_unpacked_marks(obj): + """ + obtain the unpacked marks that are stored on an object + """ + mark_list = getattr(obj, "pytestmark", []) + if not isinstance(mark_list, list): + mark_list = [mark_list] + return normalize_mark_list(mark_list) + + +def normalize_mark_list(mark_list): + """ + normalizes marker decorating helpers to mark objects + + :type mark_list: List[Union[Mark, Markdecorator]] + :rtype: List[Mark] + """ + extracted = [ + getattr(mark, "mark", mark) for mark in mark_list + ] # unpack MarkDecorator + for mark in extracted: + if not isinstance(mark, Mark): + raise TypeError("got {!r} instead of Mark".format(mark)) + return [x for x in extracted if isinstance(x, Mark)] + + +def store_mark(obj, mark): + """store a Mark on an object + this is used to implement the Mark declarations/decorators correctly + """ + assert isinstance(mark, Mark), mark + # always reassign name to avoid updating pytestmark + # in a reference that was only borrowed + obj.pytestmark = get_unpacked_marks(obj) + [mark] + + +class MarkGenerator(object): + """ Factory for :class:`MarkDecorator` objects - exposed as + a ``pytest.mark`` singleton instance. Example:: + + import pytest + @pytest.mark.slowtest + def test_function(): + pass + + will set a 'slowtest' :class:`MarkInfo` object + on the ``test_function`` object. """ + + _config = None + _markers = set() + + def __getattr__(self, name): + if name[0] == "_": + raise AttributeError("Marker name must NOT start with underscore") + + if self._config is not None: + # We store a set of markers as a performance optimisation - if a mark + # name is in the set we definitely know it, but a mark may be known and + # not in the set. We therefore start by updating the set! + if name not in self._markers: + for line in self._config.getini("markers"): + # example lines: "skipif(condition): skip the given test if..." + # or "hypothesis: tests which use Hypothesis", so to get the + # marker name we split on both `:` and `(`. + if line == "ya:external": + marker = line + else: + marker = line.split(":")[0].split("(")[0].strip() + self._markers.add(marker) + + # If the name is not in the set of known marks after updating, + # then it really is time to issue a warning or an error. + if name not in self._markers: + if self._config.option.strict_markers: + fail( + "{!r} not found in `markers` configuration option".format(name), + pytrace=False, + ) + else: + warnings.warn( + "Unknown pytest.mark.%s - is this a typo? You can register " + "custom marks to avoid this warning - for details, see " + "https://docs.pytest.org/en/latest/mark.html" % name, + PytestUnknownMarkWarning, + ) + + return MarkDecorator(Mark(name, (), {})) + + +MARK_GEN = MarkGenerator() + + +class NodeKeywords(MappingMixin): + def __init__(self, node): + self.node = node + self.parent = node.parent + self._markers = {node.name: True} + + def __getitem__(self, key): + try: + return self._markers[key] + except KeyError: + if self.parent is None: + raise + return self.parent.keywords[key] + + def __setitem__(self, key, value): + self._markers[key] = value + + def __delitem__(self, key): + raise ValueError("cannot delete key in keywords dict") + + def __iter__(self): + seen = self._seen() + return iter(seen) + + def _seen(self): + seen = set(self._markers) + if self.parent is not None: + seen.update(self.parent.keywords) + return seen + + def __len__(self): + return len(self._seen()) + + def __repr__(self): + return "<NodeKeywords for node %s>" % (self.node,) + + +# mypy cannot find this overload, remove when on attrs>=19.2 +@attr.s(hash=False, **{ATTRS_EQ_FIELD: False}) # type: ignore +class NodeMarkers(object): + """ + internal structure for storing marks belonging to a node + + ..warning:: + + unstable api + + """ + + own_markers = attr.ib(default=attr.Factory(list)) + + def update(self, add_markers): + """update the own markers + """ + self.own_markers.extend(add_markers) + + def find(self, name): + """ + find markers in own nodes or parent nodes + needs a better place + """ + for mark in self.own_markers: + if mark.name == name: + yield mark + + def __iter__(self): + return iter(self.own_markers) diff --git a/contrib/python/pytest/py2/_pytest/monkeypatch.py b/contrib/python/pytest/py2/_pytest/monkeypatch.py new file mode 100644 index 00000000000..e8671b0c702 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/monkeypatch.py @@ -0,0 +1,336 @@ +# -*- coding: utf-8 -*- +""" monkeypatching and mocking functionality. """ +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import os +import re +import sys +import warnings +from contextlib import contextmanager + +import six + +import pytest +from _pytest.fixtures import fixture +from _pytest.pathlib import Path + +RE_IMPORT_ERROR_NAME = re.compile(r"^No module named (.*)$") + + +@fixture +def monkeypatch(): + """The returned ``monkeypatch`` fixture provides these + helper methods to modify objects, dictionaries or os.environ:: + + monkeypatch.setattr(obj, name, value, raising=True) + monkeypatch.delattr(obj, name, raising=True) + monkeypatch.setitem(mapping, name, value) + monkeypatch.delitem(obj, name, raising=True) + monkeypatch.setenv(name, value, prepend=False) + monkeypatch.delenv(name, raising=True) + monkeypatch.syspath_prepend(path) + monkeypatch.chdir(path) + + All modifications will be undone after the requesting + test function or fixture has finished. The ``raising`` + parameter determines if a KeyError or AttributeError + will be raised if the set/deletion operation has no target. + """ + mpatch = MonkeyPatch() + yield mpatch + mpatch.undo() + + +def resolve(name): + # simplified from zope.dottedname + parts = name.split(".") + + used = parts.pop(0) + found = __import__(used) + for part in parts: + used += "." + part + try: + found = getattr(found, part) + except AttributeError: + pass + else: + continue + # we use explicit un-nesting of the handling block in order + # to avoid nested exceptions on python 3 + try: + __import__(used) + except ImportError as ex: + # str is used for py2 vs py3 + expected = str(ex).split()[-1] + if expected == used: + raise + else: + raise ImportError("import error in %s: %s" % (used, ex)) + found = annotated_getattr(found, part, used) + return found + + +def annotated_getattr(obj, name, ann): + try: + obj = getattr(obj, name) + except AttributeError: + raise AttributeError( + "%r object at %s has no attribute %r" % (type(obj).__name__, ann, name) + ) + return obj + + +def derive_importpath(import_path, raising): + if not isinstance(import_path, six.string_types) or "." not in import_path: + raise TypeError("must be absolute import path string, not %r" % (import_path,)) + module, attr = import_path.rsplit(".", 1) + target = resolve(module) + if raising: + annotated_getattr(target, attr, ann=module) + return attr, target + + +class Notset(object): + def __repr__(self): + return "<notset>" + + +notset = Notset() + + +class MonkeyPatch(object): + """ Object returned by the ``monkeypatch`` fixture keeping a record of setattr/item/env/syspath changes. + """ + + def __init__(self): + self._setattr = [] + self._setitem = [] + self._cwd = None + self._savesyspath = None + + @contextmanager + def context(self): + """ + Context manager that returns a new :class:`MonkeyPatch` object which + undoes any patching done inside the ``with`` block upon exit: + + .. code-block:: python + + import functools + def test_partial(monkeypatch): + with monkeypatch.context() as m: + m.setattr(functools, "partial", 3) + + Useful in situations where it is desired to undo some patches before the test ends, + such as mocking ``stdlib`` functions that might break pytest itself if mocked (for examples + of this see `#3290 <https://github.com/pytest-dev/pytest/issues/3290>`_. + """ + m = MonkeyPatch() + try: + yield m + finally: + m.undo() + + def setattr(self, target, name, value=notset, raising=True): + """ Set attribute value on target, memorizing the old value. + By default raise AttributeError if the attribute did not exist. + + For convenience you can specify a string as ``target`` which + will be interpreted as a dotted import path, with the last part + being the attribute name. Example: + ``monkeypatch.setattr("os.getcwd", lambda: "/")`` + would set the ``getcwd`` function of the ``os`` module. + + The ``raising`` value determines if the setattr should fail + if the attribute is not already present (defaults to True + which means it will raise). + """ + __tracebackhide__ = True + import inspect + + if value is notset: + if not isinstance(target, six.string_types): + raise TypeError( + "use setattr(target, name, value) or " + "setattr(target, value) with target being a dotted " + "import string" + ) + value = name + name, target = derive_importpath(target, raising) + + oldval = getattr(target, name, notset) + if raising and oldval is notset: + raise AttributeError("%r has no attribute %r" % (target, name)) + + # avoid class descriptors like staticmethod/classmethod + if inspect.isclass(target): + oldval = target.__dict__.get(name, notset) + self._setattr.append((target, name, oldval)) + setattr(target, name, value) + + def delattr(self, target, name=notset, raising=True): + """ Delete attribute ``name`` from ``target``, by default raise + AttributeError it the attribute did not previously exist. + + If no ``name`` is specified and ``target`` is a string + it will be interpreted as a dotted import path with the + last part being the attribute name. + + If ``raising`` is set to False, no exception will be raised if the + attribute is missing. + """ + __tracebackhide__ = True + import inspect + + if name is notset: + if not isinstance(target, six.string_types): + raise TypeError( + "use delattr(target, name) or " + "delattr(target) with target being a dotted " + "import string" + ) + name, target = derive_importpath(target, raising) + + if not hasattr(target, name): + if raising: + raise AttributeError(name) + else: + oldval = getattr(target, name, notset) + # Avoid class descriptors like staticmethod/classmethod. + if inspect.isclass(target): + oldval = target.__dict__.get(name, notset) + self._setattr.append((target, name, oldval)) + delattr(target, name) + + def setitem(self, dic, name, value): + """ Set dictionary entry ``name`` to value. """ + self._setitem.append((dic, name, dic.get(name, notset))) + dic[name] = value + + def delitem(self, dic, name, raising=True): + """ Delete ``name`` from dict. Raise KeyError if it doesn't exist. + + If ``raising`` is set to False, no exception will be raised if the + key is missing. + """ + if name not in dic: + if raising: + raise KeyError(name) + else: + self._setitem.append((dic, name, dic.get(name, notset))) + del dic[name] + + def _warn_if_env_name_is_not_str(self, name): + """On Python 2, warn if the given environment variable name is not a native str (#4056)""" + if six.PY2 and not isinstance(name, str): + warnings.warn( + pytest.PytestWarning( + "Environment variable name {!r} should be str".format(name) + ) + ) + + def setenv(self, name, value, prepend=None): + """ Set environment variable ``name`` to ``value``. If ``prepend`` + is a character, read the current environment variable value + and prepend the ``value`` adjoined with the ``prepend`` character.""" + if not isinstance(value, str): + warnings.warn( + pytest.PytestWarning( + "Value of environment variable {name} type should be str, but got " + "{value!r} (type: {type}); converted to str implicitly".format( + name=name, value=value, type=type(value).__name__ + ) + ), + stacklevel=2, + ) + value = str(value) + if prepend and name in os.environ: + value = value + prepend + os.environ[name] + self._warn_if_env_name_is_not_str(name) + self.setitem(os.environ, name, value) + + def delenv(self, name, raising=True): + """ Delete ``name`` from the environment. Raise KeyError if it does + not exist. + + If ``raising`` is set to False, no exception will be raised if the + environment variable is missing. + """ + self._warn_if_env_name_is_not_str(name) + self.delitem(os.environ, name, raising=raising) + + def syspath_prepend(self, path): + """ Prepend ``path`` to ``sys.path`` list of import locations. """ + from pkg_resources import fixup_namespace_packages + + if self._savesyspath is None: + self._savesyspath = sys.path[:] + sys.path.insert(0, str(path)) + + # https://github.com/pypa/setuptools/blob/d8b901bc/docs/pkg_resources.txt#L162-L171 + fixup_namespace_packages(str(path)) + + # A call to syspathinsert() usually means that the caller wants to + # import some dynamically created files, thus with python3 we + # invalidate its import caches. + # This is especially important when any namespace package is in used, + # since then the mtime based FileFinder cache (that gets created in + # this case already) gets not invalidated when writing the new files + # quickly afterwards. + if sys.version_info >= (3, 3): + from importlib import invalidate_caches + + invalidate_caches() + + def chdir(self, path): + """ Change the current working directory to the specified path. + Path can be a string or a py.path.local object. + """ + if self._cwd is None: + self._cwd = os.getcwd() + if hasattr(path, "chdir"): + path.chdir() + elif isinstance(path, Path): + # modern python uses the fspath protocol here LEGACY + os.chdir(str(path)) + else: + os.chdir(path) + + def undo(self): + """ Undo previous changes. This call consumes the + undo stack. Calling it a second time has no effect unless + you do more monkeypatching after the undo call. + + There is generally no need to call `undo()`, since it is + called automatically during tear-down. + + Note that the same `monkeypatch` fixture is used across a + single test function invocation. If `monkeypatch` is used both by + the test function itself and one of the test fixtures, + calling `undo()` will undo all of the changes made in + both functions. + """ + for obj, name, value in reversed(self._setattr): + if value is not notset: + setattr(obj, name, value) + else: + delattr(obj, name) + self._setattr[:] = [] + for dictionary, name, value in reversed(self._setitem): + if value is notset: + try: + del dictionary[name] + except KeyError: + pass # was already deleted, so we have the desired state + else: + dictionary[name] = value + self._setitem[:] = [] + if self._savesyspath is not None: + sys.path[:] = self._savesyspath + self._savesyspath = None + + if self._cwd is not None: + os.chdir(self._cwd) + self._cwd = None diff --git a/contrib/python/pytest/py2/_pytest/nodes.py b/contrib/python/pytest/py2/_pytest/nodes.py new file mode 100644 index 00000000000..206e9ae163e --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/nodes.py @@ -0,0 +1,429 @@ +# -*- coding: utf-8 -*- +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import os +import warnings + +import py +import six + +import _pytest._code +from _pytest.compat import getfslineno +from _pytest.mark.structures import NodeKeywords +from _pytest.outcomes import fail + +SEP = "/" + +tracebackcutdir = py.path.local(_pytest.__file__).dirpath() + + +def _splitnode(nodeid): + """Split a nodeid into constituent 'parts'. + + Node IDs are strings, and can be things like: + '' + 'testing/code' + 'testing/code/test_excinfo.py' + 'testing/code/test_excinfo.py::TestFormattedExcinfo' + + Return values are lists e.g. + [] + ['testing', 'code'] + ['testing', 'code', 'test_excinfo.py'] + ['testing', 'code', 'test_excinfo.py', 'TestFormattedExcinfo', '()'] + """ + if nodeid == "": + # If there is no root node at all, return an empty list so the caller's logic can remain sane + return [] + parts = nodeid.split(SEP) + # Replace single last element 'test_foo.py::Bar' with multiple elements 'test_foo.py', 'Bar' + parts[-1:] = parts[-1].split("::") + return parts + + +def ischildnode(baseid, nodeid): + """Return True if the nodeid is a child node of the baseid. + + E.g. 'foo/bar::Baz' is a child of 'foo', 'foo/bar' and 'foo/bar::Baz', but not of 'foo/blorp' + """ + base_parts = _splitnode(baseid) + node_parts = _splitnode(nodeid) + if len(node_parts) < len(base_parts): + return False + return node_parts[: len(base_parts)] == base_parts + + +class Node(object): + """ base class for Collector and Item the test collection tree. + Collector subclasses have children, Items are terminal nodes.""" + + def __init__( + self, name, parent=None, config=None, session=None, fspath=None, nodeid=None + ): + #: a unique name within the scope of the parent node + self.name = name + + #: the parent collector node. + self.parent = parent + + #: the pytest config object + self.config = config or parent.config + + #: the session this node is part of + self.session = session or parent.session + + #: filesystem path where this node was collected from (can be None) + self.fspath = fspath or getattr(parent, "fspath", None) + + #: keywords/markers collected from all scopes + self.keywords = NodeKeywords(self) + + #: the marker objects belonging to this node + self.own_markers = [] + + #: allow adding of extra keywords to use for matching + self.extra_keyword_matches = set() + + # used for storing artificial fixturedefs for direct parametrization + self._name2pseudofixturedef = {} + + if nodeid is not None: + assert "::()" not in nodeid + self._nodeid = nodeid + else: + self._nodeid = self.parent.nodeid + if self.name != "()": + self._nodeid += "::" + self.name + + @property + def ihook(self): + """ fspath sensitive hook proxy used to call pytest hooks""" + return self.session.gethookproxy(self.fspath) + + def __repr__(self): + return "<%s %s>" % (self.__class__.__name__, getattr(self, "name", None)) + + def warn(self, warning): + """Issue a warning for this item. + + Warnings will be displayed after the test session, unless explicitly suppressed + + :param Warning warning: the warning instance to issue. Must be a subclass of PytestWarning. + + :raise ValueError: if ``warning`` instance is not a subclass of PytestWarning. + + Example usage: + + .. code-block:: python + + node.warn(PytestWarning("some message")) + + """ + from _pytest.warning_types import PytestWarning + + if not isinstance(warning, PytestWarning): + raise ValueError( + "warning must be an instance of PytestWarning or subclass, got {!r}".format( + warning + ) + ) + path, lineno = get_fslocation_from_item(self) + warnings.warn_explicit( + warning, + category=None, + filename=str(path), + lineno=lineno + 1 if lineno is not None else None, + ) + + # methods for ordering nodes + @property + def nodeid(self): + """ a ::-separated string denoting its collection tree address. """ + return self._nodeid + + def __hash__(self): + return hash(self.nodeid) + + def setup(self): + pass + + def teardown(self): + pass + + def listchain(self): + """ return list of all parent collectors up to self, + starting from root of collection tree. """ + chain = [] + item = self + while item is not None: + chain.append(item) + item = item.parent + chain.reverse() + return chain + + def add_marker(self, marker, append=True): + """dynamically add a marker object to the node. + + :type marker: ``str`` or ``pytest.mark.*`` object + :param marker: + ``append=True`` whether to append the marker, + if ``False`` insert at position ``0``. + """ + from _pytest.mark import MarkDecorator, MARK_GEN + + if isinstance(marker, six.string_types): + marker = getattr(MARK_GEN, marker) + elif not isinstance(marker, MarkDecorator): + raise ValueError("is not a string or pytest.mark.* Marker") + self.keywords[marker.name] = marker + if append: + self.own_markers.append(marker.mark) + else: + self.own_markers.insert(0, marker.mark) + + def iter_markers(self, name=None): + """ + :param name: if given, filter the results by the name attribute + + iterate over all markers of the node + """ + return (x[1] for x in self.iter_markers_with_node(name=name)) + + def iter_markers_with_node(self, name=None): + """ + :param name: if given, filter the results by the name attribute + + iterate over all markers of the node + returns sequence of tuples (node, mark) + """ + for node in reversed(self.listchain()): + for mark in node.own_markers: + if name is None or getattr(mark, "name", None) == name: + yield node, mark + + def get_closest_marker(self, name, default=None): + """return the first marker matching the name, from closest (for example function) to farther level (for example + module level). + + :param default: fallback return value of no marker was found + :param name: name to filter by + """ + return next(self.iter_markers(name=name), default) + + def listextrakeywords(self): + """ Return a set of all extra keywords in self and any parents.""" + extra_keywords = set() + for item in self.listchain(): + extra_keywords.update(item.extra_keyword_matches) + return extra_keywords + + def listnames(self): + return [x.name for x in self.listchain()] + + def addfinalizer(self, fin): + """ register a function to be called when this node is finalized. + + This method can only be called when this node is active + in a setup chain, for example during self.setup(). + """ + self.session._setupstate.addfinalizer(fin, self) + + def getparent(self, cls): + """ get the next parent node (including ourself) + which is an instance of the given class""" + current = self + while current and not isinstance(current, cls): + current = current.parent + return current + + def _prunetraceback(self, excinfo): + pass + + def _repr_failure_py(self, excinfo, style=None): + if excinfo.errisinstance(fail.Exception): + if not excinfo.value.pytrace: + return six.text_type(excinfo.value) + fm = self.session._fixturemanager + if excinfo.errisinstance(fm.FixtureLookupError): + return excinfo.value.formatrepr() + tbfilter = True + if self.config.getoption("fulltrace", False): + style = "long" + else: + tb = _pytest._code.Traceback([excinfo.traceback[-1]]) + self._prunetraceback(excinfo) + if len(excinfo.traceback) == 0: + excinfo.traceback = tb + tbfilter = False # prunetraceback already does it + if style == "auto": + style = "long" + # XXX should excinfo.getrepr record all data and toterminal() process it? + if style is None: + if self.config.getoption("tbstyle", "auto") == "short": + style = "short" + else: + style = "long" + + if self.config.getoption("verbose", 0) > 1: + truncate_locals = False + else: + truncate_locals = True + + try: + os.getcwd() + abspath = False + except OSError: + abspath = True + + return excinfo.getrepr( + funcargs=True, + abspath=abspath, + showlocals=self.config.getoption("showlocals", False), + style=style, + tbfilter=tbfilter, + truncate_locals=truncate_locals, + ) + + repr_failure = _repr_failure_py + + +def get_fslocation_from_item(item): + """Tries to extract the actual location from an item, depending on available attributes: + + * "fslocation": a pair (path, lineno) + * "obj": a Python object that the item wraps. + * "fspath": just a path + + :rtype: a tuple of (str|LocalPath, int) with filename and line number. + """ + result = getattr(item, "location", None) + if result is not None: + return result[:2] + obj = getattr(item, "obj", None) + if obj is not None: + return getfslineno(obj) + return getattr(item, "fspath", "unknown location"), -1 + + +class Collector(Node): + """ Collector instances create children through collect() + and thus iteratively build a tree. + """ + + class CollectError(Exception): + """ an error during collection, contains a custom message. """ + + def collect(self): + """ returns a list of children (items and collectors) + for this collection node. + """ + raise NotImplementedError("abstract") + + def repr_failure(self, excinfo): + """ represent a collection failure. """ + if excinfo.errisinstance(self.CollectError): + exc = excinfo.value + return str(exc.args[0]) + + # Respect explicit tbstyle option, but default to "short" + # (None._repr_failure_py defaults to "long" without "fulltrace" option). + tbstyle = self.config.getoption("tbstyle", "auto") + if tbstyle == "auto": + tbstyle = "short" + + return self._repr_failure_py(excinfo, style=tbstyle) + + def _prunetraceback(self, excinfo): + if hasattr(self, "fspath"): + traceback = excinfo.traceback + ntraceback = traceback.cut(path=self.fspath) + if ntraceback == traceback: + ntraceback = ntraceback.cut(excludepath=tracebackcutdir) + excinfo.traceback = ntraceback.filter() + + +def _check_initialpaths_for_relpath(session, fspath): + for initial_path in session._initialpaths: + if fspath.common(initial_path) == initial_path: + return fspath.relto(initial_path) + + +class FSCollector(Collector): + def __init__(self, fspath, parent=None, config=None, session=None, nodeid=None): + fspath = py.path.local(fspath) # xxx only for test_resultlog.py? + name = fspath.basename + if parent is not None: + rel = fspath.relto(parent.fspath) + if rel: + name = rel + name = name.replace(os.sep, SEP) + self.fspath = fspath + + session = session or parent.session + + if nodeid is None: + nodeid = self.fspath.relto(session.config.rootdir) + + if not nodeid: + nodeid = _check_initialpaths_for_relpath(session, fspath) + if nodeid and os.sep != SEP: + nodeid = nodeid.replace(os.sep, SEP) + + super(FSCollector, self).__init__( + name, parent, config, session, nodeid=nodeid, fspath=fspath + ) + + +class File(FSCollector): + """ base class for collecting tests from a file. """ + + +class Item(Node): + """ a basic test invocation item. Note that for a single function + there might be multiple test invocation items. + """ + + nextitem = None + + def __init__(self, name, parent=None, config=None, session=None, nodeid=None): + super(Item, self).__init__(name, parent, config, session, nodeid=nodeid) + self._report_sections = [] + + #: user properties is a list of tuples (name, value) that holds user + #: defined properties for this test. + self.user_properties = [] + + def add_report_section(self, when, key, content): + """ + Adds a new report section, similar to what's done internally to add stdout and + stderr captured output:: + + item.add_report_section("call", "stdout", "report section contents") + + :param str when: + One of the possible capture states, ``"setup"``, ``"call"``, ``"teardown"``. + :param str key: + Name of the section, can be customized at will. Pytest uses ``"stdout"`` and + ``"stderr"`` internally. + + :param str content: + The full contents as a string. + """ + if content: + self._report_sections.append((when, key, content)) + + def reportinfo(self): + return self.fspath, None, "" + + @property + def location(self): + try: + return self._location + except AttributeError: + location = self.reportinfo() + fspath = self.session._node_location_to_relpath(location[0]) + location = (fspath, location[1], str(location[2])) + self._location = location + return location diff --git a/contrib/python/pytest/py2/_pytest/nose.py b/contrib/python/pytest/py2/_pytest/nose.py new file mode 100644 index 00000000000..fbab91da249 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/nose.py @@ -0,0 +1,70 @@ +# -*- coding: utf-8 -*- +""" run test suites written for nose. """ +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import sys + +import six + +import pytest +from _pytest import python +from _pytest import runner +from _pytest import unittest +from _pytest.config import hookimpl + + +def get_skip_exceptions(): + skip_classes = set() + for module_name in ("unittest", "unittest2", "nose"): + mod = sys.modules.get(module_name) + if hasattr(mod, "SkipTest"): + skip_classes.add(mod.SkipTest) + return tuple(skip_classes) + + +def pytest_runtest_makereport(item, call): + if call.excinfo and call.excinfo.errisinstance(get_skip_exceptions()): + # let's substitute the excinfo with a pytest.skip one + call2 = runner.CallInfo.from_call( + lambda: pytest.skip(six.text_type(call.excinfo.value)), call.when + ) + call.excinfo = call2.excinfo + + +@hookimpl(trylast=True) +def pytest_runtest_setup(item): + if is_potential_nosetest(item): + if not call_optional(item.obj, "setup"): + # call module level setup if there is no object level one + call_optional(item.parent.obj, "setup") + # XXX this implies we only call teardown when setup worked + item.session._setupstate.addfinalizer((lambda: teardown_nose(item)), item) + + +def teardown_nose(item): + if is_potential_nosetest(item): + if not call_optional(item.obj, "teardown"): + call_optional(item.parent.obj, "teardown") + # if hasattr(item.parent, '_nosegensetup'): + # #call_optional(item._nosegensetup, 'teardown') + # del item.parent._nosegensetup + + +def is_potential_nosetest(item): + # extra check needed since we do not do nose style setup/teardown + # on direct unittest style classes + return isinstance(item, python.Function) and not isinstance( + item, unittest.TestCaseFunction + ) + + +def call_optional(obj, name): + method = getattr(obj, name, None) + isfixture = hasattr(method, "_pytestfixturefunction") + if method is not None and not isfixture and callable(method): + # If there's any problems allow the exception to raise rather than + # silently ignoring them + method() + return True diff --git a/contrib/python/pytest/py2/_pytest/outcomes.py b/contrib/python/pytest/py2/_pytest/outcomes.py new file mode 100644 index 00000000000..4620f957c7d --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/outcomes.py @@ -0,0 +1,187 @@ +# -*- coding: utf-8 -*- +""" +exception classes and constants handling test outcomes +as well as functions creating them +""" +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import sys + +from packaging.version import Version + + +class OutcomeException(BaseException): + """ OutcomeException and its subclass instances indicate and + contain info about test and collection outcomes. + """ + + def __init__(self, msg=None, pytrace=True): + BaseException.__init__(self, msg) + self.msg = msg + self.pytrace = pytrace + + def __repr__(self): + if self.msg: + val = self.msg + if isinstance(val, bytes): + val = val.decode("UTF-8", errors="replace") + return val + return "<%s instance>" % (self.__class__.__name__,) + + __str__ = __repr__ + + +TEST_OUTCOME = (OutcomeException, Exception) + + +class Skipped(OutcomeException): + # XXX hackish: on 3k we fake to live in the builtins + # in order to have Skipped exception printing shorter/nicer + __module__ = "builtins" + + def __init__(self, msg=None, pytrace=True, allow_module_level=False): + OutcomeException.__init__(self, msg=msg, pytrace=pytrace) + self.allow_module_level = allow_module_level + + +class Failed(OutcomeException): + """ raised from an explicit call to pytest.fail() """ + + __module__ = "builtins" + + +class Exit(Exception): + """ raised for immediate program exits (no tracebacks/summaries)""" + + def __init__(self, msg="unknown reason", returncode=None): + self.msg = msg + self.returncode = returncode + super(Exit, self).__init__(msg) + + +# exposed helper methods + + +def exit(msg, returncode=None): + """ + Exit testing process. + + :param str msg: message to display upon exit. + :param int returncode: return code to be used when exiting pytest. + """ + __tracebackhide__ = True + raise Exit(msg, returncode) + + +exit.Exception = Exit + + +def skip(msg="", **kwargs): + """ + Skip an executing test with the given message. + + This function should be called only during testing (setup, call or teardown) or + during collection by using the ``allow_module_level`` flag. This function can + be called in doctests as well. + + :kwarg bool allow_module_level: allows this function to be called at + module level, skipping the rest of the module. Default to False. + + .. note:: + It is better to use the :ref:`pytest.mark.skipif ref` marker when possible to declare a test to be + skipped under certain conditions like mismatching platforms or + dependencies. + Similarly, use the ``# doctest: +SKIP`` directive (see `doctest.SKIP + <https://docs.python.org/3/library/doctest.html#doctest.SKIP>`_) + to skip a doctest statically. + """ + __tracebackhide__ = True + allow_module_level = kwargs.pop("allow_module_level", False) + if kwargs: + raise TypeError("unexpected keyword arguments: {}".format(sorted(kwargs))) + raise Skipped(msg=msg, allow_module_level=allow_module_level) + + +skip.Exception = Skipped + + +def fail(msg="", pytrace=True): + """ + Explicitly fail an executing test with the given message. + + :param str msg: the message to show the user as reason for the failure. + :param bool pytrace: if false the msg represents the full failure information and no + python traceback will be reported. + """ + __tracebackhide__ = True + raise Failed(msg=msg, pytrace=pytrace) + + +fail.Exception = Failed + + +class XFailed(fail.Exception): + """ raised from an explicit call to pytest.xfail() """ + + +def xfail(reason=""): + """ + Imperatively xfail an executing test or setup functions with the given reason. + + This function should be called only during testing (setup, call or teardown). + + .. note:: + It is better to use the :ref:`pytest.mark.xfail ref` marker when possible to declare a test to be + xfailed under certain conditions like known bugs or missing features. + """ + __tracebackhide__ = True + raise XFailed(reason) + + +xfail.Exception = XFailed + + +def importorskip(modname, minversion=None, reason=None): + """Imports and returns the requested module ``modname``, or skip the current test + if the module cannot be imported. + + :param str modname: the name of the module to import + :param str minversion: if given, the imported module ``__version__`` attribute must be + at least this minimal version, otherwise the test is still skipped. + :param str reason: if given, this reason is shown as the message when the module + cannot be imported. + """ + import warnings + + __tracebackhide__ = True + compile(modname, "", "eval") # to catch syntaxerrors + import_exc = None + + with warnings.catch_warnings(): + # make sure to ignore ImportWarnings that might happen because + # of existing directories with the same name we're trying to + # import but without a __init__.py file + warnings.simplefilter("ignore") + try: + __import__(modname) + except ImportError as exc: + # Do not raise chained exception here(#1485) + import_exc = exc + if import_exc: + if reason is None: + reason = "could not import %r: %s" % (modname, import_exc) + raise Skipped(reason, allow_module_level=True) + mod = sys.modules[modname] + if minversion is None: + return mod + verattr = getattr(mod, "__version__", None) + if minversion is not None: + if verattr is None or Version(verattr) < Version(minversion): + raise Skipped( + "module %r has __version__ %r, required is: %r" + % (modname, verattr, minversion), + allow_module_level=True, + ) + return mod diff --git a/contrib/python/pytest/py2/_pytest/pastebin.py b/contrib/python/pytest/py2/_pytest/pastebin.py new file mode 100644 index 00000000000..7a3e80231c2 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/pastebin.py @@ -0,0 +1,110 @@ +# -*- coding: utf-8 -*- +""" submit failure or test session information to a pastebin service. """ +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import sys +import tempfile + +import six + +import pytest + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting") + group._addoption( + "--pastebin", + metavar="mode", + action="store", + dest="pastebin", + default=None, + choices=["failed", "all"], + help="send failed|all info to bpaste.net pastebin service.", + ) + + +@pytest.hookimpl(trylast=True) +def pytest_configure(config): + if config.option.pastebin == "all": + tr = config.pluginmanager.getplugin("terminalreporter") + # if no terminal reporter plugin is present, nothing we can do here; + # this can happen when this function executes in a slave node + # when using pytest-xdist, for example + if tr is not None: + # pastebin file will be utf-8 encoded binary file + config._pastebinfile = tempfile.TemporaryFile("w+b") + oldwrite = tr._tw.write + + def tee_write(s, **kwargs): + oldwrite(s, **kwargs) + if isinstance(s, six.text_type): + s = s.encode("utf-8") + config._pastebinfile.write(s) + + tr._tw.write = tee_write + + +def pytest_unconfigure(config): + if hasattr(config, "_pastebinfile"): + # get terminal contents and delete file + config._pastebinfile.seek(0) + sessionlog = config._pastebinfile.read() + config._pastebinfile.close() + del config._pastebinfile + # undo our patching in the terminal reporter + tr = config.pluginmanager.getplugin("terminalreporter") + del tr._tw.__dict__["write"] + # write summary + tr.write_sep("=", "Sending information to Paste Service") + pastebinurl = create_new_paste(sessionlog) + tr.write_line("pastebin session-log: %s\n" % pastebinurl) + + +def create_new_paste(contents): + """ + Creates a new paste using bpaste.net service. + + :contents: paste contents as utf-8 encoded bytes + :returns: url to the pasted contents + """ + import re + + if sys.version_info < (3, 0): + from urllib import urlopen, urlencode + else: + from urllib.request import urlopen + from urllib.parse import urlencode + + params = {"code": contents, "lexer": "text", "expiry": "1week"} + url = "https://bpaste.net" + response = urlopen(url, data=urlencode(params).encode("ascii")).read() + m = re.search(r'href="/raw/(\w+)"', response.decode("utf-8")) + if m: + return "%s/show/%s" % (url, m.group(1)) + else: + return "bad response: " + response + + +def pytest_terminal_summary(terminalreporter): + import _pytest.config + + if terminalreporter.config.option.pastebin != "failed": + return + tr = terminalreporter + if "failed" in tr.stats: + terminalreporter.write_sep("=", "Sending information to Paste Service") + for rep in terminalreporter.stats.get("failed"): + try: + msg = rep.longrepr.reprtraceback.reprentries[-1].reprfileloc + except AttributeError: + msg = tr._getfailureheadline(rep) + tw = _pytest.config.create_terminal_writer( + terminalreporter.config, stringio=True + ) + rep.toterminal(tw) + s = tw.stringio.getvalue() + assert len(s) + pastebinurl = create_new_paste(s) + tr.write_line("%s --> %s" % (msg, pastebinurl)) diff --git a/contrib/python/pytest/py2/_pytest/pathlib.py b/contrib/python/pytest/py2/_pytest/pathlib.py new file mode 100644 index 00000000000..42071f43104 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/pathlib.py @@ -0,0 +1,380 @@ +# -*- coding: utf-8 -*- +from __future__ import absolute_import + +import atexit +import errno +import fnmatch +import itertools +import operator +import os +import shutil +import sys +import uuid +import warnings +from functools import partial +from functools import reduce +from os.path import expanduser +from os.path import expandvars +from os.path import isabs +from os.path import sep +from posixpath import sep as posix_sep + +import six +from six.moves import map + +from .compat import PY36 +from _pytest.warning_types import PytestWarning + +if PY36: + from pathlib import Path, PurePath +else: + from pathlib2 import Path, PurePath + +__all__ = ["Path", "PurePath"] + + +LOCK_TIMEOUT = 60 * 60 * 3 + +get_lock_path = operator.methodcaller("joinpath", ".lock") + + +def ensure_reset_dir(path): + """ + ensures the given path is an empty directory + """ + if path.exists(): + rm_rf(path) + path.mkdir() + + +def on_rm_rf_error(func, path, exc, **kwargs): + """Handles known read-only errors during rmtree. + + The returned value is used only by our own tests. + """ + start_path = kwargs["start_path"] + exctype, excvalue = exc[:2] + + # another process removed the file in the middle of the "rm_rf" (xdist for example) + # more context: https://github.com/pytest-dev/pytest/issues/5974#issuecomment-543799018 + if isinstance(excvalue, OSError) and excvalue.errno == errno.ENOENT: + return False + + if not isinstance(excvalue, OSError) or excvalue.errno not in ( + errno.EACCES, + errno.EPERM, + ): + warnings.warn( + PytestWarning( + "(rm_rf) error removing {}\n{}: {}".format(path, exctype, excvalue) + ) + ) + return False + + if func not in (os.rmdir, os.remove, os.unlink): + warnings.warn( + PytestWarning( + "(rm_rf) unknown function {} when removing {}:\n{}: {}".format( + path, func, exctype, excvalue + ) + ) + ) + return False + + # Chmod + retry. + import stat + + def chmod_rw(p): + mode = os.stat(p).st_mode + os.chmod(p, mode | stat.S_IRUSR | stat.S_IWUSR) + + # For files, we need to recursively go upwards in the directories to + # ensure they all are also writable. + p = Path(path) + if p.is_file(): + for parent in p.parents: + chmod_rw(str(parent)) + # stop when we reach the original path passed to rm_rf + if parent == start_path: + break + chmod_rw(str(path)) + + func(path) + return True + + +def rm_rf(path): + """Remove the path contents recursively, even if some elements + are read-only. + """ + onerror = partial(on_rm_rf_error, start_path=path) + shutil.rmtree(str(path), onerror=onerror) + + +def find_prefixed(root, prefix): + """finds all elements in root that begin with the prefix, case insensitive""" + l_prefix = prefix.lower() + for x in root.iterdir(): + if x.name.lower().startswith(l_prefix): + yield x + + +def extract_suffixes(iter, prefix): + """ + :param iter: iterator over path names + :param prefix: expected prefix of the path names + :returns: the parts of the paths following the prefix + """ + p_len = len(prefix) + for p in iter: + yield p.name[p_len:] + + +def find_suffixes(root, prefix): + """combines find_prefixes and extract_suffixes + """ + return extract_suffixes(find_prefixed(root, prefix), prefix) + + +def parse_num(maybe_num): + """parses number path suffixes, returns -1 on error""" + try: + return int(maybe_num) + except ValueError: + return -1 + + +if six.PY2: + + def _max(iterable, default): + """needed due to python2.7 lacking the default argument for max""" + return reduce(max, iterable, default) + + +else: + _max = max + + +def _force_symlink(root, target, link_to): + """helper to create the current symlink + + it's full of race conditions that are reasonably ok to ignore + for the context of best effort linking to the latest testrun + + the presumption being thatin case of much parallelism + the inaccuracy is going to be acceptable + """ + current_symlink = root.joinpath(target) + try: + current_symlink.unlink() + except OSError: + pass + try: + current_symlink.symlink_to(link_to) + except Exception: + pass + + +def make_numbered_dir(root, prefix): + """create a directory with an increased number as suffix for the given prefix""" + for i in range(10): + # try up to 10 times to create the folder + max_existing = _max(map(parse_num, find_suffixes(root, prefix)), default=-1) + new_number = max_existing + 1 + new_path = root.joinpath("{}{}".format(prefix, new_number)) + try: + new_path.mkdir() + except Exception: + pass + else: + _force_symlink(root, prefix + "current", new_path) + return new_path + else: + raise EnvironmentError( + "could not create numbered dir with prefix " + "{prefix} in {root} after 10 tries".format(prefix=prefix, root=root) + ) + + +def create_cleanup_lock(p): + """crates a lock to prevent premature folder cleanup""" + lock_path = get_lock_path(p) + try: + fd = os.open(str(lock_path), os.O_WRONLY | os.O_CREAT | os.O_EXCL, 0o644) + except OSError as e: + if e.errno == errno.EEXIST: + six.raise_from( + EnvironmentError("cannot create lockfile in {path}".format(path=p)), e + ) + else: + raise + else: + pid = os.getpid() + spid = str(pid) + if not isinstance(spid, bytes): + spid = spid.encode("ascii") + os.write(fd, spid) + os.close(fd) + if not lock_path.is_file(): + raise EnvironmentError("lock path got renamed after successful creation") + return lock_path + + +def register_cleanup_lock_removal(lock_path, register=atexit.register): + """registers a cleanup function for removing a lock, by default on atexit""" + pid = os.getpid() + + def cleanup_on_exit(lock_path=lock_path, original_pid=pid): + current_pid = os.getpid() + if current_pid != original_pid: + # fork + return + try: + lock_path.unlink() + except (OSError, IOError): + pass + + return register(cleanup_on_exit) + + +def maybe_delete_a_numbered_dir(path): + """removes a numbered directory if its lock can be obtained and it does not seem to be in use""" + lock_path = None + try: + lock_path = create_cleanup_lock(path) + parent = path.parent + + garbage = parent.joinpath("garbage-{}".format(uuid.uuid4())) + path.rename(garbage) + rm_rf(garbage) + except (OSError, EnvironmentError): + # known races: + # * other process did a cleanup at the same time + # * deletable folder was found + # * process cwd (Windows) + return + finally: + # if we created the lock, ensure we remove it even if we failed + # to properly remove the numbered dir + if lock_path is not None: + try: + lock_path.unlink() + except (OSError, IOError): + pass + + +def ensure_deletable(path, consider_lock_dead_if_created_before): + """checks if a lock exists and breaks it if its considered dead""" + if path.is_symlink(): + return False + lock = get_lock_path(path) + if not lock.exists(): + return True + try: + lock_time = lock.stat().st_mtime + except Exception: + return False + else: + if lock_time < consider_lock_dead_if_created_before: + lock.unlink() + return True + else: + return False + + +def try_cleanup(path, consider_lock_dead_if_created_before): + """tries to cleanup a folder if we can ensure it's deletable""" + if ensure_deletable(path, consider_lock_dead_if_created_before): + maybe_delete_a_numbered_dir(path) + + +def cleanup_candidates(root, prefix, keep): + """lists candidates for numbered directories to be removed - follows py.path""" + max_existing = _max(map(parse_num, find_suffixes(root, prefix)), default=-1) + max_delete = max_existing - keep + paths = find_prefixed(root, prefix) + paths, paths2 = itertools.tee(paths) + numbers = map(parse_num, extract_suffixes(paths2, prefix)) + for path, number in zip(paths, numbers): + if number <= max_delete: + yield path + + +def cleanup_numbered_dir(root, prefix, keep, consider_lock_dead_if_created_before): + """cleanup for lock driven numbered directories""" + for path in cleanup_candidates(root, prefix, keep): + try_cleanup(path, consider_lock_dead_if_created_before) + for path in root.glob("garbage-*"): + try_cleanup(path, consider_lock_dead_if_created_before) + + +def make_numbered_dir_with_cleanup(root, prefix, keep, lock_timeout): + """creates a numbered dir with a cleanup lock and removes old ones""" + e = None + for i in range(10): + try: + p = make_numbered_dir(root, prefix) + lock_path = create_cleanup_lock(p) + register_cleanup_lock_removal(lock_path) + except Exception as exc: + e = exc + else: + consider_lock_dead_if_created_before = p.stat().st_mtime - lock_timeout + cleanup_numbered_dir( + root=root, + prefix=prefix, + keep=keep, + consider_lock_dead_if_created_before=consider_lock_dead_if_created_before, + ) + return p + assert e is not None + raise e + + +def resolve_from_str(input, root): + assert not isinstance(input, Path), "would break on py2" + root = Path(root) + input = expanduser(input) + input = expandvars(input) + if isabs(input): + return Path(input) + else: + return root.joinpath(input) + + +def fnmatch_ex(pattern, path): + """FNMatcher port from py.path.common which works with PurePath() instances. + + The difference between this algorithm and PurePath.match() is that the latter matches "**" glob expressions + for each part of the path, while this algorithm uses the whole path instead. + + For example: + "tests/foo/bar/doc/test_foo.py" matches pattern "tests/**/doc/test*.py" with this algorithm, but not with + PurePath.match(). + + This algorithm was ported to keep backward-compatibility with existing settings which assume paths match according + this logic. + + References: + * https://bugs.python.org/issue29249 + * https://bugs.python.org/issue34731 + """ + path = PurePath(path) + iswin32 = sys.platform.startswith("win") + + if iswin32 and sep not in pattern and posix_sep in pattern: + # Running on Windows, the pattern has no Windows path separators, + # and the pattern has one or more Posix path separators. Replace + # the Posix path separators with the Windows path separator. + pattern = pattern.replace(posix_sep, sep) + + if sep not in pattern: + name = path.name + else: + name = six.text_type(path) + return fnmatch.fnmatch(name, pattern) + + +def parts(s): + parts = s.split(sep) + return {sep.join(parts[: i + 1]) or sep for i in range(len(parts))} diff --git a/contrib/python/pytest/py2/_pytest/pytester.py b/contrib/python/pytest/py2/_pytest/pytester.py new file mode 100644 index 00000000000..f1d739c9917 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/pytester.py @@ -0,0 +1,1413 @@ +# -*- coding: utf-8 -*- +"""(disabled by default) support for testing pytest and pytest plugins.""" +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import codecs +import gc +import os +import platform +import re +import subprocess +import sys +import time +import traceback +from fnmatch import fnmatch +from weakref import WeakKeyDictionary + +import py +import six + +import pytest +from _pytest._code import Source +from _pytest._io.saferepr import saferepr +from _pytest.assertion.rewrite import AssertionRewritingHook +from _pytest.capture import MultiCapture +from _pytest.capture import SysCapture +from _pytest.compat import safe_str +from _pytest.compat import Sequence +from _pytest.main import EXIT_INTERRUPTED +from _pytest.main import EXIT_OK +from _pytest.main import Session +from _pytest.monkeypatch import MonkeyPatch +from _pytest.pathlib import Path + +IGNORE_PAM = [ # filenames added when obtaining details about the current user + u"/var/lib/sss/mc/passwd" +] + + +def pytest_addoption(parser): + parser.addoption( + "--lsof", + action="store_true", + dest="lsof", + default=False, + help="run FD checks if lsof is available", + ) + + parser.addoption( + "--runpytest", + default="inprocess", + dest="runpytest", + choices=("inprocess", "subprocess"), + help=( + "run pytest sub runs in tests using an 'inprocess' " + "or 'subprocess' (python -m main) method" + ), + ) + + parser.addini( + "pytester_example_dir", help="directory to take the pytester example files from" + ) + + +def pytest_configure(config): + if config.getvalue("lsof"): + checker = LsofFdLeakChecker() + if checker.matching_platform(): + config.pluginmanager.register(checker) + + config.addinivalue_line( + "markers", + "pytester_example_path(*path_segments): join the given path " + "segments to `pytester_example_dir` for this test.", + ) + + +def raise_on_kwargs(kwargs): + __tracebackhide__ = True + if kwargs: # pragma: no branch + raise TypeError( + "Unexpected keyword arguments: {}".format(", ".join(sorted(kwargs))) + ) + + +class LsofFdLeakChecker(object): + def get_open_files(self): + out = self._exec_lsof() + open_files = self._parse_lsof_output(out) + return open_files + + def _exec_lsof(self): + pid = os.getpid() + # py3: use subprocess.DEVNULL directly. + with open(os.devnull, "wb") as devnull: + return subprocess.check_output( + ("lsof", "-Ffn0", "-p", str(pid)), stderr=devnull + ).decode() + + def _parse_lsof_output(self, out): + def isopen(line): + return line.startswith("f") and ( + "deleted" not in line + and "mem" not in line + and "txt" not in line + and "cwd" not in line + ) + + open_files = [] + + for line in out.split("\n"): + if isopen(line): + fields = line.split("\0") + fd = fields[0][1:] + filename = fields[1][1:] + if filename in IGNORE_PAM: + continue + if filename.startswith("/"): + open_files.append((fd, filename)) + + return open_files + + def matching_platform(self): + try: + subprocess.check_output(("lsof", "-v")) + except (OSError, subprocess.CalledProcessError): + return False + else: + return True + + @pytest.hookimpl(hookwrapper=True, tryfirst=True) + def pytest_runtest_protocol(self, item): + lines1 = self.get_open_files() + yield + if hasattr(sys, "pypy_version_info"): + gc.collect() + lines2 = self.get_open_files() + + new_fds = {t[0] for t in lines2} - {t[0] for t in lines1} + leaked_files = [t for t in lines2 if t[0] in new_fds] + if leaked_files: + error = [] + error.append("***** %s FD leakage detected" % len(leaked_files)) + error.extend([str(f) for f in leaked_files]) + error.append("*** Before:") + error.extend([str(f) for f in lines1]) + error.append("*** After:") + error.extend([str(f) for f in lines2]) + error.append(error[0]) + error.append("*** function %s:%s: %s " % item.location) + error.append("See issue #2366") + item.warn(pytest.PytestWarning("\n".join(error))) + + +# used at least by pytest-xdist plugin + + +@pytest.fixture +def _pytest(request): + """Return a helper which offers a gethookrecorder(hook) method which + returns a HookRecorder instance which helps to make assertions about called + hooks. + + """ + return PytestArg(request) + + +class PytestArg(object): + def __init__(self, request): + self.request = request + + def gethookrecorder(self, hook): + hookrecorder = HookRecorder(hook._pm) + self.request.addfinalizer(hookrecorder.finish_recording) + return hookrecorder + + +def get_public_names(values): + """Only return names from iterator values without a leading underscore.""" + return [x for x in values if x[0] != "_"] + + +class ParsedCall(object): + def __init__(self, name, kwargs): + self.__dict__.update(kwargs) + self._name = name + + def __repr__(self): + d = self.__dict__.copy() + del d["_name"] + return "<ParsedCall %r(**%r)>" % (self._name, d) + + +class HookRecorder(object): + """Record all hooks called in a plugin manager. + + This wraps all the hook calls in the plugin manager, recording each call + before propagating the normal calls. + + """ + + def __init__(self, pluginmanager): + self._pluginmanager = pluginmanager + self.calls = [] + + def before(hook_name, hook_impls, kwargs): + self.calls.append(ParsedCall(hook_name, kwargs)) + + def after(outcome, hook_name, hook_impls, kwargs): + pass + + self._undo_wrapping = pluginmanager.add_hookcall_monitoring(before, after) + + def finish_recording(self): + self._undo_wrapping() + + def getcalls(self, names): + if isinstance(names, str): + names = names.split() + return [call for call in self.calls if call._name in names] + + def assert_contains(self, entries): + __tracebackhide__ = True + i = 0 + entries = list(entries) + backlocals = sys._getframe(1).f_locals + while entries: + name, check = entries.pop(0) + for ind, call in enumerate(self.calls[i:]): + if call._name == name: + print("NAMEMATCH", name, call) + if eval(check, backlocals, call.__dict__): + print("CHECKERMATCH", repr(check), "->", call) + else: + print("NOCHECKERMATCH", repr(check), "-", call) + continue + i += ind + 1 + break + print("NONAMEMATCH", name, "with", call) + else: + pytest.fail("could not find %r check %r" % (name, check)) + + def popcall(self, name): + __tracebackhide__ = True + for i, call in enumerate(self.calls): + if call._name == name: + del self.calls[i] + return call + lines = ["could not find call %r, in:" % (name,)] + lines.extend([" %s" % x for x in self.calls]) + pytest.fail("\n".join(lines)) + + def getcall(self, name): + values = self.getcalls(name) + assert len(values) == 1, (name, values) + return values[0] + + # functionality for test reports + + def getreports(self, names="pytest_runtest_logreport pytest_collectreport"): + return [x.report for x in self.getcalls(names)] + + def matchreport( + self, + inamepart="", + names="pytest_runtest_logreport pytest_collectreport", + when=None, + ): + """return a testreport whose dotted import path matches""" + values = [] + for rep in self.getreports(names=names): + if not when and rep.when != "call" and rep.passed: + # setup/teardown passing reports - let's ignore those + continue + if when and rep.when != when: + continue + if not inamepart or inamepart in rep.nodeid.split("::"): + values.append(rep) + if not values: + raise ValueError( + "could not find test report matching %r: " + "no test reports at all!" % (inamepart,) + ) + if len(values) > 1: + raise ValueError( + "found 2 or more testreports matching %r: %s" % (inamepart, values) + ) + return values[0] + + def getfailures(self, names="pytest_runtest_logreport pytest_collectreport"): + return [rep for rep in self.getreports(names) if rep.failed] + + def getfailedcollections(self): + return self.getfailures("pytest_collectreport") + + def listoutcomes(self): + passed = [] + skipped = [] + failed = [] + for rep in self.getreports("pytest_collectreport pytest_runtest_logreport"): + if rep.passed: + if rep.when == "call": + passed.append(rep) + elif rep.skipped: + skipped.append(rep) + else: + assert rep.failed, "Unexpected outcome: {!r}".format(rep) + failed.append(rep) + return passed, skipped, failed + + def countoutcomes(self): + return [len(x) for x in self.listoutcomes()] + + def assertoutcome(self, passed=0, skipped=0, failed=0): + realpassed, realskipped, realfailed = self.listoutcomes() + assert passed == len(realpassed) + assert skipped == len(realskipped) + assert failed == len(realfailed) + + def clear(self): + self.calls[:] = [] + + +@pytest.fixture +def linecomp(request): + return LineComp() + + +@pytest.fixture(name="LineMatcher") +def LineMatcher_fixture(request): + return LineMatcher + + +@pytest.fixture +def testdir(request, tmpdir_factory): + return Testdir(request, tmpdir_factory) + + +@pytest.fixture +def _sys_snapshot(): + snappaths = SysPathsSnapshot() + snapmods = SysModulesSnapshot() + yield + snapmods.restore() + snappaths.restore() + + +@pytest.fixture +def _config_for_test(): + from _pytest.config import get_config + + config = get_config() + yield config + config._ensure_unconfigure() # cleanup, e.g. capman closing tmpfiles. + + +rex_outcome = re.compile(r"(\d+) ([\w-]+)") + + +class RunResult(object): + """The result of running a command. + + Attributes: + + :ret: the return value + :outlines: list of lines captured from stdout + :errlines: list of lines captures from stderr + :stdout: :py:class:`LineMatcher` of stdout, use ``stdout.str()`` to + reconstruct stdout or the commonly used ``stdout.fnmatch_lines()`` + method + :stderr: :py:class:`LineMatcher` of stderr + :duration: duration in seconds + + """ + + def __init__(self, ret, outlines, errlines, duration): + self.ret = ret + self.outlines = outlines + self.errlines = errlines + self.stdout = LineMatcher(outlines) + self.stderr = LineMatcher(errlines) + self.duration = duration + + def __repr__(self): + return ( + "<RunResult ret=%r len(stdout.lines)=%d len(stderr.lines)=%d duration=%.2fs>" + % (self.ret, len(self.stdout.lines), len(self.stderr.lines), self.duration) + ) + + def parseoutcomes(self): + """Return a dictionary of outcomestring->num from parsing the terminal + output that the test process produced. + + """ + for line in reversed(self.outlines): + if "seconds" in line: + outcomes = rex_outcome.findall(line) + if outcomes: + d = {} + for num, cat in outcomes: + d[cat] = int(num) + return d + raise ValueError("Pytest terminal report not found") + + def assert_outcomes( + self, passed=0, skipped=0, failed=0, error=0, xpassed=0, xfailed=0 + ): + """Assert that the specified outcomes appear with the respective + numbers (0 means it didn't occur) in the text output from a test run. + + """ + d = self.parseoutcomes() + obtained = { + "passed": d.get("passed", 0), + "skipped": d.get("skipped", 0), + "failed": d.get("failed", 0), + "error": d.get("error", 0), + "xpassed": d.get("xpassed", 0), + "xfailed": d.get("xfailed", 0), + } + expected = { + "passed": passed, + "skipped": skipped, + "failed": failed, + "error": error, + "xpassed": xpassed, + "xfailed": xfailed, + } + assert obtained == expected + + +class CwdSnapshot(object): + def __init__(self): + self.__saved = os.getcwd() + + def restore(self): + os.chdir(self.__saved) + + +class SysModulesSnapshot(object): + def __init__(self, preserve=None): + self.__preserve = preserve + self.__saved = dict(sys.modules) + + def restore(self): + if self.__preserve: + self.__saved.update( + (k, m) for k, m in sys.modules.items() if self.__preserve(k) + ) + sys.modules.clear() + sys.modules.update(self.__saved) + + +class SysPathsSnapshot(object): + def __init__(self): + self.__saved = list(sys.path), list(sys.meta_path) + + def restore(self): + sys.path[:], sys.meta_path[:] = self.__saved + + +class Testdir(object): + """Temporary test directory with tools to test/run pytest itself. + + This is based on the ``tmpdir`` fixture but provides a number of methods + which aid with testing pytest itself. Unless :py:meth:`chdir` is used all + methods will use :py:attr:`tmpdir` as their current working directory. + + Attributes: + + :tmpdir: The :py:class:`py.path.local` instance of the temporary directory. + + :plugins: A list of plugins to use with :py:meth:`parseconfig` and + :py:meth:`runpytest`. Initially this is an empty list but plugins can + be added to the list. The type of items to add to the list depends on + the method using them so refer to them for details. + + """ + + CLOSE_STDIN = object + + class TimeoutExpired(Exception): + pass + + def __init__(self, request, tmpdir_factory): + self.request = request + self._mod_collections = WeakKeyDictionary() + name = request.function.__name__ + self.tmpdir = tmpdir_factory.mktemp(name, numbered=True) + self.test_tmproot = tmpdir_factory.mktemp("tmp-" + name, numbered=True) + self.plugins = [] + self._cwd_snapshot = CwdSnapshot() + self._sys_path_snapshot = SysPathsSnapshot() + self._sys_modules_snapshot = self.__take_sys_modules_snapshot() + self.chdir() + self.request.addfinalizer(self.finalize) + method = self.request.config.getoption("--runpytest") + if method == "inprocess": + self._runpytest_method = self.runpytest_inprocess + elif method == "subprocess": + self._runpytest_method = self.runpytest_subprocess + + mp = self.monkeypatch = MonkeyPatch() + mp.setenv("PYTEST_DEBUG_TEMPROOT", str(self.test_tmproot)) + # Ensure no unexpected caching via tox. + mp.delenv("TOX_ENV_DIR", raising=False) + # Discard outer pytest options. + mp.delenv("PYTEST_ADDOPTS", raising=False) + + # Environment (updates) for inner runs. + tmphome = str(self.tmpdir) + self._env_run_update = {"HOME": tmphome, "USERPROFILE": tmphome} + + def __repr__(self): + return "<Testdir %r>" % (self.tmpdir,) + + def __str__(self): + return str(self.tmpdir) + + def finalize(self): + """Clean up global state artifacts. + + Some methods modify the global interpreter state and this tries to + clean this up. It does not remove the temporary directory however so + it can be looked at after the test run has finished. + + """ + self._sys_modules_snapshot.restore() + self._sys_path_snapshot.restore() + self._cwd_snapshot.restore() + self.monkeypatch.undo() + + def __take_sys_modules_snapshot(self): + # some zope modules used by twisted-related tests keep internal state + # and can't be deleted; we had some trouble in the past with + # `zope.interface` for example + def preserve_module(name): + return name.startswith("zope") + + return SysModulesSnapshot(preserve=preserve_module) + + def make_hook_recorder(self, pluginmanager): + """Create a new :py:class:`HookRecorder` for a PluginManager.""" + pluginmanager.reprec = reprec = HookRecorder(pluginmanager) + self.request.addfinalizer(reprec.finish_recording) + return reprec + + def chdir(self): + """Cd into the temporary directory. + + This is done automatically upon instantiation. + + """ + self.tmpdir.chdir() + + def _makefile(self, ext, args, kwargs, encoding="utf-8"): + items = list(kwargs.items()) + + def to_text(s): + return s.decode(encoding) if isinstance(s, bytes) else six.text_type(s) + + if args: + source = u"\n".join(to_text(x) for x in args) + basename = self.request.function.__name__ + items.insert(0, (basename, source)) + + ret = None + for basename, value in items: + p = self.tmpdir.join(basename).new(ext=ext) + p.dirpath().ensure_dir() + source = Source(value) + source = u"\n".join(to_text(line) for line in source.lines) + p.write(source.strip().encode(encoding), "wb") + if ret is None: + ret = p + return ret + + def makefile(self, ext, *args, **kwargs): + r"""Create new file(s) in the testdir. + + :param str ext: The extension the file(s) should use, including the dot, e.g. `.py`. + :param list[str] args: All args will be treated as strings and joined using newlines. + The result will be written as contents to the file. The name of the + file will be based on the test function requesting this fixture. + :param kwargs: Each keyword is the name of a file, while the value of it will + be written as contents of the file. + + Examples: + + .. code-block:: python + + testdir.makefile(".txt", "line1", "line2") + + testdir.makefile(".ini", pytest="[pytest]\naddopts=-rs\n") + + """ + return self._makefile(ext, args, kwargs) + + def makeconftest(self, source): + """Write a contest.py file with 'source' as contents.""" + return self.makepyfile(conftest=source) + + def makeini(self, source): + """Write a tox.ini file with 'source' as contents.""" + return self.makefile(".ini", tox=source) + + def getinicfg(self, source): + """Return the pytest section from the tox.ini config file.""" + p = self.makeini(source) + return py.iniconfig.IniConfig(p)["pytest"] + + def makepyfile(self, *args, **kwargs): + """Shortcut for .makefile() with a .py extension.""" + return self._makefile(".py", args, kwargs) + + def maketxtfile(self, *args, **kwargs): + """Shortcut for .makefile() with a .txt extension.""" + return self._makefile(".txt", args, kwargs) + + def syspathinsert(self, path=None): + """Prepend a directory to sys.path, defaults to :py:attr:`tmpdir`. + + This is undone automatically when this object dies at the end of each + test. + """ + if path is None: + path = self.tmpdir + + self.monkeypatch.syspath_prepend(str(path)) + + def mkdir(self, name): + """Create a new (sub)directory.""" + return self.tmpdir.mkdir(name) + + def mkpydir(self, name): + """Create a new python package. + + This creates a (sub)directory with an empty ``__init__.py`` file so it + gets recognised as a python package. + + """ + p = self.mkdir(name) + p.ensure("__init__.py") + return p + + def copy_example(self, name=None): + import warnings + from _pytest.warning_types import PYTESTER_COPY_EXAMPLE + + warnings.warn(PYTESTER_COPY_EXAMPLE, stacklevel=2) + example_dir = self.request.config.getini("pytester_example_dir") + if example_dir is None: + raise ValueError("pytester_example_dir is unset, can't copy examples") + example_dir = self.request.config.rootdir.join(example_dir) + + for extra_element in self.request.node.iter_markers("pytester_example_path"): + assert extra_element.args + example_dir = example_dir.join(*extra_element.args) + + if name is None: + func_name = self.request.function.__name__ + maybe_dir = example_dir / func_name + maybe_file = example_dir / (func_name + ".py") + + if maybe_dir.isdir(): + example_path = maybe_dir + elif maybe_file.isfile(): + example_path = maybe_file + else: + raise LookupError( + "{} cant be found as module or package in {}".format( + func_name, example_dir.bestrelpath(self.request.config.rootdir) + ) + ) + else: + example_path = example_dir.join(name) + + if example_path.isdir() and not example_path.join("__init__.py").isfile(): + example_path.copy(self.tmpdir) + return self.tmpdir + elif example_path.isfile(): + result = self.tmpdir.join(example_path.basename) + example_path.copy(result) + return result + else: + raise LookupError( + 'example "{}" is not found as a file or directory'.format(example_path) + ) + + Session = Session + + def getnode(self, config, arg): + """Return the collection node of a file. + + :param config: :py:class:`_pytest.config.Config` instance, see + :py:meth:`parseconfig` and :py:meth:`parseconfigure` to create the + configuration + + :param arg: a :py:class:`py.path.local` instance of the file + + """ + session = Session(config) + assert "::" not in str(arg) + p = py.path.local(arg) + config.hook.pytest_sessionstart(session=session) + res = session.perform_collect([str(p)], genitems=False)[0] + config.hook.pytest_sessionfinish(session=session, exitstatus=EXIT_OK) + return res + + def getpathnode(self, path): + """Return the collection node of a file. + + This is like :py:meth:`getnode` but uses :py:meth:`parseconfigure` to + create the (configured) pytest Config instance. + + :param path: a :py:class:`py.path.local` instance of the file + + """ + config = self.parseconfigure(path) + session = Session(config) + x = session.fspath.bestrelpath(path) + config.hook.pytest_sessionstart(session=session) + res = session.perform_collect([x], genitems=False)[0] + config.hook.pytest_sessionfinish(session=session, exitstatus=EXIT_OK) + return res + + def genitems(self, colitems): + """Generate all test items from a collection node. + + This recurses into the collection node and returns a list of all the + test items contained within. + + """ + session = colitems[0].session + result = [] + for colitem in colitems: + result.extend(session.genitems(colitem)) + return result + + def runitem(self, source): + """Run the "test_func" Item. + + The calling test instance (class containing the test method) must + provide a ``.getrunner()`` method which should return a runner which + can run the test protocol for a single item, e.g. + :py:func:`_pytest.runner.runtestprotocol`. + + """ + # used from runner functional tests + item = self.getitem(source) + # the test class where we are called from wants to provide the runner + testclassinstance = self.request.instance + runner = testclassinstance.getrunner() + return runner(item) + + def inline_runsource(self, source, *cmdlineargs): + """Run a test module in process using ``pytest.main()``. + + This run writes "source" into a temporary file and runs + ``pytest.main()`` on it, returning a :py:class:`HookRecorder` instance + for the result. + + :param source: the source code of the test module + + :param cmdlineargs: any extra command line arguments to use + + :return: :py:class:`HookRecorder` instance of the result + + """ + p = self.makepyfile(source) + values = list(cmdlineargs) + [p] + return self.inline_run(*values) + + def inline_genitems(self, *args): + """Run ``pytest.main(['--collectonly'])`` in-process. + + Runs the :py:func:`pytest.main` function to run all of pytest inside + the test process itself like :py:meth:`inline_run`, but returns a + tuple of the collected items and a :py:class:`HookRecorder` instance. + + """ + rec = self.inline_run("--collect-only", *args) + items = [x.item for x in rec.getcalls("pytest_itemcollected")] + return items, rec + + def inline_run(self, *args, **kwargs): + """Run ``pytest.main()`` in-process, returning a HookRecorder. + + Runs the :py:func:`pytest.main` function to run all of pytest inside + the test process itself. This means it can return a + :py:class:`HookRecorder` instance which gives more detailed results + from that run than can be done by matching stdout/stderr from + :py:meth:`runpytest`. + + :param args: command line arguments to pass to :py:func:`pytest.main` + + :param plugins: (keyword-only) extra plugin instances the + ``pytest.main()`` instance should use + + :return: a :py:class:`HookRecorder` instance + """ + plugins = kwargs.pop("plugins", []) + no_reraise_ctrlc = kwargs.pop("no_reraise_ctrlc", None) + raise_on_kwargs(kwargs) + + finalizers = [] + try: + # Do not load user config (during runs only). + mp_run = MonkeyPatch() + for k, v in self._env_run_update.items(): + mp_run.setenv(k, v) + finalizers.append(mp_run.undo) + + # When running pytest inline any plugins active in the main test + # process are already imported. So this disables the warning which + # will trigger to say they can no longer be rewritten, which is + # fine as they have already been rewritten. + orig_warn = AssertionRewritingHook._warn_already_imported + + def revert_warn_already_imported(): + AssertionRewritingHook._warn_already_imported = orig_warn + + finalizers.append(revert_warn_already_imported) + AssertionRewritingHook._warn_already_imported = lambda *a: None + + # Any sys.module or sys.path changes done while running pytest + # inline should be reverted after the test run completes to avoid + # clashing with later inline tests run within the same pytest test, + # e.g. just because they use matching test module names. + finalizers.append(self.__take_sys_modules_snapshot().restore) + finalizers.append(SysPathsSnapshot().restore) + + # Important note: + # - our tests should not leave any other references/registrations + # laying around other than possibly loaded test modules + # referenced from sys.modules, as nothing will clean those up + # automatically + + rec = [] + + class Collect(object): + def pytest_configure(x, config): + rec.append(self.make_hook_recorder(config.pluginmanager)) + + plugins.append(Collect()) + ret = pytest.main(list(args), plugins=plugins) + if len(rec) == 1: + reprec = rec.pop() + else: + + class reprec(object): + pass + + reprec.ret = ret + + # typically we reraise keyboard interrupts from the child run + # because it's our user requesting interruption of the testing + if ret == EXIT_INTERRUPTED and not no_reraise_ctrlc: + calls = reprec.getcalls("pytest_keyboard_interrupt") + if calls and calls[-1].excinfo.type == KeyboardInterrupt: + raise KeyboardInterrupt() + return reprec + finally: + for finalizer in finalizers: + finalizer() + + def runpytest_inprocess(self, *args, **kwargs): + """Return result of running pytest in-process, providing a similar + interface to what self.runpytest() provides. + """ + syspathinsert = kwargs.pop("syspathinsert", False) + + if syspathinsert: + self.syspathinsert() + now = time.time() + capture = MultiCapture(Capture=SysCapture) + capture.start_capturing() + try: + try: + reprec = self.inline_run(*args, **kwargs) + except SystemExit as e: + + class reprec(object): + ret = e.args[0] + + except Exception: + traceback.print_exc() + + class reprec(object): + ret = 3 + + finally: + out, err = capture.readouterr() + capture.stop_capturing() + sys.stdout.write(out) + sys.stderr.write(err) + + res = RunResult(reprec.ret, out.split("\n"), err.split("\n"), time.time() - now) + res.reprec = reprec + return res + + def runpytest(self, *args, **kwargs): + """Run pytest inline or in a subprocess, depending on the command line + option "--runpytest" and return a :py:class:`RunResult`. + + """ + args = self._ensure_basetemp(args) + return self._runpytest_method(*args, **kwargs) + + def _ensure_basetemp(self, args): + args = list(args) + for x in args: + if safe_str(x).startswith("--basetemp"): + break + else: + args.append("--basetemp=%s" % self.tmpdir.dirpath("basetemp")) + return args + + def parseconfig(self, *args): + """Return a new pytest Config instance from given commandline args. + + This invokes the pytest bootstrapping code in _pytest.config to create + a new :py:class:`_pytest.core.PluginManager` and call the + pytest_cmdline_parse hook to create a new + :py:class:`_pytest.config.Config` instance. + + If :py:attr:`plugins` has been populated they should be plugin modules + to be registered with the PluginManager. + + """ + args = self._ensure_basetemp(args) + + import _pytest.config + + config = _pytest.config._prepareconfig(args, self.plugins) + # we don't know what the test will do with this half-setup config + # object and thus we make sure it gets unconfigured properly in any + # case (otherwise capturing could still be active, for example) + self.request.addfinalizer(config._ensure_unconfigure) + return config + + def parseconfigure(self, *args): + """Return a new pytest configured Config instance. + + This returns a new :py:class:`_pytest.config.Config` instance like + :py:meth:`parseconfig`, but also calls the pytest_configure hook. + + """ + config = self.parseconfig(*args) + config._do_configure() + self.request.addfinalizer(config._ensure_unconfigure) + return config + + def getitem(self, source, funcname="test_func"): + """Return the test item for a test function. + + This writes the source to a python file and runs pytest's collection on + the resulting module, returning the test item for the requested + function name. + + :param source: the module source + + :param funcname: the name of the test function for which to return a + test item + + """ + items = self.getitems(source) + for item in items: + if item.name == funcname: + return item + assert 0, "%r item not found in module:\n%s\nitems: %s" % ( + funcname, + source, + items, + ) + + def getitems(self, source): + """Return all test items collected from the module. + + This writes the source to a python file and runs pytest's collection on + the resulting module, returning all test items contained within. + + """ + modcol = self.getmodulecol(source) + return self.genitems([modcol]) + + def getmodulecol(self, source, configargs=(), withinit=False): + """Return the module collection node for ``source``. + + This writes ``source`` to a file using :py:meth:`makepyfile` and then + runs the pytest collection on it, returning the collection node for the + test module. + + :param source: the source code of the module to collect + + :param configargs: any extra arguments to pass to + :py:meth:`parseconfigure` + + :param withinit: whether to also write an ``__init__.py`` file to the + same directory to ensure it is a package + + """ + if isinstance(source, Path): + path = self.tmpdir.join(str(source)) + assert not withinit, "not supported for paths" + else: + kw = {self.request.function.__name__: Source(source).strip()} + path = self.makepyfile(**kw) + if withinit: + self.makepyfile(__init__="#") + self.config = config = self.parseconfigure(path, *configargs) + return self.getnode(config, path) + + def collect_by_name(self, modcol, name): + """Return the collection node for name from the module collection. + + This will search a module collection node for a collection node + matching the given name. + + :param modcol: a module collection node; see :py:meth:`getmodulecol` + + :param name: the name of the node to return + + """ + if modcol not in self._mod_collections: + self._mod_collections[modcol] = list(modcol.collect()) + for colitem in self._mod_collections[modcol]: + if colitem.name == name: + return colitem + + def popen( + self, + cmdargs, + stdout=subprocess.PIPE, + stderr=subprocess.PIPE, + stdin=CLOSE_STDIN, + **kw + ): + """Invoke subprocess.Popen. + + This calls subprocess.Popen making sure the current working directory + is in the PYTHONPATH. + + You probably want to use :py:meth:`run` instead. + + """ + env = os.environ.copy() + env["PYTHONPATH"] = os.pathsep.join( + filter(None, [os.getcwd(), env.get("PYTHONPATH", "")]) + ) + env.update(self._env_run_update) + kw["env"] = env + + if stdin is Testdir.CLOSE_STDIN: + kw["stdin"] = subprocess.PIPE + elif isinstance(stdin, bytes): + kw["stdin"] = subprocess.PIPE + else: + kw["stdin"] = stdin + + popen = subprocess.Popen(cmdargs, stdout=stdout, stderr=stderr, **kw) + if stdin is Testdir.CLOSE_STDIN: + popen.stdin.close() + elif isinstance(stdin, bytes): + popen.stdin.write(stdin) + + return popen + + def run(self, *cmdargs, **kwargs): + """Run a command with arguments. + + Run a process using subprocess.Popen saving the stdout and stderr. + + :param args: the sequence of arguments to pass to `subprocess.Popen()` + :param timeout: the period in seconds after which to timeout and raise + :py:class:`Testdir.TimeoutExpired` + :param stdin: optional standard input. Bytes are being send, closing + the pipe, otherwise it is passed through to ``popen``. + Defaults to ``CLOSE_STDIN``, which translates to using a pipe + (``subprocess.PIPE``) that gets closed. + + Returns a :py:class:`RunResult`. + + """ + __tracebackhide__ = True + + timeout = kwargs.pop("timeout", None) + stdin = kwargs.pop("stdin", Testdir.CLOSE_STDIN) + raise_on_kwargs(kwargs) + + cmdargs = [ + str(arg) if isinstance(arg, py.path.local) else arg for arg in cmdargs + ] + p1 = self.tmpdir.join("stdout") + p2 = self.tmpdir.join("stderr") + print("running:", *cmdargs) + print(" in:", py.path.local()) + f1 = codecs.open(str(p1), "w", encoding="utf8") + f2 = codecs.open(str(p2), "w", encoding="utf8") + try: + now = time.time() + popen = self.popen( + cmdargs, + stdin=stdin, + stdout=f1, + stderr=f2, + close_fds=(sys.platform != "win32"), + ) + if isinstance(stdin, bytes): + popen.stdin.close() + + def handle_timeout(): + __tracebackhide__ = True + + timeout_message = ( + "{seconds} second timeout expired running:" + " {command}".format(seconds=timeout, command=cmdargs) + ) + + popen.kill() + popen.wait() + raise self.TimeoutExpired(timeout_message) + + if timeout is None: + ret = popen.wait() + elif not six.PY2: + try: + ret = popen.wait(timeout) + except subprocess.TimeoutExpired: + handle_timeout() + else: + end = time.time() + timeout + + resolution = min(0.1, timeout / 10) + + while True: + ret = popen.poll() + if ret is not None: + break + + if time.time() > end: + handle_timeout() + + time.sleep(resolution) + finally: + f1.close() + f2.close() + f1 = codecs.open(str(p1), "r", encoding="utf8") + f2 = codecs.open(str(p2), "r", encoding="utf8") + try: + out = f1.read().splitlines() + err = f2.read().splitlines() + finally: + f1.close() + f2.close() + self._dump_lines(out, sys.stdout) + self._dump_lines(err, sys.stderr) + return RunResult(ret, out, err, time.time() - now) + + def _dump_lines(self, lines, fp): + try: + for line in lines: + print(line, file=fp) + except UnicodeEncodeError: + print("couldn't print to %s because of encoding" % (fp,)) + + def _getpytestargs(self): + return sys.executable, "-mpytest" + + def runpython(self, script): + """Run a python script using sys.executable as interpreter. + + Returns a :py:class:`RunResult`. + + """ + return self.run(sys.executable, script) + + def runpython_c(self, command): + """Run python -c "command", return a :py:class:`RunResult`.""" + return self.run(sys.executable, "-c", command) + + def runpytest_subprocess(self, *args, **kwargs): + """Run pytest as a subprocess with given arguments. + + Any plugins added to the :py:attr:`plugins` list will be added using the + ``-p`` command line option. Additionally ``--basetemp`` is used to put + any temporary files and directories in a numbered directory prefixed + with "runpytest-" to not conflict with the normal numbered pytest + location for temporary files and directories. + + :param args: the sequence of arguments to pass to the pytest subprocess + :param timeout: the period in seconds after which to timeout and raise + :py:class:`Testdir.TimeoutExpired` + + Returns a :py:class:`RunResult`. + """ + __tracebackhide__ = True + timeout = kwargs.pop("timeout", None) + raise_on_kwargs(kwargs) + + p = py.path.local.make_numbered_dir( + prefix="runpytest-", keep=None, rootdir=self.tmpdir + ) + args = ("--basetemp=%s" % p,) + args + plugins = [x for x in self.plugins if isinstance(x, str)] + if plugins: + args = ("-p", plugins[0]) + args + args = self._getpytestargs() + args + return self.run(*args, timeout=timeout) + + def spawn_pytest(self, string, expect_timeout=10.0): + """Run pytest using pexpect. + + This makes sure to use the right pytest and sets up the temporary + directory locations. + + The pexpect child is returned. + + """ + basetemp = self.tmpdir.mkdir("temp-pexpect") + invoke = " ".join(map(str, self._getpytestargs())) + cmd = "%s --basetemp=%s %s" % (invoke, basetemp, string) + return self.spawn(cmd, expect_timeout=expect_timeout) + + def spawn(self, cmd, expect_timeout=10.0): + """Run a command using pexpect. + + The pexpect child is returned. + + """ + pexpect = pytest.importorskip("pexpect", "3.0") + if hasattr(sys, "pypy_version_info") and "64" in platform.machine(): + pytest.skip("pypy-64 bit not supported") + if sys.platform.startswith("freebsd"): + pytest.xfail("pexpect does not work reliably on freebsd") + logfile = self.tmpdir.join("spawn.out").open("wb") + + # Do not load user config. + env = os.environ.copy() + env.update(self._env_run_update) + + child = pexpect.spawn(cmd, logfile=logfile, env=env) + self.request.addfinalizer(logfile.close) + child.timeout = expect_timeout + return child + + +def getdecoded(out): + try: + return out.decode("utf-8") + except UnicodeDecodeError: + return "INTERNAL not-utf8-decodeable, truncated string:\n%s" % (saferepr(out),) + + +class LineComp(object): + def __init__(self): + self.stringio = py.io.TextIO() + + def assert_contains_lines(self, lines2): + """Assert that lines2 are contained (linearly) in lines1. + + Return a list of extralines found. + + """ + __tracebackhide__ = True + val = self.stringio.getvalue() + self.stringio.truncate(0) + self.stringio.seek(0) + lines1 = val.split("\n") + return LineMatcher(lines1).fnmatch_lines(lines2) + + +class LineMatcher(object): + """Flexible matching of text. + + This is a convenience class to test large texts like the output of + commands. + + The constructor takes a list of lines without their trailing newlines, i.e. + ``text.splitlines()``. + + """ + + def __init__(self, lines): + self.lines = lines + self._log_output = [] + + def str(self): + """Return the entire original text.""" + return "\n".join(self.lines) + + def _getlines(self, lines2): + if isinstance(lines2, str): + lines2 = Source(lines2) + if isinstance(lines2, Source): + lines2 = lines2.strip().lines + return lines2 + + def fnmatch_lines_random(self, lines2): + """Check lines exist in the output using in any order. + + Lines are checked using ``fnmatch.fnmatch``. The argument is a list of + lines which have to occur in the output, in any order. + + """ + self._match_lines_random(lines2, fnmatch) + + def re_match_lines_random(self, lines2): + """Check lines exist in the output using ``re.match``, in any order. + + The argument is a list of lines which have to occur in the output, in + any order. + + """ + self._match_lines_random(lines2, lambda name, pat: re.match(pat, name)) + + def _match_lines_random(self, lines2, match_func): + """Check lines exist in the output. + + The argument is a list of lines which have to occur in the output, in + any order. Each line can contain glob whildcards. + + """ + lines2 = self._getlines(lines2) + for line in lines2: + for x in self.lines: + if line == x or match_func(x, line): + self._log("matched: ", repr(line)) + break + else: + self._log("line %r not found in output" % line) + raise ValueError(self._log_text) + + def get_lines_after(self, fnline): + """Return all lines following the given line in the text. + + The given line can contain glob wildcards. + + """ + for i, line in enumerate(self.lines): + if fnline == line or fnmatch(line, fnline): + return self.lines[i + 1 :] + raise ValueError("line %r not found in output" % fnline) + + def _log(self, *args): + self._log_output.append(" ".join(str(x) for x in args)) + + @property + def _log_text(self): + return "\n".join(self._log_output) + + def fnmatch_lines(self, lines2): + """Search captured text for matching lines using ``fnmatch.fnmatch``. + + The argument is a list of lines which have to match and can use glob + wildcards. If they do not match a pytest.fail() is called. The + matches and non-matches are also printed on stdout. + + """ + __tracebackhide__ = True + self._match_lines(lines2, fnmatch, "fnmatch") + + def re_match_lines(self, lines2): + """Search captured text for matching lines using ``re.match``. + + The argument is a list of lines which have to match using ``re.match``. + If they do not match a pytest.fail() is called. + + The matches and non-matches are also printed on stdout. + + """ + __tracebackhide__ = True + self._match_lines(lines2, lambda name, pat: re.match(pat, name), "re.match") + + def _match_lines(self, lines2, match_func, match_nickname): + """Underlying implementation of ``fnmatch_lines`` and ``re_match_lines``. + + :param list[str] lines2: list of string patterns to match. The actual + format depends on ``match_func`` + :param match_func: a callable ``match_func(line, pattern)`` where line + is the captured line from stdout/stderr and pattern is the matching + pattern + :param str match_nickname: the nickname for the match function that + will be logged to stdout when a match occurs + + """ + assert isinstance(lines2, Sequence) + lines2 = self._getlines(lines2) + lines1 = self.lines[:] + nextline = None + extralines = [] + __tracebackhide__ = True + for line in lines2: + nomatchprinted = False + while lines1: + nextline = lines1.pop(0) + if line == nextline: + self._log("exact match:", repr(line)) + break + elif match_func(nextline, line): + self._log("%s:" % match_nickname, repr(line)) + self._log(" with:", repr(nextline)) + break + else: + if not nomatchprinted: + self._log("nomatch:", repr(line)) + nomatchprinted = True + self._log(" and:", repr(nextline)) + extralines.append(nextline) + else: + self._log("remains unmatched: %r" % (line,)) + pytest.fail(self._log_text) diff --git a/contrib/python/pytest/py2/_pytest/python.py b/contrib/python/pytest/py2/_pytest/python.py new file mode 100644 index 00000000000..f7c368b0c4b --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/python.py @@ -0,0 +1,1507 @@ +# -*- coding: utf-8 -*- +""" Python test discovery, setup and run of test functions. """ +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import collections +import fnmatch +import inspect +import os +import sys +import warnings +from functools import partial +from textwrap import dedent + +import py +import six + +import _pytest +from _pytest import deprecated +from _pytest import fixtures +from _pytest import nodes +from _pytest._code import filter_traceback +from _pytest.compat import ascii_escaped +from _pytest.compat import enum +from _pytest.compat import get_default_arg_names +from _pytest.compat import get_real_func +from _pytest.compat import getfslineno +from _pytest.compat import getimfunc +from _pytest.compat import getlocation +from _pytest.compat import is_generator +from _pytest.compat import isclass +from _pytest.compat import isfunction +from _pytest.compat import NOTSET +from _pytest.compat import REGEX_TYPE +from _pytest.compat import safe_getattr +from _pytest.compat import safe_isclass +from _pytest.compat import safe_str +from _pytest.compat import STRING_TYPES +from _pytest.config import hookimpl +from _pytest.main import FSHookProxy +from _pytest.mark import MARK_GEN +from _pytest.mark.structures import get_unpacked_marks +from _pytest.mark.structures import normalize_mark_list +from _pytest.outcomes import fail +from _pytest.outcomes import skip +from _pytest.pathlib import parts +from _pytest.warning_types import PytestCollectionWarning +from _pytest.warning_types import PytestUnhandledCoroutineWarning + + +def pyobj_property(name): + def get(self): + node = self.getparent(getattr(__import__("pytest"), name)) + if node is not None: + return node.obj + + doc = "python %s object this node was collected from (can be None)." % ( + name.lower(), + ) + return property(get, None, None, doc) + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group.addoption( + "--fixtures", + "--funcargs", + action="store_true", + dest="showfixtures", + default=False, + help="show available fixtures, sorted by plugin appearance " + "(fixtures with leading '_' are only shown with '-v')", + ) + group.addoption( + "--fixtures-per-test", + action="store_true", + dest="show_fixtures_per_test", + default=False, + help="show fixtures per test", + ) + parser.addini( + "python_files", + type="args", + # NOTE: default is also used in AssertionRewritingHook. + default=["test_*.py", "*_test.py"], + help="glob-style file patterns for Python test module discovery", + ) + parser.addini( + "python_classes", + type="args", + default=["Test"], + help="prefixes or glob names for Python test class discovery", + ) + parser.addini( + "python_functions", + type="args", + default=["test"], + help="prefixes or glob names for Python test function and method discovery", + ) + parser.addini( + "disable_test_id_escaping_and_forfeit_all_rights_to_community_support", + type="bool", + default=False, + help="disable string escape non-ascii characters, might cause unwanted " + "side effects(use at your own risk)", + ) + + group.addoption( + "--import-mode", + default="prepend", + choices=["prepend", "append"], + dest="importmode", + help="prepend/append to sys.path when importing test modules, " + "default is to prepend.", + ) + + +def pytest_cmdline_main(config): + if config.option.showfixtures: + showfixtures(config) + return 0 + if config.option.show_fixtures_per_test: + show_fixtures_per_test(config) + return 0 + + +def pytest_generate_tests(metafunc): + # those alternative spellings are common - raise a specific error to alert + # the user + alt_spellings = ["parameterize", "parametrise", "parameterise"] + for mark_name in alt_spellings: + if metafunc.definition.get_closest_marker(mark_name): + msg = "{0} has '{1}' mark, spelling should be 'parametrize'" + fail(msg.format(metafunc.function.__name__, mark_name), pytrace=False) + for marker in metafunc.definition.iter_markers(name="parametrize"): + metafunc.parametrize(*marker.args, **marker.kwargs) + + +def pytest_configure(config): + config.addinivalue_line( + "markers", + "parametrize(argnames, argvalues): call a test function multiple " + "times passing in different arguments in turn. argvalues generally " + "needs to be a list of values if argnames specifies only one name " + "or a list of tuples of values if argnames specifies multiple names. " + "Example: @parametrize('arg1', [1,2]) would lead to two calls of the " + "decorated test function, one with arg1=1 and another with arg1=2." + "see https://docs.pytest.org/en/latest/parametrize.html for more info " + "and examples.", + ) + config.addinivalue_line( + "markers", + "usefixtures(fixturename1, fixturename2, ...): mark tests as needing " + "all of the specified fixtures. see " + "https://docs.pytest.org/en/latest/fixture.html#usefixtures ", + ) + + +@hookimpl(trylast=True) +def pytest_pyfunc_call(pyfuncitem): + testfunction = pyfuncitem.obj + iscoroutinefunction = getattr(inspect, "iscoroutinefunction", None) + if iscoroutinefunction is not None and iscoroutinefunction(testfunction): + msg = "Coroutine functions are not natively supported and have been skipped.\n" + msg += "You need to install a suitable plugin for your async framework, for example:\n" + msg += " - pytest-asyncio\n" + msg += " - pytest-trio\n" + msg += " - pytest-tornasync" + warnings.warn(PytestUnhandledCoroutineWarning(msg.format(pyfuncitem.nodeid))) + skip(msg="coroutine function and no async plugin installed (see warnings)") + funcargs = pyfuncitem.funcargs + testargs = {arg: funcargs[arg] for arg in pyfuncitem._fixtureinfo.argnames} + testfunction(**testargs) + return True + + +def pytest_collect_file(path, parent): + ext = path.ext + if ext == ".py": + if not parent.session.isinitpath(path): + if not path_matches_patterns( + path, parent.config.getini("python_files") + ["__init__.py"] + ): + return + ihook = parent.session.gethookproxy(path) + return ihook.pytest_pycollect_makemodule(path=path, parent=parent) + + +def path_matches_patterns(path, patterns): + """Returns True if the given py.path.local matches one of the patterns in the list of globs given""" + return any(path.fnmatch(pattern) for pattern in patterns) + + +def pytest_pycollect_makemodule(path, parent): + if path.basename == "__init__.py": + return Package(path, parent) + return Module(path, parent) + + +@hookimpl(hookwrapper=True) +def pytest_pycollect_makeitem(collector, name, obj): + outcome = yield + res = outcome.get_result() + if res is not None: + return + # nothing was collected elsewhere, let's do it here + if safe_isclass(obj): + if collector.istestclass(obj, name): + outcome.force_result(Class(name, parent=collector)) + elif collector.istestfunction(obj, name): + # mock seems to store unbound methods (issue473), normalize it + obj = getattr(obj, "__func__", obj) + # We need to try and unwrap the function if it's a functools.partial + # or a funtools.wrapped. + # We musn't if it's been wrapped with mock.patch (python 2 only) + if not (isfunction(obj) or isfunction(get_real_func(obj))): + filename, lineno = getfslineno(obj) + warnings.warn_explicit( + message=PytestCollectionWarning( + "cannot collect %r because it is not a function." % name + ), + category=None, + filename=str(filename), + lineno=lineno + 1, + ) + elif getattr(obj, "__test__", True): + if is_generator(obj): + res = Function(name, parent=collector) + reason = deprecated.YIELD_TESTS.format(name=name) + res.add_marker(MARK_GEN.xfail(run=False, reason=reason)) + res.warn(PytestCollectionWarning(reason)) + else: + res = list(collector._genfunctions(name, obj)) + outcome.force_result(res) + + +def pytest_make_parametrize_id(config, val, argname=None): + return None + + +class PyobjContext(object): + module = pyobj_property("Module") + cls = pyobj_property("Class") + instance = pyobj_property("Instance") + + +class PyobjMixin(PyobjContext): + _ALLOW_MARKERS = True + + def __init__(self, *k, **kw): + super(PyobjMixin, self).__init__(*k, **kw) + + @property + def obj(self): + """Underlying Python object.""" + obj = getattr(self, "_obj", None) + if obj is None: + self._obj = obj = self._getobj() + # XXX evil hack + # used to avoid Instance collector marker duplication + if self._ALLOW_MARKERS: + self.own_markers.extend(get_unpacked_marks(self.obj)) + return obj + + @obj.setter + def obj(self, value): + self._obj = value + + def _getobj(self): + """Gets the underlying Python object. May be overwritten by subclasses.""" + return getattr(self.parent.obj, self.name) + + def getmodpath(self, stopatmodule=True, includemodule=False): + """ return python path relative to the containing module. """ + chain = self.listchain() + chain.reverse() + parts = [] + for node in chain: + if isinstance(node, Instance): + continue + name = node.name + if isinstance(node, Module): + name = os.path.splitext(name)[0] + if stopatmodule: + if includemodule: + parts.append(name) + break + parts.append(name) + parts.reverse() + s = ".".join(parts) + return s.replace(".[", "[") + + def reportinfo(self): + # XXX caching? + obj = self.obj + compat_co_firstlineno = getattr(obj, "compat_co_firstlineno", None) + if isinstance(compat_co_firstlineno, int): + # nose compatibility + fspath = sys.modules[obj.__module__].__file__ + if fspath.endswith(".pyc"): + fspath = fspath[:-1] + lineno = compat_co_firstlineno + else: + fspath, lineno = getfslineno(obj) + modpath = self.getmodpath() + assert isinstance(lineno, int) + return fspath, lineno, modpath + + +class PyCollector(PyobjMixin, nodes.Collector): + def funcnamefilter(self, name): + return self._matches_prefix_or_glob_option("python_functions", name) + + def isnosetest(self, obj): + """ Look for the __test__ attribute, which is applied by the + @nose.tools.istest decorator + """ + # We explicitly check for "is True" here to not mistakenly treat + # classes with a custom __getattr__ returning something truthy (like a + # function) as test classes. + return safe_getattr(obj, "__test__", False) is True + + def classnamefilter(self, name): + return self._matches_prefix_or_glob_option("python_classes", name) + + def istestfunction(self, obj, name): + if self.funcnamefilter(name) or self.isnosetest(obj): + if isinstance(obj, staticmethod): + # static methods need to be unwrapped + obj = safe_getattr(obj, "__func__", False) + return ( + safe_getattr(obj, "__call__", False) + and fixtures.getfixturemarker(obj) is None + ) + else: + return False + + def istestclass(self, obj, name): + return self.classnamefilter(name) or self.isnosetest(obj) + + def _matches_prefix_or_glob_option(self, option_name, name): + """ + checks if the given name matches the prefix or glob-pattern defined + in ini configuration. + """ + for option in self.config.getini(option_name): + if name.startswith(option): + return True + # check that name looks like a glob-string before calling fnmatch + # because this is called for every name in each collected module, + # and fnmatch is somewhat expensive to call + elif ("*" in option or "?" in option or "[" in option) and fnmatch.fnmatch( + name, option + ): + return True + return False + + def collect(self): + if not getattr(self.obj, "__test__", True): + return [] + + # NB. we avoid random getattrs and peek in the __dict__ instead + # (XXX originally introduced from a PyPy need, still true?) + dicts = [getattr(self.obj, "__dict__", {})] + for basecls in inspect.getmro(self.obj.__class__): + dicts.append(basecls.__dict__) + seen = {} + values = [] + for dic in dicts: + for name, obj in list(dic.items()): + if name in seen: + continue + seen[name] = True + res = self._makeitem(name, obj) + if res is None: + continue + if not isinstance(res, list): + res = [res] + values.extend(res) + values.sort(key=lambda item: item.reportinfo()[:2]) + return values + + def _makeitem(self, name, obj): + # assert self.ihook.fspath == self.fspath, self + return self.ihook.pytest_pycollect_makeitem(collector=self, name=name, obj=obj) + + def _genfunctions(self, name, funcobj): + module = self.getparent(Module).obj + clscol = self.getparent(Class) + cls = clscol and clscol.obj or None + fm = self.session._fixturemanager + + definition = FunctionDefinition(name=name, parent=self, callobj=funcobj) + fixtureinfo = fm.getfixtureinfo(definition, funcobj, cls) + + metafunc = Metafunc( + definition, fixtureinfo, self.config, cls=cls, module=module + ) + methods = [] + if hasattr(module, "pytest_generate_tests"): + methods.append(module.pytest_generate_tests) + if hasattr(cls, "pytest_generate_tests"): + methods.append(cls().pytest_generate_tests) + if methods: + self.ihook.pytest_generate_tests.call_extra( + methods, dict(metafunc=metafunc) + ) + else: + self.ihook.pytest_generate_tests(metafunc=metafunc) + + if not metafunc._calls: + yield Function(name, parent=self, fixtureinfo=fixtureinfo) + else: + # add funcargs() as fixturedefs to fixtureinfo.arg2fixturedefs + fixtures.add_funcarg_pseudo_fixture_def(self, metafunc, fm) + + # add_funcarg_pseudo_fixture_def may have shadowed some fixtures + # with direct parametrization, so make sure we update what the + # function really needs. + fixtureinfo.prune_dependency_tree() + + for callspec in metafunc._calls: + subname = "%s[%s]" % (name, callspec.id) + yield Function( + name=subname, + parent=self, + callspec=callspec, + callobj=funcobj, + fixtureinfo=fixtureinfo, + keywords={callspec.id: True}, + originalname=name, + ) + + +class Module(nodes.File, PyCollector): + """ Collector for test classes and functions. """ + + def _getobj(self): + return self._importtestmodule() + + def collect(self): + self._inject_setup_module_fixture() + self._inject_setup_function_fixture() + self.session._fixturemanager.parsefactories(self) + return super(Module, self).collect() + + def _inject_setup_module_fixture(self): + """Injects a hidden autouse, module scoped fixture into the collected module object + that invokes setUpModule/tearDownModule if either or both are available. + + Using a fixture to invoke this methods ensures we play nicely and unsurprisingly with + other fixtures (#517). + """ + setup_module = _get_non_fixture_func(self.obj, "setUpModule") + if setup_module is None: + setup_module = _get_non_fixture_func(self.obj, "setup_module") + + teardown_module = _get_non_fixture_func(self.obj, "tearDownModule") + if teardown_module is None: + teardown_module = _get_non_fixture_func(self.obj, "teardown_module") + + if setup_module is None and teardown_module is None: + return + + @fixtures.fixture(autouse=True, scope="module") + def xunit_setup_module_fixture(request): + if setup_module is not None: + _call_with_optional_argument(setup_module, request.module) + yield + if teardown_module is not None: + _call_with_optional_argument(teardown_module, request.module) + + self.obj.__pytest_setup_module = xunit_setup_module_fixture + + def _inject_setup_function_fixture(self): + """Injects a hidden autouse, function scoped fixture into the collected module object + that invokes setup_function/teardown_function if either or both are available. + + Using a fixture to invoke this methods ensures we play nicely and unsurprisingly with + other fixtures (#517). + """ + setup_function = _get_non_fixture_func(self.obj, "setup_function") + teardown_function = _get_non_fixture_func(self.obj, "teardown_function") + if setup_function is None and teardown_function is None: + return + + @fixtures.fixture(autouse=True, scope="function") + def xunit_setup_function_fixture(request): + if request.instance is not None: + # in this case we are bound to an instance, so we need to let + # setup_method handle this + yield + return + if setup_function is not None: + _call_with_optional_argument(setup_function, request.function) + yield + if teardown_function is not None: + _call_with_optional_argument(teardown_function, request.function) + + self.obj.__pytest_setup_function = xunit_setup_function_fixture + + def _importtestmodule(self): + # we assume we are only called once per module + importmode = self.config.getoption("--import-mode") + try: + mod = self.fspath.pyimport(ensuresyspath=importmode) + except SyntaxError: + raise self.CollectError( + _pytest._code.ExceptionInfo.from_current().getrepr(style="short") + ) + except self.fspath.ImportMismatchError: + e = sys.exc_info()[1] + raise self.CollectError( + "import file mismatch:\n" + "imported module %r has this __file__ attribute:\n" + " %s\n" + "which is not the same as the test file we want to collect:\n" + " %s\n" + "HINT: remove __pycache__ / .pyc files and/or use a " + "unique basename for your test file modules" % e.args + ) + except ImportError: + from _pytest._code.code import ExceptionInfo + + exc_info = ExceptionInfo.from_current() + if self.config.getoption("verbose") < 2: + exc_info.traceback = exc_info.traceback.filter(filter_traceback) + exc_repr = ( + exc_info.getrepr(style="short") + if exc_info.traceback + else exc_info.exconly() + ) + formatted_tb = safe_str(exc_repr) + raise self.CollectError( + "ImportError while importing test module '{fspath}'.\n" + "Hint: make sure your test modules/packages have valid Python names.\n" + "Traceback:\n" + "{traceback}".format(fspath=self.fspath, traceback=formatted_tb) + ) + except _pytest.runner.Skipped as e: + if e.allow_module_level: + raise + raise self.CollectError( + "Using pytest.skip outside of a test is not allowed. " + "To decorate a test function, use the @pytest.mark.skip " + "or @pytest.mark.skipif decorators instead, and to skip a " + "module use `pytestmark = pytest.mark.{skip,skipif}." + ) + self.config.pluginmanager.consider_module(mod) + return mod + + +class Package(Module): + def __init__(self, fspath, parent=None, config=None, session=None, nodeid=None): + session = parent.session + nodes.FSCollector.__init__( + self, fspath, parent=parent, config=config, session=session, nodeid=nodeid + ) + self.name = fspath.dirname + self.trace = session.trace + self._norecursepatterns = session._norecursepatterns + self.fspath = fspath + + def setup(self): + # not using fixtures to call setup_module here because autouse fixtures + # from packages are not called automatically (#4085) + setup_module = _get_non_fixture_func(self.obj, "setUpModule") + if setup_module is None: + setup_module = _get_non_fixture_func(self.obj, "setup_module") + if setup_module is not None: + _call_with_optional_argument(setup_module, self.obj) + + teardown_module = _get_non_fixture_func(self.obj, "tearDownModule") + if teardown_module is None: + teardown_module = _get_non_fixture_func(self.obj, "teardown_module") + if teardown_module is not None: + func = partial(_call_with_optional_argument, teardown_module, self.obj) + self.addfinalizer(func) + + def _recurse(self, dirpath): + if dirpath.basename == "__pycache__": + return False + ihook = self.gethookproxy(dirpath.dirpath()) + if ihook.pytest_ignore_collect(path=dirpath, config=self.config): + return + for pat in self._norecursepatterns: + if dirpath.check(fnmatch=pat): + return False + ihook = self.gethookproxy(dirpath) + ihook.pytest_collect_directory(path=dirpath, parent=self) + return True + + def gethookproxy(self, fspath): + # check if we have the common case of running + # hooks with all conftest.py filesall conftest.py + pm = self.config.pluginmanager + my_conftestmodules = pm._getconftestmodules(fspath) + remove_mods = pm._conftest_plugins.difference(my_conftestmodules) + if remove_mods: + # one or more conftests are not in use at this fspath + proxy = FSHookProxy(fspath, pm, remove_mods) + else: + # all plugis are active for this fspath + proxy = self.config.hook + return proxy + + def _collectfile(self, path, handle_dupes=True): + assert path.isfile(), "%r is not a file (isdir=%r, exists=%r, islink=%r)" % ( + path, + path.isdir(), + path.exists(), + path.islink(), + ) + ihook = self.gethookproxy(path) + if not self.isinitpath(path): + if ihook.pytest_ignore_collect(path=path, config=self.config): + return () + + if handle_dupes: + keepduplicates = self.config.getoption("keepduplicates") + if not keepduplicates: + duplicate_paths = self.config.pluginmanager._duplicatepaths + if path in duplicate_paths: + return () + else: + duplicate_paths.add(path) + + if self.fspath == path: # __init__.py + return [self] + + return ihook.pytest_collect_file(path=path, parent=self) + + def isinitpath(self, path): + return path in self.session._initialpaths + + def collect(self): + this_path = self.fspath.dirpath() + init_module = this_path.join("__init__.py") + if init_module.check(file=1) and path_matches_patterns( + init_module, self.config.getini("python_files") + ): + yield Module(init_module, self) + pkg_prefixes = set() + for path in this_path.visit(rec=self._recurse, bf=True, sort=True): + # We will visit our own __init__.py file, in which case we skip it. + is_file = path.isfile() + if is_file: + if path.basename == "__init__.py" and path.dirpath() == this_path: + continue + + parts_ = parts(path.strpath) + if any( + pkg_prefix in parts_ and pkg_prefix.join("__init__.py") != path + for pkg_prefix in pkg_prefixes + ): + continue + + if is_file: + for x in self._collectfile(path): + yield x + elif not path.isdir(): + # Broken symlink or invalid/missing file. + continue + elif path.join("__init__.py").check(file=1): + pkg_prefixes.add(path) + + +def _get_xunit_setup_teardown(holder, attr_name, param_obj=None): + """ + Return a callable to perform xunit-style setup or teardown if + the function exists in the ``holder`` object. + The ``param_obj`` parameter is the parameter which will be passed to the function + when the callable is called without arguments, defaults to the ``holder`` object. + Return ``None`` if a suitable callable is not found. + """ + # TODO: only needed because of Package! + param_obj = param_obj if param_obj is not None else holder + result = _get_non_fixture_func(holder, attr_name) + if result is not None: + arg_count = result.__code__.co_argcount + if inspect.ismethod(result): + arg_count -= 1 + if arg_count: + return lambda: result(param_obj) + else: + return result + + +def _call_with_optional_argument(func, arg): + """Call the given function with the given argument if func accepts one argument, otherwise + calls func without arguments""" + arg_count = func.__code__.co_argcount + if inspect.ismethod(func): + arg_count -= 1 + if arg_count: + func(arg) + else: + func() + + +def _get_non_fixture_func(obj, name): + """Return the attribute from the given object to be used as a setup/teardown + xunit-style function, but only if not marked as a fixture to + avoid calling it twice. + """ + meth = getattr(obj, name, None) + if fixtures.getfixturemarker(meth) is None: + return meth + + +class Class(PyCollector): + """ Collector for test methods. """ + + def collect(self): + if not safe_getattr(self.obj, "__test__", True): + return [] + if hasinit(self.obj): + self.warn( + PytestCollectionWarning( + "cannot collect test class %r because it has a " + "__init__ constructor (from: %s)" + % (self.obj.__name__, self.parent.nodeid) + ) + ) + return [] + elif hasnew(self.obj): + self.warn( + PytestCollectionWarning( + "cannot collect test class %r because it has a " + "__new__ constructor (from: %s)" + % (self.obj.__name__, self.parent.nodeid) + ) + ) + return [] + + self._inject_setup_class_fixture() + self._inject_setup_method_fixture() + + return [Instance(name="()", parent=self)] + + def _inject_setup_class_fixture(self): + """Injects a hidden autouse, class scoped fixture into the collected class object + that invokes setup_class/teardown_class if either or both are available. + + Using a fixture to invoke this methods ensures we play nicely and unsurprisingly with + other fixtures (#517). + """ + setup_class = _get_non_fixture_func(self.obj, "setup_class") + teardown_class = getattr(self.obj, "teardown_class", None) + if setup_class is None and teardown_class is None: + return + + @fixtures.fixture(autouse=True, scope="class") + def xunit_setup_class_fixture(cls): + if setup_class is not None: + func = getimfunc(setup_class) + _call_with_optional_argument(func, self.obj) + yield + if teardown_class is not None: + func = getimfunc(teardown_class) + _call_with_optional_argument(func, self.obj) + + self.obj.__pytest_setup_class = xunit_setup_class_fixture + + def _inject_setup_method_fixture(self): + """Injects a hidden autouse, function scoped fixture into the collected class object + that invokes setup_method/teardown_method if either or both are available. + + Using a fixture to invoke this methods ensures we play nicely and unsurprisingly with + other fixtures (#517). + """ + setup_method = _get_non_fixture_func(self.obj, "setup_method") + teardown_method = getattr(self.obj, "teardown_method", None) + if setup_method is None and teardown_method is None: + return + + @fixtures.fixture(autouse=True, scope="function") + def xunit_setup_method_fixture(self, request): + method = request.function + if setup_method is not None: + func = getattr(self, "setup_method") + _call_with_optional_argument(func, method) + yield + if teardown_method is not None: + func = getattr(self, "teardown_method") + _call_with_optional_argument(func, method) + + self.obj.__pytest_setup_method = xunit_setup_method_fixture + + +class Instance(PyCollector): + _ALLOW_MARKERS = False # hack, destroy later + # instances share the object with their parents in a way + # that duplicates markers instances if not taken out + # can be removed at node structure reorganization time + + def _getobj(self): + return self.parent.obj() + + def collect(self): + self.session._fixturemanager.parsefactories(self) + return super(Instance, self).collect() + + def newinstance(self): + self.obj = self._getobj() + return self.obj + + +class FunctionMixin(PyobjMixin): + """ mixin for the code common to Function and Generator. + """ + + def setup(self): + """ perform setup for this test function. """ + if isinstance(self.parent, Instance): + self.parent.newinstance() + self.obj = self._getobj() + + def _prunetraceback(self, excinfo): + if hasattr(self, "_obj") and not self.config.getoption("fulltrace", False): + code = _pytest._code.Code(get_real_func(self.obj)) + path, firstlineno = code.path, code.firstlineno + traceback = excinfo.traceback + ntraceback = traceback.cut(path=path, firstlineno=firstlineno) + if ntraceback == traceback: + ntraceback = ntraceback.cut(path=path) + if ntraceback == traceback: + ntraceback = ntraceback.filter(filter_traceback) + if not ntraceback: + ntraceback = traceback + + excinfo.traceback = ntraceback.filter() + # issue364: mark all but first and last frames to + # only show a single-line message for each frame + if self.config.getoption("tbstyle", "auto") == "auto": + if len(excinfo.traceback) > 2: + for entry in excinfo.traceback[1:-1]: + entry.set_repr_style("short") + + def repr_failure(self, excinfo, outerr=None): + assert outerr is None, "XXX outerr usage is deprecated" + style = self.config.getoption("tbstyle", "auto") + if style == "auto": + style = "long" + return self._repr_failure_py(excinfo, style=style) + + +def hasinit(obj): + init = getattr(obj, "__init__", None) + if init: + return init != object.__init__ + + +def hasnew(obj): + new = getattr(obj, "__new__", None) + if new: + return new != object.__new__ + + +class CallSpec2(object): + def __init__(self, metafunc): + self.metafunc = metafunc + self.funcargs = {} + self._idlist = [] + self.params = {} + self._globalid = NOTSET + self._globalparam = NOTSET + self._arg2scopenum = {} # used for sorting parametrized resources + self.marks = [] + self.indices = {} + + def copy(self): + cs = CallSpec2(self.metafunc) + cs.funcargs.update(self.funcargs) + cs.params.update(self.params) + cs.marks.extend(self.marks) + cs.indices.update(self.indices) + cs._arg2scopenum.update(self._arg2scopenum) + cs._idlist = list(self._idlist) + cs._globalid = self._globalid + cs._globalparam = self._globalparam + return cs + + def _checkargnotcontained(self, arg): + if arg in self.params or arg in self.funcargs: + raise ValueError("duplicate %r" % (arg,)) + + def getparam(self, name): + try: + return self.params[name] + except KeyError: + if self._globalparam is NOTSET: + raise ValueError(name) + return self._globalparam + + @property + def id(self): + return "-".join(map(safe_str, self._idlist)) + + def setmulti2(self, valtypes, argnames, valset, id, marks, scopenum, param_index): + for arg, val in zip(argnames, valset): + self._checkargnotcontained(arg) + valtype_for_arg = valtypes[arg] + getattr(self, valtype_for_arg)[arg] = val + self.indices[arg] = param_index + self._arg2scopenum[arg] = scopenum + self._idlist.append(id) + self.marks.extend(normalize_mark_list(marks)) + + def setall(self, funcargs, id, param): + for x in funcargs: + self._checkargnotcontained(x) + self.funcargs.update(funcargs) + if id is not NOTSET: + self._idlist.append(id) + if param is not NOTSET: + assert self._globalparam is NOTSET + self._globalparam = param + for arg in funcargs: + self._arg2scopenum[arg] = fixtures.scopenum_function + + +class Metafunc(fixtures.FuncargnamesCompatAttr): + """ + Metafunc objects are passed to the :func:`pytest_generate_tests <_pytest.hookspec.pytest_generate_tests>` hook. + They help to inspect a test function and to generate tests according to + test configuration or values specified in the class or module where a + test function is defined. + """ + + def __init__(self, definition, fixtureinfo, config, cls=None, module=None): + assert ( + isinstance(definition, FunctionDefinition) + or type(definition).__name__ == "DefinitionMock" + ) + self.definition = definition + + #: access to the :class:`_pytest.config.Config` object for the test session + self.config = config + + #: the module object where the test function is defined in. + self.module = module + + #: underlying python test function + self.function = definition.obj + + #: set of fixture names required by the test function + self.fixturenames = fixtureinfo.names_closure + + #: class object where the test function is defined in or ``None``. + self.cls = cls + + self._calls = [] + self._ids = set() + self._arg2fixturedefs = fixtureinfo.name2fixturedefs + + def parametrize(self, argnames, argvalues, indirect=False, ids=None, scope=None): + """ Add new invocations to the underlying test function using the list + of argvalues for the given argnames. Parametrization is performed + during the collection phase. If you need to setup expensive resources + see about setting indirect to do it rather at test setup time. + + :arg argnames: a comma-separated string denoting one or more argument + names, or a list/tuple of argument strings. + + :arg argvalues: The list of argvalues determines how often a + test is invoked with different argument values. If only one + argname was specified argvalues is a list of values. If N + argnames were specified, argvalues must be a list of N-tuples, + where each tuple-element specifies a value for its respective + argname. + + :arg indirect: The list of argnames or boolean. A list of arguments' + names (subset of argnames). If True the list contains all names from + the argnames. Each argvalue corresponding to an argname in this list will + be passed as request.param to its respective argname fixture + function so that it can perform more expensive setups during the + setup phase of a test rather than at collection time. + + :arg ids: list of string ids, or a callable. + If strings, each is corresponding to the argvalues so that they are + part of the test id. If None is given as id of specific test, the + automatically generated id for that argument will be used. + If callable, it should take one argument (a single argvalue) and return + a string or return None. If None, the automatically generated id for that + argument will be used. + If no ids are provided they will be generated automatically from + the argvalues. + + :arg scope: if specified it denotes the scope of the parameters. + The scope is used for grouping tests by parameter instances. + It will also override any fixture-function defined scope, allowing + to set a dynamic scope using test context or configuration. + """ + from _pytest.fixtures import scope2index + from _pytest.mark import ParameterSet + + argnames, parameters = ParameterSet._for_parametrize( + argnames, + argvalues, + self.function, + self.config, + function_definition=self.definition, + ) + del argvalues + + if scope is None: + scope = _find_parametrized_scope(argnames, self._arg2fixturedefs, indirect) + + self._validate_if_using_arg_names(argnames, indirect) + + arg_values_types = self._resolve_arg_value_types(argnames, indirect) + + ids = self._resolve_arg_ids(argnames, ids, parameters, item=self.definition) + + scopenum = scope2index( + scope, descr="parametrize() call in {}".format(self.function.__name__) + ) + + # create the new calls: if we are parametrize() multiple times (by applying the decorator + # more than once) then we accumulate those calls generating the cartesian product + # of all calls + newcalls = [] + for callspec in self._calls or [CallSpec2(self)]: + for param_index, (param_id, param_set) in enumerate(zip(ids, parameters)): + newcallspec = callspec.copy() + newcallspec.setmulti2( + arg_values_types, + argnames, + param_set.values, + param_id, + param_set.marks, + scopenum, + param_index, + ) + newcalls.append(newcallspec) + self._calls = newcalls + + def _resolve_arg_ids(self, argnames, ids, parameters, item): + """Resolves the actual ids for the given argnames, based on the ``ids`` parameter given + to ``parametrize``. + + :param List[str] argnames: list of argument names passed to ``parametrize()``. + :param ids: the ids parameter of the parametrized call (see docs). + :param List[ParameterSet] parameters: the list of parameter values, same size as ``argnames``. + :param Item item: the item that generated this parametrized call. + :rtype: List[str] + :return: the list of ids for each argname given + """ + from _pytest._io.saferepr import saferepr + + idfn = None + if callable(ids): + idfn = ids + ids = None + if ids: + func_name = self.function.__name__ + if len(ids) != len(parameters): + msg = "In {}: {} parameter sets specified, with different number of ids: {}" + fail(msg.format(func_name, len(parameters), len(ids)), pytrace=False) + for id_value in ids: + if id_value is not None and not isinstance(id_value, six.string_types): + msg = "In {}: ids must be list of strings, found: {} (type: {!r})" + fail( + msg.format(func_name, saferepr(id_value), type(id_value)), + pytrace=False, + ) + ids = idmaker(argnames, parameters, idfn, ids, self.config, item=item) + return ids + + def _resolve_arg_value_types(self, argnames, indirect): + """Resolves if each parametrized argument must be considered a parameter to a fixture or a "funcarg" + to the function, based on the ``indirect`` parameter of the parametrized() call. + + :param List[str] argnames: list of argument names passed to ``parametrize()``. + :param indirect: same ``indirect`` parameter of ``parametrize()``. + :rtype: Dict[str, str] + A dict mapping each arg name to either: + * "params" if the argname should be the parameter of a fixture of the same name. + * "funcargs" if the argname should be a parameter to the parametrized test function. + """ + valtypes = {} + if indirect is True: + valtypes = dict.fromkeys(argnames, "params") + elif indirect is False: + valtypes = dict.fromkeys(argnames, "funcargs") + elif isinstance(indirect, (tuple, list)): + valtypes = dict.fromkeys(argnames, "funcargs") + for arg in indirect: + if arg not in argnames: + fail( + "In {}: indirect fixture '{}' doesn't exist".format( + self.function.__name__, arg + ), + pytrace=False, + ) + valtypes[arg] = "params" + return valtypes + + def _validate_if_using_arg_names(self, argnames, indirect): + """ + Check if all argnames are being used, by default values, or directly/indirectly. + + :param List[str] argnames: list of argument names passed to ``parametrize()``. + :param indirect: same ``indirect`` parameter of ``parametrize()``. + :raise ValueError: if validation fails. + """ + default_arg_names = set(get_default_arg_names(self.function)) + func_name = self.function.__name__ + for arg in argnames: + if arg not in self.fixturenames: + if arg in default_arg_names: + fail( + "In {}: function already takes an argument '{}' with a default value".format( + func_name, arg + ), + pytrace=False, + ) + else: + if isinstance(indirect, (tuple, list)): + name = "fixture" if arg in indirect else "argument" + else: + name = "fixture" if indirect else "argument" + fail( + "In {}: function uses no {} '{}'".format(func_name, name, arg), + pytrace=False, + ) + + +def _find_parametrized_scope(argnames, arg2fixturedefs, indirect): + """Find the most appropriate scope for a parametrized call based on its arguments. + + When there's at least one direct argument, always use "function" scope. + + When a test function is parametrized and all its arguments are indirect + (e.g. fixtures), return the most narrow scope based on the fixtures used. + + Related to issue #1832, based on code posted by @Kingdread. + """ + from _pytest.fixtures import scopes + + if isinstance(indirect, (list, tuple)): + all_arguments_are_fixtures = len(indirect) == len(argnames) + else: + all_arguments_are_fixtures = bool(indirect) + + if all_arguments_are_fixtures: + fixturedefs = arg2fixturedefs or {} + used_scopes = [ + fixturedef[0].scope + for name, fixturedef in fixturedefs.items() + if name in argnames + ] + if used_scopes: + # Takes the most narrow scope from used fixtures + for scope in reversed(scopes): + if scope in used_scopes: + return scope + + return "function" + + +def _ascii_escaped_by_config(val, config): + if config is None: + escape_option = False + else: + escape_option = config.getini( + "disable_test_id_escaping_and_forfeit_all_rights_to_community_support" + ) + return val if escape_option else ascii_escaped(val) + + +def _idval(val, argname, idx, idfn, item, config): + if idfn: + try: + generated_id = idfn(val) + if generated_id is not None: + val = generated_id + except Exception as e: + # See issue https://github.com/pytest-dev/pytest/issues/2169 + msg = "{}: error raised while trying to determine id of parameter '{}' at position {}\n" + msg = msg.format(item.nodeid, argname, idx) + # we only append the exception type and message because on Python 2 reraise does nothing + msg += " {}: {}\n".format(type(e).__name__, e) + six.raise_from(ValueError(msg), e) + elif config: + hook_id = config.hook.pytest_make_parametrize_id( + config=config, val=val, argname=argname + ) + if hook_id: + return hook_id + + if isinstance(val, STRING_TYPES): + return _ascii_escaped_by_config(val, config) + elif val is None or isinstance(val, (float, int, bool)): + return str(val) + elif isinstance(val, REGEX_TYPE): + return ascii_escaped(val.pattern) + elif enum is not None and isinstance(val, enum.Enum): + return str(val) + elif (isclass(val) or isfunction(val)) and hasattr(val, "__name__"): + return val.__name__ + return str(argname) + str(idx) + + +def limit_idval(limit): + import functools + + names = {} + limit -= 6 + assert limit > 0 + + def decorator(func): + @functools.wraps(func) + def wrapper(*args, **kw): + idval = func(*args, **kw) + if len(idval) > limit: + prefix = idval[:limit] + # There might be same prefix for the different test cases - take item into account + name = "{}-{}".format(kw.get('item', ''), safe_str(prefix)) + idx = names.setdefault(name, -1) + 1 + names[name] = idx + idval = "{}-{}".format(safe_str(prefix), idx) + return idval + + return wrapper + + return decorator + + +# XXX limit testnames in the name of sanity and readability +@limit_idval(limit=500) +def _idvalset(idx, parameterset, argnames, idfn, ids, item, config): + if parameterset.id is not None: + return parameterset.id + if ids is None or (idx >= len(ids) or ids[idx] is None): + this_id = [ + _idval(val, argname, idx, idfn, item=item, config=config) + for val, argname in zip(parameterset.values, argnames) + ] + return "-".join(this_id) + else: + return _ascii_escaped_by_config(ids[idx], config) + + +def idmaker(argnames, parametersets, idfn=None, ids=None, config=None, item=None): + ids = [ + _idvalset(valindex, parameterset, argnames, idfn, ids, config=config, item=item) + for valindex, parameterset in enumerate(parametersets) + ] + if len(set(ids)) != len(ids): + # The ids are not unique + duplicates = [testid for testid in ids if ids.count(testid) > 1] + counters = collections.defaultdict(lambda: 0) + for index, testid in enumerate(ids): + if testid in duplicates: + ids[index] = testid + str(counters[testid]) + counters[testid] += 1 + return ids + + +def show_fixtures_per_test(config): + from _pytest.main import wrap_session + + return wrap_session(config, _show_fixtures_per_test) + + +def _show_fixtures_per_test(config, session): + import _pytest.config + + session.perform_collect() + curdir = py.path.local() + tw = _pytest.config.create_terminal_writer(config) + verbose = config.getvalue("verbose") + + def get_best_relpath(func): + loc = getlocation(func, curdir) + return curdir.bestrelpath(loc) + + def write_fixture(fixture_def): + argname = fixture_def.argname + if verbose <= 0 and argname.startswith("_"): + return + if verbose > 0: + bestrel = get_best_relpath(fixture_def.func) + funcargspec = "{} -- {}".format(argname, bestrel) + else: + funcargspec = argname + tw.line(funcargspec, green=True) + fixture_doc = fixture_def.func.__doc__ + if fixture_doc: + write_docstring(tw, fixture_doc) + else: + tw.line(" no docstring available", red=True) + + def write_item(item): + try: + info = item._fixtureinfo + except AttributeError: + # doctests items have no _fixtureinfo attribute + return + if not info.name2fixturedefs: + # this test item does not use any fixtures + return + tw.line() + tw.sep("-", "fixtures used by {}".format(item.name)) + tw.sep("-", "({})".format(get_best_relpath(item.function))) + # dict key not used in loop but needed for sorting + for _, fixturedefs in sorted(info.name2fixturedefs.items()): + assert fixturedefs is not None + if not fixturedefs: + continue + # last item is expected to be the one used by the test item + write_fixture(fixturedefs[-1]) + + for session_item in session.items: + write_item(session_item) + + +def showfixtures(config): + from _pytest.main import wrap_session + + return wrap_session(config, _showfixtures_main) + + +def _showfixtures_main(config, session): + import _pytest.config + + session.perform_collect() + curdir = py.path.local() + tw = _pytest.config.create_terminal_writer(config) + verbose = config.getvalue("verbose") + + fm = session._fixturemanager + + available = [] + seen = set() + + for argname, fixturedefs in fm._arg2fixturedefs.items(): + assert fixturedefs is not None + if not fixturedefs: + continue + for fixturedef in fixturedefs: + loc = getlocation(fixturedef.func, curdir) + if (fixturedef.argname, loc) in seen: + continue + seen.add((fixturedef.argname, loc)) + available.append( + ( + len(fixturedef.baseid), + fixturedef.func.__module__, + curdir.bestrelpath(loc), + fixturedef.argname, + fixturedef, + ) + ) + + available.sort() + currentmodule = None + for baseid, module, bestrel, argname, fixturedef in available: + if currentmodule != module: + if not module.startswith("_pytest."): + tw.line() + tw.sep("-", "fixtures defined from %s" % (module,)) + currentmodule = module + if verbose <= 0 and argname[0] == "_": + continue + tw.write(argname, green=True) + if fixturedef.scope != "function": + tw.write(" [%s scope]" % fixturedef.scope, cyan=True) + if verbose > 0: + tw.write(" -- %s" % bestrel, yellow=True) + tw.write("\n") + loc = getlocation(fixturedef.func, curdir) + doc = fixturedef.func.__doc__ or "" + if doc: + write_docstring(tw, doc) + else: + tw.line(" %s: no docstring available" % (loc,), red=True) + tw.line() + + +def write_docstring(tw, doc, indent=" "): + doc = doc.rstrip() + if "\n" in doc: + firstline, rest = doc.split("\n", 1) + else: + firstline, rest = doc, "" + + if firstline.strip(): + tw.line(indent + firstline.strip()) + + if rest: + for line in dedent(rest).split("\n"): + tw.write(indent + line + "\n") + + +class Function(FunctionMixin, nodes.Item, fixtures.FuncargnamesCompatAttr): + """ a Function Item is responsible for setting up and executing a + Python test function. + """ + + # disable since functions handle it themselves + _ALLOW_MARKERS = False + + def __init__( + self, + name, + parent, + args=None, + config=None, + callspec=None, + callobj=NOTSET, + keywords=None, + session=None, + fixtureinfo=None, + originalname=None, + ): + super(Function, self).__init__(name, parent, config=config, session=session) + self._args = args + if callobj is not NOTSET: + self.obj = callobj + + self.keywords.update(self.obj.__dict__) + self.own_markers.extend(get_unpacked_marks(self.obj)) + if callspec: + self.callspec = callspec + # this is total hostile and a mess + # keywords are broken by design by now + # this will be redeemed later + for mark in callspec.marks: + # feel free to cry, this was broken for years before + # and keywords cant fix it per design + self.keywords[mark.name] = mark + self.own_markers.extend(normalize_mark_list(callspec.marks)) + if keywords: + self.keywords.update(keywords) + + # todo: this is a hell of a hack + # https://github.com/pytest-dev/pytest/issues/4569 + + self.keywords.update( + dict.fromkeys( + [ + mark.name + for mark in self.iter_markers() + if mark.name not in self.keywords + ], + True, + ) + ) + + if fixtureinfo is None: + fixtureinfo = self.session._fixturemanager.getfixtureinfo( + self, self.obj, self.cls, funcargs=True + ) + self._fixtureinfo = fixtureinfo + self.fixturenames = fixtureinfo.names_closure + self._initrequest() + + #: original function name, without any decorations (for example + #: parametrization adds a ``"[...]"`` suffix to function names). + #: + #: .. versionadded:: 3.0 + self.originalname = originalname + + def _initrequest(self): + self.funcargs = {} + self._request = fixtures.FixtureRequest(self) + + @property + def function(self): + "underlying python 'function' object" + return getimfunc(self.obj) + + def _getobj(self): + name = self.name + i = name.find("[") # parametrization + if i != -1: + name = name[:i] + return getattr(self.parent.obj, name) + + @property + def _pyfuncitem(self): + "(compatonly) for code expecting pytest-2.2 style request objects" + return self + + def runtest(self): + """ execute the underlying test function. """ + self.ihook.pytest_pyfunc_call(pyfuncitem=self) + + def setup(self): + super(Function, self).setup() + fixtures.fillfixtures(self) + + +class FunctionDefinition(Function): + """ + internal hack until we get actual definition nodes instead of the + crappy metafunc hack + """ + + def runtest(self): + raise RuntimeError("function definitions are not supposed to be used") + + setup = runtest diff --git a/contrib/python/pytest/py2/_pytest/python_api.py b/contrib/python/pytest/py2/_pytest/python_api.py new file mode 100644 index 00000000000..f6e475c3a24 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/python_api.py @@ -0,0 +1,743 @@ +# -*- coding: utf-8 -*- +from __future__ import absolute_import + +import math +import pprint +import sys +import warnings +from decimal import Decimal +from numbers import Number + +from more_itertools.more import always_iterable +from six.moves import filterfalse +from six.moves import zip + +import _pytest._code +from _pytest import deprecated +from _pytest.compat import isclass +from _pytest.compat import Iterable +from _pytest.compat import Mapping +from _pytest.compat import Sized +from _pytest.compat import STRING_TYPES +from _pytest.outcomes import fail + +BASE_TYPE = (type, STRING_TYPES) + + +def _cmp_raises_type_error(self, other): + """__cmp__ implementation which raises TypeError. Used + by Approx base classes to implement only == and != and raise a + TypeError for other comparisons. + + Needed in Python 2 only, Python 3 all it takes is not implementing the + other operators at all. + """ + __tracebackhide__ = True + raise TypeError( + "Comparison operators other than == and != not supported by approx objects" + ) + + +def _non_numeric_type_error(value, at): + at_str = " at {}".format(at) if at else "" + return TypeError( + "cannot make approximate comparisons to non-numeric values: {!r} {}".format( + value, at_str + ) + ) + + +# builtin pytest.approx helper + + +class ApproxBase(object): + """ + Provide shared utilities for making approximate comparisons between numbers + or sequences of numbers. + """ + + # Tell numpy to use our `__eq__` operator instead of its. + __array_ufunc__ = None + __array_priority__ = 100 + + def __init__(self, expected, rel=None, abs=None, nan_ok=False): + __tracebackhide__ = True + self.expected = expected + self.abs = abs + self.rel = rel + self.nan_ok = nan_ok + self._check_type() + + def __repr__(self): + raise NotImplementedError + + def __eq__(self, actual): + return all( + a == self._approx_scalar(x) for a, x in self._yield_comparisons(actual) + ) + + __hash__ = None + + def __ne__(self, actual): + return not (actual == self) + + if sys.version_info[0] == 2: + __cmp__ = _cmp_raises_type_error + + def _approx_scalar(self, x): + return ApproxScalar(x, rel=self.rel, abs=self.abs, nan_ok=self.nan_ok) + + def _yield_comparisons(self, actual): + """ + Yield all the pairs of numbers to be compared. This is used to + implement the `__eq__` method. + """ + raise NotImplementedError + + def _check_type(self): + """ + Raise a TypeError if the expected value is not a valid type. + """ + # This is only a concern if the expected value is a sequence. In every + # other case, the approx() function ensures that the expected value has + # a numeric type. For this reason, the default is to do nothing. The + # classes that deal with sequences should reimplement this method to + # raise if there are any non-numeric elements in the sequence. + pass + + +def _recursive_list_map(f, x): + if isinstance(x, list): + return list(_recursive_list_map(f, xi) for xi in x) + else: + return f(x) + + +class ApproxNumpy(ApproxBase): + """ + Perform approximate comparisons where the expected value is numpy array. + """ + + def __repr__(self): + list_scalars = _recursive_list_map(self._approx_scalar, self.expected.tolist()) + return "approx({!r})".format(list_scalars) + + if sys.version_info[0] == 2: + __cmp__ = _cmp_raises_type_error + + def __eq__(self, actual): + import numpy as np + + # self.expected is supposed to always be an array here + + if not np.isscalar(actual): + try: + actual = np.asarray(actual) + except: # noqa + raise TypeError("cannot compare '{}' to numpy.ndarray".format(actual)) + + if not np.isscalar(actual) and actual.shape != self.expected.shape: + return False + + return ApproxBase.__eq__(self, actual) + + def _yield_comparisons(self, actual): + import numpy as np + + # `actual` can either be a numpy array or a scalar, it is treated in + # `__eq__` before being passed to `ApproxBase.__eq__`, which is the + # only method that calls this one. + + if np.isscalar(actual): + for i in np.ndindex(self.expected.shape): + yield actual, self.expected[i].item() + else: + for i in np.ndindex(self.expected.shape): + yield actual[i].item(), self.expected[i].item() + + +class ApproxMapping(ApproxBase): + """ + Perform approximate comparisons where the expected value is a mapping with + numeric values (the keys can be anything). + """ + + def __repr__(self): + return "approx({!r})".format( + {k: self._approx_scalar(v) for k, v in self.expected.items()} + ) + + def __eq__(self, actual): + if set(actual.keys()) != set(self.expected.keys()): + return False + + return ApproxBase.__eq__(self, actual) + + def _yield_comparisons(self, actual): + for k in self.expected.keys(): + yield actual[k], self.expected[k] + + def _check_type(self): + __tracebackhide__ = True + for key, value in self.expected.items(): + if isinstance(value, type(self.expected)): + msg = "pytest.approx() does not support nested dictionaries: key={!r} value={!r}\n full mapping={}" + raise TypeError(msg.format(key, value, pprint.pformat(self.expected))) + elif not isinstance(value, Number): + raise _non_numeric_type_error(self.expected, at="key={!r}".format(key)) + + +class ApproxSequencelike(ApproxBase): + """ + Perform approximate comparisons where the expected value is a sequence of + numbers. + """ + + def __repr__(self): + seq_type = type(self.expected) + if seq_type not in (tuple, list, set): + seq_type = list + return "approx({!r})".format( + seq_type(self._approx_scalar(x) for x in self.expected) + ) + + def __eq__(self, actual): + if len(actual) != len(self.expected): + return False + return ApproxBase.__eq__(self, actual) + + def _yield_comparisons(self, actual): + return zip(actual, self.expected) + + def _check_type(self): + __tracebackhide__ = True + for index, x in enumerate(self.expected): + if isinstance(x, type(self.expected)): + msg = "pytest.approx() does not support nested data structures: {!r} at index {}\n full sequence: {}" + raise TypeError(msg.format(x, index, pprint.pformat(self.expected))) + elif not isinstance(x, Number): + raise _non_numeric_type_error( + self.expected, at="index {}".format(index) + ) + + +class ApproxScalar(ApproxBase): + """ + Perform approximate comparisons where the expected value is a single number. + """ + + DEFAULT_ABSOLUTE_TOLERANCE = 1e-12 + DEFAULT_RELATIVE_TOLERANCE = 1e-6 + + def __repr__(self): + """ + Return a string communicating both the expected value and the tolerance + for the comparison being made, e.g. '1.0 +- 1e-6'. Use the unicode + plus/minus symbol if this is python3 (it's too hard to get right for + python2). + """ + if isinstance(self.expected, complex): + return str(self.expected) + + # Infinities aren't compared using tolerances, so don't show a + # tolerance. + if math.isinf(self.expected): + return str(self.expected) + + # If a sensible tolerance can't be calculated, self.tolerance will + # raise a ValueError. In this case, display '???'. + try: + vetted_tolerance = "{:.1e}".format(self.tolerance) + except ValueError: + vetted_tolerance = "???" + + if sys.version_info[0] == 2: + return "{} +- {}".format(self.expected, vetted_tolerance) + else: + return u"{} \u00b1 {}".format(self.expected, vetted_tolerance) + + def __eq__(self, actual): + """ + Return true if the given value is equal to the expected value within + the pre-specified tolerance. + """ + if _is_numpy_array(actual): + # Call ``__eq__()`` manually to prevent infinite-recursion with + # numpy<1.13. See #3748. + return all(self.__eq__(a) for a in actual.flat) + + # Short-circuit exact equality. + if actual == self.expected: + return True + + # Allow the user to control whether NaNs are considered equal to each + # other or not. The abs() calls are for compatibility with complex + # numbers. + if math.isnan(abs(self.expected)): + return self.nan_ok and math.isnan(abs(actual)) + + # Infinity shouldn't be approximately equal to anything but itself, but + # if there's a relative tolerance, it will be infinite and infinity + # will seem approximately equal to everything. The equal-to-itself + # case would have been short circuited above, so here we can just + # return false if the expected value is infinite. The abs() call is + # for compatibility with complex numbers. + if math.isinf(abs(self.expected)): + return False + + # Return true if the two numbers are within the tolerance. + return abs(self.expected - actual) <= self.tolerance + + __hash__ = None + + @property + def tolerance(self): + """ + Return the tolerance for the comparison. This could be either an + absolute tolerance or a relative tolerance, depending on what the user + specified or which would be larger. + """ + + def set_default(x, default): + return x if x is not None else default + + # Figure out what the absolute tolerance should be. ``self.abs`` is + # either None or a value specified by the user. + absolute_tolerance = set_default(self.abs, self.DEFAULT_ABSOLUTE_TOLERANCE) + + if absolute_tolerance < 0: + raise ValueError( + "absolute tolerance can't be negative: {}".format(absolute_tolerance) + ) + if math.isnan(absolute_tolerance): + raise ValueError("absolute tolerance can't be NaN.") + + # If the user specified an absolute tolerance but not a relative one, + # just return the absolute tolerance. + if self.rel is None: + if self.abs is not None: + return absolute_tolerance + + # Figure out what the relative tolerance should be. ``self.rel`` is + # either None or a value specified by the user. This is done after + # we've made sure the user didn't ask for an absolute tolerance only, + # because we don't want to raise errors about the relative tolerance if + # we aren't even going to use it. + relative_tolerance = set_default( + self.rel, self.DEFAULT_RELATIVE_TOLERANCE + ) * abs(self.expected) + + if relative_tolerance < 0: + raise ValueError( + "relative tolerance can't be negative: {}".format(absolute_tolerance) + ) + if math.isnan(relative_tolerance): + raise ValueError("relative tolerance can't be NaN.") + + # Return the larger of the relative and absolute tolerances. + return max(relative_tolerance, absolute_tolerance) + + +class ApproxDecimal(ApproxScalar): + """ + Perform approximate comparisons where the expected value is a decimal. + """ + + DEFAULT_ABSOLUTE_TOLERANCE = Decimal("1e-12") + DEFAULT_RELATIVE_TOLERANCE = Decimal("1e-6") + + +def approx(expected, rel=None, abs=None, nan_ok=False): + """ + Assert that two numbers (or two sets of numbers) are equal to each other + within some tolerance. + + Due to the `intricacies of floating-point arithmetic`__, numbers that we + would intuitively expect to be equal are not always so:: + + >>> 0.1 + 0.2 == 0.3 + False + + __ https://docs.python.org/3/tutorial/floatingpoint.html + + This problem is commonly encountered when writing tests, e.g. when making + sure that floating-point values are what you expect them to be. One way to + deal with this problem is to assert that two floating-point numbers are + equal to within some appropriate tolerance:: + + >>> abs((0.1 + 0.2) - 0.3) < 1e-6 + True + + However, comparisons like this are tedious to write and difficult to + understand. Furthermore, absolute comparisons like the one above are + usually discouraged because there's no tolerance that works well for all + situations. ``1e-6`` is good for numbers around ``1``, but too small for + very big numbers and too big for very small ones. It's better to express + the tolerance as a fraction of the expected value, but relative comparisons + like that are even more difficult to write correctly and concisely. + + The ``approx`` class performs floating-point comparisons using a syntax + that's as intuitive as possible:: + + >>> from pytest import approx + >>> 0.1 + 0.2 == approx(0.3) + True + + The same syntax also works for sequences of numbers:: + + >>> (0.1 + 0.2, 0.2 + 0.4) == approx((0.3, 0.6)) + True + + Dictionary *values*:: + + >>> {'a': 0.1 + 0.2, 'b': 0.2 + 0.4} == approx({'a': 0.3, 'b': 0.6}) + True + + ``numpy`` arrays:: + + >>> import numpy as np # doctest: +SKIP + >>> np.array([0.1, 0.2]) + np.array([0.2, 0.4]) == approx(np.array([0.3, 0.6])) # doctest: +SKIP + True + + And for a ``numpy`` array against a scalar:: + + >>> import numpy as np # doctest: +SKIP + >>> np.array([0.1, 0.2]) + np.array([0.2, 0.1]) == approx(0.3) # doctest: +SKIP + True + + By default, ``approx`` considers numbers within a relative tolerance of + ``1e-6`` (i.e. one part in a million) of its expected value to be equal. + This treatment would lead to surprising results if the expected value was + ``0.0``, because nothing but ``0.0`` itself is relatively close to ``0.0``. + To handle this case less surprisingly, ``approx`` also considers numbers + within an absolute tolerance of ``1e-12`` of its expected value to be + equal. Infinity and NaN are special cases. Infinity is only considered + equal to itself, regardless of the relative tolerance. NaN is not + considered equal to anything by default, but you can make it be equal to + itself by setting the ``nan_ok`` argument to True. (This is meant to + facilitate comparing arrays that use NaN to mean "no data".) + + Both the relative and absolute tolerances can be changed by passing + arguments to the ``approx`` constructor:: + + >>> 1.0001 == approx(1) + False + >>> 1.0001 == approx(1, rel=1e-3) + True + >>> 1.0001 == approx(1, abs=1e-3) + True + + If you specify ``abs`` but not ``rel``, the comparison will not consider + the relative tolerance at all. In other words, two numbers that are within + the default relative tolerance of ``1e-6`` will still be considered unequal + if they exceed the specified absolute tolerance. If you specify both + ``abs`` and ``rel``, the numbers will be considered equal if either + tolerance is met:: + + >>> 1 + 1e-8 == approx(1) + True + >>> 1 + 1e-8 == approx(1, abs=1e-12) + False + >>> 1 + 1e-8 == approx(1, rel=1e-6, abs=1e-12) + True + + If you're thinking about using ``approx``, then you might want to know how + it compares to other good ways of comparing floating-point numbers. All of + these algorithms are based on relative and absolute tolerances and should + agree for the most part, but they do have meaningful differences: + + - ``math.isclose(a, b, rel_tol=1e-9, abs_tol=0.0)``: True if the relative + tolerance is met w.r.t. either ``a`` or ``b`` or if the absolute + tolerance is met. Because the relative tolerance is calculated w.r.t. + both ``a`` and ``b``, this test is symmetric (i.e. neither ``a`` nor + ``b`` is a "reference value"). You have to specify an absolute tolerance + if you want to compare to ``0.0`` because there is no tolerance by + default. Only available in python>=3.5. `More information...`__ + + __ https://docs.python.org/3/library/math.html#math.isclose + + - ``numpy.isclose(a, b, rtol=1e-5, atol=1e-8)``: True if the difference + between ``a`` and ``b`` is less that the sum of the relative tolerance + w.r.t. ``b`` and the absolute tolerance. Because the relative tolerance + is only calculated w.r.t. ``b``, this test is asymmetric and you can + think of ``b`` as the reference value. Support for comparing sequences + is provided by ``numpy.allclose``. `More information...`__ + + __ http://docs.scipy.org/doc/numpy-1.10.0/reference/generated/numpy.isclose.html + + - ``unittest.TestCase.assertAlmostEqual(a, b)``: True if ``a`` and ``b`` + are within an absolute tolerance of ``1e-7``. No relative tolerance is + considered and the absolute tolerance cannot be changed, so this function + is not appropriate for very large or very small numbers. Also, it's only + available in subclasses of ``unittest.TestCase`` and it's ugly because it + doesn't follow PEP8. `More information...`__ + + __ https://docs.python.org/3/library/unittest.html#unittest.TestCase.assertAlmostEqual + + - ``a == pytest.approx(b, rel=1e-6, abs=1e-12)``: True if the relative + tolerance is met w.r.t. ``b`` or if the absolute tolerance is met. + Because the relative tolerance is only calculated w.r.t. ``b``, this test + is asymmetric and you can think of ``b`` as the reference value. In the + special case that you explicitly specify an absolute tolerance but not a + relative tolerance, only the absolute tolerance is considered. + + .. warning:: + + .. versionchanged:: 3.2 + + In order to avoid inconsistent behavior, ``TypeError`` is + raised for ``>``, ``>=``, ``<`` and ``<=`` comparisons. + The example below illustrates the problem:: + + assert approx(0.1) > 0.1 + 1e-10 # calls approx(0.1).__gt__(0.1 + 1e-10) + assert 0.1 + 1e-10 > approx(0.1) # calls approx(0.1).__lt__(0.1 + 1e-10) + + In the second example one expects ``approx(0.1).__le__(0.1 + 1e-10)`` + to be called. But instead, ``approx(0.1).__lt__(0.1 + 1e-10)`` is used to + comparison. This is because the call hierarchy of rich comparisons + follows a fixed behavior. `More information...`__ + + __ https://docs.python.org/3/reference/datamodel.html#object.__ge__ + """ + + # Delegate the comparison to a class that knows how to deal with the type + # of the expected value (e.g. int, float, list, dict, numpy.array, etc). + # + # The primary responsibility of these classes is to implement ``__eq__()`` + # and ``__repr__()``. The former is used to actually check if some + # "actual" value is equivalent to the given expected value within the + # allowed tolerance. The latter is used to show the user the expected + # value and tolerance, in the case that a test failed. + # + # The actual logic for making approximate comparisons can be found in + # ApproxScalar, which is used to compare individual numbers. All of the + # other Approx classes eventually delegate to this class. The ApproxBase + # class provides some convenient methods and overloads, but isn't really + # essential. + + __tracebackhide__ = True + + if isinstance(expected, Decimal): + cls = ApproxDecimal + elif isinstance(expected, Number): + cls = ApproxScalar + elif isinstance(expected, Mapping): + cls = ApproxMapping + elif _is_numpy_array(expected): + cls = ApproxNumpy + elif ( + isinstance(expected, Iterable) + and isinstance(expected, Sized) + and not isinstance(expected, STRING_TYPES) + ): + cls = ApproxSequencelike + else: + raise _non_numeric_type_error(expected, at=None) + + return cls(expected, rel, abs, nan_ok) + + +def _is_numpy_array(obj): + """ + Return true if the given object is a numpy array. Make a special effort to + avoid importing numpy unless it's really necessary. + """ + import sys + + np = sys.modules.get("numpy") + if np is not None: + return isinstance(obj, np.ndarray) + return False + + +# builtin pytest.raises helper + + +def raises(expected_exception, *args, **kwargs): + r""" + Assert that a code block/function call raises ``expected_exception`` + or raise a failure exception otherwise. + + :kwparam match: if specified, a string containing a regular expression, + or a regular expression object, that is tested against the string + representation of the exception using ``re.search``. To match a literal + string that may contain `special characters`__, the pattern can + first be escaped with ``re.escape``. + + __ https://docs.python.org/3/library/re.html#regular-expression-syntax + + :kwparam message: **(deprecated since 4.1)** if specified, provides a custom failure message + if the exception is not raised. See :ref:`the deprecation docs <raises message deprecated>` for a workaround. + + .. currentmodule:: _pytest._code + + Use ``pytest.raises`` as a context manager, which will capture the exception of the given + type:: + + >>> with raises(ZeroDivisionError): + ... 1/0 + + If the code block does not raise the expected exception (``ZeroDivisionError`` in the example + above), or no exception at all, the check will fail instead. + + You can also use the keyword argument ``match`` to assert that the + exception matches a text or regex:: + + >>> with raises(ValueError, match='must be 0 or None'): + ... raise ValueError("value must be 0 or None") + + >>> with raises(ValueError, match=r'must be \d+$'): + ... raise ValueError("value must be 42") + + The context manager produces an :class:`ExceptionInfo` object which can be used to inspect the + details of the captured exception:: + + >>> with raises(ValueError) as exc_info: + ... raise ValueError("value must be 42") + >>> assert exc_info.type is ValueError + >>> assert exc_info.value.args[0] == "value must be 42" + + .. deprecated:: 4.1 + + In the context manager form you may use the keyword argument + ``message`` to specify a custom failure message that will be displayed + in case the ``pytest.raises`` check fails. This has been deprecated as it + is considered error prone as users often mean to use ``match`` instead. + See :ref:`the deprecation docs <raises message deprecated>` for a workaround. + + .. note:: + + When using ``pytest.raises`` as a context manager, it's worthwhile to + note that normal context manager rules apply and that the exception + raised *must* be the final line in the scope of the context manager. + Lines of code after that, within the scope of the context manager will + not be executed. For example:: + + >>> value = 15 + >>> with raises(ValueError) as exc_info: + ... if value > 10: + ... raise ValueError("value must be <= 10") + ... assert exc_info.type is ValueError # this will not execute + + Instead, the following approach must be taken (note the difference in + scope):: + + >>> with raises(ValueError) as exc_info: + ... if value > 10: + ... raise ValueError("value must be <= 10") + ... + >>> assert exc_info.type is ValueError + + **Using with** ``pytest.mark.parametrize`` + + When using :ref:`pytest.mark.parametrize ref` + it is possible to parametrize tests such that + some runs raise an exception and others do not. + + See :ref:`parametrizing_conditional_raising` for an example. + + **Legacy form** + + It is possible to specify a callable by passing a to-be-called lambda:: + + >>> raises(ZeroDivisionError, lambda: 1/0) + <ExceptionInfo ...> + + or you can specify an arbitrary callable with arguments:: + + >>> def f(x): return 1/x + ... + >>> raises(ZeroDivisionError, f, 0) + <ExceptionInfo ...> + >>> raises(ZeroDivisionError, f, x=0) + <ExceptionInfo ...> + + The form above is fully supported but discouraged for new code because the + context manager form is regarded as more readable and less error-prone. + + .. note:: + Similar to caught exception objects in Python, explicitly clearing + local references to returned ``ExceptionInfo`` objects can + help the Python interpreter speed up its garbage collection. + + Clearing those references breaks a reference cycle + (``ExceptionInfo`` --> caught exception --> frame stack raising + the exception --> current frame stack --> local variables --> + ``ExceptionInfo``) which makes Python keep all objects referenced + from that cycle (including all local variables in the current + frame) alive until the next cyclic garbage collection run. See the + official Python ``try`` statement documentation for more detailed + information. + + """ + __tracebackhide__ = True + for exc in filterfalse(isclass, always_iterable(expected_exception, BASE_TYPE)): + msg = ( + "exceptions must be old-style classes or" + " derived from BaseException, not %s" + ) + raise TypeError(msg % type(exc)) + + message = "DID NOT RAISE {}".format(expected_exception) + match_expr = None + + if not args: + if "message" in kwargs: + message = kwargs.pop("message") + warnings.warn(deprecated.RAISES_MESSAGE_PARAMETER, stacklevel=2) + if "match" in kwargs: + match_expr = kwargs.pop("match") + if kwargs: + msg = "Unexpected keyword arguments passed to pytest.raises: " + msg += ", ".join(sorted(kwargs)) + raise TypeError(msg) + return RaisesContext(expected_exception, message, match_expr) + elif isinstance(args[0], str): + warnings.warn(deprecated.RAISES_EXEC, stacklevel=2) + (code,) = args + assert isinstance(code, str) + frame = sys._getframe(1) + loc = frame.f_locals.copy() + loc.update(kwargs) + # print "raises frame scope: %r" % frame.f_locals + try: + code = _pytest._code.Source(code).compile(_genframe=frame) + exec(code, frame.f_globals, loc) + # XXX didn't mean f_globals == f_locals something special? + # this is destroyed here ... + except expected_exception: + return _pytest._code.ExceptionInfo.from_current() + else: + func = args[0] + try: + func(*args[1:], **kwargs) + except expected_exception: + return _pytest._code.ExceptionInfo.from_current() + fail(message) + + +raises.Exception = fail.Exception + + +class RaisesContext(object): + def __init__(self, expected_exception, message, match_expr): + self.expected_exception = expected_exception + self.message = message + self.match_expr = match_expr + self.excinfo = None + + def __enter__(self): + self.excinfo = _pytest._code.ExceptionInfo.for_later() + return self.excinfo + + def __exit__(self, *tp): + __tracebackhide__ = True + if tp[0] is None: + fail(self.message) + self.excinfo.__init__(tp) + suppress_exception = issubclass(self.excinfo.type, self.expected_exception) + if sys.version_info[0] == 2 and suppress_exception: + sys.exc_clear() + if self.match_expr is not None and suppress_exception: + self.excinfo.match(self.match_expr) + return suppress_exception diff --git a/contrib/python/pytest/py2/_pytest/recwarn.py b/contrib/python/pytest/py2/_pytest/recwarn.py new file mode 100644 index 00000000000..7abf2e93550 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/recwarn.py @@ -0,0 +1,251 @@ +# -*- coding: utf-8 -*- +""" recording warnings during test function execution. """ +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import inspect +import re +import sys +import warnings + +import six + +import _pytest._code +from _pytest.deprecated import PYTEST_WARNS_UNKNOWN_KWARGS +from _pytest.deprecated import WARNS_EXEC +from _pytest.fixtures import yield_fixture +from _pytest.outcomes import fail + + +@yield_fixture +def recwarn(): + """Return a :class:`WarningsRecorder` instance that records all warnings emitted by test functions. + + See http://docs.python.org/library/warnings.html for information + on warning categories. + """ + wrec = WarningsRecorder() + with wrec: + warnings.simplefilter("default") + yield wrec + + +def deprecated_call(func=None, *args, **kwargs): + """context manager that can be used to ensure a block of code triggers a + ``DeprecationWarning`` or ``PendingDeprecationWarning``:: + + >>> import warnings + >>> def api_call_v2(): + ... warnings.warn('use v3 of this api', DeprecationWarning) + ... return 200 + + >>> with deprecated_call(): + ... assert api_call_v2() == 200 + + ``deprecated_call`` can also be used by passing a function and ``*args`` and ``*kwargs``, + in which case it will ensure calling ``func(*args, **kwargs)`` produces one of the warnings + types above. + """ + __tracebackhide__ = True + if func is not None: + args = (func,) + args + return warns((DeprecationWarning, PendingDeprecationWarning), *args, **kwargs) + + +def warns(expected_warning, *args, **kwargs): + r"""Assert that code raises a particular class of warning. + + Specifically, the parameter ``expected_warning`` can be a warning class or + sequence of warning classes, and the inside the ``with`` block must issue a warning of that class or + classes. + + This helper produces a list of :class:`warnings.WarningMessage` objects, + one for each warning raised. + + This function can be used as a context manager, or any of the other ways + ``pytest.raises`` can be used:: + + >>> with warns(RuntimeWarning): + ... warnings.warn("my warning", RuntimeWarning) + + In the context manager form you may use the keyword argument ``match`` to assert + that the exception matches a text or regex:: + + >>> with warns(UserWarning, match='must be 0 or None'): + ... warnings.warn("value must be 0 or None", UserWarning) + + >>> with warns(UserWarning, match=r'must be \d+$'): + ... warnings.warn("value must be 42", UserWarning) + + >>> with warns(UserWarning, match=r'must be \d+$'): + ... warnings.warn("this is not here", UserWarning) + Traceback (most recent call last): + ... + Failed: DID NOT WARN. No warnings of type ...UserWarning... was emitted... + + """ + __tracebackhide__ = True + if not args: + match_expr = kwargs.pop("match", None) + if kwargs: + warnings.warn( + PYTEST_WARNS_UNKNOWN_KWARGS.format(args=sorted(kwargs)), stacklevel=2 + ) + return WarningsChecker(expected_warning, match_expr=match_expr) + elif isinstance(args[0], str): + warnings.warn(WARNS_EXEC, stacklevel=2) + (code,) = args + assert isinstance(code, str) + frame = sys._getframe(1) + loc = frame.f_locals.copy() + loc.update(kwargs) + + with WarningsChecker(expected_warning): + code = _pytest._code.Source(code).compile() + exec(code, frame.f_globals, loc) + else: + func = args[0] + with WarningsChecker(expected_warning): + return func(*args[1:], **kwargs) + + +class WarningsRecorder(warnings.catch_warnings): + """A context manager to record raised warnings. + + Adapted from `warnings.catch_warnings`. + """ + + def __init__(self): + super(WarningsRecorder, self).__init__(record=True) + self._entered = False + self._list = [] + + @property + def list(self): + """The list of recorded warnings.""" + return self._list + + def __getitem__(self, i): + """Get a recorded warning by index.""" + return self._list[i] + + def __iter__(self): + """Iterate through the recorded warnings.""" + return iter(self._list) + + def __len__(self): + """The number of recorded warnings.""" + return len(self._list) + + def pop(self, cls=Warning): + """Pop the first recorded warning, raise exception if not exists.""" + for i, w in enumerate(self._list): + if issubclass(w.category, cls): + return self._list.pop(i) + __tracebackhide__ = True + raise AssertionError("%r not found in warning list" % cls) + + def clear(self): + """Clear the list of recorded warnings.""" + self._list[:] = [] + + def __enter__(self): + if self._entered: + __tracebackhide__ = True + raise RuntimeError("Cannot enter %r twice" % self) + self._list = super(WarningsRecorder, self).__enter__() + warnings.simplefilter("always") + # python3 keeps track of a "filter version", when the filters are + # updated previously seen warnings can be re-warned. python2 has no + # concept of this so we must reset the warnings registry manually. + # trivial patching of `warnings.warn` seems to be enough somehow? + if six.PY2: + + def warn(message, category=None, stacklevel=1): + # duplicate the stdlib logic due to + # bad handing in the c version of warnings + if isinstance(message, Warning): + category = message.__class__ + # Check category argument + if category is None: + category = UserWarning + assert issubclass(category, Warning) + + # emulate resetting the warn registry + f_globals = sys._getframe(stacklevel).f_globals + if "__warningregistry__" in f_globals: + orig = f_globals["__warningregistry__"] + f_globals["__warningregistry__"] = None + try: + return self._saved_warn(message, category, stacklevel + 1) + finally: + f_globals["__warningregistry__"] = orig + else: + return self._saved_warn(message, category, stacklevel + 1) + + warnings.warn, self._saved_warn = warn, warnings.warn + return self + + def __exit__(self, *exc_info): + if not self._entered: + __tracebackhide__ = True + raise RuntimeError("Cannot exit %r without entering first" % self) + # see above where `self._saved_warn` is assigned + if six.PY2: + warnings.warn = self._saved_warn + super(WarningsRecorder, self).__exit__(*exc_info) + + # Built-in catch_warnings does not reset entered state so we do it + # manually here for this context manager to become reusable. + self._entered = False + + +class WarningsChecker(WarningsRecorder): + def __init__(self, expected_warning=None, match_expr=None): + super(WarningsChecker, self).__init__() + + msg = "exceptions must be old-style classes or derived from Warning, not %s" + if isinstance(expected_warning, tuple): + for exc in expected_warning: + if not inspect.isclass(exc): + raise TypeError(msg % type(exc)) + elif inspect.isclass(expected_warning): + expected_warning = (expected_warning,) + elif expected_warning is not None: + raise TypeError(msg % type(expected_warning)) + + self.expected_warning = expected_warning + self.match_expr = match_expr + + def __exit__(self, *exc_info): + super(WarningsChecker, self).__exit__(*exc_info) + + __tracebackhide__ = True + + # only check if we're not currently handling an exception + if all(a is None for a in exc_info): + if self.expected_warning is not None: + if not any(issubclass(r.category, self.expected_warning) for r in self): + __tracebackhide__ = True + fail( + "DID NOT WARN. No warnings of type {} was emitted. " + "The list of emitted warnings is: {}.".format( + self.expected_warning, [each.message for each in self] + ) + ) + elif self.match_expr is not None: + for r in self: + if issubclass(r.category, self.expected_warning): + if re.compile(self.match_expr).search(str(r.message)): + break + else: + fail( + "DID NOT WARN. No warnings of type {} matching" + " ('{}') was emitted. The list of emitted warnings" + " is: {}.".format( + self.expected_warning, + self.match_expr, + [each.message for each in self], + ) + ) diff --git a/contrib/python/pytest/py2/_pytest/reports.py b/contrib/python/pytest/py2/_pytest/reports.py new file mode 100644 index 00000000000..0bba6762c33 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/reports.py @@ -0,0 +1,435 @@ +# -*- coding: utf-8 -*- +from pprint import pprint + +import py +import six + +from _pytest._code.code import ExceptionInfo +from _pytest._code.code import ReprEntry +from _pytest._code.code import ReprEntryNative +from _pytest._code.code import ReprExceptionInfo +from _pytest._code.code import ReprFileLocation +from _pytest._code.code import ReprFuncArgs +from _pytest._code.code import ReprLocals +from _pytest._code.code import ReprTraceback +from _pytest._code.code import TerminalRepr +from _pytest.outcomes import skip +from _pytest.pathlib import Path + + +def getslaveinfoline(node): + try: + return node._slaveinfocache + except AttributeError: + d = node.slaveinfo + ver = "%s.%s.%s" % d["version_info"][:3] + node._slaveinfocache = s = "[%s] %s -- Python %s %s" % ( + d["id"], + d["sysplatform"], + ver, + d["executable"], + ) + return s + + +class BaseReport(object): + when = None + location = None + + def __init__(self, **kw): + self.__dict__.update(kw) + + def toterminal(self, out): + if hasattr(self, "node"): + out.line(getslaveinfoline(self.node)) + + longrepr = self.longrepr + if longrepr is None: + return + + if hasattr(longrepr, "toterminal"): + longrepr.toterminal(out) + else: + try: + out.line(longrepr) + except UnicodeEncodeError: + out.line("<unprintable longrepr>") + + def get_sections(self, prefix): + for name, content in self.sections: + if name.startswith(prefix): + yield prefix, content + + @property + def longreprtext(self): + """ + Read-only property that returns the full string representation + of ``longrepr``. + + .. versionadded:: 3.0 + """ + tw = py.io.TerminalWriter(stringio=True) + tw.hasmarkup = False + self.toterminal(tw) + exc = tw.stringio.getvalue() + return exc.strip() + + @property + def caplog(self): + """Return captured log lines, if log capturing is enabled + + .. versionadded:: 3.5 + """ + return "\n".join( + content for (prefix, content) in self.get_sections("Captured log") + ) + + @property + def capstdout(self): + """Return captured text from stdout, if capturing is enabled + + .. versionadded:: 3.0 + """ + return "".join( + content for (prefix, content) in self.get_sections("Captured stdout") + ) + + @property + def capstderr(self): + """Return captured text from stderr, if capturing is enabled + + .. versionadded:: 3.0 + """ + return "".join( + content for (prefix, content) in self.get_sections("Captured stderr") + ) + + passed = property(lambda x: x.outcome == "passed") + failed = property(lambda x: x.outcome == "failed") + skipped = property(lambda x: x.outcome == "skipped") + + @property + def fspath(self): + return self.nodeid.split("::")[0] + + @property + def count_towards_summary(self): + """ + **Experimental** + + Returns True if this report should be counted towards the totals shown at the end of the + test session: "1 passed, 1 failure, etc". + + .. note:: + + This function is considered **experimental**, so beware that it is subject to changes + even in patch releases. + """ + return True + + @property + def head_line(self): + """ + **Experimental** + + Returns the head line shown with longrepr output for this report, more commonly during + traceback representation during failures:: + + ________ Test.foo ________ + + + In the example above, the head_line is "Test.foo". + + .. note:: + + This function is considered **experimental**, so beware that it is subject to changes + even in patch releases. + """ + if self.location is not None: + fspath, lineno, domain = self.location + return domain + + def _get_verbose_word(self, config): + _category, _short, verbose = config.hook.pytest_report_teststatus( + report=self, config=config + ) + return verbose + + def _to_json(self): + """ + This was originally the serialize_report() function from xdist (ca03269). + + Returns the contents of this report as a dict of builtin entries, suitable for + serialization. + + Experimental method. + """ + + def disassembled_report(rep): + reprtraceback = rep.longrepr.reprtraceback.__dict__.copy() + reprcrash = rep.longrepr.reprcrash.__dict__.copy() + + new_entries = [] + for entry in reprtraceback["reprentries"]: + entry_data = { + "type": type(entry).__name__, + "data": entry.__dict__.copy(), + } + for key, value in entry_data["data"].items(): + if hasattr(value, "__dict__"): + entry_data["data"][key] = value.__dict__.copy() + new_entries.append(entry_data) + + reprtraceback["reprentries"] = new_entries + + return { + "reprcrash": reprcrash, + "reprtraceback": reprtraceback, + "sections": rep.longrepr.sections, + } + + d = self.__dict__.copy() + if hasattr(self.longrepr, "toterminal"): + if hasattr(self.longrepr, "reprtraceback") and hasattr( + self.longrepr, "reprcrash" + ): + d["longrepr"] = disassembled_report(self) + else: + d["longrepr"] = six.text_type(self.longrepr) + else: + d["longrepr"] = self.longrepr + for name in d: + if isinstance(d[name], (py.path.local, Path)): + d[name] = str(d[name]) + elif name == "result": + d[name] = None # for now + return d + + @classmethod + def _from_json(cls, reportdict): + """ + This was originally the serialize_report() function from xdist (ca03269). + + Factory method that returns either a TestReport or CollectReport, depending on the calling + class. It's the callers responsibility to know which class to pass here. + + Experimental method. + """ + if reportdict["longrepr"]: + if ( + "reprcrash" in reportdict["longrepr"] + and "reprtraceback" in reportdict["longrepr"] + ): + + reprtraceback = reportdict["longrepr"]["reprtraceback"] + reprcrash = reportdict["longrepr"]["reprcrash"] + + unserialized_entries = [] + reprentry = None + for entry_data in reprtraceback["reprentries"]: + data = entry_data["data"] + entry_type = entry_data["type"] + if entry_type == "ReprEntry": + reprfuncargs = None + reprfileloc = None + reprlocals = None + if data["reprfuncargs"]: + reprfuncargs = ReprFuncArgs(**data["reprfuncargs"]) + if data["reprfileloc"]: + reprfileloc = ReprFileLocation(**data["reprfileloc"]) + if data["reprlocals"]: + reprlocals = ReprLocals(data["reprlocals"]["lines"]) + + reprentry = ReprEntry( + lines=data["lines"], + reprfuncargs=reprfuncargs, + reprlocals=reprlocals, + filelocrepr=reprfileloc, + style=data["style"], + ) + elif entry_type == "ReprEntryNative": + reprentry = ReprEntryNative(data["lines"]) + else: + _report_unserialization_failure(entry_type, cls, reportdict) + unserialized_entries.append(reprentry) + reprtraceback["reprentries"] = unserialized_entries + + exception_info = ReprExceptionInfo( + reprtraceback=ReprTraceback(**reprtraceback), + reprcrash=ReprFileLocation(**reprcrash), + ) + + for section in reportdict["longrepr"]["sections"]: + exception_info.addsection(*section) + reportdict["longrepr"] = exception_info + + return cls(**reportdict) + + +def _report_unserialization_failure(type_name, report_class, reportdict): + url = "https://github.com/pytest-dev/pytest/issues" + stream = py.io.TextIO() + pprint("-" * 100, stream=stream) + pprint("INTERNALERROR: Unknown entry type returned: %s" % type_name, stream=stream) + pprint("report_name: %s" % report_class, stream=stream) + pprint(reportdict, stream=stream) + pprint("Please report this bug at %s" % url, stream=stream) + pprint("-" * 100, stream=stream) + raise RuntimeError(stream.getvalue()) + + +class TestReport(BaseReport): + """ Basic test report object (also used for setup and teardown calls if + they fail). + """ + + __test__ = False + + def __init__( + self, + nodeid, + location, + keywords, + outcome, + longrepr, + when, + sections=(), + duration=0, + user_properties=None, + **extra + ): + #: normalized collection node id + self.nodeid = nodeid + + #: a (filesystempath, lineno, domaininfo) tuple indicating the + #: actual location of a test item - it might be different from the + #: collected one e.g. if a method is inherited from a different module. + self.location = location + + #: a name -> value dictionary containing all keywords and + #: markers associated with a test invocation. + self.keywords = keywords + + #: test outcome, always one of "passed", "failed", "skipped". + self.outcome = outcome + + #: None or a failure representation. + self.longrepr = longrepr + + #: one of 'setup', 'call', 'teardown' to indicate runtest phase. + self.when = when + + #: user properties is a list of tuples (name, value) that holds user + #: defined properties of the test + self.user_properties = list(user_properties or []) + + #: list of pairs ``(str, str)`` of extra information which needs to + #: marshallable. Used by pytest to add captured text + #: from ``stdout`` and ``stderr``, but may be used by other plugins + #: to add arbitrary information to reports. + self.sections = list(sections) + + #: time it took to run just the test + self.duration = duration + + self.__dict__.update(extra) + + def __repr__(self): + return "<%s %r when=%r outcome=%r>" % ( + self.__class__.__name__, + self.nodeid, + self.when, + self.outcome, + ) + + @classmethod + def from_item_and_call(cls, item, call): + """ + Factory method to create and fill a TestReport with standard item and call info. + """ + when = call.when + duration = call.stop - call.start + keywords = {x: 1 for x in item.keywords} + excinfo = call.excinfo + sections = [] + if not call.excinfo: + outcome = "passed" + longrepr = None + else: + if not isinstance(excinfo, ExceptionInfo): + outcome = "failed" + longrepr = excinfo + elif excinfo.errisinstance(skip.Exception): + outcome = "skipped" + r = excinfo._getreprcrash() + longrepr = (str(r.path), r.lineno, r.message) + else: + outcome = "failed" + if call.when == "call": + longrepr = item.repr_failure(excinfo) + else: # exception in setup or teardown + longrepr = item._repr_failure_py( + excinfo, style=item.config.getoption("tbstyle", "auto") + ) + for rwhen, key, content in item._report_sections: + sections.append(("Captured %s %s" % (key, rwhen), content)) + return cls( + item.nodeid, + item.location, + keywords, + outcome, + longrepr, + when, + sections, + duration, + user_properties=item.user_properties, + ) + + +class CollectReport(BaseReport): + when = "collect" + + def __init__(self, nodeid, outcome, longrepr, result, sections=(), **extra): + self.nodeid = nodeid + self.outcome = outcome + self.longrepr = longrepr + self.result = result or [] + self.sections = list(sections) + self.__dict__.update(extra) + + @property + def location(self): + return (self.fspath, None, self.fspath) + + def __repr__(self): + return "<CollectReport %r lenresult=%s outcome=%r>" % ( + self.nodeid, + len(self.result), + self.outcome, + ) + + +class CollectErrorRepr(TerminalRepr): + def __init__(self, msg): + self.longrepr = msg + + def toterminal(self, out): + out.line(self.longrepr, red=True) + + +def pytest_report_to_serializable(report): + if isinstance(report, (TestReport, CollectReport)): + data = report._to_json() + data["_report_type"] = report.__class__.__name__ + return data + + +def pytest_report_from_serializable(data): + if "_report_type" in data: + if data["_report_type"] == "TestReport": + return TestReport._from_json(data) + elif data["_report_type"] == "CollectReport": + return CollectReport._from_json(data) + assert False, "Unknown report_type unserialize data: {}".format( + data["_report_type"] + ) diff --git a/contrib/python/pytest/py2/_pytest/resultlog.py b/contrib/python/pytest/py2/_pytest/resultlog.py new file mode 100644 index 00000000000..bd30b5071e9 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/resultlog.py @@ -0,0 +1,102 @@ +# -*- coding: utf-8 -*- +""" log machine-parseable test session result information in a plain +text file. +""" +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import os + +import py + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting", "resultlog plugin options") + group.addoption( + "--resultlog", + "--result-log", + action="store", + metavar="path", + default=None, + help="DEPRECATED path for machine-readable result log.", + ) + + +def pytest_configure(config): + resultlog = config.option.resultlog + # prevent opening resultlog on slave nodes (xdist) + if resultlog and not hasattr(config, "slaveinput"): + dirname = os.path.dirname(os.path.abspath(resultlog)) + if not os.path.isdir(dirname): + os.makedirs(dirname) + logfile = open(resultlog, "w", 1) # line buffered + config._resultlog = ResultLog(config, logfile) + config.pluginmanager.register(config._resultlog) + + from _pytest.deprecated import RESULT_LOG + from _pytest.warnings import _issue_warning_captured + + _issue_warning_captured(RESULT_LOG, config.hook, stacklevel=2) + + +def pytest_unconfigure(config): + resultlog = getattr(config, "_resultlog", None) + if resultlog: + resultlog.logfile.close() + del config._resultlog + config.pluginmanager.unregister(resultlog) + + +class ResultLog(object): + def __init__(self, config, logfile): + self.config = config + self.logfile = logfile # preferably line buffered + + def write_log_entry(self, testpath, lettercode, longrepr): + print("%s %s" % (lettercode, testpath), file=self.logfile) + for line in longrepr.splitlines(): + print(" %s" % line, file=self.logfile) + + def log_outcome(self, report, lettercode, longrepr): + testpath = getattr(report, "nodeid", None) + if testpath is None: + testpath = report.fspath + self.write_log_entry(testpath, lettercode, longrepr) + + def pytest_runtest_logreport(self, report): + if report.when != "call" and report.passed: + return + res = self.config.hook.pytest_report_teststatus( + report=report, config=self.config + ) + code = res[1] + if code == "x": + longrepr = str(report.longrepr) + elif code == "X": + longrepr = "" + elif report.passed: + longrepr = "" + elif report.failed: + longrepr = str(report.longrepr) + elif report.skipped: + longrepr = str(report.longrepr[2]) + self.log_outcome(report, code, longrepr) + + def pytest_collectreport(self, report): + if not report.passed: + if report.failed: + code = "F" + longrepr = str(report.longrepr) + else: + assert report.skipped + code = "S" + longrepr = "%s:%d: %s" % report.longrepr + self.log_outcome(report, code, longrepr) + + def pytest_internalerror(self, excrepr): + reprcrash = getattr(excrepr, "reprcrash", None) + path = getattr(reprcrash, "path", None) + if path is None: + path = "cwd:%s" % py.path.local() + self.write_log_entry(path, "!", str(excrepr)) diff --git a/contrib/python/pytest/py2/_pytest/runner.py b/contrib/python/pytest/py2/_pytest/runner.py new file mode 100644 index 00000000000..34ae9177388 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/runner.py @@ -0,0 +1,376 @@ +# -*- coding: utf-8 -*- +""" basic collect and runtest protocol implementations """ +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import bdb +import os +import sys +from time import time + +import attr +import six + +from .reports import CollectErrorRepr +from .reports import CollectReport +from .reports import TestReport +from _pytest._code.code import ExceptionInfo +from _pytest.compat import safe_str +from _pytest.outcomes import Exit +from _pytest.outcomes import Skipped +from _pytest.outcomes import TEST_OUTCOME + +# +# pytest plugin hooks + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting", "reporting", after="general") + group.addoption( + "--durations", + action="store", + type=int, + default=None, + metavar="N", + help="show N slowest setup/test durations (N=0 for all).", + ), + + +def pytest_terminal_summary(terminalreporter): + durations = terminalreporter.config.option.durations + verbose = terminalreporter.config.getvalue("verbose") + if durations is None: + return + tr = terminalreporter + dlist = [] + for replist in tr.stats.values(): + for rep in replist: + if hasattr(rep, "duration"): + dlist.append(rep) + if not dlist: + return + dlist.sort(key=lambda x: x.duration) + dlist.reverse() + if not durations: + tr.write_sep("=", "slowest test durations") + else: + tr.write_sep("=", "slowest %s test durations" % durations) + dlist = dlist[:durations] + + for rep in dlist: + if verbose < 2 and rep.duration < 0.005: + tr.write_line("") + tr.write_line("(0.00 durations hidden. Use -vv to show these durations.)") + break + tr.write_line("%02.2fs %-8s %s" % (rep.duration, rep.when, rep.nodeid)) + + +def pytest_sessionstart(session): + session._setupstate = SetupState() + + +def pytest_sessionfinish(session): + session._setupstate.teardown_all() + + +def pytest_runtest_protocol(item, nextitem): + item.ihook.pytest_runtest_logstart(nodeid=item.nodeid, location=item.location) + runtestprotocol(item, nextitem=nextitem) + item.ihook.pytest_runtest_logfinish(nodeid=item.nodeid, location=item.location) + return True + + +def runtestprotocol(item, log=True, nextitem=None): + hasrequest = hasattr(item, "_request") + if hasrequest and not item._request: + item._initrequest() + rep = call_and_report(item, "setup", log) + reports = [rep] + if rep.passed: + if item.config.getoption("setupshow", False): + show_test_item(item) + if not item.config.getoption("setuponly", False): + reports.append(call_and_report(item, "call", log)) + reports.append(call_and_report(item, "teardown", log, nextitem=nextitem)) + # after all teardown hooks have been called + # want funcargs and request info to go away + if hasrequest: + item._request = False + item.funcargs = None + return reports + + +def show_test_item(item): + """Show test function, parameters and the fixtures of the test item.""" + tw = item.config.get_terminal_writer() + tw.line() + tw.write(" " * 8) + tw.write(item._nodeid) + used_fixtures = sorted(item._fixtureinfo.name2fixturedefs.keys()) + if used_fixtures: + tw.write(" (fixtures used: {})".format(", ".join(used_fixtures))) + + +def pytest_runtest_setup(item): + _update_current_test_var(item, "setup") + item.session._setupstate.prepare(item) + + +def pytest_runtest_call(item): + _update_current_test_var(item, "call") + sys.last_type, sys.last_value, sys.last_traceback = (None, None, None) + try: + item.runtest() + except Exception: + # Store trace info to allow postmortem debugging + type, value, tb = sys.exc_info() + tb = tb.tb_next # Skip *this* frame + sys.last_type = type + sys.last_value = value + sys.last_traceback = tb + del type, value, tb # Get rid of these in this frame + raise + + +def pytest_runtest_teardown(item, nextitem): + _update_current_test_var(item, "teardown") + item.session._setupstate.teardown_exact(item, nextitem) + _update_current_test_var(item, None) + + +def _update_current_test_var(item, when): + """ + Update PYTEST_CURRENT_TEST to reflect the current item and stage. + + If ``when`` is None, delete PYTEST_CURRENT_TEST from the environment. + """ + var_name = "PYTEST_CURRENT_TEST" + if when: + value = "{} ({})".format(item.nodeid, when) + # don't allow null bytes on environment variables (see #2644, #2957) + value = value.replace("\x00", "(null)") + os.environ[var_name] = value + else: + os.environ.pop(var_name) + + +def pytest_report_teststatus(report): + if report.when in ("setup", "teardown"): + if report.failed: + # category, shortletter, verbose-word + return "error", "E", "ERROR" + elif report.skipped: + return "skipped", "s", "SKIPPED" + else: + return "", "", "" + + +# +# Implementation + + +def call_and_report(item, when, log=True, **kwds): + call = call_runtest_hook(item, when, **kwds) + hook = item.ihook + report = hook.pytest_runtest_makereport(item=item, call=call) + if log: + hook.pytest_runtest_logreport(report=report) + if check_interactive_exception(call, report): + hook.pytest_exception_interact(node=item, call=call, report=report) + return report + + +def check_interactive_exception(call, report): + return call.excinfo and not ( + hasattr(report, "wasxfail") + or call.excinfo.errisinstance(Skipped) + or call.excinfo.errisinstance(bdb.BdbQuit) + ) + + +def call_runtest_hook(item, when, **kwds): + hookname = "pytest_runtest_" + when + ihook = getattr(item.ihook, hookname) + reraise = (Exit,) + if not item.config.getoption("usepdb", False): + reraise += (KeyboardInterrupt,) + return CallInfo.from_call( + lambda: ihook(item=item, **kwds), when=when, reraise=reraise + ) + + +@attr.s(repr=False) +class CallInfo(object): + """ Result/Exception info a function invocation. """ + + _result = attr.ib() + # Optional[ExceptionInfo] + excinfo = attr.ib() + start = attr.ib() + stop = attr.ib() + when = attr.ib() + + @property + def result(self): + if self.excinfo is not None: + raise AttributeError("{!r} has no valid result".format(self)) + return self._result + + @classmethod + def from_call(cls, func, when, reraise=None): + #: context of invocation: one of "setup", "call", + #: "teardown", "memocollect" + start = time() + excinfo = None + try: + result = func() + except: # noqa + excinfo = ExceptionInfo.from_current() + if reraise is not None and excinfo.errisinstance(reraise): + raise + result = None + stop = time() + return cls(start=start, stop=stop, when=when, result=result, excinfo=excinfo) + + def __repr__(self): + if self.excinfo is not None: + status = "exception" + value = self.excinfo.value + else: + # TODO: investigate unification + value = repr(self._result) + status = "result" + return "<CallInfo when={when!r} {status}: {value}>".format( + when=self.when, value=safe_str(value), status=status + ) + + +def pytest_runtest_makereport(item, call): + return TestReport.from_item_and_call(item, call) + + +def pytest_make_collect_report(collector): + call = CallInfo.from_call(lambda: list(collector.collect()), "collect") + longrepr = None + if not call.excinfo: + outcome = "passed" + else: + from _pytest import nose + + skip_exceptions = (Skipped,) + nose.get_skip_exceptions() + if call.excinfo.errisinstance(skip_exceptions): + outcome = "skipped" + r = collector._repr_failure_py(call.excinfo, "line").reprcrash + longrepr = (str(r.path), r.lineno, r.message) + else: + outcome = "failed" + errorinfo = collector.repr_failure(call.excinfo) + if not hasattr(errorinfo, "toterminal"): + errorinfo = CollectErrorRepr(errorinfo) + longrepr = errorinfo + rep = CollectReport( + collector.nodeid, outcome, longrepr, getattr(call, "result", None) + ) + rep.call = call # see collect_one_node + return rep + + +class SetupState(object): + """ shared state for setting up/tearing down test items or collectors. """ + + def __init__(self): + self.stack = [] + self._finalizers = {} + + def addfinalizer(self, finalizer, colitem): + """ attach a finalizer to the given colitem. + if colitem is None, this will add a finalizer that + is called at the end of teardown_all(). + """ + assert colitem and not isinstance(colitem, tuple) + assert callable(finalizer) + # assert colitem in self.stack # some unit tests don't setup stack :/ + self._finalizers.setdefault(colitem, []).append(finalizer) + + def _pop_and_teardown(self): + colitem = self.stack.pop() + self._teardown_with_finalization(colitem) + + def _callfinalizers(self, colitem): + finalizers = self._finalizers.pop(colitem, None) + exc = None + while finalizers: + fin = finalizers.pop() + try: + fin() + except TEST_OUTCOME: + # XXX Only first exception will be seen by user, + # ideally all should be reported. + if exc is None: + exc = sys.exc_info() + if exc: + six.reraise(*exc) + + def _teardown_with_finalization(self, colitem): + self._callfinalizers(colitem) + if hasattr(colitem, "teardown"): + colitem.teardown() + for colitem in self._finalizers: + assert ( + colitem is None or colitem in self.stack or isinstance(colitem, tuple) + ) + + def teardown_all(self): + while self.stack: + self._pop_and_teardown() + for key in list(self._finalizers): + self._teardown_with_finalization(key) + assert not self._finalizers + + def teardown_exact(self, item, nextitem): + needed_collectors = nextitem and nextitem.listchain() or [] + self._teardown_towards(needed_collectors) + + def _teardown_towards(self, needed_collectors): + exc = None + while self.stack: + if self.stack == needed_collectors[: len(self.stack)]: + break + try: + self._pop_and_teardown() + except TEST_OUTCOME: + # XXX Only first exception will be seen by user, + # ideally all should be reported. + if exc is None: + exc = sys.exc_info() + if exc: + six.reraise(*exc) + + def prepare(self, colitem): + """ setup objects along the collector chain to the test-method + and teardown previously setup objects.""" + needed_collectors = colitem.listchain() + self._teardown_towards(needed_collectors) + + # check if the last collection node has raised an error + for col in self.stack: + if hasattr(col, "_prepare_exc"): + six.reraise(*col._prepare_exc) + for col in needed_collectors[len(self.stack) :]: + self.stack.append(col) + try: + col.setup() + except TEST_OUTCOME: + col._prepare_exc = sys.exc_info() + raise + + +def collect_one_node(collector): + ihook = collector.ihook + ihook.pytest_collectstart(collector=collector) + rep = ihook.pytest_make_collect_report(collector=collector) + call = rep.__dict__.pop("call", None) + if call and check_interactive_exception(call, rep): + ihook.pytest_exception_interact(node=collector, call=call, report=rep) + return rep diff --git a/contrib/python/pytest/py2/_pytest/setuponly.py b/contrib/python/pytest/py2/_pytest/setuponly.py new file mode 100644 index 00000000000..0859011241a --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/setuponly.py @@ -0,0 +1,89 @@ +# -*- coding: utf-8 -*- +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import sys + +import pytest + + +def pytest_addoption(parser): + group = parser.getgroup("debugconfig") + group.addoption( + "--setuponly", + "--setup-only", + action="store_true", + help="only setup fixtures, do not execute tests.", + ) + group.addoption( + "--setupshow", + "--setup-show", + action="store_true", + help="show setup of fixtures while executing tests.", + ) + + +@pytest.hookimpl(hookwrapper=True) +def pytest_fixture_setup(fixturedef, request): + yield + config = request.config + if config.option.setupshow: + if hasattr(request, "param"): + # Save the fixture parameter so ._show_fixture_action() can + # display it now and during the teardown (in .finish()). + if fixturedef.ids: + if callable(fixturedef.ids): + fixturedef.cached_param = fixturedef.ids(request.param) + else: + fixturedef.cached_param = fixturedef.ids[request.param_index] + else: + fixturedef.cached_param = request.param + _show_fixture_action(fixturedef, "SETUP") + + +def pytest_fixture_post_finalizer(fixturedef): + if hasattr(fixturedef, "cached_result"): + config = fixturedef._fixturemanager.config + if config.option.setupshow: + _show_fixture_action(fixturedef, "TEARDOWN") + if hasattr(fixturedef, "cached_param"): + del fixturedef.cached_param + + +def _show_fixture_action(fixturedef, msg): + config = fixturedef._fixturemanager.config + capman = config.pluginmanager.getplugin("capturemanager") + if capman: + capman.suspend_global_capture() + out, err = capman.read_global_capture() + + tw = config.get_terminal_writer() + tw.line() + tw.write(" " * 2 * fixturedef.scopenum) + tw.write( + "{step} {scope} {fixture}".format( + step=msg.ljust(8), # align the output to TEARDOWN + scope=fixturedef.scope[0].upper(), + fixture=fixturedef.argname, + ) + ) + + if msg == "SETUP": + deps = sorted(arg for arg in fixturedef.argnames if arg != "request") + if deps: + tw.write(" (fixtures used: {})".format(", ".join(deps))) + + if hasattr(fixturedef, "cached_param"): + tw.write("[{}]".format(fixturedef.cached_param)) + + if capman: + capman.resume_global_capture() + sys.stdout.write(out) + sys.stderr.write(err) + + +@pytest.hookimpl(tryfirst=True) +def pytest_cmdline_main(config): + if config.option.setuponly: + config.option.setupshow = True diff --git a/contrib/python/pytest/py2/_pytest/setupplan.py b/contrib/python/pytest/py2/_pytest/setupplan.py new file mode 100644 index 00000000000..47b0fe82ef6 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/setupplan.py @@ -0,0 +1,32 @@ +# -*- coding: utf-8 -*- +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import pytest + + +def pytest_addoption(parser): + group = parser.getgroup("debugconfig") + group.addoption( + "--setupplan", + "--setup-plan", + action="store_true", + help="show what fixtures and tests would be executed but " + "don't execute anything.", + ) + + +@pytest.hookimpl(tryfirst=True) +def pytest_fixture_setup(fixturedef, request): + # Will return a dummy fixture if the setuponly option is provided. + if request.config.option.setupplan: + fixturedef.cached_result = (None, None, None) + return fixturedef.cached_result + + +@pytest.hookimpl(tryfirst=True) +def pytest_cmdline_main(config): + if config.option.setupplan: + config.option.setuponly = True + config.option.setupshow = True diff --git a/contrib/python/pytest/py2/_pytest/skipping.py b/contrib/python/pytest/py2/_pytest/skipping.py new file mode 100644 index 00000000000..bc8b88e7178 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/skipping.py @@ -0,0 +1,186 @@ +# -*- coding: utf-8 -*- +""" support for skip/xfail functions and markers. """ +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +from _pytest.config import hookimpl +from _pytest.mark.evaluate import MarkEvaluator +from _pytest.outcomes import fail +from _pytest.outcomes import skip +from _pytest.outcomes import xfail + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group.addoption( + "--runxfail", + action="store_true", + dest="runxfail", + default=False, + help="report the results of xfail tests as if they were not marked", + ) + + parser.addini( + "xfail_strict", + "default for the strict parameter of xfail " + "markers when not given explicitly (default: False)", + default=False, + type="bool", + ) + + +def pytest_configure(config): + if config.option.runxfail: + # yay a hack + import pytest + + old = pytest.xfail + config._cleanup.append(lambda: setattr(pytest, "xfail", old)) + + def nop(*args, **kwargs): + pass + + nop.Exception = xfail.Exception + setattr(pytest, "xfail", nop) + + config.addinivalue_line( + "markers", + "skip(reason=None): skip the given test function with an optional reason. " + 'Example: skip(reason="no way of currently testing this") skips the ' + "test.", + ) + config.addinivalue_line( + "markers", + "skipif(condition): skip the given test function if eval(condition) " + "results in a True value. Evaluation happens within the " + "module global context. Example: skipif('sys.platform == \"win32\"') " + "skips the test if we are on the win32 platform. see " + "https://docs.pytest.org/en/latest/skipping.html", + ) + config.addinivalue_line( + "markers", + "xfail(condition, reason=None, run=True, raises=None, strict=False): " + "mark the test function as an expected failure if eval(condition) " + "has a True value. Optionally specify a reason for better reporting " + "and run=False if you don't even want to execute the test function. " + "If only specific exception(s) are expected, you can list them in " + "raises, and if the test fails in other ways, it will be reported as " + "a true failure. See https://docs.pytest.org/en/latest/skipping.html", + ) + + +@hookimpl(tryfirst=True) +def pytest_runtest_setup(item): + # Check if skip or skipif are specified as pytest marks + item._skipped_by_mark = False + eval_skipif = MarkEvaluator(item, "skipif") + if eval_skipif.istrue(): + item._skipped_by_mark = True + skip(eval_skipif.getexplanation()) + + for skip_info in item.iter_markers(name="skip"): + item._skipped_by_mark = True + if "reason" in skip_info.kwargs: + skip(skip_info.kwargs["reason"]) + elif skip_info.args: + skip(skip_info.args[0]) + else: + skip("unconditional skip") + + item._evalxfail = MarkEvaluator(item, "xfail") + check_xfail_no_run(item) + + +@hookimpl(hookwrapper=True) +def pytest_pyfunc_call(pyfuncitem): + check_xfail_no_run(pyfuncitem) + outcome = yield + passed = outcome.excinfo is None + if passed: + check_strict_xfail(pyfuncitem) + + +def check_xfail_no_run(item): + """check xfail(run=False)""" + if not item.config.option.runxfail: + evalxfail = item._evalxfail + if evalxfail.istrue(): + if not evalxfail.get("run", True): + xfail("[NOTRUN] " + evalxfail.getexplanation()) + + +def check_strict_xfail(pyfuncitem): + """check xfail(strict=True) for the given PASSING test""" + evalxfail = pyfuncitem._evalxfail + if evalxfail.istrue(): + strict_default = pyfuncitem.config.getini("xfail_strict") + is_strict_xfail = evalxfail.get("strict", strict_default) + if is_strict_xfail: + del pyfuncitem._evalxfail + explanation = evalxfail.getexplanation() + fail("[XPASS(strict)] " + explanation, pytrace=False) + + +@hookimpl(hookwrapper=True) +def pytest_runtest_makereport(item, call): + outcome = yield + rep = outcome.get_result() + evalxfail = getattr(item, "_evalxfail", None) + # unitttest special case, see setting of _unexpectedsuccess + if hasattr(item, "_unexpectedsuccess") and rep.when == "call": + from _pytest.compat import _is_unittest_unexpected_success_a_failure + + if item._unexpectedsuccess: + rep.longrepr = "Unexpected success: {}".format(item._unexpectedsuccess) + else: + rep.longrepr = "Unexpected success" + if _is_unittest_unexpected_success_a_failure(): + rep.outcome = "failed" + else: + rep.outcome = "passed" + rep.wasxfail = rep.longrepr + elif item.config.option.runxfail: + pass # don't interefere + elif call.excinfo and call.excinfo.errisinstance(xfail.Exception): + rep.wasxfail = "reason: " + call.excinfo.value.msg + rep.outcome = "skipped" + elif evalxfail and not rep.skipped and evalxfail.wasvalid() and evalxfail.istrue(): + if call.excinfo: + if evalxfail.invalidraise(call.excinfo.value): + rep.outcome = "failed" + else: + rep.outcome = "skipped" + rep.wasxfail = evalxfail.getexplanation() + elif call.when == "call": + strict_default = item.config.getini("xfail_strict") + is_strict_xfail = evalxfail.get("strict", strict_default) + explanation = evalxfail.getexplanation() + if is_strict_xfail: + rep.outcome = "failed" + rep.longrepr = "[XPASS(strict)] {}".format(explanation) + else: + rep.outcome = "passed" + rep.wasxfail = explanation + elif ( + getattr(item, "_skipped_by_mark", False) + and rep.skipped + and type(rep.longrepr) is tuple + ): + # skipped by mark.skipif; change the location of the failure + # to point to the item definition, otherwise it will display + # the location of where the skip exception was raised within pytest + filename, line, reason = rep.longrepr + filename, line = item.location[:2] + rep.longrepr = filename, line, reason + + +# called by terminalreporter progress reporting + + +def pytest_report_teststatus(report): + if hasattr(report, "wasxfail"): + if report.skipped: + return "xfailed", "x", "XFAIL" + elif report.passed: + return "xpassed", "X", "XPASS" diff --git a/contrib/python/pytest/py2/_pytest/stepwise.py b/contrib/python/pytest/py2/_pytest/stepwise.py new file mode 100644 index 00000000000..88902595896 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/stepwise.py @@ -0,0 +1,109 @@ +# -*- coding: utf-8 -*- +import pytest + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group.addoption( + "--sw", + "--stepwise", + action="store_true", + dest="stepwise", + help="exit on test failure and continue from last failing test next time", + ) + group.addoption( + "--stepwise-skip", + action="store_true", + dest="stepwise_skip", + help="ignore the first failing test but stop on the next failing test", + ) + + +@pytest.hookimpl +def pytest_configure(config): + config.pluginmanager.register(StepwisePlugin(config), "stepwiseplugin") + + +class StepwisePlugin: + def __init__(self, config): + self.config = config + self.active = config.getvalue("stepwise") + self.session = None + self.report_status = "" + + if self.active: + self.lastfailed = config.cache.get("cache/stepwise", None) + self.skip = config.getvalue("stepwise_skip") + + def pytest_sessionstart(self, session): + self.session = session + + def pytest_collection_modifyitems(self, session, config, items): + if not self.active: + return + if not self.lastfailed: + self.report_status = "no previously failed tests, not skipping." + return + + already_passed = [] + found = False + + # Make a list of all tests that have been run before the last failing one. + for item in items: + if item.nodeid == self.lastfailed: + found = True + break + else: + already_passed.append(item) + + # If the previously failed test was not found among the test items, + # do not skip any tests. + if not found: + self.report_status = "previously failed test not found, not skipping." + already_passed = [] + else: + self.report_status = "skipping {} already passed items.".format( + len(already_passed) + ) + + for item in already_passed: + items.remove(item) + + config.hook.pytest_deselected(items=already_passed) + + def pytest_runtest_logreport(self, report): + if not self.active: + return + + if report.failed: + if self.skip: + # Remove test from the failed ones (if it exists) and unset the skip option + # to make sure the following tests will not be skipped. + if report.nodeid == self.lastfailed: + self.lastfailed = None + + self.skip = False + else: + # Mark test as the last failing and interrupt the test session. + self.lastfailed = report.nodeid + self.session.shouldstop = ( + "Test failed, continuing from this test next run." + ) + + else: + # If the test was actually run and did pass. + if report.when == "call": + # Remove test from the failed ones, if exists. + if report.nodeid == self.lastfailed: + self.lastfailed = None + + def pytest_report_collectionfinish(self): + if self.active and self.config.getoption("verbose") >= 0 and self.report_status: + return "stepwise: %s" % self.report_status + + def pytest_sessionfinish(self, session): + if self.active: + self.config.cache.set("cache/stepwise", self.lastfailed) + else: + # Clear the list of failing tests if the plugin is not active. + self.config.cache.set("cache/stepwise", []) diff --git a/contrib/python/pytest/py2/_pytest/terminal.py b/contrib/python/pytest/py2/_pytest/terminal.py new file mode 100644 index 00000000000..4418338c656 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/terminal.py @@ -0,0 +1,1090 @@ +# -*- coding: utf-8 -*- +""" terminal reporting of the full testing process. + +This is a good source for looking at the various reporting hooks. +""" +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import argparse +import collections +import platform +import sys +import time +from functools import partial + +import attr +import pluggy +import py +import six +from more_itertools import collapse + +import pytest +from _pytest import nodes +from _pytest.main import EXIT_INTERRUPTED +from _pytest.main import EXIT_NOTESTSCOLLECTED +from _pytest.main import EXIT_OK +from _pytest.main import EXIT_TESTSFAILED +from _pytest.main import EXIT_USAGEERROR + +REPORT_COLLECTING_RESOLUTION = 0.5 + + +class MoreQuietAction(argparse.Action): + """ + a modified copy of the argparse count action which counts down and updates + the legacy quiet attribute at the same time + + used to unify verbosity handling + """ + + def __init__(self, option_strings, dest, default=None, required=False, help=None): + super(MoreQuietAction, self).__init__( + option_strings=option_strings, + dest=dest, + nargs=0, + default=default, + required=required, + help=help, + ) + + def __call__(self, parser, namespace, values, option_string=None): + new_count = getattr(namespace, self.dest, 0) - 1 + setattr(namespace, self.dest, new_count) + # todo Deprecate config.quiet + namespace.quiet = getattr(namespace, "quiet", 0) + 1 + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting", "reporting", after="general") + group._addoption( + "-v", + "--verbose", + action="count", + default=0, + dest="verbose", + help="increase verbosity.", + ), + group._addoption( + "-q", + "--quiet", + action=MoreQuietAction, + default=0, + dest="verbose", + help="decrease verbosity.", + ), + group._addoption( + "--verbosity", dest="verbose", type=int, default=0, help="set verbosity" + ) + group._addoption( + "-r", + action="store", + dest="reportchars", + default="", + metavar="chars", + help="show extra test summary info as specified by chars: (f)ailed, " + "(E)rror, (s)kipped, (x)failed, (X)passed, " + "(p)assed, (P)assed with output, (a)ll except passed (p/P), or (A)ll. " + "Warnings are displayed at all times except when " + "--disable-warnings is set.", + ) + group._addoption( + "--disable-warnings", + "--disable-pytest-warnings", + default=False, + dest="disable_warnings", + action="store_true", + help="disable warnings summary", + ) + group._addoption( + "-l", + "--showlocals", + action="store_true", + dest="showlocals", + default=False, + help="show locals in tracebacks (disabled by default).", + ) + group._addoption( + "--tb", + metavar="style", + action="store", + dest="tbstyle", + default="auto", + choices=["auto", "long", "short", "no", "line", "native"], + help="traceback print mode (auto/long/short/line/native/no).", + ) + group._addoption( + "--show-capture", + action="store", + dest="showcapture", + choices=["no", "stdout", "stderr", "log", "all"], + default="all", + help="Controls how captured stdout/stderr/log is shown on failed tests. " + "Default is 'all'.", + ) + group._addoption( + "--fulltrace", + "--full-trace", + action="store_true", + default=False, + help="don't cut any tracebacks (default is to cut).", + ) + group._addoption( + "--color", + metavar="color", + action="store", + dest="color", + default="auto", + choices=["yes", "no", "auto"], + help="color terminal output (yes/no/auto).", + ) + + parser.addini( + "console_output_style", + help='console output: "classic", or with additional progress information ("progress" (percentage) | "count").', + default="progress", + ) + + +def pytest_configure(config): + reporter = TerminalReporter(config, sys.stdout) + config.pluginmanager.register(reporter, "terminalreporter") + if config.option.debug or config.option.traceconfig: + + def mywriter(tags, args): + msg = " ".join(map(str, args)) + reporter.write_line("[traceconfig] " + msg) + + config.trace.root.setprocessor("pytest:config", mywriter) + + +def getreportopt(config): + reportopts = "" + reportchars = config.option.reportchars + if not config.option.disable_warnings and "w" not in reportchars: + reportchars += "w" + elif config.option.disable_warnings and "w" in reportchars: + reportchars = reportchars.replace("w", "") + aliases = {"F", "S"} + for char in reportchars: + # handle old aliases + if char in aliases: + char = char.lower() + if char == "a": + reportopts = "sxXwEf" + elif char == "A": + reportopts = "PpsxXwEf" + break + elif char not in reportopts: + reportopts += char + return reportopts + + +@pytest.hookimpl(trylast=True) # after _pytest.runner +def pytest_report_teststatus(report): + letter = "F" + if report.passed: + letter = "." + elif report.skipped: + letter = "s" + + outcome = report.outcome + if report.when in ("collect", "setup", "teardown") and outcome == "failed": + outcome = "error" + letter = "E" + + return outcome, letter, outcome.upper() + + +@attr.s +class WarningReport(object): + """ + Simple structure to hold warnings information captured by ``pytest_warning_captured``. + + :ivar str message: user friendly message about the warning + :ivar str|None nodeid: node id that generated the warning (see ``get_location``). + :ivar tuple|py.path.local fslocation: + file system location of the source of the warning (see ``get_location``). + """ + + message = attr.ib() + nodeid = attr.ib(default=None) + fslocation = attr.ib(default=None) + count_towards_summary = True + + def get_location(self, config): + """ + Returns the more user-friendly information about the location + of a warning, or None. + """ + if self.nodeid: + return self.nodeid + if self.fslocation: + if isinstance(self.fslocation, tuple) and len(self.fslocation) >= 2: + filename, linenum = self.fslocation[:2] + relpath = py.path.local(filename).relto(config.invocation_dir) + if not relpath: + relpath = str(filename) + return "%s:%s" % (relpath, linenum) + else: + return str(self.fslocation) + return None + + +class TerminalReporter(object): + def __init__(self, config, file=None): + import _pytest.config + + self.config = config + self._numcollected = 0 + self._session = None + self._showfspath = None + + self.stats = {} + self.startdir = config.invocation_dir + if file is None: + file = sys.stdout + self._tw = _pytest.config.create_terminal_writer(config, file) + # self.writer will be deprecated in pytest-3.4 + self.writer = self._tw + self._screen_width = self._tw.fullwidth + self.currentfspath = None + self.reportchars = getreportopt(config) + self.hasmarkup = self._tw.hasmarkup + self.isatty = file.isatty() + self._progress_nodeids_reported = set() + self._show_progress_info = self._determine_show_progress_info() + self._collect_report_last_write = None + + def _determine_show_progress_info(self): + """Return True if we should display progress information based on the current config""" + # do not show progress if we are not capturing output (#3038) + if self.config.getoption("capture", "no") == "no": + return False + # do not show progress if we are showing fixture setup/teardown + if self.config.getoption("setupshow", False): + return False + cfg = self.config.getini("console_output_style") + if cfg in ("progress", "count"): + return cfg + return False + + @property + def verbosity(self): + return self.config.option.verbose + + @property + def showheader(self): + return self.verbosity >= 0 + + @property + def showfspath(self): + if self._showfspath is None: + return self.verbosity >= 0 + return self._showfspath + + @showfspath.setter + def showfspath(self, value): + self._showfspath = value + + @property + def showlongtestinfo(self): + return self.verbosity > 0 + + def hasopt(self, char): + char = {"xfailed": "x", "skipped": "s"}.get(char, char) + return char in self.reportchars + + def write_fspath_result(self, nodeid, res, **markup): + fspath = self.config.rootdir.join(nodeid.split("::")[0]) + # NOTE: explicitly check for None to work around py bug, and for less + # overhead in general (https://github.com/pytest-dev/py/pull/207). + if self.currentfspath is None or fspath != self.currentfspath: + if self.currentfspath is not None and self._show_progress_info: + self._write_progress_information_filling_space() + self.currentfspath = fspath + fspath = self.startdir.bestrelpath(fspath) + self._tw.line() + self._tw.write(fspath + " ") + self._tw.write(res, **markup) + + def write_ensure_prefix(self, prefix, extra="", **kwargs): + if self.currentfspath != prefix: + self._tw.line() + self.currentfspath = prefix + self._tw.write(prefix) + if extra: + self._tw.write(extra, **kwargs) + self.currentfspath = -2 + + def ensure_newline(self): + if self.currentfspath: + self._tw.line() + self.currentfspath = None + + def write(self, content, **markup): + self._tw.write(content, **markup) + + def write_line(self, line, **markup): + if not isinstance(line, six.text_type): + line = six.text_type(line, errors="replace") + self.ensure_newline() + self._tw.line(line, **markup) + + def rewrite(self, line, **markup): + """ + Rewinds the terminal cursor to the beginning and writes the given line. + + :kwarg erase: if True, will also add spaces until the full terminal width to ensure + previous lines are properly erased. + + The rest of the keyword arguments are markup instructions. + """ + erase = markup.pop("erase", False) + if erase: + fill_count = self._tw.fullwidth - len(line) - 1 + fill = " " * fill_count + else: + fill = "" + line = str(line) + self._tw.write("\r" + line + fill, **markup) + + def write_sep(self, sep, title=None, **markup): + self.ensure_newline() + self._tw.sep(sep, title, **markup) + + def section(self, title, sep="=", **kw): + self._tw.sep(sep, title, **kw) + + def line(self, msg, **kw): + self._tw.line(msg, **kw) + + def pytest_internalerror(self, excrepr): + for line in six.text_type(excrepr).split("\n"): + self.write_line("INTERNALERROR> " + line) + return 1 + + def pytest_warning_captured(self, warning_message, item): + # from _pytest.nodes import get_fslocation_from_item + from _pytest.warnings import warning_record_to_str + + warnings = self.stats.setdefault("warnings", []) + fslocation = warning_message.filename, warning_message.lineno + message = warning_record_to_str(warning_message) + + nodeid = item.nodeid if item is not None else "" + warning_report = WarningReport( + fslocation=fslocation, message=message, nodeid=nodeid + ) + warnings.append(warning_report) + + def pytest_plugin_registered(self, plugin): + if self.config.option.traceconfig: + msg = "PLUGIN registered: %s" % (plugin,) + # XXX this event may happen during setup/teardown time + # which unfortunately captures our output here + # which garbles our output if we use self.write_line + self.write_line(msg) + + def pytest_deselected(self, items): + self.stats.setdefault("deselected", []).extend(items) + + def pytest_runtest_logstart(self, nodeid, location): + # ensure that the path is printed before the + # 1st test of a module starts running + if self.showlongtestinfo: + line = self._locationline(nodeid, *location) + self.write_ensure_prefix(line, "") + elif self.showfspath: + fsid = nodeid.split("::")[0] + self.write_fspath_result(fsid, "") + + def pytest_runtest_logreport(self, report): + self._tests_ran = True + rep = report + res = self.config.hook.pytest_report_teststatus(report=rep, config=self.config) + category, letter, word = res + if isinstance(word, tuple): + word, markup = word + else: + markup = None + self.stats.setdefault(category, []).append(rep) + if not letter and not word: + # probably passed setup/teardown + return + running_xdist = hasattr(rep, "node") + if markup is None: + was_xfail = hasattr(report, "wasxfail") + if rep.passed and not was_xfail: + markup = {"green": True} + elif rep.passed and was_xfail: + markup = {"yellow": True} + elif rep.failed: + markup = {"red": True} + elif rep.skipped: + markup = {"yellow": True} + else: + markup = {} + if self.verbosity <= 0: + if not running_xdist and self.showfspath: + self.write_fspath_result(rep.nodeid, letter, **markup) + else: + self._tw.write(letter, **markup) + else: + self._progress_nodeids_reported.add(rep.nodeid) + line = self._locationline(rep.nodeid, *rep.location) + if not running_xdist: + self.write_ensure_prefix(line, word, **markup) + if self._show_progress_info: + self._write_progress_information_filling_space() + else: + self.ensure_newline() + self._tw.write("[%s]" % rep.node.gateway.id) + if self._show_progress_info: + self._tw.write( + self._get_progress_information_message() + " ", cyan=True + ) + else: + self._tw.write(" ") + self._tw.write(word, **markup) + self._tw.write(" " + line) + self.currentfspath = -2 + + def pytest_runtest_logfinish(self, nodeid): + if self.verbosity <= 0 and self._show_progress_info: + if self._show_progress_info == "count": + num_tests = self._session.testscollected + progress_length = len(" [{}/{}]".format(str(num_tests), str(num_tests))) + else: + progress_length = len(" [100%]") + + self._progress_nodeids_reported.add(nodeid) + is_last_item = ( + len(self._progress_nodeids_reported) == self._session.testscollected + ) + if is_last_item: + self._write_progress_information_filling_space() + else: + w = self._width_of_current_line + past_edge = w + progress_length + 1 >= self._screen_width + if past_edge: + msg = self._get_progress_information_message() + self._tw.write(msg + "\n", cyan=True) + + def _get_progress_information_message(self): + collected = self._session.testscollected + if self._show_progress_info == "count": + if collected: + progress = self._progress_nodeids_reported + counter_format = "{{:{}d}}".format(len(str(collected))) + format_string = " [{}/{{}}]".format(counter_format) + return format_string.format(len(progress), collected) + return " [ {} / {} ]".format(collected, collected) + else: + if collected: + progress = len(self._progress_nodeids_reported) * 100 // collected + return " [{:3d}%]".format(progress) + return " [100%]" + + def _write_progress_information_filling_space(self): + msg = self._get_progress_information_message() + w = self._width_of_current_line + fill = self._tw.fullwidth - w - 1 + self.write(msg.rjust(fill), cyan=True) + + @property + def _width_of_current_line(self): + """Return the width of current line, using the superior implementation of py-1.6 when available""" + try: + return self._tw.width_of_current_line + except AttributeError: + # py < 1.6.0 + return self._tw.chars_on_current_line + + def pytest_collection(self): + if self.isatty: + if self.config.option.verbose >= 0: + self.write("collecting ... ", bold=True) + self._collect_report_last_write = time.time() + elif self.config.option.verbose >= 1: + self.write("collecting ... ", bold=True) + + def pytest_collectreport(self, report): + if report.failed: + self.stats.setdefault("error", []).append(report) + elif report.skipped: + self.stats.setdefault("skipped", []).append(report) + items = [x for x in report.result if isinstance(x, pytest.Item)] + self._numcollected += len(items) + if self.isatty: + self.report_collect() + + def report_collect(self, final=False): + if self.config.option.verbose < 0: + return + + if not final: + # Only write "collecting" report every 0.5s. + t = time.time() + if ( + self._collect_report_last_write is not None + and self._collect_report_last_write > t - REPORT_COLLECTING_RESOLUTION + ): + return + self._collect_report_last_write = t + + errors = len(self.stats.get("error", [])) + skipped = len(self.stats.get("skipped", [])) + deselected = len(self.stats.get("deselected", [])) + selected = self._numcollected - errors - skipped - deselected + if final: + line = "collected " + else: + line = "collecting " + line += ( + str(self._numcollected) + " item" + ("" if self._numcollected == 1 else "s") + ) + if errors: + line += " / %d errors" % errors + if deselected: + line += " / %d deselected" % deselected + if skipped: + line += " / %d skipped" % skipped + if self._numcollected > selected > 0: + line += " / %d selected" % selected + if self.isatty: + self.rewrite(line, bold=True, erase=True) + if final: + self.write("\n") + else: + self.write_line(line) + + @pytest.hookimpl(trylast=True) + def pytest_sessionstart(self, session): + self._session = session + self._sessionstarttime = time.time() + if not self.showheader: + return + self.write_sep("=", "test session starts", bold=True) + verinfo = platform.python_version() + msg = "platform %s -- Python %s" % (sys.platform, verinfo) + if hasattr(sys, "pypy_version_info"): + verinfo = ".".join(map(str, sys.pypy_version_info[:3])) + msg += "[pypy-%s-%s]" % (verinfo, sys.pypy_version_info[3]) + msg += ", pytest-%s, py-%s, pluggy-%s" % ( + pytest.__version__, + py.__version__, + pluggy.__version__, + ) + if ( + self.verbosity > 0 + or self.config.option.debug + or getattr(self.config.option, "pastebin", None) + ): + msg += " -- " + str(sys.executable) + self.write_line(msg) + lines = self.config.hook.pytest_report_header( + config=self.config, startdir=self.startdir + ) + self._write_report_lines_from_hooks(lines) + + def _write_report_lines_from_hooks(self, lines): + lines.reverse() + for line in collapse(lines): + self.write_line(line) + + def pytest_report_header(self, config): + line = "rootdir: %s" % config.rootdir + + if config.inifile: + line += ", inifile: " + config.rootdir.bestrelpath(config.inifile) + + testpaths = config.getini("testpaths") + if testpaths and config.args == testpaths: + rel_paths = [config.rootdir.bestrelpath(x) for x in testpaths] + line += ", testpaths: {}".format(", ".join(rel_paths)) + result = [line] + + plugininfo = config.pluginmanager.list_plugin_distinfo() + if plugininfo: + result.append("plugins: %s" % ", ".join(_plugin_nameversions(plugininfo))) + return result + + def pytest_collection_finish(self, session): + self.report_collect(True) + + if self.config.getoption("collectonly"): + self._printcollecteditems(session.items) + + lines = self.config.hook.pytest_report_collectionfinish( + config=self.config, startdir=self.startdir, items=session.items + ) + self._write_report_lines_from_hooks(lines) + + if self.config.getoption("collectonly"): + if self.stats.get("failed"): + self._tw.sep("!", "collection failures") + for rep in self.stats.get("failed"): + rep.toterminal(self._tw) + + def _printcollecteditems(self, items): + # to print out items and their parent collectors + # we take care to leave out Instances aka () + # because later versions are going to get rid of them anyway + if self.config.option.verbose < 0: + if self.config.option.verbose < -1: + counts = {} + for item in items: + name = item.nodeid.split("::", 1)[0] + counts[name] = counts.get(name, 0) + 1 + for name, count in sorted(counts.items()): + self._tw.line("%s: %d" % (name, count)) + else: + for item in items: + self._tw.line(item.nodeid) + return + stack = [] + indent = "" + for item in items: + needed_collectors = item.listchain()[1:] # strip root node + while stack: + if stack == needed_collectors[: len(stack)]: + break + stack.pop() + for col in needed_collectors[len(stack) :]: + stack.append(col) + if col.name == "()": # Skip Instances. + continue + indent = (len(stack) - 1) * " " + self._tw.line("%s%s" % (indent, col)) + if self.config.option.verbose >= 1: + if hasattr(col, "_obj") and col._obj.__doc__: + for line in col._obj.__doc__.strip().splitlines(): + self._tw.line("%s%s" % (indent + " ", line.strip())) + + @pytest.hookimpl(hookwrapper=True) + def pytest_sessionfinish(self, exitstatus): + outcome = yield + outcome.get_result() + self._tw.line("") + summary_exit_codes = ( + EXIT_OK, + EXIT_TESTSFAILED, + EXIT_INTERRUPTED, + EXIT_USAGEERROR, + EXIT_NOTESTSCOLLECTED, + ) + if exitstatus in summary_exit_codes: + self.config.hook.pytest_terminal_summary( + terminalreporter=self, exitstatus=exitstatus, config=self.config + ) + if exitstatus == EXIT_INTERRUPTED: + self._report_keyboardinterrupt() + del self._keyboardinterrupt_memo + self.summary_stats() + + @pytest.hookimpl(hookwrapper=True) + def pytest_terminal_summary(self): + self.summary_errors() + self.summary_failures() + self.summary_warnings() + self.summary_passes() + yield + self.short_test_summary() + # Display any extra warnings from teardown here (if any). + self.summary_warnings() + + def pytest_keyboard_interrupt(self, excinfo): + self._keyboardinterrupt_memo = excinfo.getrepr(funcargs=True) + + def pytest_unconfigure(self): + if hasattr(self, "_keyboardinterrupt_memo"): + self._report_keyboardinterrupt() + + def _report_keyboardinterrupt(self): + excrepr = self._keyboardinterrupt_memo + msg = excrepr.reprcrash.message + self.write_sep("!", msg) + if "KeyboardInterrupt" in msg: + if self.config.option.fulltrace: + excrepr.toterminal(self._tw) + else: + excrepr.reprcrash.toterminal(self._tw) + self._tw.line( + "(to show a full traceback on KeyboardInterrupt use --fulltrace)", + yellow=True, + ) + + def _locationline(self, nodeid, fspath, lineno, domain): + def mkrel(nodeid): + line = self.config.cwd_relative_nodeid(nodeid) + if domain and line.endswith(domain): + line = line[: -len(domain)] + values = domain.split("[") + values[0] = values[0].replace(".", "::") # don't replace '.' in params + line += "[".join(values) + return line + + # collect_fspath comes from testid which has a "/"-normalized path + + if fspath: + res = mkrel(nodeid) + if self.verbosity >= 2 and nodeid.split("::")[0] != fspath.replace( + "\\", nodes.SEP + ): + res += " <- " + self.startdir.bestrelpath(fspath) + else: + res = "[location]" + return res + " " + + def _getfailureheadline(self, rep): + head_line = rep.head_line + if head_line: + return head_line + return "test session" # XXX? + + def _getcrashline(self, rep): + try: + return str(rep.longrepr.reprcrash) + except AttributeError: + try: + return str(rep.longrepr)[:50] + except AttributeError: + return "" + + # + # summaries for sessionfinish + # + def getreports(self, name): + values = [] + for x in self.stats.get(name, []): + if not hasattr(x, "_pdbshown"): + values.append(x) + return values + + def summary_warnings(self): + if self.hasopt("w"): + all_warnings = self.stats.get("warnings") + if not all_warnings: + return + + final = hasattr(self, "_already_displayed_warnings") + if final: + warning_reports = all_warnings[self._already_displayed_warnings :] + else: + warning_reports = all_warnings + self._already_displayed_warnings = len(warning_reports) + if not warning_reports: + return + + reports_grouped_by_message = collections.OrderedDict() + for wr in warning_reports: + reports_grouped_by_message.setdefault(wr.message, []).append(wr) + + title = "warnings summary (final)" if final else "warnings summary" + self.write_sep("=", title, yellow=True, bold=False) + for message, warning_reports in reports_grouped_by_message.items(): + has_any_location = False + for w in warning_reports: + location = w.get_location(self.config) + if location: + self._tw.line(str(location)) + has_any_location = True + if has_any_location: + lines = message.splitlines() + indented = "\n".join(" " + x for x in lines) + message = indented.rstrip() + else: + message = message.rstrip() + self._tw.line(message) + self._tw.line() + self._tw.line("-- Docs: https://docs.pytest.org/en/latest/warnings.html") + + def summary_passes(self): + if self.config.option.tbstyle != "no": + if self.hasopt("P"): + reports = self.getreports("passed") + if not reports: + return + self.write_sep("=", "PASSES") + for rep in reports: + if rep.sections: + msg = self._getfailureheadline(rep) + self.write_sep("_", msg, green=True, bold=True) + self._outrep_summary(rep) + + def print_teardown_sections(self, rep): + showcapture = self.config.option.showcapture + if showcapture == "no": + return + for secname, content in rep.sections: + if showcapture != "all" and showcapture not in secname: + continue + if "teardown" in secname: + self._tw.sep("-", secname) + if content[-1:] == "\n": + content = content[:-1] + self._tw.line(content) + + def summary_failures(self): + if self.config.option.tbstyle != "no": + reports = self.getreports("failed") + if not reports: + return + self.write_sep("=", "FAILURES") + if self.config.option.tbstyle == "line": + for rep in reports: + line = self._getcrashline(rep) + self.write_line(line) + else: + teardown_sections = {} + for report in self.getreports(""): + if report.when == "teardown": + teardown_sections.setdefault(report.nodeid, []).append(report) + + for rep in reports: + msg = self._getfailureheadline(rep) + self.write_sep("_", msg, red=True, bold=True) + self._outrep_summary(rep) + for report in teardown_sections.get(rep.nodeid, []): + self.print_teardown_sections(report) + + def summary_errors(self): + if self.config.option.tbstyle != "no": + reports = self.getreports("error") + if not reports: + return + self.write_sep("=", "ERRORS") + for rep in self.stats["error"]: + msg = self._getfailureheadline(rep) + if rep.when == "collect": + msg = "ERROR collecting " + msg + else: + msg = "ERROR at %s of %s" % (rep.when, msg) + self.write_sep("_", msg, red=True, bold=True) + self._outrep_summary(rep) + + def _outrep_summary(self, rep): + rep.toterminal(self._tw) + showcapture = self.config.option.showcapture + if showcapture == "no": + return + for secname, content in rep.sections: + if showcapture != "all" and showcapture not in secname: + continue + self._tw.sep("-", secname) + if content[-1:] == "\n": + content = content[:-1] + self._tw.line(content) + + def summary_stats(self): + session_duration = time.time() - self._sessionstarttime + (line, color) = build_summary_stats_line(self.stats) + msg = "%s in %.2f seconds" % (line, session_duration) + markup = {color: True, "bold": True} + + if self.verbosity >= 0: + self.write_sep("=", msg, **markup) + if self.verbosity == -1: + self.write_line(msg, **markup) + + def short_test_summary(self): + if not self.reportchars: + return + + def show_simple(stat, lines): + failed = self.stats.get(stat, []) + if not failed: + return + termwidth = self.writer.fullwidth + config = self.config + for rep in failed: + line = _get_line_with_reprcrash_message(config, rep, termwidth) + lines.append(line) + + def show_xfailed(lines): + xfailed = self.stats.get("xfailed", []) + for rep in xfailed: + verbose_word = rep._get_verbose_word(self.config) + pos = _get_pos(self.config, rep) + lines.append("%s %s" % (verbose_word, pos)) + reason = rep.wasxfail + if reason: + lines.append(" " + str(reason)) + + def show_xpassed(lines): + xpassed = self.stats.get("xpassed", []) + for rep in xpassed: + verbose_word = rep._get_verbose_word(self.config) + pos = _get_pos(self.config, rep) + reason = rep.wasxfail + lines.append("%s %s %s" % (verbose_word, pos, reason)) + + def show_skipped(lines): + skipped = self.stats.get("skipped", []) + fskips = _folded_skips(skipped) if skipped else [] + if not fskips: + return + verbose_word = skipped[0]._get_verbose_word(self.config) + for num, fspath, lineno, reason in fskips: + if reason.startswith("Skipped: "): + reason = reason[9:] + if lineno is not None: + lines.append( + "%s [%d] %s:%d: %s" + % (verbose_word, num, fspath, lineno + 1, reason) + ) + else: + lines.append("%s [%d] %s: %s" % (verbose_word, num, fspath, reason)) + + REPORTCHAR_ACTIONS = { + "x": show_xfailed, + "X": show_xpassed, + "f": partial(show_simple, "failed"), + "s": show_skipped, + "p": partial(show_simple, "passed"), + "E": partial(show_simple, "error"), + } + + lines = [] + for char in self.reportchars: + action = REPORTCHAR_ACTIONS.get(char) + if action: # skipping e.g. "P" (passed with output) here. + action(lines) + + if lines: + self.write_sep("=", "short test summary info") + for line in lines: + self.write_line(line) + + +def _get_pos(config, rep): + nodeid = config.cwd_relative_nodeid(rep.nodeid) + return nodeid + + +def _get_line_with_reprcrash_message(config, rep, termwidth): + """Get summary line for a report, trying to add reprcrash message.""" + from wcwidth import wcswidth + + verbose_word = rep._get_verbose_word(config) + pos = _get_pos(config, rep) + + line = "%s %s" % (verbose_word, pos) + len_line = wcswidth(line) + ellipsis, len_ellipsis = "...", 3 + if len_line > termwidth - len_ellipsis: + # No space for an additional message. + return line + + try: + msg = rep.longrepr.reprcrash.message + except AttributeError: + pass + else: + # Only use the first line. + i = msg.find("\n") + if i != -1: + msg = msg[:i] + len_msg = wcswidth(msg) + + sep, len_sep = " - ", 3 + max_len_msg = termwidth - len_line - len_sep + if max_len_msg >= len_ellipsis: + if len_msg > max_len_msg: + max_len_msg -= len_ellipsis + msg = msg[:max_len_msg] + while wcswidth(msg) > max_len_msg: + msg = msg[:-1] + if six.PY2: + # on python 2 systems with narrow unicode compilation, trying to + # get a single character out of a multi-byte unicode character such as + # u'😄' will result in a High Surrogate (U+D83D) character, which is + # rendered as u'�'; in this case we just strip that character out as it + # serves no purpose being rendered + try: + surrogate = six.unichr(0xD83D) + msg = msg.rstrip(surrogate) + except ValueError: # pragma: no cover + # Jython cannot represent this lone surrogate at all (#5256): + # ValueError: unichr() arg is a lone surrogate in range + # (0xD800, 0xDFFF) (Jython UTF-16 encoding) + # ignore this case as it shouldn't appear in the string anyway + pass + msg += ellipsis + line += sep + msg + return line + + +def _folded_skips(skipped): + d = {} + for event in skipped: + key = event.longrepr + assert len(key) == 3, (event, key) + keywords = getattr(event, "keywords", {}) + # folding reports with global pytestmark variable + # this is workaround, because for now we cannot identify the scope of a skip marker + # TODO: revisit after marks scope would be fixed + if ( + event.when == "setup" + and "skip" in keywords + and "pytestmark" not in keywords + ): + key = (key[0], None, key[2]) + d.setdefault(key, []).append(event) + values = [] + for key, events in d.items(): + values.append((len(events),) + key) + return values + + +def build_summary_stats_line(stats): + known_types = ( + "failed passed skipped deselected xfailed xpassed warnings error".split() + ) + unknown_type_seen = False + for found_type in stats: + if found_type not in known_types: + if found_type: # setup/teardown reports have an empty key, ignore them + known_types.append(found_type) + unknown_type_seen = True + parts = [] + for key in known_types: + reports = stats.get(key, None) + if reports: + count = sum( + 1 for rep in reports if getattr(rep, "count_towards_summary", True) + ) + parts.append("%d %s" % (count, key)) + + if parts: + line = ", ".join(parts) + else: + line = "no tests ran" + + if "failed" in stats or "error" in stats: + color = "red" + elif "warnings" in stats or unknown_type_seen: + color = "yellow" + elif "passed" in stats: + color = "green" + else: + color = "yellow" + + return line, color + + +def _plugin_nameversions(plugininfo): + values = [] + for plugin, dist in plugininfo: + # gets us name and version! + name = "{dist.project_name}-{dist.version}".format(dist=dist) + # questionable convenience, but it keeps things short + if name.startswith("pytest-"): + name = name[7:] + # we decided to print python package names + # they can have more than one plugin + if name not in values: + values.append(name) + return values diff --git a/contrib/python/pytest/py2/_pytest/tmpdir.py b/contrib/python/pytest/py2/_pytest/tmpdir.py new file mode 100644 index 00000000000..a8a7037713c --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/tmpdir.py @@ -0,0 +1,197 @@ +# -*- coding: utf-8 -*- +""" support for providing temporary directories to test functions. """ +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import os +import re +import tempfile +import warnings + +import attr +import py +import six + +import pytest +from .pathlib import ensure_reset_dir +from .pathlib import LOCK_TIMEOUT +from .pathlib import make_numbered_dir +from .pathlib import make_numbered_dir_with_cleanup +from .pathlib import Path +from _pytest.monkeypatch import MonkeyPatch + + +@attr.s +class TempPathFactory(object): + """Factory for temporary directories under the common base temp directory. + + The base directory can be configured using the ``--basetemp`` option.""" + + _given_basetemp = attr.ib( + # using os.path.abspath() to get absolute path instead of resolve() as it + # does not work the same in all platforms (see #4427) + # Path.absolute() exists, but it is not public (see https://bugs.python.org/issue25012) + converter=attr.converters.optional( + lambda p: Path(os.path.abspath(six.text_type(p))) + ) + ) + _trace = attr.ib() + _basetemp = attr.ib(default=None) + + @classmethod + def from_config(cls, config): + """ + :param config: a pytest configuration + """ + return cls( + given_basetemp=config.option.basetemp, trace=config.trace.get("tmpdir") + ) + + def mktemp(self, basename, numbered=True): + """makes a temporary directory managed by the factory""" + if not numbered: + p = self.getbasetemp().joinpath(basename) + p.mkdir() + else: + p = make_numbered_dir(root=self.getbasetemp(), prefix=basename) + self._trace("mktemp", p) + return p + + def getbasetemp(self): + """ return base temporary directory. """ + if self._basetemp is not None: + return self._basetemp + + if self._given_basetemp is not None: + basetemp = self._given_basetemp + ensure_reset_dir(basetemp) + basetemp = basetemp.resolve() + else: + from_env = os.environ.get("PYTEST_DEBUG_TEMPROOT") + temproot = Path(from_env or tempfile.gettempdir()).resolve() + user = get_user() or "unknown" + # use a sub-directory in the temproot to speed-up + # make_numbered_dir() call + rootdir = temproot.joinpath("pytest-of-{}".format(user)) + rootdir.mkdir(exist_ok=True) + basetemp = make_numbered_dir_with_cleanup( + prefix="pytest-", root=rootdir, keep=3, lock_timeout=LOCK_TIMEOUT + ) + assert basetemp is not None, basetemp + self._basetemp = t = basetemp + self._trace("new basetemp", t) + return t + + +@attr.s +class TempdirFactory(object): + """ + backward comptibility wrapper that implements + :class:``py.path.local`` for :class:``TempPathFactory`` + """ + + _tmppath_factory = attr.ib() + + def ensuretemp(self, string, dir=1): + """ (deprecated) return temporary directory path with + the given string as the trailing part. It is usually + better to use the 'tmpdir' function argument which + provides an empty unique-per-test-invocation directory + and is guaranteed to be empty. + """ + # py.log._apiwarn(">1.1", "use tmpdir function argument") + from .deprecated import PYTEST_ENSURETEMP + + warnings.warn(PYTEST_ENSURETEMP, stacklevel=2) + return self.getbasetemp().ensure(string, dir=dir) + + def mktemp(self, basename, numbered=True): + """Create a subdirectory of the base temporary directory and return it. + If ``numbered``, ensure the directory is unique by adding a number + prefix greater than any existing one. + """ + return py.path.local(self._tmppath_factory.mktemp(basename, numbered).resolve()) + + def getbasetemp(self): + """backward compat wrapper for ``_tmppath_factory.getbasetemp``""" + return py.path.local(self._tmppath_factory.getbasetemp().resolve()) + + +def get_user(): + """Return the current user name, or None if getuser() does not work + in the current environment (see #1010). + """ + import getpass + + try: + return getpass.getuser() + except (ImportError, KeyError): + return None + + +def pytest_configure(config): + """Create a TempdirFactory and attach it to the config object. + + This is to comply with existing plugins which expect the handler to be + available at pytest_configure time, but ideally should be moved entirely + to the tmpdir_factory session fixture. + """ + mp = MonkeyPatch() + tmppath_handler = TempPathFactory.from_config(config) + t = TempdirFactory(tmppath_handler) + config._cleanup.append(mp.undo) + mp.setattr(config, "_tmp_path_factory", tmppath_handler, raising=False) + mp.setattr(config, "_tmpdirhandler", t, raising=False) + mp.setattr(pytest, "ensuretemp", t.ensuretemp, raising=False) + + +@pytest.fixture(scope="session") +def tmpdir_factory(request): + """Return a :class:`_pytest.tmpdir.TempdirFactory` instance for the test session. + """ + return request.config._tmpdirhandler + + +@pytest.fixture(scope="session") +def tmp_path_factory(request): + """Return a :class:`_pytest.tmpdir.TempPathFactory` instance for the test session. + """ + return request.config._tmp_path_factory + + +def _mk_tmp(request, factory): + name = request.node.name + name = re.sub(r"[\W]", "_", name) + MAXVAL = 30 + name = name[:MAXVAL] + return factory.mktemp(name, numbered=True) + + +@pytest.fixture +def tmpdir(tmp_path): + """Return a temporary directory path object + which is unique to each test function invocation, + created as a sub directory of the base temporary + directory. The returned object is a `py.path.local`_ + path object. + + .. _`py.path.local`: https://py.readthedocs.io/en/latest/path.html + """ + return py.path.local(tmp_path) + + +@pytest.fixture +def tmp_path(request, tmp_path_factory): + """Return a temporary directory path object + which is unique to each test function invocation, + created as a sub directory of the base temporary + directory. The returned object is a :class:`pathlib.Path` + object. + + .. note:: + + in python < 3.6 this is a pathlib2.Path + """ + + return _mk_tmp(request, tmp_path_factory) diff --git a/contrib/python/pytest/py2/_pytest/unittest.py b/contrib/python/pytest/py2/_pytest/unittest.py new file mode 100644 index 00000000000..3ff6f45d8db --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/unittest.py @@ -0,0 +1,291 @@ +# -*- coding: utf-8 -*- +""" discovery and running of std-library "unittest" style tests. """ +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import sys +import traceback + +import _pytest._code +import pytest +from _pytest.compat import getimfunc +from _pytest.config import hookimpl +from _pytest.outcomes import fail +from _pytest.outcomes import skip +from _pytest.outcomes import xfail +from _pytest.python import Class +from _pytest.python import Function + + +def pytest_pycollect_makeitem(collector, name, obj): + # has unittest been imported and is obj a subclass of its TestCase? + try: + if not issubclass(obj, sys.modules["unittest"].TestCase): + return + except Exception: + return + # yes, so let's collect it + return UnitTestCase(name, parent=collector) + + +class UnitTestCase(Class): + # marker for fixturemanger.getfixtureinfo() + # to declare that our children do not support funcargs + nofuncargs = True + + def collect(self): + from unittest import TestLoader + + cls = self.obj + if not getattr(cls, "__test__", True): + return + + skipped = getattr(cls, "__unittest_skip__", False) + if not skipped: + self._inject_setup_teardown_fixtures(cls) + self._inject_setup_class_fixture() + + self.session._fixturemanager.parsefactories(self, unittest=True) + loader = TestLoader() + foundsomething = False + for name in loader.getTestCaseNames(self.obj): + x = getattr(self.obj, name) + if not getattr(x, "__test__", True): + continue + funcobj = getimfunc(x) + yield TestCaseFunction(name, parent=self, callobj=funcobj) + foundsomething = True + + if not foundsomething: + runtest = getattr(self.obj, "runTest", None) + if runtest is not None: + ut = sys.modules.get("twisted.trial.unittest", None) + if ut is None or runtest != ut.TestCase.runTest: + yield TestCaseFunction("runTest", parent=self) + + def _inject_setup_teardown_fixtures(self, cls): + """Injects a hidden auto-use fixture to invoke setUpClass/setup_method and corresponding + teardown functions (#517)""" + class_fixture = _make_xunit_fixture( + cls, "setUpClass", "tearDownClass", scope="class", pass_self=False + ) + if class_fixture: + cls.__pytest_class_setup = class_fixture + + method_fixture = _make_xunit_fixture( + cls, "setup_method", "teardown_method", scope="function", pass_self=True + ) + if method_fixture: + cls.__pytest_method_setup = method_fixture + + +def _make_xunit_fixture(obj, setup_name, teardown_name, scope, pass_self): + setup = getattr(obj, setup_name, None) + teardown = getattr(obj, teardown_name, None) + if setup is None and teardown is None: + return None + + @pytest.fixture(scope=scope, autouse=True) + def fixture(self, request): + if getattr(self, "__unittest_skip__", None): + reason = self.__unittest_skip_why__ + pytest.skip(reason) + if setup is not None: + if pass_self: + setup(self, request.function) + else: + setup() + yield + if teardown is not None: + if pass_self: + teardown(self, request.function) + else: + teardown() + + return fixture + + +class TestCaseFunction(Function): + nofuncargs = True + _excinfo = None + _testcase = None + + def setup(self): + self._testcase = self.parent.obj(self.name) + self._fix_unittest_skip_decorator() + self._obj = getattr(self._testcase, self.name) + if hasattr(self, "_request"): + self._request._fillfixtures() + + def _fix_unittest_skip_decorator(self): + """ + The @unittest.skip decorator calls functools.wraps(self._testcase) + The call to functools.wraps() fails unless self._testcase + has a __name__ attribute. This is usually automatically supplied + if the test is a function or method, but we need to add manually + here. + + See issue #1169 + """ + if sys.version_info[0] == 2: + setattr(self._testcase, "__name__", self.name) + + def teardown(self): + self._testcase = None + self._obj = None + + def startTest(self, testcase): + pass + + def _addexcinfo(self, rawexcinfo): + # unwrap potential exception info (see twisted trial support below) + rawexcinfo = getattr(rawexcinfo, "_rawexcinfo", rawexcinfo) + try: + excinfo = _pytest._code.ExceptionInfo(rawexcinfo) + # invoke the attributes to trigger storing the traceback + # trial causes some issue there + excinfo.value + excinfo.traceback + except TypeError: + try: + try: + values = traceback.format_exception(*rawexcinfo) + values.insert( + 0, + "NOTE: Incompatible Exception Representation, " + "displaying natively:\n\n", + ) + fail("".join(values), pytrace=False) + except (fail.Exception, KeyboardInterrupt): + raise + except: # noqa + fail( + "ERROR: Unknown Incompatible Exception " + "representation:\n%r" % (rawexcinfo,), + pytrace=False, + ) + except KeyboardInterrupt: + raise + except fail.Exception: + excinfo = _pytest._code.ExceptionInfo.from_current() + self.__dict__.setdefault("_excinfo", []).append(excinfo) + + def addError(self, testcase, rawexcinfo): + self._addexcinfo(rawexcinfo) + + def addFailure(self, testcase, rawexcinfo): + self._addexcinfo(rawexcinfo) + + def addSkip(self, testcase, reason): + try: + skip(reason) + except skip.Exception: + self._skipped_by_mark = True + self._addexcinfo(sys.exc_info()) + + def addExpectedFailure(self, testcase, rawexcinfo, reason=""): + try: + xfail(str(reason)) + except xfail.Exception: + self._addexcinfo(sys.exc_info()) + + def addUnexpectedSuccess(self, testcase, reason=""): + self._unexpectedsuccess = reason + + def addSuccess(self, testcase): + pass + + def stopTest(self, testcase): + pass + + def _handle_skip(self): + # implements the skipping machinery (see #2137) + # analog to pythons Lib/unittest/case.py:run + testMethod = getattr(self._testcase, self._testcase._testMethodName) + if getattr(self._testcase.__class__, "__unittest_skip__", False) or getattr( + testMethod, "__unittest_skip__", False + ): + # If the class or method was skipped. + skip_why = getattr( + self._testcase.__class__, "__unittest_skip_why__", "" + ) or getattr(testMethod, "__unittest_skip_why__", "") + try: # PY3, unittest2 on PY2 + self._testcase._addSkip(self, self._testcase, skip_why) + except TypeError: # PY2 + if sys.version_info[0] != 2: + raise + self._testcase._addSkip(self, skip_why) + return True + return False + + def runtest(self): + if self.config.pluginmanager.get_plugin("pdbinvoke") is None: + self._testcase(result=self) + else: + # disables tearDown and cleanups for post mortem debugging (see #1890) + if self._handle_skip(): + return + self._testcase.debug() + + def _prunetraceback(self, excinfo): + Function._prunetraceback(self, excinfo) + traceback = excinfo.traceback.filter( + lambda x: not x.frame.f_globals.get("__unittest") + ) + if traceback: + excinfo.traceback = traceback + + +@hookimpl(tryfirst=True) +def pytest_runtest_makereport(item, call): + if isinstance(item, TestCaseFunction): + if item._excinfo: + call.excinfo = item._excinfo.pop(0) + try: + del call.result + except AttributeError: + pass + + +# twisted trial support + + +@hookimpl(hookwrapper=True) +def pytest_runtest_protocol(item): + if isinstance(item, TestCaseFunction) and "twisted.trial.unittest" in sys.modules: + ut = sys.modules["twisted.python.failure"] + Failure__init__ = ut.Failure.__init__ + check_testcase_implements_trial_reporter() + + def excstore( + self, exc_value=None, exc_type=None, exc_tb=None, captureVars=None + ): + if exc_value is None: + self._rawexcinfo = sys.exc_info() + else: + if exc_type is None: + exc_type = type(exc_value) + self._rawexcinfo = (exc_type, exc_value, exc_tb) + try: + Failure__init__( + self, exc_value, exc_type, exc_tb, captureVars=captureVars + ) + except TypeError: + Failure__init__(self, exc_value, exc_type, exc_tb) + + ut.Failure.__init__ = excstore + yield + ut.Failure.__init__ = Failure__init__ + else: + yield + + +def check_testcase_implements_trial_reporter(done=[]): + if done: + return + from zope.interface import classImplements + from twisted.trial.itrial import IReporter + + classImplements(TestCaseFunction, IReporter) + done.append(1) diff --git a/contrib/python/pytest/py2/_pytest/warning_types.py b/contrib/python/pytest/py2/_pytest/warning_types.py new file mode 100644 index 00000000000..861010a1275 --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/warning_types.py @@ -0,0 +1,112 @@ +# -*- coding: utf-8 -*- +import attr + + +class PytestWarning(UserWarning): + """ + Bases: :class:`UserWarning`. + + Base class for all warnings emitted by pytest. + """ + + +class PytestAssertRewriteWarning(PytestWarning): + """ + Bases: :class:`PytestWarning`. + + Warning emitted by the pytest assert rewrite module. + """ + + +class PytestCacheWarning(PytestWarning): + """ + Bases: :class:`PytestWarning`. + + Warning emitted by the cache plugin in various situations. + """ + + +class PytestConfigWarning(PytestWarning): + """ + Bases: :class:`PytestWarning`. + + Warning emitted for configuration issues. + """ + + +class PytestCollectionWarning(PytestWarning): + """ + Bases: :class:`PytestWarning`. + + Warning emitted when pytest is not able to collect a file or symbol in a module. + """ + + +class PytestDeprecationWarning(PytestWarning, DeprecationWarning): + """ + Bases: :class:`pytest.PytestWarning`, :class:`DeprecationWarning`. + + Warning class for features that will be removed in a future version. + """ + + +class PytestExperimentalApiWarning(PytestWarning, FutureWarning): + """ + Bases: :class:`pytest.PytestWarning`, :class:`FutureWarning`. + + Warning category used to denote experiments in pytest. Use sparingly as the API might change or even be + removed completely in future version + """ + + @classmethod + def simple(cls, apiname): + return cls( + "{apiname} is an experimental api that may change over time".format( + apiname=apiname + ) + ) + + +class PytestUnhandledCoroutineWarning(PytestWarning): + """ + Bases: :class:`PytestWarning`. + + Warning emitted when pytest encounters a test function which is a coroutine, + but it was not handled by any async-aware plugin. Coroutine test functions + are not natively supported. + """ + + +class PytestUnknownMarkWarning(PytestWarning): + """ + Bases: :class:`PytestWarning`. + + Warning emitted on use of unknown markers. + See https://docs.pytest.org/en/latest/mark.html for details. + """ + + +class RemovedInPytest4Warning(PytestDeprecationWarning): + """ + Bases: :class:`pytest.PytestDeprecationWarning`. + + Warning class for features scheduled to be removed in pytest 4.0. + """ + + +@attr.s +class UnformattedWarning(object): + """Used to hold warnings that need to format their message at runtime, as opposed to a direct message. + + Using this class avoids to keep all the warning types and messages in this module, avoiding misuse. + """ + + category = attr.ib() + template = attr.ib() + + def format(self, **kwargs): + """Returns an instance of the warning category, formatted with given kwargs""" + return self.category(self.template.format(**kwargs)) + + +PYTESTER_COPY_EXAMPLE = PytestExperimentalApiWarning.simple("testdir.copy_example") diff --git a/contrib/python/pytest/py2/_pytest/warnings.py b/contrib/python/pytest/py2/_pytest/warnings.py new file mode 100644 index 00000000000..a3debae462f --- /dev/null +++ b/contrib/python/pytest/py2/_pytest/warnings.py @@ -0,0 +1,180 @@ +# -*- coding: utf-8 -*- +from __future__ import absolute_import +from __future__ import division +from __future__ import print_function + +import sys +import warnings +from contextlib import contextmanager + +import pytest +from _pytest import compat + +SHOW_PYTEST_WARNINGS_ARG = "-Walways::pytest.RemovedInPytest4Warning" + + +def _setoption(wmod, arg): + """ + Copy of the warning._setoption function but does not escape arguments. + """ + parts = arg.split(":") + if len(parts) > 5: + raise wmod._OptionError("too many fields (max 5): %r" % (arg,)) + while len(parts) < 5: + parts.append("") + action, message, category, module, lineno = [s.strip() for s in parts] + action = wmod._getaction(action) + category = wmod._getcategory(category) + if lineno: + try: + lineno = int(lineno) + if lineno < 0: + raise ValueError + except (ValueError, OverflowError): + raise wmod._OptionError("invalid lineno %r" % (lineno,)) + else: + lineno = 0 + wmod.filterwarnings(action, message, category, module, lineno) + + +def pytest_addoption(parser): + group = parser.getgroup("pytest-warnings") + group.addoption( + "-W", + "--pythonwarnings", + action="append", + help="set which warnings to report, see -W option of python itself.", + ) + parser.addini( + "filterwarnings", + type="linelist", + help="Each line specifies a pattern for " + "warnings.filterwarnings. " + "Processed after -W and --pythonwarnings.", + ) + + +def pytest_configure(config): + config.addinivalue_line( + "markers", + "filterwarnings(warning): add a warning filter to the given test. " + "see https://docs.pytest.org/en/latest/warnings.html#pytest-mark-filterwarnings ", + ) + + +@contextmanager +def catch_warnings_for_item(config, ihook, when, item): + """ + Context manager that catches warnings generated in the contained execution block. + + ``item`` can be None if we are not in the context of an item execution. + + Each warning captured triggers the ``pytest_warning_captured`` hook. + """ + cmdline_filters = config.getoption("pythonwarnings") or [] + inifilters = config.getini("filterwarnings") + with warnings.catch_warnings(record=True) as log: + + if not sys.warnoptions: + # if user is not explicitly configuring warning filters, show deprecation warnings by default (#2908) + warnings.filterwarnings("always", category=DeprecationWarning) + warnings.filterwarnings("always", category=PendingDeprecationWarning) + + warnings.filterwarnings("error", category=pytest.RemovedInPytest4Warning) + + # filters should have this precedence: mark, cmdline options, ini + # filters should be applied in the inverse order of precedence + for arg in inifilters: + _setoption(warnings, arg) + + for arg in cmdline_filters: + warnings._setoption(arg) + + if item is not None: + for mark in item.iter_markers(name="filterwarnings"): + for arg in mark.args: + _setoption(warnings, arg) + + yield + + for warning_message in log: + ihook.pytest_warning_captured.call_historic( + kwargs=dict(warning_message=warning_message, when=when, item=item) + ) + + +def warning_record_to_str(warning_message): + """Convert a warnings.WarningMessage to a string. + + This takes lot of unicode shenaningans into account for Python 2. + When Python 2 support is dropped this function can be greatly simplified. + """ + warn_msg = warning_message.message + unicode_warning = False + if compat._PY2 and any(isinstance(m, compat.UNICODE_TYPES) for m in warn_msg.args): + new_args = [] + for m in warn_msg.args: + new_args.append( + compat.ascii_escaped(m) if isinstance(m, compat.UNICODE_TYPES) else m + ) + unicode_warning = list(warn_msg.args) != new_args + warn_msg.args = new_args + + msg = warnings.formatwarning( + warn_msg, + warning_message.category, + warning_message.filename, + warning_message.lineno, + warning_message.line, + ) + if unicode_warning: + warnings.warn( + "Warning is using unicode non convertible to ascii, " + "converting to a safe representation:\n {!r}".format(compat.safe_str(msg)), + UnicodeWarning, + ) + return msg + + +@pytest.hookimpl(hookwrapper=True, tryfirst=True) +def pytest_runtest_protocol(item): + with catch_warnings_for_item( + config=item.config, ihook=item.ihook, when="runtest", item=item + ): + yield + + +@pytest.hookimpl(hookwrapper=True, tryfirst=True) +def pytest_collection(session): + config = session.config + with catch_warnings_for_item( + config=config, ihook=config.hook, when="collect", item=None + ): + yield + + +@pytest.hookimpl(hookwrapper=True) +def pytest_terminal_summary(terminalreporter): + config = terminalreporter.config + with catch_warnings_for_item( + config=config, ihook=config.hook, when="config", item=None + ): + yield + + +def _issue_warning_captured(warning, hook, stacklevel): + """ + This function should be used instead of calling ``warnings.warn`` directly when we are in the "configure" stage: + at this point the actual options might not have been set, so we manually trigger the pytest_warning_captured + hook so we can display this warnings in the terminal. This is a hack until we can sort out #2891. + + :param warning: the warning instance. + :param hook: the hook caller + :param stacklevel: stacklevel forwarded to warnings.warn + """ + with warnings.catch_warnings(record=True) as records: + warnings.simplefilter("always", type(warning)) + warnings.warn(warning, stacklevel=stacklevel) + hook.pytest_warning_captured.call_historic( + kwargs=dict(warning_message=records[0], when="config", item=None) + ) diff --git a/contrib/python/pytest/py2/patches/01-disable-warnings.patch b/contrib/python/pytest/py2/patches/01-disable-warnings.patch new file mode 100644 index 00000000000..b556f43bc73 --- /dev/null +++ b/contrib/python/pytest/py2/patches/01-disable-warnings.patch @@ -0,0 +1,12 @@ +--- contrib/python/pytest/py2/_pytest/assertion/rewrite.py (index) ++++ contrib/python/pytest/py2/_pytest/assertion/rewrite.py (working tree) +@@ -4,6 +4,9 @@ from __future__ import absolute_import + from __future__ import division + from __future__ import print_function + ++import warnings ++warnings.filterwarnings("ignore", category=DeprecationWarning, module="_pytest.assertion.rewrite") ++ + import ast + import errno + import imp diff --git a/contrib/python/pytest/py2/patches/03-limit-id.patch b/contrib/python/pytest/py2/patches/03-limit-id.patch new file mode 100644 index 00000000000..5389c9290e5 --- /dev/null +++ b/contrib/python/pytest/py2/patches/03-limit-id.patch @@ -0,0 +1,36 @@ +--- contrib/python/pytest/py2/_pytest/python.py (index) ++++ contrib/python/pytest/py2/_pytest/python.py (working tree) +@@ -1204,6 +1204,33 @@ def _idval(val, argname, idx, idfn, item, config): + return str(argname) + str(idx) + + ++def limit_idval(limit): ++ import functools ++ ++ names = {} ++ limit -= 6 ++ assert limit > 0 ++ ++ def decorator(func): ++ @functools.wraps(func) ++ def wrapper(*args, **kw): ++ idval = func(*args, **kw) ++ if len(idval) > limit: ++ prefix = idval[:limit] ++ # There might be same prefix for the different test cases - take item into account ++ name = "{}-{}".format(kw.get('item', ''), prefix) ++ idx = names.setdefault(name, -1) + 1 ++ names[name] = idx ++ idval = "{}-{}".format(prefix, idx) ++ return idval ++ ++ return wrapper ++ ++ return decorator ++ ++ ++# XXX limit testnames in the name of sanity and readability ++@limit_idval(limit=500) + def _idvalset(idx, parameterset, argnames, idfn, ids, item, config): + if parameterset.id is not None: + return parameterset.id diff --git a/contrib/python/pytest/py2/patches/04-fix-id-encoding.patch b/contrib/python/pytest/py2/patches/04-fix-id-encoding.patch new file mode 100644 index 00000000000..e70af52d191 --- /dev/null +++ b/contrib/python/pytest/py2/patches/04-fix-id-encoding.patch @@ -0,0 +1,57 @@ +--- contrib/python/pytest/py2/_pytest/compat.py (index) ++++ contrib/python/pytest/py2/_pytest/compat.py (working tree) +@@ -378,7 +378,10 @@ if _PY3: + + def safe_str(v): + """returns v as string""" +- return str(v) ++ try: ++ return str(v) ++ except UnicodeEncodeError: ++ return str(v, encoding="utf-8") + + + else: +--- contrib/python/pytest/py2/_pytest/python.py (index) ++++ contrib/python/pytest/py2/_pytest/python.py (working tree) +@@ -896,7 +896,7 @@ class CallSpec2(object): + + @property + def id(self): +- return "-".join(map(str, filter(None, self._idlist))) ++ return "-".join(map(safe_str, filter(None, self._idlist))) + + def setmulti2(self, valtypes, argnames, valset, id, marks, scopenum, param_index): + for arg, val in zip(argnames, valset): +@@ -1218,10 +1218,10 @@ def limit_idval(limit): + if len(idval) > limit: + prefix = idval[:limit] + # There might be same prefix for the different test cases - take item into account +- name = "{}-{}".format(kw.get('item', ''), prefix) ++ name = "{}-{}".format(kw.get('item', ''), safe_str(prefix)) + idx = names.setdefault(name, -1) + 1 + names[name] = idx +- idval = "{}-{}".format(prefix, idx) ++ idval = "{}-{}".format(safe_str(prefix), idx) + return idval + + return wrapper +--- contrib/python/pytest/py2/_pytest/runner.py (index) ++++ contrib/python/pytest/py2/_pytest/runner.py (working tree) +@@ -16,6 +16,7 @@ from .reports import CollectErrorRepr + from .reports import CollectReport + from .reports import TestReport + from _pytest._code.code import ExceptionInfo ++from _pytest.compat import safe_str + from _pytest.outcomes import Exit + from _pytest.outcomes import Skipped + from _pytest.outcomes import TEST_OUTCOME +@@ -241,7 +242,7 @@ class CallInfo(object): + value = repr(self._result) + status = "result" + return "<CallInfo when={when!r} {status}: {value}>".format( +- when=self.when, value=value, status=status ++ when=self.when, value=safe_str(value), status=status + ) + + diff --git a/contrib/python/pytest/py2/patches/04-support-cyrillic-id.patch b/contrib/python/pytest/py2/patches/04-support-cyrillic-id.patch new file mode 100644 index 00000000000..26242ff9704 --- /dev/null +++ b/contrib/python/pytest/py2/patches/04-support-cyrillic-id.patch @@ -0,0 +1,26 @@ +--- contrib/python/pytest/py2/_pytest/compat.py (index) ++++ contrib/python/pytest/py2/_pytest/compat.py (working tree) +@@ -243,7 +243,7 @@ if _PY3: + if isinstance(val, bytes): + ret = _bytes_to_ascii(val) + else: +- ret = val.encode("unicode_escape").decode("ascii") ++ ret = val + return _translate_non_printable(ret) + + +@@ -262,11 +262,11 @@ else: + """ + if isinstance(val, bytes): + try: +- ret = val.decode("ascii") ++ ret = val.decode("utf-8") + except UnicodeDecodeError: +- ret = val.encode("string-escape").decode("ascii") ++ ret = val.decode("utf-8", "ignore") + else: +- ret = val.encode("unicode-escape").decode("ascii") ++ ret = val.encode("utf-8", "replace").decode("utf-8") + return _translate_non_printable(ret) + + diff --git a/contrib/python/pytest/py2/patches/05-support-readline.patch b/contrib/python/pytest/py2/patches/05-support-readline.patch new file mode 100644 index 00000000000..51c6ee2bf46 --- /dev/null +++ b/contrib/python/pytest/py2/patches/05-support-readline.patch @@ -0,0 +1,69 @@ +--- contrib/python/pytest/py2/_pytest/debugging.py (index) ++++ contrib/python/pytest/py2/_pytest/debugging.py (working tree) +@@ -4,6 +4,7 @@ from __future__ import absolute_import + from __future__ import division + from __future__ import print_function + ++import os + import argparse + import pdb + import sys +@@ -14,6 +15,42 @@ from _pytest import outcomes + from _pytest.config.exceptions import UsageError + + ++def import_readline(): ++ try: ++ import readline ++ except ImportError: ++ sys.path.append('/usr/lib/python2.7/lib-dynload') ++ ++ try: ++ import readline ++ except ImportError as e: ++ print('can not import readline:', e) ++ ++ import subprocess ++ try: ++ subprocess.check_call('stty icrnl'.split()) ++ except OSError as e: ++ print('can not restore Enter, use Control+J:', e) ++ ++ ++def tty(): ++ if os.isatty(1): ++ return ++ ++ fd = os.open('/dev/tty', os.O_RDWR) ++ os.dup2(fd, 0) ++ os.dup2(fd, 1) ++ os.dup2(fd, 2) ++ os.close(fd) ++ ++ old_sys_path = sys.path ++ sys.path = list(sys.path) ++ try: ++ import_readline() ++ finally: ++ sys.path = old_sys_path ++ ++ + def _validate_usepdb_cls(value): + """Validate syntax of --pdbcls option.""" + try: +@@ -249,6 +286,7 @@ class pytestPDB(object): + @classmethod + def set_trace(cls, *args, **kwargs): + """Invoke debugging via ``Pdb.set_trace``, dropping any IO capturing.""" ++ tty() + frame = sys._getframe().f_back + _pdb = cls._init_pdb("set_trace", *args, **kwargs) + _pdb.set_trace(frame) +@@ -262,6 +300,7 @@ class PdbInvoke(object): + out, err = capman.read_global_capture() + sys.stdout.write(out) + sys.stdout.write(err) ++ tty() + _enter_pdb(node, call.excinfo, report) + + def pytest_internalerror(self, excrepr, excinfo): diff --git a/contrib/python/pytest/py2/patches/06-support-ya-markers.patch b/contrib/python/pytest/py2/patches/06-support-ya-markers.patch new file mode 100644 index 00000000000..6dae352ef8b --- /dev/null +++ b/contrib/python/pytest/py2/patches/06-support-ya-markers.patch @@ -0,0 +1,14 @@ +--- contrib/python/pytest/py2/_pytest/mark/structures.py (index) ++++ contrib/python/pytest/py2/_pytest/mark/structures.py (working tree) +@@ -316,7 +316,10 @@ class MarkGenerator(object): + # example lines: "skipif(condition): skip the given test if..." + # or "hypothesis: tests which use Hypothesis", so to get the + # marker name we split on both `:` and `(`. +- marker = line.split(":")[0].split("(")[0].strip() ++ if line == "ya:external": ++ marker = line ++ else: ++ marker = line.split(":")[0].split("(")[0].strip() + self._markers.add(marker) + + # If the name is not in the set of known marks after updating, diff --git a/contrib/python/pytest/py2/patches/07-disable-translate-non-printable.patch b/contrib/python/pytest/py2/patches/07-disable-translate-non-printable.patch new file mode 100644 index 00000000000..beed7a0aeb7 --- /dev/null +++ b/contrib/python/pytest/py2/patches/07-disable-translate-non-printable.patch @@ -0,0 +1,20 @@ +--- contrib/python/pytest/py2/_pytest/compat.py (index) ++++ contrib/python/pytest/py2/_pytest/compat.py (working tree) +@@ -244,7 +244,7 @@ if _PY3: + ret = _bytes_to_ascii(val) + else: + ret = val +- return _translate_non_printable(ret) ++ return ret + + + else: +@@ -267,7 +267,7 @@ else: + ret = val.decode("utf-8", "ignore") + else: + ret = val.encode("utf-8", "replace").decode("utf-8") +- return _translate_non_printable(ret) ++ return ret + + + class _PytestWrapper(object): diff --git a/contrib/python/pytest/py2/patches/08-backport-pr-6607.patch b/contrib/python/pytest/py2/patches/08-backport-pr-6607.patch new file mode 100644 index 00000000000..8d0ae7a5fbf --- /dev/null +++ b/contrib/python/pytest/py2/patches/08-backport-pr-6607.patch @@ -0,0 +1,17 @@ +commit 46b46cea857997531a7b9b4de32556be50bd5aea (HEAD -> pytest-backport-pr-6607) +author: danila-eremin +date: 2022-01-22T16:55:07+03:00 + + backport py2 + +--- contrib/python/pytest/py2/_pytest/python.py (b87553999455f0084413c5b59139aa9ccb5e3f52) ++++ contrib/python/pytest/py2/_pytest/python.py (46b46cea857997531a7b9b4de32556be50bd5aea) +@@ -896,7 +896,7 @@ class CallSpec2(object): + + @property + def id(self): +- return "-".join(map(safe_str, filter(None, self._idlist))) ++ return "-".join(map(safe_str, self._idlist)) + + def setmulti2(self, valtypes, argnames, valset, id, marks, scopenum, param_index): + for arg, val in zip(argnames, valset): diff --git a/contrib/python/pytest/py2/pytest.py b/contrib/python/pytest/py2/pytest.py new file mode 100644 index 00000000000..ccc77b476f5 --- /dev/null +++ b/contrib/python/pytest/py2/pytest.py @@ -0,0 +1,107 @@ +# -*- coding: utf-8 -*- +# PYTHON_ARGCOMPLETE_OK +""" +pytest: unit and functional testing with Python. +""" +# else we are imported +from _pytest import __version__ +from _pytest.assertion import register_assert_rewrite +from _pytest.config import cmdline +from _pytest.config import hookimpl +from _pytest.config import hookspec +from _pytest.config import main +from _pytest.config import UsageError +from _pytest.debugging import pytestPDB as __pytestPDB +from _pytest.fixtures import fillfixtures as _fillfuncargs +from _pytest.fixtures import fixture +from _pytest.fixtures import yield_fixture +from _pytest.freeze_support import freeze_includes +from _pytest.main import Session +from _pytest.mark import MARK_GEN as mark +from _pytest.mark import param +from _pytest.nodes import Collector +from _pytest.nodes import File +from _pytest.nodes import Item +from _pytest.outcomes import exit +from _pytest.outcomes import fail +from _pytest.outcomes import importorskip +from _pytest.outcomes import skip +from _pytest.outcomes import xfail +from _pytest.python import Class +from _pytest.python import Function +from _pytest.python import Instance +from _pytest.python import Module +from _pytest.python import Package +from _pytest.python_api import approx +from _pytest.python_api import raises +from _pytest.recwarn import deprecated_call +from _pytest.recwarn import warns +from _pytest.warning_types import PytestAssertRewriteWarning +from _pytest.warning_types import PytestCacheWarning +from _pytest.warning_types import PytestCollectionWarning +from _pytest.warning_types import PytestConfigWarning +from _pytest.warning_types import PytestDeprecationWarning +from _pytest.warning_types import PytestExperimentalApiWarning +from _pytest.warning_types import PytestUnhandledCoroutineWarning +from _pytest.warning_types import PytestUnknownMarkWarning +from _pytest.warning_types import PytestWarning +from _pytest.warning_types import RemovedInPytest4Warning + +set_trace = __pytestPDB.set_trace + +__all__ = [ + "__version__", + "_fillfuncargs", + "approx", + "Class", + "cmdline", + "Collector", + "deprecated_call", + "exit", + "fail", + "File", + "fixture", + "freeze_includes", + "Function", + "hookimpl", + "hookspec", + "importorskip", + "Instance", + "Item", + "main", + "mark", + "Module", + "Package", + "param", + "PytestAssertRewriteWarning", + "PytestCacheWarning", + "PytestCollectionWarning", + "PytestConfigWarning", + "PytestDeprecationWarning", + "PytestExperimentalApiWarning", + "PytestUnhandledCoroutineWarning", + "PytestUnknownMarkWarning", + "PytestWarning", + "raises", + "register_assert_rewrite", + "RemovedInPytest4Warning", + "Session", + "set_trace", + "skip", + "UsageError", + "warns", + "xfail", + "yield_fixture", +] + +if __name__ == "__main__": + # if run as a script or by 'python -m pytest' + # we trigger the below "else" condition by the following import + import pytest + + raise SystemExit(pytest.main()) +else: + + from _pytest.compat import _setup_collect_fakemodule + + _setup_collect_fakemodule() diff --git a/contrib/python/pytest/py2/ya.make b/contrib/python/pytest/py2/ya.make new file mode 100644 index 00000000000..4a4214535ca --- /dev/null +++ b/contrib/python/pytest/py2/ya.make @@ -0,0 +1,100 @@ +# Generated by devtools/yamaker (pypi). + +PY2_LIBRARY() + +OWNER(dmitko g:python-contrib) + +VERSION(4.6.11) + +LICENSE(MIT) + +PEERDIR( + contrib/python/atomicwrites + contrib/python/attrs + contrib/python/funcsigs + contrib/python/importlib-metadata + contrib/python/more-itertools + contrib/python/packaging + contrib/python/pathlib2 + contrib/python/pluggy + contrib/python/py + contrib/python/six + contrib/python/wcwidth +) + +NO_LINT() + +NO_CHECK_IMPORTS( + __tests__.* # all test modules get imported when tests are run + _pytest.* +) + +PY_SRCS( + TOP_LEVEL + _pytest/__init__.py + _pytest/_argcomplete.py + _pytest/_code/__init__.py + _pytest/_code/_py2traceback.py + _pytest/_code/code.py + _pytest/_code/source.py + _pytest/_io/__init__.py + _pytest/_io/saferepr.py + _pytest/_version.py + _pytest/assertion/__init__.py + _pytest/assertion/rewrite.py + _pytest/assertion/truncate.py + _pytest/assertion/util.py + _pytest/cacheprovider.py + _pytest/capture.py + _pytest/compat.py + _pytest/config/__init__.py + _pytest/config/argparsing.py + _pytest/config/exceptions.py + _pytest/config/findpaths.py + _pytest/debugging.py + _pytest/deprecated.py + _pytest/doctest.py + _pytest/fixtures.py + _pytest/freeze_support.py + _pytest/helpconfig.py + _pytest/hookspec.py + _pytest/junitxml.py + _pytest/logging.py + _pytest/main.py + _pytest/mark/__init__.py + _pytest/mark/evaluate.py + _pytest/mark/legacy.py + _pytest/mark/structures.py + _pytest/monkeypatch.py + _pytest/nodes.py + _pytest/nose.py + _pytest/outcomes.py + _pytest/pastebin.py + _pytest/pathlib.py + _pytest/pytester.py + _pytest/python.py + _pytest/python_api.py + _pytest/recwarn.py + _pytest/reports.py + _pytest/resultlog.py + _pytest/runner.py + _pytest/setuponly.py + _pytest/setupplan.py + _pytest/skipping.py + _pytest/stepwise.py + _pytest/terminal.py + _pytest/tmpdir.py + _pytest/unittest.py + _pytest/warning_types.py + _pytest/warnings.py + pytest.py +) + +RESOURCE_FILES( + PREFIX contrib/python/pytest/py2/ + .dist-info/METADATA + .dist-info/entry_points.txt + .dist-info/top_level.txt +) + +END() diff --git a/contrib/python/pytest/py3/.dist-info/METADATA b/contrib/python/pytest/py3/.dist-info/METADATA new file mode 100644 index 00000000000..2354d6e80c5 --- /dev/null +++ b/contrib/python/pytest/py3/.dist-info/METADATA @@ -0,0 +1,209 @@ +Metadata-Version: 2.1 +Name: pytest +Version: 5.4.3 +Summary: pytest: simple powerful testing with Python +Home-page: https://docs.pytest.org/en/latest/ +Author: Holger Krekel, Bruno Oliveira, Ronny Pfannschmidt, Floris Bruynooghe, Brianna Laugher, Florian Bruhin and others +License: MIT license +Project-URL: Source, https://github.com/pytest-dev/pytest +Project-URL: Tracker, https://github.com/pytest-dev/pytest/issues +Keywords: test,unittest +Platform: unix +Platform: linux +Platform: osx +Platform: cygwin +Platform: win32 +Classifier: Development Status :: 6 - Mature +Classifier: Intended Audience :: Developers +Classifier: License :: OSI Approved :: MIT License +Classifier: Operating System :: POSIX +Classifier: Operating System :: Microsoft :: Windows +Classifier: Operating System :: MacOS :: MacOS X +Classifier: Topic :: Software Development :: Testing +Classifier: Topic :: Software Development :: Libraries +Classifier: Topic :: Utilities +Classifier: Programming Language :: Python :: 3 :: Only +Classifier: Programming Language :: Python :: 3.5 +Classifier: Programming Language :: Python :: 3.6 +Classifier: Programming Language :: Python :: 3.7 +Classifier: Programming Language :: Python :: 3.8 +Classifier: Programming Language :: Python :: 3.9 +Requires-Python: >=3.5 +Requires-Dist: py (>=1.5.0) +Requires-Dist: packaging +Requires-Dist: attrs (>=17.4.0) +Requires-Dist: more-itertools (>=4.0.0) +Requires-Dist: pluggy (<1.0,>=0.12) +Requires-Dist: wcwidth +Requires-Dist: pathlib2 (>=2.2.0) ; python_version < "3.6" +Requires-Dist: importlib-metadata (>=0.12) ; python_version < "3.8" +Requires-Dist: atomicwrites (>=1.0) ; sys_platform == "win32" +Requires-Dist: colorama ; sys_platform == "win32" +Provides-Extra: checkqa-mypy +Requires-Dist: mypy (==v0.761) ; extra == 'checkqa-mypy' +Provides-Extra: testing +Requires-Dist: argcomplete ; extra == 'testing' +Requires-Dist: hypothesis (>=3.56) ; extra == 'testing' +Requires-Dist: mock ; extra == 'testing' +Requires-Dist: nose ; extra == 'testing' +Requires-Dist: requests ; extra == 'testing' +Requires-Dist: xmlschema ; extra == 'testing' + +.. image:: https://docs.pytest.org/en/latest/_static/pytest1.png + :target: https://docs.pytest.org/en/latest/ + :align: center + :alt: pytest + + +------ + +.. image:: https://img.shields.io/pypi/v/pytest.svg + :target: https://pypi.org/project/pytest/ + +.. image:: https://img.shields.io/conda/vn/conda-forge/pytest.svg + :target: https://anaconda.org/conda-forge/pytest + +.. image:: https://img.shields.io/pypi/pyversions/pytest.svg + :target: https://pypi.org/project/pytest/ + +.. image:: https://codecov.io/gh/pytest-dev/pytest/branch/master/graph/badge.svg + :target: https://codecov.io/gh/pytest-dev/pytest + :alt: Code coverage Status + +.. image:: https://travis-ci.org/pytest-dev/pytest.svg?branch=master + :target: https://travis-ci.org/pytest-dev/pytest + +.. image:: https://dev.azure.com/pytest-dev/pytest/_apis/build/status/pytest-CI?branchName=master + :target: https://dev.azure.com/pytest-dev/pytest + +.. image:: https://img.shields.io/badge/code%20style-black-000000.svg + :target: https://github.com/psf/black + +.. image:: https://www.codetriage.com/pytest-dev/pytest/badges/users.svg + :target: https://www.codetriage.com/pytest-dev/pytest + +.. image:: https://readthedocs.org/projects/pytest/badge/?version=latest + :target: https://pytest.readthedocs.io/en/latest/?badge=latest + :alt: Documentation Status + +The ``pytest`` framework makes it easy to write small tests, yet +scales to support complex functional testing for applications and libraries. + +An example of a simple test: + +.. code-block:: python + + # content of test_sample.py + def inc(x): + return x + 1 + + + def test_answer(): + assert inc(3) == 5 + + +To execute it:: + + $ pytest + ============================= test session starts ============================= + collected 1 items + + test_sample.py F + + ================================== FAILURES =================================== + _________________________________ test_answer _________________________________ + + def test_answer(): + > assert inc(3) == 5 + E assert 4 == 5 + E + where 4 = inc(3) + + test_sample.py:5: AssertionError + ========================== 1 failed in 0.04 seconds =========================== + + +Due to ``pytest``'s detailed assertion introspection, only plain ``assert`` statements are used. See `getting-started <https://docs.pytest.org/en/latest/getting-started.html#our-first-test-run>`_ for more examples. + + +Features +-------- + +- Detailed info on failing `assert statements <https://docs.pytest.org/en/latest/assert.html>`_ (no need to remember ``self.assert*`` names); + +- `Auto-discovery + <https://docs.pytest.org/en/latest/goodpractices.html#python-test-discovery>`_ + of test modules and functions; + +- `Modular fixtures <https://docs.pytest.org/en/latest/fixture.html>`_ for + managing small or parametrized long-lived test resources; + +- Can run `unittest <https://docs.pytest.org/en/latest/unittest.html>`_ (or trial), + `nose <https://docs.pytest.org/en/latest/nose.html>`_ test suites out of the box; + +- Python 3.5+ and PyPy3; + +- Rich plugin architecture, with over 315+ `external plugins <http://plugincompat.herokuapp.com>`_ and thriving community; + + +Documentation +------------- + +For full documentation, including installation, tutorials and PDF documents, please see https://docs.pytest.org/en/latest/. + + +Bugs/Requests +------------- + +Please use the `GitHub issue tracker <https://github.com/pytest-dev/pytest/issues>`_ to submit bugs or request features. + + +Changelog +--------- + +Consult the `Changelog <https://docs.pytest.org/en/latest/changelog.html>`__ page for fixes and enhancements of each version. + + +Support pytest +-------------- + +`Open Collective`_ is an online funding platform for open and transparent communities. +It provides tools to raise money and share your finances in full transparency. + +It is the platform of choice for individuals and companies that want to make one-time or +monthly donations directly to the project. + +See more details in the `pytest collective`_. + +.. _Open Collective: https://opencollective.com +.. _pytest collective: https://opencollective.com/pytest + + +pytest for enterprise +--------------------- + +Available as part of the Tidelift Subscription. + +The maintainers of pytest and thousands of other packages are working with Tidelift to deliver commercial support and +maintenance for the open source dependencies you use to build your applications. +Save time, reduce risk, and improve code health, while paying the maintainers of the exact dependencies you use. + +`Learn more. <https://tidelift.com/subscription/pkg/pypi-pytest?utm_source=pypi-pytest&utm_medium=referral&utm_campaign=enterprise&utm_term=repo>`_ + +Security +^^^^^^^^ + +pytest has never been associated with a security vulnerability, but in any case, to report a +security vulnerability please use the `Tidelift security contact <https://tidelift.com/security>`_. +Tidelift will coordinate the fix and disclosure. + + +License +------- + +Copyright Holger Krekel and others, 2004-2020. + +Distributed under the terms of the `MIT`_ license, pytest is free and open source software. + +.. _`MIT`: https://github.com/pytest-dev/pytest/blob/master/LICENSE + + diff --git a/contrib/python/pytest/py3/.dist-info/entry_points.txt b/contrib/python/pytest/py3/.dist-info/entry_points.txt new file mode 100644 index 00000000000..d8e4fd298fe --- /dev/null +++ b/contrib/python/pytest/py3/.dist-info/entry_points.txt @@ -0,0 +1,4 @@ +[console_scripts] +py.test = pytest:main +pytest = pytest:main + diff --git a/contrib/python/pytest/py3/.dist-info/top_level.txt b/contrib/python/pytest/py3/.dist-info/top_level.txt new file mode 100644 index 00000000000..e94857af964 --- /dev/null +++ b/contrib/python/pytest/py3/.dist-info/top_level.txt @@ -0,0 +1,2 @@ +_pytest +pytest diff --git a/contrib/python/pytest/py3/AUTHORS b/contrib/python/pytest/py3/AUTHORS new file mode 100644 index 00000000000..3de12aa12f5 --- /dev/null +++ b/contrib/python/pytest/py3/AUTHORS @@ -0,0 +1,293 @@ +Holger Krekel, holger at merlinux eu +merlinux GmbH, Germany, office at merlinux eu + +Contributors include:: + +Aaron Coleman +Abdeali JK +Abhijeet Kasurde +Adam Johnson +Adam Uhlir +Ahn Ki-Wook +Akiomi Kamakura +Alan Velasco +Alexander Johnson +Alexei Kozlenok +Allan Feldman +Aly Sivji +Amir Elkess +Anatoly Bubenkoff +Anders Hovmöller +Andras Mitzki +Andras Tim +Andrea Cimatoribus +Andreas Zeidler +Andrey Paramonov +Andrzej Klajnert +Andrzej Ostrowski +Andy Freeland +Anthon van der Neut +Anthony Shaw +Anthony Sottile +Anton Lodder +Antony Lee +Arel Cordero +Armin Rigo +Aron Coyle +Aron Curzon +Aviral Verma +Aviv Palivoda +Barney Gale +Ben Webb +Benjamin Peterson +Bernard Pratz +Bob Ippolito +Brian Dorsey +Brian Maissy +Brian Okken +Brianna Laugher +Bruno Oliveira +Cal Leeming +Carl Friedrich Bolz +Carlos Jenkins +Ceridwen +Charles Cloud +Charles Machalow +Charnjit SiNGH (CCSJ) +Chris Lamb +Christian Boelsen +Christian Fetzer +Christian Neumüller +Christian Theunert +Christian Tismer +Christoph Buelter +Christopher Dignam +Christopher Gilling +Claudio Madotto +CrazyMerlyn +Cyrus Maden +Damian Skrzypczak +Daniel Grana +Daniel Hahler +Daniel Nuri +Daniel Wandschneider +Danielle Jenkins +Daniil Galiev +Dave Hunt +David Díaz-Barquero +David Mohr +David Paul Röthlisberger +David Szotten +David Vierra +Daw-Ran Liou +Denis Kirisov +Dhiren Serai +Diego Russo +Dmitry Dygalo +Dmitry Pribysh +Duncan Betts +Edison Gustavo Muenz +Edoardo Batini +Eduardo Schettino +Eli Boyarski +Elizaveta Shashkova +Endre Galaczi +Eric Hunsberger +Eric Siegerman +Erik M. Bray +Evan Kepner +Fabien Zarifian +Fabio Zadrozny +Feng Ma +Florian Bruhin +Floris Bruynooghe +Gabriel Reis +Gene Wood +George Kussumoto +Georgy Dyuldin +Graham Horler +Greg Price +Gregory Lee +Grig Gheorghiu +Grigorii Eremeev (budulianin) +Guido Wesdorp +Guoqiang Zhang +Harald Armin Massa +Henk-Jaap Wagenaar +Holger Kohr +Hugo van Kemenade +Hui Wang (coldnight) +Ian Bicking +Ian Lesperance +Ilya Konstantinov +Ionuț Turturică +Iwan Briquemont +Jaap Broekhuizen +Jakub Mitoraj +Jan Balster +Janne Vanhala +Jason R. Coombs +Javier Domingo Cansino +Javier Romero +Jeff Rackauckas +Jeff Widman +Jenni Rinker +John Eddie Ayson +John Towler +Jon Sonesen +Jonas Obrist +Jordan Guymon +Jordan Moldow +Jordan Speicher +Joseph Hunkeler +Josh Karpel +Joshua Bronson +Jurko Gospodnetić +Justyna Janczyszyn +Kale Kundert +Karl O. Pinc +Katarzyna Jachim +Katerina Koukiou +Kevin Cox +Kevin J. Foley +Kodi B. Arfer +Kostis Anagnostopoulos +Kristoffer Nordström +Kyle Altendorf +Lawrence Mitchell +Lee Kamentsky +Lev Maximov +Llandy Riveron Del Risco +Loic Esteve +Lukas Bednar +Luke Murphy +Maciek Fijalkowski +Maho +Maik Figura +Mandeep Bhutani +Manuel Krebber +Marc Schlaich +Marcelo Duarte Trevisani +Marcin Bachry +Marco Gorelli +Mark Abramowitz +Mark Dickinson +Markus Unterwaditzer +Martijn Faassen +Martin Altmayer +Martin K. Scherer +Martin Prusse +Mathieu Clabaut +Matt Bachmann +Matt Duck +Matt Williams +Matthias Hafner +Maxim Filipenko +mbyt +Michael Aquilina +Michael Birtwell +Michael Droettboom +Michael Goerz +Michael Krebs +Michael Seifert +Michal Wajszczuk +Mihai Capotă +Mike Hoyle (hoylemd) +Mike Lundy +Miro Hrončok +Nathaniel Compton +Nathaniel Waisbrot +Ned Batchelder +Neven Mundar +Nicholas Devenish +Nicholas Murphy +Niclas Olofsson +Nicolas Delaby +Nikolay Kondratyev +Oleg Pidsadnyi +Oleg Sushchenko +Oliver Bestwalter +Omar Kohl +Omer Hadari +Ondřej Súkup +Oscar Benjamin +Patrick Hayes +Pauli Virtanen +Paweł Adamczak +Pedro Algarvio +Philipp Loose +Pieter Mulder +Piotr Banaszkiewicz +Pulkit Goyal +Punyashloka Biswal +Quentin Pradet +Ralf Schmitt +Ralph Giles +Ran Benita +Raphael Castaneda +Raphael Pierzina +Raquel Alegre +Ravi Chandra +Robert Holt +Roberto Polli +Roland Puntaier +Romain Dorgueil +Roman Bolshakov +Ronny Pfannschmidt +Ross Lawley +Russel Winder +Ryan Wooden +Samuel Dion-Girardeau +Samuel Searles-Bryant +Samuele Pedroni +Sankt Petersbug +Segev Finer +Serhii Mozghovyi +Seth Junot +Simon Gomizelj +Skylar Downes +Srinivas Reddy Thatiparthy +Stefan Farmbauer +Stefan Scherfke +Stefan Zimmermann +Stefano Taschini +Steffen Allner +Stephan Obermann +Sven-Hendrik Haase +Tadek Teleżyński +Takafumi Arakaki +Tarcisio Fischer +Tareq Alayan +Ted Xiao +Thomas Grainger +Thomas Hisch +Tim Hoffmann +Tim Strazny +Tom Dalton +Tom Viner +Tomáš Gavenčiak +Tomer Keren +Tor Colvin +Trevor Bekolay +Tyler Goodlet +Tzu-ping Chung +Vasily Kuznetsov +Victor Maryama +Victor Uriarte +Vidar T. Fauske +Virgil Dupras +Vitaly Lashmanov +Vlad Dragos +Vladyslav Rachek +Volodymyr Piskun +Wei Lin +Wil Cooley +William Lee +Wim Glenn +Wouter van Ackooy +Xixi Zhao +Xuan Luong +Xuecong Liao +Yoav Caspi +Zac Hatfield-Dodds +Zoltán Máté diff --git a/contrib/python/pytest/py3/LICENSE b/contrib/python/pytest/py3/LICENSE new file mode 100644 index 00000000000..d14fb7ff4b3 --- /dev/null +++ b/contrib/python/pytest/py3/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2004-2020 Holger Krekel and others + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/contrib/python/pytest/py3/README.rst b/contrib/python/pytest/py3/README.rst new file mode 100644 index 00000000000..864467ea210 --- /dev/null +++ b/contrib/python/pytest/py3/README.rst @@ -0,0 +1,156 @@ +.. image:: https://docs.pytest.org/en/latest/_static/pytest1.png + :target: https://docs.pytest.org/en/latest/ + :align: center + :alt: pytest + + +------ + +.. image:: https://img.shields.io/pypi/v/pytest.svg + :target: https://pypi.org/project/pytest/ + +.. image:: https://img.shields.io/conda/vn/conda-forge/pytest.svg + :target: https://anaconda.org/conda-forge/pytest + +.. image:: https://img.shields.io/pypi/pyversions/pytest.svg + :target: https://pypi.org/project/pytest/ + +.. image:: https://codecov.io/gh/pytest-dev/pytest/branch/master/graph/badge.svg + :target: https://codecov.io/gh/pytest-dev/pytest + :alt: Code coverage Status + +.. image:: https://travis-ci.org/pytest-dev/pytest.svg?branch=master + :target: https://travis-ci.org/pytest-dev/pytest + +.. image:: https://dev.azure.com/pytest-dev/pytest/_apis/build/status/pytest-CI?branchName=master + :target: https://dev.azure.com/pytest-dev/pytest + +.. image:: https://img.shields.io/badge/code%20style-black-000000.svg + :target: https://github.com/psf/black + +.. image:: https://www.codetriage.com/pytest-dev/pytest/badges/users.svg + :target: https://www.codetriage.com/pytest-dev/pytest + +.. image:: https://readthedocs.org/projects/pytest/badge/?version=latest + :target: https://pytest.readthedocs.io/en/latest/?badge=latest + :alt: Documentation Status + +The ``pytest`` framework makes it easy to write small tests, yet +scales to support complex functional testing for applications and libraries. + +An example of a simple test: + +.. code-block:: python + + # content of test_sample.py + def inc(x): + return x + 1 + + + def test_answer(): + assert inc(3) == 5 + + +To execute it:: + + $ pytest + ============================= test session starts ============================= + collected 1 items + + test_sample.py F + + ================================== FAILURES =================================== + _________________________________ test_answer _________________________________ + + def test_answer(): + > assert inc(3) == 5 + E assert 4 == 5 + E + where 4 = inc(3) + + test_sample.py:5: AssertionError + ========================== 1 failed in 0.04 seconds =========================== + + +Due to ``pytest``'s detailed assertion introspection, only plain ``assert`` statements are used. See `getting-started <https://docs.pytest.org/en/latest/getting-started.html#our-first-test-run>`_ for more examples. + + +Features +-------- + +- Detailed info on failing `assert statements <https://docs.pytest.org/en/latest/assert.html>`_ (no need to remember ``self.assert*`` names); + +- `Auto-discovery + <https://docs.pytest.org/en/latest/goodpractices.html#python-test-discovery>`_ + of test modules and functions; + +- `Modular fixtures <https://docs.pytest.org/en/latest/fixture.html>`_ for + managing small or parametrized long-lived test resources; + +- Can run `unittest <https://docs.pytest.org/en/latest/unittest.html>`_ (or trial), + `nose <https://docs.pytest.org/en/latest/nose.html>`_ test suites out of the box; + +- Python 3.5+ and PyPy3; + +- Rich plugin architecture, with over 315+ `external plugins <http://plugincompat.herokuapp.com>`_ and thriving community; + + +Documentation +------------- + +For full documentation, including installation, tutorials and PDF documents, please see https://docs.pytest.org/en/latest/. + + +Bugs/Requests +------------- + +Please use the `GitHub issue tracker <https://github.com/pytest-dev/pytest/issues>`_ to submit bugs or request features. + + +Changelog +--------- + +Consult the `Changelog <https://docs.pytest.org/en/latest/changelog.html>`__ page for fixes and enhancements of each version. + + +Support pytest +-------------- + +`Open Collective`_ is an online funding platform for open and transparent communities. +It provides tools to raise money and share your finances in full transparency. + +It is the platform of choice for individuals and companies that want to make one-time or +monthly donations directly to the project. + +See more details in the `pytest collective`_. + +.. _Open Collective: https://opencollective.com +.. _pytest collective: https://opencollective.com/pytest + + +pytest for enterprise +--------------------- + +Available as part of the Tidelift Subscription. + +The maintainers of pytest and thousands of other packages are working with Tidelift to deliver commercial support and +maintenance for the open source dependencies you use to build your applications. +Save time, reduce risk, and improve code health, while paying the maintainers of the exact dependencies you use. + +`Learn more. <https://tidelift.com/subscription/pkg/pypi-pytest?utm_source=pypi-pytest&utm_medium=referral&utm_campaign=enterprise&utm_term=repo>`_ + +Security +^^^^^^^^ + +pytest has never been associated with a security vulnerability, but in any case, to report a +security vulnerability please use the `Tidelift security contact <https://tidelift.com/security>`_. +Tidelift will coordinate the fix and disclosure. + + +License +------- + +Copyright Holger Krekel and others, 2004-2020. + +Distributed under the terms of the `MIT`_ license, pytest is free and open source software. + +.. _`MIT`: https://github.com/pytest-dev/pytest/blob/master/LICENSE diff --git a/contrib/python/pytest/py3/_pytest/__init__.py b/contrib/python/pytest/py3/_pytest/__init__.py new file mode 100644 index 00000000000..46c7827ed5e --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/__init__.py @@ -0,0 +1,8 @@ +__all__ = ["__version__"] + +try: + from ._version import version as __version__ +except ImportError: + # broken installation, we don't even try + # unknown only works because we do poor mans version compare + __version__ = "unknown" diff --git a/contrib/python/pytest/py3/_pytest/_argcomplete.py b/contrib/python/pytest/py3/_pytest/_argcomplete.py new file mode 100644 index 00000000000..7ca216ecf96 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/_argcomplete.py @@ -0,0 +1,109 @@ +"""allow bash-completion for argparse with argcomplete if installed +needs argcomplete>=0.5.6 for python 3.2/3.3 (older versions fail +to find the magic string, so _ARGCOMPLETE env. var is never set, and +this does not need special code. + +Function try_argcomplete(parser) should be called directly before +the call to ArgumentParser.parse_args(). + +The filescompleter is what you normally would use on the positional +arguments specification, in order to get "dirname/" after "dirn<TAB>" +instead of the default "dirname ": + + optparser.add_argument(Config._file_or_dir, nargs='*' + ).completer=filescompleter + +Other, application specific, completers should go in the file +doing the add_argument calls as they need to be specified as .completer +attributes as well. (If argcomplete is not installed, the function the +attribute points to will not be used). + +SPEEDUP +======= +The generic argcomplete script for bash-completion +(/etc/bash_completion.d/python-argcomplete.sh ) +uses a python program to determine startup script generated by pip. +You can speed up completion somewhat by changing this script to include + # PYTHON_ARGCOMPLETE_OK +so the the python-argcomplete-check-easy-install-script does not +need to be called to find the entry point of the code and see if that is +marked with PYTHON_ARGCOMPLETE_OK + +INSTALL/DEBUGGING +================= +To include this support in another application that has setup.py generated +scripts: +- add the line: + # PYTHON_ARGCOMPLETE_OK + near the top of the main python entry point +- include in the file calling parse_args(): + from _argcomplete import try_argcomplete, filescompleter + , call try_argcomplete just before parse_args(), and optionally add + filescompleter to the positional arguments' add_argument() +If things do not work right away: +- switch on argcomplete debugging with (also helpful when doing custom + completers): + export _ARC_DEBUG=1 +- run: + python-argcomplete-check-easy-install-script $(which appname) + echo $? + will echo 0 if the magic line has been found, 1 if not +- sometimes it helps to find early on errors using: + _ARGCOMPLETE=1 _ARC_DEBUG=1 appname + which should throw a KeyError: 'COMPLINE' (which is properly set by the + global argcomplete script). +""" +import argparse +import os +import sys +from glob import glob +from typing import Any +from typing import List +from typing import Optional + + +class FastFilesCompleter: + "Fast file completer class" + + def __init__(self, directories: bool = True) -> None: + self.directories = directories + + def __call__(self, prefix: str, **kwargs: Any) -> List[str]: + """only called on non option completions""" + if os.path.sep in prefix[1:]: + prefix_dir = len(os.path.dirname(prefix) + os.path.sep) + else: + prefix_dir = 0 + completion = [] + globbed = [] + if "*" not in prefix and "?" not in prefix: + # we are on unix, otherwise no bash + if not prefix or prefix[-1] == os.path.sep: + globbed.extend(glob(prefix + ".*")) + prefix += "*" + globbed.extend(glob(prefix)) + for x in sorted(globbed): + if os.path.isdir(x): + x += "/" + # append stripping the prefix (like bash, not like compgen) + completion.append(x[prefix_dir:]) + return completion + + +if os.environ.get("_ARGCOMPLETE"): + try: + import argcomplete.completers + except ImportError: + sys.exit(-1) + filescompleter = FastFilesCompleter() # type: Optional[FastFilesCompleter] + + def try_argcomplete(parser: argparse.ArgumentParser) -> None: + argcomplete.autocomplete(parser, always_complete_options=False) + + +else: + + def try_argcomplete(parser: argparse.ArgumentParser) -> None: + pass + + filescompleter = None diff --git a/contrib/python/pytest/py3/_pytest/_code/__init__.py b/contrib/python/pytest/py3/_pytest/_code/__init__.py new file mode 100644 index 00000000000..370e41dc9f3 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/_code/__init__.py @@ -0,0 +1,10 @@ +""" python inspection/code generation API """ +from .code import Code # noqa +from .code import ExceptionInfo # noqa +from .code import filter_traceback # noqa +from .code import Frame # noqa +from .code import getrawcode # noqa +from .code import Traceback # noqa +from .source import compile_ as compile # noqa +from .source import getfslineno # noqa +from .source import Source # noqa diff --git a/contrib/python/pytest/py3/_pytest/_code/code.py b/contrib/python/pytest/py3/_pytest/_code/code.py new file mode 100644 index 00000000000..965074c924b --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/_code/code.py @@ -0,0 +1,1191 @@ +import inspect +import re +import sys +import traceback +from inspect import CO_VARARGS +from inspect import CO_VARKEYWORDS +from io import StringIO +from traceback import format_exception_only +from types import CodeType +from types import FrameType +from types import TracebackType +from typing import Any +from typing import Callable +from typing import Dict +from typing import Generic +from typing import Iterable +from typing import List +from typing import Optional +from typing import Pattern +from typing import Sequence +from typing import Set +from typing import Tuple +from typing import TypeVar +from typing import Union +from weakref import ref + +import attr +import pluggy +import py + +import _pytest +from _pytest._io import TerminalWriter +from _pytest._io.saferepr import safeformat +from _pytest._io.saferepr import saferepr +from _pytest.compat import ATTRS_EQ_FIELD +from _pytest.compat import overload +from _pytest.compat import TYPE_CHECKING + +if TYPE_CHECKING: + from typing import Type + from typing_extensions import Literal + from weakref import ReferenceType # noqa: F401 + + from _pytest._code import Source + + _TracebackStyle = Literal["long", "short", "line", "no", "native"] + + +class Code: + """ wrapper around Python code objects """ + + def __init__(self, rawcode) -> None: + if not hasattr(rawcode, "co_filename"): + rawcode = getrawcode(rawcode) + if not isinstance(rawcode, CodeType): + raise TypeError("not a code object: {!r}".format(rawcode)) + self.filename = rawcode.co_filename + self.firstlineno = rawcode.co_firstlineno - 1 + self.name = rawcode.co_name + self.raw = rawcode + + def __eq__(self, other): + return self.raw == other.raw + + # Ignore type because of https://github.com/python/mypy/issues/4266. + __hash__ = None # type: ignore + + def __ne__(self, other): + return not self == other + + @property + def path(self) -> Union[py.path.local, str]: + """ return a path object pointing to source code (or a str in case + of OSError / non-existing file). + """ + if not self.raw.co_filename: + return "" + try: + p = py.path.local(self.raw.co_filename) + # maybe don't try this checking + if not p.check(): + raise OSError("py.path check failed.") + return p + except OSError: + # XXX maybe try harder like the weird logic + # in the standard lib [linecache.updatecache] does? + return self.raw.co_filename + + @property + def fullsource(self) -> Optional["Source"]: + """ return a _pytest._code.Source object for the full source file of the code + """ + from _pytest._code import source + + full, _ = source.findsource(self.raw) + return full + + def source(self) -> "Source": + """ return a _pytest._code.Source object for the code object's source only + """ + # return source only for that part of code + import _pytest._code + + return _pytest._code.Source(self.raw) + + def getargs(self, var: bool = False) -> Tuple[str, ...]: + """ return a tuple with the argument names for the code object + + if 'var' is set True also return the names of the variable and + keyword arguments when present + """ + # handfull shortcut for getting args + raw = self.raw + argcount = raw.co_argcount + if var: + argcount += raw.co_flags & CO_VARARGS + argcount += raw.co_flags & CO_VARKEYWORDS + return raw.co_varnames[:argcount] + + +class Frame: + """Wrapper around a Python frame holding f_locals and f_globals + in which expressions can be evaluated.""" + + def __init__(self, frame: FrameType) -> None: + self.lineno = frame.f_lineno - 1 + self.f_globals = frame.f_globals + self.f_locals = frame.f_locals + self.raw = frame + self.code = Code(frame.f_code) + + @property + def statement(self) -> "Source": + """ statement this frame is at """ + import _pytest._code + + if self.code.fullsource is None: + return _pytest._code.Source("") + return self.code.fullsource.getstatement(self.lineno) + + def eval(self, code, **vars): + """ evaluate 'code' in the frame + + 'vars' are optional additional local variables + + returns the result of the evaluation + """ + f_locals = self.f_locals.copy() + f_locals.update(vars) + return eval(code, self.f_globals, f_locals) + + def exec_(self, code, **vars) -> None: + """ exec 'code' in the frame + + 'vars' are optional; additional local variables + """ + f_locals = self.f_locals.copy() + f_locals.update(vars) + exec(code, self.f_globals, f_locals) + + def repr(self, object: object) -> str: + """ return a 'safe' (non-recursive, one-line) string repr for 'object' + """ + return saferepr(object) + + def is_true(self, object): + return object + + def getargs(self, var: bool = False): + """ return a list of tuples (name, value) for all arguments + + if 'var' is set True also include the variable and keyword + arguments when present + """ + retval = [] + for arg in self.code.getargs(var): + try: + retval.append((arg, self.f_locals[arg])) + except KeyError: + pass # this can occur when using Psyco + return retval + + +class TracebackEntry: + """ a single entry in a traceback """ + + _repr_style = None # type: Optional[Literal["short", "long"]] + exprinfo = None + + def __init__(self, rawentry: TracebackType, excinfo=None) -> None: + self._excinfo = excinfo + self._rawentry = rawentry + self.lineno = rawentry.tb_lineno - 1 + + def set_repr_style(self, mode: "Literal['short', 'long']") -> None: + assert mode in ("short", "long") + self._repr_style = mode + + @property + def frame(self) -> Frame: + return Frame(self._rawentry.tb_frame) + + @property + def relline(self) -> int: + return self.lineno - self.frame.code.firstlineno + + def __repr__(self) -> str: + return "<TracebackEntry %s:%d>" % (self.frame.code.path, self.lineno + 1) + + @property + def statement(self) -> "Source": + """ _pytest._code.Source object for the current statement """ + source = self.frame.code.fullsource + assert source is not None + return source.getstatement(self.lineno) + + @property + def path(self): + """ path to the source code """ + return self.frame.code.path + + @property + def locals(self) -> Dict[str, Any]: + """ locals of underlying frame """ + return self.frame.f_locals + + def getfirstlinesource(self) -> int: + return self.frame.code.firstlineno + + def getsource(self, astcache=None) -> Optional["Source"]: + """ return failing source code. """ + # we use the passed in astcache to not reparse asttrees + # within exception info printing + from _pytest._code.source import getstatementrange_ast + + source = self.frame.code.fullsource + if source is None: + return None + key = astnode = None + if astcache is not None: + key = self.frame.code.path + if key is not None: + astnode = astcache.get(key, None) + start = self.getfirstlinesource() + try: + astnode, _, end = getstatementrange_ast( + self.lineno, source, astnode=astnode + ) + except SyntaxError: + end = self.lineno + 1 + else: + if key is not None: + astcache[key] = astnode + return source[start:end] + + source = property(getsource) + + def ishidden(self): + """ return True if the current frame has a var __tracebackhide__ + resolving to True. + + If __tracebackhide__ is a callable, it gets called with the + ExceptionInfo instance and can decide whether to hide the traceback. + + mostly for internal use + """ + f = self.frame + tbh = f.f_locals.get( + "__tracebackhide__", f.f_globals.get("__tracebackhide__", False) + ) + if tbh and callable(tbh): + return tbh(None if self._excinfo is None else self._excinfo()) + return tbh + + def __str__(self) -> str: + try: + fn = str(self.path) + except py.error.Error: + fn = "???" + name = self.frame.code.name + try: + line = str(self.statement).lstrip() + except KeyboardInterrupt: + raise + except: # noqa + line = "???" + return " File %r:%d in %s\n %s\n" % (fn, self.lineno + 1, name, line) + + @property + def name(self) -> str: + """ co_name of underlying code """ + return self.frame.code.raw.co_name + + +class Traceback(List[TracebackEntry]): + """ Traceback objects encapsulate and offer higher level + access to Traceback entries. + """ + + def __init__( + self, + tb: Union[TracebackType, Iterable[TracebackEntry]], + excinfo: Optional["ReferenceType[ExceptionInfo]"] = None, + ) -> None: + """ initialize from given python traceback object and ExceptionInfo """ + self._excinfo = excinfo + if isinstance(tb, TracebackType): + + def f(cur: TracebackType) -> Iterable[TracebackEntry]: + cur_ = cur # type: Optional[TracebackType] + while cur_ is not None: + yield TracebackEntry(cur_, excinfo=excinfo) + cur_ = cur_.tb_next + + super().__init__(f(tb)) + else: + super().__init__(tb) + + def cut( + self, + path=None, + lineno: Optional[int] = None, + firstlineno: Optional[int] = None, + excludepath=None, + ) -> "Traceback": + """ return a Traceback instance wrapping part of this Traceback + + by providing any combination of path, lineno and firstlineno, the + first frame to start the to-be-returned traceback is determined + + this allows cutting the first part of a Traceback instance e.g. + for formatting reasons (removing some uninteresting bits that deal + with handling of the exception/traceback) + """ + for x in self: + code = x.frame.code + codepath = code.path + if ( + (path is None or codepath == path) + and ( + excludepath is None + or not isinstance(codepath, py.path.local) + or not codepath.relto(excludepath) + ) + and (lineno is None or x.lineno == lineno) + and (firstlineno is None or x.frame.code.firstlineno == firstlineno) + ): + return Traceback(x._rawentry, self._excinfo) + return self + + @overload + def __getitem__(self, key: int) -> TracebackEntry: + raise NotImplementedError() + + @overload # noqa: F811 + def __getitem__(self, key: slice) -> "Traceback": # noqa: F811 + raise NotImplementedError() + + def __getitem__( # noqa: F811 + self, key: Union[int, slice] + ) -> Union[TracebackEntry, "Traceback"]: + if isinstance(key, slice): + return self.__class__(super().__getitem__(key)) + else: + return super().__getitem__(key) + + def filter( + self, fn: Callable[[TracebackEntry], bool] = lambda x: not x.ishidden() + ) -> "Traceback": + """ return a Traceback instance with certain items removed + + fn is a function that gets a single argument, a TracebackEntry + instance, and should return True when the item should be added + to the Traceback, False when not + + by default this removes all the TracebackEntries which are hidden + (see ishidden() above) + """ + return Traceback(filter(fn, self), self._excinfo) + + def getcrashentry(self) -> TracebackEntry: + """ return last non-hidden traceback entry that lead + to the exception of a traceback. + """ + for i in range(-1, -len(self) - 1, -1): + entry = self[i] + if not entry.ishidden(): + return entry + return self[-1] + + def recursionindex(self) -> Optional[int]: + """ return the index of the frame/TracebackEntry where recursion + originates if appropriate, None if no recursion occurred + """ + cache = {} # type: Dict[Tuple[Any, int, int], List[Dict[str, Any]]] + for i, entry in enumerate(self): + # id for the code.raw is needed to work around + # the strange metaprogramming in the decorator lib from pypi + # which generates code objects that have hash/value equality + # XXX needs a test + key = entry.frame.code.path, id(entry.frame.code.raw), entry.lineno + # print "checking for recursion at", key + values = cache.setdefault(key, []) + if values: + f = entry.frame + loc = f.f_locals + for otherloc in values: + if f.is_true( + f.eval( + co_equal, + __recursioncache_locals_1=loc, + __recursioncache_locals_2=otherloc, + ) + ): + return i + values.append(entry.frame.f_locals) + return None + + +co_equal = compile( + "__recursioncache_locals_1 == __recursioncache_locals_2", "?", "eval" +) + + +_E = TypeVar("_E", bound=BaseException) + + +@attr.s(repr=False) +class ExceptionInfo(Generic[_E]): + """ wraps sys.exc_info() objects and offers + help for navigating the traceback. + """ + + _assert_start_repr = "AssertionError('assert " + + _excinfo = attr.ib(type=Optional[Tuple["Type[_E]", "_E", TracebackType]]) + _striptext = attr.ib(type=str, default="") + _traceback = attr.ib(type=Optional[Traceback], default=None) + + @classmethod + def from_exc_info( + cls, + exc_info: Tuple["Type[_E]", "_E", TracebackType], + exprinfo: Optional[str] = None, + ) -> "ExceptionInfo[_E]": + """returns an ExceptionInfo for an existing exc_info tuple. + + .. warning:: + + Experimental API + + + :param exprinfo: a text string helping to determine if we should + strip ``AssertionError`` from the output, defaults + to the exception message/``__str__()`` + """ + _striptext = "" + if exprinfo is None and isinstance(exc_info[1], AssertionError): + exprinfo = getattr(exc_info[1], "msg", None) + if exprinfo is None: + exprinfo = saferepr(exc_info[1]) + if exprinfo and exprinfo.startswith(cls._assert_start_repr): + _striptext = "AssertionError: " + + return cls(exc_info, _striptext) + + @classmethod + def from_current( + cls, exprinfo: Optional[str] = None + ) -> "ExceptionInfo[BaseException]": + """returns an ExceptionInfo matching the current traceback + + .. warning:: + + Experimental API + + + :param exprinfo: a text string helping to determine if we should + strip ``AssertionError`` from the output, defaults + to the exception message/``__str__()`` + """ + tup = sys.exc_info() + assert tup[0] is not None, "no current exception" + assert tup[1] is not None, "no current exception" + assert tup[2] is not None, "no current exception" + exc_info = (tup[0], tup[1], tup[2]) + return ExceptionInfo.from_exc_info(exc_info, exprinfo) + + @classmethod + def for_later(cls) -> "ExceptionInfo[_E]": + """return an unfilled ExceptionInfo + """ + return cls(None) + + def fill_unfilled(self, exc_info: Tuple["Type[_E]", _E, TracebackType]) -> None: + """fill an unfilled ExceptionInfo created with for_later()""" + assert self._excinfo is None, "ExceptionInfo was already filled" + self._excinfo = exc_info + + @property + def type(self) -> "Type[_E]": + """the exception class""" + assert ( + self._excinfo is not None + ), ".type can only be used after the context manager exits" + return self._excinfo[0] + + @property + def value(self) -> _E: + """the exception value""" + assert ( + self._excinfo is not None + ), ".value can only be used after the context manager exits" + return self._excinfo[1] + + @property + def tb(self) -> TracebackType: + """the exception raw traceback""" + assert ( + self._excinfo is not None + ), ".tb can only be used after the context manager exits" + return self._excinfo[2] + + @property + def typename(self) -> str: + """the type name of the exception""" + assert ( + self._excinfo is not None + ), ".typename can only be used after the context manager exits" + return self.type.__name__ + + @property + def traceback(self) -> Traceback: + """the traceback""" + if self._traceback is None: + self._traceback = Traceback(self.tb, excinfo=ref(self)) + return self._traceback + + @traceback.setter + def traceback(self, value: Traceback) -> None: + self._traceback = value + + def __repr__(self) -> str: + if self._excinfo is None: + return "<ExceptionInfo for raises contextmanager>" + return "<{} {} tblen={}>".format( + self.__class__.__name__, saferepr(self._excinfo[1]), len(self.traceback) + ) + + def exconly(self, tryshort: bool = False) -> str: + """ return the exception as a string + + when 'tryshort' resolves to True, and the exception is a + _pytest._code._AssertionError, only the actual exception part of + the exception representation is returned (so 'AssertionError: ' is + removed from the beginning) + """ + lines = format_exception_only(self.type, self.value) + text = "".join(lines) + text = text.rstrip() + if tryshort: + if text.startswith(self._striptext): + text = text[len(self._striptext) :] + return text + + def errisinstance( + self, exc: Union["Type[BaseException]", Tuple["Type[BaseException]", ...]] + ) -> bool: + """ return True if the exception is an instance of exc """ + return isinstance(self.value, exc) + + def _getreprcrash(self) -> "ReprFileLocation": + exconly = self.exconly(tryshort=True) + entry = self.traceback.getcrashentry() + path, lineno = entry.frame.code.raw.co_filename, entry.lineno + return ReprFileLocation(path, lineno + 1, exconly) + + def getrepr( + self, + showlocals: bool = False, + style: "_TracebackStyle" = "long", + abspath: bool = False, + tbfilter: bool = True, + funcargs: bool = False, + truncate_locals: bool = True, + chain: bool = True, + ) -> Union["ReprExceptionInfo", "ExceptionChainRepr"]: + """ + Return str()able representation of this exception info. + + :param bool showlocals: + Show locals per traceback entry. + Ignored if ``style=="native"``. + + :param str style: long|short|no|native traceback style + + :param bool abspath: + If paths should be changed to absolute or left unchanged. + + :param bool tbfilter: + Hide entries that contain a local variable ``__tracebackhide__==True``. + Ignored if ``style=="native"``. + + :param bool funcargs: + Show fixtures ("funcargs" for legacy purposes) per traceback entry. + + :param bool truncate_locals: + With ``showlocals==True``, make sure locals can be safely represented as strings. + + :param bool chain: if chained exceptions in Python 3 should be shown. + + .. versionchanged:: 3.9 + + Added the ``chain`` parameter. + """ + if style == "native": + return ReprExceptionInfo( + ReprTracebackNative( + traceback.format_exception( + self.type, self.value, self.traceback[0]._rawentry + ) + ), + self._getreprcrash(), + ) + + fmt = FormattedExcinfo( + showlocals=showlocals, + style=style, + abspath=abspath, + tbfilter=tbfilter, + funcargs=funcargs, + truncate_locals=truncate_locals, + chain=chain, + ) + return fmt.repr_excinfo(self) + + def match(self, regexp: "Union[str, Pattern]") -> "Literal[True]": + """ + Check whether the regular expression `regexp` matches the string + representation of the exception using :func:`python:re.search`. + If it matches `True` is returned. + If it doesn't match an `AssertionError` is raised. + """ + __tracebackhide__ = True + assert re.search( + regexp, str(self.value) + ), "Pattern {!r} does not match {!r}".format(regexp, str(self.value)) + # Return True to allow for "assert excinfo.match()". + return True + + +@attr.s +class FormattedExcinfo: + """ presenting information about failing Functions and Generators. """ + + # for traceback entries + flow_marker = ">" + fail_marker = "E" + + showlocals = attr.ib(type=bool, default=False) + style = attr.ib(type="_TracebackStyle", default="long") + abspath = attr.ib(type=bool, default=True) + tbfilter = attr.ib(type=bool, default=True) + funcargs = attr.ib(type=bool, default=False) + truncate_locals = attr.ib(type=bool, default=True) + chain = attr.ib(type=bool, default=True) + astcache = attr.ib(default=attr.Factory(dict), init=False, repr=False) + + def _getindent(self, source: "Source") -> int: + # figure out indent for given source + try: + s = str(source.getstatement(len(source) - 1)) + except KeyboardInterrupt: + raise + except: # noqa + try: + s = str(source[-1]) + except KeyboardInterrupt: + raise + except: # noqa + return 0 + return 4 + (len(s) - len(s.lstrip())) + + def _getentrysource(self, entry: TracebackEntry) -> Optional["Source"]: + source = entry.getsource(self.astcache) + if source is not None: + source = source.deindent() + return source + + def repr_args(self, entry: TracebackEntry) -> Optional["ReprFuncArgs"]: + if self.funcargs: + args = [] + for argname, argvalue in entry.frame.getargs(var=True): + args.append((argname, saferepr(argvalue))) + return ReprFuncArgs(args) + return None + + def get_source( + self, + source: "Source", + line_index: int = -1, + excinfo: Optional[ExceptionInfo] = None, + short: bool = False, + ) -> List[str]: + """ return formatted and marked up source lines. """ + import _pytest._code + + lines = [] + if source is None or line_index >= len(source.lines): + source = _pytest._code.Source("???") + line_index = 0 + if line_index < 0: + line_index += len(source) + space_prefix = " " + if short: + lines.append(space_prefix + source.lines[line_index].strip()) + else: + for line in source.lines[:line_index]: + lines.append(space_prefix + line) + lines.append(self.flow_marker + " " + source.lines[line_index]) + for line in source.lines[line_index + 1 :]: + lines.append(space_prefix + line) + if excinfo is not None: + indent = 4 if short else self._getindent(source) + lines.extend(self.get_exconly(excinfo, indent=indent, markall=True)) + return lines + + def get_exconly( + self, excinfo: ExceptionInfo, indent: int = 4, markall: bool = False + ) -> List[str]: + lines = [] + indentstr = " " * indent + # get the real exception information out + exlines = excinfo.exconly(tryshort=True).split("\n") + failindent = self.fail_marker + indentstr[1:] + for line in exlines: + lines.append(failindent + line) + if not markall: + failindent = indentstr + return lines + + def repr_locals(self, locals: Dict[str, object]) -> Optional["ReprLocals"]: + if self.showlocals: + lines = [] + keys = [loc for loc in locals if loc[0] != "@"] + keys.sort() + for name in keys: + value = locals[name] + if name == "__builtins__": + lines.append("__builtins__ = <builtins>") + else: + # This formatting could all be handled by the + # _repr() function, which is only reprlib.Repr in + # disguise, so is very configurable. + if self.truncate_locals: + str_repr = saferepr(value) + else: + str_repr = safeformat(value) + # if len(str_repr) < 70 or not isinstance(value, + # (list, tuple, dict)): + lines.append("{:<10} = {}".format(name, str_repr)) + # else: + # self._line("%-10s =\\" % (name,)) + # # XXX + # pprint.pprint(value, stream=self.excinfowriter) + return ReprLocals(lines) + return None + + def repr_traceback_entry( + self, entry: TracebackEntry, excinfo: Optional[ExceptionInfo] = None + ) -> "ReprEntry": + import _pytest._code + + source = self._getentrysource(entry) + if source is None: + source = _pytest._code.Source("???") + line_index = 0 + else: + line_index = entry.lineno - entry.getfirstlinesource() + + lines = [] # type: List[str] + style = entry._repr_style if entry._repr_style is not None else self.style + if style in ("short", "long"): + short = style == "short" + reprargs = self.repr_args(entry) if not short else None + s = self.get_source(source, line_index, excinfo, short=short) + lines.extend(s) + if short: + message = "in %s" % (entry.name) + else: + message = excinfo and excinfo.typename or "" + path = self._makepath(entry.path) + reprfileloc = ReprFileLocation(path, entry.lineno + 1, message) + localsrepr = self.repr_locals(entry.locals) + return ReprEntry(lines, reprargs, localsrepr, reprfileloc, style) + if excinfo: + lines.extend(self.get_exconly(excinfo, indent=4)) + return ReprEntry(lines, None, None, None, style) + + def _makepath(self, path): + if not self.abspath: + try: + np = py.path.local().bestrelpath(path) + except OSError: + return path + if len(np) < len(str(path)): + path = np + return path + + def repr_traceback(self, excinfo: ExceptionInfo) -> "ReprTraceback": + traceback = excinfo.traceback + if self.tbfilter: + traceback = traceback.filter() + + if excinfo.errisinstance(RecursionError): + traceback, extraline = self._truncate_recursive_traceback(traceback) + else: + extraline = None + + last = traceback[-1] + entries = [] + for index, entry in enumerate(traceback): + einfo = (last == entry) and excinfo or None + reprentry = self.repr_traceback_entry(entry, einfo) + entries.append(reprentry) + return ReprTraceback(entries, extraline, style=self.style) + + def _truncate_recursive_traceback( + self, traceback: Traceback + ) -> Tuple[Traceback, Optional[str]]: + """ + Truncate the given recursive traceback trying to find the starting point + of the recursion. + + The detection is done by going through each traceback entry and finding the + point in which the locals of the frame are equal to the locals of a previous frame (see ``recursionindex()``. + + Handle the situation where the recursion process might raise an exception (for example + comparing numpy arrays using equality raises a TypeError), in which case we do our best to + warn the user of the error and show a limited traceback. + """ + try: + recursionindex = traceback.recursionindex() + except Exception as e: + max_frames = 10 + extraline = ( + "!!! Recursion error detected, but an error occurred locating the origin of recursion.\n" + " The following exception happened when comparing locals in the stack frame:\n" + " {exc_type}: {exc_msg}\n" + " Displaying first and last {max_frames} stack frames out of {total}." + ).format( + exc_type=type(e).__name__, + exc_msg=str(e), + max_frames=max_frames, + total=len(traceback), + ) # type: Optional[str] + # Type ignored because adding two instaces of a List subtype + # currently incorrectly has type List instead of the subtype. + traceback = traceback[:max_frames] + traceback[-max_frames:] # type: ignore + else: + if recursionindex is not None: + extraline = "!!! Recursion detected (same locals & position)" + traceback = traceback[: recursionindex + 1] + else: + extraline = None + + return traceback, extraline + + def repr_excinfo(self, excinfo: ExceptionInfo) -> "ExceptionChainRepr": + repr_chain = ( + [] + ) # type: List[Tuple[ReprTraceback, Optional[ReprFileLocation], Optional[str]]] + e = excinfo.value + excinfo_ = excinfo # type: Optional[ExceptionInfo] + descr = None + seen = set() # type: Set[int] + while e is not None and id(e) not in seen: + seen.add(id(e)) + if excinfo_: + reprtraceback = self.repr_traceback(excinfo_) + reprcrash = excinfo_._getreprcrash() # type: Optional[ReprFileLocation] + else: + # fallback to native repr if the exception doesn't have a traceback: + # ExceptionInfo objects require a full traceback to work + reprtraceback = ReprTracebackNative( + traceback.format_exception(type(e), e, None) + ) + reprcrash = None + + repr_chain += [(reprtraceback, reprcrash, descr)] + if e.__cause__ is not None and self.chain: + e = e.__cause__ + excinfo_ = ( + ExceptionInfo((type(e), e, e.__traceback__)) + if e.__traceback__ + else None + ) + descr = "The above exception was the direct cause of the following exception:" + elif ( + e.__context__ is not None and not e.__suppress_context__ and self.chain + ): + e = e.__context__ + excinfo_ = ( + ExceptionInfo((type(e), e, e.__traceback__)) + if e.__traceback__ + else None + ) + descr = "During handling of the above exception, another exception occurred:" + else: + e = None + repr_chain.reverse() + return ExceptionChainRepr(repr_chain) + + +@attr.s(**{ATTRS_EQ_FIELD: False}) # type: ignore +class TerminalRepr: + def __str__(self) -> str: + # FYI this is called from pytest-xdist's serialization of exception + # information. + io = StringIO() + tw = TerminalWriter(file=io) + self.toterminal(tw) + return io.getvalue().strip() + + def __repr__(self) -> str: + return "<{} instance at {:0x}>".format(self.__class__, id(self)) + + def toterminal(self, tw: TerminalWriter) -> None: + raise NotImplementedError() + + +@attr.s(**{ATTRS_EQ_FIELD: False}) # type: ignore +class ExceptionRepr(TerminalRepr): + def __attrs_post_init__(self): + self.sections = [] # type: List[Tuple[str, str, str]] + + def addsection(self, name: str, content: str, sep: str = "-") -> None: + self.sections.append((name, content, sep)) + + def toterminal(self, tw: TerminalWriter) -> None: + for name, content, sep in self.sections: + tw.sep(sep, name) + tw.line(content) + + +@attr.s(**{ATTRS_EQ_FIELD: False}) # type: ignore +class ExceptionChainRepr(ExceptionRepr): + chain = attr.ib( + type=Sequence[ + Tuple["ReprTraceback", Optional["ReprFileLocation"], Optional[str]] + ] + ) + + def __attrs_post_init__(self): + super().__attrs_post_init__() + # reprcrash and reprtraceback of the outermost (the newest) exception + # in the chain + self.reprtraceback = self.chain[-1][0] + self.reprcrash = self.chain[-1][1] + + def toterminal(self, tw: TerminalWriter) -> None: + for element in self.chain: + element[0].toterminal(tw) + if element[2] is not None: + tw.line("") + tw.line(element[2], yellow=True) + super().toterminal(tw) + + +@attr.s(**{ATTRS_EQ_FIELD: False}) # type: ignore +class ReprExceptionInfo(ExceptionRepr): + reprtraceback = attr.ib(type="ReprTraceback") + reprcrash = attr.ib(type="ReprFileLocation") + + def toterminal(self, tw: TerminalWriter) -> None: + self.reprtraceback.toterminal(tw) + super().toterminal(tw) + + +@attr.s(**{ATTRS_EQ_FIELD: False}) # type: ignore +class ReprTraceback(TerminalRepr): + reprentries = attr.ib(type=Sequence[Union["ReprEntry", "ReprEntryNative"]]) + extraline = attr.ib(type=Optional[str]) + style = attr.ib(type="_TracebackStyle") + + entrysep = "_ " + + def toterminal(self, tw: TerminalWriter) -> None: + # the entries might have different styles + for i, entry in enumerate(self.reprentries): + if entry.style == "long": + tw.line("") + entry.toterminal(tw) + if i < len(self.reprentries) - 1: + next_entry = self.reprentries[i + 1] + if ( + entry.style == "long" + or entry.style == "short" + and next_entry.style == "long" + ): + tw.sep(self.entrysep) + + if self.extraline: + tw.line(self.extraline) + + +class ReprTracebackNative(ReprTraceback): + def __init__(self, tblines: Sequence[str]) -> None: + self.style = "native" + self.reprentries = [ReprEntryNative(tblines)] + self.extraline = None + + +@attr.s(**{ATTRS_EQ_FIELD: False}) # type: ignore +class ReprEntryNative(TerminalRepr): + lines = attr.ib(type=Sequence[str]) + style = "native" # type: _TracebackStyle + + def toterminal(self, tw: TerminalWriter) -> None: + tw.write("".join(self.lines)) + + +@attr.s(**{ATTRS_EQ_FIELD: False}) # type: ignore +class ReprEntry(TerminalRepr): + lines = attr.ib(type=Sequence[str]) + reprfuncargs = attr.ib(type=Optional["ReprFuncArgs"]) + reprlocals = attr.ib(type=Optional["ReprLocals"]) + reprfileloc = attr.ib(type=Optional["ReprFileLocation"]) + style = attr.ib(type="_TracebackStyle") + + def _write_entry_lines(self, tw: TerminalWriter) -> None: + """Writes the source code portions of a list of traceback entries with syntax highlighting. + + Usually entries are lines like these: + + " x = 1" + "> assert x == 2" + "E assert 1 == 2" + + This function takes care of rendering the "source" portions of it (the lines without + the "E" prefix) using syntax highlighting, taking care to not highlighting the ">" + character, as doing so might break line continuations. + """ + + indent_size = 4 + + def is_fail(line): + return line.startswith("{} ".format(FormattedExcinfo.fail_marker)) + + if not self.lines: + return + + # separate indents and source lines that are not failures: we want to + # highlight the code but not the indentation, which may contain markers + # such as "> assert 0" + indents = [] + source_lines = [] + for line in self.lines: + if not is_fail(line): + indents.append(line[:indent_size]) + source_lines.append(line[indent_size:]) + + tw._write_source(source_lines, indents) + + # failure lines are always completely red and bold + for line in (x for x in self.lines if is_fail(x)): + tw.line(line, bold=True, red=True) + + def toterminal(self, tw: TerminalWriter) -> None: + if self.style == "short": + assert self.reprfileloc is not None + self.reprfileloc.toterminal(tw) + self._write_entry_lines(tw) + if self.reprlocals: + self.reprlocals.toterminal(tw, indent=" " * 8) + return + + if self.reprfuncargs: + self.reprfuncargs.toterminal(tw) + + self._write_entry_lines(tw) + + if self.reprlocals: + tw.line("") + self.reprlocals.toterminal(tw) + if self.reprfileloc: + if self.lines: + tw.line("") + self.reprfileloc.toterminal(tw) + + def __str__(self) -> str: + return "{}\n{}\n{}".format( + "\n".join(self.lines), self.reprlocals, self.reprfileloc + ) + + +@attr.s(**{ATTRS_EQ_FIELD: False}) # type: ignore +class ReprFileLocation(TerminalRepr): + path = attr.ib(type=str, converter=str) + lineno = attr.ib(type=int) + message = attr.ib(type=str) + + def toterminal(self, tw: TerminalWriter) -> None: + # filename and lineno output for each entry, + # using an output format that most editors understand + msg = self.message + i = msg.find("\n") + if i != -1: + msg = msg[:i] + tw.write(self.path, bold=True, red=True) + tw.line(":{}: {}".format(self.lineno, msg)) + + +@attr.s(**{ATTRS_EQ_FIELD: False}) # type: ignore +class ReprLocals(TerminalRepr): + lines = attr.ib(type=Sequence[str]) + + def toterminal(self, tw: TerminalWriter, indent="") -> None: + for line in self.lines: + tw.line(indent + line) + + +@attr.s(**{ATTRS_EQ_FIELD: False}) # type: ignore +class ReprFuncArgs(TerminalRepr): + args = attr.ib(type=Sequence[Tuple[str, object]]) + + def toterminal(self, tw: TerminalWriter) -> None: + if self.args: + linesofar = "" + for name, value in self.args: + ns = "{} = {}".format(name, value) + if len(ns) + len(linesofar) + 2 > tw.fullwidth: + if linesofar: + tw.line(linesofar) + linesofar = ns + else: + if linesofar: + linesofar += ", " + ns + else: + linesofar = ns + if linesofar: + tw.line(linesofar) + tw.line("") + + +def getrawcode(obj, trycall: bool = True): + """ return code object for given function. """ + try: + return obj.__code__ + except AttributeError: + obj = getattr(obj, "f_code", obj) + obj = getattr(obj, "__code__", obj) + if trycall and not hasattr(obj, "co_firstlineno"): + if hasattr(obj, "__call__") and not inspect.isclass(obj): + x = getrawcode(obj.__call__, trycall=False) + if hasattr(x, "co_firstlineno"): + return x + return obj + + +# relative paths that we use to filter traceback entries from appearing to the user; +# see filter_traceback +# note: if we need to add more paths than what we have now we should probably use a list +# for better maintenance + +_PLUGGY_DIR = py.path.local(pluggy.__file__.rstrip("oc")) +# pluggy is either a package or a single module depending on the version +if _PLUGGY_DIR.basename == "__init__.py": + _PLUGGY_DIR = _PLUGGY_DIR.dirpath() +_PYTEST_DIR = py.path.local(_pytest.__file__).dirpath() +_PY_DIR = py.path.local(py.__file__).dirpath() + + +def filter_traceback(entry: TracebackEntry) -> bool: + """Return True if a TracebackEntry instance should be removed from tracebacks: + * dynamically generated code (no code to show up for it); + * internal traceback from pytest or its internal libraries, py and pluggy. + """ + # entry.path might sometimes return a str object when the entry + # points to dynamically generated code + # see https://bitbucket.org/pytest-dev/py/issues/71 + raw_filename = entry.frame.code.raw.co_filename + is_generated = "<" in raw_filename and ">" in raw_filename + if is_generated: + return False + # entry.path might point to a non-existing file, in which case it will + # also return a str object. see #1133 + p = py.path.local(entry.path) + return ( + not p.relto(_PLUGGY_DIR) and not p.relto(_PYTEST_DIR) and not p.relto(_PY_DIR) + ) diff --git a/contrib/python/pytest/py3/_pytest/_code/source.py b/contrib/python/pytest/py3/_pytest/_code/source.py new file mode 100644 index 00000000000..28c11e5d5e3 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/_code/source.py @@ -0,0 +1,416 @@ +import ast +import inspect +import linecache +import sys +import textwrap +import tokenize +import warnings +from bisect import bisect_right +from types import CodeType +from types import FrameType +from typing import Any +from typing import Iterator +from typing import List +from typing import Optional +from typing import Sequence +from typing import Tuple +from typing import Union + +import py + +from _pytest.compat import get_real_func +from _pytest.compat import overload +from _pytest.compat import TYPE_CHECKING + +if TYPE_CHECKING: + from typing_extensions import Literal + + +class Source: + """ an immutable object holding a source code fragment, + possibly deindenting it. + """ + + _compilecounter = 0 + + def __init__(self, *parts, **kwargs) -> None: + self.lines = lines = [] # type: List[str] + de = kwargs.get("deindent", True) + for part in parts: + if not part: + partlines = [] # type: List[str] + elif isinstance(part, Source): + partlines = part.lines + elif isinstance(part, (tuple, list)): + partlines = [x.rstrip("\n") for x in part] + elif isinstance(part, str): + partlines = part.split("\n") + else: + partlines = getsource(part, deindent=de).lines + if de: + partlines = deindent(partlines) + lines.extend(partlines) + + def __eq__(self, other): + try: + return self.lines == other.lines + except AttributeError: + if isinstance(other, str): + return str(self) == other + return False + + # Ignore type because of https://github.com/python/mypy/issues/4266. + __hash__ = None # type: ignore + + @overload + def __getitem__(self, key: int) -> str: + raise NotImplementedError() + + @overload # noqa: F811 + def __getitem__(self, key: slice) -> "Source": # noqa: F811 + raise NotImplementedError() + + def __getitem__(self, key: Union[int, slice]) -> Union[str, "Source"]: # noqa: F811 + if isinstance(key, int): + return self.lines[key] + else: + if key.step not in (None, 1): + raise IndexError("cannot slice a Source with a step") + newsource = Source() + newsource.lines = self.lines[key.start : key.stop] + return newsource + + def __iter__(self) -> Iterator[str]: + return iter(self.lines) + + def __len__(self) -> int: + return len(self.lines) + + def strip(self) -> "Source": + """ return new source object with trailing + and leading blank lines removed. + """ + start, end = 0, len(self) + while start < end and not self.lines[start].strip(): + start += 1 + while end > start and not self.lines[end - 1].strip(): + end -= 1 + source = Source() + source.lines[:] = self.lines[start:end] + return source + + def putaround( + self, before: str = "", after: str = "", indent: str = " " * 4 + ) -> "Source": + """ return a copy of the source object with + 'before' and 'after' wrapped around it. + """ + beforesource = Source(before) + aftersource = Source(after) + newsource = Source() + lines = [(indent + line) for line in self.lines] + newsource.lines = beforesource.lines + lines + aftersource.lines + return newsource + + def indent(self, indent: str = " " * 4) -> "Source": + """ return a copy of the source object with + all lines indented by the given indent-string. + """ + newsource = Source() + newsource.lines = [(indent + line) for line in self.lines] + return newsource + + def getstatement(self, lineno: int) -> "Source": + """ return Source statement which contains the + given linenumber (counted from 0). + """ + start, end = self.getstatementrange(lineno) + return self[start:end] + + def getstatementrange(self, lineno: int) -> Tuple[int, int]: + """ return (start, end) tuple which spans the minimal + statement region which containing the given lineno. + """ + if not (0 <= lineno < len(self)): + raise IndexError("lineno out of range") + ast, start, end = getstatementrange_ast(lineno, self) + return start, end + + def deindent(self) -> "Source": + """return a new source object deindented.""" + newsource = Source() + newsource.lines[:] = deindent(self.lines) + return newsource + + def isparseable(self, deindent: bool = True) -> bool: + """ return True if source is parseable, heuristically + deindenting it by default. + """ + if deindent: + source = str(self.deindent()) + else: + source = str(self) + try: + ast.parse(source) + except (SyntaxError, ValueError, TypeError): + return False + else: + return True + + def __str__(self) -> str: + return "\n".join(self.lines) + + @overload + def compile( + self, + filename: Optional[str] = ..., + mode: str = ..., + flag: "Literal[0]" = ..., + dont_inherit: int = ..., + _genframe: Optional[FrameType] = ..., + ) -> CodeType: + raise NotImplementedError() + + @overload # noqa: F811 + def compile( # noqa: F811 + self, + filename: Optional[str] = ..., + mode: str = ..., + flag: int = ..., + dont_inherit: int = ..., + _genframe: Optional[FrameType] = ..., + ) -> Union[CodeType, ast.AST]: + raise NotImplementedError() + + def compile( # noqa: F811 + self, + filename: Optional[str] = None, + mode: str = "exec", + flag: int = 0, + dont_inherit: int = 0, + _genframe: Optional[FrameType] = None, + ) -> Union[CodeType, ast.AST]: + """ return compiled code object. if filename is None + invent an artificial filename which displays + the source/line position of the caller frame. + """ + if not filename or py.path.local(filename).check(file=0): + if _genframe is None: + _genframe = sys._getframe(1) # the caller + fn, lineno = _genframe.f_code.co_filename, _genframe.f_lineno + base = "<%d-codegen " % self._compilecounter + self.__class__._compilecounter += 1 + if not filename: + filename = base + "%s:%d>" % (fn, lineno) + else: + filename = base + "%r %s:%d>" % (filename, fn, lineno) + source = "\n".join(self.lines) + "\n" + try: + co = compile(source, filename, mode, flag) + except SyntaxError as ex: + # re-represent syntax errors from parsing python strings + msglines = self.lines[: ex.lineno] + if ex.offset: + msglines.append(" " * ex.offset + "^") + msglines.append("(code was compiled probably from here: %s)" % filename) + newex = SyntaxError("\n".join(msglines)) + newex.offset = ex.offset + newex.lineno = ex.lineno + newex.text = ex.text + raise newex + else: + if flag & ast.PyCF_ONLY_AST: + assert isinstance(co, ast.AST) + return co + assert isinstance(co, CodeType) + lines = [(x + "\n") for x in self.lines] + # Type ignored because linecache.cache is private. + linecache.cache[filename] = (1, None, lines, filename) # type: ignore + return co + + +# +# public API shortcut functions +# + + +@overload +def compile_( + source: Union[str, bytes, ast.mod, ast.AST], + filename: Optional[str] = ..., + mode: str = ..., + flags: "Literal[0]" = ..., + dont_inherit: int = ..., +) -> CodeType: + raise NotImplementedError() + + +@overload # noqa: F811 +def compile_( # noqa: F811 + source: Union[str, bytes, ast.mod, ast.AST], + filename: Optional[str] = ..., + mode: str = ..., + flags: int = ..., + dont_inherit: int = ..., +) -> Union[CodeType, ast.AST]: + raise NotImplementedError() + + +def compile_( # noqa: F811 + source: Union[str, bytes, ast.mod, ast.AST], + filename: Optional[str] = None, + mode: str = "exec", + flags: int = 0, + dont_inherit: int = 0, +) -> Union[CodeType, ast.AST]: + """ compile the given source to a raw code object, + and maintain an internal cache which allows later + retrieval of the source code for the code object + and any recursively created code objects. + """ + if isinstance(source, ast.AST): + # XXX should Source support having AST? + assert filename is not None + co = compile(source, filename, mode, flags, dont_inherit) + assert isinstance(co, (CodeType, ast.AST)) + return co + _genframe = sys._getframe(1) # the caller + s = Source(source) + return s.compile(filename, mode, flags, _genframe=_genframe) + + +def getfslineno(obj: Any) -> Tuple[Union[str, py.path.local], int]: + """ Return source location (path, lineno) for the given object. + If the source cannot be determined return ("", -1). + + The line number is 0-based. + """ + from .code import Code + + # xxx let decorators etc specify a sane ordering + # NOTE: this used to be done in _pytest.compat.getfslineno, initially added + # in 6ec13a2b9. It ("place_as") appears to be something very custom. + obj = get_real_func(obj) + if hasattr(obj, "place_as"): + obj = obj.place_as + + try: + code = Code(obj) + except TypeError: + try: + fn = inspect.getsourcefile(obj) or inspect.getfile(obj) + except TypeError: + return "", -1 + + fspath = fn and py.path.local(fn) or "" + lineno = -1 + if fspath: + try: + _, lineno = findsource(obj) + except IOError: + pass + return fspath, lineno + else: + return code.path, code.firstlineno + + +# +# helper functions +# + + +def findsource(obj) -> Tuple[Optional[Source], int]: + try: + sourcelines, lineno = inspect.findsource(obj) + except Exception: + return None, -1 + source = Source() + source.lines = [line.rstrip() for line in sourcelines] + return source, lineno + + +def getsource(obj, **kwargs) -> Source: + from .code import getrawcode + + obj = getrawcode(obj) + try: + strsrc = inspect.getsource(obj) + except IndentationError: + strsrc = '"Buggy python version consider upgrading, cannot get source"' + assert isinstance(strsrc, str) + return Source(strsrc, **kwargs) + + +def deindent(lines: Sequence[str]) -> List[str]: + return textwrap.dedent("\n".join(lines)).splitlines() + + +def get_statement_startend2(lineno: int, node: ast.AST) -> Tuple[int, Optional[int]]: + import ast + + # flatten all statements and except handlers into one lineno-list + # AST's line numbers start indexing at 1 + values = [] # type: List[int] + for x in ast.walk(node): + if isinstance(x, (ast.stmt, ast.ExceptHandler)): + values.append(x.lineno - 1) + for name in ("finalbody", "orelse"): + val = getattr(x, name, None) # type: Optional[List[ast.stmt]] + if val: + # treat the finally/orelse part as its own statement + values.append(val[0].lineno - 1 - 1) + values.sort() + insert_index = bisect_right(values, lineno) + start = values[insert_index - 1] + if insert_index >= len(values): + end = None + else: + end = values[insert_index] + return start, end + + +def getstatementrange_ast( + lineno: int, + source: Source, + assertion: bool = False, + astnode: Optional[ast.AST] = None, +) -> Tuple[ast.AST, int, int]: + if astnode is None: + content = str(source) + # See #4260: + # don't produce duplicate warnings when compiling source to find ast + with warnings.catch_warnings(): + warnings.simplefilter("ignore") + astnode = ast.parse(content, "source", "exec") + + start, end = get_statement_startend2(lineno, astnode) + # we need to correct the end: + # - ast-parsing strips comments + # - there might be empty lines + # - we might have lesser indented code blocks at the end + if end is None: + end = len(source.lines) + + if end > start + 1: + # make sure we don't span differently indented code blocks + # by using the BlockFinder helper used which inspect.getsource() uses itself + block_finder = inspect.BlockFinder() + # if we start with an indented line, put blockfinder to "started" mode + block_finder.started = source.lines[start][0].isspace() + it = ((x + "\n") for x in source.lines[start:end]) + try: + for tok in tokenize.generate_tokens(lambda: next(it)): + block_finder.tokeneater(*tok) + except (inspect.EndOfBlock, IndentationError): + end = block_finder.last + start + except Exception: + pass + + # the end might still point to a comment or empty line, correct it + while end: + line = source.lines[end - 1].lstrip() + if line.startswith("#") or not line: + end -= 1 + else: + break + return astnode, start, end diff --git a/contrib/python/pytest/py3/_pytest/_io/__init__.py b/contrib/python/pytest/py3/_pytest/_io/__init__.py new file mode 100644 index 00000000000..f56579806cc --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/_io/__init__.py @@ -0,0 +1,39 @@ +from typing import List +from typing import Sequence + +from py.io import TerminalWriter as BaseTerminalWriter # noqa: F401 + + +class TerminalWriter(BaseTerminalWriter): + def _write_source(self, lines: List[str], indents: Sequence[str] = ()) -> None: + """Write lines of source code possibly highlighted. + + Keeping this private for now because the API is clunky. We should discuss how + to evolve the terminal writer so we can have more precise color support, for example + being able to write part of a line in one color and the rest in another, and so on. + """ + if indents and len(indents) != len(lines): + raise ValueError( + "indents size ({}) should have same size as lines ({})".format( + len(indents), len(lines) + ) + ) + if not indents: + indents = [""] * len(lines) + source = "\n".join(lines) + new_lines = self._highlight(source).splitlines() + for indent, new_line in zip(indents, new_lines): + self.line(indent + new_line) + + def _highlight(self, source): + """Highlight the given source code according to the "code_highlight" option""" + if not self.hasmarkup: + return source + try: + from pygments.formatters.terminal import TerminalFormatter + from pygments.lexers.python import PythonLexer + from pygments import highlight + except ImportError: + return source + else: + return highlight(source, PythonLexer(), TerminalFormatter(bg="dark")) diff --git a/contrib/python/pytest/py3/_pytest/_io/saferepr.py b/contrib/python/pytest/py3/_pytest/_io/saferepr.py new file mode 100644 index 00000000000..47a00de6063 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/_io/saferepr.py @@ -0,0 +1,103 @@ +import pprint +import reprlib +from typing import Any + + +def _try_repr_or_str(obj): + try: + return repr(obj) + except (KeyboardInterrupt, SystemExit): + raise + except BaseException: + return '{}("{}")'.format(type(obj).__name__, obj) + + +def _format_repr_exception(exc: BaseException, obj: Any) -> str: + try: + exc_info = _try_repr_or_str(exc) + except (KeyboardInterrupt, SystemExit): + raise + except BaseException as exc: + exc_info = "unpresentable exception ({})".format(_try_repr_or_str(exc)) + return "<[{} raised in repr()] {} object at 0x{:x}>".format( + exc_info, type(obj).__name__, id(obj) + ) + + +def _ellipsize(s: str, maxsize: int) -> str: + if len(s) > maxsize: + i = max(0, (maxsize - 3) // 2) + j = max(0, maxsize - 3 - i) + return s[:i] + "..." + s[len(s) - j :] + return s + + +class SafeRepr(reprlib.Repr): + """subclass of repr.Repr that limits the resulting size of repr() + and includes information on exceptions raised during the call. + """ + + def __init__(self, maxsize: int) -> None: + super().__init__() + self.maxstring = maxsize + self.maxsize = maxsize + + def repr(self, x: Any) -> str: + try: + s = super().repr(x) + except (KeyboardInterrupt, SystemExit): + raise + except BaseException as exc: + s = _format_repr_exception(exc, x) + return _ellipsize(s, self.maxsize) + + def repr_instance(self, x: Any, level: int) -> str: + try: + s = repr(x) + except (KeyboardInterrupt, SystemExit): + raise + except BaseException as exc: + s = _format_repr_exception(exc, x) + return _ellipsize(s, self.maxsize) + + +def safeformat(obj: Any) -> str: + """return a pretty printed string for the given object. + Failing __repr__ functions of user instances will be represented + with a short exception info. + """ + try: + return pprint.pformat(obj) + except Exception as exc: + return _format_repr_exception(exc, obj) + + +def saferepr(obj: Any, maxsize: int = 240) -> str: + """return a size-limited safe repr-string for the given object. + Failing __repr__ functions of user instances will be represented + with a short exception info and 'saferepr' generally takes + care to never raise exceptions itself. This function is a wrapper + around the Repr/reprlib functionality of the standard 2.6 lib. + """ + return SafeRepr(maxsize).repr(obj) + + +class AlwaysDispatchingPrettyPrinter(pprint.PrettyPrinter): + """PrettyPrinter that always dispatches (regardless of width).""" + + def _format(self, object, stream, indent, allowance, context, level): + p = self._dispatch.get(type(object).__repr__, None) + + objid = id(object) + if objid in context or p is None: + return super()._format(object, stream, indent, allowance, context, level) + + context[objid] = 1 + p(self, object, stream, indent, allowance, context, level + 1) + del context[objid] + + +def _pformat_dispatch(object, indent=1, width=80, depth=None, *, compact=False): + return AlwaysDispatchingPrettyPrinter( + indent=indent, width=width, depth=depth, compact=compact + ).pformat(object) diff --git a/contrib/python/pytest/py3/_pytest/_version.py b/contrib/python/pytest/py3/_pytest/_version.py new file mode 100644 index 00000000000..cfc10f60ae8 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/_version.py @@ -0,0 +1,4 @@ +# coding: utf-8 +# file generated by setuptools_scm +# don't change, don't track in version control +version = '5.4.3' diff --git a/contrib/python/pytest/py3/_pytest/assertion/__init__.py b/contrib/python/pytest/py3/_pytest/assertion/__init__.py new file mode 100644 index 00000000000..ee7fa6a3af0 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/assertion/__init__.py @@ -0,0 +1,179 @@ +""" +support for presenting detailed information in failing assertions. +""" +import sys +from typing import Any +from typing import List +from typing import Optional + +from _pytest.assertion import rewrite +from _pytest.assertion import truncate +from _pytest.assertion import util +from _pytest.assertion.rewrite import assertstate_key +from _pytest.compat import TYPE_CHECKING +from _pytest.config import Config +from _pytest.config import hookimpl + +if TYPE_CHECKING: + from _pytest.main import Session + + +def pytest_addoption(parser): + group = parser.getgroup("debugconfig") + group.addoption( + "--assert", + action="store", + dest="assertmode", + choices=("rewrite", "plain"), + default="rewrite", + metavar="MODE", + help="""Control assertion debugging tools. 'plain' + performs no assertion debugging. 'rewrite' + (the default) rewrites assert statements in + test modules on import to provide assert + expression information.""", + ) + parser.addini( + "enable_assertion_pass_hook", + type="bool", + default=False, + help="Enables the pytest_assertion_pass hook." + "Make sure to delete any previously generated pyc cache files.", + ) + + +def register_assert_rewrite(*names) -> None: + """Register one or more module names to be rewritten on import. + + This function will make sure that this module or all modules inside + the package will get their assert statements rewritten. + Thus you should make sure to call this before the module is + actually imported, usually in your __init__.py if you are a plugin + using a package. + + :raise TypeError: if the given module names are not strings. + """ + for name in names: + if not isinstance(name, str): + msg = "expected module names as *args, got {0} instead" + raise TypeError(msg.format(repr(names))) + for hook in sys.meta_path: + if isinstance(hook, rewrite.AssertionRewritingHook): + importhook = hook + break + else: + # TODO(typing): Add a protocol for mark_rewrite() and use it + # for importhook and for PytestPluginManager.rewrite_hook. + importhook = DummyRewriteHook() # type: ignore + importhook.mark_rewrite(*names) + + +class DummyRewriteHook: + """A no-op import hook for when rewriting is disabled.""" + + def mark_rewrite(self, *names): + pass + + +class AssertionState: + """State for the assertion plugin.""" + + def __init__(self, config, mode): + self.mode = mode + self.trace = config.trace.root.get("assertion") + self.hook = None # type: Optional[rewrite.AssertionRewritingHook] + + +def install_importhook(config): + """Try to install the rewrite hook, raise SystemError if it fails.""" + config._store[assertstate_key] = AssertionState(config, "rewrite") + config._store[assertstate_key].hook = hook = rewrite.AssertionRewritingHook(config) + sys.meta_path.insert(0, hook) + config._store[assertstate_key].trace("installed rewrite import hook") + + def undo(): + hook = config._store[assertstate_key].hook + if hook is not None and hook in sys.meta_path: + sys.meta_path.remove(hook) + + config.add_cleanup(undo) + return hook + + +def pytest_collection(session: "Session") -> None: + # this hook is only called when test modules are collected + # so for example not in the master process of pytest-xdist + # (which does not collect test modules) + assertstate = session.config._store.get(assertstate_key, None) + if assertstate: + if assertstate.hook is not None: + assertstate.hook.set_session(session) + + +@hookimpl(tryfirst=True, hookwrapper=True) +def pytest_runtest_protocol(item): + """Setup the pytest_assertrepr_compare and pytest_assertion_pass hooks + + The newinterpret and rewrite modules will use util._reprcompare if + it exists to use custom reporting via the + pytest_assertrepr_compare hook. This sets up this custom + comparison for the test. + """ + + def callbinrepr(op, left, right): + # type: (str, object, object) -> Optional[str] + """Call the pytest_assertrepr_compare hook and prepare the result + + This uses the first result from the hook and then ensures the + following: + * Overly verbose explanations are truncated unless configured otherwise + (eg. if running in verbose mode). + * Embedded newlines are escaped to help util.format_explanation() + later. + * If the rewrite mode is used embedded %-characters are replaced + to protect later % formatting. + + The result can be formatted by util.format_explanation() for + pretty printing. + """ + hook_result = item.ihook.pytest_assertrepr_compare( + config=item.config, op=op, left=left, right=right + ) + for new_expl in hook_result: + if new_expl: + new_expl = truncate.truncate_if_required(new_expl, item) + new_expl = [line.replace("\n", "\\n") for line in new_expl] + res = "\n~".join(new_expl) + if item.config.getvalue("assertmode") == "rewrite": + res = res.replace("%", "%%") + return res + return None + + saved_assert_hooks = util._reprcompare, util._assertion_pass + util._reprcompare = callbinrepr + + if item.ihook.pytest_assertion_pass.get_hookimpls(): + + def call_assertion_pass_hook(lineno, orig, expl): + item.ihook.pytest_assertion_pass( + item=item, lineno=lineno, orig=orig, expl=expl + ) + + util._assertion_pass = call_assertion_pass_hook + + yield + + util._reprcompare, util._assertion_pass = saved_assert_hooks + + +def pytest_sessionfinish(session): + assertstate = session.config._store.get(assertstate_key, None) + if assertstate: + if assertstate.hook is not None: + assertstate.hook.set_session(None) + + +def pytest_assertrepr_compare( + config: Config, op: str, left: Any, right: Any +) -> Optional[List[str]]: + return util.assertrepr_compare(config=config, op=op, left=left, right=right) diff --git a/contrib/python/pytest/py3/_pytest/assertion/rewrite.py b/contrib/python/pytest/py3/_pytest/assertion/rewrite.py new file mode 100644 index 00000000000..f84127dcaf1 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/assertion/rewrite.py @@ -0,0 +1,1066 @@ +"""Rewrite assertion AST to produce nice error messages""" +import ast +import errno +import functools +import importlib.abc +import importlib.machinery +import importlib.util +import io +import itertools +import marshal +import os +import struct +import sys +import tokenize +import types +from typing import Dict +from typing import List +from typing import Optional +from typing import Set +from typing import Tuple + +from _pytest._io.saferepr import saferepr +from _pytest._version import version +from _pytest.assertion import util +from _pytest.assertion.util import ( # noqa: F401 + format_explanation as _format_explanation, +) +from _pytest.compat import fspath +from _pytest.compat import TYPE_CHECKING +from _pytest.pathlib import fnmatch_ex +from _pytest.pathlib import Path +from _pytest.pathlib import PurePath +from _pytest.store import StoreKey + +if TYPE_CHECKING: + from _pytest.assertion import AssertionState # noqa: F401 + + +assertstate_key = StoreKey["AssertionState"]() + + +# pytest caches rewritten pycs in pycache dirs +PYTEST_TAG = "{}-pytest-{}".format(sys.implementation.cache_tag, version) +PYC_EXT = ".py" + (__debug__ and "c" or "o") +PYC_TAIL = "." + PYTEST_TAG + PYC_EXT + + +class AssertionRewritingHook(importlib.abc.MetaPathFinder, importlib.abc.Loader): + """PEP302/PEP451 import hook which rewrites asserts.""" + + def __init__(self, config): + self.config = config + try: + self.fnpats = config.getini("python_files") + except ValueError: + self.fnpats = ["test_*.py", "*_test.py"] + self.session = None + self._rewritten_names = set() # type: Set[str] + self._must_rewrite = set() # type: Set[str] + # flag to guard against trying to rewrite a pyc file while we are already writing another pyc file, + # which might result in infinite recursion (#3506) + self._writing_pyc = False + self._basenames_to_check_rewrite = {"conftest"} + self._marked_for_rewrite_cache = {} # type: Dict[str, bool] + self._session_paths_checked = False + + def set_session(self, session): + self.session = session + self._session_paths_checked = False + + # Indirection so we can mock calls to find_spec originated from the hook during testing + _find_spec = importlib.machinery.PathFinder.find_spec + + def find_spec(self, name, path=None, target=None): + if self._writing_pyc: + return None + state = self.config._store[assertstate_key] + if self._early_rewrite_bailout(name, state): + return None + state.trace("find_module called for: %s" % name) + + spec = self._find_spec(name, path) + if ( + # the import machinery could not find a file to import + spec is None + # this is a namespace package (without `__init__.py`) + # there's nothing to rewrite there + # python3.5 - python3.6: `namespace` + # python3.7+: `None` + or spec.origin == "namespace" + or spec.origin is None + # we can only rewrite source files + or not isinstance(spec.loader, importlib.machinery.SourceFileLoader) + # if the file doesn't exist, we can't rewrite it + or not os.path.exists(spec.origin) + ): + return None + else: + fn = spec.origin + + if not self._should_rewrite(name, fn, state): + return None + + return importlib.util.spec_from_file_location( + name, + fn, + loader=self, + submodule_search_locations=spec.submodule_search_locations, + ) + + def create_module(self, spec): + return None # default behaviour is fine + + def exec_module(self, module): + fn = Path(module.__spec__.origin) + state = self.config._store[assertstate_key] + + self._rewritten_names.add(module.__name__) + + # The requested module looks like a test file, so rewrite it. This is + # the most magical part of the process: load the source, rewrite the + # asserts, and load the rewritten source. We also cache the rewritten + # module code in a special pyc. We must be aware of the possibility of + # concurrent pytest processes rewriting and loading pycs. To avoid + # tricky race conditions, we maintain the following invariant: The + # cached pyc is always a complete, valid pyc. Operations on it must be + # atomic. POSIX's atomic rename comes in handy. + write = not sys.dont_write_bytecode + cache_dir = get_cache_dir(fn) + if write: + ok = try_makedirs(cache_dir) + if not ok: + write = False + state.trace("read only directory: {}".format(cache_dir)) + + cache_name = fn.name[:-3] + PYC_TAIL + pyc = cache_dir / cache_name + # Notice that even if we're in a read-only directory, I'm going + # to check for a cached pyc. This may not be optimal... + co = _read_pyc(fn, pyc, state.trace) + if co is None: + state.trace("rewriting {!r}".format(fn)) + source_stat, co = _rewrite_test(fn, self.config) + if write: + self._writing_pyc = True + try: + _write_pyc(state, co, source_stat, pyc) + finally: + self._writing_pyc = False + else: + state.trace("found cached rewritten pyc for {}".format(fn)) + exec(co, module.__dict__) + + def _early_rewrite_bailout(self, name, state): + """This is a fast way to get out of rewriting modules. + + Profiling has shown that the call to PathFinder.find_spec (inside of + the find_spec from this class) is a major slowdown, so, this method + tries to filter what we're sure won't be rewritten before getting to + it. + """ + if self.session is not None and not self._session_paths_checked: + self._session_paths_checked = True + for path in self.session._initialpaths: + # Make something as c:/projects/my_project/path.py -> + # ['c:', 'projects', 'my_project', 'path.py'] + parts = str(path).split(os.path.sep) + # add 'path' to basenames to be checked. + self._basenames_to_check_rewrite.add(os.path.splitext(parts[-1])[0]) + + # Note: conftest already by default in _basenames_to_check_rewrite. + parts = name.split(".") + if parts[-1] in self._basenames_to_check_rewrite: + return False + + # For matching the name it must be as if it was a filename. + path = PurePath(os.path.sep.join(parts) + ".py") + + for pat in self.fnpats: + # if the pattern contains subdirectories ("tests/**.py" for example) we can't bail out based + # on the name alone because we need to match against the full path + if os.path.dirname(pat): + return False + if fnmatch_ex(pat, path): + return False + + if self._is_marked_for_rewrite(name, state): + return False + + state.trace("early skip of rewriting module: {}".format(name)) + return True + + def _should_rewrite(self, name, fn, state): + # always rewrite conftest files + if os.path.basename(fn) == "conftest.py": + state.trace("rewriting conftest file: {!r}".format(fn)) + return True + + if self.session is not None: + if self.session.isinitpath(fn): + state.trace( + "matched test file (was specified on cmdline): {!r}".format(fn) + ) + return True + + # modules not passed explicitly on the command line are only + # rewritten if they match the naming convention for test files + fn_path = PurePath(fn) + for pat in self.fnpats: + if fnmatch_ex(pat, fn_path): + state.trace("matched test file {!r}".format(fn)) + return True + + return self._is_marked_for_rewrite(name, state) + + def _is_marked_for_rewrite(self, name: str, state): + try: + return self._marked_for_rewrite_cache[name] + except KeyError: + for marked in self._must_rewrite: + if name == marked or name.startswith(marked + "."): + state.trace( + "matched marked file {!r} (from {!r})".format(name, marked) + ) + self._marked_for_rewrite_cache[name] = True + return True + + self._marked_for_rewrite_cache[name] = False + return False + + def mark_rewrite(self, *names: str) -> None: + """Mark import names as needing to be rewritten. + + The named module or package as well as any nested modules will + be rewritten on import. + """ + already_imported = ( + set(names).intersection(sys.modules).difference(self._rewritten_names) + ) + for name in already_imported: + mod = sys.modules[name] + if not AssertionRewriter.is_rewrite_disabled( + mod.__doc__ or "" + ) and not isinstance(mod.__loader__, type(self)): + self._warn_already_imported(name) + self._must_rewrite.update(names) + self._marked_for_rewrite_cache.clear() + + def _warn_already_imported(self, name): + from _pytest.warning_types import PytestAssertRewriteWarning + from _pytest.warnings import _issue_warning_captured + + _issue_warning_captured( + PytestAssertRewriteWarning( + "Module already imported so cannot be rewritten: %s" % name + ), + self.config.hook, + stacklevel=5, + ) + + def get_data(self, pathname): + """Optional PEP302 get_data API.""" + with open(pathname, "rb") as f: + return f.read() + + +def _write_pyc_fp(fp, source_stat, co): + # Technically, we don't have to have the same pyc format as + # (C)Python, since these "pycs" should never be seen by builtin + # import. However, there's little reason deviate. + fp.write(importlib.util.MAGIC_NUMBER) + # as of now, bytecode header expects 32-bit numbers for size and mtime (#4903) + mtime = int(source_stat.st_mtime) & 0xFFFFFFFF + size = source_stat.st_size & 0xFFFFFFFF + # "<LL" stands for 2 unsigned longs, little-ending + fp.write(struct.pack("<LL", mtime, size)) + fp.write(marshal.dumps(co)) + + +if sys.platform == "win32": + from atomicwrites import atomic_write + + def _write_pyc(state, co, source_stat, pyc): + try: + with atomic_write(fspath(pyc), mode="wb", overwrite=True) as fp: + _write_pyc_fp(fp, source_stat, co) + except EnvironmentError as e: + state.trace("error writing pyc file at {}: errno={}".format(pyc, e.errno)) + # we ignore any failure to write the cache file + # there are many reasons, permission-denied, pycache dir being a + # file etc. + return False + return True + + +else: + + def _write_pyc(state, co, source_stat, pyc): + proc_pyc = "{}.{}".format(pyc, os.getpid()) + try: + fp = open(proc_pyc, "wb") + except EnvironmentError as e: + state.trace( + "error writing pyc file at {}: errno={}".format(proc_pyc, e.errno) + ) + return False + + try: + _write_pyc_fp(fp, source_stat, co) + os.rename(proc_pyc, fspath(pyc)) + except BaseException as e: + state.trace("error writing pyc file at {}: errno={}".format(pyc, e.errno)) + # we ignore any failure to write the cache file + # there are many reasons, permission-denied, pycache dir being a + # file etc. + return False + finally: + fp.close() + return True + + +def _rewrite_test(fn, config): + """read and rewrite *fn* and return the code object.""" + fn = fspath(fn) + stat = os.stat(fn) + with open(fn, "rb") as f: + source = f.read() + tree = ast.parse(source, filename=fn) + rewrite_asserts(tree, source, fn, config) + co = compile(tree, fn, "exec", dont_inherit=True) + return stat, co + + +def _read_pyc(source, pyc, trace=lambda x: None): + """Possibly read a pytest pyc containing rewritten code. + + Return rewritten code if successful or None if not. + """ + try: + fp = open(fspath(pyc), "rb") + except IOError: + return None + with fp: + try: + stat_result = os.stat(fspath(source)) + mtime = int(stat_result.st_mtime) + size = stat_result.st_size + data = fp.read(12) + except EnvironmentError as e: + trace("_read_pyc({}): EnvironmentError {}".format(source, e)) + return None + # Check for invalid or out of date pyc file. + if ( + len(data) != 12 + or data[:4] != importlib.util.MAGIC_NUMBER + or struct.unpack("<LL", data[4:]) != (mtime & 0xFFFFFFFF, size & 0xFFFFFFFF) + ): + trace("_read_pyc(%s): invalid or out of date pyc" % source) + return None + try: + co = marshal.load(fp) + except Exception as e: + trace("_read_pyc({}): marshal.load error {}".format(source, e)) + return None + if not isinstance(co, types.CodeType): + trace("_read_pyc(%s): not a code object" % source) + return None + return co + + +def rewrite_asserts(mod, source, module_path=None, config=None): + """Rewrite the assert statements in mod.""" + AssertionRewriter(module_path, config, source).run(mod) + + +def _saferepr(obj): + """Get a safe repr of an object for assertion error messages. + + The assertion formatting (util.format_explanation()) requires + newlines to be escaped since they are a special character for it. + Normally assertion.util.format_explanation() does this but for a + custom repr it is possible to contain one of the special escape + sequences, especially '\n{' and '\n}' are likely to be present in + JSON reprs. + + """ + return saferepr(obj).replace("\n", "\\n") + + +def _format_assertmsg(obj): + """Format the custom assertion message given. + + For strings this simply replaces newlines with '\n~' so that + util.format_explanation() will preserve them instead of escaping + newlines. For other objects saferepr() is used first. + + """ + # reprlib appears to have a bug which means that if a string + # contains a newline it gets escaped, however if an object has a + # .__repr__() which contains newlines it does not get escaped. + # However in either case we want to preserve the newline. + replaces = [("\n", "\n~"), ("%", "%%")] + if not isinstance(obj, str): + obj = saferepr(obj) + replaces.append(("\\n", "\n~")) + + for r1, r2 in replaces: + obj = obj.replace(r1, r2) + + return obj + + +def _should_repr_global_name(obj): + if callable(obj): + return False + + try: + return not hasattr(obj, "__name__") + except Exception: + return True + + +def _format_boolop(explanations, is_or): + explanation = "(" + (is_or and " or " or " and ").join(explanations) + ")" + if isinstance(explanation, str): + return explanation.replace("%", "%%") + else: + return explanation.replace(b"%", b"%%") + + +def _call_reprcompare(ops, results, expls, each_obj): + # type: (Tuple[str, ...], Tuple[bool, ...], Tuple[str, ...], Tuple[object, ...]) -> str + for i, res, expl in zip(range(len(ops)), results, expls): + try: + done = not res + except Exception: + done = True + if done: + break + if util._reprcompare is not None: + custom = util._reprcompare(ops[i], each_obj[i], each_obj[i + 1]) + if custom is not None: + return custom + return expl + + +def _call_assertion_pass(lineno, orig, expl): + # type: (int, str, str) -> None + if util._assertion_pass is not None: + util._assertion_pass(lineno, orig, expl) + + +def _check_if_assertion_pass_impl(): + # type: () -> bool + """Checks if any plugins implement the pytest_assertion_pass hook + in order not to generate explanation unecessarily (might be expensive)""" + return True if util._assertion_pass else False + + +UNARY_MAP = {ast.Not: "not %s", ast.Invert: "~%s", ast.USub: "-%s", ast.UAdd: "+%s"} + +BINOP_MAP = { + ast.BitOr: "|", + ast.BitXor: "^", + ast.BitAnd: "&", + ast.LShift: "<<", + ast.RShift: ">>", + ast.Add: "+", + ast.Sub: "-", + ast.Mult: "*", + ast.Div: "/", + ast.FloorDiv: "//", + ast.Mod: "%%", # escaped for string formatting + ast.Eq: "==", + ast.NotEq: "!=", + ast.Lt: "<", + ast.LtE: "<=", + ast.Gt: ">", + ast.GtE: ">=", + ast.Pow: "**", + ast.Is: "is", + ast.IsNot: "is not", + ast.In: "in", + ast.NotIn: "not in", + ast.MatMult: "@", +} + + +def set_location(node, lineno, col_offset): + """Set node location information recursively.""" + + def _fix(node, lineno, col_offset): + if "lineno" in node._attributes: + node.lineno = lineno + if "col_offset" in node._attributes: + node.col_offset = col_offset + for child in ast.iter_child_nodes(node): + _fix(child, lineno, col_offset) + + _fix(node, lineno, col_offset) + return node + + +def _get_assertion_exprs(src: bytes) -> Dict[int, str]: + """Returns a mapping from {lineno: "assertion test expression"}""" + ret = {} # type: Dict[int, str] + + depth = 0 + lines = [] # type: List[str] + assert_lineno = None # type: Optional[int] + seen_lines = set() # type: Set[int] + + def _write_and_reset() -> None: + nonlocal depth, lines, assert_lineno, seen_lines + assert assert_lineno is not None + ret[assert_lineno] = "".join(lines).rstrip().rstrip("\\") + depth = 0 + lines = [] + assert_lineno = None + seen_lines = set() + + tokens = tokenize.tokenize(io.BytesIO(src).readline) + for tp, source, (lineno, offset), _, line in tokens: + if tp == tokenize.NAME and source == "assert": + assert_lineno = lineno + elif assert_lineno is not None: + # keep track of depth for the assert-message `,` lookup + if tp == tokenize.OP and source in "([{": + depth += 1 + elif tp == tokenize.OP and source in ")]}": + depth -= 1 + + if not lines: + lines.append(line[offset:]) + seen_lines.add(lineno) + # a non-nested comma separates the expression from the message + elif depth == 0 and tp == tokenize.OP and source == ",": + # one line assert with message + if lineno in seen_lines and len(lines) == 1: + offset_in_trimmed = offset + len(lines[-1]) - len(line) + lines[-1] = lines[-1][:offset_in_trimmed] + # multi-line assert with message + elif lineno in seen_lines: + lines[-1] = lines[-1][:offset] + # multi line assert with escapd newline before message + else: + lines.append(line[:offset]) + _write_and_reset() + elif tp in {tokenize.NEWLINE, tokenize.ENDMARKER}: + _write_and_reset() + elif lines and lineno not in seen_lines: + lines.append(line) + seen_lines.add(lineno) + + return ret + + +class AssertionRewriter(ast.NodeVisitor): + """Assertion rewriting implementation. + + The main entrypoint is to call .run() with an ast.Module instance, + this will then find all the assert statements and rewrite them to + provide intermediate values and a detailed assertion error. See + http://pybites.blogspot.be/2011/07/behind-scenes-of-pytests-new-assertion.html + for an overview of how this works. + + The entry point here is .run() which will iterate over all the + statements in an ast.Module and for each ast.Assert statement it + finds call .visit() with it. Then .visit_Assert() takes over and + is responsible for creating new ast statements to replace the + original assert statement: it rewrites the test of an assertion + to provide intermediate values and replace it with an if statement + which raises an assertion error with a detailed explanation in + case the expression is false and calls pytest_assertion_pass hook + if expression is true. + + For this .visit_Assert() uses the visitor pattern to visit all the + AST nodes of the ast.Assert.test field, each visit call returning + an AST node and the corresponding explanation string. During this + state is kept in several instance attributes: + + :statements: All the AST statements which will replace the assert + statement. + + :variables: This is populated by .variable() with each variable + used by the statements so that they can all be set to None at + the end of the statements. + + :variable_counter: Counter to create new unique variables needed + by statements. Variables are created using .variable() and + have the form of "@py_assert0". + + :expl_stmts: The AST statements which will be executed to get + data from the assertion. This is the code which will construct + the detailed assertion message that is used in the AssertionError + or for the pytest_assertion_pass hook. + + :explanation_specifiers: A dict filled by .explanation_param() + with %-formatting placeholders and their corresponding + expressions to use in the building of an assertion message. + This is used by .pop_format_context() to build a message. + + :stack: A stack of the explanation_specifiers dicts maintained by + .push_format_context() and .pop_format_context() which allows + to build another %-formatted string while already building one. + + This state is reset on every new assert statement visited and used + by the other visitors. + + """ + + def __init__(self, module_path, config, source): + super().__init__() + self.module_path = module_path + self.config = config + if config is not None: + self.enable_assertion_pass_hook = config.getini( + "enable_assertion_pass_hook" + ) + else: + self.enable_assertion_pass_hook = False + self.source = source + + @functools.lru_cache(maxsize=1) + def _assert_expr_to_lineno(self): + return _get_assertion_exprs(self.source) + + def run(self, mod: ast.Module) -> None: + """Find all assert statements in *mod* and rewrite them.""" + if not mod.body: + # Nothing to do. + return + # Insert some special imports at the top of the module but after any + # docstrings and __future__ imports. + aliases = [ + ast.alias("builtins", "@py_builtins"), + ast.alias("_pytest.assertion.rewrite", "@pytest_ar"), + ] + doc = getattr(mod, "docstring", None) + expect_docstring = doc is None + if doc is not None and self.is_rewrite_disabled(doc): + return + pos = 0 + lineno = 1 + for item in mod.body: + if ( + expect_docstring + and isinstance(item, ast.Expr) + and isinstance(item.value, ast.Str) + ): + doc = item.value.s + if self.is_rewrite_disabled(doc): + return + expect_docstring = False + elif ( + not isinstance(item, ast.ImportFrom) + or item.level > 0 + or item.module != "__future__" + ): + lineno = item.lineno + break + pos += 1 + else: + lineno = item.lineno + imports = [ + ast.Import([alias], lineno=lineno, col_offset=0) for alias in aliases + ] + mod.body[pos:pos] = imports + # Collect asserts. + nodes = [mod] # type: List[ast.AST] + while nodes: + node = nodes.pop() + for name, field in ast.iter_fields(node): + if isinstance(field, list): + new = [] # type: List + for i, child in enumerate(field): + if isinstance(child, ast.Assert): + # Transform assert. + new.extend(self.visit(child)) + else: + new.append(child) + if isinstance(child, ast.AST): + nodes.append(child) + setattr(node, name, new) + elif ( + isinstance(field, ast.AST) + # Don't recurse into expressions as they can't contain + # asserts. + and not isinstance(field, ast.expr) + ): + nodes.append(field) + + @staticmethod + def is_rewrite_disabled(docstring): + return "PYTEST_DONT_REWRITE" in docstring + + def variable(self): + """Get a new variable.""" + # Use a character invalid in python identifiers to avoid clashing. + name = "@py_assert" + str(next(self.variable_counter)) + self.variables.append(name) + return name + + def assign(self, expr): + """Give *expr* a name.""" + name = self.variable() + self.statements.append(ast.Assign([ast.Name(name, ast.Store())], expr)) + return ast.Name(name, ast.Load()) + + def display(self, expr): + """Call saferepr on the expression.""" + return self.helper("_saferepr", expr) + + def helper(self, name, *args): + """Call a helper in this module.""" + py_name = ast.Name("@pytest_ar", ast.Load()) + attr = ast.Attribute(py_name, name, ast.Load()) + return ast.Call(attr, list(args), []) + + def builtin(self, name): + """Return the builtin called *name*.""" + builtin_name = ast.Name("@py_builtins", ast.Load()) + return ast.Attribute(builtin_name, name, ast.Load()) + + def explanation_param(self, expr): + """Return a new named %-formatting placeholder for expr. + + This creates a %-formatting placeholder for expr in the + current formatting context, e.g. ``%(py0)s``. The placeholder + and expr are placed in the current format context so that it + can be used on the next call to .pop_format_context(). + + """ + specifier = "py" + str(next(self.variable_counter)) + self.explanation_specifiers[specifier] = expr + return "%(" + specifier + ")s" + + def push_format_context(self): + """Create a new formatting context. + + The format context is used for when an explanation wants to + have a variable value formatted in the assertion message. In + this case the value required can be added using + .explanation_param(). Finally .pop_format_context() is used + to format a string of %-formatted values as added by + .explanation_param(). + + """ + self.explanation_specifiers = {} # type: Dict[str, ast.expr] + self.stack.append(self.explanation_specifiers) + + def pop_format_context(self, expl_expr): + """Format the %-formatted string with current format context. + + The expl_expr should be an ast.Str instance constructed from + the %-placeholders created by .explanation_param(). This will + add the required code to format said string to .expl_stmts and + return the ast.Name instance of the formatted string. + + """ + current = self.stack.pop() + if self.stack: + self.explanation_specifiers = self.stack[-1] + keys = [ast.Str(key) for key in current.keys()] + format_dict = ast.Dict(keys, list(current.values())) + form = ast.BinOp(expl_expr, ast.Mod(), format_dict) + name = "@py_format" + str(next(self.variable_counter)) + if self.enable_assertion_pass_hook: + self.format_variables.append(name) + self.expl_stmts.append(ast.Assign([ast.Name(name, ast.Store())], form)) + return ast.Name(name, ast.Load()) + + def generic_visit(self, node): + """Handle expressions we don't have custom code for.""" + assert isinstance(node, ast.expr) + res = self.assign(node) + return res, self.explanation_param(self.display(res)) + + def visit_Assert(self, assert_): + """Return the AST statements to replace the ast.Assert instance. + + This rewrites the test of an assertion to provide + intermediate values and replace it with an if statement which + raises an assertion error with a detailed explanation in case + the expression is false. + + """ + if isinstance(assert_.test, ast.Tuple) and len(assert_.test.elts) >= 1: + from _pytest.warning_types import PytestAssertRewriteWarning + import warnings + + warnings.warn_explicit( + PytestAssertRewriteWarning( + "assertion is always true, perhaps remove parentheses?" + ), + category=None, + filename=fspath(self.module_path), + lineno=assert_.lineno, + ) + + self.statements = [] # type: List[ast.stmt] + self.variables = [] # type: List[str] + self.variable_counter = itertools.count() + + if self.enable_assertion_pass_hook: + self.format_variables = [] # type: List[str] + + self.stack = [] # type: List[Dict[str, ast.expr]] + self.expl_stmts = [] # type: List[ast.stmt] + self.push_format_context() + # Rewrite assert into a bunch of statements. + top_condition, explanation = self.visit(assert_.test) + + negation = ast.UnaryOp(ast.Not(), top_condition) + + if self.enable_assertion_pass_hook: # Experimental pytest_assertion_pass hook + msg = self.pop_format_context(ast.Str(explanation)) + + # Failed + if assert_.msg: + assertmsg = self.helper("_format_assertmsg", assert_.msg) + gluestr = "\n>assert " + else: + assertmsg = ast.Str("") + gluestr = "assert " + err_explanation = ast.BinOp(ast.Str(gluestr), ast.Add(), msg) + err_msg = ast.BinOp(assertmsg, ast.Add(), err_explanation) + err_name = ast.Name("AssertionError", ast.Load()) + fmt = self.helper("_format_explanation", err_msg) + exc = ast.Call(err_name, [fmt], []) + raise_ = ast.Raise(exc, None) + statements_fail = [] + statements_fail.extend(self.expl_stmts) + statements_fail.append(raise_) + + # Passed + fmt_pass = self.helper("_format_explanation", msg) + orig = self._assert_expr_to_lineno()[assert_.lineno] + hook_call_pass = ast.Expr( + self.helper( + "_call_assertion_pass", + ast.Num(assert_.lineno), + ast.Str(orig), + fmt_pass, + ) + ) + # If any hooks implement assert_pass hook + hook_impl_test = ast.If( + self.helper("_check_if_assertion_pass_impl"), + self.expl_stmts + [hook_call_pass], + [], + ) + statements_pass = [hook_impl_test] + + # Test for assertion condition + main_test = ast.If(negation, statements_fail, statements_pass) + self.statements.append(main_test) + if self.format_variables: + variables = [ + ast.Name(name, ast.Store()) for name in self.format_variables + ] + clear_format = ast.Assign(variables, ast.NameConstant(None)) + self.statements.append(clear_format) + + else: # Original assertion rewriting + # Create failure message. + body = self.expl_stmts + self.statements.append(ast.If(negation, body, [])) + if assert_.msg: + assertmsg = self.helper("_format_assertmsg", assert_.msg) + explanation = "\n>assert " + explanation + else: + assertmsg = ast.Str("") + explanation = "assert " + explanation + template = ast.BinOp(assertmsg, ast.Add(), ast.Str(explanation)) + msg = self.pop_format_context(template) + fmt = self.helper("_format_explanation", msg) + err_name = ast.Name("AssertionError", ast.Load()) + exc = ast.Call(err_name, [fmt], []) + raise_ = ast.Raise(exc, None) + + body.append(raise_) + + # Clear temporary variables by setting them to None. + if self.variables: + variables = [ast.Name(name, ast.Store()) for name in self.variables] + clear = ast.Assign(variables, ast.NameConstant(None)) + self.statements.append(clear) + # Fix line numbers. + for stmt in self.statements: + set_location(stmt, assert_.lineno, assert_.col_offset) + return self.statements + + def visit_Name(self, name): + # Display the repr of the name if it's a local variable or + # _should_repr_global_name() thinks it's acceptable. + locs = ast.Call(self.builtin("locals"), [], []) + inlocs = ast.Compare(ast.Str(name.id), [ast.In()], [locs]) + dorepr = self.helper("_should_repr_global_name", name) + test = ast.BoolOp(ast.Or(), [inlocs, dorepr]) + expr = ast.IfExp(test, self.display(name), ast.Str(name.id)) + return name, self.explanation_param(expr) + + def visit_BoolOp(self, boolop): + res_var = self.variable() + expl_list = self.assign(ast.List([], ast.Load())) + app = ast.Attribute(expl_list, "append", ast.Load()) + is_or = int(isinstance(boolop.op, ast.Or)) + body = save = self.statements + fail_save = self.expl_stmts + levels = len(boolop.values) - 1 + self.push_format_context() + # Process each operand, short-circuiting if needed. + for i, v in enumerate(boolop.values): + if i: + fail_inner = [] # type: List[ast.stmt] + # cond is set in a prior loop iteration below + self.expl_stmts.append(ast.If(cond, fail_inner, [])) # noqa + self.expl_stmts = fail_inner + self.push_format_context() + res, expl = self.visit(v) + body.append(ast.Assign([ast.Name(res_var, ast.Store())], res)) + expl_format = self.pop_format_context(ast.Str(expl)) + call = ast.Call(app, [expl_format], []) + self.expl_stmts.append(ast.Expr(call)) + if i < levels: + cond = res # type: ast.expr + if is_or: + cond = ast.UnaryOp(ast.Not(), cond) + inner = [] # type: List[ast.stmt] + self.statements.append(ast.If(cond, inner, [])) + self.statements = body = inner + self.statements = save + self.expl_stmts = fail_save + expl_template = self.helper("_format_boolop", expl_list, ast.Num(is_or)) + expl = self.pop_format_context(expl_template) + return ast.Name(res_var, ast.Load()), self.explanation_param(expl) + + def visit_UnaryOp(self, unary): + pattern = UNARY_MAP[unary.op.__class__] + operand_res, operand_expl = self.visit(unary.operand) + res = self.assign(ast.UnaryOp(unary.op, operand_res)) + return res, pattern % (operand_expl,) + + def visit_BinOp(self, binop): + symbol = BINOP_MAP[binop.op.__class__] + left_expr, left_expl = self.visit(binop.left) + right_expr, right_expl = self.visit(binop.right) + explanation = "({} {} {})".format(left_expl, symbol, right_expl) + res = self.assign(ast.BinOp(left_expr, binop.op, right_expr)) + return res, explanation + + def visit_Call(self, call): + """ + visit `ast.Call` nodes + """ + new_func, func_expl = self.visit(call.func) + arg_expls = [] + new_args = [] + new_kwargs = [] + for arg in call.args: + res, expl = self.visit(arg) + arg_expls.append(expl) + new_args.append(res) + for keyword in call.keywords: + res, expl = self.visit(keyword.value) + new_kwargs.append(ast.keyword(keyword.arg, res)) + if keyword.arg: + arg_expls.append(keyword.arg + "=" + expl) + else: # **args have `arg` keywords with an .arg of None + arg_expls.append("**" + expl) + + expl = "{}({})".format(func_expl, ", ".join(arg_expls)) + new_call = ast.Call(new_func, new_args, new_kwargs) + res = self.assign(new_call) + res_expl = self.explanation_param(self.display(res)) + outer_expl = "{}\n{{{} = {}\n}}".format(res_expl, res_expl, expl) + return res, outer_expl + + def visit_Starred(self, starred): + # From Python 3.5, a Starred node can appear in a function call + res, expl = self.visit(starred.value) + new_starred = ast.Starred(res, starred.ctx) + return new_starred, "*" + expl + + def visit_Attribute(self, attr): + if not isinstance(attr.ctx, ast.Load): + return self.generic_visit(attr) + value, value_expl = self.visit(attr.value) + res = self.assign(ast.Attribute(value, attr.attr, ast.Load())) + res_expl = self.explanation_param(self.display(res)) + pat = "%s\n{%s = %s.%s\n}" + expl = pat % (res_expl, res_expl, value_expl, attr.attr) + return res, expl + + def visit_Compare(self, comp: ast.Compare): + self.push_format_context() + left_res, left_expl = self.visit(comp.left) + if isinstance(comp.left, (ast.Compare, ast.BoolOp)): + left_expl = "({})".format(left_expl) + res_variables = [self.variable() for i in range(len(comp.ops))] + load_names = [ast.Name(v, ast.Load()) for v in res_variables] + store_names = [ast.Name(v, ast.Store()) for v in res_variables] + it = zip(range(len(comp.ops)), comp.ops, comp.comparators) + expls = [] + syms = [] + results = [left_res] + for i, op, next_operand in it: + next_res, next_expl = self.visit(next_operand) + if isinstance(next_operand, (ast.Compare, ast.BoolOp)): + next_expl = "({})".format(next_expl) + results.append(next_res) + sym = BINOP_MAP[op.__class__] + syms.append(ast.Str(sym)) + expl = "{} {} {}".format(left_expl, sym, next_expl) + expls.append(ast.Str(expl)) + res_expr = ast.Compare(left_res, [op], [next_res]) + self.statements.append(ast.Assign([store_names[i]], res_expr)) + left_res, left_expl = next_res, next_expl + # Use pytest.assertion.util._reprcompare if that's available. + expl_call = self.helper( + "_call_reprcompare", + ast.Tuple(syms, ast.Load()), + ast.Tuple(load_names, ast.Load()), + ast.Tuple(expls, ast.Load()), + ast.Tuple(results, ast.Load()), + ) + if len(comp.ops) > 1: + res = ast.BoolOp(ast.And(), load_names) # type: ast.expr + else: + res = load_names[0] + return res, self.explanation_param(self.pop_format_context(expl_call)) + + +def try_makedirs(cache_dir) -> bool: + """Attempts to create the given directory and sub-directories exist, returns True if + successful or it already exists""" + try: + os.makedirs(fspath(cache_dir), exist_ok=True) + except (FileNotFoundError, NotADirectoryError, FileExistsError): + # One of the path components was not a directory: + # - we're in a zip file + # - it is a file + return False + except PermissionError: + return False + except OSError as e: + # as of now, EROFS doesn't have an equivalent OSError-subclass + if e.errno == errno.EROFS: + return False + raise + return True + + +def get_cache_dir(file_path: Path) -> Path: + """Returns the cache directory to write .pyc files for the given .py file path""" + if sys.version_info >= (3, 8) and sys.pycache_prefix: + # given: + # prefix = '/tmp/pycs' + # path = '/home/user/proj/test_app.py' + # we want: + # '/tmp/pycs/home/user/proj' + return Path(sys.pycache_prefix) / Path(*file_path.parts[1:-1]) + else: + # classic pycache directory + return file_path.parent / "__pycache__" diff --git a/contrib/python/pytest/py3/_pytest/assertion/truncate.py b/contrib/python/pytest/py3/_pytest/assertion/truncate.py new file mode 100644 index 00000000000..d97b05b441e --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/assertion/truncate.py @@ -0,0 +1,95 @@ +""" +Utilities for truncating assertion output. + +Current default behaviour is to truncate assertion explanations at +~8 terminal lines, unless running in "-vv" mode or running on CI. +""" +import os + +DEFAULT_MAX_LINES = 8 +DEFAULT_MAX_CHARS = 8 * 80 +USAGE_MSG = "use '-vv' to show" + + +def truncate_if_required(explanation, item, max_length=None): + """ + Truncate this assertion explanation if the given test item is eligible. + """ + if _should_truncate_item(item): + return _truncate_explanation(explanation) + return explanation + + +def _should_truncate_item(item): + """ + Whether or not this test item is eligible for truncation. + """ + verbose = item.config.option.verbose + return verbose < 2 and not _running_on_ci() + + +def _running_on_ci(): + """Check if we're currently running on a CI system.""" + env_vars = ["CI", "BUILD_NUMBER"] + return any(var in os.environ for var in env_vars) + + +def _truncate_explanation(input_lines, max_lines=None, max_chars=None): + """ + Truncate given list of strings that makes up the assertion explanation. + + Truncates to either 8 lines, or 640 characters - whichever the input reaches + first. The remaining lines will be replaced by a usage message. + """ + + if max_lines is None: + max_lines = DEFAULT_MAX_LINES + if max_chars is None: + max_chars = DEFAULT_MAX_CHARS + + # Check if truncation required + input_char_count = len("".join(input_lines)) + if len(input_lines) <= max_lines and input_char_count <= max_chars: + return input_lines + + # Truncate first to max_lines, and then truncate to max_chars if max_chars + # is exceeded. + truncated_explanation = input_lines[:max_lines] + truncated_explanation = _truncate_by_char_count(truncated_explanation, max_chars) + + # Add ellipsis to final line + truncated_explanation[-1] = truncated_explanation[-1] + "..." + + # Append useful message to explanation + truncated_line_count = len(input_lines) - len(truncated_explanation) + truncated_line_count += 1 # Account for the part-truncated final line + msg = "...Full output truncated" + if truncated_line_count == 1: + msg += " ({} line hidden)".format(truncated_line_count) + else: + msg += " ({} lines hidden)".format(truncated_line_count) + msg += ", {}".format(USAGE_MSG) + truncated_explanation.extend(["", str(msg)]) + return truncated_explanation + + +def _truncate_by_char_count(input_lines, max_chars): + # Check if truncation required + if len("".join(input_lines)) <= max_chars: + return input_lines + + # Find point at which input length exceeds total allowed length + iterated_char_count = 0 + for iterated_index, input_line in enumerate(input_lines): + if iterated_char_count + len(input_line) > max_chars: + break + iterated_char_count += len(input_line) + + # Create truncated explanation with modified final line + truncated_result = input_lines[:iterated_index] + final_line = input_lines[iterated_index] + if final_line: + final_line_truncate_point = max_chars - iterated_char_count + final_line = final_line[:final_line_truncate_point] + truncated_result.append(final_line) + return truncated_result diff --git a/contrib/python/pytest/py3/_pytest/assertion/util.py b/contrib/python/pytest/py3/_pytest/assertion/util.py new file mode 100644 index 00000000000..7d525aa4c42 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/assertion/util.py @@ -0,0 +1,463 @@ +"""Utilities for assertion debugging""" +import collections.abc +import pprint +from typing import AbstractSet +from typing import Any +from typing import Callable +from typing import Iterable +from typing import List +from typing import Mapping +from typing import Optional +from typing import Sequence +from typing import Tuple + +import _pytest._code +from _pytest import outcomes +from _pytest._io.saferepr import _pformat_dispatch +from _pytest._io.saferepr import safeformat +from _pytest._io.saferepr import saferepr +from _pytest.compat import ATTRS_EQ_FIELD + +# The _reprcompare attribute on the util module is used by the new assertion +# interpretation code and assertion rewriter to detect this plugin was +# loaded and in turn call the hooks defined here as part of the +# DebugInterpreter. +_reprcompare = None # type: Optional[Callable[[str, object, object], Optional[str]]] + +# Works similarly as _reprcompare attribute. Is populated with the hook call +# when pytest_runtest_setup is called. +_assertion_pass = None # type: Optional[Callable[[int, str, str], None]] + + +def format_explanation(explanation: str) -> str: + """This formats an explanation + + Normally all embedded newlines are escaped, however there are + three exceptions: \n{, \n} and \n~. The first two are intended + cover nested explanations, see function and attribute explanations + for examples (.visit_Call(), visit_Attribute()). The last one is + for when one explanation needs to span multiple lines, e.g. when + displaying diffs. + """ + lines = _split_explanation(explanation) + result = _format_lines(lines) + return "\n".join(result) + + +def _split_explanation(explanation: str) -> List[str]: + """Return a list of individual lines in the explanation + + This will return a list of lines split on '\n{', '\n}' and '\n~'. + Any other newlines will be escaped and appear in the line as the + literal '\n' characters. + """ + raw_lines = (explanation or "").split("\n") + lines = [raw_lines[0]] + for values in raw_lines[1:]: + if values and values[0] in ["{", "}", "~", ">"]: + lines.append(values) + else: + lines[-1] += "\\n" + values + return lines + + +def _format_lines(lines: Sequence[str]) -> List[str]: + """Format the individual lines + + This will replace the '{', '}' and '~' characters of our mini + formatting language with the proper 'where ...', 'and ...' and ' + + ...' text, taking care of indentation along the way. + + Return a list of formatted lines. + """ + result = list(lines[:1]) + stack = [0] + stackcnt = [0] + for line in lines[1:]: + if line.startswith("{"): + if stackcnt[-1]: + s = "and " + else: + s = "where " + stack.append(len(result)) + stackcnt[-1] += 1 + stackcnt.append(0) + result.append(" +" + " " * (len(stack) - 1) + s + line[1:]) + elif line.startswith("}"): + stack.pop() + stackcnt.pop() + result[stack[-1]] += line[1:] + else: + assert line[0] in ["~", ">"] + stack[-1] += 1 + indent = len(stack) if line.startswith("~") else len(stack) - 1 + result.append(" " * indent + line[1:]) + assert len(stack) == 1 + return result + + +def issequence(x: Any) -> bool: + return isinstance(x, collections.abc.Sequence) and not isinstance(x, str) + + +def istext(x: Any) -> bool: + return isinstance(x, str) + + +def isdict(x: Any) -> bool: + return isinstance(x, dict) + + +def isset(x: Any) -> bool: + return isinstance(x, (set, frozenset)) + + +def isdatacls(obj: Any) -> bool: + return getattr(obj, "__dataclass_fields__", None) is not None + + +def isattrs(obj: Any) -> bool: + return getattr(obj, "__attrs_attrs__", None) is not None + + +def isiterable(obj: Any) -> bool: + try: + iter(obj) + return not istext(obj) + except TypeError: + return False + + +def assertrepr_compare(config, op: str, left: Any, right: Any) -> Optional[List[str]]: + """Return specialised explanations for some operators/operands""" + verbose = config.getoption("verbose") + if verbose > 1: + left_repr = safeformat(left) + right_repr = safeformat(right) + else: + # XXX: "15 chars indentation" is wrong + # ("E AssertionError: assert "); should use term width. + maxsize = ( + 80 - 15 - len(op) - 2 + ) // 2 # 15 chars indentation, 1 space around op + left_repr = saferepr(left, maxsize=maxsize) + right_repr = saferepr(right, maxsize=maxsize) + + summary = "{} {} {}".format(left_repr, op, right_repr) + + explanation = None + try: + if op == "==": + if istext(left) and istext(right): + explanation = _diff_text(left, right, verbose) + else: + if issequence(left) and issequence(right): + explanation = _compare_eq_sequence(left, right, verbose) + elif isset(left) and isset(right): + explanation = _compare_eq_set(left, right, verbose) + elif isdict(left) and isdict(right): + explanation = _compare_eq_dict(left, right, verbose) + elif type(left) == type(right) and (isdatacls(left) or isattrs(left)): + type_fn = (isdatacls, isattrs) + explanation = _compare_eq_cls(left, right, verbose, type_fn) + elif verbose > 0: + explanation = _compare_eq_verbose(left, right) + if isiterable(left) and isiterable(right): + expl = _compare_eq_iterable(left, right, verbose) + if explanation is not None: + explanation.extend(expl) + else: + explanation = expl + elif op == "not in": + if istext(left) and istext(right): + explanation = _notin_text(left, right, verbose) + except outcomes.Exit: + raise + except Exception: + explanation = [ + "(pytest_assertion plugin: representation of details failed: {}.".format( + _pytest._code.ExceptionInfo.from_current()._getreprcrash() + ), + " Probably an object has a faulty __repr__.)", + ] + + if not explanation: + return None + + return [summary] + explanation + + +def _diff_text(left: str, right: str, verbose: int = 0) -> List[str]: + """Return the explanation for the diff between text. + + Unless --verbose is used this will skip leading and trailing + characters which are identical to keep the diff minimal. + """ + from difflib import ndiff + + explanation = [] # type: List[str] + + if verbose < 1: + i = 0 # just in case left or right has zero length + for i in range(min(len(left), len(right))): + if left[i] != right[i]: + break + if i > 42: + i -= 10 # Provide some context + explanation = [ + "Skipping %s identical leading characters in diff, use -v to show" % i + ] + left = left[i:] + right = right[i:] + if len(left) == len(right): + for i in range(len(left)): + if left[-i] != right[-i]: + break + if i > 42: + i -= 10 # Provide some context + explanation += [ + "Skipping {} identical trailing " + "characters in diff, use -v to show".format(i) + ] + left = left[:-i] + right = right[:-i] + keepends = True + if left.isspace() or right.isspace(): + left = repr(str(left)) + right = repr(str(right)) + explanation += ["Strings contain only whitespace, escaping them using repr()"] + # "right" is the expected base against which we compare "left", + # see https://github.com/pytest-dev/pytest/issues/3333 + explanation += [ + line.strip("\n") + for line in ndiff(right.splitlines(keepends), left.splitlines(keepends)) + ] + return explanation + + +def _compare_eq_verbose(left: Any, right: Any) -> List[str]: + keepends = True + left_lines = repr(left).splitlines(keepends) + right_lines = repr(right).splitlines(keepends) + + explanation = [] # type: List[str] + explanation += ["+" + line for line in left_lines] + explanation += ["-" + line for line in right_lines] + + return explanation + + +def _surrounding_parens_on_own_lines(lines: List[str]) -> None: + """Move opening/closing parenthesis/bracket to own lines.""" + opening = lines[0][:1] + if opening in ["(", "[", "{"]: + lines[0] = " " + lines[0][1:] + lines[:] = [opening] + lines + closing = lines[-1][-1:] + if closing in [")", "]", "}"]: + lines[-1] = lines[-1][:-1] + "," + lines[:] = lines + [closing] + + +def _compare_eq_iterable( + left: Iterable[Any], right: Iterable[Any], verbose: int = 0 +) -> List[str]: + if not verbose: + return ["Use -v to get the full diff"] + # dynamic import to speedup pytest + import difflib + + left_formatting = pprint.pformat(left).splitlines() + right_formatting = pprint.pformat(right).splitlines() + + # Re-format for different output lengths. + lines_left = len(left_formatting) + lines_right = len(right_formatting) + if lines_left != lines_right: + left_formatting = _pformat_dispatch(left).splitlines() + right_formatting = _pformat_dispatch(right).splitlines() + + if lines_left > 1 or lines_right > 1: + _surrounding_parens_on_own_lines(left_formatting) + _surrounding_parens_on_own_lines(right_formatting) + + explanation = ["Full diff:"] + # "right" is the expected base against which we compare "left", + # see https://github.com/pytest-dev/pytest/issues/3333 + explanation.extend( + line.rstrip() for line in difflib.ndiff(right_formatting, left_formatting) + ) + return explanation + + +def _compare_eq_sequence( + left: Sequence[Any], right: Sequence[Any], verbose: int = 0 +) -> List[str]: + comparing_bytes = isinstance(left, bytes) and isinstance(right, bytes) + explanation = [] # type: List[str] + len_left = len(left) + len_right = len(right) + for i in range(min(len_left, len_right)): + if left[i] != right[i]: + if comparing_bytes: + # when comparing bytes, we want to see their ascii representation + # instead of their numeric values (#5260) + # using a slice gives us the ascii representation: + # >>> s = b'foo' + # >>> s[0] + # 102 + # >>> s[0:1] + # b'f' + left_value = left[i : i + 1] + right_value = right[i : i + 1] + else: + left_value = left[i] + right_value = right[i] + + explanation += [ + "At index {} diff: {!r} != {!r}".format(i, left_value, right_value) + ] + break + + if comparing_bytes: + # when comparing bytes, it doesn't help to show the "sides contain one or more + # items" longer explanation, so skip it + + return explanation + + len_diff = len_left - len_right + if len_diff: + if len_diff > 0: + dir_with_more = "Left" + extra = saferepr(left[len_right]) + else: + len_diff = 0 - len_diff + dir_with_more = "Right" + extra = saferepr(right[len_left]) + + if len_diff == 1: + explanation += [ + "{} contains one more item: {}".format(dir_with_more, extra) + ] + else: + explanation += [ + "%s contains %d more items, first extra item: %s" + % (dir_with_more, len_diff, extra) + ] + return explanation + + +def _compare_eq_set( + left: AbstractSet[Any], right: AbstractSet[Any], verbose: int = 0 +) -> List[str]: + explanation = [] + diff_left = left - right + diff_right = right - left + if diff_left: + explanation.append("Extra items in the left set:") + for item in diff_left: + explanation.append(saferepr(item)) + if diff_right: + explanation.append("Extra items in the right set:") + for item in diff_right: + explanation.append(saferepr(item)) + return explanation + + +def _compare_eq_dict( + left: Mapping[Any, Any], right: Mapping[Any, Any], verbose: int = 0 +) -> List[str]: + explanation = [] # type: List[str] + set_left = set(left) + set_right = set(right) + common = set_left.intersection(set_right) + same = {k: left[k] for k in common if left[k] == right[k]} + if same and verbose < 2: + explanation += ["Omitting %s identical items, use -vv to show" % len(same)] + elif same: + explanation += ["Common items:"] + explanation += pprint.pformat(same).splitlines() + diff = {k for k in common if left[k] != right[k]} + if diff: + explanation += ["Differing items:"] + for k in diff: + explanation += [saferepr({k: left[k]}) + " != " + saferepr({k: right[k]})] + extra_left = set_left - set_right + len_extra_left = len(extra_left) + if len_extra_left: + explanation.append( + "Left contains %d more item%s:" + % (len_extra_left, "" if len_extra_left == 1 else "s") + ) + explanation.extend( + pprint.pformat({k: left[k] for k in extra_left}).splitlines() + ) + extra_right = set_right - set_left + len_extra_right = len(extra_right) + if len_extra_right: + explanation.append( + "Right contains %d more item%s:" + % (len_extra_right, "" if len_extra_right == 1 else "s") + ) + explanation.extend( + pprint.pformat({k: right[k] for k in extra_right}).splitlines() + ) + return explanation + + +def _compare_eq_cls( + left: Any, + right: Any, + verbose: int, + type_fns: Tuple[Callable[[Any], bool], Callable[[Any], bool]], +) -> List[str]: + isdatacls, isattrs = type_fns + if isdatacls(left): + all_fields = left.__dataclass_fields__ + fields_to_check = [field for field, info in all_fields.items() if info.compare] + elif isattrs(left): + all_fields = left.__attrs_attrs__ + fields_to_check = [ + field.name for field in all_fields if getattr(field, ATTRS_EQ_FIELD) + ] + + same = [] + diff = [] + for field in fields_to_check: + if getattr(left, field) == getattr(right, field): + same.append(field) + else: + diff.append(field) + + explanation = [] + if same and verbose < 2: + explanation.append("Omitting %s identical items, use -vv to show" % len(same)) + elif same: + explanation += ["Matching attributes:"] + explanation += pprint.pformat(same).splitlines() + if diff: + explanation += ["Differing attributes:"] + for field in diff: + explanation += [ + ("%s: %r != %r") % (field, getattr(left, field), getattr(right, field)) + ] + return explanation + + +def _notin_text(term: str, text: str, verbose: int = 0) -> List[str]: + index = text.find(term) + head = text[:index] + tail = text[index + len(term) :] + correct_text = head + tail + diff = _diff_text(text, correct_text, verbose) + newdiff = ["%s is contained here:" % saferepr(term, maxsize=42)] + for line in diff: + if line.startswith("Skipping"): + continue + if line.startswith("- "): + continue + if line.startswith("+ "): + newdiff.append(" " + line[2:]) + else: + newdiff.append(line) + return newdiff diff --git a/contrib/python/pytest/py3/_pytest/cacheprovider.py b/contrib/python/pytest/py3/_pytest/cacheprovider.py new file mode 100644 index 00000000000..a0f486089ff --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/cacheprovider.py @@ -0,0 +1,508 @@ +""" +merged implementation of the cache provider + +the name cache was not chosen to ensure pluggy automatically +ignores the external pytest-cache +""" +import json +import os +from collections import OrderedDict +from typing import Dict +from typing import Generator +from typing import List +from typing import Optional +from typing import Set + +import attr +import py + +import pytest +from .pathlib import Path +from .pathlib import resolve_from_str +from .pathlib import rm_rf +from .reports import CollectReport +from _pytest import nodes +from _pytest._io import TerminalWriter +from _pytest.config import Config +from _pytest.main import Session +from _pytest.python import Module + +README_CONTENT = """\ +# pytest cache directory # + +This directory contains data from the pytest's cache plugin, +which provides the `--lf` and `--ff` options, as well as the `cache` fixture. + +**Do not** commit this to version control. + +See [the docs](https://docs.pytest.org/en/latest/cache.html) for more information. +""" + +CACHEDIR_TAG_CONTENT = b"""\ +Signature: 8a477f597d28d172789f06886806bc55 +# This file is a cache directory tag created by pytest. +# For information about cache directory tags, see: +# http://www.bford.info/cachedir/spec.html +""" + + +@attr.s +class Cache: + _cachedir = attr.ib(repr=False) + _config = attr.ib(repr=False) + + # sub-directory under cache-dir for directories created by "makedir" + _CACHE_PREFIX_DIRS = "d" + + # sub-directory under cache-dir for values created by "set" + _CACHE_PREFIX_VALUES = "v" + + @classmethod + def for_config(cls, config): + cachedir = cls.cache_dir_from_config(config) + if config.getoption("cacheclear") and cachedir.is_dir(): + cls.clear_cache(cachedir) + return cls(cachedir, config) + + @classmethod + def clear_cache(cls, cachedir: Path): + """Clears the sub-directories used to hold cached directories and values.""" + for prefix in (cls._CACHE_PREFIX_DIRS, cls._CACHE_PREFIX_VALUES): + d = cachedir / prefix + if d.is_dir(): + rm_rf(d) + + @staticmethod + def cache_dir_from_config(config): + return resolve_from_str(config.getini("cache_dir"), config.rootdir) + + def warn(self, fmt, **args): + import warnings + from _pytest.warning_types import PytestCacheWarning + + warnings.warn( + PytestCacheWarning(fmt.format(**args) if args else fmt), + self._config.hook, + stacklevel=3, + ) + + def makedir(self, name): + """ return a directory path object with the given name. If the + directory does not yet exist, it will be created. You can use it + to manage files likes e. g. store/retrieve database + dumps across test sessions. + + :param name: must be a string not containing a ``/`` separator. + Make sure the name contains your plugin or application + identifiers to prevent clashes with other cache users. + """ + name = Path(name) + if len(name.parts) > 1: + raise ValueError("name is not allowed to contain path separators") + res = self._cachedir.joinpath(self._CACHE_PREFIX_DIRS, name) + res.mkdir(exist_ok=True, parents=True) + return py.path.local(res) + + def _getvaluepath(self, key): + return self._cachedir.joinpath(self._CACHE_PREFIX_VALUES, Path(key)) + + def get(self, key, default): + """ return cached value for the given key. If no value + was yet cached or the value cannot be read, the specified + default is returned. + + :param key: must be a ``/`` separated value. Usually the first + name is the name of your plugin or your application. + :param default: must be provided in case of a cache-miss or + invalid cache values. + + """ + path = self._getvaluepath(key) + try: + with path.open("r") as f: + return json.load(f) + except (ValueError, IOError, OSError): + return default + + def set(self, key, value): + """ save value for the given key. + + :param key: must be a ``/`` separated value. Usually the first + name is the name of your plugin or your application. + :param value: must be of any combination of basic + python types, including nested types + like e. g. lists of dictionaries. + """ + path = self._getvaluepath(key) + try: + if path.parent.is_dir(): + cache_dir_exists_already = True + else: + cache_dir_exists_already = self._cachedir.exists() + path.parent.mkdir(exist_ok=True, parents=True) + except (IOError, OSError): + self.warn("could not create cache path {path}", path=path) + return + if not cache_dir_exists_already: + self._ensure_supporting_files() + data = json.dumps(value, indent=2, sort_keys=True) + try: + f = path.open("w") + except (IOError, OSError): + self.warn("cache could not write path {path}", path=path) + else: + with f: + f.write(data) + + def _ensure_supporting_files(self): + """Create supporting files in the cache dir that are not really part of the cache.""" + readme_path = self._cachedir / "README.md" + readme_path.write_text(README_CONTENT) + + gitignore_path = self._cachedir.joinpath(".gitignore") + msg = "# Created by pytest automatically.\n*\n" + gitignore_path.write_text(msg, encoding="UTF-8") + + cachedir_tag_path = self._cachedir.joinpath("CACHEDIR.TAG") + cachedir_tag_path.write_bytes(CACHEDIR_TAG_CONTENT) + + +class LFPluginCollWrapper: + def __init__(self, lfplugin: "LFPlugin"): + self.lfplugin = lfplugin + self._collected_at_least_one_failure = False + + @pytest.hookimpl(hookwrapper=True) + def pytest_make_collect_report(self, collector) -> Generator: + if isinstance(collector, Session): + out = yield + res = out.get_result() # type: CollectReport + + # Sort any lf-paths to the beginning. + lf_paths = self.lfplugin._last_failed_paths + res.result = sorted( + res.result, key=lambda x: 0 if Path(str(x.fspath)) in lf_paths else 1, + ) + out.force_result(res) + return + + elif isinstance(collector, Module): + if Path(str(collector.fspath)) in self.lfplugin._last_failed_paths: + out = yield + res = out.get_result() + + filtered_result = [ + x for x in res.result if x.nodeid in self.lfplugin.lastfailed + ] + if filtered_result: + res.result = filtered_result + out.force_result(res) + + if not self._collected_at_least_one_failure: + self.lfplugin.config.pluginmanager.register( + LFPluginCollSkipfiles(self.lfplugin), "lfplugin-collskip" + ) + self._collected_at_least_one_failure = True + return res + yield + + +class LFPluginCollSkipfiles: + def __init__(self, lfplugin: "LFPlugin"): + self.lfplugin = lfplugin + + @pytest.hookimpl + def pytest_make_collect_report(self, collector) -> Optional[CollectReport]: + if isinstance(collector, Module): + if Path(str(collector.fspath)) not in self.lfplugin._last_failed_paths: + self.lfplugin._skipped_files += 1 + + return CollectReport( + collector.nodeid, "passed", longrepr=None, result=[] + ) + return None + + +class LFPlugin: + """ Plugin which implements the --lf (run last-failing) option """ + + def __init__(self, config: Config) -> None: + self.config = config + active_keys = "lf", "failedfirst" + self.active = any(config.getoption(key) for key in active_keys) + assert config.cache + self.lastfailed = config.cache.get( + "cache/lastfailed", {} + ) # type: Dict[str, bool] + self._previously_failed_count = None + self._report_status = None + self._skipped_files = 0 # count skipped files during collection due to --lf + + if config.getoption("lf"): + self._last_failed_paths = self.get_last_failed_paths() + config.pluginmanager.register( + LFPluginCollWrapper(self), "lfplugin-collwrapper" + ) + + def get_last_failed_paths(self) -> Set[Path]: + """Returns a set with all Paths()s of the previously failed nodeids.""" + rootpath = Path(str(self.config.rootdir)) + result = {rootpath / nodeid.split("::")[0] for nodeid in self.lastfailed} + return {x for x in result if x.exists()} + + def pytest_report_collectionfinish(self): + if self.active and self.config.getoption("verbose") >= 0: + return "run-last-failure: %s" % self._report_status + + def pytest_runtest_logreport(self, report): + if (report.when == "call" and report.passed) or report.skipped: + self.lastfailed.pop(report.nodeid, None) + elif report.failed: + self.lastfailed[report.nodeid] = True + + def pytest_collectreport(self, report): + passed = report.outcome in ("passed", "skipped") + if passed: + if report.nodeid in self.lastfailed: + self.lastfailed.pop(report.nodeid) + self.lastfailed.update((item.nodeid, True) for item in report.result) + else: + self.lastfailed[report.nodeid] = True + + def pytest_collection_modifyitems(self, session, config, items): + if not self.active: + return + + if self.lastfailed: + previously_failed = [] + previously_passed = [] + for item in items: + if item.nodeid in self.lastfailed: + previously_failed.append(item) + else: + previously_passed.append(item) + self._previously_failed_count = len(previously_failed) + + if not previously_failed: + # Running a subset of all tests with recorded failures + # only outside of it. + self._report_status = "%d known failures not in selected tests" % ( + len(self.lastfailed), + ) + else: + if self.config.getoption("lf"): + items[:] = previously_failed + config.hook.pytest_deselected(items=previously_passed) + else: # --failedfirst + items[:] = previously_failed + previously_passed + + noun = "failure" if self._previously_failed_count == 1 else "failures" + suffix = " first" if self.config.getoption("failedfirst") else "" + self._report_status = "rerun previous {count} {noun}{suffix}".format( + count=self._previously_failed_count, suffix=suffix, noun=noun + ) + + if self._skipped_files > 0: + files_noun = "file" if self._skipped_files == 1 else "files" + self._report_status += " (skipped {files} {files_noun})".format( + files=self._skipped_files, files_noun=files_noun + ) + else: + self._report_status = "no previously failed tests, " + if self.config.getoption("last_failed_no_failures") == "none": + self._report_status += "deselecting all items." + config.hook.pytest_deselected(items=items[:]) + items[:] = [] + else: + self._report_status += "not deselecting items." + + def pytest_sessionfinish(self, session): + config = self.config + if config.getoption("cacheshow") or hasattr(config, "slaveinput"): + return + + saved_lastfailed = config.cache.get("cache/lastfailed", {}) + if saved_lastfailed != self.lastfailed: + config.cache.set("cache/lastfailed", self.lastfailed) + + +class NFPlugin: + """ Plugin which implements the --nf (run new-first) option """ + + def __init__(self, config): + self.config = config + self.active = config.option.newfirst + self.cached_nodeids = config.cache.get("cache/nodeids", []) + + def pytest_collection_modifyitems( + self, session: Session, config: Config, items: List[nodes.Item] + ) -> None: + new_items = OrderedDict() # type: OrderedDict[str, nodes.Item] + if self.active: + other_items = OrderedDict() # type: OrderedDict[str, nodes.Item] + for item in items: + if item.nodeid not in self.cached_nodeids: + new_items[item.nodeid] = item + else: + other_items[item.nodeid] = item + + items[:] = self._get_increasing_order( + new_items.values() + ) + self._get_increasing_order(other_items.values()) + else: + for item in items: + if item.nodeid not in self.cached_nodeids: + new_items[item.nodeid] = item + self.cached_nodeids.extend(new_items) + + def _get_increasing_order(self, items): + return sorted(items, key=lambda item: item.fspath.mtime(), reverse=True) + + def pytest_sessionfinish(self, session): + config = self.config + if config.getoption("cacheshow") or hasattr(config, "slaveinput"): + return + + config.cache.set("cache/nodeids", self.cached_nodeids) + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group.addoption( + "--lf", + "--last-failed", + action="store_true", + dest="lf", + help="rerun only the tests that failed " + "at the last run (or all if none failed)", + ) + group.addoption( + "--ff", + "--failed-first", + action="store_true", + dest="failedfirst", + help="run all tests but run the last failures first. " + "This may re-order tests and thus lead to " + "repeated fixture setup/teardown", + ) + group.addoption( + "--nf", + "--new-first", + action="store_true", + dest="newfirst", + help="run tests from new files first, then the rest of the tests " + "sorted by file mtime", + ) + group.addoption( + "--cache-show", + action="append", + nargs="?", + dest="cacheshow", + help=( + "show cache contents, don't perform collection or tests. " + "Optional argument: glob (default: '*')." + ), + ) + group.addoption( + "--cache-clear", + action="store_true", + dest="cacheclear", + help="remove all cache contents at start of test run.", + ) + cache_dir_default = ".pytest_cache" + if "TOX_ENV_DIR" in os.environ: + cache_dir_default = os.path.join(os.environ["TOX_ENV_DIR"], cache_dir_default) + parser.addini("cache_dir", default=cache_dir_default, help="cache directory path.") + group.addoption( + "--lfnf", + "--last-failed-no-failures", + action="store", + dest="last_failed_no_failures", + choices=("all", "none"), + default="all", + help="which tests to run with no previously (known) failures.", + ) + + +def pytest_cmdline_main(config): + if config.option.cacheshow: + from _pytest.main import wrap_session + + return wrap_session(config, cacheshow) + + +@pytest.hookimpl(tryfirst=True) +def pytest_configure(config: Config) -> None: + config.cache = Cache.for_config(config) + config.pluginmanager.register(LFPlugin(config), "lfplugin") + config.pluginmanager.register(NFPlugin(config), "nfplugin") + + +@pytest.fixture +def cache(request): + """ + Return a cache object that can persist state between testing sessions. + + cache.get(key, default) + cache.set(key, value) + + Keys must be a ``/`` separated value, where the first part is usually the + name of your plugin or application to avoid clashes with other cache users. + + Values can be any object handled by the json stdlib module. + """ + return request.config.cache + + +def pytest_report_header(config): + """Display cachedir with --cache-show and if non-default.""" + if config.option.verbose > 0 or config.getini("cache_dir") != ".pytest_cache": + cachedir = config.cache._cachedir + # TODO: evaluate generating upward relative paths + # starting with .., ../.. if sensible + + try: + displaypath = cachedir.relative_to(config.rootdir) + except ValueError: + displaypath = cachedir + return "cachedir: {}".format(displaypath) + + +def cacheshow(config, session): + from pprint import pformat + + tw = TerminalWriter() + tw.line("cachedir: " + str(config.cache._cachedir)) + if not config.cache._cachedir.is_dir(): + tw.line("cache is empty") + return 0 + + glob = config.option.cacheshow[0] + if glob is None: + glob = "*" + + dummy = object() + basedir = config.cache._cachedir + vdir = basedir / Cache._CACHE_PREFIX_VALUES + tw.sep("-", "cache values for %r" % glob) + for valpath in sorted(x for x in vdir.rglob(glob) if x.is_file()): + key = valpath.relative_to(vdir) + val = config.cache.get(key, dummy) + if val is dummy: + tw.line("%s contains unreadable content, will be ignored" % key) + else: + tw.line("%s contains:" % key) + for line in pformat(val).splitlines(): + tw.line(" " + line) + + ddir = basedir / Cache._CACHE_PREFIX_DIRS + if ddir.is_dir(): + contents = sorted(ddir.rglob(glob)) + tw.sep("-", "cache directories for %r" % glob) + for p in contents: + # if p.check(dir=1): + # print("%s/" % p.relto(basedir)) + if p.is_file(): + key = p.relative_to(basedir) + tw.line("{} is a file of length {:d}".format(key, p.stat().st_size)) + return 0 diff --git a/contrib/python/pytest/py3/_pytest/capture.py b/contrib/python/pytest/py3/_pytest/capture.py new file mode 100644 index 00000000000..673bb07a9b6 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/capture.py @@ -0,0 +1,853 @@ +""" +per-test stdout/stderr capturing mechanism. + +""" +import collections +import contextlib +import io +import os +import sys +from io import UnsupportedOperation +from tempfile import TemporaryFile +from typing import BinaryIO +from typing import Generator +from typing import Iterable +from typing import Optional + +import pytest +from _pytest.compat import CaptureAndPassthroughIO +from _pytest.compat import CaptureIO +from _pytest.compat import TYPE_CHECKING +from _pytest.config import Config +from _pytest.fixtures import FixtureRequest + +if TYPE_CHECKING: + from typing_extensions import Literal + + _CaptureMethod = Literal["fd", "sys", "no", "tee-sys"] + +patchsysdict = {0: "stdin", 1: "stdout", 2: "stderr"} + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group._addoption( + "--capture", + action="store", + default="fd" if hasattr(os, "dup") else "sys", + metavar="method", + choices=["fd", "sys", "no", "tee-sys"], + help="per-test capturing method: one of fd|sys|no|tee-sys.", + ) + group._addoption( + "-s", + action="store_const", + const="no", + dest="capture", + help="shortcut for --capture=no.", + ) + + +@pytest.hookimpl(hookwrapper=True) +def pytest_load_initial_conftests(early_config: Config): + ns = early_config.known_args_namespace + if ns.capture == "fd": + _py36_windowsconsoleio_workaround(sys.stdout) + _colorama_workaround() + _readline_workaround() + pluginmanager = early_config.pluginmanager + capman = CaptureManager(ns.capture) + pluginmanager.register(capman, "capturemanager") + + # make sure that capturemanager is properly reset at final shutdown + early_config.add_cleanup(capman.stop_global_capturing) + + # finally trigger conftest loading but while capturing (issue93) + capman.start_global_capturing() + outcome = yield + capman.suspend_global_capture() + if outcome.excinfo is not None: + out, err = capman.read_global_capture() + sys.stdout.write(out) + sys.stderr.write(err) + + +def _get_multicapture(method: "_CaptureMethod") -> "MultiCapture": + if method == "fd": + return MultiCapture(out=True, err=True, Capture=FDCapture) + elif method == "sys": + return MultiCapture(out=True, err=True, Capture=SysCapture) + elif method == "no": + return MultiCapture(out=False, err=False, in_=False) + elif method == "tee-sys": + return MultiCapture(out=True, err=True, in_=False, Capture=TeeSysCapture) + raise ValueError("unknown capturing method: {!r}".format(method)) + + +class CaptureManager: + """ + Capture plugin, manages that the appropriate capture method is enabled/disabled during collection and each + test phase (setup, call, teardown). After each of those points, the captured output is obtained and + attached to the collection/runtest report. + + There are two levels of capture: + * global: which is enabled by default and can be suppressed by the ``-s`` option. This is always enabled/disabled + during collection and each test phase. + * fixture: when a test function or one of its fixture depend on the ``capsys`` or ``capfd`` fixtures. In this + case special handling is needed to ensure the fixtures take precedence over the global capture. + """ + + def __init__(self, method: "_CaptureMethod") -> None: + self._method = method + self._global_capturing = None + self._capture_fixture = None # type: Optional[CaptureFixture] + + def __repr__(self): + return "<CaptureManager _method={!r} _global_capturing={!r} _capture_fixture={!r}>".format( + self._method, self._global_capturing, self._capture_fixture + ) + + def is_capturing(self): + if self.is_globally_capturing(): + return "global" + if self._capture_fixture: + return "fixture %s" % self._capture_fixture.request.fixturename + return False + + # Global capturing control + + def is_globally_capturing(self): + return self._method != "no" + + def start_global_capturing(self): + assert self._global_capturing is None + self._global_capturing = _get_multicapture(self._method) + self._global_capturing.start_capturing() + + def stop_global_capturing(self): + if self._global_capturing is not None: + self._global_capturing.pop_outerr_to_orig() + self._global_capturing.stop_capturing() + self._global_capturing = None + + def resume_global_capture(self): + # During teardown of the python process, and on rare occasions, capture + # attributes can be `None` while trying to resume global capture. + if self._global_capturing is not None: + self._global_capturing.resume_capturing() + + def suspend_global_capture(self, in_=False): + cap = getattr(self, "_global_capturing", None) + if cap is not None: + cap.suspend_capturing(in_=in_) + + def suspend(self, in_=False): + # Need to undo local capsys-et-al if it exists before disabling global capture. + self.suspend_fixture() + self.suspend_global_capture(in_) + + def resume(self): + self.resume_global_capture() + self.resume_fixture() + + def read_global_capture(self): + return self._global_capturing.readouterr() + + # Fixture Control (it's just forwarding, think about removing this later) + + @contextlib.contextmanager + def _capturing_for_request( + self, request: FixtureRequest + ) -> Generator["CaptureFixture", None, None]: + """ + Context manager that creates a ``CaptureFixture`` instance for the + given ``request``, ensuring there is only a single one being requested + at the same time. + + This is used as a helper with ``capsys``, ``capfd`` etc. + """ + if self._capture_fixture: + other_name = next( + k + for k, v in map_fixname_class.items() + if v is self._capture_fixture.captureclass + ) + raise request.raiseerror( + "cannot use {} and {} at the same time".format( + request.fixturename, other_name + ) + ) + capture_class = map_fixname_class[request.fixturename] + self._capture_fixture = CaptureFixture(capture_class, request) + self.activate_fixture() + yield self._capture_fixture + self._capture_fixture.close() + self._capture_fixture = None + + def activate_fixture(self): + """If the current item is using ``capsys`` or ``capfd``, activate them so they take precedence over + the global capture. + """ + if self._capture_fixture: + self._capture_fixture._start() + + def deactivate_fixture(self): + """Deactivates the ``capsys`` or ``capfd`` fixture of this item, if any.""" + if self._capture_fixture: + self._capture_fixture.close() + + def suspend_fixture(self): + if self._capture_fixture: + self._capture_fixture._suspend() + + def resume_fixture(self): + if self._capture_fixture: + self._capture_fixture._resume() + + # Helper context managers + + @contextlib.contextmanager + def global_and_fixture_disabled(self): + """Context manager to temporarily disable global and current fixture capturing.""" + self.suspend() + try: + yield + finally: + self.resume() + + @contextlib.contextmanager + def item_capture(self, when, item): + self.resume_global_capture() + self.activate_fixture() + try: + yield + finally: + self.deactivate_fixture() + self.suspend_global_capture(in_=False) + + out, err = self.read_global_capture() + item.add_report_section(when, "stdout", out) + item.add_report_section(when, "stderr", err) + + # Hooks + + @pytest.hookimpl(hookwrapper=True) + def pytest_make_collect_report(self, collector): + if isinstance(collector, pytest.File): + self.resume_global_capture() + outcome = yield + self.suspend_global_capture() + out, err = self.read_global_capture() + rep = outcome.get_result() + if out: + rep.sections.append(("Captured stdout", out)) + if err: + rep.sections.append(("Captured stderr", err)) + else: + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_setup(self, item): + with self.item_capture("setup", item): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_call(self, item): + with self.item_capture("call", item): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_teardown(self, item): + with self.item_capture("teardown", item): + yield + + @pytest.hookimpl(tryfirst=True) + def pytest_keyboard_interrupt(self, excinfo): + self.stop_global_capturing() + + @pytest.hookimpl(tryfirst=True) + def pytest_internalerror(self, excinfo): + self.stop_global_capturing() + + +@pytest.fixture +def capsys(request): + """Enable text capturing of writes to ``sys.stdout`` and ``sys.stderr``. + + The captured output is made available via ``capsys.readouterr()`` method + calls, which return a ``(out, err)`` namedtuple. + ``out`` and ``err`` will be ``text`` objects. + """ + capman = request.config.pluginmanager.getplugin("capturemanager") + with capman._capturing_for_request(request) as fixture: + yield fixture + + +@pytest.fixture +def capsysbinary(request): + """Enable bytes capturing of writes to ``sys.stdout`` and ``sys.stderr``. + + The captured output is made available via ``capsysbinary.readouterr()`` + method calls, which return a ``(out, err)`` namedtuple. + ``out`` and ``err`` will be ``bytes`` objects. + """ + capman = request.config.pluginmanager.getplugin("capturemanager") + with capman._capturing_for_request(request) as fixture: + yield fixture + + +@pytest.fixture +def capfd(request): + """Enable text capturing of writes to file descriptors ``1`` and ``2``. + + The captured output is made available via ``capfd.readouterr()`` method + calls, which return a ``(out, err)`` namedtuple. + ``out`` and ``err`` will be ``text`` objects. + """ + if not hasattr(os, "dup"): + pytest.skip( + "capfd fixture needs os.dup function which is not available in this system" + ) + capman = request.config.pluginmanager.getplugin("capturemanager") + with capman._capturing_for_request(request) as fixture: + yield fixture + + +@pytest.fixture +def capfdbinary(request): + """Enable bytes capturing of writes to file descriptors ``1`` and ``2``. + + The captured output is made available via ``capfd.readouterr()`` method + calls, which return a ``(out, err)`` namedtuple. + ``out`` and ``err`` will be ``byte`` objects. + """ + if not hasattr(os, "dup"): + pytest.skip( + "capfdbinary fixture needs os.dup function which is not available in this system" + ) + capman = request.config.pluginmanager.getplugin("capturemanager") + with capman._capturing_for_request(request) as fixture: + yield fixture + + +class CaptureFixture: + """ + Object returned by :py:func:`capsys`, :py:func:`capsysbinary`, :py:func:`capfd` and :py:func:`capfdbinary` + fixtures. + """ + + def __init__(self, captureclass, request): + self.captureclass = captureclass + self.request = request + self._capture = None + self._captured_out = self.captureclass.EMPTY_BUFFER + self._captured_err = self.captureclass.EMPTY_BUFFER + + def _start(self): + if self._capture is None: + self._capture = MultiCapture( + out=True, err=True, in_=False, Capture=self.captureclass + ) + self._capture.start_capturing() + + def close(self): + if self._capture is not None: + out, err = self._capture.pop_outerr_to_orig() + self._captured_out += out + self._captured_err += err + self._capture.stop_capturing() + self._capture = None + + def readouterr(self): + """Read and return the captured output so far, resetting the internal buffer. + + :return: captured content as a namedtuple with ``out`` and ``err`` string attributes + """ + captured_out, captured_err = self._captured_out, self._captured_err + if self._capture is not None: + out, err = self._capture.readouterr() + captured_out += out + captured_err += err + self._captured_out = self.captureclass.EMPTY_BUFFER + self._captured_err = self.captureclass.EMPTY_BUFFER + return CaptureResult(captured_out, captured_err) + + def _suspend(self): + """Suspends this fixture's own capturing temporarily.""" + if self._capture is not None: + self._capture.suspend_capturing() + + def _resume(self): + """Resumes this fixture's own capturing temporarily.""" + if self._capture is not None: + self._capture.resume_capturing() + + @contextlib.contextmanager + def disabled(self): + """Temporarily disables capture while inside the 'with' block.""" + capmanager = self.request.config.pluginmanager.getplugin("capturemanager") + with capmanager.global_and_fixture_disabled(): + yield + + +def safe_text_dupfile(f, mode, default_encoding="UTF8"): + """ return an open text file object that's a duplicate of f on the + FD-level if possible. + """ + encoding = getattr(f, "encoding", None) + try: + fd = f.fileno() + except Exception: + if "b" not in getattr(f, "mode", "") and hasattr(f, "encoding"): + # we seem to have a text stream, let's just use it + return f + else: + newfd = os.dup(fd) + if "b" not in mode: + mode += "b" + f = os.fdopen(newfd, mode, 0) # no buffering + return EncodedFile(f, encoding or default_encoding) + + +class EncodedFile: + errors = "strict" # possibly needed by py3 code (issue555) + + def __init__(self, buffer: BinaryIO, encoding: str) -> None: + self.buffer = buffer + self.encoding = encoding + + def write(self, s: str) -> int: + if not isinstance(s, str): + raise TypeError( + "write() argument must be str, not {}".format(type(s).__name__) + ) + return self.buffer.write(s.encode(self.encoding, "replace")) + + def writelines(self, lines: Iterable[str]) -> None: + self.buffer.writelines(x.encode(self.encoding, "replace") for x in lines) + + @property + def name(self) -> str: + """Ensure that file.name is a string.""" + return repr(self.buffer) + + @property + def mode(self) -> str: + return self.buffer.mode.replace("b", "") + + def __getattr__(self, name): + return getattr(object.__getattribute__(self, "buffer"), name) + + +CaptureResult = collections.namedtuple("CaptureResult", ["out", "err"]) + + +class MultiCapture: + out = err = in_ = None + _state = None + _in_suspended = False + + def __init__(self, out=True, err=True, in_=True, Capture=None): + if in_: + self.in_ = Capture(0) + if out: + self.out = Capture(1) + if err: + self.err = Capture(2) + + def __repr__(self): + return "<MultiCapture out={!r} err={!r} in_={!r} _state={!r} _in_suspended={!r}>".format( + self.out, self.err, self.in_, self._state, self._in_suspended, + ) + + def start_capturing(self): + self._state = "started" + if self.in_: + self.in_.start() + if self.out: + self.out.start() + if self.err: + self.err.start() + + def pop_outerr_to_orig(self): + """ pop current snapshot out/err capture and flush to orig streams. """ + out, err = self.readouterr() + if out: + self.out.writeorg(out) + if err: + self.err.writeorg(err) + return out, err + + def suspend_capturing(self, in_=False): + self._state = "suspended" + if self.out: + self.out.suspend() + if self.err: + self.err.suspend() + if in_ and self.in_: + self.in_.suspend() + self._in_suspended = True + + def resume_capturing(self): + self._state = "resumed" + if self.out: + self.out.resume() + if self.err: + self.err.resume() + if self._in_suspended: + self.in_.resume() + self._in_suspended = False + + def stop_capturing(self): + """ stop capturing and reset capturing streams """ + if self._state == "stopped": + raise ValueError("was already stopped") + self._state = "stopped" + if self.out: + self.out.done() + if self.err: + self.err.done() + if self.in_: + self.in_.done() + + def readouterr(self) -> CaptureResult: + if self.out: + out = self.out.snap() + else: + out = "" + if self.err: + err = self.err.snap() + else: + err = "" + return CaptureResult(out, err) + + +class NoCapture: + EMPTY_BUFFER = None + __init__ = start = done = suspend = resume = lambda *args: None + + +class FDCaptureBinary: + """Capture IO to/from a given os-level filedescriptor. + + snap() produces `bytes` + """ + + EMPTY_BUFFER = b"" + _state = None + + def __init__(self, targetfd, tmpfile=None): + self.targetfd = targetfd + try: + self.targetfd_save = os.dup(self.targetfd) + except OSError: + self.start = lambda: None + self.done = lambda: None + else: + self.start = self._start + self.done = self._done + if targetfd == 0: + assert not tmpfile, "cannot set tmpfile with stdin" + tmpfile = open(os.devnull, "r") + self.syscapture = SysCapture(targetfd) + else: + if tmpfile is None: + f = TemporaryFile() + with f: + tmpfile = safe_text_dupfile(f, mode="wb+") + if targetfd in patchsysdict: + self.syscapture = SysCapture(targetfd, tmpfile) + else: + self.syscapture = NoCapture() + self.tmpfile = tmpfile + self.tmpfile_fd = tmpfile.fileno() + + def __repr__(self): + return "<{} {} oldfd={} _state={!r} tmpfile={}>".format( + self.__class__.__name__, + self.targetfd, + getattr(self, "targetfd_save", "<UNSET>"), + self._state, + hasattr(self, "tmpfile") and repr(self.tmpfile) or "<UNSET>", + ) + + def _start(self): + """ Start capturing on targetfd using memorized tmpfile. """ + try: + os.fstat(self.targetfd_save) + except (AttributeError, OSError): + raise ValueError("saved filedescriptor not valid anymore") + os.dup2(self.tmpfile_fd, self.targetfd) + self.syscapture.start() + self._state = "started" + + def snap(self): + self.tmpfile.seek(0) + res = self.tmpfile.read() + self.tmpfile.seek(0) + self.tmpfile.truncate() + return res + + def _done(self): + """ stop capturing, restore streams, return original capture file, + seeked to position zero. """ + targetfd_save = self.__dict__.pop("targetfd_save") + os.dup2(targetfd_save, self.targetfd) + os.close(targetfd_save) + self.syscapture.done() + self.tmpfile.close() + self._state = "done" + + def suspend(self): + self.syscapture.suspend() + os.dup2(self.targetfd_save, self.targetfd) + self._state = "suspended" + + def resume(self): + self.syscapture.resume() + os.dup2(self.tmpfile_fd, self.targetfd) + self._state = "resumed" + + def writeorg(self, data): + """ write to original file descriptor. """ + os.write(self.targetfd_save, data) + + +class FDCapture(FDCaptureBinary): + """Capture IO to/from a given os-level filedescriptor. + + snap() produces text + """ + + # Ignore type because it doesn't match the type in the superclass (bytes). + EMPTY_BUFFER = str() # type: ignore + + def snap(self): + res = super().snap() + enc = getattr(self.tmpfile, "encoding", None) + if enc and isinstance(res, bytes): + res = str(res, enc, "replace") + return res + + def writeorg(self, data): + """ write to original file descriptor. """ + data = data.encode("utf-8") # XXX use encoding of original stream + os.write(self.targetfd_save, data) + + +class SysCaptureBinary: + + EMPTY_BUFFER = b"" + _state = None + + def __init__(self, fd, tmpfile=None): + name = patchsysdict[fd] + self._old = getattr(sys, name) + self.name = name + if tmpfile is None: + if name == "stdin": + tmpfile = DontReadFromInput() + else: + tmpfile = CaptureIO() + self.tmpfile = tmpfile + + def __repr__(self): + return "<{} {} _old={} _state={!r} tmpfile={!r}>".format( + self.__class__.__name__, + self.name, + hasattr(self, "_old") and repr(self._old) or "<UNSET>", + self._state, + self.tmpfile, + ) + + def start(self): + setattr(sys, self.name, self.tmpfile) + self._state = "started" + + def snap(self): + res = self.tmpfile.buffer.getvalue() + self.tmpfile.seek(0) + self.tmpfile.truncate() + return res + + def done(self): + setattr(sys, self.name, self._old) + del self._old + self.tmpfile.close() + self._state = "done" + + def suspend(self): + setattr(sys, self.name, self._old) + self._state = "suspended" + + def resume(self): + setattr(sys, self.name, self.tmpfile) + self._state = "resumed" + + def writeorg(self, data): + self._old.flush() + self._old.buffer.write(data) + self._old.buffer.flush() + + +class SysCapture(SysCaptureBinary): + EMPTY_BUFFER = str() # type: ignore[assignment] # noqa: F821 + + def snap(self): + res = self.tmpfile.getvalue() + self.tmpfile.seek(0) + self.tmpfile.truncate() + return res + + def writeorg(self, data): + self._old.write(data) + self._old.flush() + + +class TeeSysCapture(SysCapture): + def __init__(self, fd, tmpfile=None): + name = patchsysdict[fd] + self._old = getattr(sys, name) + self.name = name + if tmpfile is None: + if name == "stdin": + tmpfile = DontReadFromInput() + else: + tmpfile = CaptureAndPassthroughIO(self._old) + self.tmpfile = tmpfile + + +map_fixname_class = { + "capfd": FDCapture, + "capfdbinary": FDCaptureBinary, + "capsys": SysCapture, + "capsysbinary": SysCaptureBinary, +} + + +class DontReadFromInput: + encoding = None + + def read(self, *args): + raise IOError( + "pytest: reading from stdin while output is captured! Consider using `-s`." + ) + + readline = read + readlines = read + __next__ = read + + def __iter__(self): + return self + + def fileno(self): + raise UnsupportedOperation("redirected stdin is pseudofile, has no fileno()") + + def isatty(self): + return False + + def close(self): + pass + + @property + def buffer(self): + return self + + +def _colorama_workaround(): + """ + Ensure colorama is imported so that it attaches to the correct stdio + handles on Windows. + + colorama uses the terminal on import time. So if something does the + first import of colorama while I/O capture is active, colorama will + fail in various ways. + """ + if sys.platform.startswith("win32"): + try: + import colorama # noqa: F401 + except ImportError: + pass + + +def _readline_workaround(): + """ + Ensure readline is imported so that it attaches to the correct stdio + handles on Windows. + + Pdb uses readline support where available--when not running from the Python + prompt, the readline module is not imported until running the pdb REPL. If + running pytest with the --pdb option this means the readline module is not + imported until after I/O capture has been started. + + This is a problem for pyreadline, which is often used to implement readline + support on Windows, as it does not attach to the correct handles for stdout + and/or stdin if they have been redirected by the FDCapture mechanism. This + workaround ensures that readline is imported before I/O capture is setup so + that it can attach to the actual stdin/out for the console. + + See https://github.com/pytest-dev/pytest/pull/1281 + """ + if sys.platform.startswith("win32"): + try: + import readline # noqa: F401 + except ImportError: + pass + + +def _py36_windowsconsoleio_workaround(stream): + """ + Python 3.6 implemented unicode console handling for Windows. This works + by reading/writing to the raw console handle using + ``{Read,Write}ConsoleW``. + + The problem is that we are going to ``dup2`` over the stdio file + descriptors when doing ``FDCapture`` and this will ``CloseHandle`` the + handles used by Python to write to the console. Though there is still some + weirdness and the console handle seems to only be closed randomly and not + on the first call to ``CloseHandle``, or maybe it gets reopened with the + same handle value when we suspend capturing. + + The workaround in this case will reopen stdio with a different fd which + also means a different handle by replicating the logic in + "Py_lifecycle.c:initstdio/create_stdio". + + :param stream: in practice ``sys.stdout`` or ``sys.stderr``, but given + here as parameter for unittesting purposes. + + See https://github.com/pytest-dev/py/issues/103 + """ + if ( + not sys.platform.startswith("win32") + or sys.version_info[:2] < (3, 6) + or hasattr(sys, "pypy_version_info") + ): + return + + # bail out if ``stream`` doesn't seem like a proper ``io`` stream (#2666) + if not hasattr(stream, "buffer"): + return + + buffered = hasattr(stream.buffer, "raw") + raw_stdout = stream.buffer.raw if buffered else stream.buffer + + if not isinstance(raw_stdout, io._WindowsConsoleIO): + return + + def _reopen_stdio(f, mode): + if not buffered and mode[0] == "w": + buffering = 0 + else: + buffering = -1 + + return io.TextIOWrapper( + open(os.dup(f.fileno()), mode, buffering), + f.encoding, + f.errors, + f.newlines, + f.line_buffering, + ) + + sys.stdin = _reopen_stdio(sys.stdin, "rb") + sys.stdout = _reopen_stdio(sys.stdout, "wb") + sys.stderr = _reopen_stdio(sys.stderr, "wb") diff --git a/contrib/python/pytest/py3/_pytest/compat.py b/contrib/python/pytest/py3/_pytest/compat.py new file mode 100644 index 00000000000..4e11bcab761 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/compat.py @@ -0,0 +1,428 @@ +""" +python version compatibility code +""" +import functools +import inspect +import io +import os +import re +import sys +from contextlib import contextmanager +from inspect import Parameter +from inspect import signature +from typing import Any +from typing import Callable +from typing import Generic +from typing import IO +from typing import Optional +from typing import overload +from typing import Tuple +from typing import TypeVar +from typing import Union + +import attr +import py + +from _pytest._io.saferepr import saferepr +from _pytest.outcomes import fail +from _pytest.outcomes import TEST_OUTCOME + +if sys.version_info < (3, 5, 2): + TYPE_CHECKING = False # type: bool +else: + from typing import TYPE_CHECKING + + +if TYPE_CHECKING: + from typing import Type # noqa: F401 (used in type string) + + +_T = TypeVar("_T") +_S = TypeVar("_S") + + +NOTSET = object() + +MODULE_NOT_FOUND_ERROR = ( + "ModuleNotFoundError" if sys.version_info[:2] >= (3, 6) else "ImportError" +) + + +if sys.version_info >= (3, 8): + from importlib import metadata as importlib_metadata +else: + import importlib_metadata # noqa: F401 + + +def _format_args(func: Callable[..., Any]) -> str: + return str(signature(func)) + + +# The type of re.compile objects is not exposed in Python. +REGEX_TYPE = type(re.compile("")) + + +if sys.version_info < (3, 6): + + def fspath(p): + """os.fspath replacement, useful to point out when we should replace it by the + real function once we drop py35. + """ + return str(p) + + +else: + fspath = os.fspath + + +def is_generator(func: object) -> bool: + genfunc = inspect.isgeneratorfunction(func) + return genfunc and not iscoroutinefunction(func) + + +def iscoroutinefunction(func: object) -> bool: + """ + Return True if func is a coroutine function (a function defined with async + def syntax, and doesn't contain yield), or a function decorated with + @asyncio.coroutine. + + Note: copied and modified from Python 3.5's builtin couroutines.py to avoid + importing asyncio directly, which in turns also initializes the "logging" + module as a side-effect (see issue #8). + """ + return inspect.iscoroutinefunction(func) or getattr(func, "_is_coroutine", False) + + +def is_async_function(func: object) -> bool: + """Return True if the given function seems to be an async function or async generator""" + return iscoroutinefunction(func) or ( + sys.version_info >= (3, 6) and inspect.isasyncgenfunction(func) + ) + + +def getlocation(function, curdir=None) -> str: + function = get_real_func(function) + fn = py.path.local(inspect.getfile(function)) + lineno = function.__code__.co_firstlineno + if curdir is not None: + relfn = fn.relto(curdir) + if relfn: + return "%s:%d" % (relfn, lineno + 1) + return "%s:%d" % (fn, lineno + 1) + + +def num_mock_patch_args(function) -> int: + """ return number of arguments used up by mock arguments (if any) """ + patchings = getattr(function, "patchings", None) + if not patchings: + return 0 + + mock_sentinel = getattr(sys.modules.get("mock"), "DEFAULT", object()) + ut_mock_sentinel = getattr(sys.modules.get("unittest.mock"), "DEFAULT", object()) + + return len( + [ + p + for p in patchings + if not p.attribute_name + and (p.new is mock_sentinel or p.new is ut_mock_sentinel) + ] + ) + + +def getfuncargnames( + function: Callable[..., Any], + *, + name: str = "", + is_method: bool = False, + cls: Optional[type] = None +) -> Tuple[str, ...]: + """Returns the names of a function's mandatory arguments. + + This should return the names of all function arguments that: + * Aren't bound to an instance or type as in instance or class methods. + * Don't have default values. + * Aren't bound with functools.partial. + * Aren't replaced with mocks. + + The is_method and cls arguments indicate that the function should + be treated as a bound method even though it's not unless, only in + the case of cls, the function is a static method. + + The name parameter should be the original name in which the function was collected. + """ + # TODO(RonnyPfannschmidt): This function should be refactored when we + # revisit fixtures. The fixture mechanism should ask the node for + # the fixture names, and not try to obtain directly from the + # function object well after collection has occurred. + + # The parameters attribute of a Signature object contains an + # ordered mapping of parameter names to Parameter instances. This + # creates a tuple of the names of the parameters that don't have + # defaults. + try: + parameters = signature(function).parameters + except (ValueError, TypeError) as e: + fail( + "Could not determine arguments of {!r}: {}".format(function, e), + pytrace=False, + ) + + arg_names = tuple( + p.name + for p in parameters.values() + if ( + p.kind is Parameter.POSITIONAL_OR_KEYWORD + or p.kind is Parameter.KEYWORD_ONLY + ) + and p.default is Parameter.empty + ) + if not name: + name = function.__name__ + + # If this function should be treated as a bound method even though + # it's passed as an unbound method or function, remove the first + # parameter name. + if is_method or ( + cls and not isinstance(cls.__dict__.get(name, None), staticmethod) + ): + arg_names = arg_names[1:] + # Remove any names that will be replaced with mocks. + if hasattr(function, "__wrapped__"): + arg_names = arg_names[num_mock_patch_args(function) :] + return arg_names + + +if sys.version_info < (3, 7): + + @contextmanager + def nullcontext(): + yield + + +else: + from contextlib import nullcontext # noqa + + +def get_default_arg_names(function: Callable[..., Any]) -> Tuple[str, ...]: + # Note: this code intentionally mirrors the code at the beginning of getfuncargnames, + # to get the arguments which were excluded from its result because they had default values + return tuple( + p.name + for p in signature(function).parameters.values() + if p.kind in (Parameter.POSITIONAL_OR_KEYWORD, Parameter.KEYWORD_ONLY) + and p.default is not Parameter.empty + ) + + +_non_printable_ascii_translate_table = { + i: "\\x{:02x}".format(i) for i in range(128) if i not in range(32, 127) +} +_non_printable_ascii_translate_table.update( + {ord("\t"): "\\t", ord("\r"): "\\r", ord("\n"): "\\n"} +) + + +def _translate_non_printable(s: str) -> str: + return s.translate(_non_printable_ascii_translate_table) + + +STRING_TYPES = bytes, str + + +def _bytes_to_ascii(val: bytes) -> str: + return val.decode("ascii", "backslashreplace") + + +def ascii_escaped(val: Union[bytes, str]) -> str: + """If val is pure ascii, returns it as a str(). Otherwise, escapes + bytes objects into a sequence of escaped bytes: + + b'\xc3\xb4\xc5\xd6' -> '\\xc3\\xb4\\xc5\\xd6' + + and escapes unicode objects into a sequence of escaped unicode + ids, e.g.: + + '4\\nV\\U00043efa\\x0eMXWB\\x1e\\u3028\\u15fd\\xcd\\U0007d944' + + note: + the obvious "v.decode('unicode-escape')" will return + valid utf-8 unicode if it finds them in bytes, but we + want to return escaped bytes for any byte, even if they match + a utf-8 string. + + """ + if isinstance(val, bytes): + ret = _bytes_to_ascii(val) + else: + ret = val + return ret + + +@attr.s +class _PytestWrapper: + """Dummy wrapper around a function object for internal use only. + + Used to correctly unwrap the underlying function object + when we are creating fixtures, because we wrap the function object ourselves with a decorator + to issue warnings when the fixture function is called directly. + """ + + obj = attr.ib() + + +def get_real_func(obj): + """ gets the real function object of the (possibly) wrapped object by + functools.wraps or functools.partial. + """ + start_obj = obj + for i in range(100): + # __pytest_wrapped__ is set by @pytest.fixture when wrapping the fixture function + # to trigger a warning if it gets called directly instead of by pytest: we don't + # want to unwrap further than this otherwise we lose useful wrappings like @mock.patch (#3774) + new_obj = getattr(obj, "__pytest_wrapped__", None) + if isinstance(new_obj, _PytestWrapper): + obj = new_obj.obj + break + new_obj = getattr(obj, "__wrapped__", None) + if new_obj is None: + break + obj = new_obj + else: + raise ValueError( + ("could not find real function of {start}\nstopped at {current}").format( + start=saferepr(start_obj), current=saferepr(obj) + ) + ) + if isinstance(obj, functools.partial): + obj = obj.func + return obj + + +def get_real_method(obj, holder): + """ + Attempts to obtain the real function object that might be wrapping ``obj``, while at the same time + returning a bound method to ``holder`` if the original object was a bound method. + """ + try: + is_method = hasattr(obj, "__func__") + obj = get_real_func(obj) + except Exception: # pragma: no cover + return obj + if is_method and hasattr(obj, "__get__") and callable(obj.__get__): + obj = obj.__get__(holder) + return obj + + +def getimfunc(func): + try: + return func.__func__ + except AttributeError: + return func + + +def safe_getattr(object: Any, name: str, default: Any) -> Any: + """ Like getattr but return default upon any Exception or any OutcomeException. + + Attribute access can potentially fail for 'evil' Python objects. + See issue #214. + It catches OutcomeException because of #2490 (issue #580), new outcomes are derived from BaseException + instead of Exception (for more details check #2707) + """ + try: + return getattr(object, name, default) + except TEST_OUTCOME: + return default + + +def safe_isclass(obj: object) -> bool: + """Ignore any exception via isinstance on Python 3.""" + try: + return inspect.isclass(obj) + except Exception: + return False + + +COLLECT_FAKEMODULE_ATTRIBUTES = ( + "Collector", + "Module", + "Function", + "Instance", + "Session", + "Item", + "Class", + "File", + "_fillfuncargs", +) + + +def _setup_collect_fakemodule() -> None: + from types import ModuleType + import pytest + + # Types ignored because the module is created dynamically. + pytest.collect = ModuleType("pytest.collect") # type: ignore + pytest.collect.__all__ = [] # type: ignore # used for setns + for attr_name in COLLECT_FAKEMODULE_ATTRIBUTES: + setattr(pytest.collect, attr_name, getattr(pytest, attr_name)) # type: ignore + + +class CaptureIO(io.TextIOWrapper): + def __init__(self) -> None: + super().__init__(io.BytesIO(), encoding="UTF-8", newline="", write_through=True) + + def getvalue(self) -> str: + assert isinstance(self.buffer, io.BytesIO) + return self.buffer.getvalue().decode("UTF-8") + + +class CaptureAndPassthroughIO(CaptureIO): + def __init__(self, other: IO) -> None: + self._other = other + super().__init__() + + def write(self, s) -> int: + super().write(s) + return self._other.write(s) + + +if sys.version_info < (3, 5, 2): + + def overload(f): # noqa: F811 + return f + + +if getattr(attr, "__version_info__", ()) >= (19, 2): + ATTRS_EQ_FIELD = "eq" +else: + ATTRS_EQ_FIELD = "cmp" + + +if sys.version_info >= (3, 8): + from functools import cached_property +else: + + class cached_property(Generic[_S, _T]): + __slots__ = ("func", "__doc__") + + def __init__(self, func: Callable[[_S], _T]) -> None: + self.func = func + self.__doc__ = func.__doc__ + + @overload + def __get__( + self, instance: None, owner: Optional["Type[_S]"] = ... + ) -> "cached_property[_S, _T]": + raise NotImplementedError() + + @overload # noqa: F811 + def __get__( # noqa: F811 + self, instance: _S, owner: Optional["Type[_S]"] = ... + ) -> _T: + raise NotImplementedError() + + def __get__(self, instance, owner=None): # noqa: F811 + if instance is None: + return self + value = instance.__dict__[self.func.__name__] = self.func(instance) + return value diff --git a/contrib/python/pytest/py3/_pytest/config/__init__.py b/contrib/python/pytest/py3/_pytest/config/__init__.py new file mode 100644 index 00000000000..e21b9f1e2b2 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/config/__init__.py @@ -0,0 +1,1232 @@ +""" command line options, ini-file and conftest.py processing. """ +import argparse +import copy +import enum +import inspect +import os +import shlex +import sys +import types +import warnings +from functools import lru_cache +from types import TracebackType +from typing import Any +from typing import Callable +from typing import Dict +from typing import List +from typing import Optional +from typing import Sequence +from typing import Set +from typing import Tuple +from typing import Union + +import attr +import py +from packaging.version import Version +from pluggy import HookimplMarker +from pluggy import HookspecMarker +from pluggy import PluginManager + +import _pytest._code +import _pytest.deprecated +import _pytest.hookspec # the extension point definitions +from .exceptions import PrintHelp +from .exceptions import UsageError +from .findpaths import determine_setup +from .findpaths import exists +from _pytest._code import ExceptionInfo +from _pytest._code import filter_traceback +from _pytest._io import TerminalWriter +from _pytest.compat import importlib_metadata +from _pytest.compat import TYPE_CHECKING +from _pytest.outcomes import fail +from _pytest.outcomes import Skipped +from _pytest.pathlib import Path +from _pytest.store import Store +from _pytest.warning_types import PytestConfigWarning + +if TYPE_CHECKING: + from typing import Type + + from .argparsing import Argument + + +_PluggyPlugin = object +"""A type to represent plugin objects. +Plugins can be any namespace, so we can't narrow it down much, but we use an +alias to make the intent clear. +Ideally this type would be provided by pluggy itself.""" + + +hookimpl = HookimplMarker("pytest") +hookspec = HookspecMarker("pytest") + + +class ExitCode(enum.IntEnum): + """ + .. versionadded:: 5.0 + + Encodes the valid exit codes by pytest. + + Currently users and plugins may supply other exit codes as well. + """ + + #: tests passed + OK = 0 + #: tests failed + TESTS_FAILED = 1 + #: pytest was interrupted + INTERRUPTED = 2 + #: an internal error got in the way + INTERNAL_ERROR = 3 + #: pytest was misused + USAGE_ERROR = 4 + #: pytest couldn't find tests + NO_TESTS_COLLECTED = 5 + + +class ConftestImportFailure(Exception): + def __init__(self, path, excinfo): + Exception.__init__(self, path, excinfo) + self.path = path + self.excinfo = excinfo # type: Tuple[Type[Exception], Exception, TracebackType] + + +def main(args=None, plugins=None) -> Union[int, ExitCode]: + """ return exit code, after performing an in-process test run. + + :arg args: list of command line arguments. + + :arg plugins: list of plugin objects to be auto-registered during + initialization. + """ + try: + try: + config = _prepareconfig(args, plugins) + except ConftestImportFailure as e: + exc_info = ExceptionInfo(e.excinfo) + tw = TerminalWriter(sys.stderr) + tw.line( + "ImportError while loading conftest '{e.path}'.".format(e=e), red=True + ) + exc_info.traceback = exc_info.traceback.filter(filter_traceback) + exc_repr = ( + exc_info.getrepr(style="short", chain=False) + if exc_info.traceback + else exc_info.exconly() + ) + formatted_tb = str(exc_repr) + for line in formatted_tb.splitlines(): + tw.line(line.rstrip(), red=True) + return ExitCode.USAGE_ERROR + else: + try: + ret = config.hook.pytest_cmdline_main( + config=config + ) # type: Union[ExitCode, int] + try: + return ExitCode(ret) + except ValueError: + return ret + finally: + config._ensure_unconfigure() + except UsageError as e: + tw = TerminalWriter(sys.stderr) + for msg in e.args: + tw.line("ERROR: {}\n".format(msg), red=True) + return ExitCode.USAGE_ERROR + + +class cmdline: # compatibility namespace + main = staticmethod(main) + + +def filename_arg(path, optname): + """ Argparse type validator for filename arguments. + + :path: path of filename + :optname: name of the option + """ + if os.path.isdir(path): + raise UsageError("{} must be a filename, given: {}".format(optname, path)) + return path + + +def directory_arg(path, optname): + """Argparse type validator for directory arguments. + + :path: path of directory + :optname: name of the option + """ + if not os.path.isdir(path): + raise UsageError("{} must be a directory, given: {}".format(optname, path)) + return path + + +# Plugins that cannot be disabled via "-p no:X" currently. +essential_plugins = ( + "mark", + "main", + "runner", + "fixtures", + "helpconfig", # Provides -p. +) + +default_plugins = essential_plugins + ( + "python", + "terminal", + "debugging", + "unittest", + "capture", + "skipping", + "tmpdir", + "monkeypatch", + "recwarn", + "pastebin", + "nose", + "assertion", + "junitxml", + "resultlog", + "doctest", + "cacheprovider", + "freeze_support", + "setuponly", + "setupplan", + "stepwise", + "warnings", + "logging", + "reports", + "faulthandler", +) + +builtin_plugins = set(default_plugins) +builtin_plugins.add("pytester") + + +def get_config(args=None, plugins=None): + # subsequent calls to main will create a fresh instance + pluginmanager = PytestPluginManager() + config = Config( + pluginmanager, + invocation_params=Config.InvocationParams( + args=args or (), plugins=plugins, dir=Path().resolve() + ), + ) + + if args is not None: + # Handle any "-p no:plugin" args. + pluginmanager.consider_preparse(args, exclude_only=True) + + for spec in default_plugins: + pluginmanager.import_plugin(spec) + return config + + +def get_plugin_manager(): + """ + Obtain a new instance of the + :py:class:`_pytest.config.PytestPluginManager`, with default plugins + already loaded. + + This function can be used by integration with other tools, like hooking + into pytest to run tests into an IDE. + """ + return get_config().pluginmanager + + +def _prepareconfig( + args: Optional[Union[py.path.local, List[str]]] = None, plugins=None +): + if args is None: + args = sys.argv[1:] + elif isinstance(args, py.path.local): + args = [str(args)] + elif not isinstance(args, list): + msg = "`args` parameter expected to be a list of strings, got: {!r} (type: {})" + raise TypeError(msg.format(args, type(args))) + + config = get_config(args, plugins) + pluginmanager = config.pluginmanager + try: + if plugins: + for plugin in plugins: + if isinstance(plugin, str): + pluginmanager.consider_pluginarg(plugin) + else: + pluginmanager.register(plugin) + return pluginmanager.hook.pytest_cmdline_parse( + pluginmanager=pluginmanager, args=args + ) + except BaseException: + config._ensure_unconfigure() + raise + + +def _fail_on_non_top_pytest_plugins(conftestpath, confcutdir): + msg = ( + "Defining 'pytest_plugins' in a non-top-level conftest is no longer supported:\n" + "It affects the entire test suite instead of just below the conftest as expected.\n" + " {}\n" + "Please move it to a top level conftest file at the rootdir:\n" + " {}\n" + "For more information, visit:\n" + " https://docs.pytest.org/en/latest/deprecations.html#pytest-plugins-in-non-top-level-conftest-files" + ) + fail(msg.format(conftestpath, confcutdir), pytrace=False) + + +class PytestPluginManager(PluginManager): + """ + Overwrites :py:class:`pluggy.PluginManager <pluggy.PluginManager>` to add pytest-specific + functionality: + + * loading plugins from the command line, ``PYTEST_PLUGINS`` env variable and + ``pytest_plugins`` global variables found in plugins being loaded; + * ``conftest.py`` loading during start-up; + """ + + def __init__(self): + import _pytest.assertion + + super().__init__("pytest") + # The objects are module objects, only used generically. + self._conftest_plugins = set() # type: Set[object] + + # state related to local conftest plugins + # Maps a py.path.local to a list of module objects. + self._dirpath2confmods = {} # type: Dict[Any, List[object]] + # Maps a py.path.local to a module object. + self._conftestpath2mod = {} # type: Dict[Any, object] + self._confcutdir = None + self._noconftest = False + # Set of py.path.local's. + self._duplicatepaths = set() # type: Set[Any] + + self.add_hookspecs(_pytest.hookspec) + self.register(self) + if os.environ.get("PYTEST_DEBUG"): + err = sys.stderr + encoding = getattr(err, "encoding", "utf8") + try: + err = py.io.dupfile(err, encoding=encoding) + except Exception: + pass + self.trace.root.setwriter(err.write) + self.enable_tracing() + + # Config._consider_importhook will set a real object if required. + self.rewrite_hook = _pytest.assertion.DummyRewriteHook() + # Used to know when we are importing conftests after the pytest_configure stage + self._configured = False + + def parse_hookimpl_opts(self, plugin, name): + # pytest hooks are always prefixed with pytest_ + # so we avoid accessing possibly non-readable attributes + # (see issue #1073) + if not name.startswith("pytest_"): + return + # ignore names which can not be hooks + if name == "pytest_plugins": + return + + method = getattr(plugin, name) + opts = super().parse_hookimpl_opts(plugin, name) + + # consider only actual functions for hooks (#3775) + if not inspect.isroutine(method): + return + + # collect unmarked hooks as long as they have the `pytest_' prefix + if opts is None and name.startswith("pytest_"): + opts = {} + if opts is not None: + # TODO: DeprecationWarning, people should use hookimpl + # https://github.com/pytest-dev/pytest/issues/4562 + known_marks = {m.name for m in getattr(method, "pytestmark", [])} + + for name in ("tryfirst", "trylast", "optionalhook", "hookwrapper"): + opts.setdefault(name, hasattr(method, name) or name in known_marks) + return opts + + def parse_hookspec_opts(self, module_or_class, name): + opts = super().parse_hookspec_opts(module_or_class, name) + if opts is None: + method = getattr(module_or_class, name) + + if name.startswith("pytest_"): + # todo: deprecate hookspec hacks + # https://github.com/pytest-dev/pytest/issues/4562 + known_marks = {m.name for m in getattr(method, "pytestmark", [])} + opts = { + "firstresult": hasattr(method, "firstresult") + or "firstresult" in known_marks, + "historic": hasattr(method, "historic") + or "historic" in known_marks, + } + return opts + + def register(self, plugin, name=None): + if name in _pytest.deprecated.DEPRECATED_EXTERNAL_PLUGINS: + warnings.warn( + PytestConfigWarning( + "{} plugin has been merged into the core, " + "please remove it from your requirements.".format( + name.replace("_", "-") + ) + ) + ) + return + ret = super().register(plugin, name) + if ret: + self.hook.pytest_plugin_registered.call_historic( + kwargs=dict(plugin=plugin, manager=self) + ) + + if isinstance(plugin, types.ModuleType): + self.consider_module(plugin) + return ret + + def getplugin(self, name): + # support deprecated naming because plugins (xdist e.g.) use it + return self.get_plugin(name) + + def hasplugin(self, name): + """Return True if the plugin with the given name is registered.""" + return bool(self.get_plugin(name)) + + def pytest_configure(self, config): + # XXX now that the pluginmanager exposes hookimpl(tryfirst...) + # we should remove tryfirst/trylast as markers + config.addinivalue_line( + "markers", + "tryfirst: mark a hook implementation function such that the " + "plugin machinery will try to call it first/as early as possible.", + ) + config.addinivalue_line( + "markers", + "trylast: mark a hook implementation function such that the " + "plugin machinery will try to call it last/as late as possible.", + ) + self._configured = True + + # + # internal API for local conftest plugin handling + # + def _set_initial_conftests(self, namespace): + """ load initial conftest files given a preparsed "namespace". + As conftest files may add their own command line options + which have arguments ('--my-opt somepath') we might get some + false positives. All builtin and 3rd party plugins will have + been loaded, however, so common options will not confuse our logic + here. + """ + current = py.path.local() + self._confcutdir = ( + current.join(namespace.confcutdir, abs=True) + if namespace.confcutdir + else None + ) + self._noconftest = namespace.noconftest + self._using_pyargs = namespace.pyargs + testpaths = namespace.file_or_dir + foundanchor = False + for path in testpaths: + path = str(path) + # remove node-id syntax + i = path.find("::") + if i != -1: + path = path[:i] + anchor = current.join(path, abs=1) + if exists(anchor): # we found some file object + self._try_load_conftest(anchor) + foundanchor = True + if not foundanchor: + self._try_load_conftest(current) + + def _try_load_conftest(self, anchor): + self._getconftestmodules(anchor) + # let's also consider test* subdirs + if anchor.check(dir=1): + for x in anchor.listdir("test*"): + if x.check(dir=1): + self._getconftestmodules(x) + + @lru_cache(maxsize=128) + def _getconftestmodules(self, path): + if self._noconftest: + return [] + + if path.isfile(): + directory = path.dirpath() + else: + directory = path + + # XXX these days we may rather want to use config.rootdir + # and allow users to opt into looking into the rootdir parent + # directories instead of requiring to specify confcutdir + clist = [] + for parent in directory.realpath().parts(): + if self._confcutdir and self._confcutdir.relto(parent): + continue + conftestpath = parent.join("conftest.py") + if conftestpath.isfile(): + mod = self._importconftest(conftestpath) + clist.append(mod) + self._dirpath2confmods[directory] = clist + return clist + + def _rget_with_confmod(self, name, path): + modules = self._getconftestmodules(path) + for mod in reversed(modules): + try: + return mod, getattr(mod, name) + except AttributeError: + continue + raise KeyError(name) + + def _importconftest(self, conftestpath): + # Use a resolved Path object as key to avoid loading the same conftest twice + # with build systems that create build directories containing + # symlinks to actual files. + # Using Path().resolve() is better than py.path.realpath because + # it resolves to the correct path/drive in case-insensitive file systems (#5792) + key = Path(str(conftestpath)).resolve() + try: + return self._conftestpath2mod[key] + except KeyError: + pkgpath = conftestpath.pypkgpath() + if pkgpath is None: + _ensure_removed_sysmodule(conftestpath.purebasename) + try: + mod = conftestpath.pyimport() + if ( + hasattr(mod, "pytest_plugins") + and self._configured + and not self._using_pyargs + ): + _fail_on_non_top_pytest_plugins(conftestpath, self._confcutdir) + except Exception: + raise ConftestImportFailure(conftestpath, sys.exc_info()) + + self._conftest_plugins.add(mod) + self._conftestpath2mod[key] = mod + dirpath = conftestpath.dirpath() + if dirpath in self._dirpath2confmods: + for path, mods in self._dirpath2confmods.items(): + if path and path.relto(dirpath) or path == dirpath: + assert mod not in mods + mods.append(mod) + self.trace("loading conftestmodule {!r}".format(mod)) + self.consider_conftest(mod) + return mod + + # + # API for bootstrapping plugin loading + # + # + + def consider_preparse(self, args, *, exclude_only=False): + i = 0 + n = len(args) + while i < n: + opt = args[i] + i += 1 + if isinstance(opt, str): + if opt == "-p": + try: + parg = args[i] + except IndexError: + return + i += 1 + elif opt.startswith("-p"): + parg = opt[2:] + else: + continue + if exclude_only and not parg.startswith("no:"): + continue + self.consider_pluginarg(parg) + + def consider_pluginarg(self, arg): + if arg.startswith("no:"): + name = arg[3:] + if name in essential_plugins: + raise UsageError("plugin %s cannot be disabled" % name) + + # PR #4304 : remove stepwise if cacheprovider is blocked + if name == "cacheprovider": + self.set_blocked("stepwise") + self.set_blocked("pytest_stepwise") + + self.set_blocked(name) + if not name.startswith("pytest_"): + self.set_blocked("pytest_" + name) + else: + name = arg + # Unblock the plugin. None indicates that it has been blocked. + # There is no interface with pluggy for this. + if self._name2plugin.get(name, -1) is None: + del self._name2plugin[name] + if not name.startswith("pytest_"): + if self._name2plugin.get("pytest_" + name, -1) is None: + del self._name2plugin["pytest_" + name] + self.import_plugin(arg, consider_entry_points=True) + + def consider_conftest(self, conftestmodule): + self.register(conftestmodule, name=conftestmodule.__file__) + + def consider_env(self): + self._import_plugin_specs(os.environ.get("PYTEST_PLUGINS")) + + def consider_module(self, mod): + self._import_plugin_specs(getattr(mod, "pytest_plugins", [])) + + def _import_plugin_specs(self, spec): + plugins = _get_plugin_specs_as_list(spec) + for import_spec in plugins: + self.import_plugin(import_spec) + + def import_plugin(self, modname, consider_entry_points=False): + """ + Imports a plugin with ``modname``. If ``consider_entry_points`` is True, entry point + names are also considered to find a plugin. + """ + # most often modname refers to builtin modules, e.g. "pytester", + # "terminal" or "capture". Those plugins are registered under their + # basename for historic purposes but must be imported with the + # _pytest prefix. + assert isinstance(modname, str), ( + "module name as text required, got %r" % modname + ) + modname = str(modname) + if self.is_blocked(modname) or self.get_plugin(modname) is not None: + return + + importspec = "_pytest." + modname if modname in builtin_plugins else modname + self.rewrite_hook.mark_rewrite(importspec) + + if consider_entry_points: + loaded = self.load_setuptools_entrypoints("pytest11", name=modname) + if loaded: + return + + try: + __import__(importspec) + except ImportError as e: + raise ImportError( + 'Error importing plugin "{}": {}'.format(modname, str(e.args[0])) + ).with_traceback(e.__traceback__) + + except Skipped as e: + from _pytest.warnings import _issue_warning_captured + + _issue_warning_captured( + PytestConfigWarning("skipped plugin {!r}: {}".format(modname, e.msg)), + self.hook, + stacklevel=2, + ) + else: + mod = sys.modules[importspec] + self.register(mod, modname) + + +def _get_plugin_specs_as_list(specs): + """ + Parses a list of "plugin specs" and returns a list of plugin names. + + Plugin specs can be given as a list of strings separated by "," or already as a list/tuple in + which case it is returned as a list. Specs can also be `None` in which case an + empty list is returned. + """ + if specs is not None and not isinstance(specs, types.ModuleType): + if isinstance(specs, str): + specs = specs.split(",") if specs else [] + if not isinstance(specs, (list, tuple)): + raise UsageError( + "Plugin specs must be a ','-separated string or a " + "list/tuple of strings for plugin names. Given: %r" % specs + ) + return list(specs) + return [] + + +def _ensure_removed_sysmodule(modname): + try: + del sys.modules[modname] + except KeyError: + pass + + +class Notset: + def __repr__(self): + return "<NOTSET>" + + +notset = Notset() + + +def _iter_rewritable_modules(package_files): + """ + Given an iterable of file names in a source distribution, return the "names" that should + be marked for assertion rewrite (for example the package "pytest_mock/__init__.py" should + be added as "pytest_mock" in the assertion rewrite mechanism. + + This function has to deal with dist-info based distributions and egg based distributions + (which are still very much in use for "editable" installs). + + Here are the file names as seen in a dist-info based distribution: + + pytest_mock/__init__.py + pytest_mock/_version.py + pytest_mock/plugin.py + pytest_mock.egg-info/PKG-INFO + + Here are the file names as seen in an egg based distribution: + + src/pytest_mock/__init__.py + src/pytest_mock/_version.py + src/pytest_mock/plugin.py + src/pytest_mock.egg-info/PKG-INFO + LICENSE + setup.py + + We have to take in account those two distribution flavors in order to determine which + names should be considered for assertion rewriting. + + More information: + https://github.com/pytest-dev/pytest-mock/issues/167 + """ + package_files = list(package_files) + seen_some = False + for fn in package_files: + is_simple_module = "/" not in fn and fn.endswith(".py") + is_package = fn.count("/") == 1 and fn.endswith("__init__.py") + if is_simple_module: + module_name, _ = os.path.splitext(fn) + # we ignore "setup.py" at the root of the distribution + if module_name != "setup": + seen_some = True + yield module_name + elif is_package: + package_name = os.path.dirname(fn) + seen_some = True + yield package_name + + if not seen_some: + # at this point we did not find any packages or modules suitable for assertion + # rewriting, so we try again by stripping the first path component (to account for + # "src" based source trees for example) + # this approach lets us have the common case continue to be fast, as egg-distributions + # are rarer + new_package_files = [] + for fn in package_files: + parts = fn.split("/") + new_fn = "/".join(parts[1:]) + if new_fn: + new_package_files.append(new_fn) + if new_package_files: + yield from _iter_rewritable_modules(new_package_files) + + +class Config: + """ + Access to configuration values, pluginmanager and plugin hooks. + + :ivar PytestPluginManager pluginmanager: the plugin manager handles plugin registration and hook invocation. + + :ivar argparse.Namespace option: access to command line option as attributes. + + :ivar InvocationParams invocation_params: + + Object containing the parameters regarding the ``pytest.main`` + invocation. + + Contains the following read-only attributes: + + * ``args``: tuple of command-line arguments as passed to ``pytest.main()``. + * ``plugins``: list of extra plugins, might be None. + * ``dir``: directory where ``pytest.main()`` was invoked from. + """ + + @attr.s(frozen=True) + class InvocationParams: + """Holds parameters passed during ``pytest.main()`` + + .. versionadded:: 5.1 + + .. note:: + + Note that the environment variable ``PYTEST_ADDOPTS`` and the ``addopts`` + ini option are handled by pytest, not being included in the ``args`` attribute. + + Plugins accessing ``InvocationParams`` must be aware of that. + """ + + args = attr.ib(converter=tuple) + plugins = attr.ib() + dir = attr.ib(type=Path) + + def __init__(self, pluginmanager, *, invocation_params=None) -> None: + from .argparsing import Parser, FILE_OR_DIR + + if invocation_params is None: + invocation_params = self.InvocationParams( + args=(), plugins=None, dir=Path().resolve() + ) + + self.option = argparse.Namespace() + self.invocation_params = invocation_params + + _a = FILE_OR_DIR + self._parser = Parser( + usage="%(prog)s [options] [{}] [{}] [...]".format(_a, _a), + processopt=self._processopt, + ) + self.pluginmanager = pluginmanager + self.trace = self.pluginmanager.trace.root.get("config") + self.hook = self.pluginmanager.hook + self._inicache = {} # type: Dict[str, Any] + self._override_ini = () # type: Sequence[str] + self._opt2dest = {} # type: Dict[str, str] + self._cleanup = [] # type: List[Callable[[], None]] + # A place where plugins can store information on the config for their + # own use. Currently only intended for internal plugins. + self._store = Store() + self.pluginmanager.register(self, "pytestconfig") + self._configured = False + self.hook.pytest_addoption.call_historic( + kwargs=dict(parser=self._parser, pluginmanager=self.pluginmanager) + ) + + if TYPE_CHECKING: + from _pytest.cacheprovider import Cache + + self.cache = None # type: Optional[Cache] + + @property + def invocation_dir(self): + """Backward compatibility""" + return py.path.local(str(self.invocation_params.dir)) + + def add_cleanup(self, func): + """ Add a function to be called when the config object gets out of + use (usually coninciding with pytest_unconfigure).""" + self._cleanup.append(func) + + def _do_configure(self): + assert not self._configured + self._configured = True + with warnings.catch_warnings(): + warnings.simplefilter("default") + self.hook.pytest_configure.call_historic(kwargs=dict(config=self)) + + def _ensure_unconfigure(self): + if self._configured: + self._configured = False + self.hook.pytest_unconfigure(config=self) + self.hook.pytest_configure._call_history = [] + while self._cleanup: + fin = self._cleanup.pop() + fin() + + def get_terminal_writer(self): + return self.pluginmanager.get_plugin("terminalreporter")._tw + + def pytest_cmdline_parse(self, pluginmanager, args): + try: + self.parse(args) + except UsageError: + + # Handle --version and --help here in a minimal fashion. + # This gets done via helpconfig normally, but its + # pytest_cmdline_main is not called in case of errors. + if getattr(self.option, "version", False) or "--version" in args: + from _pytest.helpconfig import showversion + + showversion(self) + elif ( + getattr(self.option, "help", False) or "--help" in args or "-h" in args + ): + self._parser._getparser().print_help() + sys.stdout.write( + "\nNOTE: displaying only minimal help due to UsageError.\n\n" + ) + + raise + + return self + + def notify_exception(self, excinfo, option=None): + if option and getattr(option, "fulltrace", False): + style = "long" + else: + style = "native" + excrepr = excinfo.getrepr( + funcargs=True, showlocals=getattr(option, "showlocals", False), style=style + ) + res = self.hook.pytest_internalerror(excrepr=excrepr, excinfo=excinfo) + if not any(res): + for line in str(excrepr).split("\n"): + sys.stderr.write("INTERNALERROR> %s\n" % line) + sys.stderr.flush() + + def cwd_relative_nodeid(self, nodeid): + # nodeid's are relative to the rootpath, compute relative to cwd + if self.invocation_dir != self.rootdir: + fullpath = self.rootdir.join(nodeid) + nodeid = self.invocation_dir.bestrelpath(fullpath) + return nodeid + + @classmethod + def fromdictargs(cls, option_dict, args): + """ constructor usable for subprocesses. """ + config = get_config(args) + config.option.__dict__.update(option_dict) + config.parse(args, addopts=False) + for x in config.option.plugins: + config.pluginmanager.consider_pluginarg(x) + return config + + def _processopt(self, opt: "Argument") -> None: + for name in opt._short_opts + opt._long_opts: + self._opt2dest[name] = opt.dest + + if hasattr(opt, "default"): + if not hasattr(self.option, opt.dest): + setattr(self.option, opt.dest, opt.default) + + @hookimpl(trylast=True) + def pytest_load_initial_conftests(self, early_config): + self.pluginmanager._set_initial_conftests(early_config.known_args_namespace) + + def _initini(self, args: Sequence[str]) -> None: + ns, unknown_args = self._parser.parse_known_and_unknown_args( + args, namespace=copy.copy(self.option) + ) + r = determine_setup( + ns.inifilename, + ns.file_or_dir + unknown_args, + rootdir_cmd_arg=ns.rootdir or None, + config=self, + ) + self.rootdir, self.inifile, self.inicfg = r + self._parser.extra_info["rootdir"] = self.rootdir + self._parser.extra_info["inifile"] = self.inifile + self._parser.addini("addopts", "extra command line options", "args") + self._parser.addini("minversion", "minimally required pytest version") + self._override_ini = ns.override_ini or () + + def _consider_importhook(self, args: Sequence[str]) -> None: + """Install the PEP 302 import hook if using assertion rewriting. + + Needs to parse the --assert=<mode> option from the commandline + and find all the installed plugins to mark them for rewriting + by the importhook. + """ + ns, unknown_args = self._parser.parse_known_and_unknown_args(args) + mode = getattr(ns, "assertmode", "plain") + if mode == "rewrite": + import _pytest.assertion + + try: + hook = _pytest.assertion.install_importhook(self) + except SystemError: + mode = "plain" + else: + self._mark_plugins_for_rewrite(hook) + _warn_about_missing_assertion(mode) + + def _mark_plugins_for_rewrite(self, hook): + """ + Given an importhook, mark for rewrite any top-level + modules or packages in the distribution package for + all pytest plugins. + """ + self.pluginmanager.rewrite_hook = hook + + if os.environ.get("PYTEST_DISABLE_PLUGIN_AUTOLOAD"): + # We don't autoload from setuptools entry points, no need to continue. + return + + package_files = ( + str(file) + for dist in importlib_metadata.distributions() + if any(ep.group == "pytest11" for ep in dist.entry_points) + for file in dist.files or [] + ) + + for name in _iter_rewritable_modules(package_files): + hook.mark_rewrite(name) + + def _validate_args(self, args: List[str], via: str) -> List[str]: + """Validate known args.""" + self._parser._config_source_hint = via # type: ignore + try: + self._parser.parse_known_and_unknown_args( + args, namespace=copy.copy(self.option) + ) + finally: + del self._parser._config_source_hint # type: ignore + + return args + + def _preparse(self, args: List[str], addopts: bool = True) -> None: + if addopts: + env_addopts = os.environ.get("PYTEST_ADDOPTS", "") + if len(env_addopts): + args[:] = ( + self._validate_args(shlex.split(env_addopts), "via PYTEST_ADDOPTS") + + args + ) + self._initini(args) + if addopts: + args[:] = ( + self._validate_args(self.getini("addopts"), "via addopts config") + args + ) + + self._checkversion() + self._consider_importhook(args) + self.pluginmanager.consider_preparse(args, exclude_only=False) + if not os.environ.get("PYTEST_DISABLE_PLUGIN_AUTOLOAD"): + # Don't autoload from setuptools entry point. Only explicitly specified + # plugins are going to be loaded. + self.pluginmanager.load_setuptools_entrypoints("pytest11") + self.pluginmanager.consider_env() + self.known_args_namespace = ns = self._parser.parse_known_args( + args, namespace=copy.copy(self.option) + ) + if self.known_args_namespace.confcutdir is None and self.inifile: + confcutdir = py.path.local(self.inifile).dirname + self.known_args_namespace.confcutdir = confcutdir + try: + self.hook.pytest_load_initial_conftests( + early_config=self, args=args, parser=self._parser + ) + except ConftestImportFailure as e: + if ns.help or ns.version: + # we don't want to prevent --help/--version to work + # so just let is pass and print a warning at the end + from _pytest.warnings import _issue_warning_captured + + _issue_warning_captured( + PytestConfigWarning( + "could not load initial conftests: {}".format(e.path) + ), + self.hook, + stacklevel=2, + ) + else: + raise + + def _checkversion(self): + import pytest + + minver = self.inicfg.get("minversion", None) + if minver: + if Version(minver) > Version(pytest.__version__): + raise pytest.UsageError( + "%s:%d: requires pytest-%s, actual pytest-%s'" + % ( + self.inicfg.config.path, + self.inicfg.lineof("minversion"), + minver, + pytest.__version__, + ) + ) + + def parse(self, args: List[str], addopts: bool = True) -> None: + # parse given cmdline arguments into this config object. + assert not hasattr( + self, "args" + ), "can only parse cmdline args at most once per Config object" + self.hook.pytest_addhooks.call_historic( + kwargs=dict(pluginmanager=self.pluginmanager) + ) + self._preparse(args, addopts=addopts) + # XXX deprecated hook: + self.hook.pytest_cmdline_preparse(config=self, args=args) + self._parser.after_preparse = True # type: ignore + try: + args = self._parser.parse_setoption( + args, self.option, namespace=self.option + ) + if not args: + if self.invocation_dir == self.rootdir: + args = self.getini("testpaths") + if not args: + args = [str(self.invocation_dir)] + self.args = args + except PrintHelp: + pass + + def addinivalue_line(self, name, line): + """ add a line to an ini-file option. The option must have been + declared but might not yet be set in which case the line becomes the + the first line in its value. """ + x = self.getini(name) + assert isinstance(x, list) + x.append(line) # modifies the cached list inline + + def getini(self, name: str): + """ return configuration value from an :ref:`ini file <inifiles>`. If the + specified name hasn't been registered through a prior + :py:func:`parser.addini <_pytest.config.argparsing.Parser.addini>` + call (usually from a plugin), a ValueError is raised. """ + try: + return self._inicache[name] + except KeyError: + self._inicache[name] = val = self._getini(name) + return val + + def _getini(self, name: str) -> Any: + try: + description, type, default = self._parser._inidict[name] + except KeyError: + raise ValueError("unknown configuration value: {!r}".format(name)) + value = self._get_override_ini_value(name) + if value is None: + try: + value = self.inicfg[name] + except KeyError: + if default is not None: + return default + if type is None: + return "" + return [] + if type == "pathlist": + dp = py.path.local(self.inicfg.config.path).dirpath() + values = [] + for relpath in shlex.split(value): + values.append(dp.join(relpath, abs=True)) + return values + elif type == "args": + return shlex.split(value) + elif type == "linelist": + return [t for t in map(lambda x: x.strip(), value.split("\n")) if t] + elif type == "bool": + return bool(_strtobool(value.strip())) + else: + assert type is None + return value + + def _getconftest_pathlist(self, name, path): + try: + mod, relroots = self.pluginmanager._rget_with_confmod(name, path) + except KeyError: + return None + modpath = py.path.local(mod.__file__).dirpath() + values = [] + for relroot in relroots: + if not isinstance(relroot, py.path.local): + relroot = relroot.replace("/", py.path.local.sep) + relroot = modpath.join(relroot, abs=True) + values.append(relroot) + return values + + def _get_override_ini_value(self, name: str) -> Optional[str]: + value = None + # override_ini is a list of "ini=value" options + # always use the last item if multiple values are set for same ini-name, + # e.g. -o foo=bar1 -o foo=bar2 will set foo to bar2 + for ini_config in self._override_ini: + try: + key, user_ini_value = ini_config.split("=", 1) + except ValueError: + raise UsageError( + "-o/--override-ini expects option=value style (got: {!r}).".format( + ini_config + ) + ) + else: + if key == name: + value = user_ini_value + return value + + def getoption(self, name: str, default=notset, skip: bool = False): + """ return command line option value. + + :arg name: name of the option. You may also specify + the literal ``--OPT`` option instead of the "dest" option name. + :arg default: default value if no option of that name exists. + :arg skip: if True raise pytest.skip if option does not exists + or has a None value. + """ + name = self._opt2dest.get(name, name) + try: + val = getattr(self.option, name) + if val is None and skip: + raise AttributeError(name) + return val + except AttributeError: + if default is not notset: + return default + if skip: + import pytest + + pytest.skip("no {!r} option found".format(name)) + raise ValueError("no option named {!r}".format(name)) + + def getvalue(self, name, path=None): + """ (deprecated, use getoption()) """ + return self.getoption(name) + + def getvalueorskip(self, name, path=None): + """ (deprecated, use getoption(skip=True)) """ + return self.getoption(name, skip=True) + + +def _assertion_supported(): + try: + assert False + except AssertionError: + return True + else: + return False + + +def _warn_about_missing_assertion(mode): + if not _assertion_supported(): + if mode == "plain": + sys.stderr.write( + "WARNING: ASSERTIONS ARE NOT EXECUTED" + " and FAILING TESTS WILL PASS. Are you" + " using python -O?" + ) + else: + sys.stderr.write( + "WARNING: assertions not in test modules or" + " plugins will be ignored" + " because assert statements are not executed " + "by the underlying Python interpreter " + "(are you using python -O?)\n" + ) + + +def create_terminal_writer(config: Config, *args, **kwargs) -> TerminalWriter: + """Create a TerminalWriter instance configured according to the options + in the config object. Every code which requires a TerminalWriter object + and has access to a config object should use this function. + """ + tw = TerminalWriter(*args, **kwargs) + if config.option.color == "yes": + tw.hasmarkup = True + if config.option.color == "no": + tw.hasmarkup = False + return tw + + +def _strtobool(val): + """Convert a string representation of truth to true (1) or false (0). + + True values are 'y', 'yes', 't', 'true', 'on', and '1'; false values + are 'n', 'no', 'f', 'false', 'off', and '0'. Raises ValueError if + 'val' is anything else. + + .. note:: copied from distutils.util + """ + val = val.lower() + if val in ("y", "yes", "t", "true", "on", "1"): + return 1 + elif val in ("n", "no", "f", "false", "off", "0"): + return 0 + else: + raise ValueError("invalid truth value {!r}".format(val)) diff --git a/contrib/python/pytest/py3/_pytest/config/argparsing.py b/contrib/python/pytest/py3/_pytest/config/argparsing.py new file mode 100644 index 00000000000..140e04e9723 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/config/argparsing.py @@ -0,0 +1,510 @@ +import argparse +import sys +import warnings +from gettext import gettext +from typing import Any +from typing import Callable +from typing import cast +from typing import Dict +from typing import List +from typing import Mapping +from typing import Optional +from typing import Sequence +from typing import Tuple +from typing import Union + +import py + +from _pytest.compat import TYPE_CHECKING +from _pytest.config.exceptions import UsageError + +if TYPE_CHECKING: + from typing import NoReturn + from typing_extensions import Literal # noqa: F401 + +FILE_OR_DIR = "file_or_dir" + + +class Parser: + """ Parser for command line arguments and ini-file values. + + :ivar extra_info: dict of generic param -> value to display in case + there's an error processing the command line arguments. + """ + + prog = None # type: Optional[str] + + def __init__( + self, + usage: Optional[str] = None, + processopt: Optional[Callable[["Argument"], None]] = None, + ) -> None: + self._anonymous = OptionGroup("custom options", parser=self) + self._groups = [] # type: List[OptionGroup] + self._processopt = processopt + self._usage = usage + self._inidict = {} # type: Dict[str, Tuple[str, Optional[str], Any]] + self._ininames = [] # type: List[str] + self.extra_info = {} # type: Dict[str, Any] + + def processoption(self, option: "Argument") -> None: + if self._processopt: + if option.dest: + self._processopt(option) + + def getgroup( + self, name: str, description: str = "", after: Optional[str] = None + ) -> "OptionGroup": + """ get (or create) a named option Group. + + :name: name of the option group. + :description: long description for --help output. + :after: name of other group, used for ordering --help output. + + The returned group object has an ``addoption`` method with the same + signature as :py:func:`parser.addoption + <_pytest.config.argparsing.Parser.addoption>` but will be shown in the + respective group in the output of ``pytest. --help``. + """ + for group in self._groups: + if group.name == name: + return group + group = OptionGroup(name, description, parser=self) + i = 0 + for i, grp in enumerate(self._groups): + if grp.name == after: + break + self._groups.insert(i + 1, group) + return group + + def addoption(self, *opts: str, **attrs: Any) -> None: + """ register a command line option. + + :opts: option names, can be short or long options. + :attrs: same attributes which the ``add_argument()`` function of the + `argparse library + <https://docs.python.org/library/argparse.html>`_ + accepts. + + After command line parsing options are available on the pytest config + object via ``config.option.NAME`` where ``NAME`` is usually set + by passing a ``dest`` attribute, for example + ``addoption("--long", dest="NAME", ...)``. + """ + self._anonymous.addoption(*opts, **attrs) + + def parse( + self, + args: Sequence[Union[str, py.path.local]], + namespace: Optional[argparse.Namespace] = None, + ) -> argparse.Namespace: + from _pytest._argcomplete import try_argcomplete + + self.optparser = self._getparser() + try_argcomplete(self.optparser) + strargs = [str(x) if isinstance(x, py.path.local) else x for x in args] + return self.optparser.parse_args(strargs, namespace=namespace) + + def _getparser(self) -> "MyOptionParser": + from _pytest._argcomplete import filescompleter + + optparser = MyOptionParser(self, self.extra_info, prog=self.prog) + groups = self._groups + [self._anonymous] + for group in groups: + if group.options: + desc = group.description or group.name + arggroup = optparser.add_argument_group(desc) + for option in group.options: + n = option.names() + a = option.attrs() + arggroup.add_argument(*n, **a) + file_or_dir_arg = optparser.add_argument(FILE_OR_DIR, nargs="*") + # bash like autocompletion for dirs (appending '/') + # Type ignored because typeshed doesn't know about argcomplete. + file_or_dir_arg.completer = filescompleter # type: ignore + return optparser + + def parse_setoption( + self, + args: Sequence[Union[str, py.path.local]], + option: argparse.Namespace, + namespace: Optional[argparse.Namespace] = None, + ) -> List[str]: + parsedoption = self.parse(args, namespace=namespace) + for name, value in parsedoption.__dict__.items(): + setattr(option, name, value) + return cast(List[str], getattr(parsedoption, FILE_OR_DIR)) + + def parse_known_args( + self, + args: Sequence[Union[str, py.path.local]], + namespace: Optional[argparse.Namespace] = None, + ) -> argparse.Namespace: + """parses and returns a namespace object with known arguments at this + point. + """ + return self.parse_known_and_unknown_args(args, namespace=namespace)[0] + + def parse_known_and_unknown_args( + self, + args: Sequence[Union[str, py.path.local]], + namespace: Optional[argparse.Namespace] = None, + ) -> Tuple[argparse.Namespace, List[str]]: + """parses and returns a namespace object with known arguments, and + the remaining arguments unknown at this point. + """ + optparser = self._getparser() + strargs = [str(x) if isinstance(x, py.path.local) else x for x in args] + return optparser.parse_known_args(strargs, namespace=namespace) + + def addini( + self, + name: str, + help: str, + type: Optional["Literal['pathlist', 'args', 'linelist', 'bool']"] = None, + default=None, + ) -> None: + """ register an ini-file option. + + :name: name of the ini-variable + :type: type of the variable, can be ``pathlist``, ``args``, ``linelist`` + or ``bool``. + :default: default value if no ini-file option exists but is queried. + + The value of ini-variables can be retrieved via a call to + :py:func:`config.getini(name) <_pytest.config.Config.getini>`. + """ + assert type in (None, "pathlist", "args", "linelist", "bool") + self._inidict[name] = (help, type, default) + self._ininames.append(name) + + +class ArgumentError(Exception): + """ + Raised if an Argument instance is created with invalid or + inconsistent arguments. + """ + + def __init__(self, msg: str, option: Union["Argument", str]) -> None: + self.msg = msg + self.option_id = str(option) + + def __str__(self) -> str: + if self.option_id: + return "option {}: {}".format(self.option_id, self.msg) + else: + return self.msg + + +class Argument: + """class that mimics the necessary behaviour of optparse.Option + + it's currently a least effort implementation + and ignoring choices and integer prefixes + https://docs.python.org/3/library/optparse.html#optparse-standard-option-types + """ + + _typ_map = {"int": int, "string": str, "float": float, "complex": complex} + + def __init__(self, *names: str, **attrs: Any) -> None: + """store parms in private vars for use in add_argument""" + self._attrs = attrs + self._short_opts = [] # type: List[str] + self._long_opts = [] # type: List[str] + if "%default" in (attrs.get("help") or ""): + warnings.warn( + 'pytest now uses argparse. "%default" should be' + ' changed to "%(default)s" ', + DeprecationWarning, + stacklevel=3, + ) + try: + typ = attrs["type"] + except KeyError: + pass + else: + # this might raise a keyerror as well, don't want to catch that + if isinstance(typ, str): + if typ == "choice": + warnings.warn( + "`type` argument to addoption() is the string %r." + " For choices this is optional and can be omitted, " + " but when supplied should be a type (for example `str` or `int`)." + " (options: %s)" % (typ, names), + DeprecationWarning, + stacklevel=4, + ) + # argparse expects a type here take it from + # the type of the first element + attrs["type"] = type(attrs["choices"][0]) + else: + warnings.warn( + "`type` argument to addoption() is the string %r, " + " but when supplied should be a type (for example `str` or `int`)." + " (options: %s)" % (typ, names), + DeprecationWarning, + stacklevel=4, + ) + attrs["type"] = Argument._typ_map[typ] + # used in test_parseopt -> test_parse_defaultgetter + self.type = attrs["type"] + else: + self.type = typ + try: + # attribute existence is tested in Config._processopt + self.default = attrs["default"] + except KeyError: + pass + self._set_opt_strings(names) + dest = attrs.get("dest") # type: Optional[str] + if dest: + self.dest = dest + elif self._long_opts: + self.dest = self._long_opts[0][2:].replace("-", "_") + else: + try: + self.dest = self._short_opts[0][1:] + except IndexError: + self.dest = "???" # Needed for the error repr. + raise ArgumentError("need a long or short option", self) + + def names(self) -> List[str]: + return self._short_opts + self._long_opts + + def attrs(self) -> Mapping[str, Any]: + # update any attributes set by processopt + attrs = "default dest help".split() + attrs.append(self.dest) + for attr in attrs: + try: + self._attrs[attr] = getattr(self, attr) + except AttributeError: + pass + if self._attrs.get("help"): + a = self._attrs["help"] + a = a.replace("%default", "%(default)s") + # a = a.replace('%prog', '%(prog)s') + self._attrs["help"] = a + return self._attrs + + def _set_opt_strings(self, opts: Sequence[str]) -> None: + """directly from optparse + + might not be necessary as this is passed to argparse later on""" + for opt in opts: + if len(opt) < 2: + raise ArgumentError( + "invalid option string %r: " + "must be at least two characters long" % opt, + self, + ) + elif len(opt) == 2: + if not (opt[0] == "-" and opt[1] != "-"): + raise ArgumentError( + "invalid short option string %r: " + "must be of the form -x, (x any non-dash char)" % opt, + self, + ) + self._short_opts.append(opt) + else: + if not (opt[0:2] == "--" and opt[2] != "-"): + raise ArgumentError( + "invalid long option string %r: " + "must start with --, followed by non-dash" % opt, + self, + ) + self._long_opts.append(opt) + + def __repr__(self) -> str: + args = [] # type: List[str] + if self._short_opts: + args += ["_short_opts: " + repr(self._short_opts)] + if self._long_opts: + args += ["_long_opts: " + repr(self._long_opts)] + args += ["dest: " + repr(self.dest)] + if hasattr(self, "type"): + args += ["type: " + repr(self.type)] + if hasattr(self, "default"): + args += ["default: " + repr(self.default)] + return "Argument({})".format(", ".join(args)) + + +class OptionGroup: + def __init__( + self, name: str, description: str = "", parser: Optional[Parser] = None + ) -> None: + self.name = name + self.description = description + self.options = [] # type: List[Argument] + self.parser = parser + + def addoption(self, *optnames: str, **attrs: Any) -> None: + """ add an option to this group. + + if a shortened version of a long option is specified it will + be suppressed in the help. addoption('--twowords', '--two-words') + results in help showing '--two-words' only, but --twowords gets + accepted **and** the automatic destination is in args.twowords + """ + conflict = set(optnames).intersection( + name for opt in self.options for name in opt.names() + ) + if conflict: + raise ValueError("option names %s already added" % conflict) + option = Argument(*optnames, **attrs) + self._addoption_instance(option, shortupper=False) + + def _addoption(self, *optnames: str, **attrs: Any) -> None: + option = Argument(*optnames, **attrs) + self._addoption_instance(option, shortupper=True) + + def _addoption_instance(self, option: "Argument", shortupper: bool = False) -> None: + if not shortupper: + for opt in option._short_opts: + if opt[0] == "-" and opt[1].islower(): + raise ValueError("lowercase shortoptions reserved") + if self.parser: + self.parser.processoption(option) + self.options.append(option) + + +class MyOptionParser(argparse.ArgumentParser): + def __init__( + self, + parser: Parser, + extra_info: Optional[Dict[str, Any]] = None, + prog: Optional[str] = None, + ) -> None: + self._parser = parser + argparse.ArgumentParser.__init__( + self, + prog=prog, + usage=parser._usage, + add_help=False, + formatter_class=DropShorterLongHelpFormatter, + allow_abbrev=False, + ) + # extra_info is a dict of (param -> value) to display if there's + # an usage error to provide more contextual information to the user + self.extra_info = extra_info if extra_info else {} + + def error(self, message: str) -> "NoReturn": + """Transform argparse error message into UsageError.""" + msg = "{}: error: {}".format(self.prog, message) + + if hasattr(self._parser, "_config_source_hint"): + # Type ignored because the attribute is set dynamically. + msg = "{} ({})".format(msg, self._parser._config_source_hint) # type: ignore + + raise UsageError(self.format_usage() + msg) + + # Type ignored because typeshed has a very complex type in the superclass. + def parse_args( # type: ignore + self, + args: Optional[Sequence[str]] = None, + namespace: Optional[argparse.Namespace] = None, + ) -> argparse.Namespace: + """allow splitting of positional arguments""" + parsed, unrecognized = self.parse_known_args(args, namespace) + if unrecognized: + for arg in unrecognized: + if arg and arg[0] == "-": + lines = ["unrecognized arguments: %s" % (" ".join(unrecognized))] + for k, v in sorted(self.extra_info.items()): + lines.append(" {}: {}".format(k, v)) + self.error("\n".join(lines)) + getattr(parsed, FILE_OR_DIR).extend(unrecognized) + return parsed + + if sys.version_info[:2] < (3, 9): # pragma: no cover + # Backport of https://github.com/python/cpython/pull/14316 so we can + # disable long --argument abbreviations without breaking short flags. + def _parse_optional( + self, arg_string: str + ) -> Optional[Tuple[Optional[argparse.Action], str, Optional[str]]]: + if not arg_string: + return None + if not arg_string[0] in self.prefix_chars: + return None + if arg_string in self._option_string_actions: + action = self._option_string_actions[arg_string] + return action, arg_string, None + if len(arg_string) == 1: + return None + if "=" in arg_string: + option_string, explicit_arg = arg_string.split("=", 1) + if option_string in self._option_string_actions: + action = self._option_string_actions[option_string] + return action, option_string, explicit_arg + if self.allow_abbrev or not arg_string.startswith("--"): + option_tuples = self._get_option_tuples(arg_string) + if len(option_tuples) > 1: + msg = gettext( + "ambiguous option: %(option)s could match %(matches)s" + ) + options = ", ".join(option for _, option, _ in option_tuples) + self.error(msg % {"option": arg_string, "matches": options}) + elif len(option_tuples) == 1: + (option_tuple,) = option_tuples + return option_tuple + if self._negative_number_matcher.match(arg_string): + if not self._has_negative_number_optionals: + return None + if " " in arg_string: + return None + return None, arg_string, None + + +class DropShorterLongHelpFormatter(argparse.HelpFormatter): + """shorten help for long options that differ only in extra hyphens + + - collapse **long** options that are the same except for extra hyphens + - shortcut if there are only two options and one of them is a short one + - cache result on action object as this is called at least 2 times + """ + + def __init__(self, *args: Any, **kwargs: Any) -> None: + """Use more accurate terminal width via pylib.""" + if "width" not in kwargs: + kwargs["width"] = py.io.get_terminal_width() + super().__init__(*args, **kwargs) + + def _format_action_invocation(self, action: argparse.Action) -> str: + orgstr = argparse.HelpFormatter._format_action_invocation(self, action) + if orgstr and orgstr[0] != "-": # only optional arguments + return orgstr + res = getattr( + action, "_formatted_action_invocation", None + ) # type: Optional[str] + if res: + return res + options = orgstr.split(", ") + if len(options) == 2 and (len(options[0]) == 2 or len(options[1]) == 2): + # a shortcut for '-h, --help' or '--abc', '-a' + action._formatted_action_invocation = orgstr # type: ignore + return orgstr + return_list = [] + short_long = {} # type: Dict[str, str] + for option in options: + if len(option) == 2 or option[2] == " ": + continue + if not option.startswith("--"): + raise ArgumentError( + 'long optional argument without "--": [%s]' % (option), option + ) + xxoption = option[2:] + shortened = xxoption.replace("-", "") + if shortened not in short_long or len(short_long[shortened]) < len( + xxoption + ): + short_long[shortened] = xxoption + # now short_long has been filled out to the longest with dashes + # **and** we keep the right option ordering from add_argument + for option in options: + if len(option) == 2 or option[2] == " ": + return_list.append(option) + if option[2:] == short_long.get(option.replace("-", "")): + return_list.append(option.replace(" ", "=", 1)) + formatted_action_invocation = ", ".join(return_list) + action._formatted_action_invocation = formatted_action_invocation # type: ignore + return formatted_action_invocation diff --git a/contrib/python/pytest/py3/_pytest/config/exceptions.py b/contrib/python/pytest/py3/_pytest/config/exceptions.py new file mode 100644 index 00000000000..19fe5cb08ed --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/config/exceptions.py @@ -0,0 +1,9 @@ +class UsageError(Exception): + """ error in pytest usage or invocation""" + + +class PrintHelp(Exception): + """Raised when pytest should print it's help to skip the rest of the + argument parsing and validation.""" + + pass diff --git a/contrib/python/pytest/py3/_pytest/config/findpaths.py b/contrib/python/pytest/py3/_pytest/config/findpaths.py new file mode 100644 index 00000000000..fb84160c1ff --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/config/findpaths.py @@ -0,0 +1,167 @@ +import os +from typing import Any +from typing import Iterable +from typing import List +from typing import Optional +from typing import Tuple + +import py + +from .exceptions import UsageError +from _pytest.compat import TYPE_CHECKING +from _pytest.outcomes import fail + +if TYPE_CHECKING: + from . import Config # noqa: F401 + + +def exists(path, ignore=EnvironmentError): + try: + return path.check() + except ignore: + return False + + +def getcfg(args, config=None): + """ + Search the list of arguments for a valid ini-file for pytest, + and return a tuple of (rootdir, inifile, cfg-dict). + + note: config is optional and used only to issue warnings explicitly (#2891). + """ + inibasenames = ["pytest.ini", "tox.ini", "setup.cfg"] + args = [x for x in args if not str(x).startswith("-")] + if not args: + args = [py.path.local()] + for arg in args: + arg = py.path.local(arg) + for base in arg.parts(reverse=True): + for inibasename in inibasenames: + p = base.join(inibasename) + if exists(p): + try: + iniconfig = py.iniconfig.IniConfig(p) + except py.iniconfig.ParseError as exc: + raise UsageError(str(exc)) + + if ( + inibasename == "setup.cfg" + and "tool:pytest" in iniconfig.sections + ): + return base, p, iniconfig["tool:pytest"] + elif "pytest" in iniconfig.sections: + if inibasename == "setup.cfg" and config is not None: + + fail( + CFG_PYTEST_SECTION.format(filename=inibasename), + pytrace=False, + ) + return base, p, iniconfig["pytest"] + elif inibasename == "pytest.ini": + # allowed to be empty + return base, p, {} + return None, None, None + + +def get_common_ancestor(paths: Iterable[py.path.local]) -> py.path.local: + common_ancestor = None + for path in paths: + if not path.exists(): + continue + if common_ancestor is None: + common_ancestor = path + else: + if path.relto(common_ancestor) or path == common_ancestor: + continue + elif common_ancestor.relto(path): + common_ancestor = path + else: + shared = path.common(common_ancestor) + if shared is not None: + common_ancestor = shared + if common_ancestor is None: + common_ancestor = py.path.local() + elif common_ancestor.isfile(): + common_ancestor = common_ancestor.dirpath() + return common_ancestor + + +def get_dirs_from_args(args): + def is_option(x): + return str(x).startswith("-") + + def get_file_part_from_node_id(x): + return str(x).split("::")[0] + + def get_dir_from_path(path): + if path.isdir(): + return path + return py.path.local(path.dirname) + + # These look like paths but may not exist + possible_paths = ( + py.path.local(get_file_part_from_node_id(arg)) + for arg in args + if not is_option(arg) + ) + + return [get_dir_from_path(path) for path in possible_paths if path.exists()] + + +CFG_PYTEST_SECTION = "[pytest] section in {filename} files is no longer supported, change to [tool:pytest] instead." + + +def determine_setup( + inifile: Optional[str], + args: List[str], + rootdir_cmd_arg: Optional[str] = None, + config: Optional["Config"] = None, +) -> Tuple[py.path.local, Optional[str], Any]: + dirs = get_dirs_from_args(args) + if inifile: + iniconfig = py.iniconfig.IniConfig(inifile) + is_cfg_file = str(inifile).endswith(".cfg") + sections = ["tool:pytest", "pytest"] if is_cfg_file else ["pytest"] + for section in sections: + try: + inicfg = iniconfig[ + section + ] # type: Optional[py.iniconfig._SectionWrapper] + if is_cfg_file and section == "pytest" and config is not None: + fail( + CFG_PYTEST_SECTION.format(filename=str(inifile)), pytrace=False + ) + break + except KeyError: + inicfg = None + if rootdir_cmd_arg is None: + rootdir = get_common_ancestor(dirs) + else: + ancestor = get_common_ancestor(dirs) + rootdir, inifile, inicfg = getcfg([ancestor], config=config) + if rootdir is None and rootdir_cmd_arg is None: + for possible_rootdir in ancestor.parts(reverse=True): + if possible_rootdir.join("setup.py").exists(): + rootdir = possible_rootdir + break + else: + if dirs != [ancestor]: + rootdir, inifile, inicfg = getcfg(dirs, config=config) + if rootdir is None: + if config is not None: + cwd = config.invocation_dir + else: + cwd = py.path.local() + rootdir = get_common_ancestor([cwd, ancestor]) + is_fs_root = os.path.splitdrive(str(rootdir))[1] == "/" + if is_fs_root: + rootdir = ancestor + if rootdir_cmd_arg: + rootdir = py.path.local(os.path.expandvars(rootdir_cmd_arg)) + if not rootdir.isdir(): + raise UsageError( + "Directory '{}' not found. Check your '--rootdir' option.".format( + rootdir + ) + ) + return rootdir, inifile, inicfg or {} diff --git a/contrib/python/pytest/py3/_pytest/debugging.py b/contrib/python/pytest/py3/_pytest/debugging.py new file mode 100644 index 00000000000..07f212fa5e3 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/debugging.py @@ -0,0 +1,394 @@ +""" interactive debugging with PDB, the Python Debugger. """ +import argparse +import functools +import os +import sys + +from _pytest import outcomes +from _pytest.config import ConftestImportFailure +from _pytest.config import hookimpl +from _pytest.config.exceptions import UsageError + + +def import_readline(): + try: + import readline + except ImportError: + sys.path.append('/usr/lib/python2.7/lib-dynload') + + try: + import readline + except ImportError as e: + print('can not import readline:', e) + + import subprocess + try: + subprocess.check_call('stty icrnl'.split()) + except OSError as e: + print('can not restore Enter, use Control+J:', e) + + +def tty(): + if os.isatty(1): + return + + fd = os.open('/dev/tty', os.O_RDWR) + os.dup2(fd, 0) + os.dup2(fd, 1) + os.dup2(fd, 2) + os.close(fd) + + old_sys_path = sys.path + sys.path = list(sys.path) + try: + import_readline() + finally: + sys.path = old_sys_path + + +def _validate_usepdb_cls(value): + """Validate syntax of --pdbcls option.""" + try: + modname, classname = value.split(":") + except ValueError: + raise argparse.ArgumentTypeError( + "{!r} is not in the format 'modname:classname'".format(value) + ) + return (modname, classname) + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group._addoption( + "--pdb", + dest="usepdb", + action="store_true", + help="start the interactive Python debugger on errors or KeyboardInterrupt.", + ) + group._addoption( + "--pdbcls", + dest="usepdb_cls", + metavar="modulename:classname", + type=_validate_usepdb_cls, + help="start a custom interactive Python debugger on errors. " + "For example: --pdbcls=IPython.terminal.debugger:TerminalPdb", + ) + group._addoption( + "--trace", + dest="trace", + action="store_true", + help="Immediately break when running each test.", + ) + + +def pytest_configure(config): + import pdb + + if config.getvalue("trace"): + config.pluginmanager.register(PdbTrace(), "pdbtrace") + if config.getvalue("usepdb"): + config.pluginmanager.register(PdbInvoke(), "pdbinvoke") + + pytestPDB._saved.append( + (pdb.set_trace, pytestPDB._pluginmanager, pytestPDB._config) + ) + pdb.set_trace = pytestPDB.set_trace + pytestPDB._pluginmanager = config.pluginmanager + pytestPDB._config = config + + # NOTE: not using pytest_unconfigure, since it might get called although + # pytest_configure was not (if another plugin raises UsageError). + def fin(): + ( + pdb.set_trace, + pytestPDB._pluginmanager, + pytestPDB._config, + ) = pytestPDB._saved.pop() + + config._cleanup.append(fin) + + +class pytestPDB: + """ Pseudo PDB that defers to the real pdb. """ + + _pluginmanager = None + _config = None + _saved = [] # type: list + _recursive_debug = 0 + _wrapped_pdb_cls = None + + @classmethod + def _is_capturing(cls, capman): + if capman: + return capman.is_capturing() + return False + + @classmethod + def _import_pdb_cls(cls, capman): + if not cls._config: + import pdb + + # Happens when using pytest.set_trace outside of a test. + return pdb.Pdb + + usepdb_cls = cls._config.getvalue("usepdb_cls") + + if cls._wrapped_pdb_cls and cls._wrapped_pdb_cls[0] == usepdb_cls: + return cls._wrapped_pdb_cls[1] + + if usepdb_cls: + modname, classname = usepdb_cls + + try: + __import__(modname) + mod = sys.modules[modname] + + # Handle --pdbcls=pdb:pdb.Pdb (useful e.g. with pdbpp). + parts = classname.split(".") + pdb_cls = getattr(mod, parts[0]) + for part in parts[1:]: + pdb_cls = getattr(pdb_cls, part) + except Exception as exc: + value = ":".join((modname, classname)) + raise UsageError( + "--pdbcls: could not import {!r}: {}".format(value, exc) + ) + else: + import pdb + + pdb_cls = pdb.Pdb + + wrapped_cls = cls._get_pdb_wrapper_class(pdb_cls, capman) + cls._wrapped_pdb_cls = (usepdb_cls, wrapped_cls) + return wrapped_cls + + @classmethod + def _get_pdb_wrapper_class(cls, pdb_cls, capman): + import _pytest.config + + class PytestPdbWrapper(pdb_cls): + _pytest_capman = capman + _continued = False + + def do_debug(self, arg): + cls._recursive_debug += 1 + ret = super().do_debug(arg) + cls._recursive_debug -= 1 + return ret + + def do_continue(self, arg): + ret = super().do_continue(arg) + if cls._recursive_debug == 0: + tw = _pytest.config.create_terminal_writer(cls._config) + tw.line() + + capman = self._pytest_capman + capturing = pytestPDB._is_capturing(capman) + if capturing: + if capturing == "global": + tw.sep(">", "PDB continue (IO-capturing resumed)") + else: + tw.sep( + ">", + "PDB continue (IO-capturing resumed for %s)" + % capturing, + ) + capman.resume() + else: + tw.sep(">", "PDB continue") + cls._pluginmanager.hook.pytest_leave_pdb(config=cls._config, pdb=self) + self._continued = True + return ret + + do_c = do_cont = do_continue + + def do_quit(self, arg): + """Raise Exit outcome when quit command is used in pdb. + + This is a bit of a hack - it would be better if BdbQuit + could be handled, but this would require to wrap the + whole pytest run, and adjust the report etc. + """ + ret = super().do_quit(arg) + + if cls._recursive_debug == 0: + outcomes.exit("Quitting debugger") + + return ret + + do_q = do_quit + do_exit = do_quit + + def setup(self, f, tb): + """Suspend on setup(). + + Needed after do_continue resumed, and entering another + breakpoint again. + """ + ret = super().setup(f, tb) + if not ret and self._continued: + # pdb.setup() returns True if the command wants to exit + # from the interaction: do not suspend capturing then. + if self._pytest_capman: + self._pytest_capman.suspend_global_capture(in_=True) + return ret + + def get_stack(self, f, t): + stack, i = super().get_stack(f, t) + if f is None: + # Find last non-hidden frame. + i = max(0, len(stack) - 1) + while i and stack[i][0].f_locals.get("__tracebackhide__", False): + i -= 1 + return stack, i + + return PytestPdbWrapper + + @classmethod + def _init_pdb(cls, method, *args, **kwargs): + """ Initialize PDB debugging, dropping any IO capturing. """ + import _pytest.config + + if cls._pluginmanager is not None: + capman = cls._pluginmanager.getplugin("capturemanager") + else: + capman = None + if capman: + capman.suspend(in_=True) + + if cls._config: + tw = _pytest.config.create_terminal_writer(cls._config) + tw.line() + + if cls._recursive_debug == 0: + # Handle header similar to pdb.set_trace in py37+. + header = kwargs.pop("header", None) + if header is not None: + tw.sep(">", header) + else: + capturing = cls._is_capturing(capman) + if capturing == "global": + tw.sep(">", "PDB {} (IO-capturing turned off)".format(method)) + elif capturing: + tw.sep( + ">", + "PDB %s (IO-capturing turned off for %s)" + % (method, capturing), + ) + else: + tw.sep(">", "PDB {}".format(method)) + + _pdb = cls._import_pdb_cls(capman)(**kwargs) + + if cls._pluginmanager: + cls._pluginmanager.hook.pytest_enter_pdb(config=cls._config, pdb=_pdb) + return _pdb + + @classmethod + def set_trace(cls, *args, **kwargs): + """Invoke debugging via ``Pdb.set_trace``, dropping any IO capturing.""" + tty() + frame = sys._getframe().f_back + _pdb = cls._init_pdb("set_trace", *args, **kwargs) + _pdb.set_trace(frame) + + +class PdbInvoke: + def pytest_exception_interact(self, node, call, report): + capman = node.config.pluginmanager.getplugin("capturemanager") + if capman: + capman.suspend_global_capture(in_=True) + out, err = capman.read_global_capture() + sys.stdout.write(out) + sys.stdout.write(err) + tty() + _enter_pdb(node, call.excinfo, report) + + def pytest_internalerror(self, excrepr, excinfo): + tb = _postmortem_traceback(excinfo) + post_mortem(tb) + + +class PdbTrace: + @hookimpl(hookwrapper=True) + def pytest_pyfunc_call(self, pyfuncitem): + wrap_pytest_function_for_tracing(pyfuncitem) + yield + + +def wrap_pytest_function_for_tracing(pyfuncitem): + """Changes the python function object of the given Function item by a wrapper which actually + enters pdb before calling the python function itself, effectively leaving the user + in the pdb prompt in the first statement of the function. + """ + _pdb = pytestPDB._init_pdb("runcall") + testfunction = pyfuncitem.obj + + # we can't just return `partial(pdb.runcall, testfunction)` because (on + # python < 3.7.4) runcall's first param is `func`, which means we'd get + # an exception if one of the kwargs to testfunction was called `func` + @functools.wraps(testfunction) + def wrapper(*args, **kwargs): + func = functools.partial(testfunction, *args, **kwargs) + _pdb.runcall(func) + + pyfuncitem.obj = wrapper + + +def maybe_wrap_pytest_function_for_tracing(pyfuncitem): + """Wrap the given pytestfunct item for tracing support if --trace was given in + the command line""" + if pyfuncitem.config.getvalue("trace"): + wrap_pytest_function_for_tracing(pyfuncitem) + + +def _enter_pdb(node, excinfo, rep): + # XXX we re-use the TerminalReporter's terminalwriter + # because this seems to avoid some encoding related troubles + # for not completely clear reasons. + tw = node.config.pluginmanager.getplugin("terminalreporter")._tw + tw.line() + + showcapture = node.config.option.showcapture + + for sectionname, content in ( + ("stdout", rep.capstdout), + ("stderr", rep.capstderr), + ("log", rep.caplog), + ): + if showcapture in (sectionname, "all") and content: + tw.sep(">", "captured " + sectionname) + if content[-1:] == "\n": + content = content[:-1] + tw.line(content) + + tw.sep(">", "traceback") + rep.toterminal(tw) + tw.sep(">", "entering PDB") + tb = _postmortem_traceback(excinfo) + rep._pdbshown = True + post_mortem(tb) + return rep + + +def _postmortem_traceback(excinfo): + from doctest import UnexpectedException + + if isinstance(excinfo.value, UnexpectedException): + # A doctest.UnexpectedException is not useful for post_mortem. + # Use the underlying exception instead: + return excinfo.value.exc_info[2] + elif isinstance(excinfo.value, ConftestImportFailure): + # A config.ConftestImportFailure is not useful for post_mortem. + # Use the underlying exception instead: + return excinfo.value.excinfo[2] + else: + return excinfo._excinfo[2] + + +def post_mortem(t): + p = pytestPDB._init_pdb("post_mortem") + p.reset() + p.interaction(None, t) + if p.quitting: + outcomes.exit("Quitting debugger") diff --git a/contrib/python/pytest/py3/_pytest/deprecated.py b/contrib/python/pytest/py3/_pytest/deprecated.py new file mode 100644 index 00000000000..b11093910af --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/deprecated.py @@ -0,0 +1,62 @@ +""" +This module contains deprecation messages and bits of code used elsewhere in the codebase +that is planned to be removed in the next pytest release. + +Keeping it in a central location makes it easy to track what is deprecated and should +be removed when the time comes. + +All constants defined in this module should be either PytestWarning instances or UnformattedWarning +in case of warnings which need to format their messages. +""" +from _pytest.warning_types import PytestDeprecationWarning +from _pytest.warning_types import UnformattedWarning + +# set of plugins which have been integrated into the core; we use this list to ignore +# them during registration to avoid conflicts +DEPRECATED_EXTERNAL_PLUGINS = { + "pytest_catchlog", + "pytest_capturelog", + "pytest_faulthandler", +} + +FUNCARGNAMES = PytestDeprecationWarning( + "The `funcargnames` attribute was an alias for `fixturenames`, " + "since pytest 2.3 - use the newer attribute instead." +) + +RESULT_LOG = PytestDeprecationWarning( + "--result-log is deprecated, please try the new pytest-reportlog plugin.\n" + "See https://docs.pytest.org/en/latest/deprecations.html#result-log-result-log for more information." +) + +FIXTURE_POSITIONAL_ARGUMENTS = PytestDeprecationWarning( + "Passing arguments to pytest.fixture() as positional arguments is deprecated - pass them " + "as a keyword argument instead." +) + +NODE_USE_FROM_PARENT = UnformattedWarning( + PytestDeprecationWarning, + "direct construction of {name} has been deprecated, please use {name}.from_parent", +) + +JUNIT_XML_DEFAULT_FAMILY = PytestDeprecationWarning( + "The 'junit_family' default value will change to 'xunit2' in pytest 6.0.\n" + "Add 'junit_family=xunit1' to your pytest.ini file to keep the current format " + "in future versions of pytest and silence this warning." +) + +NO_PRINT_LOGS = PytestDeprecationWarning( + "--no-print-logs is deprecated and scheduled for removal in pytest 6.0.\n" + "Please use --show-capture instead." +) + +COLLECT_DIRECTORY_HOOK = PytestDeprecationWarning( + "The pytest_collect_directory hook is not working.\n" + "Please use collect_ignore in conftests or pytest_collection_modifyitems." +) + + +TERMINALWRITER_WRITER = PytestDeprecationWarning( + "The TerminalReporter.writer attribute is deprecated, use TerminalReporter._tw instead at your own risk.\n" + "See https://docs.pytest.org/en/latest/deprecations.html#terminalreporter-writer for more information." +) diff --git a/contrib/python/pytest/py3/_pytest/doctest.py b/contrib/python/pytest/py3/_pytest/doctest.py new file mode 100644 index 00000000000..e1dd9691cc9 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/doctest.py @@ -0,0 +1,686 @@ +""" discover and run doctests in modules and test files.""" +import bdb +import inspect +import platform +import sys +import traceback +import warnings +from contextlib import contextmanager +from typing import Dict +from typing import List +from typing import Optional +from typing import Sequence +from typing import Tuple +from typing import Union + +import py.path + +import pytest +from _pytest import outcomes +from _pytest._code.code import ExceptionInfo +from _pytest._code.code import ReprFileLocation +from _pytest._code.code import TerminalRepr +from _pytest._io import TerminalWriter +from _pytest.compat import safe_getattr +from _pytest.compat import TYPE_CHECKING +from _pytest.fixtures import FixtureRequest +from _pytest.outcomes import OutcomeException +from _pytest.python_api import approx +from _pytest.warning_types import PytestWarning + +if TYPE_CHECKING: + import doctest + from typing import Type + +DOCTEST_REPORT_CHOICE_NONE = "none" +DOCTEST_REPORT_CHOICE_CDIFF = "cdiff" +DOCTEST_REPORT_CHOICE_NDIFF = "ndiff" +DOCTEST_REPORT_CHOICE_UDIFF = "udiff" +DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE = "only_first_failure" + +DOCTEST_REPORT_CHOICES = ( + DOCTEST_REPORT_CHOICE_NONE, + DOCTEST_REPORT_CHOICE_CDIFF, + DOCTEST_REPORT_CHOICE_NDIFF, + DOCTEST_REPORT_CHOICE_UDIFF, + DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE, +) + +# Lazy definition of runner class +RUNNER_CLASS = None +# Lazy definition of output checker class +CHECKER_CLASS = None # type: Optional[Type[doctest.OutputChecker]] + + +def pytest_addoption(parser): + parser.addini( + "doctest_optionflags", + "option flags for doctests", + type="args", + default=["ELLIPSIS"], + ) + parser.addini( + "doctest_encoding", "encoding used for doctest files", default="utf-8" + ) + group = parser.getgroup("collect") + group.addoption( + "--doctest-modules", + action="store_true", + default=False, + help="run doctests in all .py modules", + dest="doctestmodules", + ) + group.addoption( + "--doctest-report", + type=str.lower, + default="udiff", + help="choose another output format for diffs on doctest failure", + choices=DOCTEST_REPORT_CHOICES, + dest="doctestreport", + ) + group.addoption( + "--doctest-glob", + action="append", + default=[], + metavar="pat", + help="doctests file matching pattern, default: test*.txt", + dest="doctestglob", + ) + group.addoption( + "--doctest-ignore-import-errors", + action="store_true", + default=False, + help="ignore doctest ImportErrors", + dest="doctest_ignore_import_errors", + ) + group.addoption( + "--doctest-continue-on-failure", + action="store_true", + default=False, + help="for a given doctest, continue to run after the first failure", + dest="doctest_continue_on_failure", + ) + + +def pytest_unconfigure(): + global RUNNER_CLASS + + RUNNER_CLASS = None + + +def pytest_collect_file(path: py.path.local, parent): + config = parent.config + if path.ext == ".py": + if config.option.doctestmodules and not _is_setup_py(path): + return DoctestModule.from_parent(parent, fspath=path) + elif _is_doctest(config, path, parent): + return DoctestTextfile.from_parent(parent, fspath=path) + + +def _is_setup_py(path: py.path.local) -> bool: + if path.basename != "setup.py": + return False + contents = path.read_binary() + return b"setuptools" in contents or b"distutils" in contents + + +def _is_doctest(config, path, parent): + if path.ext in (".txt", ".rst") and parent.session.isinitpath(path): + return True + globs = config.getoption("doctestglob") or ["test*.txt"] + for glob in globs: + if path.check(fnmatch=glob): + return True + return False + + +class ReprFailDoctest(TerminalRepr): + def __init__( + self, reprlocation_lines: Sequence[Tuple[ReprFileLocation, Sequence[str]]] + ): + self.reprlocation_lines = reprlocation_lines + + def toterminal(self, tw: TerminalWriter) -> None: + for reprlocation, lines in self.reprlocation_lines: + for line in lines: + tw.line(line) + reprlocation.toterminal(tw) + + +class MultipleDoctestFailures(Exception): + def __init__(self, failures): + super().__init__() + self.failures = failures + + +def _init_runner_class() -> "Type[doctest.DocTestRunner]": + import doctest + + class PytestDoctestRunner(doctest.DebugRunner): + """ + Runner to collect failures. Note that the out variable in this case is + a list instead of a stdout-like object + """ + + def __init__( + self, checker=None, verbose=None, optionflags=0, continue_on_failure=True + ): + doctest.DebugRunner.__init__( + self, checker=checker, verbose=verbose, optionflags=optionflags + ) + self.continue_on_failure = continue_on_failure + + def report_failure(self, out, test, example, got): + failure = doctest.DocTestFailure(test, example, got) + if self.continue_on_failure: + out.append(failure) + else: + raise failure + + def report_unexpected_exception(self, out, test, example, exc_info): + if isinstance(exc_info[1], OutcomeException): + raise exc_info[1] + if isinstance(exc_info[1], bdb.BdbQuit): + outcomes.exit("Quitting debugger") + failure = doctest.UnexpectedException(test, example, exc_info) + if self.continue_on_failure: + out.append(failure) + else: + raise failure + + return PytestDoctestRunner + + +def _get_runner( + checker: Optional["doctest.OutputChecker"] = None, + verbose: Optional[bool] = None, + optionflags: int = 0, + continue_on_failure: bool = True, +) -> "doctest.DocTestRunner": + # We need this in order to do a lazy import on doctest + global RUNNER_CLASS + if RUNNER_CLASS is None: + RUNNER_CLASS = _init_runner_class() + # Type ignored because the continue_on_failure argument is only defined on + # PytestDoctestRunner, which is lazily defined so can't be used as a type. + return RUNNER_CLASS( # type: ignore + checker=checker, + verbose=verbose, + optionflags=optionflags, + continue_on_failure=continue_on_failure, + ) + + +class DoctestItem(pytest.Item): + def __init__(self, name, parent, runner=None, dtest=None): + super().__init__(name, parent) + self.runner = runner + self.dtest = dtest + self.obj = None + self.fixture_request = None + + @classmethod + def from_parent( # type: ignore + cls, parent: "Union[DoctestTextfile, DoctestModule]", *, name, runner, dtest + ): + # incompatible signature due to to imposed limits on sublcass + """ + the public named constructor + """ + return super().from_parent(name=name, parent=parent, runner=runner, dtest=dtest) + + def setup(self): + if self.dtest is not None: + self.fixture_request = _setup_fixtures(self) + globs = dict(getfixture=self.fixture_request.getfixturevalue) + for name, value in self.fixture_request.getfixturevalue( + "doctest_namespace" + ).items(): + globs[name] = value + self.dtest.globs.update(globs) + + def runtest(self) -> None: + _check_all_skipped(self.dtest) + self._disable_output_capturing_for_darwin() + failures = [] # type: List[doctest.DocTestFailure] + self.runner.run(self.dtest, out=failures) + if failures: + raise MultipleDoctestFailures(failures) + + def _disable_output_capturing_for_darwin(self): + """ + Disable output capturing. Otherwise, stdout is lost to doctest (#985) + """ + if platform.system() != "Darwin": + return + capman = self.config.pluginmanager.getplugin("capturemanager") + if capman: + capman.suspend_global_capture(in_=True) + out, err = capman.read_global_capture() + sys.stdout.write(out) + sys.stderr.write(err) + + def repr_failure(self, excinfo): + import doctest + + failures = ( + None + ) # type: Optional[List[Union[doctest.DocTestFailure, doctest.UnexpectedException]]] + if excinfo.errisinstance((doctest.DocTestFailure, doctest.UnexpectedException)): + failures = [excinfo.value] + elif excinfo.errisinstance(MultipleDoctestFailures): + failures = excinfo.value.failures + + if failures is not None: + reprlocation_lines = [] + for failure in failures: + example = failure.example + test = failure.test + filename = test.filename + if test.lineno is None: + lineno = None + else: + lineno = test.lineno + example.lineno + 1 + message = type(failure).__name__ + reprlocation = ReprFileLocation(filename, lineno, message) + checker = _get_checker() + report_choice = _get_report_choice( + self.config.getoption("doctestreport") + ) + if lineno is not None: + assert failure.test.docstring is not None + lines = failure.test.docstring.splitlines(False) + # add line numbers to the left of the error message + assert test.lineno is not None + lines = [ + "%03d %s" % (i + test.lineno + 1, x) + for (i, x) in enumerate(lines) + ] + # trim docstring error lines to 10 + lines = lines[max(example.lineno - 9, 0) : example.lineno + 1] + else: + lines = [ + "EXAMPLE LOCATION UNKNOWN, not showing all tests of that example" + ] + indent = ">>>" + for line in example.source.splitlines(): + lines.append("??? {} {}".format(indent, line)) + indent = "..." + if isinstance(failure, doctest.DocTestFailure): + lines += checker.output_difference( + example, failure.got, report_choice + ).split("\n") + else: + inner_excinfo = ExceptionInfo(failure.exc_info) + lines += ["UNEXPECTED EXCEPTION: %s" % repr(inner_excinfo.value)] + lines += [ + x.strip("\n") + for x in traceback.format_exception(*failure.exc_info) + ] + reprlocation_lines.append((reprlocation, lines)) + return ReprFailDoctest(reprlocation_lines) + else: + return super().repr_failure(excinfo) + + def reportinfo(self) -> Tuple[py.path.local, int, str]: + return self.fspath, self.dtest.lineno, "[doctest] %s" % self.name + + +def _get_flag_lookup() -> Dict[str, int]: + import doctest + + return dict( + DONT_ACCEPT_TRUE_FOR_1=doctest.DONT_ACCEPT_TRUE_FOR_1, + DONT_ACCEPT_BLANKLINE=doctest.DONT_ACCEPT_BLANKLINE, + NORMALIZE_WHITESPACE=doctest.NORMALIZE_WHITESPACE, + ELLIPSIS=doctest.ELLIPSIS, + IGNORE_EXCEPTION_DETAIL=doctest.IGNORE_EXCEPTION_DETAIL, + COMPARISON_FLAGS=doctest.COMPARISON_FLAGS, + ALLOW_UNICODE=_get_allow_unicode_flag(), + ALLOW_BYTES=_get_allow_bytes_flag(), + NUMBER=_get_number_flag(), + ) + + +def get_optionflags(parent): + optionflags_str = parent.config.getini("doctest_optionflags") + flag_lookup_table = _get_flag_lookup() + flag_acc = 0 + for flag in optionflags_str: + flag_acc |= flag_lookup_table[flag] + return flag_acc + + +def _get_continue_on_failure(config): + continue_on_failure = config.getvalue("doctest_continue_on_failure") + if continue_on_failure: + # We need to turn off this if we use pdb since we should stop at + # the first failure + if config.getvalue("usepdb"): + continue_on_failure = False + return continue_on_failure + + +class DoctestTextfile(pytest.Module): + obj = None + + def collect(self): + import doctest + + # inspired by doctest.testfile; ideally we would use it directly, + # but it doesn't support passing a custom checker + encoding = self.config.getini("doctest_encoding") + text = self.fspath.read_text(encoding) + filename = str(self.fspath) + name = self.fspath.basename + globs = {"__name__": "__main__"} + + optionflags = get_optionflags(self) + + runner = _get_runner( + verbose=False, + optionflags=optionflags, + checker=_get_checker(), + continue_on_failure=_get_continue_on_failure(self.config), + ) + + parser = doctest.DocTestParser() + test = parser.get_doctest(text, globs, name, filename, 0) + if test.examples: + yield DoctestItem.from_parent( + self, name=test.name, runner=runner, dtest=test + ) + + +def _check_all_skipped(test): + """raises pytest.skip() if all examples in the given DocTest have the SKIP + option set. + """ + import doctest + + all_skipped = all(x.options.get(doctest.SKIP, False) for x in test.examples) + if all_skipped: + pytest.skip("all tests skipped by +SKIP option") + + +def _is_mocked(obj): + """ + returns if a object is possibly a mock object by checking the existence of a highly improbable attribute + """ + return ( + safe_getattr(obj, "pytest_mock_example_attribute_that_shouldnt_exist", None) + is not None + ) + + +@contextmanager +def _patch_unwrap_mock_aware(): + """ + contextmanager which replaces ``inspect.unwrap`` with a version + that's aware of mock objects and doesn't recurse on them + """ + real_unwrap = inspect.unwrap + + def _mock_aware_unwrap(obj, stop=None): + try: + if stop is None or stop is _is_mocked: + return real_unwrap(obj, stop=_is_mocked) + return real_unwrap(obj, stop=lambda obj: _is_mocked(obj) or stop(obj)) + except Exception as e: + warnings.warn( + "Got %r when unwrapping %r. This is usually caused " + "by a violation of Python's object protocol; see e.g. " + "https://github.com/pytest-dev/pytest/issues/5080" % (e, obj), + PytestWarning, + ) + raise + + inspect.unwrap = _mock_aware_unwrap + try: + yield + finally: + inspect.unwrap = real_unwrap + + +class DoctestModule(pytest.Module): + def collect(self): + import doctest + + class MockAwareDocTestFinder(doctest.DocTestFinder): + """ + a hackish doctest finder that overrides stdlib internals to fix a stdlib bug + + https://github.com/pytest-dev/pytest/issues/3456 + https://bugs.python.org/issue25532 + """ + + def _find_lineno(self, obj, source_lines): + """ + Doctest code does not take into account `@property`, this is a hackish way to fix it. + + https://bugs.python.org/issue17446 + """ + if isinstance(obj, property): + obj = getattr(obj, "fget", obj) + return doctest.DocTestFinder._find_lineno(self, obj, source_lines) + + def _find( + self, tests, obj, name, module, source_lines, globs, seen + ) -> None: + if _is_mocked(obj): + return + with _patch_unwrap_mock_aware(): + + # Type ignored because this is a private function. + doctest.DocTestFinder._find( # type: ignore + self, tests, obj, name, module, source_lines, globs, seen + ) + + if self.fspath.basename == "conftest.py": + module = self.config.pluginmanager._importconftest(self.fspath) + else: + try: + module = self.fspath.pyimport() + except ImportError: + if self.config.getvalue("doctest_ignore_import_errors"): + pytest.skip("unable to import module %r" % self.fspath) + else: + raise + # uses internal doctest module parsing mechanism + finder = MockAwareDocTestFinder() + optionflags = get_optionflags(self) + runner = _get_runner( + verbose=False, + optionflags=optionflags, + checker=_get_checker(), + continue_on_failure=_get_continue_on_failure(self.config), + ) + + for test in finder.find(module, module.__name__): + if test.examples: # skip empty doctests + yield DoctestItem.from_parent( + self, name=test.name, runner=runner, dtest=test + ) + + +def _setup_fixtures(doctest_item): + """ + Used by DoctestTextfile and DoctestItem to setup fixture information. + """ + + def func(): + pass + + doctest_item.funcargs = {} + fm = doctest_item.session._fixturemanager + doctest_item._fixtureinfo = fm.getfixtureinfo( + node=doctest_item, func=func, cls=None, funcargs=False + ) + fixture_request = FixtureRequest(doctest_item) + fixture_request._fillfixtures() + return fixture_request + + +def _init_checker_class() -> "Type[doctest.OutputChecker]": + import doctest + import re + + class LiteralsOutputChecker(doctest.OutputChecker): + """ + Based on doctest_nose_plugin.py from the nltk project + (https://github.com/nltk/nltk) and on the "numtest" doctest extension + by Sebastien Boisgerault (https://github.com/boisgera/numtest). + """ + + _unicode_literal_re = re.compile(r"(\W|^)[uU]([rR]?[\'\"])", re.UNICODE) + _bytes_literal_re = re.compile(r"(\W|^)[bB]([rR]?[\'\"])", re.UNICODE) + _number_re = re.compile( + r""" + (?P<number> + (?P<mantissa> + (?P<integer1> [+-]?\d*)\.(?P<fraction>\d+) + | + (?P<integer2> [+-]?\d+)\. + ) + (?: + [Ee] + (?P<exponent1> [+-]?\d+) + )? + | + (?P<integer3> [+-]?\d+) + (?: + [Ee] + (?P<exponent2> [+-]?\d+) + ) + ) + """, + re.VERBOSE, + ) + + def check_output(self, want, got, optionflags): + if doctest.OutputChecker.check_output(self, want, got, optionflags): + return True + + allow_unicode = optionflags & _get_allow_unicode_flag() + allow_bytes = optionflags & _get_allow_bytes_flag() + allow_number = optionflags & _get_number_flag() + + if not allow_unicode and not allow_bytes and not allow_number: + return False + + def remove_prefixes(regex, txt): + return re.sub(regex, r"\1\2", txt) + + if allow_unicode: + want = remove_prefixes(self._unicode_literal_re, want) + got = remove_prefixes(self._unicode_literal_re, got) + + if allow_bytes: + want = remove_prefixes(self._bytes_literal_re, want) + got = remove_prefixes(self._bytes_literal_re, got) + + if allow_number: + got = self._remove_unwanted_precision(want, got) + + return doctest.OutputChecker.check_output(self, want, got, optionflags) + + def _remove_unwanted_precision(self, want, got): + wants = list(self._number_re.finditer(want)) + gots = list(self._number_re.finditer(got)) + if len(wants) != len(gots): + return got + offset = 0 + for w, g in zip(wants, gots): + fraction = w.group("fraction") + exponent = w.group("exponent1") + if exponent is None: + exponent = w.group("exponent2") + if fraction is None: + precision = 0 + else: + precision = len(fraction) + if exponent is not None: + precision -= int(exponent) + if float(w.group()) == approx(float(g.group()), abs=10 ** -precision): + # They're close enough. Replace the text we actually + # got with the text we want, so that it will match when we + # check the string literally. + got = ( + got[: g.start() + offset] + w.group() + got[g.end() + offset :] + ) + offset += w.end() - w.start() - (g.end() - g.start()) + return got + + return LiteralsOutputChecker + + +def _get_checker() -> "doctest.OutputChecker": + """ + Returns a doctest.OutputChecker subclass that supports some + additional options: + + * ALLOW_UNICODE and ALLOW_BYTES options to ignore u'' and b'' + prefixes (respectively) in string literals. Useful when the same + doctest should run in Python 2 and Python 3. + + * NUMBER to ignore floating-point differences smaller than the + precision of the literal number in the doctest. + + An inner class is used to avoid importing "doctest" at the module + level. + """ + global CHECKER_CLASS + if CHECKER_CLASS is None: + CHECKER_CLASS = _init_checker_class() + return CHECKER_CLASS() + + +def _get_allow_unicode_flag() -> int: + """ + Registers and returns the ALLOW_UNICODE flag. + """ + import doctest + + return doctest.register_optionflag("ALLOW_UNICODE") + + +def _get_allow_bytes_flag() -> int: + """ + Registers and returns the ALLOW_BYTES flag. + """ + import doctest + + return doctest.register_optionflag("ALLOW_BYTES") + + +def _get_number_flag() -> int: + """ + Registers and returns the NUMBER flag. + """ + import doctest + + return doctest.register_optionflag("NUMBER") + + +def _get_report_choice(key: str) -> int: + """ + This function returns the actual `doctest` module flag value, we want to do it as late as possible to avoid + importing `doctest` and all its dependencies when parsing options, as it adds overhead and breaks tests. + """ + import doctest + + return { + DOCTEST_REPORT_CHOICE_UDIFF: doctest.REPORT_UDIFF, + DOCTEST_REPORT_CHOICE_CDIFF: doctest.REPORT_CDIFF, + DOCTEST_REPORT_CHOICE_NDIFF: doctest.REPORT_NDIFF, + DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE: doctest.REPORT_ONLY_FIRST_FAILURE, + DOCTEST_REPORT_CHOICE_NONE: 0, + }[key] + + +@pytest.fixture(scope="session") +def doctest_namespace(): + """ + Fixture that returns a :py:class:`dict` that will be injected into the namespace of doctests. + """ + return dict() diff --git a/contrib/python/pytest/py3/_pytest/faulthandler.py b/contrib/python/pytest/py3/_pytest/faulthandler.py new file mode 100644 index 00000000000..8d723c206cb --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/faulthandler.py @@ -0,0 +1,113 @@ +import io +import os +import sys +from typing import TextIO + +import pytest +from _pytest.store import StoreKey + + +fault_handler_stderr_key = StoreKey[TextIO]() + + +def pytest_addoption(parser): + help = ( + "Dump the traceback of all threads if a test takes " + "more than TIMEOUT seconds to finish.\n" + "Not available on Windows." + ) + parser.addini("faulthandler_timeout", help, default=0.0) + + +def pytest_configure(config): + import faulthandler + + if not faulthandler.is_enabled(): + # faulthhandler is not enabled, so install plugin that does the actual work + # of enabling faulthandler before each test executes. + config.pluginmanager.register(FaultHandlerHooks(), "faulthandler-hooks") + else: + from _pytest.warnings import _issue_warning_captured + + # Do not handle dumping to stderr if faulthandler is already enabled, so warn + # users that the option is being ignored. + timeout = FaultHandlerHooks.get_timeout_config_value(config) + if timeout > 0: + _issue_warning_captured( + pytest.PytestConfigWarning( + "faulthandler module enabled before pytest configuration step, " + "'faulthandler_timeout' option ignored" + ), + config.hook, + stacklevel=2, + ) + + +class FaultHandlerHooks: + """Implements hooks that will actually install fault handler before tests execute, + as well as correctly handle pdb and internal errors.""" + + def pytest_configure(self, config): + import faulthandler + + stderr_fd_copy = os.dup(self._get_stderr_fileno()) + config._store[fault_handler_stderr_key] = open(stderr_fd_copy, "w") + faulthandler.enable(file=config._store[fault_handler_stderr_key]) + + def pytest_unconfigure(self, config): + import faulthandler + + faulthandler.disable() + # close our dup file installed during pytest_configure + # re-enable the faulthandler, attaching it to the default sys.stderr + # so we can see crashes after pytest has finished, usually during + # garbage collection during interpreter shutdown + config._store[fault_handler_stderr_key].close() + del config._store[fault_handler_stderr_key] + faulthandler.enable(file=self._get_stderr_fileno()) + + @staticmethod + def _get_stderr_fileno(): + try: + return sys.stderr.fileno() + except (AttributeError, io.UnsupportedOperation): + # pytest-xdist monkeypatches sys.stderr with an object that is not an actual file. + # https://docs.python.org/3/library/faulthandler.html#issue-with-file-descriptors + # This is potentially dangerous, but the best we can do. + return sys.__stderr__.fileno() + + @staticmethod + def get_timeout_config_value(config): + return float(config.getini("faulthandler_timeout") or 0.0) + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_protocol(self, item): + timeout = self.get_timeout_config_value(item.config) + stderr = item.config._store[fault_handler_stderr_key] + if timeout > 0 and stderr is not None: + import faulthandler + + faulthandler.dump_traceback_later(timeout, file=stderr) + try: + yield + finally: + faulthandler.cancel_dump_traceback_later() + else: + yield + + @pytest.hookimpl(tryfirst=True) + def pytest_enter_pdb(self): + """Cancel any traceback dumping due to timeout before entering pdb. + """ + import faulthandler + + faulthandler.cancel_dump_traceback_later() + + @pytest.hookimpl(tryfirst=True) + def pytest_exception_interact(self): + """Cancel any traceback dumping due to an interactive exception being + raised. + """ + import faulthandler + + faulthandler.cancel_dump_traceback_later() diff --git a/contrib/python/pytest/py3/_pytest/fixtures.py b/contrib/python/pytest/py3/_pytest/fixtures.py new file mode 100644 index 00000000000..22964770d22 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/fixtures.py @@ -0,0 +1,1480 @@ +import functools +import inspect +import itertools +import sys +import warnings +from collections import defaultdict +from collections import deque +from collections import OrderedDict +from typing import Dict +from typing import List +from typing import Tuple + +import attr +import py + +import _pytest +from _pytest._code.code import FormattedExcinfo +from _pytest._code.code import TerminalRepr +from _pytest._code.source import getfslineno +from _pytest._io import TerminalWriter +from _pytest.compat import _format_args +from _pytest.compat import _PytestWrapper +from _pytest.compat import get_real_func +from _pytest.compat import get_real_method +from _pytest.compat import getfuncargnames +from _pytest.compat import getimfunc +from _pytest.compat import getlocation +from _pytest.compat import is_generator +from _pytest.compat import NOTSET +from _pytest.compat import safe_getattr +from _pytest.compat import TYPE_CHECKING +from _pytest.deprecated import FIXTURE_POSITIONAL_ARGUMENTS +from _pytest.deprecated import FUNCARGNAMES +from _pytest.mark import ParameterSet +from _pytest.outcomes import fail +from _pytest.outcomes import TEST_OUTCOME + +if TYPE_CHECKING: + from typing import Type + + from _pytest import nodes + from _pytest.main import Session + + +@attr.s(frozen=True) +class PseudoFixtureDef: + cached_result = attr.ib() + scope = attr.ib() + + +def pytest_sessionstart(session: "Session"): + import _pytest.python + import _pytest.nodes + + scopename2class.update( + { + "package": _pytest.python.Package, + "class": _pytest.python.Class, + "module": _pytest.python.Module, + "function": _pytest.nodes.Item, + "session": _pytest.main.Session, + } + ) + session._fixturemanager = FixtureManager(session) + + +scopename2class = {} # type: Dict[str, Type[nodes.Node]] + +scope2props = dict(session=()) # type: Dict[str, Tuple[str, ...]] +scope2props["package"] = ("fspath",) +scope2props["module"] = ("fspath", "module") +scope2props["class"] = scope2props["module"] + ("cls",) +scope2props["instance"] = scope2props["class"] + ("instance",) +scope2props["function"] = scope2props["instance"] + ("function", "keywords") + + +def scopeproperty(name=None, doc=None): + def decoratescope(func): + scopename = name or func.__name__ + + def provide(self): + if func.__name__ in scope2props[self.scope]: + return func(self) + raise AttributeError( + "{} not available in {}-scoped context".format(scopename, self.scope) + ) + + return property(provide, None, None, func.__doc__) + + return decoratescope + + +def get_scope_package(node, fixturedef): + import pytest + + cls = pytest.Package + current = node + fixture_package_name = "{}/{}".format(fixturedef.baseid, "__init__.py") + while current and ( + type(current) is not cls or fixture_package_name != current.nodeid + ): + current = current.parent + if current is None: + return node.session + return current + + +def get_scope_node(node, scope): + cls = scopename2class.get(scope) + if cls is None: + raise ValueError("unknown scope") + return node.getparent(cls) + + +def add_funcarg_pseudo_fixture_def(collector, metafunc, fixturemanager): + # this function will transform all collected calls to a functions + # if they use direct funcargs (i.e. direct parametrization) + # because we want later test execution to be able to rely on + # an existing FixtureDef structure for all arguments. + # XXX we can probably avoid this algorithm if we modify CallSpec2 + # to directly care for creating the fixturedefs within its methods. + if not metafunc._calls[0].funcargs: + return # this function call does not have direct parametrization + # collect funcargs of all callspecs into a list of values + arg2params = {} + arg2scope = {} + for callspec in metafunc._calls: + for argname, argvalue in callspec.funcargs.items(): + assert argname not in callspec.params + callspec.params[argname] = argvalue + arg2params_list = arg2params.setdefault(argname, []) + callspec.indices[argname] = len(arg2params_list) + arg2params_list.append(argvalue) + if argname not in arg2scope: + scopenum = callspec._arg2scopenum.get(argname, scopenum_function) + arg2scope[argname] = scopes[scopenum] + callspec.funcargs.clear() + + # register artificial FixtureDef's so that later at test execution + # time we can rely on a proper FixtureDef to exist for fixture setup. + arg2fixturedefs = metafunc._arg2fixturedefs + for argname, valuelist in arg2params.items(): + # if we have a scope that is higher than function we need + # to make sure we only ever create an according fixturedef on + # a per-scope basis. We thus store and cache the fixturedef on the + # node related to the scope. + scope = arg2scope[argname] + node = None + if scope != "function": + node = get_scope_node(collector, scope) + if node is None: + assert scope == "class" and isinstance(collector, _pytest.python.Module) + # use module-level collector for class-scope (for now) + node = collector + if node and argname in node._name2pseudofixturedef: + arg2fixturedefs[argname] = [node._name2pseudofixturedef[argname]] + else: + fixturedef = FixtureDef( + fixturemanager, + "", + argname, + get_direct_param_fixture_func, + arg2scope[argname], + valuelist, + False, + False, + ) + arg2fixturedefs[argname] = [fixturedef] + if node is not None: + node._name2pseudofixturedef[argname] = fixturedef + + +def getfixturemarker(obj): + """ return fixturemarker or None if it doesn't exist or raised + exceptions.""" + try: + return getattr(obj, "_pytestfixturefunction", None) + except TEST_OUTCOME: + # some objects raise errors like request (from flask import request) + # we don't expect them to be fixture functions + return None + + +def get_parametrized_fixture_keys(item, scopenum): + """ return list of keys for all parametrized arguments which match + the specified scope. """ + assert scopenum < scopenum_function # function + try: + cs = item.callspec + except AttributeError: + pass + else: + # cs.indices.items() is random order of argnames. Need to + # sort this so that different calls to + # get_parametrized_fixture_keys will be deterministic. + for argname, param_index in sorted(cs.indices.items()): + if cs._arg2scopenum[argname] != scopenum: + continue + if scopenum == 0: # session + key = (argname, param_index) + elif scopenum == 1: # package + key = (argname, param_index, item.fspath.dirpath()) + elif scopenum == 2: # module + key = (argname, param_index, item.fspath) + elif scopenum == 3: # class + key = (argname, param_index, item.fspath, item.cls) + yield key + + +# algorithm for sorting on a per-parametrized resource setup basis +# it is called for scopenum==0 (session) first and performs sorting +# down to the lower scopes such as to minimize number of "high scope" +# setups and teardowns + + +def reorder_items(items): + argkeys_cache = {} + items_by_argkey = {} + for scopenum in range(0, scopenum_function): + argkeys_cache[scopenum] = d = {} + items_by_argkey[scopenum] = item_d = defaultdict(deque) + for item in items: + keys = OrderedDict.fromkeys(get_parametrized_fixture_keys(item, scopenum)) + if keys: + d[item] = keys + for key in keys: + item_d[key].append(item) + items = OrderedDict.fromkeys(items) + return list(reorder_items_atscope(items, argkeys_cache, items_by_argkey, 0)) + + +def fix_cache_order(item, argkeys_cache, items_by_argkey): + for scopenum in range(0, scopenum_function): + for key in argkeys_cache[scopenum].get(item, []): + items_by_argkey[scopenum][key].appendleft(item) + + +def reorder_items_atscope(items, argkeys_cache, items_by_argkey, scopenum): + if scopenum >= scopenum_function or len(items) < 3: + return items + ignore = set() + items_deque = deque(items) + items_done = OrderedDict() + scoped_items_by_argkey = items_by_argkey[scopenum] + scoped_argkeys_cache = argkeys_cache[scopenum] + while items_deque: + no_argkey_group = OrderedDict() + slicing_argkey = None + while items_deque: + item = items_deque.popleft() + if item in items_done or item in no_argkey_group: + continue + argkeys = OrderedDict.fromkeys( + k for k in scoped_argkeys_cache.get(item, []) if k not in ignore + ) + if not argkeys: + no_argkey_group[item] = None + else: + slicing_argkey, _ = argkeys.popitem() + # we don't have to remove relevant items from later in the deque because they'll just be ignored + matching_items = [ + i for i in scoped_items_by_argkey[slicing_argkey] if i in items + ] + for i in reversed(matching_items): + fix_cache_order(i, argkeys_cache, items_by_argkey) + items_deque.appendleft(i) + break + if no_argkey_group: + no_argkey_group = reorder_items_atscope( + no_argkey_group, argkeys_cache, items_by_argkey, scopenum + 1 + ) + for item in no_argkey_group: + items_done[item] = None + ignore.add(slicing_argkey) + return items_done + + +def fillfixtures(function): + """ fill missing funcargs for a test function. """ + try: + request = function._request + except AttributeError: + # XXX this special code path is only expected to execute + # with the oejskit plugin. It uses classes with funcargs + # and we thus have to work a bit to allow this. + fm = function.session._fixturemanager + fi = fm.getfixtureinfo(function.parent, function.obj, None) + function._fixtureinfo = fi + request = function._request = FixtureRequest(function) + request._fillfixtures() + # prune out funcargs for jstests + newfuncargs = {} + for name in fi.argnames: + newfuncargs[name] = function.funcargs[name] + function.funcargs = newfuncargs + else: + request._fillfixtures() + + +def get_direct_param_fixture_func(request): + return request.param + + +@attr.s(slots=True) +class FuncFixtureInfo: + # original function argument names + argnames = attr.ib(type=tuple) + # argnames that function immediately requires. These include argnames + + # fixture names specified via usefixtures and via autouse=True in fixture + # definitions. + initialnames = attr.ib(type=tuple) + names_closure = attr.ib() # List[str] + name2fixturedefs = attr.ib() # List[str, List[FixtureDef]] + + def prune_dependency_tree(self): + """Recompute names_closure from initialnames and name2fixturedefs + + Can only reduce names_closure, which means that the new closure will + always be a subset of the old one. The order is preserved. + + This method is needed because direct parametrization may shadow some + of the fixtures that were included in the originally built dependency + tree. In this way the dependency tree can get pruned, and the closure + of argnames may get reduced. + """ + closure = set() + working_set = set(self.initialnames) + while working_set: + argname = working_set.pop() + # argname may be smth not included in the original names_closure, + # in which case we ignore it. This currently happens with pseudo + # FixtureDefs which wrap 'get_direct_param_fixture_func(request)'. + # So they introduce the new dependency 'request' which might have + # been missing in the original tree (closure). + if argname not in closure and argname in self.names_closure: + closure.add(argname) + if argname in self.name2fixturedefs: + working_set.update(self.name2fixturedefs[argname][-1].argnames) + + self.names_closure[:] = sorted(closure, key=self.names_closure.index) + + +class FixtureRequest: + """ A request for a fixture from a test or fixture function. + + A request object gives access to the requesting test context + and has an optional ``param`` attribute in case + the fixture is parametrized indirectly. + """ + + def __init__(self, pyfuncitem): + self._pyfuncitem = pyfuncitem + #: fixture for which this request is being performed + self.fixturename = None + #: Scope string, one of "function", "class", "module", "session" + self.scope = "function" + self._fixture_defs = {} # type: Dict[str, FixtureDef] + fixtureinfo = pyfuncitem._fixtureinfo + self._arg2fixturedefs = fixtureinfo.name2fixturedefs.copy() + self._arg2index = {} + self._fixturemanager = pyfuncitem.session._fixturemanager + + @property + def fixturenames(self): + """names of all active fixtures in this request""" + result = list(self._pyfuncitem._fixtureinfo.names_closure) + result.extend(set(self._fixture_defs).difference(result)) + return result + + @property + def funcargnames(self): + """ alias attribute for ``fixturenames`` for pre-2.3 compatibility""" + warnings.warn(FUNCARGNAMES, stacklevel=2) + return self.fixturenames + + @property + def node(self): + """ underlying collection node (depends on current request scope)""" + return self._getscopeitem(self.scope) + + def _getnextfixturedef(self, argname): + fixturedefs = self._arg2fixturedefs.get(argname, None) + if fixturedefs is None: + # we arrive here because of a dynamic call to + # getfixturevalue(argname) usage which was naturally + # not known at parsing/collection time + parentid = self._pyfuncitem.parent.nodeid + fixturedefs = self._fixturemanager.getfixturedefs(argname, parentid) + self._arg2fixturedefs[argname] = fixturedefs + # fixturedefs list is immutable so we maintain a decreasing index + index = self._arg2index.get(argname, 0) - 1 + if fixturedefs is None or (-index > len(fixturedefs)): + raise FixtureLookupError(argname, self) + self._arg2index[argname] = index + return fixturedefs[index] + + @property + def config(self): + """ the pytest config object associated with this request. """ + return self._pyfuncitem.config + + @scopeproperty() + def function(self): + """ test function object if the request has a per-function scope. """ + return self._pyfuncitem.obj + + @scopeproperty("class") + def cls(self): + """ class (can be None) where the test function was collected. """ + clscol = self._pyfuncitem.getparent(_pytest.python.Class) + if clscol: + return clscol.obj + + @property + def instance(self): + """ instance (can be None) on which test function was collected. """ + # unittest support hack, see _pytest.unittest.TestCaseFunction + try: + return self._pyfuncitem._testcase + except AttributeError: + function = getattr(self, "function", None) + return getattr(function, "__self__", None) + + @scopeproperty() + def module(self): + """ python module object where the test function was collected. """ + return self._pyfuncitem.getparent(_pytest.python.Module).obj + + @scopeproperty() + def fspath(self) -> py.path.local: + """ the file system path of the test module which collected this test. """ + # TODO: Remove ignore once _pyfuncitem is properly typed. + return self._pyfuncitem.fspath # type: ignore + + @property + def keywords(self): + """ keywords/markers dictionary for the underlying node. """ + return self.node.keywords + + @property + def session(self): + """ pytest session object. """ + return self._pyfuncitem.session + + def addfinalizer(self, finalizer): + """ add finalizer/teardown function to be called after the + last test within the requesting test context finished + execution. """ + # XXX usually this method is shadowed by fixturedef specific ones + self._addfinalizer(finalizer, scope=self.scope) + + def _addfinalizer(self, finalizer, scope): + colitem = self._getscopeitem(scope) + self._pyfuncitem.session._setupstate.addfinalizer( + finalizer=finalizer, colitem=colitem + ) + + def applymarker(self, marker): + """ Apply a marker to a single test function invocation. + This method is useful if you don't want to have a keyword/marker + on all function invocations. + + :arg marker: a :py:class:`_pytest.mark.MarkDecorator` object + created by a call to ``pytest.mark.NAME(...)``. + """ + self.node.add_marker(marker) + + def raiseerror(self, msg): + """ raise a FixtureLookupError with the given message. """ + raise self._fixturemanager.FixtureLookupError(None, self, msg) + + def _fillfixtures(self): + item = self._pyfuncitem + fixturenames = getattr(item, "fixturenames", self.fixturenames) + for argname in fixturenames: + if argname not in item.funcargs: + item.funcargs[argname] = self.getfixturevalue(argname) + + def getfixturevalue(self, argname): + """ Dynamically run a named fixture function. + + Declaring fixtures via function argument is recommended where possible. + But if you can only decide whether to use another fixture at test + setup time, you may use this function to retrieve it inside a fixture + or test function body. + """ + return self._get_active_fixturedef(argname).cached_result[0] + + def _get_active_fixturedef(self, argname): + try: + return self._fixture_defs[argname] + except KeyError: + try: + fixturedef = self._getnextfixturedef(argname) + except FixtureLookupError: + if argname == "request": + cached_result = (self, [0], None) + scope = "function" + return PseudoFixtureDef(cached_result, scope) + raise + # remove indent to prevent the python3 exception + # from leaking into the call + self._compute_fixture_value(fixturedef) + self._fixture_defs[argname] = fixturedef + return fixturedef + + def _get_fixturestack(self): + current = self + values = [] + while 1: + fixturedef = getattr(current, "_fixturedef", None) + if fixturedef is None: + values.reverse() + return values + values.append(fixturedef) + current = current._parent_request + + def _compute_fixture_value(self, fixturedef: "FixtureDef") -> None: + """ + Creates a SubRequest based on "self" and calls the execute method of the given fixturedef object. This will + force the FixtureDef object to throw away any previous results and compute a new fixture value, which + will be stored into the FixtureDef object itself. + """ + # prepare a subrequest object before calling fixture function + # (latter managed by fixturedef) + argname = fixturedef.argname + funcitem = self._pyfuncitem + scope = fixturedef.scope + try: + param = funcitem.callspec.getparam(argname) + except (AttributeError, ValueError): + param = NOTSET + param_index = 0 + has_params = fixturedef.params is not None + fixtures_not_supported = getattr(funcitem, "nofuncargs", False) + if has_params and fixtures_not_supported: + msg = ( + "{name} does not support fixtures, maybe unittest.TestCase subclass?\n" + "Node id: {nodeid}\n" + "Function type: {typename}" + ).format( + name=funcitem.name, + nodeid=funcitem.nodeid, + typename=type(funcitem).__name__, + ) + fail(msg, pytrace=False) + if has_params: + frame = inspect.stack()[3] + frameinfo = inspect.getframeinfo(frame[0]) + source_path = py.path.local(frameinfo.filename) + source_lineno = frameinfo.lineno + rel_source_path = source_path.relto(funcitem.config.rootdir) + if rel_source_path: + source_path_str = rel_source_path + else: + source_path_str = str(source_path) + msg = ( + "The requested fixture has no parameter defined for test:\n" + " {}\n\n" + "Requested fixture '{}' defined in:\n{}" + "\n\nRequested here:\n{}:{}".format( + funcitem.nodeid, + fixturedef.argname, + getlocation(fixturedef.func, funcitem.config.rootdir), + source_path_str, + source_lineno, + ) + ) + fail(msg, pytrace=False) + else: + param_index = funcitem.callspec.indices[argname] + # if a parametrize invocation set a scope it will override + # the static scope defined with the fixture function + paramscopenum = funcitem.callspec._arg2scopenum.get(argname) + if paramscopenum is not None: + scope = scopes[paramscopenum] + + subrequest = SubRequest(self, scope, param, param_index, fixturedef) + + # check if a higher-level scoped fixture accesses a lower level one + subrequest._check_scope(argname, self.scope, scope) + try: + # call the fixture function + fixturedef.execute(request=subrequest) + finally: + self._schedule_finalizers(fixturedef, subrequest) + + def _schedule_finalizers(self, fixturedef, subrequest): + # if fixture function failed it might have registered finalizers + self.session._setupstate.addfinalizer( + functools.partial(fixturedef.finish, request=subrequest), subrequest.node + ) + + def _check_scope(self, argname, invoking_scope, requested_scope): + if argname == "request": + return + if scopemismatch(invoking_scope, requested_scope): + # try to report something helpful + lines = self._factorytraceback() + fail( + "ScopeMismatch: You tried to access the %r scoped " + "fixture %r with a %r scoped request object, " + "involved factories\n%s" + % ((requested_scope, argname, invoking_scope, "\n".join(lines))), + pytrace=False, + ) + + def _factorytraceback(self): + lines = [] + for fixturedef in self._get_fixturestack(): + factory = fixturedef.func + fs, lineno = getfslineno(factory) + p = self._pyfuncitem.session.fspath.bestrelpath(fs) + args = _format_args(factory) + lines.append("%s:%d: def %s%s" % (p, lineno + 1, factory.__name__, args)) + return lines + + def _getscopeitem(self, scope): + if scope == "function": + # this might also be a non-function Item despite its attribute name + return self._pyfuncitem + if scope == "package": + node = get_scope_package(self._pyfuncitem, self._fixturedef) + else: + node = get_scope_node(self._pyfuncitem, scope) + if node is None and scope == "class": + # fallback to function item itself + node = self._pyfuncitem + assert node, 'Could not obtain a node for scope "{}" for function {!r}'.format( + scope, self._pyfuncitem + ) + return node + + def __repr__(self): + return "<FixtureRequest for %r>" % (self.node) + + +class SubRequest(FixtureRequest): + """ a sub request for handling getting a fixture from a + test function/fixture. """ + + def __init__(self, request, scope, param, param_index, fixturedef): + self._parent_request = request + self.fixturename = fixturedef.argname + if param is not NOTSET: + self.param = param + self.param_index = param_index + self.scope = scope + self._fixturedef = fixturedef + self._pyfuncitem = request._pyfuncitem + self._fixture_defs = request._fixture_defs + self._arg2fixturedefs = request._arg2fixturedefs + self._arg2index = request._arg2index + self._fixturemanager = request._fixturemanager + + def __repr__(self): + return "<SubRequest {!r} for {!r}>".format(self.fixturename, self._pyfuncitem) + + def addfinalizer(self, finalizer): + self._fixturedef.addfinalizer(finalizer) + + def _schedule_finalizers(self, fixturedef, subrequest): + # if the executing fixturedef was not explicitly requested in the argument list (via + # getfixturevalue inside the fixture call) then ensure this fixture def will be finished + # first + if fixturedef.argname not in self.fixturenames: + fixturedef.addfinalizer( + functools.partial(self._fixturedef.finish, request=self) + ) + super()._schedule_finalizers(fixturedef, subrequest) + + +scopes = "session package module class function".split() +scopenum_function = scopes.index("function") + + +def scopemismatch(currentscope, newscope): + return scopes.index(newscope) > scopes.index(currentscope) + + +def scope2index(scope, descr, where=None): + """Look up the index of ``scope`` and raise a descriptive value error + if not defined. + """ + try: + return scopes.index(scope) + except ValueError: + fail( + "{} {}got an unexpected scope value '{}'".format( + descr, "from {} ".format(where) if where else "", scope + ), + pytrace=False, + ) + + +class FixtureLookupError(LookupError): + """ could not return a requested Fixture (missing or invalid). """ + + def __init__(self, argname, request, msg=None): + self.argname = argname + self.request = request + self.fixturestack = request._get_fixturestack() + self.msg = msg + + def formatrepr(self) -> "FixtureLookupErrorRepr": + tblines = [] # type: List[str] + addline = tblines.append + stack = [self.request._pyfuncitem.obj] + stack.extend(map(lambda x: x.func, self.fixturestack)) + msg = self.msg + if msg is not None: + # the last fixture raise an error, let's present + # it at the requesting side + stack = stack[:-1] + for function in stack: + fspath, lineno = getfslineno(function) + try: + lines, _ = inspect.getsourcelines(get_real_func(function)) + except (IOError, IndexError, TypeError): + error_msg = "file %s, line %s: source code not available" + addline(error_msg % (fspath, lineno + 1)) + else: + addline("file {}, line {}".format(fspath, lineno + 1)) + for i, line in enumerate(lines): + line = line.rstrip() + addline(" " + line) + if line.lstrip().startswith("def"): + break + + if msg is None: + fm = self.request._fixturemanager + available = set() + parentid = self.request._pyfuncitem.parent.nodeid + for name, fixturedefs in fm._arg2fixturedefs.items(): + faclist = list(fm._matchfactories(fixturedefs, parentid)) + if faclist: + available.add(name) + if self.argname in available: + msg = " recursive dependency involving fixture '{}' detected".format( + self.argname + ) + else: + msg = "fixture '{}' not found".format(self.argname) + msg += "\n available fixtures: {}".format(", ".join(sorted(available))) + msg += "\n use 'pytest --fixtures [testpath]' for help on them." + + return FixtureLookupErrorRepr(fspath, lineno, tblines, msg, self.argname) + + +class FixtureLookupErrorRepr(TerminalRepr): + def __init__(self, filename, firstlineno, tblines, errorstring, argname): + self.tblines = tblines + self.errorstring = errorstring + self.filename = filename + self.firstlineno = firstlineno + self.argname = argname + + def toterminal(self, tw: TerminalWriter) -> None: + # tw.line("FixtureLookupError: %s" %(self.argname), red=True) + for tbline in self.tblines: + tw.line(tbline.rstrip()) + lines = self.errorstring.split("\n") + if lines: + tw.line( + "{} {}".format(FormattedExcinfo.fail_marker, lines[0].strip()), + red=True, + ) + for line in lines[1:]: + tw.line( + "{} {}".format(FormattedExcinfo.flow_marker, line.strip()), + red=True, + ) + tw.line() + tw.line("%s:%d" % (self.filename, self.firstlineno + 1)) + + +def fail_fixturefunc(fixturefunc, msg): + fs, lineno = getfslineno(fixturefunc) + location = "{}:{}".format(fs, lineno + 1) + source = _pytest._code.Source(fixturefunc) + fail(msg + ":\n\n" + str(source.indent()) + "\n" + location, pytrace=False) + + +def call_fixture_func(fixturefunc, request, kwargs): + yieldctx = is_generator(fixturefunc) + if yieldctx: + it = fixturefunc(**kwargs) + res = next(it) + finalizer = functools.partial(_teardown_yield_fixture, fixturefunc, it) + request.addfinalizer(finalizer) + else: + res = fixturefunc(**kwargs) + return res + + +def _teardown_yield_fixture(fixturefunc, it): + """Executes the teardown of a fixture function by advancing the iterator after the + yield and ensure the iteration ends (if not it means there is more than one yield in the function)""" + try: + next(it) + except StopIteration: + pass + else: + fail_fixturefunc( + fixturefunc, "yield_fixture function has more than one 'yield'" + ) + + +def _eval_scope_callable(scope_callable, fixture_name, config): + try: + result = scope_callable(fixture_name=fixture_name, config=config) + except Exception: + raise TypeError( + "Error evaluating {} while defining fixture '{}'.\n" + "Expected a function with the signature (*, fixture_name, config)".format( + scope_callable, fixture_name + ) + ) + if not isinstance(result, str): + fail( + "Expected {} to return a 'str' while defining fixture '{}', but it returned:\n" + "{!r}".format(scope_callable, fixture_name, result), + pytrace=False, + ) + return result + + +class FixtureDef: + """ A container for a factory definition. """ + + def __init__( + self, + fixturemanager, + baseid, + argname, + func, + scope, + params, + unittest=False, + ids=None, + ): + self._fixturemanager = fixturemanager + self.baseid = baseid or "" + self.has_location = baseid is not None + self.func = func + self.argname = argname + if callable(scope): + scope = _eval_scope_callable(scope, argname, fixturemanager.config) + self.scope = scope + self.scopenum = scope2index( + scope or "function", + descr="Fixture '{}'".format(func.__name__), + where=baseid, + ) + self.params = params + self.argnames = getfuncargnames(func, name=argname, is_method=unittest) + self.unittest = unittest + self.ids = ids + self.cached_result = None + self._finalizers = [] + + def addfinalizer(self, finalizer): + self._finalizers.append(finalizer) + + def finish(self, request): + exc = None + try: + while self._finalizers: + try: + func = self._finalizers.pop() + func() + except BaseException as e: + # XXX Only first exception will be seen by user, + # ideally all should be reported. + if exc is None: + exc = e + if exc: + raise exc + finally: + hook = self._fixturemanager.session.gethookproxy(request.node.fspath) + hook.pytest_fixture_post_finalizer(fixturedef=self, request=request) + # even if finalization fails, we invalidate + # the cached fixture value and remove + # all finalizers because they may be bound methods which will + # keep instances alive + self.cached_result = None + self._finalizers = [] + + def execute(self, request): + # get required arguments and register our own finish() + # with their finalization + for argname in self.argnames: + fixturedef = request._get_active_fixturedef(argname) + if argname != "request": + fixturedef.addfinalizer(functools.partial(self.finish, request=request)) + + my_cache_key = self.cache_key(request) + if self.cached_result is not None: + result, cache_key, err = self.cached_result + # note: comparison with `==` can fail (or be expensive) for e.g. + # numpy arrays (#6497) + if my_cache_key is cache_key: + if err is not None: + _, val, tb = err + raise val.with_traceback(tb) + else: + return result + # we have a previous but differently parametrized fixture instance + # so we need to tear it down before creating a new one + self.finish(request) + assert self.cached_result is None + + hook = self._fixturemanager.session.gethookproxy(request.node.fspath) + return hook.pytest_fixture_setup(fixturedef=self, request=request) + + def cache_key(self, request): + return request.param_index if not hasattr(request, "param") else request.param + + def __repr__(self): + return "<FixtureDef argname={!r} scope={!r} baseid={!r}>".format( + self.argname, self.scope, self.baseid + ) + + +def resolve_fixture_function(fixturedef, request): + """Gets the actual callable that can be called to obtain the fixture value, dealing with unittest-specific + instances and bound methods. + """ + fixturefunc = fixturedef.func + if fixturedef.unittest: + if request.instance is not None: + # bind the unbound method to the TestCase instance + fixturefunc = fixturedef.func.__get__(request.instance) + else: + # the fixture function needs to be bound to the actual + # request.instance so that code working with "fixturedef" behaves + # as expected. + if request.instance is not None: + # handle the case where fixture is defined not in a test class, but some other class + # (for example a plugin class with a fixture), see #2270 + if hasattr(fixturefunc, "__self__") and not isinstance( + request.instance, fixturefunc.__self__.__class__ + ): + return fixturefunc + fixturefunc = getimfunc(fixturedef.func) + if fixturefunc != fixturedef.func: + fixturefunc = fixturefunc.__get__(request.instance) + return fixturefunc + + +def pytest_fixture_setup(fixturedef, request): + """ Execution of fixture setup. """ + kwargs = {} + for argname in fixturedef.argnames: + fixdef = request._get_active_fixturedef(argname) + assert fixdef.cached_result is not None + result, arg_cache_key, exc = fixdef.cached_result + request._check_scope(argname, request.scope, fixdef.scope) + kwargs[argname] = result + + fixturefunc = resolve_fixture_function(fixturedef, request) + my_cache_key = fixturedef.cache_key(request) + try: + result = call_fixture_func(fixturefunc, request, kwargs) + except TEST_OUTCOME: + fixturedef.cached_result = (None, my_cache_key, sys.exc_info()) + raise + fixturedef.cached_result = (result, my_cache_key, None) + return result + + +def _ensure_immutable_ids(ids): + if ids is None: + return + if callable(ids): + return ids + return tuple(ids) + + +def wrap_function_to_error_out_if_called_directly(function, fixture_marker): + """Wrap the given fixture function so we can raise an error about it being called directly, + instead of used as an argument in a test function. + """ + message = ( + 'Fixture "{name}" called directly. Fixtures are not meant to be called directly,\n' + "but are created automatically when test functions request them as parameters.\n" + "See https://docs.pytest.org/en/latest/fixture.html for more information about fixtures, and\n" + "https://docs.pytest.org/en/latest/deprecations.html#calling-fixtures-directly about how to update your code." + ).format(name=fixture_marker.name or function.__name__) + + @functools.wraps(function) + def result(*args, **kwargs): + fail(message, pytrace=False) + + # keep reference to the original function in our own custom attribute so we don't unwrap + # further than this point and lose useful wrappings like @mock.patch (#3774) + result.__pytest_wrapped__ = _PytestWrapper(function) + + return result + + +@attr.s(frozen=True) +class FixtureFunctionMarker: + scope = attr.ib() + params = attr.ib(converter=attr.converters.optional(tuple)) + autouse = attr.ib(default=False) + # Ignore type because of https://github.com/python/mypy/issues/6172. + ids = attr.ib(default=None, converter=_ensure_immutable_ids) # type: ignore + name = attr.ib(default=None) + + def __call__(self, function): + if inspect.isclass(function): + raise ValueError("class fixtures not supported (maybe in the future)") + + if getattr(function, "_pytestfixturefunction", False): + raise ValueError( + "fixture is being applied more than once to the same function" + ) + + function = wrap_function_to_error_out_if_called_directly(function, self) + + name = self.name or function.__name__ + if name == "request": + location = getlocation(function) + fail( + "'request' is a reserved word for fixtures, use another name:\n {}".format( + location + ), + pytrace=False, + ) + function._pytestfixturefunction = self + return function + + +FIXTURE_ARGS_ORDER = ("scope", "params", "autouse", "ids", "name") + + +def _parse_fixture_args(callable_or_scope, *args, **kwargs): + arguments = { + "scope": "function", + "params": None, + "autouse": False, + "ids": None, + "name": None, + } + kwargs = { + key: value for key, value in kwargs.items() if arguments.get(key) != value + } + + fixture_function = None + if isinstance(callable_or_scope, str): + args = list(args) + args.insert(0, callable_or_scope) + else: + fixture_function = callable_or_scope + + positionals = set() + for positional, argument_name in zip(args, FIXTURE_ARGS_ORDER): + arguments[argument_name] = positional + positionals.add(argument_name) + + duplicated_kwargs = {kwarg for kwarg in kwargs.keys() if kwarg in positionals} + if duplicated_kwargs: + raise TypeError( + "The fixture arguments are defined as positional and keyword: {}. " + "Use only keyword arguments.".format(", ".join(duplicated_kwargs)) + ) + + if positionals: + warnings.warn(FIXTURE_POSITIONAL_ARGUMENTS, stacklevel=2) + + arguments.update(kwargs) + + return fixture_function, arguments + + +def fixture( + callable_or_scope=None, + *args, + scope="function", + params=None, + autouse=False, + ids=None, + name=None +): + """Decorator to mark a fixture factory function. + + This decorator can be used, with or without parameters, to define a + fixture function. + + The name of the fixture function can later be referenced to cause its + invocation ahead of running tests: test + modules or classes can use the ``pytest.mark.usefixtures(fixturename)`` + marker. + + Test functions can directly use fixture names as input + arguments in which case the fixture instance returned from the fixture + function will be injected. + + Fixtures can provide their values to test functions using ``return`` or ``yield`` + statements. When using ``yield`` the code block after the ``yield`` statement is executed + as teardown code regardless of the test outcome, and must yield exactly once. + + :arg scope: the scope for which this fixture is shared, one of + ``"function"`` (default), ``"class"``, ``"module"``, + ``"package"`` or ``"session"`` (``"package"`` is considered **experimental** + at this time). + + This parameter may also be a callable which receives ``(fixture_name, config)`` + as parameters, and must return a ``str`` with one of the values mentioned above. + + See :ref:`dynamic scope` in the docs for more information. + + :arg params: an optional list of parameters which will cause multiple + invocations of the fixture function and all of the tests + using it. + The current parameter is available in ``request.param``. + + :arg autouse: if True, the fixture func is activated for all tests that + can see it. If False (the default) then an explicit + reference is needed to activate the fixture. + + :arg ids: list of string ids each corresponding to the params + so that they are part of the test id. If no ids are provided + they will be generated automatically from the params. + + :arg name: the name of the fixture. This defaults to the name of the + decorated function. If a fixture is used in the same module in + which it is defined, the function name of the fixture will be + shadowed by the function arg that requests the fixture; one way + to resolve this is to name the decorated function + ``fixture_<fixturename>`` and then use + ``@pytest.fixture(name='<fixturename>')``. + """ + if params is not None: + params = list(params) + + fixture_function, arguments = _parse_fixture_args( + callable_or_scope, + *args, + scope=scope, + params=params, + autouse=autouse, + ids=ids, + name=name, + ) + scope = arguments.get("scope") + params = arguments.get("params") + autouse = arguments.get("autouse") + ids = arguments.get("ids") + name = arguments.get("name") + + if fixture_function and params is None and autouse is False: + # direct decoration + return FixtureFunctionMarker(scope, params, autouse, name=name)( + fixture_function + ) + + return FixtureFunctionMarker(scope, params, autouse, ids=ids, name=name) + + +def yield_fixture( + callable_or_scope=None, + *args, + scope="function", + params=None, + autouse=False, + ids=None, + name=None +): + """ (return a) decorator to mark a yield-fixture factory function. + + .. deprecated:: 3.0 + Use :py:func:`pytest.fixture` directly instead. + """ + return fixture( + callable_or_scope, + *args, + scope=scope, + params=params, + autouse=autouse, + ids=ids, + name=name, + ) + + +defaultfuncargprefixmarker = fixture() + + +@fixture(scope="session") +def pytestconfig(request): + """Session-scoped fixture that returns the :class:`_pytest.config.Config` object. + + Example:: + + def test_foo(pytestconfig): + if pytestconfig.getoption("verbose") > 0: + ... + + """ + return request.config + + +def pytest_addoption(parser): + parser.addini( + "usefixtures", + type="args", + default=[], + help="list of default fixtures to be used with this project", + ) + + +class FixtureManager: + """ + pytest fixtures definitions and information is stored and managed + from this class. + + During collection fm.parsefactories() is called multiple times to parse + fixture function definitions into FixtureDef objects and internal + data structures. + + During collection of test functions, metafunc-mechanics instantiate + a FuncFixtureInfo object which is cached per node/func-name. + This FuncFixtureInfo object is later retrieved by Function nodes + which themselves offer a fixturenames attribute. + + The FuncFixtureInfo object holds information about fixtures and FixtureDefs + relevant for a particular function. An initial list of fixtures is + assembled like this: + + - ini-defined usefixtures + - autouse-marked fixtures along the collection chain up from the function + - usefixtures markers at module/class/function level + - test function funcargs + + Subsequently the funcfixtureinfo.fixturenames attribute is computed + as the closure of the fixtures needed to setup the initial fixtures, + i. e. fixtures needed by fixture functions themselves are appended + to the fixturenames list. + + Upon the test-setup phases all fixturenames are instantiated, retrieved + by a lookup of their FuncFixtureInfo. + """ + + FixtureLookupError = FixtureLookupError + FixtureLookupErrorRepr = FixtureLookupErrorRepr + + def __init__(self, session): + self.session = session + self.config = session.config + self._arg2fixturedefs = {} + self._holderobjseen = set() + self._nodeid_and_autousenames = [("", self.config.getini("usefixtures"))] + session.config.pluginmanager.register(self, "funcmanage") + + def _get_direct_parametrize_args(self, node): + """This function returns all the direct parametrization + arguments of a node, so we don't mistake them for fixtures + + Check https://github.com/pytest-dev/pytest/issues/5036 + + This things are done later as well when dealing with parametrization + so this could be improved + """ + parametrize_argnames = [] + for marker in node.iter_markers(name="parametrize"): + if not marker.kwargs.get("indirect", False): + p_argnames, _ = ParameterSet._parse_parametrize_args( + *marker.args, **marker.kwargs + ) + parametrize_argnames.extend(p_argnames) + + return parametrize_argnames + + def getfixtureinfo(self, node, func, cls, funcargs=True): + if funcargs and not getattr(node, "nofuncargs", False): + argnames = getfuncargnames(func, name=node.name, cls=cls) + else: + argnames = () + + usefixtures = itertools.chain.from_iterable( + mark.args for mark in node.iter_markers(name="usefixtures") + ) + initialnames = tuple(usefixtures) + argnames + fm = node.session._fixturemanager + initialnames, names_closure, arg2fixturedefs = fm.getfixtureclosure( + initialnames, node, ignore_args=self._get_direct_parametrize_args(node) + ) + return FuncFixtureInfo(argnames, initialnames, names_closure, arg2fixturedefs) + + def pytest_plugin_registered(self, plugin): + nodeid = None + try: + p = py.path.local(plugin.__file__).realpath() + except AttributeError: + pass + else: + from _pytest import nodes + + # construct the base nodeid which is later used to check + # what fixtures are visible for particular tests (as denoted + # by their test id) + if p.basename.startswith("conftest.py"): + nodeid = p.dirpath().relto(self.config.rootdir) + if p.sep != nodes.SEP: + nodeid = nodeid.replace(p.sep, nodes.SEP) + + self.parsefactories(plugin, nodeid) + + def _getautousenames(self, nodeid): + """ return a tuple of fixture names to be used. """ + autousenames = [] + for baseid, basenames in self._nodeid_and_autousenames: + if nodeid.startswith(baseid): + if baseid: + i = len(baseid) + nextchar = nodeid[i : i + 1] + if nextchar and nextchar not in ":/": + continue + autousenames.extend(basenames) + return autousenames + + def getfixtureclosure(self, fixturenames, parentnode, ignore_args=()): + # collect the closure of all fixtures , starting with the given + # fixturenames as the initial set. As we have to visit all + # factory definitions anyway, we also return an arg2fixturedefs + # mapping so that the caller can reuse it and does not have + # to re-discover fixturedefs again for each fixturename + # (discovering matching fixtures for a given name/node is expensive) + + parentid = parentnode.nodeid + fixturenames_closure = self._getautousenames(parentid) + + def merge(otherlist): + for arg in otherlist: + if arg not in fixturenames_closure: + fixturenames_closure.append(arg) + + merge(fixturenames) + + # at this point, fixturenames_closure contains what we call "initialnames", + # which is a set of fixturenames the function immediately requests. We + # need to return it as well, so save this. + initialnames = tuple(fixturenames_closure) + + arg2fixturedefs = {} + lastlen = -1 + while lastlen != len(fixturenames_closure): + lastlen = len(fixturenames_closure) + for argname in fixturenames_closure: + if argname in ignore_args: + continue + if argname in arg2fixturedefs: + continue + fixturedefs = self.getfixturedefs(argname, parentid) + if fixturedefs: + arg2fixturedefs[argname] = fixturedefs + merge(fixturedefs[-1].argnames) + + def sort_by_scope(arg_name): + try: + fixturedefs = arg2fixturedefs[arg_name] + except KeyError: + return scopes.index("function") + else: + return fixturedefs[-1].scopenum + + fixturenames_closure.sort(key=sort_by_scope) + return initialnames, fixturenames_closure, arg2fixturedefs + + def pytest_generate_tests(self, metafunc): + for argname in metafunc.fixturenames: + faclist = metafunc._arg2fixturedefs.get(argname) + if faclist: + fixturedef = faclist[-1] + if fixturedef.params is not None: + markers = list(metafunc.definition.iter_markers("parametrize")) + for parametrize_mark in markers: + if "argnames" in parametrize_mark.kwargs: + argnames = parametrize_mark.kwargs["argnames"] + else: + argnames = parametrize_mark.args[0] + + if not isinstance(argnames, (tuple, list)): + argnames = [ + x.strip() for x in argnames.split(",") if x.strip() + ] + if argname in argnames: + break + else: + metafunc.parametrize( + argname, + fixturedef.params, + indirect=True, + scope=fixturedef.scope, + ids=fixturedef.ids, + ) + else: + continue # will raise FixtureLookupError at setup time + + def pytest_collection_modifyitems(self, items): + # separate parametrized setups + items[:] = reorder_items(items) + + def parsefactories(self, node_or_obj, nodeid=NOTSET, unittest=False): + if nodeid is not NOTSET: + holderobj = node_or_obj + else: + holderobj = node_or_obj.obj + nodeid = node_or_obj.nodeid + if holderobj in self._holderobjseen: + return + + self._holderobjseen.add(holderobj) + autousenames = [] + for name in dir(holderobj): + # The attribute can be an arbitrary descriptor, so the attribute + # access below can raise. safe_getatt() ignores such exceptions. + obj = safe_getattr(holderobj, name, None) + marker = getfixturemarker(obj) + if not isinstance(marker, FixtureFunctionMarker): + # magic globals with __getattr__ might have got us a wrong + # fixture attribute + continue + + if marker.name: + name = marker.name + + # during fixture definition we wrap the original fixture function + # to issue a warning if called directly, so here we unwrap it in order to not emit the warning + # when pytest itself calls the fixture function + obj = get_real_method(obj, holderobj) + + fixture_def = FixtureDef( + self, + nodeid, + name, + obj, + marker.scope, + marker.params, + unittest=unittest, + ids=marker.ids, + ) + + faclist = self._arg2fixturedefs.setdefault(name, []) + if fixture_def.has_location: + faclist.append(fixture_def) + else: + # fixturedefs with no location are at the front + # so this inserts the current fixturedef after the + # existing fixturedefs from external plugins but + # before the fixturedefs provided in conftests. + i = len([f for f in faclist if not f.has_location]) + faclist.insert(i, fixture_def) + if marker.autouse: + autousenames.append(name) + + if autousenames: + self._nodeid_and_autousenames.append((nodeid or "", autousenames)) + + def getfixturedefs(self, argname, nodeid): + """ + Gets a list of fixtures which are applicable to the given node id. + + :param str argname: name of the fixture to search for + :param str nodeid: full node id of the requesting test. + :return: list[FixtureDef] + """ + try: + fixturedefs = self._arg2fixturedefs[argname] + except KeyError: + return None + return tuple(self._matchfactories(fixturedefs, nodeid)) + + def _matchfactories(self, fixturedefs, nodeid): + from _pytest import nodes + + for fixturedef in fixturedefs: + if nodes.ischildnode(fixturedef.baseid, nodeid): + yield fixturedef diff --git a/contrib/python/pytest/py3/_pytest/freeze_support.py b/contrib/python/pytest/py3/_pytest/freeze_support.py new file mode 100644 index 00000000000..f9d613a2b64 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/freeze_support.py @@ -0,0 +1,44 @@ +""" +Provides a function to report all internal modules for using freezing tools +pytest +""" + + +def freeze_includes(): + """ + Returns a list of module names used by pytest that should be + included by cx_freeze. + """ + import py + import _pytest + + result = list(_iter_all_modules(py)) + result += list(_iter_all_modules(_pytest)) + return result + + +def _iter_all_modules(package, prefix=""): + """ + Iterates over the names of all modules that can be found in the given + package, recursively. + Example: + _iter_all_modules(_pytest) -> + ['_pytest.assertion.newinterpret', + '_pytest.capture', + '_pytest.core', + ... + ] + """ + import os + import pkgutil + + if type(package) is not str: + path, prefix = package.__path__[0], package.__name__ + "." + else: + path = package + for _, name, is_package in pkgutil.iter_modules([path]): + if is_package: + for m in _iter_all_modules(os.path.join(path, name), prefix=name + "."): + yield prefix + m + else: + yield prefix + name diff --git a/contrib/python/pytest/py3/_pytest/helpconfig.py b/contrib/python/pytest/py3/_pytest/helpconfig.py new file mode 100644 index 00000000000..ae37fdea45b --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/helpconfig.py @@ -0,0 +1,246 @@ +""" version info, help messages, tracing configuration. """ +import os +import sys +from argparse import Action + +import py + +import pytest +from _pytest.config import PrintHelp + + +class HelpAction(Action): + """This is an argparse Action that will raise an exception in + order to skip the rest of the argument parsing when --help is passed. + This prevents argparse from quitting due to missing required arguments + when any are defined, for example by ``pytest_addoption``. + This is similar to the way that the builtin argparse --help option is + implemented by raising SystemExit. + """ + + def __init__(self, option_strings, dest=None, default=False, help=None): + super().__init__( + option_strings=option_strings, + dest=dest, + const=True, + default=default, + nargs=0, + help=help, + ) + + def __call__(self, parser, namespace, values, option_string=None): + setattr(namespace, self.dest, self.const) + + # We should only skip the rest of the parsing after preparse is done + if getattr(parser._parser, "after_preparse", False): + raise PrintHelp + + +def pytest_addoption(parser): + group = parser.getgroup("debugconfig") + group.addoption( + "--version", + "-V", + action="store_true", + help="display pytest version and information about plugins.", + ) + group._addoption( + "-h", + "--help", + action=HelpAction, + dest="help", + help="show help message and configuration info", + ) + group._addoption( + "-p", + action="append", + dest="plugins", + default=[], + metavar="name", + help="early-load given plugin module name or entry point (multi-allowed). " + "To avoid loading of plugins, use the `no:` prefix, e.g. " + "`no:doctest`.", + ) + group.addoption( + "--traceconfig", + "--trace-config", + action="store_true", + default=False, + help="trace considerations of conftest.py files.", + ) + group.addoption( + "--debug", + action="store_true", + dest="debug", + default=False, + help="store internal tracing debug information in 'pytestdebug.log'.", + ) + group._addoption( + "-o", + "--override-ini", + dest="override_ini", + action="append", + help='override ini option with "option=value" style, e.g. `-o xfail_strict=True -o cache_dir=cache`.', + ) + + +@pytest.hookimpl(hookwrapper=True) +def pytest_cmdline_parse(): + outcome = yield + config = outcome.get_result() + if config.option.debug: + path = os.path.abspath("pytestdebug.log") + debugfile = open(path, "w") + debugfile.write( + "versions pytest-%s, py-%s, " + "python-%s\ncwd=%s\nargs=%s\n\n" + % ( + pytest.__version__, + py.__version__, + ".".join(map(str, sys.version_info)), + os.getcwd(), + config.invocation_params.args, + ) + ) + config.trace.root.setwriter(debugfile.write) + undo_tracing = config.pluginmanager.enable_tracing() + sys.stderr.write("writing pytestdebug information to %s\n" % path) + + def unset_tracing(): + debugfile.close() + sys.stderr.write("wrote pytestdebug information to %s\n" % debugfile.name) + config.trace.root.setwriter(None) + undo_tracing() + + config.add_cleanup(unset_tracing) + + +def showversion(config): + sys.stderr.write( + "This is pytest version {}, imported from {}\n".format( + pytest.__version__, pytest.__file__ + ) + ) + plugininfo = getpluginversioninfo(config) + if plugininfo: + for line in plugininfo: + sys.stderr.write(line + "\n") + + +def pytest_cmdline_main(config): + if config.option.version: + showversion(config) + return 0 + elif config.option.help: + config._do_configure() + showhelp(config) + config._ensure_unconfigure() + return 0 + + +def showhelp(config): + import textwrap + + reporter = config.pluginmanager.get_plugin("terminalreporter") + tw = reporter._tw + tw.write(config._parser.optparser.format_help()) + tw.line() + tw.line( + "[pytest] ini-options in the first pytest.ini|tox.ini|setup.cfg file found:" + ) + tw.line() + + columns = tw.fullwidth # costly call + indent_len = 24 # based on argparse's max_help_position=24 + indent = " " * indent_len + for name in config._parser._ininames: + help, type, default = config._parser._inidict[name] + if type is None: + type = "string" + spec = "{} ({}):".format(name, type) + tw.write(" %s" % spec) + spec_len = len(spec) + if spec_len > (indent_len - 3): + # Display help starting at a new line. + tw.line() + helplines = textwrap.wrap( + help, + columns, + initial_indent=indent, + subsequent_indent=indent, + break_on_hyphens=False, + ) + + for line in helplines: + tw.line(line) + else: + # Display help starting after the spec, following lines indented. + tw.write(" " * (indent_len - spec_len - 2)) + wrapped = textwrap.wrap(help, columns - indent_len, break_on_hyphens=False) + + tw.line(wrapped[0]) + for line in wrapped[1:]: + tw.line(indent + line) + + tw.line() + tw.line("environment variables:") + vars = [ + ("PYTEST_ADDOPTS", "extra command line options"), + ("PYTEST_PLUGINS", "comma-separated plugins to load during startup"), + ("PYTEST_DISABLE_PLUGIN_AUTOLOAD", "set to disable plugin auto-loading"), + ("PYTEST_DEBUG", "set to enable debug tracing of pytest's internals"), + ] + for name, help in vars: + tw.line(" {:<24} {}".format(name, help)) + tw.line() + tw.line() + + tw.line("to see available markers type: pytest --markers") + tw.line("to see available fixtures type: pytest --fixtures") + tw.line( + "(shown according to specified file_or_dir or current dir " + "if not specified; fixtures with leading '_' are only shown " + "with the '-v' option" + ) + + for warningreport in reporter.stats.get("warnings", []): + tw.line("warning : " + warningreport.message, red=True) + return + + +conftest_options = [("pytest_plugins", "list of plugin names to load")] + + +def getpluginversioninfo(config): + lines = [] + plugininfo = config.pluginmanager.list_plugin_distinfo() + if plugininfo: + lines.append("setuptools registered plugins:") + for plugin, dist in plugininfo: + loc = getattr(plugin, "__file__", repr(plugin)) + content = "{}-{} at {}".format(dist.project_name, dist.version, loc) + lines.append(" " + content) + return lines + + +def pytest_report_header(config): + lines = [] + if config.option.debug or config.option.traceconfig: + lines.append( + "using: pytest-{} pylib-{}".format(pytest.__version__, py.__version__) + ) + + verinfo = getpluginversioninfo(config) + if verinfo: + lines.extend(verinfo) + + if config.option.traceconfig: + lines.append("active plugins:") + items = config.pluginmanager.list_name_plugin() + for name, plugin in items: + if hasattr(plugin, "__file__"): + r = plugin.__file__ + else: + r = repr(plugin) + lines.append(" {:<20}: {}".format(name, r)) + return lines diff --git a/contrib/python/pytest/py3/_pytest/hookspec.py b/contrib/python/pytest/py3/_pytest/hookspec.py new file mode 100644 index 00000000000..1e16d092d0b --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/hookspec.py @@ -0,0 +1,648 @@ +""" hook specifications for pytest plugins, invoked from main.py and builtin plugins. """ +from typing import Any +from typing import Optional + +from pluggy import HookspecMarker + +from .deprecated import COLLECT_DIRECTORY_HOOK +from _pytest.compat import TYPE_CHECKING + +if TYPE_CHECKING: + from _pytest.main import Session + + +hookspec = HookspecMarker("pytest") + +# ------------------------------------------------------------------------- +# Initialization hooks called for every plugin +# ------------------------------------------------------------------------- + + +@hookspec(historic=True) +def pytest_addhooks(pluginmanager): + """called at plugin registration time to allow adding new hooks via a call to + ``pluginmanager.add_hookspecs(module_or_class, prefix)``. + + + :param _pytest.config.PytestPluginManager pluginmanager: pytest plugin manager + + .. note:: + This hook is incompatible with ``hookwrapper=True``. + """ + + +@hookspec(historic=True) +def pytest_plugin_registered(plugin, manager): + """ a new pytest plugin got registered. + + :param plugin: the plugin module or instance + :param _pytest.config.PytestPluginManager manager: pytest plugin manager + + .. note:: + This hook is incompatible with ``hookwrapper=True``. + """ + + +@hookspec(historic=True) +def pytest_addoption(parser, pluginmanager): + """register argparse-style options and ini-style config values, + called once at the beginning of a test run. + + .. note:: + + This function should be implemented only in plugins or ``conftest.py`` + files situated at the tests root directory due to how pytest + :ref:`discovers plugins during startup <pluginorder>`. + + :arg _pytest.config.argparsing.Parser parser: To add command line options, call + :py:func:`parser.addoption(...) <_pytest.config.argparsing.Parser.addoption>`. + To add ini-file values call :py:func:`parser.addini(...) + <_pytest.config.argparsing.Parser.addini>`. + + :arg _pytest.config.PytestPluginManager pluginmanager: pytest plugin manager, + which can be used to install :py:func:`hookspec`'s or :py:func:`hookimpl`'s + and allow one plugin to call another plugin's hooks to change how + command line options are added. + + Options can later be accessed through the + :py:class:`config <_pytest.config.Config>` object, respectively: + + - :py:func:`config.getoption(name) <_pytest.config.Config.getoption>` to + retrieve the value of a command line option. + + - :py:func:`config.getini(name) <_pytest.config.Config.getini>` to retrieve + a value read from an ini-style file. + + The config object is passed around on many internal objects via the ``.config`` + attribute or can be retrieved as the ``pytestconfig`` fixture. + + .. note:: + This hook is incompatible with ``hookwrapper=True``. + """ + + +@hookspec(historic=True) +def pytest_configure(config): + """ + Allows plugins and conftest files to perform initial configuration. + + This hook is called for every plugin and initial conftest file + after command line options have been parsed. + + After that, the hook is called for other conftest files as they are + imported. + + .. note:: + This hook is incompatible with ``hookwrapper=True``. + + :arg _pytest.config.Config config: pytest config object + """ + + +# ------------------------------------------------------------------------- +# Bootstrapping hooks called for plugins registered early enough: +# internal and 3rd party plugins. +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_cmdline_parse(pluginmanager, args): + """return initialized config object, parsing the specified args. + + Stops at first non-None result, see :ref:`firstresult` + + .. note:: + This hook will only be called for plugin classes passed to the ``plugins`` arg when using `pytest.main`_ to + perform an in-process test run. + + :param _pytest.config.PytestPluginManager pluginmanager: pytest plugin manager + :param list[str] args: list of arguments passed on the command line + """ + + +def pytest_cmdline_preparse(config, args): + """(**Deprecated**) modify command line arguments before option parsing. + + This hook is considered deprecated and will be removed in a future pytest version. Consider + using :func:`pytest_load_initial_conftests` instead. + + .. note:: + This hook will not be called for ``conftest.py`` files, only for setuptools plugins. + + :param _pytest.config.Config config: pytest config object + :param list[str] args: list of arguments passed on the command line + """ + + +@hookspec(firstresult=True) +def pytest_cmdline_main(config): + """ called for performing the main command line action. The default + implementation will invoke the configure hooks and runtest_mainloop. + + .. note:: + This hook will not be called for ``conftest.py`` files, only for setuptools plugins. + + Stops at first non-None result, see :ref:`firstresult` + + :param _pytest.config.Config config: pytest config object + """ + + +def pytest_load_initial_conftests(early_config, parser, args): + """ implements the loading of initial conftest files ahead + of command line option parsing. + + .. note:: + This hook will not be called for ``conftest.py`` files, only for setuptools plugins. + + :param _pytest.config.Config early_config: pytest config object + :param list[str] args: list of arguments passed on the command line + :param _pytest.config.argparsing.Parser parser: to add command line options + """ + + +# ------------------------------------------------------------------------- +# collection hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_collection(session: "Session") -> Optional[Any]: + """Perform the collection protocol for the given session. + + Stops at first non-None result, see :ref:`firstresult`. + + :param _pytest.main.Session session: the pytest session object + """ + + +def pytest_collection_modifyitems(session, config, items): + """ called after collection has been performed, may filter or re-order + the items in-place. + + :param _pytest.main.Session session: the pytest session object + :param _pytest.config.Config config: pytest config object + :param List[_pytest.nodes.Item] items: list of item objects + """ + + +def pytest_collection_finish(session): + """ called after collection has been performed and modified. + + :param _pytest.main.Session session: the pytest session object + """ + + +@hookspec(firstresult=True) +def pytest_ignore_collect(path, config): + """ return True to prevent considering this path for collection. + This hook is consulted for all files and directories prior to calling + more specific hooks. + + Stops at first non-None result, see :ref:`firstresult` + + :param path: a :py:class:`py.path.local` - the path to analyze + :param _pytest.config.Config config: pytest config object + """ + + +@hookspec(firstresult=True, warn_on_impl=COLLECT_DIRECTORY_HOOK) +def pytest_collect_directory(path, parent): + """ called before traversing a directory for collection files. + + Stops at first non-None result, see :ref:`firstresult` + + :param path: a :py:class:`py.path.local` - the path to analyze + """ + + +def pytest_collect_file(path, parent): + """ return collection Node or None for the given path. Any new node + needs to have the specified ``parent`` as a parent. + + :param path: a :py:class:`py.path.local` - the path to collect + """ + + +# logging hooks for collection + + +def pytest_collectstart(collector): + """ collector starts collecting. """ + + +def pytest_itemcollected(item): + """ we just collected a test item. """ + + +def pytest_collectreport(report): + """ collector finished collecting. """ + + +def pytest_deselected(items): + """ called for test items deselected, e.g. by keyword. """ + + +@hookspec(firstresult=True) +def pytest_make_collect_report(collector): + """ perform ``collector.collect()`` and return a CollectReport. + + Stops at first non-None result, see :ref:`firstresult` """ + + +# ------------------------------------------------------------------------- +# Python test function related hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_pycollect_makemodule(path, parent): + """ return a Module collector or None for the given path. + This hook will be called for each matching test module path. + The pytest_collect_file hook needs to be used if you want to + create test modules for files that do not match as a test module. + + Stops at first non-None result, see :ref:`firstresult` + + :param path: a :py:class:`py.path.local` - the path of module to collect + """ + + +@hookspec(firstresult=True) +def pytest_pycollect_makeitem(collector, name, obj): + """ return custom item/collector for a python object in a module, or None. + + Stops at first non-None result, see :ref:`firstresult` """ + + +@hookspec(firstresult=True) +def pytest_pyfunc_call(pyfuncitem): + """ call underlying test function. + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_generate_tests(metafunc): + """ generate (multiple) parametrized calls to a test function.""" + + +@hookspec(firstresult=True) +def pytest_make_parametrize_id(config, val, argname): + """Return a user-friendly string representation of the given ``val`` that will be used + by @pytest.mark.parametrize calls. Return None if the hook doesn't know about ``val``. + The parameter name is available as ``argname``, if required. + + Stops at first non-None result, see :ref:`firstresult` + + :param _pytest.config.Config config: pytest config object + :param val: the parametrized value + :param str argname: the automatic parameter name produced by pytest + """ + + +# ------------------------------------------------------------------------- +# generic runtest related hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_runtestloop(session): + """ called for performing the main runtest loop + (after collection finished). + + Stops at first non-None result, see :ref:`firstresult` + + :param _pytest.main.Session session: the pytest session object + """ + + +@hookspec(firstresult=True) +def pytest_runtest_protocol(item, nextitem): + """ implements the runtest_setup/call/teardown protocol for + the given test item, including capturing exceptions and calling + reporting hooks. + + :arg item: test item for which the runtest protocol is performed. + + :arg nextitem: the scheduled-to-be-next test item (or None if this + is the end my friend). This argument is passed on to + :py:func:`pytest_runtest_teardown`. + + :return boolean: True if no further hook implementations should be invoked. + + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_runtest_logstart(nodeid, location): + """ signal the start of running a single test item. + + This hook will be called **before** :func:`pytest_runtest_setup`, :func:`pytest_runtest_call` and + :func:`pytest_runtest_teardown` hooks. + + :param str nodeid: full id of the item + :param location: a triple of ``(filename, linenum, testname)`` + """ + + +def pytest_runtest_logfinish(nodeid, location): + """ signal the complete finish of running a single test item. + + This hook will be called **after** :func:`pytest_runtest_setup`, :func:`pytest_runtest_call` and + :func:`pytest_runtest_teardown` hooks. + + :param str nodeid: full id of the item + :param location: a triple of ``(filename, linenum, testname)`` + """ + + +def pytest_runtest_setup(item): + """ called before ``pytest_runtest_call(item)``. """ + + +def pytest_runtest_call(item): + """ called to execute the test ``item``. """ + + +def pytest_runtest_teardown(item, nextitem): + """ called after ``pytest_runtest_call``. + + :arg nextitem: the scheduled-to-be-next test item (None if no further + test item is scheduled). This argument can be used to + perform exact teardowns, i.e. calling just enough finalizers + so that nextitem only needs to call setup-functions. + """ + + +@hookspec(firstresult=True) +def pytest_runtest_makereport(item, call): + """ return a :py:class:`_pytest.runner.TestReport` object + for the given :py:class:`pytest.Item <_pytest.main.Item>` and + :py:class:`_pytest.runner.CallInfo`. + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_runtest_logreport(report): + """ process a test setup/call/teardown report relating to + the respective phase of executing a test. """ + + +@hookspec(firstresult=True) +def pytest_report_to_serializable(config, report): + """ + Serializes the given report object into a data structure suitable for sending + over the wire, e.g. converted to JSON. + """ + + +@hookspec(firstresult=True) +def pytest_report_from_serializable(config, data): + """ + Restores a report object previously serialized with pytest_report_to_serializable(). + """ + + +# ------------------------------------------------------------------------- +# Fixture related hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_fixture_setup(fixturedef, request): + """ performs fixture setup execution. + + :return: The return value of the call to the fixture function + + Stops at first non-None result, see :ref:`firstresult` + + .. note:: + If the fixture function returns None, other implementations of + this hook function will continue to be called, according to the + behavior of the :ref:`firstresult` option. + """ + + +def pytest_fixture_post_finalizer(fixturedef, request): + """Called after fixture teardown, but before the cache is cleared, so + the fixture result ``fixturedef.cached_result`` is still available (not + ``None``).""" + + +# ------------------------------------------------------------------------- +# test session related hooks +# ------------------------------------------------------------------------- + + +def pytest_sessionstart(session): + """ called after the ``Session`` object has been created and before performing collection + and entering the run test loop. + + :param _pytest.main.Session session: the pytest session object + """ + + +def pytest_sessionfinish(session, exitstatus): + """ called after whole test run finished, right before returning the exit status to the system. + + :param _pytest.main.Session session: the pytest session object + :param int exitstatus: the status which pytest will return to the system + """ + + +def pytest_unconfigure(config): + """ called before test process is exited. + + :param _pytest.config.Config config: pytest config object + """ + + +# ------------------------------------------------------------------------- +# hooks for customizing the assert methods +# ------------------------------------------------------------------------- + + +def pytest_assertrepr_compare(config, op, left, right): + """return explanation for comparisons in failing assert expressions. + + Return None for no custom explanation, otherwise return a list + of strings. The strings will be joined by newlines but any newlines + *in* a string will be escaped. Note that all but the first line will + be indented slightly, the intention is for the first line to be a summary. + + :param _pytest.config.Config config: pytest config object + """ + + +def pytest_assertion_pass(item, lineno, orig, expl): + """ + **(Experimental)** + + .. versionadded:: 5.0 + + Hook called whenever an assertion *passes*. + + Use this hook to do some processing after a passing assertion. + The original assertion information is available in the `orig` string + and the pytest introspected assertion information is available in the + `expl` string. + + This hook must be explicitly enabled by the ``enable_assertion_pass_hook`` + ini-file option: + + .. code-block:: ini + + [pytest] + enable_assertion_pass_hook=true + + You need to **clean the .pyc** files in your project directory and interpreter libraries + when enabling this option, as assertions will require to be re-written. + + :param _pytest.nodes.Item item: pytest item object of current test + :param int lineno: line number of the assert statement + :param string orig: string with original assertion + :param string expl: string with assert explanation + + .. note:: + + This hook is **experimental**, so its parameters or even the hook itself might + be changed/removed without warning in any future pytest release. + + If you find this hook useful, please share your feedback opening an issue. + """ + + +# ------------------------------------------------------------------------- +# hooks for influencing reporting (invoked from _pytest_terminal) +# ------------------------------------------------------------------------- + + +def pytest_report_header(config, startdir): + """ return a string or list of strings to be displayed as header info for terminal reporting. + + :param _pytest.config.Config config: pytest config object + :param startdir: py.path object with the starting dir + + .. note:: + + This function should be implemented only in plugins or ``conftest.py`` + files situated at the tests root directory due to how pytest + :ref:`discovers plugins during startup <pluginorder>`. + """ + + +def pytest_report_collectionfinish(config, startdir, items): + """ + .. versionadded:: 3.2 + + return a string or list of strings to be displayed after collection has finished successfully. + + This strings will be displayed after the standard "collected X items" message. + + :param _pytest.config.Config config: pytest config object + :param startdir: py.path object with the starting dir + :param items: list of pytest items that are going to be executed; this list should not be modified. + """ + + +@hookspec(firstresult=True) +def pytest_report_teststatus(report, config): + """ return result-category, shortletter and verbose word for reporting. + + :param _pytest.config.Config config: pytest config object + + Stops at first non-None result, see :ref:`firstresult` """ + + +def pytest_terminal_summary(terminalreporter, exitstatus, config): + """Add a section to terminal summary reporting. + + :param _pytest.terminal.TerminalReporter terminalreporter: the internal terminal reporter object + :param int exitstatus: the exit status that will be reported back to the OS + :param _pytest.config.Config config: pytest config object + + .. versionadded:: 4.2 + The ``config`` parameter. + """ + + +@hookspec(historic=True) +def pytest_warning_captured(warning_message, when, item, location): + """ + Process a warning captured by the internal pytest warnings plugin. + + :param warnings.WarningMessage warning_message: + The captured warning. This is the same object produced by :py:func:`warnings.catch_warnings`, and contains + the same attributes as the parameters of :py:func:`warnings.showwarning`. + + :param str when: + Indicates when the warning was captured. Possible values: + + * ``"config"``: during pytest configuration/initialization stage. + * ``"collect"``: during test collection. + * ``"runtest"``: during test execution. + + :param pytest.Item|None item: + **DEPRECATED**: This parameter is incompatible with ``pytest-xdist``, and will always receive ``None`` + in a future release. + + The item being executed if ``when`` is ``"runtest"``, otherwise ``None``. + + :param tuple location: + Holds information about the execution context of the captured warning (filename, linenumber, function). + ``function`` evaluates to <module> when the execution context is at the module level. + """ + + +# ------------------------------------------------------------------------- +# doctest hooks +# ------------------------------------------------------------------------- + + +@hookspec(firstresult=True) +def pytest_doctest_prepare_content(content): + """ return processed content for a given doctest + + Stops at first non-None result, see :ref:`firstresult` """ + + +# ------------------------------------------------------------------------- +# error handling and internal debugging hooks +# ------------------------------------------------------------------------- + + +def pytest_internalerror(excrepr, excinfo): + """ called for internal errors. """ + + +def pytest_keyboard_interrupt(excinfo): + """ called for keyboard interrupt. """ + + +def pytest_exception_interact(node, call, report): + """called when an exception was raised which can potentially be + interactively handled. + + This hook is only called if an exception was raised + that is not an internal exception like ``skip.Exception``. + """ + + +def pytest_enter_pdb(config, pdb): + """ called upon pdb.set_trace(), can be used by plugins to take special + action just before the python debugger enters in interactive mode. + + :param _pytest.config.Config config: pytest config object + :param pdb.Pdb pdb: Pdb instance + """ + + +def pytest_leave_pdb(config, pdb): + """ called when leaving pdb (e.g. with continue after pdb.set_trace()). + + Can be used by plugins to take special action just after the python + debugger leaves interactive mode. + + :param _pytest.config.Config config: pytest config object + :param pdb.Pdb pdb: Pdb instance + """ diff --git a/contrib/python/pytest/py3/_pytest/junitxml.py b/contrib/python/pytest/py3/_pytest/junitxml.py new file mode 100644 index 00000000000..77e1843127a --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/junitxml.py @@ -0,0 +1,682 @@ +""" + report test results in JUnit-XML format, + for use with Jenkins and build integration servers. + + +Based on initial code from Ross Lawley. + +Output conforms to https://github.com/jenkinsci/xunit-plugin/blob/master/ +src/main/resources/org/jenkinsci/plugins/xunit/types/model/xsd/junit-10.xsd +""" +import functools +import os +import platform +import re +import sys +import time +from datetime import datetime + +import py + +import pytest +from _pytest import deprecated +from _pytest import nodes +from _pytest.config import filename_arg +from _pytest.store import StoreKey +from _pytest.warnings import _issue_warning_captured + + +xml_key = StoreKey["LogXML"]() + + +class Junit(py.xml.Namespace): + pass + + +# We need to get the subset of the invalid unicode ranges according to +# XML 1.0 which are valid in this python build. Hence we calculate +# this dynamically instead of hardcoding it. The spec range of valid +# chars is: Char ::= #x9 | #xA | #xD | [#x20-#xD7FF] | [#xE000-#xFFFD] +# | [#x10000-#x10FFFF] +_legal_chars = (0x09, 0x0A, 0x0D) +_legal_ranges = ((0x20, 0x7E), (0x80, 0xD7FF), (0xE000, 0xFFFD), (0x10000, 0x10FFFF)) +_legal_xml_re = [ + "{}-{}".format(chr(low), chr(high)) + for (low, high) in _legal_ranges + if low < sys.maxunicode +] +_legal_xml_re = [chr(x) for x in _legal_chars] + _legal_xml_re +illegal_xml_re = re.compile("[^%s]" % "".join(_legal_xml_re)) +del _legal_chars +del _legal_ranges +del _legal_xml_re + +_py_ext_re = re.compile(r"\.py$") + + +def bin_xml_escape(arg): + def repl(matchobj): + i = ord(matchobj.group()) + if i <= 0xFF: + return "#x%02X" % i + else: + return "#x%04X" % i + + return py.xml.raw(illegal_xml_re.sub(repl, py.xml.escape(arg))) + + +def merge_family(left, right): + result = {} + for kl, vl in left.items(): + for kr, vr in right.items(): + if not isinstance(vl, list): + raise TypeError(type(vl)) + result[kl] = vl + vr + left.update(result) + + +families = {} +families["_base"] = {"testcase": ["classname", "name"]} +families["_base_legacy"] = {"testcase": ["file", "line", "url"]} + +# xUnit 1.x inherits legacy attributes +families["xunit1"] = families["_base"].copy() +merge_family(families["xunit1"], families["_base_legacy"]) + +# xUnit 2.x uses strict base attributes +families["xunit2"] = families["_base"] + + +class _NodeReporter: + def __init__(self, nodeid, xml): + self.id = nodeid + self.xml = xml + self.add_stats = self.xml.add_stats + self.family = self.xml.family + self.duration = 0 + self.properties = [] + self.nodes = [] + self.testcase = None + self.attrs = {} + + def append(self, node): + self.xml.add_stats(type(node).__name__) + self.nodes.append(node) + + def add_property(self, name, value): + self.properties.append((str(name), bin_xml_escape(value))) + + def add_attribute(self, name, value): + self.attrs[str(name)] = bin_xml_escape(value) + + def make_properties_node(self): + """Return a Junit node containing custom properties, if any. + """ + if self.properties: + return Junit.properties( + [ + Junit.property(name=name, value=value) + for name, value in self.properties + ] + ) + return "" + + def record_testreport(self, testreport): + assert not self.testcase + names = mangle_test_address(testreport.nodeid) + existing_attrs = self.attrs + classnames = names[:-1] + if self.xml.prefix: + classnames.insert(0, self.xml.prefix) + attrs = { + "classname": ".".join(classnames), + "name": bin_xml_escape(names[-1]), + "file": testreport.location[0], + } + if testreport.location[1] is not None: + attrs["line"] = testreport.location[1] + if hasattr(testreport, "url"): + attrs["url"] = testreport.url + self.attrs = attrs + self.attrs.update(existing_attrs) # restore any user-defined attributes + + # Preserve legacy testcase behavior + if self.family == "xunit1": + return + + # Filter out attributes not permitted by this test family. + # Including custom attributes because they are not valid here. + temp_attrs = {} + for key in self.attrs.keys(): + if key in families[self.family]["testcase"]: + temp_attrs[key] = self.attrs[key] + self.attrs = temp_attrs + + def to_xml(self): + testcase = Junit.testcase(time="%.3f" % self.duration, **self.attrs) + testcase.append(self.make_properties_node()) + for node in self.nodes: + testcase.append(node) + return testcase + + def _add_simple(self, kind, message, data=None): + data = bin_xml_escape(data) + node = kind(data, message=message) + self.append(node) + + def write_captured_output(self, report): + if not self.xml.log_passing_tests and report.passed: + return + + content_out = report.capstdout + content_log = report.caplog + content_err = report.capstderr + if self.xml.logging == "no": + return + content_all = "" + if self.xml.logging in ["log", "all"]: + content_all = self._prepare_content(content_log, " Captured Log ") + if self.xml.logging in ["system-out", "out-err", "all"]: + content_all += self._prepare_content(content_out, " Captured Out ") + self._write_content(report, content_all, "system-out") + content_all = "" + if self.xml.logging in ["system-err", "out-err", "all"]: + content_all += self._prepare_content(content_err, " Captured Err ") + self._write_content(report, content_all, "system-err") + content_all = "" + if content_all: + self._write_content(report, content_all, "system-out") + + def _prepare_content(self, content, header): + return "\n".join([header.center(80, "-"), content, ""]) + + def _write_content(self, report, content, jheader): + tag = getattr(Junit, jheader) + self.append(tag(bin_xml_escape(content))) + + def append_pass(self, report): + self.add_stats("passed") + + def append_failure(self, report): + # msg = str(report.longrepr.reprtraceback.extraline) + if hasattr(report, "wasxfail"): + self._add_simple(Junit.skipped, "xfail-marked test passes unexpectedly") + else: + if hasattr(report.longrepr, "reprcrash"): + message = report.longrepr.reprcrash.message + elif isinstance(report.longrepr, str): + message = report.longrepr + else: + message = str(report.longrepr) + message = bin_xml_escape(message) + fail = Junit.failure(message=message) + fail.append(bin_xml_escape(report.longrepr)) + self.append(fail) + + def append_collect_error(self, report): + # msg = str(report.longrepr.reprtraceback.extraline) + self.append( + Junit.error(bin_xml_escape(report.longrepr), message="collection failure") + ) + + def append_collect_skipped(self, report): + self._add_simple(Junit.skipped, "collection skipped", report.longrepr) + + def append_error(self, report): + if report.when == "teardown": + msg = "test teardown failure" + else: + msg = "test setup failure" + self._add_simple(Junit.error, msg, report.longrepr) + + def append_skipped(self, report): + if hasattr(report, "wasxfail"): + xfailreason = report.wasxfail + if xfailreason.startswith("reason: "): + xfailreason = xfailreason[8:] + self.append( + Junit.skipped( + "", type="pytest.xfail", message=bin_xml_escape(xfailreason) + ) + ) + else: + filename, lineno, skipreason = report.longrepr + if skipreason.startswith("Skipped: "): + skipreason = skipreason[9:] + details = "{}:{}: {}".format(filename, lineno, skipreason) + + self.append( + Junit.skipped( + bin_xml_escape(details), + type="pytest.skip", + message=bin_xml_escape(skipreason), + ) + ) + self.write_captured_output(report) + + def finalize(self): + data = self.to_xml().unicode(indent=0) + self.__dict__.clear() + self.to_xml = lambda: py.xml.raw(data) + + +def _warn_incompatibility_with_xunit2(request, fixture_name): + """Emits a PytestWarning about the given fixture being incompatible with newer xunit revisions""" + from _pytest.warning_types import PytestWarning + + xml = request.config._store.get(xml_key, None) + if xml is not None and xml.family not in ("xunit1", "legacy"): + request.node.warn( + PytestWarning( + "{fixture_name} is incompatible with junit_family '{family}' (use 'legacy' or 'xunit1')".format( + fixture_name=fixture_name, family=xml.family + ) + ) + ) + + +@pytest.fixture +def record_property(request): + """Add an extra properties the calling test. + User properties become part of the test report and are available to the + configured reporters, like JUnit XML. + The fixture is callable with ``(name, value)``, with value being automatically + xml-encoded. + + Example:: + + def test_function(record_property): + record_property("example_key", 1) + """ + _warn_incompatibility_with_xunit2(request, "record_property") + + def append_property(name, value): + request.node.user_properties.append((name, value)) + + return append_property + + +@pytest.fixture +def record_xml_attribute(request): + """Add extra xml attributes to the tag for the calling test. + The fixture is callable with ``(name, value)``, with value being + automatically xml-encoded + """ + from _pytest.warning_types import PytestExperimentalApiWarning + + request.node.warn( + PytestExperimentalApiWarning("record_xml_attribute is an experimental feature") + ) + + _warn_incompatibility_with_xunit2(request, "record_xml_attribute") + + # Declare noop + def add_attr_noop(name, value): + pass + + attr_func = add_attr_noop + + xml = request.config._store.get(xml_key, None) + if xml is not None: + node_reporter = xml.node_reporter(request.node.nodeid) + attr_func = node_reporter.add_attribute + + return attr_func + + +def _check_record_param_type(param, v): + """Used by record_testsuite_property to check that the given parameter name is of the proper + type""" + __tracebackhide__ = True + if not isinstance(v, str): + msg = "{param} parameter needs to be a string, but {g} given" + raise TypeError(msg.format(param=param, g=type(v).__name__)) + + +@pytest.fixture(scope="session") +def record_testsuite_property(request): + """ + Records a new ``<property>`` tag as child of the root ``<testsuite>``. This is suitable to + writing global information regarding the entire test suite, and is compatible with ``xunit2`` JUnit family. + + This is a ``session``-scoped fixture which is called with ``(name, value)``. Example: + + .. code-block:: python + + def test_foo(record_testsuite_property): + record_testsuite_property("ARCH", "PPC") + record_testsuite_property("STORAGE_TYPE", "CEPH") + + ``name`` must be a string, ``value`` will be converted to a string and properly xml-escaped. + """ + + __tracebackhide__ = True + + def record_func(name, value): + """noop function in case --junitxml was not passed in the command-line""" + __tracebackhide__ = True + _check_record_param_type("name", name) + + xml = request.config._store.get(xml_key, None) + if xml is not None: + record_func = xml.add_global_property # noqa + return record_func + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting") + group.addoption( + "--junitxml", + "--junit-xml", + action="store", + dest="xmlpath", + metavar="path", + type=functools.partial(filename_arg, optname="--junitxml"), + default=None, + help="create junit-xml style report file at given path.", + ) + group.addoption( + "--junitprefix", + "--junit-prefix", + action="store", + metavar="str", + default=None, + help="prepend prefix to classnames in junit-xml output", + ) + parser.addini( + "junit_suite_name", "Test suite name for JUnit report", default="pytest" + ) + parser.addini( + "junit_logging", + "Write captured log messages to JUnit report: " + "one of no|log|system-out|system-err|out-err|all", + default="no", + ) + parser.addini( + "junit_log_passing_tests", + "Capture log information for passing tests to JUnit report: ", + type="bool", + default=True, + ) + parser.addini( + "junit_duration_report", + "Duration time to report: one of total|call", + default="total", + ) # choices=['total', 'call']) + parser.addini( + "junit_family", "Emit XML for schema: one of legacy|xunit1|xunit2", default=None + ) + + +def pytest_configure(config): + xmlpath = config.option.xmlpath + # prevent opening xmllog on slave nodes (xdist) + if xmlpath and not hasattr(config, "slaveinput"): + junit_family = config.getini("junit_family") + if not junit_family: + _issue_warning_captured(deprecated.JUNIT_XML_DEFAULT_FAMILY, config.hook, 2) + junit_family = "xunit1" + config._store[xml_key] = LogXML( + xmlpath, + config.option.junitprefix, + config.getini("junit_suite_name"), + config.getini("junit_logging"), + config.getini("junit_duration_report"), + junit_family, + config.getini("junit_log_passing_tests"), + ) + config.pluginmanager.register(config._store[xml_key]) + + +def pytest_unconfigure(config): + xml = config._store.get(xml_key, None) + if xml: + del config._store[xml_key] + config.pluginmanager.unregister(xml) + + +def mangle_test_address(address): + path, possible_open_bracket, params = address.partition("[") + names = path.split("::") + try: + names.remove("()") + except ValueError: + pass + # convert file path to dotted path + names[0] = names[0].replace(nodes.SEP, ".") + names[0] = _py_ext_re.sub("", names[0]) + # put any params back + names[-1] += possible_open_bracket + params + return names + + +class LogXML: + def __init__( + self, + logfile, + prefix, + suite_name="pytest", + logging="no", + report_duration="total", + family="xunit1", + log_passing_tests=True, + ): + logfile = os.path.expanduser(os.path.expandvars(logfile)) + self.logfile = os.path.normpath(os.path.abspath(logfile)) + self.prefix = prefix + self.suite_name = suite_name + self.logging = logging + self.log_passing_tests = log_passing_tests + self.report_duration = report_duration + self.family = family + self.stats = dict.fromkeys(["error", "passed", "failure", "skipped"], 0) + self.node_reporters = {} # nodeid -> _NodeReporter + self.node_reporters_ordered = [] + self.global_properties = [] + + # List of reports that failed on call but teardown is pending. + self.open_reports = [] + self.cnt_double_fail_tests = 0 + + # Replaces convenience family with real family + if self.family == "legacy": + self.family = "xunit1" + + def finalize(self, report): + nodeid = getattr(report, "nodeid", report) + # local hack to handle xdist report order + slavenode = getattr(report, "node", None) + reporter = self.node_reporters.pop((nodeid, slavenode)) + if reporter is not None: + reporter.finalize() + + def node_reporter(self, report): + nodeid = getattr(report, "nodeid", report) + # local hack to handle xdist report order + slavenode = getattr(report, "node", None) + + key = nodeid, slavenode + + if key in self.node_reporters: + # TODO: breaks for --dist=each + return self.node_reporters[key] + + reporter = _NodeReporter(nodeid, self) + + self.node_reporters[key] = reporter + self.node_reporters_ordered.append(reporter) + + return reporter + + def add_stats(self, key): + if key in self.stats: + self.stats[key] += 1 + + def _opentestcase(self, report): + reporter = self.node_reporter(report) + reporter.record_testreport(report) + return reporter + + def pytest_runtest_logreport(self, report): + """handle a setup/call/teardown report, generating the appropriate + xml tags as necessary. + + note: due to plugins like xdist, this hook may be called in interlaced + order with reports from other nodes. for example: + + usual call order: + -> setup node1 + -> call node1 + -> teardown node1 + -> setup node2 + -> call node2 + -> teardown node2 + + possible call order in xdist: + -> setup node1 + -> call node1 + -> setup node2 + -> call node2 + -> teardown node2 + -> teardown node1 + """ + close_report = None + if report.passed: + if report.when == "call": # ignore setup/teardown + reporter = self._opentestcase(report) + reporter.append_pass(report) + elif report.failed: + if report.when == "teardown": + # The following vars are needed when xdist plugin is used + report_wid = getattr(report, "worker_id", None) + report_ii = getattr(report, "item_index", None) + close_report = next( + ( + rep + for rep in self.open_reports + if ( + rep.nodeid == report.nodeid + and getattr(rep, "item_index", None) == report_ii + and getattr(rep, "worker_id", None) == report_wid + ) + ), + None, + ) + if close_report: + # We need to open new testcase in case we have failure in + # call and error in teardown in order to follow junit + # schema + self.finalize(close_report) + self.cnt_double_fail_tests += 1 + reporter = self._opentestcase(report) + if report.when == "call": + reporter.append_failure(report) + self.open_reports.append(report) + if not self.log_passing_tests: + reporter.write_captured_output(report) + else: + reporter.append_error(report) + elif report.skipped: + reporter = self._opentestcase(report) + reporter.append_skipped(report) + self.update_testcase_duration(report) + if report.when == "teardown": + reporter = self._opentestcase(report) + reporter.write_captured_output(report) + + for propname, propvalue in report.user_properties: + reporter.add_property(propname, propvalue) + + self.finalize(report) + report_wid = getattr(report, "worker_id", None) + report_ii = getattr(report, "item_index", None) + close_report = next( + ( + rep + for rep in self.open_reports + if ( + rep.nodeid == report.nodeid + and getattr(rep, "item_index", None) == report_ii + and getattr(rep, "worker_id", None) == report_wid + ) + ), + None, + ) + if close_report: + self.open_reports.remove(close_report) + + def update_testcase_duration(self, report): + """accumulates total duration for nodeid from given report and updates + the Junit.testcase with the new total if already created. + """ + if self.report_duration == "total" or report.when == self.report_duration: + reporter = self.node_reporter(report) + reporter.duration += getattr(report, "duration", 0.0) + + def pytest_collectreport(self, report): + if not report.passed: + reporter = self._opentestcase(report) + if report.failed: + reporter.append_collect_error(report) + else: + reporter.append_collect_skipped(report) + + def pytest_internalerror(self, excrepr): + reporter = self.node_reporter("internal") + reporter.attrs.update(classname="pytest", name="internal") + reporter._add_simple(Junit.error, "internal error", excrepr) + + def pytest_sessionstart(self): + self.suite_start_time = time.time() + + def pytest_sessionfinish(self): + dirname = os.path.dirname(os.path.abspath(self.logfile)) + if not os.path.isdir(dirname): + os.makedirs(dirname) + logfile = open(self.logfile, "w", encoding="utf-8") + suite_stop_time = time.time() + suite_time_delta = suite_stop_time - self.suite_start_time + + numtests = ( + self.stats["passed"] + + self.stats["failure"] + + self.stats["skipped"] + + self.stats["error"] + - self.cnt_double_fail_tests + ) + logfile.write('<?xml version="1.0" encoding="utf-8"?>') + + suite_node = Junit.testsuite( + self._get_global_properties_node(), + [x.to_xml() for x in self.node_reporters_ordered], + name=self.suite_name, + errors=self.stats["error"], + failures=self.stats["failure"], + skipped=self.stats["skipped"], + tests=numtests, + time="%.3f" % suite_time_delta, + timestamp=datetime.fromtimestamp(self.suite_start_time).isoformat(), + hostname=platform.node(), + ) + logfile.write(Junit.testsuites([suite_node]).unicode(indent=0)) + logfile.close() + + def pytest_terminal_summary(self, terminalreporter): + terminalreporter.write_sep("-", "generated xml file: %s" % (self.logfile)) + + def add_global_property(self, name, value): + __tracebackhide__ = True + _check_record_param_type("name", name) + self.global_properties.append((name, bin_xml_escape(value))) + + def _get_global_properties_node(self): + """Return a Junit node containing custom properties, if any. + """ + if self.global_properties: + return Junit.properties( + [ + Junit.property(name=name, value=value) + for name, value in self.global_properties + ] + ) + return "" diff --git a/contrib/python/pytest/py3/_pytest/logging.py b/contrib/python/pytest/py3/_pytest/logging.py new file mode 100644 index 00000000000..5e60a232172 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/logging.py @@ -0,0 +1,787 @@ +""" Access and control log capturing. """ +import logging +import re +from contextlib import contextmanager +from io import StringIO +from typing import AbstractSet +from typing import Dict +from typing import Generator +from typing import List +from typing import Mapping +from typing import Optional + +import pytest +from _pytest import nodes +from _pytest.compat import nullcontext +from _pytest.config import _strtobool +from _pytest.config import Config +from _pytest.config import create_terminal_writer +from _pytest.pathlib import Path + +DEFAULT_LOG_FORMAT = "%(levelname)-8s %(name)s:%(filename)s:%(lineno)d %(message)s" +DEFAULT_LOG_DATE_FORMAT = "%H:%M:%S" +_ANSI_ESCAPE_SEQ = re.compile(r"\x1b\[[\d;]+m") + + +def _remove_ansi_escape_sequences(text): + return _ANSI_ESCAPE_SEQ.sub("", text) + + +class ColoredLevelFormatter(logging.Formatter): + """ + Colorize the %(levelname)..s part of the log format passed to __init__. + """ + + LOGLEVEL_COLOROPTS = { + logging.CRITICAL: {"red"}, + logging.ERROR: {"red", "bold"}, + logging.WARNING: {"yellow"}, + logging.WARN: {"yellow"}, + logging.INFO: {"green"}, + logging.DEBUG: {"purple"}, + logging.NOTSET: set(), + } # type: Mapping[int, AbstractSet[str]] + LEVELNAME_FMT_REGEX = re.compile(r"%\(levelname\)([+-.]?\d*s)") + + def __init__(self, terminalwriter, *args, **kwargs) -> None: + super().__init__(*args, **kwargs) + self._original_fmt = self._style._fmt + self._level_to_fmt_mapping = {} # type: Dict[int, str] + + assert self._fmt is not None + levelname_fmt_match = self.LEVELNAME_FMT_REGEX.search(self._fmt) + if not levelname_fmt_match: + return + levelname_fmt = levelname_fmt_match.group() + + for level, color_opts in self.LOGLEVEL_COLOROPTS.items(): + formatted_levelname = levelname_fmt % { + "levelname": logging.getLevelName(level) + } + + # add ANSI escape sequences around the formatted levelname + color_kwargs = {name: True for name in color_opts} + colorized_formatted_levelname = terminalwriter.markup( + formatted_levelname, **color_kwargs + ) + self._level_to_fmt_mapping[level] = self.LEVELNAME_FMT_REGEX.sub( + colorized_formatted_levelname, self._fmt + ) + + def format(self, record): + fmt = self._level_to_fmt_mapping.get(record.levelno, self._original_fmt) + self._style._fmt = fmt + return super().format(record) + + +class PercentStyleMultiline(logging.PercentStyle): + """A logging style with special support for multiline messages. + + If the message of a record consists of multiple lines, this style + formats the message as if each line were logged separately. + """ + + def __init__(self, fmt, auto_indent): + super().__init__(fmt) + self._auto_indent = self._get_auto_indent(auto_indent) + + @staticmethod + def _update_message(record_dict, message): + tmp = record_dict.copy() + tmp["message"] = message + return tmp + + @staticmethod + def _get_auto_indent(auto_indent_option) -> int: + """Determines the current auto indentation setting + + Specify auto indent behavior (on/off/fixed) by passing in + extra={"auto_indent": [value]} to the call to logging.log() or + using a --log-auto-indent [value] command line or the + log_auto_indent [value] config option. + + Default behavior is auto-indent off. + + Using the string "True" or "on" or the boolean True as the value + turns auto indent on, using the string "False" or "off" or the + boolean False or the int 0 turns it off, and specifying a + positive integer fixes the indentation position to the value + specified. + + Any other values for the option are invalid, and will silently be + converted to the default. + + :param any auto_indent_option: User specified option for indentation + from command line, config or extra kwarg. Accepts int, bool or str. + str option accepts the same range of values as boolean config options, + as well as positive integers represented in str form. + + :returns: indentation value, which can be + -1 (automatically determine indentation) or + 0 (auto-indent turned off) or + >0 (explicitly set indentation position). + """ + + if type(auto_indent_option) is int: + return int(auto_indent_option) + elif type(auto_indent_option) is str: + try: + return int(auto_indent_option) + except ValueError: + pass + try: + if _strtobool(auto_indent_option): + return -1 + except ValueError: + return 0 + elif type(auto_indent_option) is bool: + if auto_indent_option: + return -1 + + return 0 + + def format(self, record): + if "\n" in record.message: + if hasattr(record, "auto_indent"): + # passed in from the "extra={}" kwarg on the call to logging.log() + auto_indent = self._get_auto_indent(record.auto_indent) + else: + auto_indent = self._auto_indent + + if auto_indent: + lines = record.message.splitlines() + formatted = self._fmt % self._update_message(record.__dict__, lines[0]) + + if auto_indent < 0: + indentation = _remove_ansi_escape_sequences(formatted).find( + lines[0] + ) + else: + # optimizes logging by allowing a fixed indentation + indentation = auto_indent + lines[0] = formatted + return ("\n" + " " * indentation).join(lines) + return self._fmt % record.__dict__ + + +def get_option_ini(config, *names): + for name in names: + ret = config.getoption(name) # 'default' arg won't work as expected + if ret is None: + ret = config.getini(name) + if ret: + return ret + + +def pytest_addoption(parser): + """Add options to control log capturing.""" + group = parser.getgroup("logging") + + def add_option_ini(option, dest, default=None, type=None, **kwargs): + parser.addini( + dest, default=default, type=type, help="default value for " + option + ) + group.addoption(option, dest=dest, **kwargs) + + add_option_ini( + "--no-print-logs", + dest="log_print", + action="store_const", + const=False, + default=True, + type="bool", + help="disable printing caught logs on failed tests.", + ) + add_option_ini( + "--log-level", + dest="log_level", + default=None, + metavar="LEVEL", + help=( + "level of messages to catch/display.\n" + "Not set by default, so it depends on the root/parent log handler's" + ' effective level, where it is "WARNING" by default.' + ), + ) + add_option_ini( + "--log-format", + dest="log_format", + default=DEFAULT_LOG_FORMAT, + help="log format as used by the logging module.", + ) + add_option_ini( + "--log-date-format", + dest="log_date_format", + default=DEFAULT_LOG_DATE_FORMAT, + help="log date format as used by the logging module.", + ) + parser.addini( + "log_cli", + default=False, + type="bool", + help='enable log display during test run (also known as "live logging").', + ) + add_option_ini( + "--log-cli-level", dest="log_cli_level", default=None, help="cli logging level." + ) + add_option_ini( + "--log-cli-format", + dest="log_cli_format", + default=None, + help="log format as used by the logging module.", + ) + add_option_ini( + "--log-cli-date-format", + dest="log_cli_date_format", + default=None, + help="log date format as used by the logging module.", + ) + add_option_ini( + "--log-file", + dest="log_file", + default=None, + help="path to a file when logging will be written to.", + ) + add_option_ini( + "--log-file-level", + dest="log_file_level", + default=None, + help="log file logging level.", + ) + add_option_ini( + "--log-file-format", + dest="log_file_format", + default=DEFAULT_LOG_FORMAT, + help="log format as used by the logging module.", + ) + add_option_ini( + "--log-file-date-format", + dest="log_file_date_format", + default=DEFAULT_LOG_DATE_FORMAT, + help="log date format as used by the logging module.", + ) + add_option_ini( + "--log-auto-indent", + dest="log_auto_indent", + default=None, + help="Auto-indent multiline messages passed to the logging module. Accepts true|on, false|off or an integer.", + ) + + +@contextmanager +def catching_logs(handler, formatter=None, level=None): + """Context manager that prepares the whole logging machinery properly.""" + root_logger = logging.getLogger() + + if formatter is not None: + handler.setFormatter(formatter) + if level is not None: + handler.setLevel(level) + + # Adding the same handler twice would confuse logging system. + # Just don't do that. + add_new_handler = handler not in root_logger.handlers + + if add_new_handler: + root_logger.addHandler(handler) + if level is not None: + orig_level = root_logger.level + root_logger.setLevel(min(orig_level, level)) + try: + yield handler + finally: + if level is not None: + root_logger.setLevel(orig_level) + if add_new_handler: + root_logger.removeHandler(handler) + + +class LogCaptureHandler(logging.StreamHandler): + """A logging handler that stores log records and the log text.""" + + def __init__(self) -> None: + """Creates a new log handler.""" + logging.StreamHandler.__init__(self, StringIO()) + self.records = [] # type: List[logging.LogRecord] + + def emit(self, record: logging.LogRecord) -> None: + """Keep the log records in a list in addition to the log text.""" + self.records.append(record) + logging.StreamHandler.emit(self, record) + + def reset(self) -> None: + self.records = [] + self.stream = StringIO() + + +class LogCaptureFixture: + """Provides access and control of log capturing.""" + + def __init__(self, item) -> None: + """Creates a new funcarg.""" + self._item = item + # dict of log name -> log level + self._initial_log_levels = {} # type: Dict[str, int] + + def _finalize(self) -> None: + """Finalizes the fixture. + + This restores the log levels changed by :meth:`set_level`. + """ + # restore log levels + for logger_name, level in self._initial_log_levels.items(): + logger = logging.getLogger(logger_name) + logger.setLevel(level) + + @property + def handler(self) -> LogCaptureHandler: + """ + :rtype: LogCaptureHandler + """ + return self._item.catch_log_handler # type: ignore[no-any-return] # noqa: F723 + + def get_records(self, when: str) -> List[logging.LogRecord]: + """ + Get the logging records for one of the possible test phases. + + :param str when: + Which test phase to obtain the records from. Valid values are: "setup", "call" and "teardown". + + :rtype: List[logging.LogRecord] + :return: the list of captured records at the given stage + + .. versionadded:: 3.4 + """ + handler = self._item.catch_log_handlers.get(when) + if handler: + return handler.records # type: ignore[no-any-return] # noqa: F723 + else: + return [] + + @property + def text(self): + """Returns the formatted log text.""" + return _remove_ansi_escape_sequences(self.handler.stream.getvalue()) + + @property + def records(self): + """Returns the list of log records.""" + return self.handler.records + + @property + def record_tuples(self): + """Returns a list of a stripped down version of log records intended + for use in assertion comparison. + + The format of the tuple is: + + (logger_name, log_level, message) + """ + return [(r.name, r.levelno, r.getMessage()) for r in self.records] + + @property + def messages(self): + """Returns a list of format-interpolated log messages. + + Unlike 'records', which contains the format string and parameters for interpolation, log messages in this list + are all interpolated. + Unlike 'text', which contains the output from the handler, log messages in this list are unadorned with + levels, timestamps, etc, making exact comparisons more reliable. + + Note that traceback or stack info (from :func:`logging.exception` or the `exc_info` or `stack_info` arguments + to the logging functions) is not included, as this is added by the formatter in the handler. + + .. versionadded:: 3.7 + """ + return [r.getMessage() for r in self.records] + + def clear(self): + """Reset the list of log records and the captured log text.""" + self.handler.reset() + + def set_level(self, level, logger=None): + """Sets the level for capturing of logs. The level will be restored to its previous value at the end of + the test. + + :param int level: the logger to level. + :param str logger: the logger to update the level. If not given, the root logger level is updated. + + .. versionchanged:: 3.4 + The levels of the loggers changed by this function will be restored to their initial values at the + end of the test. + """ + logger_name = logger + logger = logging.getLogger(logger_name) + # save the original log-level to restore it during teardown + self._initial_log_levels.setdefault(logger_name, logger.level) + logger.setLevel(level) + + @contextmanager + def at_level(self, level, logger=None): + """Context manager that sets the level for capturing of logs. After the end of the 'with' statement the + level is restored to its original value. + + :param int level: the logger to level. + :param str logger: the logger to update the level. If not given, the root logger level is updated. + """ + logger = logging.getLogger(logger) + orig_level = logger.level + logger.setLevel(level) + try: + yield + finally: + logger.setLevel(orig_level) + + +@pytest.fixture +def caplog(request): + """Access and control log capturing. + + Captured logs are available through the following properties/methods:: + + * caplog.messages -> list of format-interpolated log messages + * caplog.text -> string containing formatted log output + * caplog.records -> list of logging.LogRecord instances + * caplog.record_tuples -> list of (logger_name, level, message) tuples + * caplog.clear() -> clear captured records and formatted log output string + """ + result = LogCaptureFixture(request.node) + yield result + result._finalize() + + +def get_log_level_for_setting(config: Config, *setting_names: str) -> Optional[int]: + for setting_name in setting_names: + log_level = config.getoption(setting_name) + if log_level is None: + log_level = config.getini(setting_name) + if log_level: + break + else: + return None + + if isinstance(log_level, str): + log_level = log_level.upper() + try: + return int(getattr(logging, log_level, log_level)) + except ValueError: + # Python logging does not recognise this as a logging level + raise pytest.UsageError( + "'{}' is not recognized as a logging level name for " + "'{}'. Please consider passing the " + "logging level num instead.".format(log_level, setting_name) + ) + + +# run after terminalreporter/capturemanager are configured +@pytest.hookimpl(trylast=True) +def pytest_configure(config): + config.pluginmanager.register(LoggingPlugin(config), "logging-plugin") + + +class LoggingPlugin: + """Attaches to the logging module and captures log messages for each test. + """ + + def __init__(self, config: Config) -> None: + """Creates a new plugin to capture log messages. + + The formatter can be safely shared across all handlers so + create a single one for the entire test session here. + """ + self._config = config + + self.print_logs = get_option_ini(config, "log_print") + if not self.print_logs: + from _pytest.warnings import _issue_warning_captured + from _pytest.deprecated import NO_PRINT_LOGS + + _issue_warning_captured(NO_PRINT_LOGS, self._config.hook, stacklevel=2) + + self.formatter = self._create_formatter( + get_option_ini(config, "log_format"), + get_option_ini(config, "log_date_format"), + get_option_ini(config, "log_auto_indent"), + ) + self.log_level = get_log_level_for_setting(config, "log_level") + + self.log_file_level = get_log_level_for_setting(config, "log_file_level") + self.log_file_format = get_option_ini(config, "log_file_format", "log_format") + self.log_file_date_format = get_option_ini( + config, "log_file_date_format", "log_date_format" + ) + self.log_file_formatter = logging.Formatter( + self.log_file_format, datefmt=self.log_file_date_format + ) + + log_file = get_option_ini(config, "log_file") + if log_file: + self.log_file_handler = logging.FileHandler( + log_file, mode="w", encoding="UTF-8" + ) # type: Optional[logging.FileHandler] + self.log_file_handler.setFormatter(self.log_file_formatter) + else: + self.log_file_handler = None + + self.log_cli_handler = None + + self.live_logs_context = lambda: nullcontext() + # Note that the lambda for the live_logs_context is needed because + # live_logs_context can otherwise not be entered multiple times due + # to limitations of contextlib.contextmanager. + + if self._log_cli_enabled(): + self._setup_cli_logging() + + def _create_formatter(self, log_format, log_date_format, auto_indent): + # color option doesn't exist if terminal plugin is disabled + color = getattr(self._config.option, "color", "no") + if color != "no" and ColoredLevelFormatter.LEVELNAME_FMT_REGEX.search( + log_format + ): + formatter = ColoredLevelFormatter( + create_terminal_writer(self._config), log_format, log_date_format + ) # type: logging.Formatter + else: + formatter = logging.Formatter(log_format, log_date_format) + + formatter._style = PercentStyleMultiline( + formatter._style._fmt, auto_indent=auto_indent + ) + + return formatter + + def _setup_cli_logging(self): + config = self._config + terminal_reporter = config.pluginmanager.get_plugin("terminalreporter") + if terminal_reporter is None: + # terminal reporter is disabled e.g. by pytest-xdist. + return + + capture_manager = config.pluginmanager.get_plugin("capturemanager") + # if capturemanager plugin is disabled, live logging still works. + log_cli_handler = _LiveLoggingStreamHandler(terminal_reporter, capture_manager) + + log_cli_formatter = self._create_formatter( + get_option_ini(config, "log_cli_format", "log_format"), + get_option_ini(config, "log_cli_date_format", "log_date_format"), + get_option_ini(config, "log_auto_indent"), + ) + + log_cli_level = get_log_level_for_setting(config, "log_cli_level", "log_level") + self.log_cli_handler = log_cli_handler + self.live_logs_context = lambda: catching_logs( + log_cli_handler, formatter=log_cli_formatter, level=log_cli_level + ) + + def set_log_path(self, fname): + """Public method, which can set filename parameter for + Logging.FileHandler(). Also creates parent directory if + it does not exist. + + .. warning:: + Please considered as an experimental API. + """ + fname = Path(fname) + + if not fname.is_absolute(): + fname = Path(self._config.rootdir, fname) + + if not fname.parent.exists(): + fname.parent.mkdir(exist_ok=True, parents=True) + + self.log_file_handler = logging.FileHandler( + str(fname), mode="w", encoding="UTF-8" + ) + self.log_file_handler.setFormatter(self.log_file_formatter) + + def _log_cli_enabled(self): + """Return True if log_cli should be considered enabled, either explicitly + or because --log-cli-level was given in the command-line. + """ + return self._config.getoption( + "--log-cli-level" + ) is not None or self._config.getini("log_cli") + + @pytest.hookimpl(hookwrapper=True, tryfirst=True) + def pytest_collection(self) -> Generator[None, None, None]: + with self.live_logs_context(): + if self.log_cli_handler: + self.log_cli_handler.set_when("collection") + + if self.log_file_handler is not None: + with catching_logs(self.log_file_handler, level=self.log_file_level): + yield + else: + yield + + @contextmanager + def _runtest_for(self, item, when): + with self._runtest_for_main(item, when): + if self.log_file_handler is not None: + with catching_logs(self.log_file_handler, level=self.log_file_level): + yield + else: + yield + + @contextmanager + def _runtest_for_main( + self, item: nodes.Item, when: str + ) -> Generator[None, None, None]: + """Implements the internals of pytest_runtest_xxx() hook.""" + with catching_logs( + LogCaptureHandler(), formatter=self.formatter, level=self.log_level + ) as log_handler: + if self.log_cli_handler: + self.log_cli_handler.set_when(when) + + if item is None: + yield # run the test + return + + if not hasattr(item, "catch_log_handlers"): + item.catch_log_handlers = {} # type: ignore[attr-defined] # noqa: F821 + item.catch_log_handlers[when] = log_handler # type: ignore[attr-defined] # noqa: F821 + item.catch_log_handler = log_handler # type: ignore[attr-defined] # noqa: F821 + try: + yield # run test + finally: + if when == "teardown": + del item.catch_log_handler # type: ignore[attr-defined] # noqa: F821 + del item.catch_log_handlers # type: ignore[attr-defined] # noqa: F821 + + if self.print_logs: + # Add a captured log section to the report. + log = log_handler.stream.getvalue().strip() + item.add_report_section(when, "log", log) + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_setup(self, item): + with self._runtest_for(item, "setup"): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_call(self, item): + with self._runtest_for(item, "call"): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_teardown(self, item): + with self._runtest_for(item, "teardown"): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_logstart(self): + if self.log_cli_handler: + self.log_cli_handler.reset() + with self._runtest_for(None, "start"): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_logfinish(self): + with self._runtest_for(None, "finish"): + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtest_logreport(self): + with self._runtest_for(None, "logreport"): + yield + + @pytest.hookimpl(hookwrapper=True, tryfirst=True) + def pytest_sessionfinish(self): + with self.live_logs_context(): + if self.log_cli_handler: + self.log_cli_handler.set_when("sessionfinish") + if self.log_file_handler is not None: + try: + with catching_logs( + self.log_file_handler, level=self.log_file_level + ): + yield + finally: + # Close the FileHandler explicitly. + # (logging.shutdown might have lost the weakref?!) + self.log_file_handler.close() + else: + yield + + @pytest.hookimpl(hookwrapper=True, tryfirst=True) + def pytest_sessionstart(self): + with self.live_logs_context(): + if self.log_cli_handler: + self.log_cli_handler.set_when("sessionstart") + if self.log_file_handler is not None: + with catching_logs(self.log_file_handler, level=self.log_file_level): + yield + else: + yield + + @pytest.hookimpl(hookwrapper=True) + def pytest_runtestloop(self, session): + """Runs all collected test items.""" + + if session.config.option.collectonly: + yield + return + + if self._log_cli_enabled() and self._config.getoption("verbose") < 1: + # setting verbose flag is needed to avoid messy test progress output + self._config.option.verbose = 1 + + with self.live_logs_context(): + if self.log_file_handler is not None: + with catching_logs(self.log_file_handler, level=self.log_file_level): + yield # run all the tests + else: + yield # run all the tests + + +class _LiveLoggingStreamHandler(logging.StreamHandler): + """ + Custom StreamHandler used by the live logging feature: it will write a newline before the first log message + in each test. + + During live logging we must also explicitly disable stdout/stderr capturing otherwise it will get captured + and won't appear in the terminal. + """ + + def __init__(self, terminal_reporter, capture_manager): + """ + :param _pytest.terminal.TerminalReporter terminal_reporter: + :param _pytest.capture.CaptureManager capture_manager: + """ + logging.StreamHandler.__init__(self, stream=terminal_reporter) + self.capture_manager = capture_manager + self.reset() + self.set_when(None) + self._test_outcome_written = False + + def reset(self): + """Reset the handler; should be called before the start of each test""" + self._first_record_emitted = False + + def set_when(self, when): + """Prepares for the given test phase (setup/call/teardown)""" + self._when = when + self._section_name_shown = False + if when == "start": + self._test_outcome_written = False + + def emit(self, record): + ctx_manager = ( + self.capture_manager.global_and_fixture_disabled() + if self.capture_manager + else nullcontext() + ) + with ctx_manager: + if not self._first_record_emitted: + self.stream.write("\n") + self._first_record_emitted = True + elif self._when in ("teardown", "finish"): + if not self._test_outcome_written: + self._test_outcome_written = True + self.stream.write("\n") + if not self._section_name_shown and self._when: + self.stream.section("live log " + self._when, sep="-", bold=True) + self._section_name_shown = True + logging.StreamHandler.emit(self, record) diff --git a/contrib/python/pytest/py3/_pytest/main.py b/contrib/python/pytest/py3/_pytest/main.py new file mode 100644 index 00000000000..61eb7ca74c2 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/main.py @@ -0,0 +1,685 @@ +""" core implementation of testing process: init, session, runtest loop. """ +import fnmatch +import functools +import importlib +import os +import sys +from typing import Callable +from typing import Dict +from typing import FrozenSet +from typing import List +from typing import Optional +from typing import Sequence +from typing import Tuple +from typing import Union + +import attr +import py + +import _pytest._code +from _pytest import nodes +from _pytest.compat import TYPE_CHECKING +from _pytest.config import Config +from _pytest.config import directory_arg +from _pytest.config import ExitCode +from _pytest.config import hookimpl +from _pytest.config import UsageError +from _pytest.fixtures import FixtureManager +from _pytest.outcomes import exit +from _pytest.reports import CollectReport +from _pytest.runner import collect_one_node +from _pytest.runner import SetupState + + +if TYPE_CHECKING: + from typing import Type + from typing_extensions import Literal + + from _pytest.python import Package + + +def pytest_addoption(parser): + parser.addini( + "norecursedirs", + "directory patterns to avoid for recursion", + type="args", + default=[".*", "build", "dist", "CVS", "_darcs", "{arch}", "*.egg", "venv"], + ) + parser.addini( + "testpaths", + "directories to search for tests when no files or directories are given in the " + "command line.", + type="args", + default=[], + ) + group = parser.getgroup("general", "running and selection options") + group._addoption( + "-x", + "--exitfirst", + action="store_const", + dest="maxfail", + const=1, + help="exit instantly on first error or failed test.", + ) + group._addoption( + "--maxfail", + metavar="num", + action="store", + type=int, + dest="maxfail", + default=0, + help="exit after first num failures or errors.", + ) + group._addoption( + "--strict-markers", + "--strict", + action="store_true", + help="markers not registered in the `markers` section of the configuration file raise errors.", + ) + group._addoption( + "-c", + metavar="file", + type=str, + dest="inifilename", + help="load configuration from `file` instead of trying to locate one of the implicit " + "configuration files.", + ) + group._addoption( + "--continue-on-collection-errors", + action="store_true", + default=False, + dest="continue_on_collection_errors", + help="Force test execution even if collection errors occur.", + ) + group._addoption( + "--rootdir", + action="store", + dest="rootdir", + help="Define root directory for tests. Can be relative path: 'root_dir', './root_dir', " + "'root_dir/another_dir/'; absolute path: '/home/user/root_dir'; path with variables: " + "'$HOME/root_dir'.", + ) + + group = parser.getgroup("collect", "collection") + group.addoption( + "--collectonly", + "--collect-only", + "--co", + action="store_true", + help="only collect tests, don't execute them.", + ) + group.addoption( + "--pyargs", + action="store_true", + help="try to interpret all arguments as python packages.", + ) + group.addoption( + "--ignore", + action="append", + metavar="path", + help="ignore path during collection (multi-allowed).", + ) + group.addoption( + "--ignore-glob", + action="append", + metavar="path", + help="ignore path pattern during collection (multi-allowed).", + ) + group.addoption( + "--deselect", + action="append", + metavar="nodeid_prefix", + help="deselect item (via node id prefix) during collection (multi-allowed).", + ) + group.addoption( + "--confcutdir", + dest="confcutdir", + default=None, + metavar="dir", + type=functools.partial(directory_arg, optname="--confcutdir"), + help="only load conftest.py's relative to specified dir.", + ) + group.addoption( + "--noconftest", + action="store_true", + dest="noconftest", + default=False, + help="Don't load any conftest.py files.", + ) + group.addoption( + "--keepduplicates", + "--keep-duplicates", + action="store_true", + dest="keepduplicates", + default=False, + help="Keep duplicate tests.", + ) + group.addoption( + "--collect-in-virtualenv", + action="store_true", + dest="collect_in_virtualenv", + default=False, + help="Don't ignore tests in a local virtualenv directory", + ) + + group = parser.getgroup("debugconfig", "test session debugging and configuration") + group.addoption( + "--basetemp", + dest="basetemp", + default=None, + metavar="dir", + help=( + "base temporary directory for this test run." + "(warning: this directory is removed if it exists)" + ), + ) + + +def wrap_session( + config: Config, doit: Callable[[Config, "Session"], Optional[Union[int, ExitCode]]] +) -> Union[int, ExitCode]: + """Skeleton command line program""" + session = Session.from_config(config) + session.exitstatus = ExitCode.OK + initstate = 0 + try: + try: + config._do_configure() + initstate = 1 + config.hook.pytest_sessionstart(session=session) + initstate = 2 + session.exitstatus = doit(config, session) or 0 + except UsageError: + session.exitstatus = ExitCode.USAGE_ERROR + raise + except Failed: + session.exitstatus = ExitCode.TESTS_FAILED + except (KeyboardInterrupt, exit.Exception): + excinfo = _pytest._code.ExceptionInfo.from_current() + exitstatus = ExitCode.INTERRUPTED # type: Union[int, ExitCode] + if isinstance(excinfo.value, exit.Exception): + if excinfo.value.returncode is not None: + exitstatus = excinfo.value.returncode + if initstate < 2: + sys.stderr.write( + "{}: {}\n".format(excinfo.typename, excinfo.value.msg) + ) + config.hook.pytest_keyboard_interrupt(excinfo=excinfo) + session.exitstatus = exitstatus + except: # noqa + session.exitstatus = ExitCode.INTERNAL_ERROR + excinfo = _pytest._code.ExceptionInfo.from_current() + try: + config.notify_exception(excinfo, config.option) + except exit.Exception as exc: + if exc.returncode is not None: + session.exitstatus = exc.returncode + sys.stderr.write("{}: {}\n".format(type(exc).__name__, exc)) + else: + if excinfo.errisinstance(SystemExit): + sys.stderr.write("mainloop: caught unexpected SystemExit!\n") + + finally: + # Explicitly break reference cycle. + excinfo = None # type: ignore + session.startdir.chdir() + if initstate >= 2: + try: + config.hook.pytest_sessionfinish( + session=session, exitstatus=session.exitstatus + ) + except exit.Exception as exc: + if exc.returncode is not None: + session.exitstatus = exc.returncode + sys.stderr.write("{}: {}\n".format(type(exc).__name__, exc)) + config._ensure_unconfigure() + return session.exitstatus + + +def pytest_cmdline_main(config): + return wrap_session(config, _main) + + +def _main(config: Config, session: "Session") -> Optional[Union[int, ExitCode]]: + """ default command line protocol for initialization, session, + running tests and reporting. """ + config.hook.pytest_collection(session=session) + config.hook.pytest_runtestloop(session=session) + + if session.testsfailed: + return ExitCode.TESTS_FAILED + elif session.testscollected == 0: + return ExitCode.NO_TESTS_COLLECTED + return None + + +def pytest_collection(session): + return session.perform_collect() + + +def pytest_runtestloop(session): + if session.testsfailed and not session.config.option.continue_on_collection_errors: + raise session.Interrupted( + "%d error%s during collection" + % (session.testsfailed, "s" if session.testsfailed != 1 else "") + ) + + if session.config.option.collectonly: + return True + + for i, item in enumerate(session.items): + nextitem = session.items[i + 1] if i + 1 < len(session.items) else None + item.config.hook.pytest_runtest_protocol(item=item, nextitem=nextitem) + if session.shouldfail: + raise session.Failed(session.shouldfail) + if session.shouldstop: + raise session.Interrupted(session.shouldstop) + return True + + +def _in_venv(path): + """Attempts to detect if ``path`` is the root of a Virtual Environment by + checking for the existence of the appropriate activate script""" + bindir = path.join("Scripts" if sys.platform.startswith("win") else "bin") + if not bindir.isdir(): + return False + activates = ( + "activate", + "activate.csh", + "activate.fish", + "Activate", + "Activate.bat", + "Activate.ps1", + ) + return any([fname.basename in activates for fname in bindir.listdir()]) + + +def pytest_ignore_collect( + path: py.path.local, config: Config +) -> "Optional[Literal[True]]": + ignore_paths = config._getconftest_pathlist("collect_ignore", path=path.dirpath()) + ignore_paths = ignore_paths or [] + excludeopt = config.getoption("ignore") + if excludeopt: + ignore_paths.extend([py.path.local(x) for x in excludeopt]) + + if py.path.local(path) in ignore_paths: + return True + + ignore_globs = config._getconftest_pathlist( + "collect_ignore_glob", path=path.dirpath() + ) + ignore_globs = ignore_globs or [] + excludeglobopt = config.getoption("ignore_glob") + if excludeglobopt: + ignore_globs.extend([py.path.local(x) for x in excludeglobopt]) + + if any(fnmatch.fnmatch(str(path), str(glob)) for glob in ignore_globs): + return True + + allow_in_venv = config.getoption("collect_in_virtualenv") + if not allow_in_venv and _in_venv(path): + return True + return None + + +def pytest_collection_modifyitems(items, config): + deselect_prefixes = tuple(config.getoption("deselect") or []) + if not deselect_prefixes: + return + + remaining = [] + deselected = [] + for colitem in items: + if colitem.nodeid.startswith(deselect_prefixes): + deselected.append(colitem) + else: + remaining.append(colitem) + + if deselected: + config.hook.pytest_deselected(items=deselected) + items[:] = remaining + + +class NoMatch(Exception): + """ raised if matching cannot locate a matching names. """ + + +class Interrupted(KeyboardInterrupt): + """ signals an interrupted test run. """ + + __module__ = "builtins" # for py3 + + +class Failed(Exception): + """ signals a stop as failed test run. """ + + +@attr.s +class _bestrelpath_cache(dict): + path = attr.ib(type=py.path.local) + + def __missing__(self, path: py.path.local) -> str: + r = self.path.bestrelpath(path) # type: str + self[path] = r + return r + + +class Session(nodes.FSCollector): + Interrupted = Interrupted + Failed = Failed + # Set on the session by runner.pytest_sessionstart. + _setupstate = None # type: SetupState + # Set on the session by fixtures.pytest_sessionstart. + _fixturemanager = None # type: FixtureManager + exitstatus = None # type: Union[int, ExitCode] + + def __init__(self, config: Config) -> None: + nodes.FSCollector.__init__( + self, config.rootdir, parent=None, config=config, session=self, nodeid="" + ) + self.testsfailed = 0 + self.testscollected = 0 + self.shouldstop = False + self.shouldfail = False + self.trace = config.trace.root.get("collection") + self.startdir = config.invocation_dir + self._initialpaths = frozenset() # type: FrozenSet[py.path.local] + + # Keep track of any collected nodes in here, so we don't duplicate fixtures + self._collection_node_cache1 = ( + {} + ) # type: Dict[py.path.local, Sequence[nodes.Collector]] + self._collection_node_cache2 = ( + {} + ) # type: Dict[Tuple[Type[nodes.Collector], py.path.local], nodes.Collector] + self._collection_node_cache3 = ( + {} + ) # type: Dict[Tuple[Type[nodes.Collector], str], CollectReport] + + # Dirnames of pkgs with dunder-init files. + self._collection_pkg_roots = {} # type: Dict[py.path.local, Package] + + self._bestrelpathcache = _bestrelpath_cache( + config.rootdir + ) # type: Dict[py.path.local, str] + + self.config.pluginmanager.register(self, name="session") + + @classmethod + def from_config(cls, config): + return cls._create(config) + + def __repr__(self): + return "<%s %s exitstatus=%r testsfailed=%d testscollected=%d>" % ( + self.__class__.__name__, + self.name, + getattr(self, "exitstatus", "<UNSET>"), + self.testsfailed, + self.testscollected, + ) + + def _node_location_to_relpath(self, node_path: py.path.local) -> str: + # bestrelpath is a quite slow function + return self._bestrelpathcache[node_path] + + @hookimpl(tryfirst=True) + def pytest_collectstart(self): + if self.shouldfail: + raise self.Failed(self.shouldfail) + if self.shouldstop: + raise self.Interrupted(self.shouldstop) + + @hookimpl(tryfirst=True) + def pytest_runtest_logreport(self, report): + if report.failed and not hasattr(report, "wasxfail"): + self.testsfailed += 1 + maxfail = self.config.getvalue("maxfail") + if maxfail and self.testsfailed >= maxfail: + self.shouldfail = "stopping after %d failures" % (self.testsfailed) + + pytest_collectreport = pytest_runtest_logreport + + def isinitpath(self, path): + return path in self._initialpaths + + def gethookproxy(self, fspath: py.path.local): + return super()._gethookproxy(fspath) + + def perform_collect(self, args=None, genitems=True): + hook = self.config.hook + try: + items = self._perform_collect(args, genitems) + self.config.pluginmanager.check_pending() + hook.pytest_collection_modifyitems( + session=self, config=self.config, items=items + ) + finally: + hook.pytest_collection_finish(session=self) + self.testscollected = len(items) + return items + + def _perform_collect(self, args, genitems): + if args is None: + args = self.config.args + self.trace("perform_collect", self, args) + self.trace.root.indent += 1 + self._notfound = [] + initialpaths = [] # type: List[py.path.local] + self._initial_parts = [] # type: List[Tuple[py.path.local, List[str]]] + self.items = items = [] + for arg in args: + fspath, parts = self._parsearg(arg) + self._initial_parts.append((fspath, parts)) + initialpaths.append(fspath) + self._initialpaths = frozenset(initialpaths) + rep = collect_one_node(self) + self.ihook.pytest_collectreport(report=rep) + self.trace.root.indent -= 1 + if self._notfound: + errors = [] + for arg, exc in self._notfound: + line = "(no name {!r} in any of {!r})".format(arg, exc.args[0]) + errors.append("not found: {}\n{}".format(arg, line)) + raise UsageError(*errors) + if not genitems: + return rep.result + else: + if rep.passed: + for node in rep.result: + self.items.extend(self.genitems(node)) + return items + + def collect(self): + for fspath, parts in self._initial_parts: + self.trace("processing argument", (fspath, parts)) + self.trace.root.indent += 1 + try: + yield from self._collect(fspath, parts) + except NoMatch as exc: + report_arg = "::".join((str(fspath), *parts)) + # we are inside a make_report hook so + # we cannot directly pass through the exception + self._notfound.append((report_arg, exc)) + + self.trace.root.indent -= 1 + self._collection_node_cache1.clear() + self._collection_node_cache2.clear() + self._collection_node_cache3.clear() + self._collection_pkg_roots.clear() + + def _collect(self, argpath, names): + from _pytest.python import Package + + # Start with a Session root, and delve to argpath item (dir or file) + # and stack all Packages found on the way. + # No point in finding packages when collecting doctests + if not self.config.getoption("doctestmodules", False): + pm = self.config.pluginmanager + for parent in reversed(argpath.parts()): + if pm._confcutdir and pm._confcutdir.relto(parent): + break + + if parent.isdir(): + pkginit = parent.join("__init__.py") + if pkginit.isfile(): + if pkginit not in self._collection_node_cache1: + col = self._collectfile(pkginit, handle_dupes=False) + if col: + if isinstance(col[0], Package): + self._collection_pkg_roots[parent] = col[0] + # always store a list in the cache, matchnodes expects it + self._collection_node_cache1[col[0].fspath] = [col[0]] + + # If it's a directory argument, recurse and look for any Subpackages. + # Let the Package collector deal with subnodes, don't collect here. + if argpath.check(dir=1): + assert not names, "invalid arg {!r}".format((argpath, names)) + + seen_dirs = set() + for path in argpath.visit( + fil=self._visit_filter, rec=self._recurse, bf=True, sort=True + ): + dirpath = path.dirpath() + if dirpath not in seen_dirs: + # Collect packages first. + seen_dirs.add(dirpath) + pkginit = dirpath.join("__init__.py") + if pkginit.exists(): + for x in self._collectfile(pkginit): + yield x + if isinstance(x, Package): + self._collection_pkg_roots[dirpath] = x + if dirpath in self._collection_pkg_roots: + # Do not collect packages here. + continue + + for x in self._collectfile(path): + key = (type(x), x.fspath) + if key in self._collection_node_cache2: + yield self._collection_node_cache2[key] + else: + self._collection_node_cache2[key] = x + yield x + else: + assert argpath.check(file=1) + + if argpath in self._collection_node_cache1: + col = self._collection_node_cache1[argpath] + else: + collect_root = self._collection_pkg_roots.get(argpath.dirname, self) + col = collect_root._collectfile(argpath, handle_dupes=False) + if col: + self._collection_node_cache1[argpath] = col + m = self.matchnodes(col, names) + # If __init__.py was the only file requested, then the matched node will be + # the corresponding Package, and the first yielded item will be the __init__ + # Module itself, so just use that. If this special case isn't taken, then all + # the files in the package will be yielded. + if argpath.basename == "__init__.py": + try: + yield next(m[0].collect()) + except StopIteration: + # The package collects nothing with only an __init__.py + # file in it, which gets ignored by the default + # "python_files" option. + pass + return + yield from m + + @staticmethod + def _visit_filter(f): + return f.check(file=1) + + def _tryconvertpyarg(self, x): + """Convert a dotted module name to path.""" + try: + spec = importlib.util.find_spec(x) + # AttributeError: looks like package module, but actually filename + # ImportError: module does not exist + # ValueError: not a module name + except (AttributeError, ImportError, ValueError): + return x + if spec is None or spec.origin in {None, "namespace"}: + return x + elif spec.submodule_search_locations: + return os.path.dirname(spec.origin) + else: + return spec.origin + + def _parsearg(self, arg): + """ return (fspath, names) tuple after checking the file exists. """ + strpath, *parts = str(arg).split("::") + if self.config.option.pyargs: + strpath = self._tryconvertpyarg(strpath) + relpath = strpath.replace("/", os.sep) + fspath = self.config.invocation_dir.join(relpath, abs=True) + if not fspath.check(): + if self.config.option.pyargs: + raise UsageError( + "file or package not found: " + arg + " (missing __init__.py?)" + ) + raise UsageError("file not found: " + arg) + fspath = fspath.realpath() + return (fspath, parts) + + def matchnodes(self, matching, names): + self.trace("matchnodes", matching, names) + self.trace.root.indent += 1 + nodes = self._matchnodes(matching, names) + num = len(nodes) + self.trace("matchnodes finished -> ", num, "nodes") + self.trace.root.indent -= 1 + if num == 0: + raise NoMatch(matching, names[:1]) + return nodes + + def _matchnodes(self, matching, names): + if not matching or not names: + return matching + name = names[0] + assert name + nextnames = names[1:] + resultnodes = [] + for node in matching: + if isinstance(node, nodes.Item): + if not names: + resultnodes.append(node) + continue + assert isinstance(node, nodes.Collector) + key = (type(node), node.nodeid) + if key in self._collection_node_cache3: + rep = self._collection_node_cache3[key] + else: + rep = collect_one_node(node) + self._collection_node_cache3[key] = rep + if rep.passed: + has_matched = False + for x in rep.result: + # TODO: remove parametrized workaround once collection structure contains parametrization + if x.name == name or x.name.split("[")[0] == name: + resultnodes.extend(self.matchnodes([x], nextnames)) + has_matched = True + # XXX accept IDs that don't have "()" for class instances + if not has_matched and len(rep.result) == 1 and x.name == "()": + nextnames.insert(0, name) + resultnodes.extend(self.matchnodes([x], nextnames)) + else: + # report collection failures here to avoid failing to run some test + # specified in the command line because the module could not be + # imported (#134) + node.ihook.pytest_collectreport(report=rep) + return resultnodes + + def genitems(self, node): + self.trace("genitems", node) + if isinstance(node, nodes.Item): + node.ihook.pytest_itemcollected(item=node) + yield node + else: + assert isinstance(node, nodes.Collector) + rep = collect_one_node(node) + if rep.passed: + for subnode in rep.result: + yield from self.genitems(subnode) + node.ihook.pytest_collectreport(report=rep) diff --git a/contrib/python/pytest/py3/_pytest/mark/__init__.py b/contrib/python/pytest/py3/_pytest/mark/__init__.py new file mode 100644 index 00000000000..dab0cf149fd --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/mark/__init__.py @@ -0,0 +1,168 @@ +""" generic mechanism for marking and selecting python functions. """ +from typing import Optional + +from .legacy import matchkeyword +from .legacy import matchmark +from .structures import EMPTY_PARAMETERSET_OPTION +from .structures import get_empty_parameterset_mark +from .structures import Mark +from .structures import MARK_GEN +from .structures import MarkDecorator +from .structures import MarkGenerator +from .structures import ParameterSet +from _pytest.config import Config +from _pytest.config import hookimpl +from _pytest.config import UsageError +from _pytest.store import StoreKey + +__all__ = ["Mark", "MarkDecorator", "MarkGenerator", "get_empty_parameterset_mark"] + + +old_mark_config_key = StoreKey[Optional[Config]]() + + +def param(*values, **kw): + """Specify a parameter in `pytest.mark.parametrize`_ calls or + :ref:`parametrized fixtures <fixture-parametrize-marks>`. + + .. code-block:: python + + @pytest.mark.parametrize("test_input,expected", [ + ("3+5", 8), + pytest.param("6*9", 42, marks=pytest.mark.xfail), + ]) + def test_eval(test_input, expected): + assert eval(test_input) == expected + + :param values: variable args of the values of the parameter set, in order. + :keyword marks: a single mark or a list of marks to be applied to this parameter set. + :keyword str id: the id to attribute to this parameter set. + """ + return ParameterSet.param(*values, **kw) + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group._addoption( + "-k", + action="store", + dest="keyword", + default="", + metavar="EXPRESSION", + help="only run tests which match the given substring expression. " + "An expression is a python evaluatable expression " + "where all names are substring-matched against test names " + "and their parent classes. Example: -k 'test_method or test_" + "other' matches all test functions and classes whose name " + "contains 'test_method' or 'test_other', while -k 'not test_method' " + "matches those that don't contain 'test_method' in their names. " + "-k 'not test_method and not test_other' will eliminate the matches. " + "Additionally keywords are matched to classes and functions " + "containing extra names in their 'extra_keyword_matches' set, " + "as well as functions which have names assigned directly to them. " + "The matching is case-insensitive.", + ) + + group._addoption( + "-m", + action="store", + dest="markexpr", + default="", + metavar="MARKEXPR", + help="only run tests matching given mark expression. " + "example: -m 'mark1 and not mark2'.", + ) + + group.addoption( + "--markers", + action="store_true", + help="show markers (builtin, plugin and per-project ones).", + ) + + parser.addini("markers", "markers for test functions", "linelist") + parser.addini(EMPTY_PARAMETERSET_OPTION, "default marker for empty parametersets") + + +@hookimpl(tryfirst=True) +def pytest_cmdline_main(config): + import _pytest.config + + if config.option.markers: + config._do_configure() + tw = _pytest.config.create_terminal_writer(config) + for line in config.getini("markers"): + parts = line.split(":", 1) + name = parts[0] + rest = parts[1] if len(parts) == 2 else "" + tw.write("@pytest.mark.%s:" % name, bold=True) + tw.line(rest) + tw.line() + config._ensure_unconfigure() + return 0 + + +def deselect_by_keyword(items, config): + keywordexpr = config.option.keyword.lstrip() + if not keywordexpr: + return + + if keywordexpr.startswith("-"): + keywordexpr = "not " + keywordexpr[1:] + selectuntil = False + if keywordexpr[-1:] == ":": + selectuntil = True + keywordexpr = keywordexpr[:-1] + + remaining = [] + deselected = [] + for colitem in items: + if keywordexpr and not matchkeyword(colitem, keywordexpr): + deselected.append(colitem) + else: + if selectuntil: + keywordexpr = None + remaining.append(colitem) + + if deselected: + config.hook.pytest_deselected(items=deselected) + items[:] = remaining + + +def deselect_by_mark(items, config): + matchexpr = config.option.markexpr + if not matchexpr: + return + + remaining = [] + deselected = [] + for item in items: + if matchmark(item, matchexpr): + remaining.append(item) + else: + deselected.append(item) + + if deselected: + config.hook.pytest_deselected(items=deselected) + items[:] = remaining + + +def pytest_collection_modifyitems(items, config): + deselect_by_keyword(items, config) + deselect_by_mark(items, config) + + +def pytest_configure(config): + config._store[old_mark_config_key] = MARK_GEN._config + MARK_GEN._config = config + + empty_parameterset = config.getini(EMPTY_PARAMETERSET_OPTION) + + if empty_parameterset not in ("skip", "xfail", "fail_at_collect", None, ""): + raise UsageError( + "{!s} must be one of skip, xfail or fail_at_collect" + " but it is {!r}".format(EMPTY_PARAMETERSET_OPTION, empty_parameterset) + ) + + +def pytest_unconfigure(config): + MARK_GEN._config = config._store.get(old_mark_config_key, None) diff --git a/contrib/python/pytest/py3/_pytest/mark/evaluate.py b/contrib/python/pytest/py3/_pytest/mark/evaluate.py new file mode 100644 index 00000000000..772baf31b6e --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/mark/evaluate.py @@ -0,0 +1,132 @@ +import os +import platform +import sys +import traceback +from typing import Any +from typing import Dict + +from ..outcomes import fail +from ..outcomes import TEST_OUTCOME +from _pytest.config import Config +from _pytest.store import StoreKey + + +evalcache_key = StoreKey[Dict[str, Any]]() + + +def cached_eval(config: Config, expr: str, d: Dict[str, object]) -> Any: + default = {} # type: Dict[str, object] + evalcache = config._store.setdefault(evalcache_key, default) + try: + return evalcache[expr] + except KeyError: + import _pytest._code + + exprcode = _pytest._code.compile(expr, mode="eval") + evalcache[expr] = x = eval(exprcode, d) + return x + + +class MarkEvaluator: + def __init__(self, item, name): + self.item = item + self._marks = None + self._mark = None + self._mark_name = name + + def __bool__(self): + # don't cache here to prevent staleness + return bool(self._get_marks()) + + __nonzero__ = __bool__ + + def wasvalid(self): + return not hasattr(self, "exc") + + def _get_marks(self): + return list(self.item.iter_markers(name=self._mark_name)) + + def invalidraise(self, exc): + raises = self.get("raises") + if not raises: + return + return not isinstance(exc, raises) + + def istrue(self): + try: + return self._istrue() + except TEST_OUTCOME: + self.exc = sys.exc_info() + if isinstance(self.exc[1], SyntaxError): + # TODO: Investigate why SyntaxError.offset is Optional, and if it can be None here. + assert self.exc[1].offset is not None + msg = [" " * (self.exc[1].offset + 4) + "^"] + msg.append("SyntaxError: invalid syntax") + else: + msg = traceback.format_exception_only(*self.exc[:2]) + fail( + "Error evaluating %r expression\n" + " %s\n" + "%s" % (self._mark_name, self.expr, "\n".join(msg)), + pytrace=False, + ) + + def _getglobals(self): + d = {"os": os, "sys": sys, "platform": platform, "config": self.item.config} + if hasattr(self.item, "obj"): + d.update(self.item.obj.__globals__) + return d + + def _istrue(self): + if hasattr(self, "result"): + return self.result + self._marks = self._get_marks() + + if self._marks: + self.result = False + for mark in self._marks: + self._mark = mark + if "condition" in mark.kwargs: + args = (mark.kwargs["condition"],) + else: + args = mark.args + + for expr in args: + self.expr = expr + if isinstance(expr, str): + d = self._getglobals() + result = cached_eval(self.item.config, expr, d) + else: + if "reason" not in mark.kwargs: + # XXX better be checked at collection time + msg = ( + "you need to specify reason=STRING " + "when using booleans as conditions." + ) + fail(msg) + result = bool(expr) + if result: + self.result = True + self.reason = mark.kwargs.get("reason", None) + self.expr = expr + return self.result + + if not args: + self.result = True + self.reason = mark.kwargs.get("reason", None) + return self.result + return False + + def get(self, attr, default=None): + if self._mark is None: + return default + return self._mark.kwargs.get(attr, default) + + def getexplanation(self): + expl = getattr(self, "reason", None) or self.get("reason", None) + if not expl: + if not hasattr(self, "expr"): + return "" + else: + return "condition: " + str(self.expr) + return expl diff --git a/contrib/python/pytest/py3/_pytest/mark/legacy.py b/contrib/python/pytest/py3/_pytest/mark/legacy.py new file mode 100644 index 00000000000..3d7a194b615 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/mark/legacy.py @@ -0,0 +1,116 @@ +""" +this is a place where we put datastructures used by legacy apis +we hope to remove +""" +import keyword +from typing import Set + +import attr + +from _pytest.compat import TYPE_CHECKING +from _pytest.config import UsageError + +if TYPE_CHECKING: + from _pytest.nodes import Item # noqa: F401 (used in type string) + + +@attr.s +class MarkMapping: + """Provides a local mapping for markers where item access + resolves to True if the marker is present. """ + + own_mark_names = attr.ib() + + @classmethod + def from_item(cls, item): + mark_names = {mark.name for mark in item.iter_markers()} + return cls(mark_names) + + def __getitem__(self, name): + return name in self.own_mark_names + + +@attr.s +class KeywordMapping: + """Provides a local mapping for keywords. + Given a list of names, map any substring of one of these names to True. + """ + + _names = attr.ib(type=Set[str]) + + @classmethod + def from_item(cls, item: "Item") -> "KeywordMapping": + mapped_names = set() + + # Add the names of the current item and any parent items + import pytest + + for item in item.listchain(): + if not isinstance(item, pytest.Instance): + mapped_names.add(item.name) + + # Add the names added as extra keywords to current or parent items + mapped_names.update(item.listextrakeywords()) + + # Add the names attached to the current function through direct assignment + function_obj = getattr(item, "function", None) + if function_obj: + mapped_names.update(function_obj.__dict__) + + # add the markers to the keywords as we no longer handle them correctly + mapped_names.update(mark.name for mark in item.iter_markers()) + + return cls(mapped_names) + + def __getitem__(self, subname: str) -> bool: + """Return whether subname is included within stored names. + + The string inclusion check is case-insensitive. + + """ + subname = subname.lower() + names = (name.lower() for name in self._names) + + for name in names: + if subname in name: + return True + return False + + +python_keywords_allowed_list = ["or", "and", "not"] + + +def matchmark(colitem, markexpr): + """Tries to match on any marker names, attached to the given colitem.""" + try: + return eval(markexpr, {}, MarkMapping.from_item(colitem)) + except SyntaxError as e: + raise SyntaxError(str(e) + "\nMarker expression must be valid Python!") + + +def matchkeyword(colitem, keywordexpr): + """Tries to match given keyword expression to given collector item. + + Will match on the name of colitem, including the names of its parents. + Only matches names of items which are either a :class:`Class` or a + :class:`Function`. + Additionally, matches on names in the 'extra_keyword_matches' set of + any item, as well as names directly assigned to test functions. + """ + mapping = KeywordMapping.from_item(colitem) + if " " not in keywordexpr: + # special case to allow for simple "-k pass" and "-k 1.3" + return mapping[keywordexpr] + elif keywordexpr.startswith("not ") and " " not in keywordexpr[4:]: + return not mapping[keywordexpr[4:]] + for kwd in keywordexpr.split(): + if keyword.iskeyword(kwd) and kwd not in python_keywords_allowed_list: + raise UsageError( + "Python keyword '{}' not accepted in expressions passed to '-k'".format( + kwd + ) + ) + try: + return eval(keywordexpr, {}, mapping) + except SyntaxError: + raise UsageError("Wrong expression passed to '-k': {}".format(keywordexpr)) diff --git a/contrib/python/pytest/py3/_pytest/mark/structures.py b/contrib/python/pytest/py3/_pytest/mark/structures.py new file mode 100644 index 00000000000..50ad81baa69 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/mark/structures.py @@ -0,0 +1,397 @@ +import inspect +import warnings +from collections import namedtuple +from collections.abc import MutableMapping +from typing import Iterable +from typing import List +from typing import Optional +from typing import Set +from typing import Union + +import attr + +from .._code.source import getfslineno +from ..compat import ascii_escaped +from ..compat import NOTSET +from _pytest.outcomes import fail +from _pytest.warning_types import PytestUnknownMarkWarning + +EMPTY_PARAMETERSET_OPTION = "empty_parameter_set_mark" + + +def istestfunc(func): + return ( + hasattr(func, "__call__") + and getattr(func, "__name__", "<lambda>") != "<lambda>" + ) + + +def get_empty_parameterset_mark(config, argnames, func): + from ..nodes import Collector + + requested_mark = config.getini(EMPTY_PARAMETERSET_OPTION) + if requested_mark in ("", None, "skip"): + mark = MARK_GEN.skip + elif requested_mark == "xfail": + mark = MARK_GEN.xfail(run=False) + elif requested_mark == "fail_at_collect": + f_name = func.__name__ + _, lineno = getfslineno(func) + raise Collector.CollectError( + "Empty parameter set in '%s' at line %d" % (f_name, lineno + 1) + ) + else: + raise LookupError(requested_mark) + fs, lineno = getfslineno(func) + reason = "got empty parameter set %r, function %s at %s:%d" % ( + argnames, + func.__name__, + fs, + lineno, + ) + return mark(reason=reason) + + +class ParameterSet(namedtuple("ParameterSet", "values, marks, id")): + @classmethod + def param(cls, *values, marks=(), id=None): + if isinstance(marks, MarkDecorator): + marks = (marks,) + else: + assert isinstance(marks, (tuple, list, set)) + + if id is not None: + if not isinstance(id, str): + raise TypeError( + "Expected id to be a string, got {}: {!r}".format(type(id), id) + ) + id = ascii_escaped(id) + return cls(values, marks, id) + + @classmethod + def extract_from(cls, parameterset, force_tuple=False): + """ + :param parameterset: + a legacy style parameterset that may or may not be a tuple, + and may or may not be wrapped into a mess of mark objects + + :param force_tuple: + enforce tuple wrapping so single argument tuple values + don't get decomposed and break tests + """ + + if isinstance(parameterset, cls): + return parameterset + if force_tuple: + return cls.param(parameterset) + else: + return cls(parameterset, marks=[], id=None) + + @staticmethod + def _parse_parametrize_args(argnames, argvalues, *args, **kwargs): + if not isinstance(argnames, (tuple, list)): + argnames = [x.strip() for x in argnames.split(",") if x.strip()] + force_tuple = len(argnames) == 1 + else: + force_tuple = False + return argnames, force_tuple + + @staticmethod + def _parse_parametrize_parameters(argvalues, force_tuple): + return [ + ParameterSet.extract_from(x, force_tuple=force_tuple) for x in argvalues + ] + + @classmethod + def _for_parametrize(cls, argnames, argvalues, func, config, function_definition): + argnames, force_tuple = cls._parse_parametrize_args(argnames, argvalues) + parameters = cls._parse_parametrize_parameters(argvalues, force_tuple) + del argvalues + + if parameters: + # check all parameter sets have the correct number of values + for param in parameters: + if len(param.values) != len(argnames): + msg = ( + '{nodeid}: in "parametrize" the number of names ({names_len}):\n' + " {names}\n" + "must be equal to the number of values ({values_len}):\n" + " {values}" + ) + fail( + msg.format( + nodeid=function_definition.nodeid, + values=param.values, + names=argnames, + names_len=len(argnames), + values_len=len(param.values), + ), + pytrace=False, + ) + else: + # empty parameter set (likely computed at runtime): create a single + # parameter set with NOTSET values, with the "empty parameter set" mark applied to it + mark = get_empty_parameterset_mark(config, argnames, func) + parameters.append( + ParameterSet(values=(NOTSET,) * len(argnames), marks=[mark], id=None) + ) + return argnames, parameters + + +@attr.s(frozen=True) +class Mark: + #: name of the mark + name = attr.ib(type=str) + #: positional arguments of the mark decorator + args = attr.ib() # List[object] + #: keyword arguments of the mark decorator + kwargs = attr.ib() # Dict[str, object] + + #: source Mark for ids with parametrize Marks + _param_ids_from = attr.ib(type=Optional["Mark"], default=None, repr=False) + #: resolved/generated ids with parametrize Marks + _param_ids_generated = attr.ib(type=Optional[List[str]], default=None, repr=False) + + def _has_param_ids(self): + return "ids" in self.kwargs or len(self.args) >= 4 + + def combined_with(self, other: "Mark") -> "Mark": + """ + :param other: the mark to combine with + :type other: Mark + :rtype: Mark + + combines by appending args and merging the mappings + """ + assert self.name == other.name + + # Remember source of ids with parametrize Marks. + param_ids_from = None # type: Optional[Mark] + if self.name == "parametrize": + if other._has_param_ids(): + param_ids_from = other + elif self._has_param_ids(): + param_ids_from = self + + return Mark( + self.name, + self.args + other.args, + dict(self.kwargs, **other.kwargs), + param_ids_from=param_ids_from, + ) + + +@attr.s +class MarkDecorator: + """ A decorator for test functions and test classes. When applied + it will create :class:`Mark` objects which are often created like this:: + + mark1 = pytest.mark.NAME # simple MarkDecorator + mark2 = pytest.mark.NAME(name1=value) # parametrized MarkDecorator + + and can then be applied as decorators to test functions:: + + @mark2 + def test_function(): + pass + + When a MarkDecorator instance is called it does the following: + + 1. If called with a single class as its only positional argument and no + additional keyword arguments, it attaches itself to the class so it + gets applied automatically to all test cases found in that class. + 2. If called with a single function as its only positional argument and + no additional keyword arguments, it attaches a MarkInfo object to the + function, containing all the arguments already stored internally in + the MarkDecorator. + 3. When called in any other case, it performs a 'fake construction' call, + i.e. it returns a new MarkDecorator instance with the original + MarkDecorator's content updated with the arguments passed to this + call. + + Note: The rules above prevent MarkDecorator objects from storing only a + single function or class reference as their positional argument with no + additional keyword or positional arguments. + + """ + + mark = attr.ib(validator=attr.validators.instance_of(Mark)) + + @property + def name(self): + """alias for mark.name""" + return self.mark.name + + @property + def args(self): + """alias for mark.args""" + return self.mark.args + + @property + def kwargs(self): + """alias for mark.kwargs""" + return self.mark.kwargs + + @property + def markname(self): + return self.name # for backward-compat (2.4.1 had this attr) + + def __repr__(self): + return "<MarkDecorator {!r}>".format(self.mark) + + def with_args(self, *args, **kwargs): + """ return a MarkDecorator with extra arguments added + + unlike call this can be used even if the sole argument is a callable/class + + :return: MarkDecorator + """ + + mark = Mark(self.name, args, kwargs) + return self.__class__(self.mark.combined_with(mark)) + + def __call__(self, *args, **kwargs): + """ if passed a single callable argument: decorate it with mark info. + otherwise add *args/**kwargs in-place to mark information. """ + if args and not kwargs: + func = args[0] + is_class = inspect.isclass(func) + if len(args) == 1 and (istestfunc(func) or is_class): + store_mark(func, self.mark) + return func + return self.with_args(*args, **kwargs) + + +def get_unpacked_marks(obj): + """ + obtain the unpacked marks that are stored on an object + """ + mark_list = getattr(obj, "pytestmark", []) + if not isinstance(mark_list, list): + mark_list = [mark_list] + return normalize_mark_list(mark_list) + + +def normalize_mark_list(mark_list: Iterable[Union[Mark, MarkDecorator]]) -> List[Mark]: + """ + normalizes marker decorating helpers to mark objects + + :type mark_list: List[Union[Mark, Markdecorator]] + :rtype: List[Mark] + """ + extracted = [ + getattr(mark, "mark", mark) for mark in mark_list + ] # unpack MarkDecorator + for mark in extracted: + if not isinstance(mark, Mark): + raise TypeError("got {!r} instead of Mark".format(mark)) + return [x for x in extracted if isinstance(x, Mark)] + + +def store_mark(obj, mark): + """store a Mark on an object + this is used to implement the Mark declarations/decorators correctly + """ + assert isinstance(mark, Mark), mark + # always reassign name to avoid updating pytestmark + # in a reference that was only borrowed + obj.pytestmark = get_unpacked_marks(obj) + [mark] + + +class MarkGenerator: + """ Factory for :class:`MarkDecorator` objects - exposed as + a ``pytest.mark`` singleton instance. Example:: + + import pytest + @pytest.mark.slowtest + def test_function(): + pass + + will set a 'slowtest' :class:`MarkInfo` object + on the ``test_function`` object. """ + + _config = None + _markers = set() # type: Set[str] + + def __getattr__(self, name: str) -> MarkDecorator: + if name[0] == "_": + raise AttributeError("Marker name must NOT start with underscore") + + if self._config is not None: + # We store a set of markers as a performance optimisation - if a mark + # name is in the set we definitely know it, but a mark may be known and + # not in the set. We therefore start by updating the set! + if name not in self._markers: + for line in self._config.getini("markers"): + # example lines: "skipif(condition): skip the given test if..." + # or "hypothesis: tests which use Hypothesis", so to get the + # marker name we split on both `:` and `(`. + if line == "ya:external": + marker = line + else: + marker = line.split(":")[0].split("(")[0].strip() + self._markers.add(marker) + + # If the name is not in the set of known marks after updating, + # then it really is time to issue a warning or an error. + if name not in self._markers: + if self._config.option.strict_markers: + fail( + "{!r} not found in `markers` configuration option".format(name), + pytrace=False, + ) + + # Raise a specific error for common misspellings of "parametrize". + if name in ["parameterize", "parametrise", "parameterise"]: + __tracebackhide__ = True + fail("Unknown '{}' mark, did you mean 'parametrize'?".format(name)) + + warnings.warn( + "Unknown pytest.mark.%s - is this a typo? You can register " + "custom marks to avoid this warning - for details, see " + "https://docs.pytest.org/en/latest/mark.html" % name, + PytestUnknownMarkWarning, + 2, + ) + + return MarkDecorator(Mark(name, (), {})) + + +MARK_GEN = MarkGenerator() + + +class NodeKeywords(MutableMapping): + def __init__(self, node): + self.node = node + self.parent = node.parent + self._markers = {node.name: True} + + def __getitem__(self, key): + try: + return self._markers[key] + except KeyError: + if self.parent is None: + raise + return self.parent.keywords[key] + + def __setitem__(self, key, value): + self._markers[key] = value + + def __delitem__(self, key): + raise ValueError("cannot delete key in keywords dict") + + def __iter__(self): + seen = self._seen() + return iter(seen) + + def _seen(self): + seen = set(self._markers) + if self.parent is not None: + seen.update(self.parent.keywords) + return seen + + def __len__(self): + return len(self._seen()) + + def __repr__(self): + return "<NodeKeywords for node {}>".format(self.node) diff --git a/contrib/python/pytest/py3/_pytest/monkeypatch.py b/contrib/python/pytest/py3/_pytest/monkeypatch.py new file mode 100644 index 00000000000..ce1c0f65102 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/monkeypatch.py @@ -0,0 +1,322 @@ +""" monkeypatching and mocking functionality. """ +import os +import re +import sys +import warnings +from contextlib import contextmanager +from typing import Generator + +import pytest +from _pytest.fixtures import fixture +from _pytest.pathlib import Path + +RE_IMPORT_ERROR_NAME = re.compile(r"^No module named (.*)$") + + +@fixture +def monkeypatch(): + """The returned ``monkeypatch`` fixture provides these + helper methods to modify objects, dictionaries or os.environ:: + + monkeypatch.setattr(obj, name, value, raising=True) + monkeypatch.delattr(obj, name, raising=True) + monkeypatch.setitem(mapping, name, value) + monkeypatch.delitem(obj, name, raising=True) + monkeypatch.setenv(name, value, prepend=False) + monkeypatch.delenv(name, raising=True) + monkeypatch.syspath_prepend(path) + monkeypatch.chdir(path) + + All modifications will be undone after the requesting + test function or fixture has finished. The ``raising`` + parameter determines if a KeyError or AttributeError + will be raised if the set/deletion operation has no target. + """ + mpatch = MonkeyPatch() + yield mpatch + mpatch.undo() + + +def resolve(name): + # simplified from zope.dottedname + parts = name.split(".") + + used = parts.pop(0) + found = __import__(used) + for part in parts: + used += "." + part + try: + found = getattr(found, part) + except AttributeError: + pass + else: + continue + # we use explicit un-nesting of the handling block in order + # to avoid nested exceptions on python 3 + try: + __import__(used) + except ImportError as ex: + # str is used for py2 vs py3 + expected = str(ex).split()[-1] + if expected == used: + raise + else: + raise ImportError("import error in {}: {}".format(used, ex)) + found = annotated_getattr(found, part, used) + return found + + +def annotated_getattr(obj, name, ann): + try: + obj = getattr(obj, name) + except AttributeError: + raise AttributeError( + "{!r} object at {} has no attribute {!r}".format( + type(obj).__name__, ann, name + ) + ) + return obj + + +def derive_importpath(import_path, raising): + if not isinstance(import_path, str) or "." not in import_path: + raise TypeError( + "must be absolute import path string, not {!r}".format(import_path) + ) + module, attr = import_path.rsplit(".", 1) + target = resolve(module) + if raising: + annotated_getattr(target, attr, ann=module) + return attr, target + + +class Notset: + def __repr__(self): + return "<notset>" + + +notset = Notset() + + +class MonkeyPatch: + """ Object returned by the ``monkeypatch`` fixture keeping a record of setattr/item/env/syspath changes. + """ + + def __init__(self): + self._setattr = [] + self._setitem = [] + self._cwd = None + self._savesyspath = None + + @contextmanager + def context(self) -> Generator["MonkeyPatch", None, None]: + """ + Context manager that returns a new :class:`MonkeyPatch` object which + undoes any patching done inside the ``with`` block upon exit: + + .. code-block:: python + + import functools + def test_partial(monkeypatch): + with monkeypatch.context() as m: + m.setattr(functools, "partial", 3) + + Useful in situations where it is desired to undo some patches before the test ends, + such as mocking ``stdlib`` functions that might break pytest itself if mocked (for examples + of this see `#3290 <https://github.com/pytest-dev/pytest/issues/3290>`_. + """ + m = MonkeyPatch() + try: + yield m + finally: + m.undo() + + def setattr(self, target, name, value=notset, raising=True): + """ Set attribute value on target, memorizing the old value. + By default raise AttributeError if the attribute did not exist. + + For convenience you can specify a string as ``target`` which + will be interpreted as a dotted import path, with the last part + being the attribute name. Example: + ``monkeypatch.setattr("os.getcwd", lambda: "/")`` + would set the ``getcwd`` function of the ``os`` module. + + The ``raising`` value determines if the setattr should fail + if the attribute is not already present (defaults to True + which means it will raise). + """ + __tracebackhide__ = True + import inspect + + if value is notset: + if not isinstance(target, str): + raise TypeError( + "use setattr(target, name, value) or " + "setattr(target, value) with target being a dotted " + "import string" + ) + value = name + name, target = derive_importpath(target, raising) + + oldval = getattr(target, name, notset) + if raising and oldval is notset: + raise AttributeError("{!r} has no attribute {!r}".format(target, name)) + + # avoid class descriptors like staticmethod/classmethod + if inspect.isclass(target): + oldval = target.__dict__.get(name, notset) + self._setattr.append((target, name, oldval)) + setattr(target, name, value) + + def delattr(self, target, name=notset, raising=True): + """ Delete attribute ``name`` from ``target``, by default raise + AttributeError it the attribute did not previously exist. + + If no ``name`` is specified and ``target`` is a string + it will be interpreted as a dotted import path with the + last part being the attribute name. + + If ``raising`` is set to False, no exception will be raised if the + attribute is missing. + """ + __tracebackhide__ = True + import inspect + + if name is notset: + if not isinstance(target, str): + raise TypeError( + "use delattr(target, name) or " + "delattr(target) with target being a dotted " + "import string" + ) + name, target = derive_importpath(target, raising) + + if not hasattr(target, name): + if raising: + raise AttributeError(name) + else: + oldval = getattr(target, name, notset) + # Avoid class descriptors like staticmethod/classmethod. + if inspect.isclass(target): + oldval = target.__dict__.get(name, notset) + self._setattr.append((target, name, oldval)) + delattr(target, name) + + def setitem(self, dic, name, value): + """ Set dictionary entry ``name`` to value. """ + self._setitem.append((dic, name, dic.get(name, notset))) + dic[name] = value + + def delitem(self, dic, name, raising=True): + """ Delete ``name`` from dict. Raise KeyError if it doesn't exist. + + If ``raising`` is set to False, no exception will be raised if the + key is missing. + """ + if name not in dic: + if raising: + raise KeyError(name) + else: + self._setitem.append((dic, name, dic.get(name, notset))) + del dic[name] + + def setenv(self, name, value, prepend=None): + """ Set environment variable ``name`` to ``value``. If ``prepend`` + is a character, read the current environment variable value + and prepend the ``value`` adjoined with the ``prepend`` character.""" + if not isinstance(value, str): + warnings.warn( + pytest.PytestWarning( + "Value of environment variable {name} type should be str, but got " + "{value!r} (type: {type}); converted to str implicitly".format( + name=name, value=value, type=type(value).__name__ + ) + ), + stacklevel=2, + ) + value = str(value) + if prepend and name in os.environ: + value = value + prepend + os.environ[name] + self.setitem(os.environ, name, value) + + def delenv(self, name, raising=True): + """ Delete ``name`` from the environment. Raise KeyError if it does + not exist. + + If ``raising`` is set to False, no exception will be raised if the + environment variable is missing. + """ + self.delitem(os.environ, name, raising=raising) + + def syspath_prepend(self, path): + """ Prepend ``path`` to ``sys.path`` list of import locations. """ + from pkg_resources import fixup_namespace_packages + + if self._savesyspath is None: + self._savesyspath = sys.path[:] + sys.path.insert(0, str(path)) + + # https://github.com/pypa/setuptools/blob/d8b901bc/docs/pkg_resources.txt#L162-L171 + fixup_namespace_packages(str(path)) + + # A call to syspathinsert() usually means that the caller wants to + # import some dynamically created files, thus with python3 we + # invalidate its import caches. + # This is especially important when any namespace package is in use, + # since then the mtime based FileFinder cache (that gets created in + # this case already) gets not invalidated when writing the new files + # quickly afterwards. + from importlib import invalidate_caches + + invalidate_caches() + + def chdir(self, path): + """ Change the current working directory to the specified path. + Path can be a string or a py.path.local object. + """ + if self._cwd is None: + self._cwd = os.getcwd() + if hasattr(path, "chdir"): + path.chdir() + elif isinstance(path, Path): + # modern python uses the fspath protocol here LEGACY + os.chdir(str(path)) + else: + os.chdir(path) + + def undo(self): + """ Undo previous changes. This call consumes the + undo stack. Calling it a second time has no effect unless + you do more monkeypatching after the undo call. + + There is generally no need to call `undo()`, since it is + called automatically during tear-down. + + Note that the same `monkeypatch` fixture is used across a + single test function invocation. If `monkeypatch` is used both by + the test function itself and one of the test fixtures, + calling `undo()` will undo all of the changes made in + both functions. + """ + for obj, name, value in reversed(self._setattr): + if value is not notset: + setattr(obj, name, value) + else: + delattr(obj, name) + self._setattr[:] = [] + for dictionary, name, value in reversed(self._setitem): + if value is notset: + try: + del dictionary[name] + except KeyError: + pass # was already deleted, so we have the desired state + else: + dictionary[name] = value + self._setitem[:] = [] + if self._savesyspath is not None: + sys.path[:] = self._savesyspath + self._savesyspath = None + + if self._cwd is not None: + os.chdir(self._cwd) + self._cwd = None diff --git a/contrib/python/pytest/py3/_pytest/nodes.py b/contrib/python/pytest/py3/_pytest/nodes.py new file mode 100644 index 00000000000..6f22a8daaa0 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/nodes.py @@ -0,0 +1,594 @@ +import os +import warnings +from functools import lru_cache +from typing import Any +from typing import Dict +from typing import List +from typing import Optional +from typing import Set +from typing import Tuple +from typing import Union + +import py + +import _pytest._code +from _pytest._code.code import ExceptionChainRepr +from _pytest._code.code import ExceptionInfo +from _pytest._code.code import ReprExceptionInfo +from _pytest._code.source import getfslineno +from _pytest.compat import cached_property +from _pytest.compat import TYPE_CHECKING +from _pytest.config import Config +from _pytest.config import ConftestImportFailure +from _pytest.config import PytestPluginManager +from _pytest.deprecated import NODE_USE_FROM_PARENT +from _pytest.fixtures import FixtureDef +from _pytest.fixtures import FixtureLookupError +from _pytest.fixtures import FixtureLookupErrorRepr +from _pytest.mark.structures import Mark +from _pytest.mark.structures import MarkDecorator +from _pytest.mark.structures import NodeKeywords +from _pytest.outcomes import fail +from _pytest.pathlib import Path +from _pytest.store import Store + +if TYPE_CHECKING: + # Imported here due to circular import. + from _pytest.main import Session # noqa: F401 + +SEP = "/" + +tracebackcutdir = py.path.local(_pytest.__file__).dirpath() + + +@lru_cache(maxsize=None) +def _splitnode(nodeid): + """Split a nodeid into constituent 'parts'. + + Node IDs are strings, and can be things like: + '' + 'testing/code' + 'testing/code/test_excinfo.py' + 'testing/code/test_excinfo.py::TestFormattedExcinfo' + + Return values are lists e.g. + [] + ['testing', 'code'] + ['testing', 'code', 'test_excinfo.py'] + ['testing', 'code', 'test_excinfo.py', 'TestFormattedExcinfo'] + """ + if nodeid == "": + # If there is no root node at all, return an empty list so the caller's logic can remain sane + return () + parts = nodeid.split(SEP) + # Replace single last element 'test_foo.py::Bar' with multiple elements 'test_foo.py', 'Bar' + parts[-1:] = parts[-1].split("::") + # Convert parts into a tuple to avoid possible errors with caching of a mutable type + return tuple(parts) + + +def ischildnode(baseid, nodeid): + """Return True if the nodeid is a child node of the baseid. + + E.g. 'foo/bar::Baz' is a child of 'foo', 'foo/bar' and 'foo/bar::Baz', but not of 'foo/blorp' + """ + base_parts = _splitnode(baseid) + node_parts = _splitnode(nodeid) + if len(node_parts) < len(base_parts): + return False + return node_parts[: len(base_parts)] == base_parts + + +class NodeMeta(type): + def __call__(self, *k, **kw): + warnings.warn(NODE_USE_FROM_PARENT.format(name=self.__name__), stacklevel=2) + return super().__call__(*k, **kw) + + def _create(self, *k, **kw): + return super().__call__(*k, **kw) + + +class Node(metaclass=NodeMeta): + """ base class for Collector and Item the test collection tree. + Collector subclasses have children, Items are terminal nodes.""" + + def __init__( + self, + name: str, + parent: Optional["Node"] = None, + config: Optional[Config] = None, + session: Optional["Session"] = None, + fspath: Optional[py.path.local] = None, + nodeid: Optional[str] = None, + ) -> None: + #: a unique name within the scope of the parent node + self.name = name + + #: the parent collector node. + self.parent = parent + + #: the pytest config object + if config: + self.config = config + else: + if not parent: + raise TypeError("config or parent must be provided") + self.config = parent.config + + #: the session this node is part of + if session: + self.session = session + else: + if not parent: + raise TypeError("session or parent must be provided") + self.session = parent.session + + #: filesystem path where this node was collected from (can be None) + self.fspath = fspath or getattr(parent, "fspath", None) + + #: keywords/markers collected from all scopes + self.keywords = NodeKeywords(self) + + #: the marker objects belonging to this node + self.own_markers = [] # type: List[Mark] + + #: allow adding of extra keywords to use for matching + self.extra_keyword_matches = set() # type: Set[str] + + # used for storing artificial fixturedefs for direct parametrization + self._name2pseudofixturedef = {} # type: Dict[str, FixtureDef] + + if nodeid is not None: + assert "::()" not in nodeid + self._nodeid = nodeid + else: + if not self.parent: + raise TypeError("nodeid or parent must be provided") + self._nodeid = self.parent.nodeid + if self.name != "()": + self._nodeid += "::" + self.name + + # A place where plugins can store information on the node for their + # own use. Currently only intended for internal plugins. + self._store = Store() + + @classmethod + def from_parent(cls, parent: "Node", **kw): + """ + Public Constructor for Nodes + + This indirection got introduced in order to enable removing + the fragile logic from the node constructors. + + Subclasses can use ``super().from_parent(...)`` when overriding the construction + + :param parent: the parent node of this test Node + """ + if "config" in kw: + raise TypeError("config is not a valid argument for from_parent") + if "session" in kw: + raise TypeError("session is not a valid argument for from_parent") + return cls._create(parent=parent, **kw) + + @property + def ihook(self): + """ fspath sensitive hook proxy used to call pytest hooks""" + return self.session.gethookproxy(self.fspath) + + def __repr__(self): + return "<{} {}>".format(self.__class__.__name__, getattr(self, "name", None)) + + def warn(self, warning): + """Issue a warning for this item. + + Warnings will be displayed after the test session, unless explicitly suppressed + + :param Warning warning: the warning instance to issue. Must be a subclass of PytestWarning. + + :raise ValueError: if ``warning`` instance is not a subclass of PytestWarning. + + Example usage: + + .. code-block:: python + + node.warn(PytestWarning("some message")) + + """ + from _pytest.warning_types import PytestWarning + + if not isinstance(warning, PytestWarning): + raise ValueError( + "warning must be an instance of PytestWarning or subclass, got {!r}".format( + warning + ) + ) + path, lineno = get_fslocation_from_item(self) + warnings.warn_explicit( + warning, + category=None, + filename=str(path), + lineno=lineno + 1 if lineno is not None else None, + ) + + # methods for ordering nodes + @property + def nodeid(self): + """ a ::-separated string denoting its collection tree address. """ + return self._nodeid + + def __hash__(self): + return hash(self.nodeid) + + def setup(self): + pass + + def teardown(self): + pass + + def listchain(self): + """ return list of all parent collectors up to self, + starting from root of collection tree. """ + chain = [] + item = self # type: Optional[Node] + while item is not None: + chain.append(item) + item = item.parent + chain.reverse() + return chain + + def add_marker( + self, marker: Union[str, MarkDecorator], append: bool = True + ) -> None: + """dynamically add a marker object to the node. + + :type marker: ``str`` or ``pytest.mark.*`` object + :param marker: + ``append=True`` whether to append the marker, + if ``False`` insert at position ``0``. + """ + from _pytest.mark import MARK_GEN + + if isinstance(marker, MarkDecorator): + marker_ = marker + elif isinstance(marker, str): + marker_ = getattr(MARK_GEN, marker) + else: + raise ValueError("is not a string or pytest.mark.* Marker") + self.keywords[marker_.name] = marker + if append: + self.own_markers.append(marker_.mark) + else: + self.own_markers.insert(0, marker_.mark) + + def iter_markers(self, name=None): + """ + :param name: if given, filter the results by the name attribute + + iterate over all markers of the node + """ + return (x[1] for x in self.iter_markers_with_node(name=name)) + + def iter_markers_with_node(self, name=None): + """ + :param name: if given, filter the results by the name attribute + + iterate over all markers of the node + returns sequence of tuples (node, mark) + """ + for node in reversed(self.listchain()): + for mark in node.own_markers: + if name is None or getattr(mark, "name", None) == name: + yield node, mark + + def get_closest_marker(self, name, default=None): + """return the first marker matching the name, from closest (for example function) to farther level (for example + module level). + + :param default: fallback return value of no marker was found + :param name: name to filter by + """ + return next(self.iter_markers(name=name), default) + + def listextrakeywords(self): + """ Return a set of all extra keywords in self and any parents.""" + extra_keywords = set() # type: Set[str] + for item in self.listchain(): + extra_keywords.update(item.extra_keyword_matches) + return extra_keywords + + def listnames(self): + return [x.name for x in self.listchain()] + + def addfinalizer(self, fin): + """ register a function to be called when this node is finalized. + + This method can only be called when this node is active + in a setup chain, for example during self.setup(). + """ + self.session._setupstate.addfinalizer(fin, self) + + def getparent(self, cls): + """ get the next parent node (including ourself) + which is an instance of the given class""" + current = self # type: Optional[Node] + while current and not isinstance(current, cls): + current = current.parent + return current + + def _prunetraceback(self, excinfo): + pass + + def _repr_failure_py( + self, excinfo: ExceptionInfo[BaseException], style=None, + ) -> Union[str, ReprExceptionInfo, ExceptionChainRepr, FixtureLookupErrorRepr]: + if isinstance(excinfo.value, ConftestImportFailure): + excinfo = ExceptionInfo(excinfo.value.excinfo) + if isinstance(excinfo.value, fail.Exception): + if not excinfo.value.pytrace: + return str(excinfo.value) + if isinstance(excinfo.value, FixtureLookupError): + return excinfo.value.formatrepr() + if self.config.getoption("fulltrace", False): + style = "long" + else: + tb = _pytest._code.Traceback([excinfo.traceback[-1]]) + self._prunetraceback(excinfo) + if len(excinfo.traceback) == 0: + excinfo.traceback = tb + if style == "auto": + style = "long" + # XXX should excinfo.getrepr record all data and toterminal() process it? + if style is None: + if self.config.getoption("tbstyle", "auto") == "short": + style = "short" + else: + style = "long" + + if self.config.getoption("verbose", 0) > 1: + truncate_locals = False + else: + truncate_locals = True + + # excinfo.getrepr() formats paths relative to the CWD if `abspath` is False. + # It is possible for a fixture/test to change the CWD while this code runs, which + # would then result in the user seeing confusing paths in the failure message. + # To fix this, if the CWD changed, always display the full absolute path. + # It will be better to just always display paths relative to invocation_dir, but + # this requires a lot of plumbing (#6428). + try: + abspath = Path(os.getcwd()) != Path(self.config.invocation_dir) + except OSError: + abspath = True + + return excinfo.getrepr( + funcargs=True, + abspath=abspath, + showlocals=self.config.getoption("showlocals", False), + style=style, + tbfilter=False, # pruned already, or in --fulltrace mode. + truncate_locals=truncate_locals, + ) + + def repr_failure( + self, excinfo, style=None + ) -> Union[str, ReprExceptionInfo, ExceptionChainRepr, FixtureLookupErrorRepr]: + return self._repr_failure_py(excinfo, style) + + +def get_fslocation_from_item( + item: "Item", +) -> Tuple[Union[str, py.path.local], Optional[int]]: + """Tries to extract the actual location from an item, depending on available attributes: + + * "fslocation": a pair (path, lineno) + * "obj": a Python object that the item wraps. + * "fspath": just a path + + :rtype: a tuple of (str|LocalPath, int) with filename and line number. + """ + try: + return item.location[:2] + except AttributeError: + pass + obj = getattr(item, "obj", None) + if obj is not None: + return getfslineno(obj) + return getattr(item, "fspath", "unknown location"), -1 + + +class Collector(Node): + """ Collector instances create children through collect() + and thus iteratively build a tree. + """ + + class CollectError(Exception): + """ an error during collection, contains a custom message. """ + + def collect(self): + """ returns a list of children (items and collectors) + for this collection node. + """ + raise NotImplementedError("abstract") + + def repr_failure(self, excinfo): + """ represent a collection failure. """ + if excinfo.errisinstance(self.CollectError) and not self.config.getoption( + "fulltrace", False + ): + exc = excinfo.value + return str(exc.args[0]) + + # Respect explicit tbstyle option, but default to "short" + # (_repr_failure_py uses "long" with "fulltrace" option always). + tbstyle = self.config.getoption("tbstyle", "auto") + if tbstyle == "auto": + tbstyle = "short" + + return self._repr_failure_py(excinfo, style=tbstyle) + + def _prunetraceback(self, excinfo): + if hasattr(self, "fspath"): + traceback = excinfo.traceback + ntraceback = traceback.cut(path=self.fspath) + if ntraceback == traceback: + ntraceback = ntraceback.cut(excludepath=tracebackcutdir) + excinfo.traceback = ntraceback.filter() + + +def _check_initialpaths_for_relpath(session, fspath): + for initial_path in session._initialpaths: + if fspath.common(initial_path) == initial_path: + return fspath.relto(initial_path) + + +class FSHookProxy: + def __init__( + self, fspath: py.path.local, pm: PytestPluginManager, remove_mods + ) -> None: + self.fspath = fspath + self.pm = pm + self.remove_mods = remove_mods + + def __getattr__(self, name: str): + x = self.pm.subset_hook_caller(name, remove_plugins=self.remove_mods) + self.__dict__[name] = x + return x + + +class FSCollector(Collector): + def __init__( + self, fspath: py.path.local, parent=None, config=None, session=None, nodeid=None + ) -> None: + name = fspath.basename + if parent is not None: + rel = fspath.relto(parent.fspath) + if rel: + name = rel + name = name.replace(os.sep, SEP) + self.fspath = fspath + + session = session or parent.session + + if nodeid is None: + nodeid = self.fspath.relto(session.config.rootdir) + + if not nodeid: + nodeid = _check_initialpaths_for_relpath(session, fspath) + if nodeid and os.sep != SEP: + nodeid = nodeid.replace(os.sep, SEP) + + super().__init__(name, parent, config, session, nodeid=nodeid, fspath=fspath) + + self._norecursepatterns = self.config.getini("norecursedirs") + + @classmethod + def from_parent(cls, parent, *, fspath, **kw): + """ + The public constructor + """ + return super().from_parent(parent=parent, fspath=fspath, **kw) + + def _gethookproxy(self, fspath: py.path.local): + # check if we have the common case of running + # hooks with all conftest.py files + pm = self.config.pluginmanager + my_conftestmodules = pm._getconftestmodules(fspath) + remove_mods = pm._conftest_plugins.difference(my_conftestmodules) + if remove_mods: + # one or more conftests are not in use at this fspath + proxy = FSHookProxy(fspath, pm, remove_mods) + else: + # all plugins are active for this fspath + proxy = self.config.hook + return proxy + + def _recurse(self, dirpath: py.path.local) -> bool: + if dirpath.basename == "__pycache__": + return False + ihook = self._gethookproxy(dirpath.dirpath()) + if ihook.pytest_ignore_collect(path=dirpath, config=self.config): + return False + for pat in self._norecursepatterns: + if dirpath.check(fnmatch=pat): + return False + ihook = self._gethookproxy(dirpath) + ihook.pytest_collect_directory(path=dirpath, parent=self) + return True + + def _collectfile(self, path, handle_dupes=True): + assert ( + path.isfile() + ), "{!r} is not a file (isdir={!r}, exists={!r}, islink={!r})".format( + path, path.isdir(), path.exists(), path.islink() + ) + ihook = self.gethookproxy(path) + if not self.isinitpath(path): + if ihook.pytest_ignore_collect(path=path, config=self.config): + return () + + if handle_dupes: + keepduplicates = self.config.getoption("keepduplicates") + if not keepduplicates: + duplicate_paths = self.config.pluginmanager._duplicatepaths + if path in duplicate_paths: + return () + else: + duplicate_paths.add(path) + + return ihook.pytest_collect_file(path=path, parent=self) + + +class File(FSCollector): + """ base class for collecting tests from a file. """ + + +class Item(Node): + """ a basic test invocation item. Note that for a single function + there might be multiple test invocation items. + """ + + nextitem = None + + def __init__(self, name, parent=None, config=None, session=None, nodeid=None): + super().__init__(name, parent, config, session, nodeid=nodeid) + self._report_sections = [] # type: List[Tuple[str, str, str]] + + #: user properties is a list of tuples (name, value) that holds user + #: defined properties for this test. + self.user_properties = [] # type: List[Tuple[str, Any]] + + def runtest(self) -> None: + raise NotImplementedError("runtest must be implemented by Item subclass") + + def add_report_section(self, when: str, key: str, content: str) -> None: + """ + Adds a new report section, similar to what's done internally to add stdout and + stderr captured output:: + + item.add_report_section("call", "stdout", "report section contents") + + :param str when: + One of the possible capture states, ``"setup"``, ``"call"``, ``"teardown"``. + :param str key: + Name of the section, can be customized at will. Pytest uses ``"stdout"`` and + ``"stderr"`` internally. + + :param str content: + The full contents as a string. + """ + if content: + self._report_sections.append((when, key, content)) + + def reportinfo(self) -> Tuple[Union[py.path.local, str], Optional[int], str]: + return self.fspath, None, "" + + @cached_property + def location(self) -> Tuple[str, Optional[int], str]: + location = self.reportinfo() + if isinstance(location[0], py.path.local): + fspath = location[0] + else: + fspath = py.path.local(location[0]) + relfspath = self.session._node_location_to_relpath(fspath) + assert type(location[2]) is str + return (relfspath, location[1], location[2]) diff --git a/contrib/python/pytest/py3/_pytest/nose.py b/contrib/python/pytest/py3/_pytest/nose.py new file mode 100644 index 00000000000..d6f3c2b224a --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/nose.py @@ -0,0 +1,38 @@ +""" run test suites written for nose. """ +from _pytest import python +from _pytest import unittest +from _pytest.config import hookimpl + + +@hookimpl(trylast=True) +def pytest_runtest_setup(item): + if is_potential_nosetest(item): + if not call_optional(item.obj, "setup"): + # call module level setup if there is no object level one + call_optional(item.parent.obj, "setup") + # XXX this implies we only call teardown when setup worked + item.session._setupstate.addfinalizer((lambda: teardown_nose(item)), item) + + +def teardown_nose(item): + if is_potential_nosetest(item): + if not call_optional(item.obj, "teardown"): + call_optional(item.parent.obj, "teardown") + + +def is_potential_nosetest(item): + # extra check needed since we do not do nose style setup/teardown + # on direct unittest style classes + return isinstance(item, python.Function) and not isinstance( + item, unittest.TestCaseFunction + ) + + +def call_optional(obj, name): + method = getattr(obj, name, None) + isfixture = hasattr(method, "_pytestfixturefunction") + if method is not None and not isfixture and callable(method): + # If there's any problems allow the exception to raise rather than + # silently ignoring them + method() + return True diff --git a/contrib/python/pytest/py3/_pytest/outcomes.py b/contrib/python/pytest/py3/_pytest/outcomes.py new file mode 100644 index 00000000000..bed73c94de9 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/outcomes.py @@ -0,0 +1,226 @@ +""" +exception classes and constants handling test outcomes +as well as functions creating them +""" +import sys +from typing import Any +from typing import Callable +from typing import cast +from typing import Optional +from typing import TypeVar + +from packaging.version import Version + +TYPE_CHECKING = False # avoid circular import through compat + +if TYPE_CHECKING: + from typing import NoReturn + from typing import Type # noqa: F401 (Used in string type annotation.) + from typing_extensions import Protocol +else: + # typing.Protocol is only available starting from Python 3.8. It is also + # available from typing_extensions, but we don't want a runtime dependency + # on that. So use a dummy runtime implementation. + from typing import Generic + + Protocol = Generic + + +class OutcomeException(BaseException): + """ OutcomeException and its subclass instances indicate and + contain info about test and collection outcomes. + """ + + def __init__(self, msg: Optional[str] = None, pytrace: bool = True) -> None: + if msg is not None and not isinstance(msg, str): + error_msg = ( + "{} expected string as 'msg' parameter, got '{}' instead.\n" + "Perhaps you meant to use a mark?" + ) + raise TypeError(error_msg.format(type(self).__name__, type(msg).__name__)) + BaseException.__init__(self, msg) + self.msg = msg + self.pytrace = pytrace + + def __repr__(self) -> str: + if self.msg: + return self.msg + return "<{} instance>".format(self.__class__.__name__) + + __str__ = __repr__ + + +TEST_OUTCOME = (OutcomeException, Exception) + + +class Skipped(OutcomeException): + # XXX hackish: on 3k we fake to live in the builtins + # in order to have Skipped exception printing shorter/nicer + __module__ = "builtins" + + def __init__( + self, + msg: Optional[str] = None, + pytrace: bool = True, + allow_module_level: bool = False, + ) -> None: + OutcomeException.__init__(self, msg=msg, pytrace=pytrace) + self.allow_module_level = allow_module_level + + +class Failed(OutcomeException): + """ raised from an explicit call to pytest.fail() """ + + __module__ = "builtins" + + +class Exit(Exception): + """ raised for immediate program exits (no tracebacks/summaries)""" + + def __init__( + self, msg: str = "unknown reason", returncode: Optional[int] = None + ) -> None: + self.msg = msg + self.returncode = returncode + super().__init__(msg) + + +# Elaborate hack to work around https://github.com/python/mypy/issues/2087. +# Ideally would just be `exit.Exception = Exit` etc. + +_F = TypeVar("_F", bound=Callable) +_ET = TypeVar("_ET", bound="Type[BaseException]") + + +class _WithException(Protocol[_F, _ET]): + Exception = None # type: _ET + __call__ = None # type: _F + + +def _with_exception(exception_type: _ET) -> Callable[[_F], _WithException[_F, _ET]]: + def decorate(func: _F) -> _WithException[_F, _ET]: + func_with_exception = cast(_WithException[_F, _ET], func) + func_with_exception.Exception = exception_type + return func_with_exception + + return decorate + + +# exposed helper methods + + +@_with_exception(Exit) +def exit(msg: str, returncode: Optional[int] = None) -> "NoReturn": + """ + Exit testing process. + + :param str msg: message to display upon exit. + :param int returncode: return code to be used when exiting pytest. + """ + __tracebackhide__ = True + raise Exit(msg, returncode) + + +@_with_exception(Skipped) +def skip(msg: str = "", *, allow_module_level: bool = False) -> "NoReturn": + """ + Skip an executing test with the given message. + + This function should be called only during testing (setup, call or teardown) or + during collection by using the ``allow_module_level`` flag. This function can + be called in doctests as well. + + :kwarg bool allow_module_level: allows this function to be called at + module level, skipping the rest of the module. Default to False. + + .. note:: + It is better to use the :ref:`pytest.mark.skipif ref` marker when possible to declare a test to be + skipped under certain conditions like mismatching platforms or + dependencies. + Similarly, use the ``# doctest: +SKIP`` directive (see `doctest.SKIP + <https://docs.python.org/3/library/doctest.html#doctest.SKIP>`_) + to skip a doctest statically. + """ + __tracebackhide__ = True + raise Skipped(msg=msg, allow_module_level=allow_module_level) + + +@_with_exception(Failed) +def fail(msg: str = "", pytrace: bool = True) -> "NoReturn": + """ + Explicitly fail an executing test with the given message. + + :param str msg: the message to show the user as reason for the failure. + :param bool pytrace: if false the msg represents the full failure information and no + python traceback will be reported. + """ + __tracebackhide__ = True + raise Failed(msg=msg, pytrace=pytrace) + + +class XFailed(Failed): + """ raised from an explicit call to pytest.xfail() """ + + +@_with_exception(XFailed) +def xfail(reason: str = "") -> "NoReturn": + """ + Imperatively xfail an executing test or setup functions with the given reason. + + This function should be called only during testing (setup, call or teardown). + + .. note:: + It is better to use the :ref:`pytest.mark.xfail ref` marker when possible to declare a test to be + xfailed under certain conditions like known bugs or missing features. + """ + __tracebackhide__ = True + raise XFailed(reason) + + +def importorskip( + modname: str, minversion: Optional[str] = None, reason: Optional[str] = None +) -> Any: + """Imports and returns the requested module ``modname``, or skip the + current test if the module cannot be imported. + + :param str modname: the name of the module to import + :param str minversion: if given, the imported module's ``__version__`` + attribute must be at least this minimal version, otherwise the test is + still skipped. + :param str reason: if given, this reason is shown as the message when the + module cannot be imported. + :returns: The imported module. This should be assigned to its canonical + name. + + Example:: + + docutils = pytest.importorskip("docutils") + """ + import warnings + + __tracebackhide__ = True + compile(modname, "", "eval") # to catch syntaxerrors + + with warnings.catch_warnings(): + # make sure to ignore ImportWarnings that might happen because + # of existing directories with the same name we're trying to + # import but without a __init__.py file + warnings.simplefilter("ignore") + try: + __import__(modname) + except ImportError as exc: + if reason is None: + reason = "could not import {!r}: {}".format(modname, exc) + raise Skipped(reason, allow_module_level=True) from None + mod = sys.modules[modname] + if minversion is None: + return mod + verattr = getattr(mod, "__version__", None) + if minversion is not None: + if verattr is None or Version(verattr) < Version(minversion): + raise Skipped( + "module %r has __version__ %r, required is: %r" + % (modname, verattr, minversion), + allow_module_level=True, + ) + return mod diff --git a/contrib/python/pytest/py3/_pytest/pastebin.py b/contrib/python/pytest/py3/_pytest/pastebin.py new file mode 100644 index 00000000000..3f4a7502d59 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/pastebin.py @@ -0,0 +1,109 @@ +""" submit failure or test session information to a pastebin service. """ +import tempfile +from typing import IO + +import pytest +from _pytest.store import StoreKey + + +pastebinfile_key = StoreKey[IO[bytes]]() + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting") + group._addoption( + "--pastebin", + metavar="mode", + action="store", + dest="pastebin", + default=None, + choices=["failed", "all"], + help="send failed|all info to bpaste.net pastebin service.", + ) + + +@pytest.hookimpl(trylast=True) +def pytest_configure(config): + if config.option.pastebin == "all": + tr = config.pluginmanager.getplugin("terminalreporter") + # if no terminal reporter plugin is present, nothing we can do here; + # this can happen when this function executes in a slave node + # when using pytest-xdist, for example + if tr is not None: + # pastebin file will be utf-8 encoded binary file + config._store[pastebinfile_key] = tempfile.TemporaryFile("w+b") + oldwrite = tr._tw.write + + def tee_write(s, **kwargs): + oldwrite(s, **kwargs) + if isinstance(s, str): + s = s.encode("utf-8") + config._store[pastebinfile_key].write(s) + + tr._tw.write = tee_write + + +def pytest_unconfigure(config): + if pastebinfile_key in config._store: + pastebinfile = config._store[pastebinfile_key] + # get terminal contents and delete file + pastebinfile.seek(0) + sessionlog = pastebinfile.read() + pastebinfile.close() + del config._store[pastebinfile_key] + # undo our patching in the terminal reporter + tr = config.pluginmanager.getplugin("terminalreporter") + del tr._tw.__dict__["write"] + # write summary + tr.write_sep("=", "Sending information to Paste Service") + pastebinurl = create_new_paste(sessionlog) + tr.write_line("pastebin session-log: %s\n" % pastebinurl) + + +def create_new_paste(contents): + """ + Creates a new paste using bpaste.net service. + + :contents: paste contents as utf-8 encoded bytes + :returns: url to the pasted contents or error message + """ + import re + from urllib.request import urlopen + from urllib.parse import urlencode + + params = {"code": contents, "lexer": "text", "expiry": "1week"} + url = "https://bpaste.net" + try: + response = ( + urlopen(url, data=urlencode(params).encode("ascii")).read().decode("utf-8") + ) + except OSError as exc_info: # urllib errors + return "bad response: %s" % exc_info + m = re.search(r'href="/raw/(\w+)"', response) + if m: + return "{}/show/{}".format(url, m.group(1)) + else: + return "bad response: invalid format ('" + response + "')" + + +def pytest_terminal_summary(terminalreporter): + import _pytest.config + + if terminalreporter.config.option.pastebin != "failed": + return + tr = terminalreporter + if "failed" in tr.stats: + terminalreporter.write_sep("=", "Sending information to Paste Service") + for rep in terminalreporter.stats.get("failed"): + try: + msg = rep.longrepr.reprtraceback.reprentries[-1].reprfileloc + except AttributeError: + msg = tr._getfailureheadline(rep) + tw = _pytest.config.create_terminal_writer( + terminalreporter.config, stringio=True + ) + rep.toterminal(tw) + s = tw.stringio.getvalue() + assert len(s) + pastebinurl = create_new_paste(s) + tr.write_line("{} --> {}".format(msg, pastebinurl)) diff --git a/contrib/python/pytest/py3/_pytest/pathlib.py b/contrib/python/pytest/py3/_pytest/pathlib.py new file mode 100644 index 00000000000..2f04b02d7a7 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/pathlib.py @@ -0,0 +1,399 @@ +import atexit +import fnmatch +import itertools +import os +import shutil +import sys +import uuid +import warnings +from functools import partial +from os.path import expanduser +from os.path import expandvars +from os.path import isabs +from os.path import sep +from posixpath import sep as posix_sep +from typing import Iterable +from typing import Iterator +from typing import Set +from typing import TypeVar +from typing import Union + +from _pytest.warning_types import PytestWarning + +if sys.version_info[:2] >= (3, 6): + from pathlib import Path, PurePath +else: + from pathlib2 import Path, PurePath + +__all__ = ["Path", "PurePath"] + + +LOCK_TIMEOUT = 60 * 60 * 3 + + +_AnyPurePath = TypeVar("_AnyPurePath", bound=PurePath) + + +def get_lock_path(path: _AnyPurePath) -> _AnyPurePath: + return path.joinpath(".lock") + + +def ensure_reset_dir(path: Path) -> None: + """ + ensures the given path is an empty directory + """ + if path.exists(): + rm_rf(path) + path.mkdir() + + +def on_rm_rf_error(func, path: str, exc, *, start_path: Path) -> bool: + """Handles known read-only errors during rmtree. + + The returned value is used only by our own tests. + """ + exctype, excvalue = exc[:2] + + # another process removed the file in the middle of the "rm_rf" (xdist for example) + # more context: https://github.com/pytest-dev/pytest/issues/5974#issuecomment-543799018 + if isinstance(excvalue, FileNotFoundError): + return False + + if not isinstance(excvalue, PermissionError): + warnings.warn( + PytestWarning( + "(rm_rf) error removing {}\n{}: {}".format(path, exctype, excvalue) + ) + ) + return False + + if func not in (os.rmdir, os.remove, os.unlink): + if func not in (os.open,): + warnings.warn( + PytestWarning( + "(rm_rf) unknown function {} when removing {}:\n{}: {}".format( + func, path, exctype, excvalue + ) + ) + ) + return False + + # Chmod + retry. + import stat + + def chmod_rw(p: str) -> None: + mode = os.stat(p).st_mode + os.chmod(p, mode | stat.S_IRUSR | stat.S_IWUSR) + + # For files, we need to recursively go upwards in the directories to + # ensure they all are also writable. + p = Path(path) + if p.is_file(): + for parent in p.parents: + chmod_rw(str(parent)) + # stop when we reach the original path passed to rm_rf + if parent == start_path: + break + chmod_rw(str(path)) + + func(path) + return True + + +def ensure_extended_length_path(path: Path) -> Path: + """Get the extended-length version of a path (Windows). + + On Windows, by default, the maximum length of a path (MAX_PATH) is 260 + characters, and operations on paths longer than that fail. But it is possible + to overcome this by converting the path to "extended-length" form before + performing the operation: + https://docs.microsoft.com/en-us/windows/win32/fileio/naming-a-file#maximum-path-length-limitation + + On Windows, this function returns the extended-length absolute version of path. + On other platforms it returns path unchanged. + """ + if sys.platform.startswith("win32"): + path = path.resolve() + path = Path(get_extended_length_path_str(str(path))) + return path + + +def get_extended_length_path_str(path: str) -> str: + """Converts to extended length path as a str""" + long_path_prefix = "\\\\?\\" + unc_long_path_prefix = "\\\\?\\UNC\\" + if path.startswith((long_path_prefix, unc_long_path_prefix)): + return path + # UNC + if path.startswith("\\\\"): + return unc_long_path_prefix + path[2:] + return long_path_prefix + path + + +def rm_rf(path: Path) -> None: + """Remove the path contents recursively, even if some elements + are read-only. + """ + path = ensure_extended_length_path(path) + onerror = partial(on_rm_rf_error, start_path=path) + shutil.rmtree(str(path), onerror=onerror) + + +def find_prefixed(root: Path, prefix: str) -> Iterator[Path]: + """finds all elements in root that begin with the prefix, case insensitive""" + l_prefix = prefix.lower() + for x in root.iterdir(): + if x.name.lower().startswith(l_prefix): + yield x + + +def extract_suffixes(iter: Iterable[PurePath], prefix: str) -> Iterator[str]: + """ + :param iter: iterator over path names + :param prefix: expected prefix of the path names + :returns: the parts of the paths following the prefix + """ + p_len = len(prefix) + for p in iter: + yield p.name[p_len:] + + +def find_suffixes(root: Path, prefix: str) -> Iterator[str]: + """combines find_prefixes and extract_suffixes + """ + return extract_suffixes(find_prefixed(root, prefix), prefix) + + +def parse_num(maybe_num) -> int: + """parses number path suffixes, returns -1 on error""" + try: + return int(maybe_num) + except ValueError: + return -1 + + +def _force_symlink( + root: Path, target: Union[str, PurePath], link_to: Union[str, Path] +) -> None: + """helper to create the current symlink + + it's full of race conditions that are reasonably ok to ignore + for the context of best effort linking to the latest test run + + the presumption being that in case of much parallelism + the inaccuracy is going to be acceptable + """ + current_symlink = root.joinpath(target) + try: + current_symlink.unlink() + except OSError: + pass + try: + current_symlink.symlink_to(link_to) + except Exception: + pass + + +def make_numbered_dir(root: Path, prefix: str) -> Path: + """create a directory with an increased number as suffix for the given prefix""" + for i in range(10): + # try up to 10 times to create the folder + max_existing = max(map(parse_num, find_suffixes(root, prefix)), default=-1) + new_number = max_existing + 1 + new_path = root.joinpath("{}{}".format(prefix, new_number)) + try: + new_path.mkdir() + except Exception: + pass + else: + _force_symlink(root, prefix + "current", new_path) + return new_path + else: + raise EnvironmentError( + "could not create numbered dir with prefix " + "{prefix} in {root} after 10 tries".format(prefix=prefix, root=root) + ) + + +def create_cleanup_lock(p: Path) -> Path: + """crates a lock to prevent premature folder cleanup""" + lock_path = get_lock_path(p) + try: + fd = os.open(str(lock_path), os.O_WRONLY | os.O_CREAT | os.O_EXCL, 0o644) + except FileExistsError as e: + raise EnvironmentError("cannot create lockfile in {path}".format(path=p)) from e + else: + pid = os.getpid() + spid = str(pid).encode() + os.write(fd, spid) + os.close(fd) + if not lock_path.is_file(): + raise EnvironmentError("lock path got renamed after successful creation") + return lock_path + + +def register_cleanup_lock_removal(lock_path: Path, register=atexit.register): + """registers a cleanup function for removing a lock, by default on atexit""" + pid = os.getpid() + + def cleanup_on_exit(lock_path: Path = lock_path, original_pid: int = pid) -> None: + current_pid = os.getpid() + if current_pid != original_pid: + # fork + return + try: + lock_path.unlink() + except (OSError, IOError): + pass + + return register(cleanup_on_exit) + + +def maybe_delete_a_numbered_dir(path: Path) -> None: + """removes a numbered directory if its lock can be obtained and it does not seem to be in use""" + path = ensure_extended_length_path(path) + lock_path = None + try: + lock_path = create_cleanup_lock(path) + parent = path.parent + + garbage = parent.joinpath("garbage-{}".format(uuid.uuid4())) + path.rename(garbage) + rm_rf(garbage) + except (OSError, EnvironmentError): + # known races: + # * other process did a cleanup at the same time + # * deletable folder was found + # * process cwd (Windows) + return + finally: + # if we created the lock, ensure we remove it even if we failed + # to properly remove the numbered dir + if lock_path is not None: + try: + lock_path.unlink() + except (OSError, IOError): + pass + + +def ensure_deletable(path: Path, consider_lock_dead_if_created_before: float) -> bool: + """checks if a lock exists and breaks it if its considered dead""" + if path.is_symlink(): + return False + lock = get_lock_path(path) + if not lock.exists(): + return True + try: + lock_time = lock.stat().st_mtime + except Exception: + return False + else: + if lock_time < consider_lock_dead_if_created_before: + lock.unlink() + return True + else: + return False + + +def try_cleanup(path: Path, consider_lock_dead_if_created_before: float) -> None: + """tries to cleanup a folder if we can ensure it's deletable""" + if ensure_deletable(path, consider_lock_dead_if_created_before): + maybe_delete_a_numbered_dir(path) + + +def cleanup_candidates(root: Path, prefix: str, keep: int) -> Iterator[Path]: + """lists candidates for numbered directories to be removed - follows py.path""" + max_existing = max(map(parse_num, find_suffixes(root, prefix)), default=-1) + max_delete = max_existing - keep + paths = find_prefixed(root, prefix) + paths, paths2 = itertools.tee(paths) + numbers = map(parse_num, extract_suffixes(paths2, prefix)) + for path, number in zip(paths, numbers): + if number <= max_delete: + yield path + + +def cleanup_numbered_dir( + root: Path, prefix: str, keep: int, consider_lock_dead_if_created_before: float +) -> None: + """cleanup for lock driven numbered directories""" + for path in cleanup_candidates(root, prefix, keep): + try_cleanup(path, consider_lock_dead_if_created_before) + for path in root.glob("garbage-*"): + try_cleanup(path, consider_lock_dead_if_created_before) + + +def make_numbered_dir_with_cleanup( + root: Path, prefix: str, keep: int, lock_timeout: float +) -> Path: + """creates a numbered dir with a cleanup lock and removes old ones""" + e = None + for i in range(10): + try: + p = make_numbered_dir(root, prefix) + lock_path = create_cleanup_lock(p) + register_cleanup_lock_removal(lock_path) + except Exception as exc: + e = exc + else: + consider_lock_dead_if_created_before = p.stat().st_mtime - lock_timeout + cleanup_numbered_dir( + root=root, + prefix=prefix, + keep=keep, + consider_lock_dead_if_created_before=consider_lock_dead_if_created_before, + ) + return p + assert e is not None + raise e + + +def resolve_from_str(input, root): + assert not isinstance(input, Path), "would break on py2" + root = Path(root) + input = expanduser(input) + input = expandvars(input) + if isabs(input): + return Path(input) + else: + return root.joinpath(input) + + +def fnmatch_ex(pattern: str, path) -> bool: + """FNMatcher port from py.path.common which works with PurePath() instances. + + The difference between this algorithm and PurePath.match() is that the latter matches "**" glob expressions + for each part of the path, while this algorithm uses the whole path instead. + + For example: + "tests/foo/bar/doc/test_foo.py" matches pattern "tests/**/doc/test*.py" with this algorithm, but not with + PurePath.match(). + + This algorithm was ported to keep backward-compatibility with existing settings which assume paths match according + this logic. + + References: + * https://bugs.python.org/issue29249 + * https://bugs.python.org/issue34731 + """ + path = PurePath(path) + iswin32 = sys.platform.startswith("win") + + if iswin32 and sep not in pattern and posix_sep in pattern: + # Running on Windows, the pattern has no Windows path separators, + # and the pattern has one or more Posix path separators. Replace + # the Posix path separators with the Windows path separator. + pattern = pattern.replace(posix_sep, sep) + + if sep not in pattern: + name = path.name + else: + name = str(path) + if path.is_absolute() and not os.path.isabs(pattern): + pattern = "*{}{}".format(os.sep, pattern) + return fnmatch.fnmatch(name, pattern) + + +def parts(s: str) -> Set[str]: + parts = s.split(sep) + return {sep.join(parts[: i + 1]) or sep for i in range(len(parts))} diff --git a/contrib/python/pytest/py3/_pytest/pytester.py b/contrib/python/pytest/py3/_pytest/pytester.py new file mode 100644 index 00000000000..9df3ed779d5 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/pytester.py @@ -0,0 +1,1521 @@ +"""(disabled by default) support for testing pytest and pytest plugins.""" +import collections.abc +import gc +import importlib +import os +import platform +import re +import subprocess +import sys +import time +import traceback +from fnmatch import fnmatch +from io import StringIO +from typing import Callable +from typing import Dict +from typing import Iterable +from typing import List +from typing import Optional +from typing import Sequence +from typing import Tuple +from typing import Union +from weakref import WeakKeyDictionary + +import py + +import pytest +from _pytest._code import Source +from _pytest.capture import MultiCapture +from _pytest.capture import SysCapture +from _pytest.compat import TYPE_CHECKING +from _pytest.config import _PluggyPlugin +from _pytest.config import ExitCode +from _pytest.fixtures import FixtureRequest +from _pytest.main import Session +from _pytest.monkeypatch import MonkeyPatch +from _pytest.nodes import Collector +from _pytest.nodes import Item +from _pytest.pathlib import Path +from _pytest.python import Module +from _pytest.reports import TestReport +from _pytest.tmpdir import TempdirFactory + +if TYPE_CHECKING: + from typing import Type + + import pexpect + + +IGNORE_PAM = [ # filenames added when obtaining details about the current user + "/var/lib/sss/mc/passwd" +] + + +def pytest_addoption(parser): + parser.addoption( + "--lsof", + action="store_true", + dest="lsof", + default=False, + help="run FD checks if lsof is available", + ) + + parser.addoption( + "--runpytest", + default="inprocess", + dest="runpytest", + choices=("inprocess", "subprocess"), + help=( + "run pytest sub runs in tests using an 'inprocess' " + "or 'subprocess' (python -m main) method" + ), + ) + + parser.addini( + "pytester_example_dir", help="directory to take the pytester example files from" + ) + + +def pytest_configure(config): + if config.getvalue("lsof"): + checker = LsofFdLeakChecker() + if checker.matching_platform(): + config.pluginmanager.register(checker) + + config.addinivalue_line( + "markers", + "pytester_example_path(*path_segments): join the given path " + "segments to `pytester_example_dir` for this test.", + ) + + +class LsofFdLeakChecker: + def get_open_files(self): + out = self._exec_lsof() + open_files = self._parse_lsof_output(out) + return open_files + + def _exec_lsof(self): + pid = os.getpid() + # py3: use subprocess.DEVNULL directly. + with open(os.devnull, "wb") as devnull: + return subprocess.check_output( + ("lsof", "-Ffn0", "-p", str(pid)), stderr=devnull + ).decode() + + def _parse_lsof_output(self, out): + def isopen(line): + return line.startswith("f") and ( + "deleted" not in line + and "mem" not in line + and "txt" not in line + and "cwd" not in line + ) + + open_files = [] + + for line in out.split("\n"): + if isopen(line): + fields = line.split("\0") + fd = fields[0][1:] + filename = fields[1][1:] + if filename in IGNORE_PAM: + continue + if filename.startswith("/"): + open_files.append((fd, filename)) + + return open_files + + def matching_platform(self): + try: + subprocess.check_output(("lsof", "-v")) + except (OSError, subprocess.CalledProcessError): + return False + else: + return True + + @pytest.hookimpl(hookwrapper=True, tryfirst=True) + def pytest_runtest_protocol(self, item): + lines1 = self.get_open_files() + yield + if hasattr(sys, "pypy_version_info"): + gc.collect() + lines2 = self.get_open_files() + + new_fds = {t[0] for t in lines2} - {t[0] for t in lines1} + leaked_files = [t for t in lines2 if t[0] in new_fds] + if leaked_files: + error = [] + error.append("***** %s FD leakage detected" % len(leaked_files)) + error.extend([str(f) for f in leaked_files]) + error.append("*** Before:") + error.extend([str(f) for f in lines1]) + error.append("*** After:") + error.extend([str(f) for f in lines2]) + error.append(error[0]) + error.append("*** function %s:%s: %s " % item.location) + error.append("See issue #2366") + item.warn(pytest.PytestWarning("\n".join(error))) + + +# used at least by pytest-xdist plugin + + +@pytest.fixture +def _pytest(request: FixtureRequest) -> "PytestArg": + """Return a helper which offers a gethookrecorder(hook) method which + returns a HookRecorder instance which helps to make assertions about called + hooks. + + """ + return PytestArg(request) + + +class PytestArg: + def __init__(self, request: FixtureRequest) -> None: + self.request = request + + def gethookrecorder(self, hook) -> "HookRecorder": + hookrecorder = HookRecorder(hook._pm) + self.request.addfinalizer(hookrecorder.finish_recording) + return hookrecorder + + +def get_public_names(values): + """Only return names from iterator values without a leading underscore.""" + return [x for x in values if x[0] != "_"] + + +class ParsedCall: + def __init__(self, name, kwargs): + self.__dict__.update(kwargs) + self._name = name + + def __repr__(self): + d = self.__dict__.copy() + del d["_name"] + return "<ParsedCall {!r}(**{!r})>".format(self._name, d) + + if TYPE_CHECKING: + # The class has undetermined attributes, this tells mypy about it. + def __getattr__(self, key): + raise NotImplementedError() + + +class HookRecorder: + """Record all hooks called in a plugin manager. + + This wraps all the hook calls in the plugin manager, recording each call + before propagating the normal calls. + + """ + + def __init__(self, pluginmanager) -> None: + self._pluginmanager = pluginmanager + self.calls = [] # type: List[ParsedCall] + + def before(hook_name: str, hook_impls, kwargs) -> None: + self.calls.append(ParsedCall(hook_name, kwargs)) + + def after(outcome, hook_name: str, hook_impls, kwargs) -> None: + pass + + self._undo_wrapping = pluginmanager.add_hookcall_monitoring(before, after) + + def finish_recording(self) -> None: + self._undo_wrapping() + + def getcalls(self, names: Union[str, Iterable[str]]) -> List[ParsedCall]: + if isinstance(names, str): + names = names.split() + return [call for call in self.calls if call._name in names] + + def assert_contains(self, entries) -> None: + __tracebackhide__ = True + i = 0 + entries = list(entries) + backlocals = sys._getframe(1).f_locals + while entries: + name, check = entries.pop(0) + for ind, call in enumerate(self.calls[i:]): + if call._name == name: + print("NAMEMATCH", name, call) + if eval(check, backlocals, call.__dict__): + print("CHECKERMATCH", repr(check), "->", call) + else: + print("NOCHECKERMATCH", repr(check), "-", call) + continue + i += ind + 1 + break + print("NONAMEMATCH", name, "with", call) + else: + pytest.fail("could not find {!r} check {!r}".format(name, check)) + + def popcall(self, name: str) -> ParsedCall: + __tracebackhide__ = True + for i, call in enumerate(self.calls): + if call._name == name: + del self.calls[i] + return call + lines = ["could not find call {!r}, in:".format(name)] + lines.extend([" %s" % x for x in self.calls]) + pytest.fail("\n".join(lines)) + + def getcall(self, name: str) -> ParsedCall: + values = self.getcalls(name) + assert len(values) == 1, (name, values) + return values[0] + + # functionality for test reports + + def getreports( + self, + names: Union[ + str, Iterable[str] + ] = "pytest_runtest_logreport pytest_collectreport", + ) -> List[TestReport]: + return [x.report for x in self.getcalls(names)] + + def matchreport( + self, + inamepart: str = "", + names: Union[ + str, Iterable[str] + ] = "pytest_runtest_logreport pytest_collectreport", + when=None, + ): + """return a testreport whose dotted import path matches""" + values = [] + for rep in self.getreports(names=names): + if not when and rep.when != "call" and rep.passed: + # setup/teardown passing reports - let's ignore those + continue + if when and rep.when != when: + continue + if not inamepart or inamepart in rep.nodeid.split("::"): + values.append(rep) + if not values: + raise ValueError( + "could not find test report matching %r: " + "no test reports at all!" % (inamepart,) + ) + if len(values) > 1: + raise ValueError( + "found 2 or more testreports matching {!r}: {}".format( + inamepart, values + ) + ) + return values[0] + + def getfailures( + self, + names: Union[ + str, Iterable[str] + ] = "pytest_runtest_logreport pytest_collectreport", + ) -> List[TestReport]: + return [rep for rep in self.getreports(names) if rep.failed] + + def getfailedcollections(self) -> List[TestReport]: + return self.getfailures("pytest_collectreport") + + def listoutcomes( + self, + ) -> Tuple[List[TestReport], List[TestReport], List[TestReport]]: + passed = [] + skipped = [] + failed = [] + for rep in self.getreports("pytest_collectreport pytest_runtest_logreport"): + if rep.passed: + if rep.when == "call": + passed.append(rep) + elif rep.skipped: + skipped.append(rep) + else: + assert rep.failed, "Unexpected outcome: {!r}".format(rep) + failed.append(rep) + return passed, skipped, failed + + def countoutcomes(self) -> List[int]: + return [len(x) for x in self.listoutcomes()] + + def assertoutcome(self, passed: int = 0, skipped: int = 0, failed: int = 0) -> None: + __tracebackhide__ = True + + outcomes = self.listoutcomes() + realpassed, realskipped, realfailed = outcomes + obtained = { + "passed": len(realpassed), + "skipped": len(realskipped), + "failed": len(realfailed), + } + expected = {"passed": passed, "skipped": skipped, "failed": failed} + assert obtained == expected, outcomes + + def clear(self) -> None: + self.calls[:] = [] + + +@pytest.fixture +def linecomp() -> "LineComp": + return LineComp() + + +@pytest.fixture(name="LineMatcher") +def LineMatcher_fixture(request: FixtureRequest) -> "Type[LineMatcher]": + return LineMatcher + + +@pytest.fixture +def testdir(request: FixtureRequest, tmpdir_factory) -> "Testdir": + return Testdir(request, tmpdir_factory) + + +@pytest.fixture +def _sys_snapshot(): + snappaths = SysPathsSnapshot() + snapmods = SysModulesSnapshot() + yield + snapmods.restore() + snappaths.restore() + + +@pytest.fixture +def _config_for_test(): + from _pytest.config import get_config + + config = get_config() + yield config + config._ensure_unconfigure() # cleanup, e.g. capman closing tmpfiles. + + +# regex to match the session duration string in the summary: "74.34s" +rex_session_duration = re.compile(r"\d+\.\d\ds") +# regex to match all the counts and phrases in the summary line: "34 passed, 111 skipped" +rex_outcome = re.compile(r"(\d+) (\w+)") + + +class RunResult: + """The result of running a command. + + Attributes: + + :ivar ret: the return value + :ivar outlines: list of lines captured from stdout + :ivar errlines: list of lines captured from stderr + :ivar stdout: :py:class:`LineMatcher` of stdout, use ``stdout.str()`` to + reconstruct stdout or the commonly used ``stdout.fnmatch_lines()`` + method + :ivar stderr: :py:class:`LineMatcher` of stderr + :ivar duration: duration in seconds + """ + + def __init__( + self, + ret: Union[int, ExitCode], + outlines: List[str], + errlines: List[str], + duration: float, + ) -> None: + try: + self.ret = pytest.ExitCode(ret) # type: Union[int, ExitCode] + except ValueError: + self.ret = ret + self.outlines = outlines + self.errlines = errlines + self.stdout = LineMatcher(outlines) + self.stderr = LineMatcher(errlines) + self.duration = duration + + def __repr__(self) -> str: + return ( + "<RunResult ret=%s len(stdout.lines)=%d len(stderr.lines)=%d duration=%.2fs>" + % (self.ret, len(self.stdout.lines), len(self.stderr.lines), self.duration) + ) + + def parseoutcomes(self) -> Dict[str, int]: + """Return a dictionary of outcomestring->num from parsing the terminal + output that the test process produced. + + """ + for line in reversed(self.outlines): + if rex_session_duration.search(line): + outcomes = rex_outcome.findall(line) + ret = {noun: int(count) for (count, noun) in outcomes} + break + else: + raise ValueError("Pytest terminal summary report not found") + if "errors" in ret: + assert "error" not in ret + ret["error"] = ret.pop("errors") + return ret + + def assert_outcomes( + self, + passed: int = 0, + skipped: int = 0, + failed: int = 0, + error: int = 0, + xpassed: int = 0, + xfailed: int = 0, + ) -> None: + """Assert that the specified outcomes appear with the respective + numbers (0 means it didn't occur) in the text output from a test run. + """ + __tracebackhide__ = True + + d = self.parseoutcomes() + obtained = { + "passed": d.get("passed", 0), + "skipped": d.get("skipped", 0), + "failed": d.get("failed", 0), + "error": d.get("error", 0), + "xpassed": d.get("xpassed", 0), + "xfailed": d.get("xfailed", 0), + } + expected = { + "passed": passed, + "skipped": skipped, + "failed": failed, + "error": error, + "xpassed": xpassed, + "xfailed": xfailed, + } + assert obtained == expected + + +class CwdSnapshot: + def __init__(self) -> None: + self.__saved = os.getcwd() + + def restore(self) -> None: + os.chdir(self.__saved) + + +class SysModulesSnapshot: + def __init__(self, preserve: Optional[Callable[[str], bool]] = None): + self.__preserve = preserve + self.__saved = dict(sys.modules) + + def restore(self) -> None: + if self.__preserve: + self.__saved.update( + (k, m) for k, m in sys.modules.items() if self.__preserve(k) + ) + sys.modules.clear() + sys.modules.update(self.__saved) + + +class SysPathsSnapshot: + def __init__(self) -> None: + self.__saved = list(sys.path), list(sys.meta_path) + + def restore(self) -> None: + sys.path[:], sys.meta_path[:] = self.__saved + + +class Testdir: + """Temporary test directory with tools to test/run pytest itself. + + This is based on the ``tmpdir`` fixture but provides a number of methods + which aid with testing pytest itself. Unless :py:meth:`chdir` is used all + methods will use :py:attr:`tmpdir` as their current working directory. + + Attributes: + + :ivar tmpdir: The :py:class:`py.path.local` instance of the temporary directory. + + :ivar plugins: A list of plugins to use with :py:meth:`parseconfig` and + :py:meth:`runpytest`. Initially this is an empty list but plugins can + be added to the list. The type of items to add to the list depends on + the method using them so refer to them for details. + + """ + + __test__ = False + + CLOSE_STDIN = object + + class TimeoutExpired(Exception): + pass + + def __init__(self, request: FixtureRequest, tmpdir_factory: TempdirFactory) -> None: + self.request = request + self._mod_collections = ( + WeakKeyDictionary() + ) # type: WeakKeyDictionary[Module, List[Union[Item, Collector]]] + if request.function: + name = request.function.__name__ # type: str + else: + name = request.node.name + self._name = name + self.tmpdir = tmpdir_factory.mktemp(name, numbered=True) + self.test_tmproot = tmpdir_factory.mktemp("tmp-" + name, numbered=True) + self.plugins = [] # type: List[Union[str, _PluggyPlugin]] + self._cwd_snapshot = CwdSnapshot() + self._sys_path_snapshot = SysPathsSnapshot() + self._sys_modules_snapshot = self.__take_sys_modules_snapshot() + self.chdir() + self.request.addfinalizer(self.finalize) + self._method = self.request.config.getoption("--runpytest") + + mp = self.monkeypatch = MonkeyPatch() + mp.setenv("PYTEST_DEBUG_TEMPROOT", str(self.test_tmproot)) + # Ensure no unexpected caching via tox. + mp.delenv("TOX_ENV_DIR", raising=False) + # Discard outer pytest options. + mp.delenv("PYTEST_ADDOPTS", raising=False) + # Ensure no user config is used. + tmphome = str(self.tmpdir) + mp.setenv("HOME", tmphome) + mp.setenv("USERPROFILE", tmphome) + # Do not use colors for inner runs by default. + mp.setenv("PY_COLORS", "0") + + def __repr__(self): + return "<Testdir {!r}>".format(self.tmpdir) + + def __str__(self): + return str(self.tmpdir) + + def finalize(self): + """Clean up global state artifacts. + + Some methods modify the global interpreter state and this tries to + clean this up. It does not remove the temporary directory however so + it can be looked at after the test run has finished. + + """ + self._sys_modules_snapshot.restore() + self._sys_path_snapshot.restore() + self._cwd_snapshot.restore() + self.monkeypatch.undo() + + def __take_sys_modules_snapshot(self): + # some zope modules used by twisted-related tests keep internal state + # and can't be deleted; we had some trouble in the past with + # `zope.interface` for example + def preserve_module(name): + return name.startswith("zope") + + return SysModulesSnapshot(preserve=preserve_module) + + def make_hook_recorder(self, pluginmanager): + """Create a new :py:class:`HookRecorder` for a PluginManager.""" + pluginmanager.reprec = reprec = HookRecorder(pluginmanager) + self.request.addfinalizer(reprec.finish_recording) + return reprec + + def chdir(self): + """Cd into the temporary directory. + + This is done automatically upon instantiation. + + """ + self.tmpdir.chdir() + + def _makefile(self, ext, lines, files, encoding="utf-8"): + items = list(files.items()) + + def to_text(s): + return s.decode(encoding) if isinstance(s, bytes) else str(s) + + if lines: + source = "\n".join(to_text(x) for x in lines) + basename = self._name + items.insert(0, (basename, source)) + + ret = None + for basename, value in items: + p = self.tmpdir.join(basename).new(ext=ext) + p.dirpath().ensure_dir() + source = Source(value) + source = "\n".join(to_text(line) for line in source.lines) + p.write(source.strip().encode(encoding), "wb") + if ret is None: + ret = p + return ret + + def makefile(self, ext, *args, **kwargs): + r"""Create new file(s) in the testdir. + + :param str ext: The extension the file(s) should use, including the dot, e.g. `.py`. + :param list[str] args: All args will be treated as strings and joined using newlines. + The result will be written as contents to the file. The name of the + file will be based on the test function requesting this fixture. + :param kwargs: Each keyword is the name of a file, while the value of it will + be written as contents of the file. + + Examples: + + .. code-block:: python + + testdir.makefile(".txt", "line1", "line2") + + testdir.makefile(".ini", pytest="[pytest]\naddopts=-rs\n") + + """ + return self._makefile(ext, args, kwargs) + + def makeconftest(self, source): + """Write a contest.py file with 'source' as contents.""" + return self.makepyfile(conftest=source) + + def makeini(self, source): + """Write a tox.ini file with 'source' as contents.""" + return self.makefile(".ini", tox=source) + + def getinicfg(self, source): + """Return the pytest section from the tox.ini config file.""" + p = self.makeini(source) + return py.iniconfig.IniConfig(p)["pytest"] + + def makepyfile(self, *args, **kwargs): + """Shortcut for .makefile() with a .py extension.""" + return self._makefile(".py", args, kwargs) + + def maketxtfile(self, *args, **kwargs): + """Shortcut for .makefile() with a .txt extension.""" + return self._makefile(".txt", args, kwargs) + + def syspathinsert(self, path=None): + """Prepend a directory to sys.path, defaults to :py:attr:`tmpdir`. + + This is undone automatically when this object dies at the end of each + test. + """ + if path is None: + path = self.tmpdir + + self.monkeypatch.syspath_prepend(str(path)) + + def mkdir(self, name): + """Create a new (sub)directory.""" + return self.tmpdir.mkdir(name) + + def mkpydir(self, name): + """Create a new python package. + + This creates a (sub)directory with an empty ``__init__.py`` file so it + gets recognised as a python package. + + """ + p = self.mkdir(name) + p.ensure("__init__.py") + return p + + def copy_example(self, name=None): + """Copy file from project's directory into the testdir. + + :param str name: The name of the file to copy. + :return: path to the copied directory (inside ``self.tmpdir``). + + """ + import warnings + from _pytest.warning_types import PYTESTER_COPY_EXAMPLE + + warnings.warn(PYTESTER_COPY_EXAMPLE, stacklevel=2) + example_dir = self.request.config.getini("pytester_example_dir") + if example_dir is None: + raise ValueError("pytester_example_dir is unset, can't copy examples") + example_dir = self.request.config.rootdir.join(example_dir) + + for extra_element in self.request.node.iter_markers("pytester_example_path"): + assert extra_element.args + example_dir = example_dir.join(*extra_element.args) + + if name is None: + func_name = self._name + maybe_dir = example_dir / func_name + maybe_file = example_dir / (func_name + ".py") + + if maybe_dir.isdir(): + example_path = maybe_dir + elif maybe_file.isfile(): + example_path = maybe_file + else: + raise LookupError( + "{} cant be found as module or package in {}".format( + func_name, example_dir.bestrelpath(self.request.config.rootdir) + ) + ) + else: + example_path = example_dir.join(name) + + if example_path.isdir() and not example_path.join("__init__.py").isfile(): + example_path.copy(self.tmpdir) + return self.tmpdir + elif example_path.isfile(): + result = self.tmpdir.join(example_path.basename) + example_path.copy(result) + return result + else: + raise LookupError( + 'example "{}" is not found as a file or directory'.format(example_path) + ) + + Session = Session + + def getnode(self, config, arg): + """Return the collection node of a file. + + :param config: :py:class:`_pytest.config.Config` instance, see + :py:meth:`parseconfig` and :py:meth:`parseconfigure` to create the + configuration + + :param arg: a :py:class:`py.path.local` instance of the file + + """ + session = Session.from_config(config) + assert "::" not in str(arg) + p = py.path.local(arg) + config.hook.pytest_sessionstart(session=session) + res = session.perform_collect([str(p)], genitems=False)[0] + config.hook.pytest_sessionfinish(session=session, exitstatus=ExitCode.OK) + return res + + def getpathnode(self, path): + """Return the collection node of a file. + + This is like :py:meth:`getnode` but uses :py:meth:`parseconfigure` to + create the (configured) pytest Config instance. + + :param path: a :py:class:`py.path.local` instance of the file + + """ + config = self.parseconfigure(path) + session = Session.from_config(config) + x = session.fspath.bestrelpath(path) + config.hook.pytest_sessionstart(session=session) + res = session.perform_collect([x], genitems=False)[0] + config.hook.pytest_sessionfinish(session=session, exitstatus=ExitCode.OK) + return res + + def genitems(self, colitems): + """Generate all test items from a collection node. + + This recurses into the collection node and returns a list of all the + test items contained within. + + """ + session = colitems[0].session + result = [] + for colitem in colitems: + result.extend(session.genitems(colitem)) + return result + + def runitem(self, source): + """Run the "test_func" Item. + + The calling test instance (class containing the test method) must + provide a ``.getrunner()`` method which should return a runner which + can run the test protocol for a single item, e.g. + :py:func:`_pytest.runner.runtestprotocol`. + + """ + # used from runner functional tests + item = self.getitem(source) + # the test class where we are called from wants to provide the runner + testclassinstance = self.request.instance + runner = testclassinstance.getrunner() + return runner(item) + + def inline_runsource(self, source, *cmdlineargs): + """Run a test module in process using ``pytest.main()``. + + This run writes "source" into a temporary file and runs + ``pytest.main()`` on it, returning a :py:class:`HookRecorder` instance + for the result. + + :param source: the source code of the test module + + :param cmdlineargs: any extra command line arguments to use + + :return: :py:class:`HookRecorder` instance of the result + + """ + p = self.makepyfile(source) + values = list(cmdlineargs) + [p] + return self.inline_run(*values) + + def inline_genitems(self, *args): + """Run ``pytest.main(['--collectonly'])`` in-process. + + Runs the :py:func:`pytest.main` function to run all of pytest inside + the test process itself like :py:meth:`inline_run`, but returns a + tuple of the collected items and a :py:class:`HookRecorder` instance. + + """ + rec = self.inline_run("--collect-only", *args) + items = [x.item for x in rec.getcalls("pytest_itemcollected")] + return items, rec + + def inline_run(self, *args, plugins=(), no_reraise_ctrlc: bool = False): + """Run ``pytest.main()`` in-process, returning a HookRecorder. + + Runs the :py:func:`pytest.main` function to run all of pytest inside + the test process itself. This means it can return a + :py:class:`HookRecorder` instance which gives more detailed results + from that run than can be done by matching stdout/stderr from + :py:meth:`runpytest`. + + :param args: command line arguments to pass to :py:func:`pytest.main` + + :kwarg plugins: extra plugin instances the ``pytest.main()`` instance should use. + + :kwarg no_reraise_ctrlc: typically we reraise keyboard interrupts from the child run. If + True, the KeyboardInterrupt exception is captured. + + :return: a :py:class:`HookRecorder` instance + """ + # (maybe a cpython bug?) the importlib cache sometimes isn't updated + # properly between file creation and inline_run (especially if imports + # are interspersed with file creation) + importlib.invalidate_caches() + + plugins = list(plugins) + finalizers = [] + try: + # Any sys.module or sys.path changes done while running pytest + # inline should be reverted after the test run completes to avoid + # clashing with later inline tests run within the same pytest test, + # e.g. just because they use matching test module names. + finalizers.append(self.__take_sys_modules_snapshot().restore) + finalizers.append(SysPathsSnapshot().restore) + + # Important note: + # - our tests should not leave any other references/registrations + # laying around other than possibly loaded test modules + # referenced from sys.modules, as nothing will clean those up + # automatically + + rec = [] + + class Collect: + def pytest_configure(x, config): + rec.append(self.make_hook_recorder(config.pluginmanager)) + + plugins.append(Collect()) + ret = pytest.main(list(args), plugins=plugins) + if len(rec) == 1: + reprec = rec.pop() + else: + + class reprec: # type: ignore + pass + + reprec.ret = ret + + # typically we reraise keyboard interrupts from the child run + # because it's our user requesting interruption of the testing + if ret == ExitCode.INTERRUPTED and not no_reraise_ctrlc: + calls = reprec.getcalls("pytest_keyboard_interrupt") + if calls and calls[-1].excinfo.type == KeyboardInterrupt: + raise KeyboardInterrupt() + return reprec + finally: + for finalizer in finalizers: + finalizer() + + def runpytest_inprocess(self, *args, **kwargs) -> RunResult: + """Return result of running pytest in-process, providing a similar + interface to what self.runpytest() provides. + """ + syspathinsert = kwargs.pop("syspathinsert", False) + + if syspathinsert: + self.syspathinsert() + now = time.time() + capture = MultiCapture(Capture=SysCapture) + capture.start_capturing() + try: + try: + reprec = self.inline_run(*args, **kwargs) + except SystemExit as e: + ret = e.args[0] + try: + ret = ExitCode(e.args[0]) + except ValueError: + pass + + class reprec: # type: ignore + ret = ret + + except Exception: + traceback.print_exc() + + class reprec: # type: ignore + ret = ExitCode(3) + + finally: + out, err = capture.readouterr() + capture.stop_capturing() + sys.stdout.write(out) + sys.stderr.write(err) + + res = RunResult( + reprec.ret, out.splitlines(), err.splitlines(), time.time() - now + ) + res.reprec = reprec # type: ignore + return res + + def runpytest(self, *args, **kwargs) -> RunResult: + """Run pytest inline or in a subprocess, depending on the command line + option "--runpytest" and return a :py:class:`RunResult`. + + """ + args = self._ensure_basetemp(args) + if self._method == "inprocess": + return self.runpytest_inprocess(*args, **kwargs) + elif self._method == "subprocess": + return self.runpytest_subprocess(*args, **kwargs) + raise RuntimeError("Unrecognized runpytest option: {}".format(self._method)) + + def _ensure_basetemp(self, args): + args = list(args) + for x in args: + if str(x).startswith("--basetemp"): + break + else: + args.append("--basetemp=%s" % self.tmpdir.dirpath("basetemp")) + return args + + def parseconfig(self, *args): + """Return a new pytest Config instance from given commandline args. + + This invokes the pytest bootstrapping code in _pytest.config to create + a new :py:class:`_pytest.core.PluginManager` and call the + pytest_cmdline_parse hook to create a new + :py:class:`_pytest.config.Config` instance. + + If :py:attr:`plugins` has been populated they should be plugin modules + to be registered with the PluginManager. + + """ + args = self._ensure_basetemp(args) + + import _pytest.config + + config = _pytest.config._prepareconfig(args, self.plugins) + # we don't know what the test will do with this half-setup config + # object and thus we make sure it gets unconfigured properly in any + # case (otherwise capturing could still be active, for example) + self.request.addfinalizer(config._ensure_unconfigure) + return config + + def parseconfigure(self, *args): + """Return a new pytest configured Config instance. + + This returns a new :py:class:`_pytest.config.Config` instance like + :py:meth:`parseconfig`, but also calls the pytest_configure hook. + """ + config = self.parseconfig(*args) + config._do_configure() + return config + + def getitem(self, source, funcname="test_func"): + """Return the test item for a test function. + + This writes the source to a python file and runs pytest's collection on + the resulting module, returning the test item for the requested + function name. + + :param source: the module source + + :param funcname: the name of the test function for which to return a + test item + + """ + items = self.getitems(source) + for item in items: + if item.name == funcname: + return item + assert 0, "{!r} item not found in module:\n{}\nitems: {}".format( + funcname, source, items + ) + + def getitems(self, source): + """Return all test items collected from the module. + + This writes the source to a python file and runs pytest's collection on + the resulting module, returning all test items contained within. + + """ + modcol = self.getmodulecol(source) + return self.genitems([modcol]) + + def getmodulecol(self, source, configargs=(), withinit=False): + """Return the module collection node for ``source``. + + This writes ``source`` to a file using :py:meth:`makepyfile` and then + runs the pytest collection on it, returning the collection node for the + test module. + + :param source: the source code of the module to collect + + :param configargs: any extra arguments to pass to + :py:meth:`parseconfigure` + + :param withinit: whether to also write an ``__init__.py`` file to the + same directory to ensure it is a package + + """ + if isinstance(source, Path): + path = self.tmpdir.join(str(source)) + assert not withinit, "not supported for paths" + else: + kw = {self._name: Source(source).strip()} + path = self.makepyfile(**kw) + if withinit: + self.makepyfile(__init__="#") + self.config = config = self.parseconfigure(path, *configargs) + return self.getnode(config, path) + + def collect_by_name( + self, modcol: Module, name: str + ) -> Optional[Union[Item, Collector]]: + """Return the collection node for name from the module collection. + + This will search a module collection node for a collection node + matching the given name. + + :param modcol: a module collection node; see :py:meth:`getmodulecol` + + :param name: the name of the node to return + """ + if modcol not in self._mod_collections: + self._mod_collections[modcol] = list(modcol.collect()) + for colitem in self._mod_collections[modcol]: + if colitem.name == name: + return colitem + return None + + def popen( + self, + cmdargs, + stdout=subprocess.PIPE, + stderr=subprocess.PIPE, + stdin=CLOSE_STDIN, + **kw + ): + """Invoke subprocess.Popen. + + This calls subprocess.Popen making sure the current working directory + is in the PYTHONPATH. + + You probably want to use :py:meth:`run` instead. + + """ + env = os.environ.copy() + env["PYTHONPATH"] = os.pathsep.join( + filter(None, [os.getcwd(), env.get("PYTHONPATH", "")]) + ) + kw["env"] = env + + if stdin is Testdir.CLOSE_STDIN: + kw["stdin"] = subprocess.PIPE + elif isinstance(stdin, bytes): + kw["stdin"] = subprocess.PIPE + else: + kw["stdin"] = stdin + + popen = subprocess.Popen(cmdargs, stdout=stdout, stderr=stderr, **kw) + if stdin is Testdir.CLOSE_STDIN: + popen.stdin.close() + elif isinstance(stdin, bytes): + popen.stdin.write(stdin) + + return popen + + def run(self, *cmdargs, timeout=None, stdin=CLOSE_STDIN) -> RunResult: + """Run a command with arguments. + + Run a process using subprocess.Popen saving the stdout and stderr. + + :param args: the sequence of arguments to pass to `subprocess.Popen()` + :kwarg timeout: the period in seconds after which to timeout and raise + :py:class:`Testdir.TimeoutExpired` + :kwarg stdin: optional standard input. Bytes are being send, closing + the pipe, otherwise it is passed through to ``popen``. + Defaults to ``CLOSE_STDIN``, which translates to using a pipe + (``subprocess.PIPE``) that gets closed. + + Returns a :py:class:`RunResult`. + + """ + __tracebackhide__ = True + + cmdargs = tuple( + str(arg) if isinstance(arg, py.path.local) else arg for arg in cmdargs + ) + p1 = self.tmpdir.join("stdout") + p2 = self.tmpdir.join("stderr") + print("running:", *cmdargs) + print(" in:", py.path.local()) + f1 = open(str(p1), "w", encoding="utf8") + f2 = open(str(p2), "w", encoding="utf8") + try: + now = time.time() + popen = self.popen( + cmdargs, + stdin=stdin, + stdout=f1, + stderr=f2, + close_fds=(sys.platform != "win32"), + ) + if isinstance(stdin, bytes): + popen.stdin.close() + + def handle_timeout(): + __tracebackhide__ = True + + timeout_message = ( + "{seconds} second timeout expired running:" + " {command}".format(seconds=timeout, command=cmdargs) + ) + + popen.kill() + popen.wait() + raise self.TimeoutExpired(timeout_message) + + if timeout is None: + ret = popen.wait() + else: + try: + ret = popen.wait(timeout) + except subprocess.TimeoutExpired: + handle_timeout() + finally: + f1.close() + f2.close() + f1 = open(str(p1), "r", encoding="utf8") + f2 = open(str(p2), "r", encoding="utf8") + try: + out = f1.read().splitlines() + err = f2.read().splitlines() + finally: + f1.close() + f2.close() + self._dump_lines(out, sys.stdout) + self._dump_lines(err, sys.stderr) + try: + ret = ExitCode(ret) + except ValueError: + pass + return RunResult(ret, out, err, time.time() - now) + + def _dump_lines(self, lines, fp): + try: + for line in lines: + print(line, file=fp) + except UnicodeEncodeError: + print("couldn't print to {} because of encoding".format(fp)) + + def _getpytestargs(self): + return sys.executable, "-mpytest" + + def runpython(self, script) -> RunResult: + """Run a python script using sys.executable as interpreter. + + Returns a :py:class:`RunResult`. + + """ + return self.run(sys.executable, script) + + def runpython_c(self, command): + """Run python -c "command", return a :py:class:`RunResult`.""" + return self.run(sys.executable, "-c", command) + + def runpytest_subprocess(self, *args, timeout=None) -> RunResult: + """Run pytest as a subprocess with given arguments. + + Any plugins added to the :py:attr:`plugins` list will be added using the + ``-p`` command line option. Additionally ``--basetemp`` is used to put + any temporary files and directories in a numbered directory prefixed + with "runpytest-" to not conflict with the normal numbered pytest + location for temporary files and directories. + + :param args: the sequence of arguments to pass to the pytest subprocess + :param timeout: the period in seconds after which to timeout and raise + :py:class:`Testdir.TimeoutExpired` + + Returns a :py:class:`RunResult`. + """ + __tracebackhide__ = True + p = py.path.local.make_numbered_dir( + prefix="runpytest-", keep=None, rootdir=self.tmpdir + ) + args = ("--basetemp=%s" % p,) + args + plugins = [x for x in self.plugins if isinstance(x, str)] + if plugins: + args = ("-p", plugins[0]) + args + args = self._getpytestargs() + args + return self.run(*args, timeout=timeout) + + def spawn_pytest( + self, string: str, expect_timeout: float = 10.0 + ) -> "pexpect.spawn": + """Run pytest using pexpect. + + This makes sure to use the right pytest and sets up the temporary + directory locations. + + The pexpect child is returned. + + """ + basetemp = self.tmpdir.mkdir("temp-pexpect") + invoke = " ".join(map(str, self._getpytestargs())) + cmd = "{} --basetemp={} {}".format(invoke, basetemp, string) + return self.spawn(cmd, expect_timeout=expect_timeout) + + def spawn(self, cmd: str, expect_timeout: float = 10.0) -> "pexpect.spawn": + """Run a command using pexpect. + + The pexpect child is returned. + + """ + pexpect = pytest.importorskip("pexpect", "3.0") + if hasattr(sys, "pypy_version_info") and "64" in platform.machine(): + pytest.skip("pypy-64 bit not supported") + if not hasattr(pexpect, "spawn"): + pytest.skip("pexpect.spawn not available") + logfile = self.tmpdir.join("spawn.out").open("wb") + + child = pexpect.spawn(cmd, logfile=logfile) + self.request.addfinalizer(logfile.close) + child.timeout = expect_timeout + return child + + +class LineComp: + def __init__(self) -> None: + self.stringio = StringIO() + """:class:`python:io.StringIO()` instance used for input.""" + + def assert_contains_lines(self, lines2: Sequence[str]) -> None: + """Assert that ``lines2`` are contained (linearly) in :attr:`stringio`'s value. + + Lines are matched using :func:`LineMatcher.fnmatch_lines`. + """ + __tracebackhide__ = True + val = self.stringio.getvalue() + self.stringio.truncate(0) + self.stringio.seek(0) + lines1 = val.split("\n") + LineMatcher(lines1).fnmatch_lines(lines2) + + +class LineMatcher: + """Flexible matching of text. + + This is a convenience class to test large texts like the output of + commands. + + The constructor takes a list of lines without their trailing newlines, i.e. + ``text.splitlines()``. + """ + + def __init__(self, lines: List[str]) -> None: + self.lines = lines + self._log_output = [] # type: List[str] + + def _getlines(self, lines2: Union[str, Sequence[str], Source]) -> Sequence[str]: + if isinstance(lines2, str): + lines2 = Source(lines2) + if isinstance(lines2, Source): + lines2 = lines2.strip().lines + return lines2 + + def fnmatch_lines_random(self, lines2: Sequence[str]) -> None: + """Check lines exist in the output in any order (using :func:`python:fnmatch.fnmatch`). + """ + __tracebackhide__ = True + self._match_lines_random(lines2, fnmatch) + + def re_match_lines_random(self, lines2: Sequence[str]) -> None: + """Check lines exist in the output in any order (using :func:`python:re.match`). + """ + __tracebackhide__ = True + self._match_lines_random(lines2, lambda name, pat: bool(re.match(pat, name))) + + def _match_lines_random( + self, lines2: Sequence[str], match_func: Callable[[str, str], bool] + ) -> None: + __tracebackhide__ = True + lines2 = self._getlines(lines2) + for line in lines2: + for x in self.lines: + if line == x or match_func(x, line): + self._log("matched: ", repr(line)) + break + else: + msg = "line %r not found in output" % line + self._log(msg) + self._fail(msg) + + def get_lines_after(self, fnline: str) -> Sequence[str]: + """Return all lines following the given line in the text. + + The given line can contain glob wildcards. + """ + for i, line in enumerate(self.lines): + if fnline == line or fnmatch(line, fnline): + return self.lines[i + 1 :] + raise ValueError("line %r not found in output" % fnline) + + def _log(self, *args) -> None: + self._log_output.append(" ".join(str(x) for x in args)) + + @property + def _log_text(self) -> str: + return "\n".join(self._log_output) + + def fnmatch_lines( + self, lines2: Sequence[str], *, consecutive: bool = False + ) -> None: + """Check lines exist in the output (using :func:`python:fnmatch.fnmatch`). + + The argument is a list of lines which have to match and can use glob + wildcards. If they do not match a pytest.fail() is called. The + matches and non-matches are also shown as part of the error message. + + :param lines2: string patterns to match. + :param consecutive: match lines consecutive? + """ + __tracebackhide__ = True + self._match_lines(lines2, fnmatch, "fnmatch", consecutive=consecutive) + + def re_match_lines( + self, lines2: Sequence[str], *, consecutive: bool = False + ) -> None: + """Check lines exist in the output (using :func:`python:re.match`). + + The argument is a list of lines which have to match using ``re.match``. + If they do not match a pytest.fail() is called. + + The matches and non-matches are also shown as part of the error message. + + :param lines2: string patterns to match. + :param consecutive: match lines consecutively? + """ + __tracebackhide__ = True + self._match_lines( + lines2, + lambda name, pat: bool(re.match(pat, name)), + "re.match", + consecutive=consecutive, + ) + + def _match_lines( + self, + lines2: Sequence[str], + match_func: Callable[[str, str], bool], + match_nickname: str, + *, + consecutive: bool = False + ) -> None: + """Underlying implementation of ``fnmatch_lines`` and ``re_match_lines``. + + :param list[str] lines2: list of string patterns to match. The actual + format depends on ``match_func`` + :param match_func: a callable ``match_func(line, pattern)`` where line + is the captured line from stdout/stderr and pattern is the matching + pattern + :param str match_nickname: the nickname for the match function that + will be logged to stdout when a match occurs + :param consecutive: match lines consecutively? + """ + if not isinstance(lines2, collections.abc.Sequence): + raise TypeError("invalid type for lines2: {}".format(type(lines2).__name__)) + lines2 = self._getlines(lines2) + lines1 = self.lines[:] + nextline = None + extralines = [] + __tracebackhide__ = True + wnick = len(match_nickname) + 1 + started = False + for line in lines2: + nomatchprinted = False + while lines1: + nextline = lines1.pop(0) + if line == nextline: + self._log("exact match:", repr(line)) + started = True + break + elif match_func(nextline, line): + self._log("%s:" % match_nickname, repr(line)) + self._log( + "{:>{width}}".format("with:", width=wnick), repr(nextline) + ) + started = True + break + else: + if consecutive and started: + msg = "no consecutive match: {!r}".format(line) + self._log(msg) + self._log( + "{:>{width}}".format("with:", width=wnick), repr(nextline) + ) + self._fail(msg) + if not nomatchprinted: + self._log( + "{:>{width}}".format("nomatch:", width=wnick), repr(line) + ) + nomatchprinted = True + self._log("{:>{width}}".format("and:", width=wnick), repr(nextline)) + extralines.append(nextline) + else: + msg = "remains unmatched: {!r}".format(line) + self._log(msg) + self._fail(msg) + self._log_output = [] + + def no_fnmatch_line(self, pat: str) -> None: + """Ensure captured lines do not match the given pattern, using ``fnmatch.fnmatch``. + + :param str pat: the pattern to match lines. + """ + __tracebackhide__ = True + self._no_match_line(pat, fnmatch, "fnmatch") + + def no_re_match_line(self, pat: str) -> None: + """Ensure captured lines do not match the given pattern, using ``re.match``. + + :param str pat: the regular expression to match lines. + """ + __tracebackhide__ = True + self._no_match_line( + pat, lambda name, pat: bool(re.match(pat, name)), "re.match" + ) + + def _no_match_line( + self, pat: str, match_func: Callable[[str, str], bool], match_nickname: str + ) -> None: + """Ensure captured lines does not have a the given pattern, using ``fnmatch.fnmatch`` + + :param str pat: the pattern to match lines + """ + __tracebackhide__ = True + nomatch_printed = False + wnick = len(match_nickname) + 1 + for line in self.lines: + if match_func(line, pat): + msg = "{}: {!r}".format(match_nickname, pat) + self._log(msg) + self._log("{:>{width}}".format("with:", width=wnick), repr(line)) + self._fail(msg) + else: + if not nomatch_printed: + self._log("{:>{width}}".format("nomatch:", width=wnick), repr(pat)) + nomatch_printed = True + self._log("{:>{width}}".format("and:", width=wnick), repr(line)) + self._log_output = [] + + def _fail(self, msg: str) -> None: + __tracebackhide__ = True + log_text = self._log_text + self._log_output = [] + pytest.fail(log_text) + + def str(self) -> str: + """Return the entire original text.""" + return "\n".join(self.lines) diff --git a/contrib/python/pytest/py3/_pytest/python.py b/contrib/python/pytest/py3/_pytest/python.py new file mode 100644 index 00000000000..0c1df99e362 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/python.py @@ -0,0 +1,1550 @@ +""" Python test discovery, setup and run of test functions. """ +import enum +import fnmatch +import inspect +import itertools +import os +import sys +import typing +import warnings +from collections import Counter +from collections import defaultdict +from collections.abc import Sequence +from functools import partial +from typing import Callable +from typing import Dict +from typing import Iterable +from typing import List +from typing import Optional +from typing import Tuple +from typing import Union + +import py + +import _pytest +from _pytest import fixtures +from _pytest import nodes +from _pytest._code import filter_traceback +from _pytest._code.code import ExceptionInfo +from _pytest._code.source import getfslineno +from _pytest._io import TerminalWriter +from _pytest._io.saferepr import saferepr +from _pytest.compat import ascii_escaped +from _pytest.compat import get_default_arg_names +from _pytest.compat import get_real_func +from _pytest.compat import getimfunc +from _pytest.compat import getlocation +from _pytest.compat import is_async_function +from _pytest.compat import is_generator +from _pytest.compat import NOTSET +from _pytest.compat import REGEX_TYPE +from _pytest.compat import safe_getattr +from _pytest.compat import safe_isclass +from _pytest.compat import STRING_TYPES +from _pytest.config import Config +from _pytest.config import hookimpl +from _pytest.deprecated import FUNCARGNAMES +from _pytest.fixtures import FuncFixtureInfo +from _pytest.mark import MARK_GEN +from _pytest.mark import ParameterSet +from _pytest.mark.structures import get_unpacked_marks +from _pytest.mark.structures import Mark +from _pytest.mark.structures import normalize_mark_list +from _pytest.outcomes import fail +from _pytest.outcomes import skip +from _pytest.pathlib import parts +from _pytest.warning_types import PytestCollectionWarning +from _pytest.warning_types import PytestUnhandledCoroutineWarning + + +def pyobj_property(name): + def get(self): + node = self.getparent(getattr(__import__("pytest"), name)) + if node is not None: + return node.obj + + doc = "python {} object this node was collected from (can be None).".format( + name.lower() + ) + return property(get, None, None, doc) + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group.addoption( + "--fixtures", + "--funcargs", + action="store_true", + dest="showfixtures", + default=False, + help="show available fixtures, sorted by plugin appearance " + "(fixtures with leading '_' are only shown with '-v')", + ) + group.addoption( + "--fixtures-per-test", + action="store_true", + dest="show_fixtures_per_test", + default=False, + help="show fixtures per test", + ) + parser.addini( + "python_files", + type="args", + # NOTE: default is also used in AssertionRewritingHook. + default=["test_*.py", "*_test.py"], + help="glob-style file patterns for Python test module discovery", + ) + parser.addini( + "python_classes", + type="args", + default=["Test"], + help="prefixes or glob names for Python test class discovery", + ) + parser.addini( + "python_functions", + type="args", + default=["test"], + help="prefixes or glob names for Python test function and method discovery", + ) + parser.addini( + "disable_test_id_escaping_and_forfeit_all_rights_to_community_support", + type="bool", + default=False, + help="disable string escape non-ascii characters, might cause unwanted " + "side effects(use at your own risk)", + ) + + group.addoption( + "--import-mode", + default="prepend", + choices=["prepend", "append"], + dest="importmode", + help="prepend/append to sys.path when importing test modules, " + "default is to prepend.", + ) + + +def pytest_cmdline_main(config): + if config.option.showfixtures: + showfixtures(config) + return 0 + if config.option.show_fixtures_per_test: + show_fixtures_per_test(config) + return 0 + + +def pytest_generate_tests(metafunc: "Metafunc") -> None: + for marker in metafunc.definition.iter_markers(name="parametrize"): + # TODO: Fix this type-ignore (overlapping kwargs). + metafunc.parametrize(*marker.args, **marker.kwargs, _param_mark=marker) # type: ignore[misc] # noqa: F821 + + +def pytest_configure(config): + config.addinivalue_line( + "markers", + "parametrize(argnames, argvalues): call a test function multiple " + "times passing in different arguments in turn. argvalues generally " + "needs to be a list of values if argnames specifies only one name " + "or a list of tuples of values if argnames specifies multiple names. " + "Example: @parametrize('arg1', [1,2]) would lead to two calls of the " + "decorated test function, one with arg1=1 and another with arg1=2." + "see https://docs.pytest.org/en/latest/parametrize.html for more info " + "and examples.", + ) + config.addinivalue_line( + "markers", + "usefixtures(fixturename1, fixturename2, ...): mark tests as needing " + "all of the specified fixtures. see " + "https://docs.pytest.org/en/latest/fixture.html#usefixtures ", + ) + + +def async_warn_and_skip(nodeid: str) -> None: + msg = "async def functions are not natively supported and have been skipped.\n" + msg += ( + "You need to install a suitable plugin for your async framework, for example:\n" + ) + msg += " - pytest-asyncio\n" + msg += " - pytest-trio\n" + msg += " - pytest-tornasync\n" + msg += " - pytest-twisted" + warnings.warn(PytestUnhandledCoroutineWarning(msg.format(nodeid))) + skip(msg="async def function and no async plugin installed (see warnings)") + + +@hookimpl(trylast=True) +def pytest_pyfunc_call(pyfuncitem: "Function"): + testfunction = pyfuncitem.obj + if is_async_function(testfunction): + async_warn_and_skip(pyfuncitem.nodeid) + funcargs = pyfuncitem.funcargs + testargs = {arg: funcargs[arg] for arg in pyfuncitem._fixtureinfo.argnames} + result = testfunction(**testargs) + if hasattr(result, "__await__") or hasattr(result, "__aiter__"): + async_warn_and_skip(pyfuncitem.nodeid) + return True + + +def pytest_collect_file(path, parent): + ext = path.ext + if ext == ".py": + if not parent.session.isinitpath(path): + if not path_matches_patterns( + path, parent.config.getini("python_files") + ["__init__.py"] + ): + return + ihook = parent.session.gethookproxy(path) + return ihook.pytest_pycollect_makemodule(path=path, parent=parent) + + +def path_matches_patterns(path, patterns): + """Returns True if the given py.path.local matches one of the patterns in the list of globs given""" + return any(path.fnmatch(pattern) for pattern in patterns) + + +def pytest_pycollect_makemodule(path, parent): + if path.basename == "__init__.py": + return Package.from_parent(parent, fspath=path) + return Module.from_parent(parent, fspath=path) + + +@hookimpl(hookwrapper=True) +def pytest_pycollect_makeitem(collector, name, obj): + outcome = yield + res = outcome.get_result() + if res is not None: + return + # nothing was collected elsewhere, let's do it here + if safe_isclass(obj): + if collector.istestclass(obj, name): + outcome.force_result(Class.from_parent(collector, name=name, obj=obj)) + elif collector.istestfunction(obj, name): + # mock seems to store unbound methods (issue473), normalize it + obj = getattr(obj, "__func__", obj) + # We need to try and unwrap the function if it's a functools.partial + # or a functools.wrapped. + # We mustn't if it's been wrapped with mock.patch (python 2 only) + if not (inspect.isfunction(obj) or inspect.isfunction(get_real_func(obj))): + filename, lineno = getfslineno(obj) + warnings.warn_explicit( + message=PytestCollectionWarning( + "cannot collect %r because it is not a function." % name + ), + category=None, + filename=str(filename), + lineno=lineno + 1, + ) + elif getattr(obj, "__test__", True): + if is_generator(obj): + res = Function.from_parent(collector, name=name) + reason = "yield tests were removed in pytest 4.0 - {name} will be ignored".format( + name=name + ) + res.add_marker(MARK_GEN.xfail(run=False, reason=reason)) + res.warn(PytestCollectionWarning(reason)) + else: + res = list(collector._genfunctions(name, obj)) + outcome.force_result(res) + + +class PyobjMixin: + module = pyobj_property("Module") + cls = pyobj_property("Class") + instance = pyobj_property("Instance") + _ALLOW_MARKERS = True + + @property + def obj(self): + """Underlying Python object.""" + obj = getattr(self, "_obj", None) + if obj is None: + self._obj = obj = self._getobj() + # XXX evil hack + # used to avoid Instance collector marker duplication + if self._ALLOW_MARKERS: + self.own_markers.extend(get_unpacked_marks(self.obj)) + return obj + + @obj.setter + def obj(self, value): + self._obj = value + + def _getobj(self): + """Gets the underlying Python object. May be overwritten by subclasses.""" + return getattr(self.parent.obj, self.name) + + def getmodpath(self, stopatmodule=True, includemodule=False): + """ return python path relative to the containing module. """ + chain = self.listchain() + chain.reverse() + parts = [] + for node in chain: + if isinstance(node, Instance): + continue + name = node.name + if isinstance(node, Module): + name = os.path.splitext(name)[0] + if stopatmodule: + if includemodule: + parts.append(name) + break + parts.append(name) + parts.reverse() + return ".".join(parts) + + def reportinfo(self) -> Tuple[Union[py.path.local, str], int, str]: + # XXX caching? + obj = self.obj + compat_co_firstlineno = getattr(obj, "compat_co_firstlineno", None) + if isinstance(compat_co_firstlineno, int): + # nose compatibility + file_path = sys.modules[obj.__module__].__file__ + if file_path.endswith(".pyc"): + file_path = file_path[:-1] + fspath = file_path # type: Union[py.path.local, str] + lineno = compat_co_firstlineno + else: + fspath, lineno = getfslineno(obj) + modpath = self.getmodpath() + assert isinstance(lineno, int) + return fspath, lineno, modpath + + +class PyCollector(PyobjMixin, nodes.Collector): + def funcnamefilter(self, name): + return self._matches_prefix_or_glob_option("python_functions", name) + + def isnosetest(self, obj): + """ Look for the __test__ attribute, which is applied by the + @nose.tools.istest decorator + """ + # We explicitly check for "is True" here to not mistakenly treat + # classes with a custom __getattr__ returning something truthy (like a + # function) as test classes. + return safe_getattr(obj, "__test__", False) is True + + def classnamefilter(self, name): + return self._matches_prefix_or_glob_option("python_classes", name) + + def istestfunction(self, obj, name): + if self.funcnamefilter(name) or self.isnosetest(obj): + if isinstance(obj, staticmethod): + # static methods need to be unwrapped + obj = safe_getattr(obj, "__func__", False) + return ( + safe_getattr(obj, "__call__", False) + and fixtures.getfixturemarker(obj) is None + ) + else: + return False + + def istestclass(self, obj, name): + return self.classnamefilter(name) or self.isnosetest(obj) + + def _matches_prefix_or_glob_option(self, option_name, name): + """ + checks if the given name matches the prefix or glob-pattern defined + in ini configuration. + """ + for option in self.config.getini(option_name): + if name.startswith(option): + return True + # check that name looks like a glob-string before calling fnmatch + # because this is called for every name in each collected module, + # and fnmatch is somewhat expensive to call + elif ("*" in option or "?" in option or "[" in option) and fnmatch.fnmatch( + name, option + ): + return True + return False + + def collect(self): + if not getattr(self.obj, "__test__", True): + return [] + + # NB. we avoid random getattrs and peek in the __dict__ instead + # (XXX originally introduced from a PyPy need, still true?) + dicts = [getattr(self.obj, "__dict__", {})] + for basecls in inspect.getmro(self.obj.__class__): + dicts.append(basecls.__dict__) + seen = {} + values = [] + for dic in dicts: + for name, obj in list(dic.items()): + if name in seen: + continue + seen[name] = True + res = self._makeitem(name, obj) + if res is None: + continue + if not isinstance(res, list): + res = [res] + values.extend(res) + + def sort_key(item): + fspath, lineno, _ = item.reportinfo() + return (str(fspath), lineno) + + values.sort(key=sort_key) + return values + + def _makeitem(self, name, obj): + # assert self.ihook.fspath == self.fspath, self + return self.ihook.pytest_pycollect_makeitem(collector=self, name=name, obj=obj) + + def _genfunctions(self, name, funcobj): + module = self.getparent(Module).obj + clscol = self.getparent(Class) + cls = clscol and clscol.obj or None + fm = self.session._fixturemanager + + definition = FunctionDefinition.from_parent(self, name=name, callobj=funcobj) + fixtureinfo = definition._fixtureinfo + + metafunc = Metafunc( + definition, fixtureinfo, self.config, cls=cls, module=module + ) + methods = [] + if hasattr(module, "pytest_generate_tests"): + methods.append(module.pytest_generate_tests) + if hasattr(cls, "pytest_generate_tests"): + methods.append(cls().pytest_generate_tests) + + self.ihook.pytest_generate_tests.call_extra(methods, dict(metafunc=metafunc)) + + if not metafunc._calls: + yield Function.from_parent(self, name=name, fixtureinfo=fixtureinfo) + else: + # add funcargs() as fixturedefs to fixtureinfo.arg2fixturedefs + fixtures.add_funcarg_pseudo_fixture_def(self, metafunc, fm) + + # add_funcarg_pseudo_fixture_def may have shadowed some fixtures + # with direct parametrization, so make sure we update what the + # function really needs. + fixtureinfo.prune_dependency_tree() + + for callspec in metafunc._calls: + subname = "{}[{}]".format(name, callspec.id) + yield Function.from_parent( + self, + name=subname, + callspec=callspec, + callobj=funcobj, + fixtureinfo=fixtureinfo, + keywords={callspec.id: True}, + originalname=name, + ) + + +class Module(nodes.File, PyCollector): + """ Collector for test classes and functions. """ + + def _getobj(self): + return self._importtestmodule() + + def collect(self): + self._inject_setup_module_fixture() + self._inject_setup_function_fixture() + self.session._fixturemanager.parsefactories(self) + return super().collect() + + def _inject_setup_module_fixture(self): + """Injects a hidden autouse, module scoped fixture into the collected module object + that invokes setUpModule/tearDownModule if either or both are available. + + Using a fixture to invoke this methods ensures we play nicely and unsurprisingly with + other fixtures (#517). + """ + setup_module = _get_first_non_fixture_func( + self.obj, ("setUpModule", "setup_module") + ) + teardown_module = _get_first_non_fixture_func( + self.obj, ("tearDownModule", "teardown_module") + ) + + if setup_module is None and teardown_module is None: + return + + @fixtures.fixture(autouse=True, scope="module") + def xunit_setup_module_fixture(request): + if setup_module is not None: + _call_with_optional_argument(setup_module, request.module) + yield + if teardown_module is not None: + _call_with_optional_argument(teardown_module, request.module) + + self.obj.__pytest_setup_module = xunit_setup_module_fixture + + def _inject_setup_function_fixture(self): + """Injects a hidden autouse, function scoped fixture into the collected module object + that invokes setup_function/teardown_function if either or both are available. + + Using a fixture to invoke this methods ensures we play nicely and unsurprisingly with + other fixtures (#517). + """ + setup_function = _get_first_non_fixture_func(self.obj, ("setup_function",)) + teardown_function = _get_first_non_fixture_func( + self.obj, ("teardown_function",) + ) + if setup_function is None and teardown_function is None: + return + + @fixtures.fixture(autouse=True, scope="function") + def xunit_setup_function_fixture(request): + if request.instance is not None: + # in this case we are bound to an instance, so we need to let + # setup_method handle this + yield + return + if setup_function is not None: + _call_with_optional_argument(setup_function, request.function) + yield + if teardown_function is not None: + _call_with_optional_argument(teardown_function, request.function) + + self.obj.__pytest_setup_function = xunit_setup_function_fixture + + def _importtestmodule(self): + # we assume we are only called once per module + importmode = self.config.getoption("--import-mode") + try: + mod = self.fspath.pyimport(ensuresyspath=importmode) + except SyntaxError: + raise self.CollectError(ExceptionInfo.from_current().getrepr(style="short")) + except self.fspath.ImportMismatchError as e: + raise self.CollectError( + "import file mismatch:\n" + "imported module %r has this __file__ attribute:\n" + " %s\n" + "which is not the same as the test file we want to collect:\n" + " %s\n" + "HINT: remove __pycache__ / .pyc files and/or use a " + "unique basename for your test file modules" % e.args + ) + except ImportError: + exc_info = ExceptionInfo.from_current() + if self.config.getoption("verbose") < 2: + exc_info.traceback = exc_info.traceback.filter(filter_traceback) + exc_repr = ( + exc_info.getrepr(style="short") + if exc_info.traceback + else exc_info.exconly() + ) + formatted_tb = str(exc_repr) + raise self.CollectError( + "ImportError while importing test module '{fspath}'.\n" + "Hint: make sure your test modules/packages have valid Python names.\n" + "Traceback:\n" + "{traceback}".format(fspath=self.fspath, traceback=formatted_tb) + ) + except _pytest.runner.Skipped as e: + if e.allow_module_level: + raise + raise self.CollectError( + "Using pytest.skip outside of a test is not allowed. " + "To decorate a test function, use the @pytest.mark.skip " + "or @pytest.mark.skipif decorators instead, and to skip a " + "module use `pytestmark = pytest.mark.{skip,skipif}." + ) + self.config.pluginmanager.consider_module(mod) + return mod + + +class Package(Module): + def __init__( + self, + fspath: py.path.local, + parent: nodes.Collector, + # NOTE: following args are unused: + config=None, + session=None, + nodeid=None, + ) -> None: + # NOTE: could be just the following, but kept as-is for compat. + # nodes.FSCollector.__init__(self, fspath, parent=parent) + session = parent.session + nodes.FSCollector.__init__( + self, fspath, parent=parent, config=config, session=session, nodeid=nodeid + ) + + self.name = fspath.dirname + + def setup(self): + # not using fixtures to call setup_module here because autouse fixtures + # from packages are not called automatically (#4085) + setup_module = _get_first_non_fixture_func( + self.obj, ("setUpModule", "setup_module") + ) + if setup_module is not None: + _call_with_optional_argument(setup_module, self.obj) + + teardown_module = _get_first_non_fixture_func( + self.obj, ("tearDownModule", "teardown_module") + ) + if teardown_module is not None: + func = partial(_call_with_optional_argument, teardown_module, self.obj) + self.addfinalizer(func) + + def gethookproxy(self, fspath: py.path.local): + return super()._gethookproxy(fspath) + + def isinitpath(self, path): + return path in self.session._initialpaths + + def collect(self): + this_path = self.fspath.dirpath() + init_module = this_path.join("__init__.py") + if init_module.check(file=1) and path_matches_patterns( + init_module, self.config.getini("python_files") + ): + yield Module.from_parent(self, fspath=init_module) + pkg_prefixes = set() + for path in this_path.visit(rec=self._recurse, bf=True, sort=True): + # We will visit our own __init__.py file, in which case we skip it. + is_file = path.isfile() + if is_file: + if path.basename == "__init__.py" and path.dirpath() == this_path: + continue + + parts_ = parts(path.strpath) + if any( + pkg_prefix in parts_ and pkg_prefix.join("__init__.py") != path + for pkg_prefix in pkg_prefixes + ): + continue + + if is_file: + yield from self._collectfile(path) + elif not path.isdir(): + # Broken symlink or invalid/missing file. + continue + elif path.join("__init__.py").check(file=1): + pkg_prefixes.add(path) + + +def _call_with_optional_argument(func, arg): + """Call the given function with the given argument if func accepts one argument, otherwise + calls func without arguments""" + arg_count = func.__code__.co_argcount + if inspect.ismethod(func): + arg_count -= 1 + if arg_count: + func(arg) + else: + func() + + +def _get_first_non_fixture_func(obj, names): + """Return the attribute from the given object to be used as a setup/teardown + xunit-style function, but only if not marked as a fixture to + avoid calling it twice. + """ + for name in names: + meth = getattr(obj, name, None) + if meth is not None and fixtures.getfixturemarker(meth) is None: + return meth + + +class Class(PyCollector): + """ Collector for test methods. """ + + @classmethod + def from_parent(cls, parent, *, name, obj=None): + """ + The public constructor + """ + return super().from_parent(name=name, parent=parent) + + def collect(self): + if not safe_getattr(self.obj, "__test__", True): + return [] + if hasinit(self.obj): + self.warn( + PytestCollectionWarning( + "cannot collect test class %r because it has a " + "__init__ constructor (from: %s)" + % (self.obj.__name__, self.parent.nodeid) + ) + ) + return [] + elif hasnew(self.obj): + self.warn( + PytestCollectionWarning( + "cannot collect test class %r because it has a " + "__new__ constructor (from: %s)" + % (self.obj.__name__, self.parent.nodeid) + ) + ) + return [] + + self._inject_setup_class_fixture() + self._inject_setup_method_fixture() + + return [Instance.from_parent(self, name="()")] + + def _inject_setup_class_fixture(self): + """Injects a hidden autouse, class scoped fixture into the collected class object + that invokes setup_class/teardown_class if either or both are available. + + Using a fixture to invoke this methods ensures we play nicely and unsurprisingly with + other fixtures (#517). + """ + setup_class = _get_first_non_fixture_func(self.obj, ("setup_class",)) + teardown_class = getattr(self.obj, "teardown_class", None) + if setup_class is None and teardown_class is None: + return + + @fixtures.fixture(autouse=True, scope="class") + def xunit_setup_class_fixture(cls): + if setup_class is not None: + func = getimfunc(setup_class) + _call_with_optional_argument(func, self.obj) + yield + if teardown_class is not None: + func = getimfunc(teardown_class) + _call_with_optional_argument(func, self.obj) + + self.obj.__pytest_setup_class = xunit_setup_class_fixture + + def _inject_setup_method_fixture(self): + """Injects a hidden autouse, function scoped fixture into the collected class object + that invokes setup_method/teardown_method if either or both are available. + + Using a fixture to invoke this methods ensures we play nicely and unsurprisingly with + other fixtures (#517). + """ + setup_method = _get_first_non_fixture_func(self.obj, ("setup_method",)) + teardown_method = getattr(self.obj, "teardown_method", None) + if setup_method is None and teardown_method is None: + return + + @fixtures.fixture(autouse=True, scope="function") + def xunit_setup_method_fixture(self, request): + method = request.function + if setup_method is not None: + func = getattr(self, "setup_method") + _call_with_optional_argument(func, method) + yield + if teardown_method is not None: + func = getattr(self, "teardown_method") + _call_with_optional_argument(func, method) + + self.obj.__pytest_setup_method = xunit_setup_method_fixture + + +class Instance(PyCollector): + _ALLOW_MARKERS = False # hack, destroy later + # instances share the object with their parents in a way + # that duplicates markers instances if not taken out + # can be removed at node structure reorganization time + + def _getobj(self): + return self.parent.obj() + + def collect(self): + self.session._fixturemanager.parsefactories(self) + return super().collect() + + def newinstance(self): + self.obj = self._getobj() + return self.obj + + +def hasinit(obj): + init = getattr(obj, "__init__", None) + if init: + return init != object.__init__ + + +def hasnew(obj): + new = getattr(obj, "__new__", None) + if new: + return new != object.__new__ + + +class CallSpec2: + def __init__(self, metafunc): + self.metafunc = metafunc + self.funcargs = {} + self._idlist = [] + self.params = {} + self._arg2scopenum = {} # used for sorting parametrized resources + self.marks = [] + self.indices = {} + + def copy(self): + cs = CallSpec2(self.metafunc) + cs.funcargs.update(self.funcargs) + cs.params.update(self.params) + cs.marks.extend(self.marks) + cs.indices.update(self.indices) + cs._arg2scopenum.update(self._arg2scopenum) + cs._idlist = list(self._idlist) + return cs + + def _checkargnotcontained(self, arg): + if arg in self.params or arg in self.funcargs: + raise ValueError("duplicate {!r}".format(arg)) + + def getparam(self, name): + try: + return self.params[name] + except KeyError: + raise ValueError(name) + + @property + def id(self): + return "-".join(map(str, self._idlist)) + + def setmulti2(self, valtypes, argnames, valset, id, marks, scopenum, param_index): + for arg, val in zip(argnames, valset): + self._checkargnotcontained(arg) + valtype_for_arg = valtypes[arg] + getattr(self, valtype_for_arg)[arg] = val + self.indices[arg] = param_index + self._arg2scopenum[arg] = scopenum + self._idlist.append(id) + self.marks.extend(normalize_mark_list(marks)) + + +class Metafunc: + """ + Metafunc objects are passed to the :func:`pytest_generate_tests <_pytest.hookspec.pytest_generate_tests>` hook. + They help to inspect a test function and to generate tests according to + test configuration or values specified in the class or module where a + test function is defined. + """ + + def __init__( + self, + definition: "FunctionDefinition", + fixtureinfo: fixtures.FuncFixtureInfo, + config: Config, + cls=None, + module=None, + ) -> None: + self.definition = definition + + #: access to the :class:`_pytest.config.Config` object for the test session + self.config = config + + #: the module object where the test function is defined in. + self.module = module + + #: underlying python test function + self.function = definition.obj + + #: set of fixture names required by the test function + self.fixturenames = fixtureinfo.names_closure + + #: class object where the test function is defined in or ``None``. + self.cls = cls + + self._calls = [] # type: List[CallSpec2] + self._arg2fixturedefs = fixtureinfo.name2fixturedefs + + @property + def funcargnames(self): + """ alias attribute for ``fixturenames`` for pre-2.3 compatibility""" + warnings.warn(FUNCARGNAMES, stacklevel=2) + return self.fixturenames + + def parametrize( + self, + argnames: Union[str, List[str], Tuple[str, ...]], + argvalues: Iterable[Union[ParameterSet, typing.Sequence[object], object]], + indirect: Union[bool, typing.Sequence[str]] = False, + ids: Optional[ + Union[ + Iterable[Union[None, str, float, int, bool]], + Callable[[object], Optional[object]], + ] + ] = None, + scope: "Optional[str]" = None, + *, + _param_mark: Optional[Mark] = None + ) -> None: + """ Add new invocations to the underlying test function using the list + of argvalues for the given argnames. Parametrization is performed + during the collection phase. If you need to setup expensive resources + see about setting indirect to do it rather at test setup time. + + :arg argnames: a comma-separated string denoting one or more argument + names, or a list/tuple of argument strings. + + :arg argvalues: The list of argvalues determines how often a + test is invoked with different argument values. If only one + argname was specified argvalues is a list of values. If N + argnames were specified, argvalues must be a list of N-tuples, + where each tuple-element specifies a value for its respective + argname. + + :arg indirect: The list of argnames or boolean. A list of arguments' + names (subset of argnames). If True the list contains all names from + the argnames. Each argvalue corresponding to an argname in this list will + be passed as request.param to its respective argname fixture + function so that it can perform more expensive setups during the + setup phase of a test rather than at collection time. + + :arg ids: sequence of (or generator for) ids for ``argvalues``, + or a callable to return part of the id for each argvalue. + + With sequences (and generators like ``itertools.count()``) the + returned ids should be of type ``string``, ``int``, ``float``, + ``bool``, or ``None``. + They are mapped to the corresponding index in ``argvalues``. + ``None`` means to use the auto-generated id. + + If it is a callable it will be called for each entry in + ``argvalues``, and the return value is used as part of the + auto-generated id for the whole set (where parts are joined with + dashes ("-")). + This is useful to provide more specific ids for certain items, e.g. + dates. Returning ``None`` will use an auto-generated id. + + If no ids are provided they will be generated automatically from + the argvalues. + + :arg scope: if specified it denotes the scope of the parameters. + The scope is used for grouping tests by parameter instances. + It will also override any fixture-function defined scope, allowing + to set a dynamic scope using test context or configuration. + """ + from _pytest.fixtures import scope2index + + argnames, parameters = ParameterSet._for_parametrize( + argnames, + argvalues, + self.function, + self.config, + function_definition=self.definition, + ) + del argvalues + + if "request" in argnames: + fail( + "'request' is a reserved name and cannot be used in @pytest.mark.parametrize", + pytrace=False, + ) + + if scope is None: + scope = _find_parametrized_scope(argnames, self._arg2fixturedefs, indirect) + + self._validate_if_using_arg_names(argnames, indirect) + + arg_values_types = self._resolve_arg_value_types(argnames, indirect) + + # Use any already (possibly) generated ids with parametrize Marks. + if _param_mark and _param_mark._param_ids_from: + generated_ids = _param_mark._param_ids_from._param_ids_generated + if generated_ids is not None: + ids = generated_ids + + ids = self._resolve_arg_ids(argnames, ids, parameters, item=self.definition) + + # Store used (possibly generated) ids with parametrize Marks. + if _param_mark and _param_mark._param_ids_from and generated_ids is None: + object.__setattr__(_param_mark._param_ids_from, "_param_ids_generated", ids) + + scopenum = scope2index( + scope, descr="parametrize() call in {}".format(self.function.__name__) + ) + + # create the new calls: if we are parametrize() multiple times (by applying the decorator + # more than once) then we accumulate those calls generating the cartesian product + # of all calls + newcalls = [] + for callspec in self._calls or [CallSpec2(self)]: + for param_index, (param_id, param_set) in enumerate(zip(ids, parameters)): + newcallspec = callspec.copy() + newcallspec.setmulti2( + arg_values_types, + argnames, + param_set.values, + param_id, + param_set.marks, + scopenum, + param_index, + ) + newcalls.append(newcallspec) + self._calls = newcalls + + def _resolve_arg_ids( + self, + argnames: typing.Sequence[str], + ids: Optional[ + Union[ + Iterable[Union[None, str, float, int, bool]], + Callable[[object], Optional[object]], + ] + ], + parameters: typing.Sequence[ParameterSet], + item, + ) -> List[str]: + """Resolves the actual ids for the given argnames, based on the ``ids`` parameter given + to ``parametrize``. + + :param List[str] argnames: list of argument names passed to ``parametrize()``. + :param ids: the ids parameter of the parametrized call (see docs). + :param List[ParameterSet] parameters: the list of parameter values, same size as ``argnames``. + :param Item item: the item that generated this parametrized call. + :rtype: List[str] + :return: the list of ids for each argname given + """ + if ids is None: + idfn = None + ids_ = None + elif callable(ids): + idfn = ids + ids_ = None + else: + idfn = None + ids_ = self._validate_ids(ids, parameters, self.function.__name__) + return idmaker(argnames, parameters, idfn, ids_, self.config, item=item) + + def _validate_ids( + self, + ids: Iterable[Union[None, str, float, int, bool]], + parameters: typing.Sequence[ParameterSet], + func_name: str, + ) -> List[Union[None, str]]: + try: + num_ids = len(ids) # type: ignore[arg-type] # noqa: F821 + except TypeError: + try: + iter(ids) + except TypeError: + raise TypeError("ids must be a callable or an iterable") + num_ids = len(parameters) + + # num_ids == 0 is a special case: https://github.com/pytest-dev/pytest/issues/1849 + if num_ids != len(parameters) and num_ids != 0: + msg = "In {}: {} parameter sets specified, with different number of ids: {}" + fail(msg.format(func_name, len(parameters), num_ids), pytrace=False) + + new_ids = [] + for idx, id_value in enumerate(itertools.islice(ids, num_ids)): + if id_value is None or isinstance(id_value, str): + new_ids.append(id_value) + elif isinstance(id_value, (float, int, bool)): + new_ids.append(str(id_value)) + else: + msg = "In {}: ids must be list of string/float/int/bool, found: {} (type: {!r}) at index {}" + fail( + msg.format(func_name, saferepr(id_value), type(id_value), idx), + pytrace=False, + ) + return new_ids + + def _resolve_arg_value_types( + self, + argnames: typing.Sequence[str], + indirect: Union[bool, typing.Sequence[str]], + ) -> Dict[str, str]: + """Resolves if each parametrized argument must be considered a parameter to a fixture or a "funcarg" + to the function, based on the ``indirect`` parameter of the parametrized() call. + + :param List[str] argnames: list of argument names passed to ``parametrize()``. + :param indirect: same ``indirect`` parameter of ``parametrize()``. + :rtype: Dict[str, str] + A dict mapping each arg name to either: + * "params" if the argname should be the parameter of a fixture of the same name. + * "funcargs" if the argname should be a parameter to the parametrized test function. + """ + if isinstance(indirect, bool): + valtypes = dict.fromkeys(argnames, "params" if indirect else "funcargs") + elif isinstance(indirect, Sequence): + valtypes = dict.fromkeys(argnames, "funcargs") + for arg in indirect: + if arg not in argnames: + fail( + "In {}: indirect fixture '{}' doesn't exist".format( + self.function.__name__, arg + ), + pytrace=False, + ) + valtypes[arg] = "params" + else: + fail( + "In {func}: expected Sequence or boolean for indirect, got {type}".format( + type=type(indirect).__name__, func=self.function.__name__ + ), + pytrace=False, + ) + return valtypes + + def _validate_if_using_arg_names( + self, + argnames: typing.Sequence[str], + indirect: Union[bool, typing.Sequence[str]], + ) -> None: + """ + Check if all argnames are being used, by default values, or directly/indirectly. + + :param List[str] argnames: list of argument names passed to ``parametrize()``. + :param indirect: same ``indirect`` parameter of ``parametrize()``. + :raise ValueError: if validation fails. + """ + default_arg_names = set(get_default_arg_names(self.function)) + func_name = self.function.__name__ + for arg in argnames: + if arg not in self.fixturenames: + if arg in default_arg_names: + fail( + "In {}: function already takes an argument '{}' with a default value".format( + func_name, arg + ), + pytrace=False, + ) + else: + if isinstance(indirect, Sequence): + name = "fixture" if arg in indirect else "argument" + else: + name = "fixture" if indirect else "argument" + fail( + "In {}: function uses no {} '{}'".format(func_name, name, arg), + pytrace=False, + ) + + +def _find_parametrized_scope(argnames, arg2fixturedefs, indirect): + """Find the most appropriate scope for a parametrized call based on its arguments. + + When there's at least one direct argument, always use "function" scope. + + When a test function is parametrized and all its arguments are indirect + (e.g. fixtures), return the most narrow scope based on the fixtures used. + + Related to issue #1832, based on code posted by @Kingdread. + """ + from _pytest.fixtures import scopes + + if isinstance(indirect, (list, tuple)): + all_arguments_are_fixtures = len(indirect) == len(argnames) + else: + all_arguments_are_fixtures = bool(indirect) + + if all_arguments_are_fixtures: + fixturedefs = arg2fixturedefs or {} + used_scopes = [ + fixturedef[0].scope + for name, fixturedef in fixturedefs.items() + if name in argnames + ] + if used_scopes: + # Takes the most narrow scope from used fixtures + for scope in reversed(scopes): + if scope in used_scopes: + return scope + + return "function" + + +def _ascii_escaped_by_config(val: Union[str, bytes], config: Optional[Config]) -> str: + if config is None: + escape_option = False + else: + escape_option = config.getini( + "disable_test_id_escaping_and_forfeit_all_rights_to_community_support" + ) + # TODO: If escaping is turned off and the user passes bytes, + # will return a bytes. For now we ignore this but the + # code *probably* doesn't handle this case. + return val if escape_option else ascii_escaped(val) # type: ignore + + +def _idval( + val: object, + argname: str, + idx: int, + idfn: Optional[Callable[[object], Optional[object]]], + item, + config: Optional[Config], +) -> str: + if idfn: + try: + generated_id = idfn(val) + if generated_id is not None: + val = generated_id + except Exception as e: + msg = "{}: error raised while trying to determine id of parameter '{}' at position {}" + msg = msg.format(item.nodeid, argname, idx) + raise ValueError(msg) from e + elif config: + hook_id = config.hook.pytest_make_parametrize_id( + config=config, val=val, argname=argname + ) # type: Optional[str] + if hook_id: + return hook_id + + if isinstance(val, STRING_TYPES): + return _ascii_escaped_by_config(val, config) + elif val is None or isinstance(val, (float, int, bool)): + return str(val) + elif isinstance(val, REGEX_TYPE): + return ascii_escaped(val.pattern) + elif isinstance(val, enum.Enum): + return str(val) + elif isinstance(getattr(val, "__name__", None), str): + # name of a class, function, module, etc. + name = getattr(val, "__name__") # type: str + return name + return str(argname) + str(idx) + + +def limit_idval(limit): + import functools + + names = {} + limit -= 6 + assert limit > 0 + + def decorator(func): + @functools.wraps(func) + def wrapper(*args, **kw): + idval = func(*args, **kw) + if len(idval) > limit: + prefix = idval[:limit] + # There might be same prefix for the different test cases - take item into account + name = "{}-{}".format(kw.get('item', ''), prefix) + idx = names.setdefault(name, -1) + 1 + names[name] = idx + idval = "{}-{}".format(prefix, idx) + return idval + + return wrapper + + return decorator + + +# XXX limit testnames in the name of sanity and readability +@limit_idval(limit=500) +def _idvalset( + idx: int, + parameterset: ParameterSet, + argnames: Iterable[str], + idfn: Optional[Callable[[object], Optional[object]]], + ids: Optional[List[Union[None, str]]], + item, + config: Optional[Config], +): + if parameterset.id is not None: + return parameterset.id + id = None if ids is None or idx >= len(ids) else ids[idx] + if id is None: + this_id = [ + _idval(val, argname, idx, idfn, item=item, config=config) + for val, argname in zip(parameterset.values, argnames) + ] + return "-".join(this_id) + else: + return _ascii_escaped_by_config(id, config) + + +def idmaker( + argnames: Iterable[str], + parametersets: Iterable[ParameterSet], + idfn: Optional[Callable[[object], Optional[object]]] = None, + ids: Optional[List[Union[None, str]]] = None, + config: Optional[Config] = None, + item=None, +) -> List[str]: + resolved_ids = [ + _idvalset(valindex, parameterset, argnames, idfn, ids, config=config, item=item) + for valindex, parameterset in enumerate(parametersets) + ] + + # All IDs must be unique! + unique_ids = set(resolved_ids) + if len(unique_ids) != len(resolved_ids): + + # Record the number of occurrences of each test ID + test_id_counts = Counter(resolved_ids) + + # Map the test ID to its next suffix + test_id_suffixes = defaultdict(int) # type: Dict[str, int] + + # Suffix non-unique IDs to make them unique + for index, test_id in enumerate(resolved_ids): + if test_id_counts[test_id] > 1: + resolved_ids[index] = "{}{}".format(test_id, test_id_suffixes[test_id]) + test_id_suffixes[test_id] += 1 + + return resolved_ids + + +def show_fixtures_per_test(config): + from _pytest.main import wrap_session + + return wrap_session(config, _show_fixtures_per_test) + + +def _show_fixtures_per_test(config, session): + import _pytest.config + + session.perform_collect() + curdir = py.path.local() + tw = _pytest.config.create_terminal_writer(config) + verbose = config.getvalue("verbose") + + def get_best_relpath(func): + loc = getlocation(func, curdir) + return curdir.bestrelpath(loc) + + def write_fixture(fixture_def): + argname = fixture_def.argname + if verbose <= 0 and argname.startswith("_"): + return + if verbose > 0: + bestrel = get_best_relpath(fixture_def.func) + funcargspec = "{} -- {}".format(argname, bestrel) + else: + funcargspec = argname + tw.line(funcargspec, green=True) + fixture_doc = inspect.getdoc(fixture_def.func) + if fixture_doc: + write_docstring(tw, fixture_doc) + else: + tw.line(" no docstring available", red=True) + + def write_item(item): + try: + info = item._fixtureinfo + except AttributeError: + # doctests items have no _fixtureinfo attribute + return + if not info.name2fixturedefs: + # this test item does not use any fixtures + return + tw.line() + tw.sep("-", "fixtures used by {}".format(item.name)) + tw.sep("-", "({})".format(get_best_relpath(item.function))) + # dict key not used in loop but needed for sorting + for _, fixturedefs in sorted(info.name2fixturedefs.items()): + assert fixturedefs is not None + if not fixturedefs: + continue + # last item is expected to be the one used by the test item + write_fixture(fixturedefs[-1]) + + for session_item in session.items: + write_item(session_item) + + +def showfixtures(config): + from _pytest.main import wrap_session + + return wrap_session(config, _showfixtures_main) + + +def _showfixtures_main(config, session): + import _pytest.config + + session.perform_collect() + curdir = py.path.local() + tw = _pytest.config.create_terminal_writer(config) + verbose = config.getvalue("verbose") + + fm = session._fixturemanager + + available = [] + seen = set() + + for argname, fixturedefs in fm._arg2fixturedefs.items(): + assert fixturedefs is not None + if not fixturedefs: + continue + for fixturedef in fixturedefs: + loc = getlocation(fixturedef.func, curdir) + if (fixturedef.argname, loc) in seen: + continue + seen.add((fixturedef.argname, loc)) + available.append( + ( + len(fixturedef.baseid), + fixturedef.func.__module__, + curdir.bestrelpath(loc), + fixturedef.argname, + fixturedef, + ) + ) + + available.sort() + currentmodule = None + for baseid, module, bestrel, argname, fixturedef in available: + if currentmodule != module: + if not module.startswith("_pytest."): + tw.line() + tw.sep("-", "fixtures defined from {}".format(module)) + currentmodule = module + if verbose <= 0 and argname[0] == "_": + continue + tw.write(argname, green=True) + if fixturedef.scope != "function": + tw.write(" [%s scope]" % fixturedef.scope, cyan=True) + if verbose > 0: + tw.write(" -- %s" % bestrel, yellow=True) + tw.write("\n") + loc = getlocation(fixturedef.func, curdir) + doc = inspect.getdoc(fixturedef.func) + if doc: + write_docstring(tw, doc) + else: + tw.line(" {}: no docstring available".format(loc), red=True) + tw.line() + + +def write_docstring(tw: TerminalWriter, doc: str, indent: str = " ") -> None: + for line in doc.split("\n"): + tw.write(indent + line + "\n") + + +class Function(PyobjMixin, nodes.Item): + """ a Function Item is responsible for setting up and executing a + Python test function. + """ + + # disable since functions handle it themselves + _ALLOW_MARKERS = False + + def __init__( + self, + name, + parent, + args=None, + config=None, + callspec: Optional[CallSpec2] = None, + callobj=NOTSET, + keywords=None, + session=None, + fixtureinfo: Optional[FuncFixtureInfo] = None, + originalname=None, + ) -> None: + super().__init__(name, parent, config=config, session=session) + self._args = args + if callobj is not NOTSET: + self.obj = callobj + + self.keywords.update(self.obj.__dict__) + self.own_markers.extend(get_unpacked_marks(self.obj)) + if callspec: + self.callspec = callspec + # this is total hostile and a mess + # keywords are broken by design by now + # this will be redeemed later + for mark in callspec.marks: + # feel free to cry, this was broken for years before + # and keywords cant fix it per design + self.keywords[mark.name] = mark + self.own_markers.extend(normalize_mark_list(callspec.marks)) + if keywords: + self.keywords.update(keywords) + + # todo: this is a hell of a hack + # https://github.com/pytest-dev/pytest/issues/4569 + + self.keywords.update( + { + mark.name: True + for mark in self.iter_markers() + if mark.name not in self.keywords + } + ) + + if fixtureinfo is None: + fixtureinfo = self.session._fixturemanager.getfixtureinfo( + self, self.obj, self.cls, funcargs=True + ) + self._fixtureinfo = fixtureinfo # type: FuncFixtureInfo + self.fixturenames = fixtureinfo.names_closure + self._initrequest() + + #: original function name, without any decorations (for example + #: parametrization adds a ``"[...]"`` suffix to function names). + #: + #: .. versionadded:: 3.0 + self.originalname = originalname + + @classmethod + def from_parent(cls, parent, **kw): # todo: determine sound type limitations + """ + The public constructor + """ + return super().from_parent(parent=parent, **kw) + + def _initrequest(self): + self.funcargs = {} + self._request = fixtures.FixtureRequest(self) + + @property + def function(self): + "underlying python 'function' object" + return getimfunc(self.obj) + + def _getobj(self): + name = self.name + i = name.find("[") # parametrization + if i != -1: + name = name[:i] + return getattr(self.parent.obj, name) + + @property + def _pyfuncitem(self): + "(compatonly) for code expecting pytest-2.2 style request objects" + return self + + @property + def funcargnames(self): + """ alias attribute for ``fixturenames`` for pre-2.3 compatibility""" + warnings.warn(FUNCARGNAMES, stacklevel=2) + return self.fixturenames + + def runtest(self) -> None: + """ execute the underlying test function. """ + self.ihook.pytest_pyfunc_call(pyfuncitem=self) + + def setup(self) -> None: + if isinstance(self.parent, Instance): + self.parent.newinstance() + self.obj = self._getobj() + fixtures.fillfixtures(self) + + def _prunetraceback(self, excinfo: ExceptionInfo) -> None: + if hasattr(self, "_obj") and not self.config.getoption("fulltrace", False): + code = _pytest._code.Code(get_real_func(self.obj)) + path, firstlineno = code.path, code.firstlineno + traceback = excinfo.traceback + ntraceback = traceback.cut(path=path, firstlineno=firstlineno) + if ntraceback == traceback: + ntraceback = ntraceback.cut(path=path) + if ntraceback == traceback: + ntraceback = ntraceback.filter(filter_traceback) + if not ntraceback: + ntraceback = traceback + + excinfo.traceback = ntraceback.filter() + # issue364: mark all but first and last frames to + # only show a single-line message for each frame + if self.config.getoption("tbstyle", "auto") == "auto": + if len(excinfo.traceback) > 2: + for entry in excinfo.traceback[1:-1]: + entry.set_repr_style("short") + + def repr_failure(self, excinfo, outerr=None): + assert outerr is None, "XXX outerr usage is deprecated" + style = self.config.getoption("tbstyle", "auto") + if style == "auto": + style = "long" + return self._repr_failure_py(excinfo, style=style) + + +class FunctionDefinition(Function): + """ + internal hack until we get actual definition nodes instead of the + crappy metafunc hack + """ + + def runtest(self) -> None: + raise RuntimeError("function definitions are not supposed to be used") + + setup = runtest diff --git a/contrib/python/pytest/py3/_pytest/python_api.py b/contrib/python/pytest/py3/_pytest/python_api.py new file mode 100644 index 00000000000..df97181f4fc --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/python_api.py @@ -0,0 +1,751 @@ +import inspect +import math +import pprint +from collections.abc import Iterable +from collections.abc import Mapping +from collections.abc import Sized +from decimal import Decimal +from itertools import filterfalse +from numbers import Number +from types import TracebackType +from typing import Any +from typing import Callable +from typing import cast +from typing import Generic +from typing import Optional +from typing import Pattern +from typing import Tuple +from typing import TypeVar +from typing import Union + +from more_itertools.more import always_iterable + +import _pytest._code +from _pytest.compat import overload +from _pytest.compat import STRING_TYPES +from _pytest.compat import TYPE_CHECKING +from _pytest.outcomes import fail + +if TYPE_CHECKING: + from typing import Type # noqa: F401 (used in type string) + + +BASE_TYPE = (type, STRING_TYPES) + + +def _non_numeric_type_error(value, at): + at_str = " at {}".format(at) if at else "" + return TypeError( + "cannot make approximate comparisons to non-numeric values: {!r} {}".format( + value, at_str + ) + ) + + +# builtin pytest.approx helper + + +class ApproxBase: + """ + Provide shared utilities for making approximate comparisons between numbers + or sequences of numbers. + """ + + # Tell numpy to use our `__eq__` operator instead of its. + __array_ufunc__ = None + __array_priority__ = 100 + + def __init__(self, expected, rel=None, abs=None, nan_ok=False): + __tracebackhide__ = True + self.expected = expected + self.abs = abs + self.rel = rel + self.nan_ok = nan_ok + self._check_type() + + def __repr__(self): + raise NotImplementedError + + def __eq__(self, actual): + return all( + a == self._approx_scalar(x) for a, x in self._yield_comparisons(actual) + ) + + # Ignore type because of https://github.com/python/mypy/issues/4266. + __hash__ = None # type: ignore + + def __ne__(self, actual): + return not (actual == self) + + def _approx_scalar(self, x): + return ApproxScalar(x, rel=self.rel, abs=self.abs, nan_ok=self.nan_ok) + + def _yield_comparisons(self, actual): + """ + Yield all the pairs of numbers to be compared. This is used to + implement the `__eq__` method. + """ + raise NotImplementedError + + def _check_type(self): + """ + Raise a TypeError if the expected value is not a valid type. + """ + # This is only a concern if the expected value is a sequence. In every + # other case, the approx() function ensures that the expected value has + # a numeric type. For this reason, the default is to do nothing. The + # classes that deal with sequences should reimplement this method to + # raise if there are any non-numeric elements in the sequence. + pass + + +def _recursive_list_map(f, x): + if isinstance(x, list): + return list(_recursive_list_map(f, xi) for xi in x) + else: + return f(x) + + +class ApproxNumpy(ApproxBase): + """ + Perform approximate comparisons where the expected value is numpy array. + """ + + def __repr__(self): + list_scalars = _recursive_list_map(self._approx_scalar, self.expected.tolist()) + return "approx({!r})".format(list_scalars) + + def __eq__(self, actual): + import numpy as np + + # self.expected is supposed to always be an array here + + if not np.isscalar(actual): + try: + actual = np.asarray(actual) + except: # noqa + raise TypeError("cannot compare '{}' to numpy.ndarray".format(actual)) + + if not np.isscalar(actual) and actual.shape != self.expected.shape: + return False + + return ApproxBase.__eq__(self, actual) + + def _yield_comparisons(self, actual): + import numpy as np + + # `actual` can either be a numpy array or a scalar, it is treated in + # `__eq__` before being passed to `ApproxBase.__eq__`, which is the + # only method that calls this one. + + if np.isscalar(actual): + for i in np.ndindex(self.expected.shape): + yield actual, self.expected[i].item() + else: + for i in np.ndindex(self.expected.shape): + yield actual[i].item(), self.expected[i].item() + + +class ApproxMapping(ApproxBase): + """ + Perform approximate comparisons where the expected value is a mapping with + numeric values (the keys can be anything). + """ + + def __repr__(self): + return "approx({!r})".format( + {k: self._approx_scalar(v) for k, v in self.expected.items()} + ) + + def __eq__(self, actual): + if set(actual.keys()) != set(self.expected.keys()): + return False + + return ApproxBase.__eq__(self, actual) + + def _yield_comparisons(self, actual): + for k in self.expected.keys(): + yield actual[k], self.expected[k] + + def _check_type(self): + __tracebackhide__ = True + for key, value in self.expected.items(): + if isinstance(value, type(self.expected)): + msg = "pytest.approx() does not support nested dictionaries: key={!r} value={!r}\n full mapping={}" + raise TypeError(msg.format(key, value, pprint.pformat(self.expected))) + elif not isinstance(value, Number): + raise _non_numeric_type_error(self.expected, at="key={!r}".format(key)) + + +class ApproxSequencelike(ApproxBase): + """ + Perform approximate comparisons where the expected value is a sequence of + numbers. + """ + + def __repr__(self): + seq_type = type(self.expected) + if seq_type not in (tuple, list, set): + seq_type = list + return "approx({!r})".format( + seq_type(self._approx_scalar(x) for x in self.expected) + ) + + def __eq__(self, actual): + if len(actual) != len(self.expected): + return False + return ApproxBase.__eq__(self, actual) + + def _yield_comparisons(self, actual): + return zip(actual, self.expected) + + def _check_type(self): + __tracebackhide__ = True + for index, x in enumerate(self.expected): + if isinstance(x, type(self.expected)): + msg = "pytest.approx() does not support nested data structures: {!r} at index {}\n full sequence: {}" + raise TypeError(msg.format(x, index, pprint.pformat(self.expected))) + elif not isinstance(x, Number): + raise _non_numeric_type_error( + self.expected, at="index {}".format(index) + ) + + +class ApproxScalar(ApproxBase): + """ + Perform approximate comparisons where the expected value is a single number. + """ + + # Using Real should be better than this Union, but not possible yet: + # https://github.com/python/typeshed/pull/3108 + DEFAULT_ABSOLUTE_TOLERANCE = 1e-12 # type: Union[float, Decimal] + DEFAULT_RELATIVE_TOLERANCE = 1e-6 # type: Union[float, Decimal] + + def __repr__(self): + """ + Return a string communicating both the expected value and the tolerance + for the comparison being made, e.g. '1.0 ± 1e-6', '(3+4j) ± 5e-6 ∠ ±180°'. + """ + + # Infinities aren't compared using tolerances, so don't show a + # tolerance. Need to call abs to handle complex numbers, e.g. (inf + 1j) + if math.isinf(abs(self.expected)): + return str(self.expected) + + # If a sensible tolerance can't be calculated, self.tolerance will + # raise a ValueError. In this case, display '???'. + try: + vetted_tolerance = "{:.1e}".format(self.tolerance) + if isinstance(self.expected, complex) and not math.isinf(self.tolerance): + vetted_tolerance += " ∠ ±180°" + except ValueError: + vetted_tolerance = "???" + + return "{} ± {}".format(self.expected, vetted_tolerance) + + def __eq__(self, actual): + """ + Return true if the given value is equal to the expected value within + the pre-specified tolerance. + """ + if _is_numpy_array(actual): + # Call ``__eq__()`` manually to prevent infinite-recursion with + # numpy<1.13. See #3748. + return all(self.__eq__(a) for a in actual.flat) + + # Short-circuit exact equality. + if actual == self.expected: + return True + + # Allow the user to control whether NaNs are considered equal to each + # other or not. The abs() calls are for compatibility with complex + # numbers. + if math.isnan(abs(self.expected)): + return self.nan_ok and math.isnan(abs(actual)) + + # Infinity shouldn't be approximately equal to anything but itself, but + # if there's a relative tolerance, it will be infinite and infinity + # will seem approximately equal to everything. The equal-to-itself + # case would have been short circuited above, so here we can just + # return false if the expected value is infinite. The abs() call is + # for compatibility with complex numbers. + if math.isinf(abs(self.expected)): + return False + + # Return true if the two numbers are within the tolerance. + return abs(self.expected - actual) <= self.tolerance + + # Ignore type because of https://github.com/python/mypy/issues/4266. + __hash__ = None # type: ignore + + @property + def tolerance(self): + """ + Return the tolerance for the comparison. This could be either an + absolute tolerance or a relative tolerance, depending on what the user + specified or which would be larger. + """ + + def set_default(x, default): + return x if x is not None else default + + # Figure out what the absolute tolerance should be. ``self.abs`` is + # either None or a value specified by the user. + absolute_tolerance = set_default(self.abs, self.DEFAULT_ABSOLUTE_TOLERANCE) + + if absolute_tolerance < 0: + raise ValueError( + "absolute tolerance can't be negative: {}".format(absolute_tolerance) + ) + if math.isnan(absolute_tolerance): + raise ValueError("absolute tolerance can't be NaN.") + + # If the user specified an absolute tolerance but not a relative one, + # just return the absolute tolerance. + if self.rel is None: + if self.abs is not None: + return absolute_tolerance + + # Figure out what the relative tolerance should be. ``self.rel`` is + # either None or a value specified by the user. This is done after + # we've made sure the user didn't ask for an absolute tolerance only, + # because we don't want to raise errors about the relative tolerance if + # we aren't even going to use it. + relative_tolerance = set_default( + self.rel, self.DEFAULT_RELATIVE_TOLERANCE + ) * abs(self.expected) + + if relative_tolerance < 0: + raise ValueError( + "relative tolerance can't be negative: {}".format(absolute_tolerance) + ) + if math.isnan(relative_tolerance): + raise ValueError("relative tolerance can't be NaN.") + + # Return the larger of the relative and absolute tolerances. + return max(relative_tolerance, absolute_tolerance) + + +class ApproxDecimal(ApproxScalar): + """ + Perform approximate comparisons where the expected value is a decimal. + """ + + DEFAULT_ABSOLUTE_TOLERANCE = Decimal("1e-12") + DEFAULT_RELATIVE_TOLERANCE = Decimal("1e-6") + + +def approx(expected, rel=None, abs=None, nan_ok=False): + """ + Assert that two numbers (or two sets of numbers) are equal to each other + within some tolerance. + + Due to the `intricacies of floating-point arithmetic`__, numbers that we + would intuitively expect to be equal are not always so:: + + >>> 0.1 + 0.2 == 0.3 + False + + __ https://docs.python.org/3/tutorial/floatingpoint.html + + This problem is commonly encountered when writing tests, e.g. when making + sure that floating-point values are what you expect them to be. One way to + deal with this problem is to assert that two floating-point numbers are + equal to within some appropriate tolerance:: + + >>> abs((0.1 + 0.2) - 0.3) < 1e-6 + True + + However, comparisons like this are tedious to write and difficult to + understand. Furthermore, absolute comparisons like the one above are + usually discouraged because there's no tolerance that works well for all + situations. ``1e-6`` is good for numbers around ``1``, but too small for + very big numbers and too big for very small ones. It's better to express + the tolerance as a fraction of the expected value, but relative comparisons + like that are even more difficult to write correctly and concisely. + + The ``approx`` class performs floating-point comparisons using a syntax + that's as intuitive as possible:: + + >>> from pytest import approx + >>> 0.1 + 0.2 == approx(0.3) + True + + The same syntax also works for sequences of numbers:: + + >>> (0.1 + 0.2, 0.2 + 0.4) == approx((0.3, 0.6)) + True + + Dictionary *values*:: + + >>> {'a': 0.1 + 0.2, 'b': 0.2 + 0.4} == approx({'a': 0.3, 'b': 0.6}) + True + + ``numpy`` arrays:: + + >>> import numpy as np # doctest: +SKIP + >>> np.array([0.1, 0.2]) + np.array([0.2, 0.4]) == approx(np.array([0.3, 0.6])) # doctest: +SKIP + True + + And for a ``numpy`` array against a scalar:: + + >>> import numpy as np # doctest: +SKIP + >>> np.array([0.1, 0.2]) + np.array([0.2, 0.1]) == approx(0.3) # doctest: +SKIP + True + + By default, ``approx`` considers numbers within a relative tolerance of + ``1e-6`` (i.e. one part in a million) of its expected value to be equal. + This treatment would lead to surprising results if the expected value was + ``0.0``, because nothing but ``0.0`` itself is relatively close to ``0.0``. + To handle this case less surprisingly, ``approx`` also considers numbers + within an absolute tolerance of ``1e-12`` of its expected value to be + equal. Infinity and NaN are special cases. Infinity is only considered + equal to itself, regardless of the relative tolerance. NaN is not + considered equal to anything by default, but you can make it be equal to + itself by setting the ``nan_ok`` argument to True. (This is meant to + facilitate comparing arrays that use NaN to mean "no data".) + + Both the relative and absolute tolerances can be changed by passing + arguments to the ``approx`` constructor:: + + >>> 1.0001 == approx(1) + False + >>> 1.0001 == approx(1, rel=1e-3) + True + >>> 1.0001 == approx(1, abs=1e-3) + True + + If you specify ``abs`` but not ``rel``, the comparison will not consider + the relative tolerance at all. In other words, two numbers that are within + the default relative tolerance of ``1e-6`` will still be considered unequal + if they exceed the specified absolute tolerance. If you specify both + ``abs`` and ``rel``, the numbers will be considered equal if either + tolerance is met:: + + >>> 1 + 1e-8 == approx(1) + True + >>> 1 + 1e-8 == approx(1, abs=1e-12) + False + >>> 1 + 1e-8 == approx(1, rel=1e-6, abs=1e-12) + True + + If you're thinking about using ``approx``, then you might want to know how + it compares to other good ways of comparing floating-point numbers. All of + these algorithms are based on relative and absolute tolerances and should + agree for the most part, but they do have meaningful differences: + + - ``math.isclose(a, b, rel_tol=1e-9, abs_tol=0.0)``: True if the relative + tolerance is met w.r.t. either ``a`` or ``b`` or if the absolute + tolerance is met. Because the relative tolerance is calculated w.r.t. + both ``a`` and ``b``, this test is symmetric (i.e. neither ``a`` nor + ``b`` is a "reference value"). You have to specify an absolute tolerance + if you want to compare to ``0.0`` because there is no tolerance by + default. Only available in python>=3.5. `More information...`__ + + __ https://docs.python.org/3/library/math.html#math.isclose + + - ``numpy.isclose(a, b, rtol=1e-5, atol=1e-8)``: True if the difference + between ``a`` and ``b`` is less that the sum of the relative tolerance + w.r.t. ``b`` and the absolute tolerance. Because the relative tolerance + is only calculated w.r.t. ``b``, this test is asymmetric and you can + think of ``b`` as the reference value. Support for comparing sequences + is provided by ``numpy.allclose``. `More information...`__ + + __ http://docs.scipy.org/doc/numpy-1.10.0/reference/generated/numpy.isclose.html + + - ``unittest.TestCase.assertAlmostEqual(a, b)``: True if ``a`` and ``b`` + are within an absolute tolerance of ``1e-7``. No relative tolerance is + considered and the absolute tolerance cannot be changed, so this function + is not appropriate for very large or very small numbers. Also, it's only + available in subclasses of ``unittest.TestCase`` and it's ugly because it + doesn't follow PEP8. `More information...`__ + + __ https://docs.python.org/3/library/unittest.html#unittest.TestCase.assertAlmostEqual + + - ``a == pytest.approx(b, rel=1e-6, abs=1e-12)``: True if the relative + tolerance is met w.r.t. ``b`` or if the absolute tolerance is met. + Because the relative tolerance is only calculated w.r.t. ``b``, this test + is asymmetric and you can think of ``b`` as the reference value. In the + special case that you explicitly specify an absolute tolerance but not a + relative tolerance, only the absolute tolerance is considered. + + .. warning:: + + .. versionchanged:: 3.2 + + In order to avoid inconsistent behavior, ``TypeError`` is + raised for ``>``, ``>=``, ``<`` and ``<=`` comparisons. + The example below illustrates the problem:: + + assert approx(0.1) > 0.1 + 1e-10 # calls approx(0.1).__gt__(0.1 + 1e-10) + assert 0.1 + 1e-10 > approx(0.1) # calls approx(0.1).__lt__(0.1 + 1e-10) + + In the second example one expects ``approx(0.1).__le__(0.1 + 1e-10)`` + to be called. But instead, ``approx(0.1).__lt__(0.1 + 1e-10)`` is used to + comparison. This is because the call hierarchy of rich comparisons + follows a fixed behavior. `More information...`__ + + __ https://docs.python.org/3/reference/datamodel.html#object.__ge__ + """ + + # Delegate the comparison to a class that knows how to deal with the type + # of the expected value (e.g. int, float, list, dict, numpy.array, etc). + # + # The primary responsibility of these classes is to implement ``__eq__()`` + # and ``__repr__()``. The former is used to actually check if some + # "actual" value is equivalent to the given expected value within the + # allowed tolerance. The latter is used to show the user the expected + # value and tolerance, in the case that a test failed. + # + # The actual logic for making approximate comparisons can be found in + # ApproxScalar, which is used to compare individual numbers. All of the + # other Approx classes eventually delegate to this class. The ApproxBase + # class provides some convenient methods and overloads, but isn't really + # essential. + + __tracebackhide__ = True + + if isinstance(expected, Decimal): + cls = ApproxDecimal + elif isinstance(expected, Number): + cls = ApproxScalar + elif isinstance(expected, Mapping): + cls = ApproxMapping + elif _is_numpy_array(expected): + cls = ApproxNumpy + elif ( + isinstance(expected, Iterable) + and isinstance(expected, Sized) + and not isinstance(expected, STRING_TYPES) + ): + cls = ApproxSequencelike + else: + raise _non_numeric_type_error(expected, at=None) + + return cls(expected, rel, abs, nan_ok) + + +def _is_numpy_array(obj): + """ + Return true if the given object is a numpy array. Make a special effort to + avoid importing numpy unless it's really necessary. + """ + import sys + + np = sys.modules.get("numpy") + if np is not None: + return isinstance(obj, np.ndarray) + return False + + +# builtin pytest.raises helper + +_E = TypeVar("_E", bound=BaseException) + + +@overload +def raises( + expected_exception: Union["Type[_E]", Tuple["Type[_E]", ...]], + *, + match: "Optional[Union[str, Pattern]]" = ... +) -> "RaisesContext[_E]": + ... # pragma: no cover + + +@overload # noqa: F811 +def raises( # noqa: F811 + expected_exception: Union["Type[_E]", Tuple["Type[_E]", ...]], + func: Callable, + *args: Any, + **kwargs: Any +) -> _pytest._code.ExceptionInfo[_E]: + ... # pragma: no cover + + +def raises( # noqa: F811 + expected_exception: Union["Type[_E]", Tuple["Type[_E]", ...]], + *args: Any, + **kwargs: Any +) -> Union["RaisesContext[_E]", _pytest._code.ExceptionInfo[_E]]: + r""" + Assert that a code block/function call raises ``expected_exception`` + or raise a failure exception otherwise. + + :kwparam match: if specified, a string containing a regular expression, + or a regular expression object, that is tested against the string + representation of the exception using ``re.search``. To match a literal + string that may contain `special characters`__, the pattern can + first be escaped with ``re.escape``. + + (This is only used when ``pytest.raises`` is used as a context manager, + and passed through to the function otherwise. + When using ``pytest.raises`` as a function, you can use: + ``pytest.raises(Exc, func, match="passed on").match("my pattern")``.) + + __ https://docs.python.org/3/library/re.html#regular-expression-syntax + + .. currentmodule:: _pytest._code + + Use ``pytest.raises`` as a context manager, which will capture the exception of the given + type:: + + >>> with raises(ZeroDivisionError): + ... 1/0 + + If the code block does not raise the expected exception (``ZeroDivisionError`` in the example + above), or no exception at all, the check will fail instead. + + You can also use the keyword argument ``match`` to assert that the + exception matches a text or regex:: + + >>> with raises(ValueError, match='must be 0 or None'): + ... raise ValueError("value must be 0 or None") + + >>> with raises(ValueError, match=r'must be \d+$'): + ... raise ValueError("value must be 42") + + The context manager produces an :class:`ExceptionInfo` object which can be used to inspect the + details of the captured exception:: + + >>> with raises(ValueError) as exc_info: + ... raise ValueError("value must be 42") + >>> assert exc_info.type is ValueError + >>> assert exc_info.value.args[0] == "value must be 42" + + .. note:: + + When using ``pytest.raises`` as a context manager, it's worthwhile to + note that normal context manager rules apply and that the exception + raised *must* be the final line in the scope of the context manager. + Lines of code after that, within the scope of the context manager will + not be executed. For example:: + + >>> value = 15 + >>> with raises(ValueError) as exc_info: + ... if value > 10: + ... raise ValueError("value must be <= 10") + ... assert exc_info.type is ValueError # this will not execute + + Instead, the following approach must be taken (note the difference in + scope):: + + >>> with raises(ValueError) as exc_info: + ... if value > 10: + ... raise ValueError("value must be <= 10") + ... + >>> assert exc_info.type is ValueError + + **Using with** ``pytest.mark.parametrize`` + + When using :ref:`pytest.mark.parametrize ref` + it is possible to parametrize tests such that + some runs raise an exception and others do not. + + See :ref:`parametrizing_conditional_raising` for an example. + + **Legacy form** + + It is possible to specify a callable by passing a to-be-called lambda:: + + >>> raises(ZeroDivisionError, lambda: 1/0) + <ExceptionInfo ...> + + or you can specify an arbitrary callable with arguments:: + + >>> def f(x): return 1/x + ... + >>> raises(ZeroDivisionError, f, 0) + <ExceptionInfo ...> + >>> raises(ZeroDivisionError, f, x=0) + <ExceptionInfo ...> + + The form above is fully supported but discouraged for new code because the + context manager form is regarded as more readable and less error-prone. + + .. note:: + Similar to caught exception objects in Python, explicitly clearing + local references to returned ``ExceptionInfo`` objects can + help the Python interpreter speed up its garbage collection. + + Clearing those references breaks a reference cycle + (``ExceptionInfo`` --> caught exception --> frame stack raising + the exception --> current frame stack --> local variables --> + ``ExceptionInfo``) which makes Python keep all objects referenced + from that cycle (including all local variables in the current + frame) alive until the next cyclic garbage collection run. + More detailed information can be found in the official Python + documentation for :ref:`the try statement <python:try>`. + """ + __tracebackhide__ = True + for exc in filterfalse( + inspect.isclass, always_iterable(expected_exception, BASE_TYPE) # type: ignore[arg-type] # noqa: F821 + ): + msg = "exceptions must be derived from BaseException, not %s" + raise TypeError(msg % type(exc)) + + message = "DID NOT RAISE {}".format(expected_exception) + + if not args: + match = kwargs.pop("match", None) + if kwargs: + msg = "Unexpected keyword arguments passed to pytest.raises: " + msg += ", ".join(sorted(kwargs)) + msg += "\nUse context-manager form instead?" + raise TypeError(msg) + return RaisesContext(expected_exception, message, match) + else: + func = args[0] + if not callable(func): + raise TypeError( + "{!r} object (type: {}) must be callable".format(func, type(func)) + ) + try: + func(*args[1:], **kwargs) + except expected_exception as e: + # We just caught the exception - there is a traceback. + assert e.__traceback__ is not None + return _pytest._code.ExceptionInfo.from_exc_info( + (type(e), e, e.__traceback__) + ) + fail(message) + + +raises.Exception = fail.Exception # type: ignore + + +class RaisesContext(Generic[_E]): + def __init__( + self, + expected_exception: Union["Type[_E]", Tuple["Type[_E]", ...]], + message: str, + match_expr: Optional[Union[str, "Pattern"]] = None, + ) -> None: + self.expected_exception = expected_exception + self.message = message + self.match_expr = match_expr + self.excinfo = None # type: Optional[_pytest._code.ExceptionInfo[_E]] + + def __enter__(self) -> _pytest._code.ExceptionInfo[_E]: + self.excinfo = _pytest._code.ExceptionInfo.for_later() + return self.excinfo + + def __exit__( + self, + exc_type: Optional["Type[BaseException]"], + exc_val: Optional[BaseException], + exc_tb: Optional[TracebackType], + ) -> bool: + __tracebackhide__ = True + if exc_type is None: + fail(self.message) + assert self.excinfo is not None + if not issubclass(exc_type, self.expected_exception): + return False + # Cast to narrow the exception type now that it's verified. + exc_info = cast( + Tuple["Type[_E]", _E, TracebackType], (exc_type, exc_val, exc_tb) + ) + self.excinfo.fill_unfilled(exc_info) + if self.match_expr is not None: + self.excinfo.match(self.match_expr) + return True diff --git a/contrib/python/pytest/py3/_pytest/recwarn.py b/contrib/python/pytest/py3/_pytest/recwarn.py new file mode 100644 index 00000000000..c57c94b1cb1 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/recwarn.py @@ -0,0 +1,264 @@ +""" recording warnings during test function execution. """ +import re +import warnings +from types import TracebackType +from typing import Any +from typing import Callable +from typing import Iterator +from typing import List +from typing import Optional +from typing import Pattern +from typing import Tuple +from typing import Union + +from _pytest.compat import overload +from _pytest.compat import TYPE_CHECKING +from _pytest.fixtures import yield_fixture +from _pytest.outcomes import fail + +if TYPE_CHECKING: + from typing import Type + + +@yield_fixture +def recwarn(): + """Return a :class:`WarningsRecorder` instance that records all warnings emitted by test functions. + + See http://docs.python.org/library/warnings.html for information + on warning categories. + """ + wrec = WarningsRecorder() + with wrec: + warnings.simplefilter("default") + yield wrec + + +def deprecated_call(func=None, *args, **kwargs): + """context manager that can be used to ensure a block of code triggers a + ``DeprecationWarning`` or ``PendingDeprecationWarning``:: + + >>> import warnings + >>> def api_call_v2(): + ... warnings.warn('use v3 of this api', DeprecationWarning) + ... return 200 + + >>> with deprecated_call(): + ... assert api_call_v2() == 200 + + ``deprecated_call`` can also be used by passing a function and ``*args`` and ``*kwargs``, + in which case it will ensure calling ``func(*args, **kwargs)`` produces one of the warnings + types above. + """ + __tracebackhide__ = True + if func is not None: + args = (func,) + args + return warns((DeprecationWarning, PendingDeprecationWarning), *args, **kwargs) + + +@overload +def warns( + expected_warning: Optional[Union["Type[Warning]", Tuple["Type[Warning]", ...]]], + *, + match: "Optional[Union[str, Pattern]]" = ... +) -> "WarningsChecker": + raise NotImplementedError() + + +@overload # noqa: F811 +def warns( # noqa: F811 + expected_warning: Optional[Union["Type[Warning]", Tuple["Type[Warning]", ...]]], + func: Callable, + *args: Any, + match: Optional[Union[str, "Pattern"]] = ..., + **kwargs: Any +) -> Union[Any]: + raise NotImplementedError() + + +def warns( # noqa: F811 + expected_warning: Optional[Union["Type[Warning]", Tuple["Type[Warning]", ...]]], + *args: Any, + match: Optional[Union[str, "Pattern"]] = None, + **kwargs: Any +) -> Union["WarningsChecker", Any]: + r"""Assert that code raises a particular class of warning. + + Specifically, the parameter ``expected_warning`` can be a warning class or + sequence of warning classes, and the inside the ``with`` block must issue a warning of that class or + classes. + + This helper produces a list of :class:`warnings.WarningMessage` objects, + one for each warning raised. + + This function can be used as a context manager, or any of the other ways + ``pytest.raises`` can be used:: + + >>> with warns(RuntimeWarning): + ... warnings.warn("my warning", RuntimeWarning) + + In the context manager form you may use the keyword argument ``match`` to assert + that the exception matches a text or regex:: + + >>> with warns(UserWarning, match='must be 0 or None'): + ... warnings.warn("value must be 0 or None", UserWarning) + + >>> with warns(UserWarning, match=r'must be \d+$'): + ... warnings.warn("value must be 42", UserWarning) + + >>> with warns(UserWarning, match=r'must be \d+$'): + ... warnings.warn("this is not here", UserWarning) + Traceback (most recent call last): + ... + Failed: DID NOT WARN. No warnings of type ...UserWarning... was emitted... + + """ + __tracebackhide__ = True + if not args: + if kwargs: + msg = "Unexpected keyword arguments passed to pytest.warns: " + msg += ", ".join(sorted(kwargs)) + msg += "\nUse context-manager form instead?" + raise TypeError(msg) + return WarningsChecker(expected_warning, match_expr=match) + else: + func = args[0] + if not callable(func): + raise TypeError( + "{!r} object (type: {}) must be callable".format(func, type(func)) + ) + with WarningsChecker(expected_warning): + return func(*args[1:], **kwargs) + + +class WarningsRecorder(warnings.catch_warnings): + """A context manager to record raised warnings. + + Adapted from `warnings.catch_warnings`. + """ + + def __init__(self): + super().__init__(record=True) + self._entered = False + self._list = [] # type: List[warnings._Record] + + @property + def list(self) -> List["warnings._Record"]: + """The list of recorded warnings.""" + return self._list + + def __getitem__(self, i: int) -> "warnings._Record": + """Get a recorded warning by index.""" + return self._list[i] + + def __iter__(self) -> Iterator["warnings._Record"]: + """Iterate through the recorded warnings.""" + return iter(self._list) + + def __len__(self) -> int: + """The number of recorded warnings.""" + return len(self._list) + + def pop(self, cls: "Type[Warning]" = Warning) -> "warnings._Record": + """Pop the first recorded warning, raise exception if not exists.""" + for i, w in enumerate(self._list): + if issubclass(w.category, cls): + return self._list.pop(i) + __tracebackhide__ = True + raise AssertionError("%r not found in warning list" % cls) + + def clear(self) -> None: + """Clear the list of recorded warnings.""" + self._list[:] = [] + + # Type ignored because it doesn't exactly warnings.catch_warnings.__enter__ + # -- it returns a List but we only emulate one. + def __enter__(self) -> "WarningsRecorder": # type: ignore + if self._entered: + __tracebackhide__ = True + raise RuntimeError("Cannot enter %r twice" % self) + _list = super().__enter__() + # record=True means it's None. + assert _list is not None + self._list = _list + warnings.simplefilter("always") + return self + + def __exit__( + self, + exc_type: Optional["Type[BaseException]"], + exc_val: Optional[BaseException], + exc_tb: Optional[TracebackType], + ) -> None: + if not self._entered: + __tracebackhide__ = True + raise RuntimeError("Cannot exit %r without entering first" % self) + + super().__exit__(exc_type, exc_val, exc_tb) + + # Built-in catch_warnings does not reset entered state so we do it + # manually here for this context manager to become reusable. + self._entered = False + + +class WarningsChecker(WarningsRecorder): + def __init__( + self, + expected_warning: Optional[ + Union["Type[Warning]", Tuple["Type[Warning]", ...]] + ] = None, + match_expr: Optional[Union[str, "Pattern"]] = None, + ) -> None: + super().__init__() + + msg = "exceptions must be derived from Warning, not %s" + if expected_warning is None: + expected_warning_tup = None + elif isinstance(expected_warning, tuple): + for exc in expected_warning: + if not issubclass(exc, Warning): + raise TypeError(msg % type(exc)) + expected_warning_tup = expected_warning + elif issubclass(expected_warning, Warning): + expected_warning_tup = (expected_warning,) + else: + raise TypeError(msg % type(expected_warning)) + + self.expected_warning = expected_warning_tup + self.match_expr = match_expr + + def __exit__( + self, + exc_type: Optional["Type[BaseException]"], + exc_val: Optional[BaseException], + exc_tb: Optional[TracebackType], + ) -> None: + super().__exit__(exc_type, exc_val, exc_tb) + + __tracebackhide__ = True + + # only check if we're not currently handling an exception + if exc_type is None and exc_val is None and exc_tb is None: + if self.expected_warning is not None: + if not any(issubclass(r.category, self.expected_warning) for r in self): + __tracebackhide__ = True + fail( + "DID NOT WARN. No warnings of type {} was emitted. " + "The list of emitted warnings is: {}.".format( + self.expected_warning, [each.message for each in self] + ) + ) + elif self.match_expr is not None: + for r in self: + if issubclass(r.category, self.expected_warning): + if re.compile(self.match_expr).search(str(r.message)): + break + else: + fail( + "DID NOT WARN. No warnings of type {} matching" + " ('{}') was emitted. The list of emitted warnings" + " is: {}.".format( + self.expected_warning, + self.match_expr, + [each.message for each in self], + ) + ) diff --git a/contrib/python/pytest/py3/_pytest/reports.py b/contrib/python/pytest/py3/_pytest/reports.py new file mode 100644 index 00000000000..4fa465ea71c --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/reports.py @@ -0,0 +1,507 @@ +from io import StringIO +from pprint import pprint +from typing import Any +from typing import List +from typing import Optional +from typing import Tuple +from typing import Union + +import attr +import py + +from _pytest._code.code import ExceptionChainRepr +from _pytest._code.code import ExceptionInfo +from _pytest._code.code import ReprEntry +from _pytest._code.code import ReprEntryNative +from _pytest._code.code import ReprExceptionInfo +from _pytest._code.code import ReprFileLocation +from _pytest._code.code import ReprFuncArgs +from _pytest._code.code import ReprLocals +from _pytest._code.code import ReprTraceback +from _pytest._code.code import TerminalRepr +from _pytest._io import TerminalWriter +from _pytest.compat import TYPE_CHECKING +from _pytest.nodes import Node +from _pytest.outcomes import skip +from _pytest.pathlib import Path + + +def getslaveinfoline(node): + try: + return node._slaveinfocache + except AttributeError: + d = node.slaveinfo + ver = "%s.%s.%s" % d["version_info"][:3] + node._slaveinfocache = s = "[{}] {} -- Python {} {}".format( + d["id"], d["sysplatform"], ver, d["executable"] + ) + return s + + +class BaseReport: + when = None # type: Optional[str] + location = None # type: Optional[Tuple[str, Optional[int], str]] + longrepr = None + sections = [] # type: List[Tuple[str, str]] + nodeid = None # type: str + + def __init__(self, **kw: Any) -> None: + self.__dict__.update(kw) + + if TYPE_CHECKING: + # Can have arbitrary fields given to __init__(). + def __getattr__(self, key: str) -> Any: + raise NotImplementedError() + + def toterminal(self, out) -> None: + if hasattr(self, "node"): + out.line(getslaveinfoline(self.node)) # type: ignore + + longrepr = self.longrepr + if longrepr is None: + return + + if hasattr(longrepr, "toterminal"): + longrepr.toterminal(out) + else: + try: + out.line(longrepr) + except UnicodeEncodeError: + out.line("<unprintable longrepr>") + + def get_sections(self, prefix): + for name, content in self.sections: + if name.startswith(prefix): + yield prefix, content + + @property + def longreprtext(self): + """ + Read-only property that returns the full string representation + of ``longrepr``. + + .. versionadded:: 3.0 + """ + tw = TerminalWriter(stringio=True) + tw.hasmarkup = False + self.toterminal(tw) + exc = tw.stringio.getvalue() + return exc.strip() + + @property + def caplog(self): + """Return captured log lines, if log capturing is enabled + + .. versionadded:: 3.5 + """ + return "\n".join( + content for (prefix, content) in self.get_sections("Captured log") + ) + + @property + def capstdout(self): + """Return captured text from stdout, if capturing is enabled + + .. versionadded:: 3.0 + """ + return "".join( + content for (prefix, content) in self.get_sections("Captured stdout") + ) + + @property + def capstderr(self): + """Return captured text from stderr, if capturing is enabled + + .. versionadded:: 3.0 + """ + return "".join( + content for (prefix, content) in self.get_sections("Captured stderr") + ) + + passed = property(lambda x: x.outcome == "passed") + failed = property(lambda x: x.outcome == "failed") + skipped = property(lambda x: x.outcome == "skipped") + + @property + def fspath(self) -> str: + return self.nodeid.split("::")[0] + + @property + def count_towards_summary(self): + """ + **Experimental** + + Returns True if this report should be counted towards the totals shown at the end of the + test session: "1 passed, 1 failure, etc". + + .. note:: + + This function is considered **experimental**, so beware that it is subject to changes + even in patch releases. + """ + return True + + @property + def head_line(self): + """ + **Experimental** + + Returns the head line shown with longrepr output for this report, more commonly during + traceback representation during failures:: + + ________ Test.foo ________ + + + In the example above, the head_line is "Test.foo". + + .. note:: + + This function is considered **experimental**, so beware that it is subject to changes + even in patch releases. + """ + if self.location is not None: + fspath, lineno, domain = self.location + return domain + + def _get_verbose_word(self, config): + _category, _short, verbose = config.hook.pytest_report_teststatus( + report=self, config=config + ) + return verbose + + def _to_json(self): + """ + This was originally the serialize_report() function from xdist (ca03269). + + Returns the contents of this report as a dict of builtin entries, suitable for + serialization. + + Experimental method. + """ + return _report_to_json(self) + + @classmethod + def _from_json(cls, reportdict): + """ + This was originally the serialize_report() function from xdist (ca03269). + + Factory method that returns either a TestReport or CollectReport, depending on the calling + class. It's the callers responsibility to know which class to pass here. + + Experimental method. + """ + kwargs = _report_kwargs_from_json(reportdict) + return cls(**kwargs) + + +def _report_unserialization_failure(type_name, report_class, reportdict): + url = "https://github.com/pytest-dev/pytest/issues" + stream = StringIO() + pprint("-" * 100, stream=stream) + pprint("INTERNALERROR: Unknown entry type returned: %s" % type_name, stream=stream) + pprint("report_name: %s" % report_class, stream=stream) + pprint(reportdict, stream=stream) + pprint("Please report this bug at %s" % url, stream=stream) + pprint("-" * 100, stream=stream) + raise RuntimeError(stream.getvalue()) + + +class TestReport(BaseReport): + """ Basic test report object (also used for setup and teardown calls if + they fail). + """ + + __test__ = False + + def __init__( + self, + nodeid, + location: Tuple[str, Optional[int], str], + keywords, + outcome, + longrepr, + when, + sections=(), + duration=0, + user_properties=None, + **extra + ) -> None: + #: normalized collection node id + self.nodeid = nodeid + + #: a (filesystempath, lineno, domaininfo) tuple indicating the + #: actual location of a test item - it might be different from the + #: collected one e.g. if a method is inherited from a different module. + self.location = location # type: Tuple[str, Optional[int], str] + + #: a name -> value dictionary containing all keywords and + #: markers associated with a test invocation. + self.keywords = keywords + + #: test outcome, always one of "passed", "failed", "skipped". + self.outcome = outcome + + #: None or a failure representation. + self.longrepr = longrepr + + #: one of 'setup', 'call', 'teardown' to indicate runtest phase. + self.when = when + + #: user properties is a list of tuples (name, value) that holds user + #: defined properties of the test + self.user_properties = list(user_properties or []) + + #: list of pairs ``(str, str)`` of extra information which needs to + #: marshallable. Used by pytest to add captured text + #: from ``stdout`` and ``stderr``, but may be used by other plugins + #: to add arbitrary information to reports. + self.sections = list(sections) + + #: time it took to run just the test + self.duration = duration + + self.__dict__.update(extra) + + def __repr__(self): + return "<{} {!r} when={!r} outcome={!r}>".format( + self.__class__.__name__, self.nodeid, self.when, self.outcome + ) + + @classmethod + def from_item_and_call(cls, item, call) -> "TestReport": + """ + Factory method to create and fill a TestReport with standard item and call info. + """ + when = call.when + duration = call.stop - call.start + keywords = {x: 1 for x in item.keywords} + excinfo = call.excinfo + sections = [] + if not call.excinfo: + outcome = "passed" + longrepr = None + else: + if not isinstance(excinfo, ExceptionInfo): + outcome = "failed" + longrepr = excinfo + elif excinfo.errisinstance(skip.Exception): + outcome = "skipped" + r = excinfo._getreprcrash() + longrepr = (str(r.path), r.lineno, r.message) + else: + outcome = "failed" + if call.when == "call": + longrepr = item.repr_failure(excinfo) + else: # exception in setup or teardown + longrepr = item._repr_failure_py( + excinfo, style=item.config.getoption("tbstyle", "auto") + ) + for rwhen, key, content in item._report_sections: + sections.append(("Captured {} {}".format(key, rwhen), content)) + return cls( + item.nodeid, + item.location, + keywords, + outcome, + longrepr, + when, + sections, + duration, + user_properties=item.user_properties, + ) + + +class CollectReport(BaseReport): + when = "collect" + + def __init__( + self, nodeid: str, outcome, longrepr, result: List[Node], sections=(), **extra + ) -> None: + self.nodeid = nodeid + self.outcome = outcome + self.longrepr = longrepr + self.result = result or [] + self.sections = list(sections) + self.__dict__.update(extra) + + @property + def location(self): + return (self.fspath, None, self.fspath) + + def __repr__(self): + return "<CollectReport {!r} lenresult={} outcome={!r}>".format( + self.nodeid, len(self.result), self.outcome + ) + + +class CollectErrorRepr(TerminalRepr): + def __init__(self, msg): + self.longrepr = msg + + def toterminal(self, out) -> None: + out.line(self.longrepr, red=True) + + +def pytest_report_to_serializable(report): + if isinstance(report, (TestReport, CollectReport)): + data = report._to_json() + data["$report_type"] = report.__class__.__name__ + return data + + +def pytest_report_from_serializable(data): + if "$report_type" in data: + if data["$report_type"] == "TestReport": + return TestReport._from_json(data) + elif data["$report_type"] == "CollectReport": + return CollectReport._from_json(data) + assert False, "Unknown report_type unserialize data: {}".format( + data["$report_type"] + ) + + +def _report_to_json(report): + """ + This was originally the serialize_report() function from xdist (ca03269). + + Returns the contents of this report as a dict of builtin entries, suitable for + serialization. + """ + + def serialize_repr_entry(entry): + entry_data = {"type": type(entry).__name__, "data": attr.asdict(entry)} + for key, value in entry_data["data"].items(): + if hasattr(value, "__dict__"): + entry_data["data"][key] = attr.asdict(value) + return entry_data + + def serialize_repr_traceback(reprtraceback: ReprTraceback): + result = attr.asdict(reprtraceback) + result["reprentries"] = [ + serialize_repr_entry(x) for x in reprtraceback.reprentries + ] + return result + + def serialize_repr_crash(reprcrash: Optional[ReprFileLocation]): + if reprcrash is not None: + return attr.asdict(reprcrash) + else: + return None + + def serialize_longrepr(rep): + result = { + "reprcrash": serialize_repr_crash(rep.longrepr.reprcrash), + "reprtraceback": serialize_repr_traceback(rep.longrepr.reprtraceback), + "sections": rep.longrepr.sections, + } + if isinstance(rep.longrepr, ExceptionChainRepr): + result["chain"] = [] + for repr_traceback, repr_crash, description in rep.longrepr.chain: + result["chain"].append( + ( + serialize_repr_traceback(repr_traceback), + serialize_repr_crash(repr_crash), + description, + ) + ) + else: + result["chain"] = None + return result + + d = report.__dict__.copy() + if hasattr(report.longrepr, "toterminal"): + if hasattr(report.longrepr, "reprtraceback") and hasattr( + report.longrepr, "reprcrash" + ): + d["longrepr"] = serialize_longrepr(report) + else: + d["longrepr"] = str(report.longrepr) + else: + d["longrepr"] = report.longrepr + for name in d: + if isinstance(d[name], (py.path.local, Path)): + d[name] = str(d[name]) + elif name == "result": + d[name] = None # for now + return d + + +def _report_kwargs_from_json(reportdict): + """ + This was originally the serialize_report() function from xdist (ca03269). + + Returns **kwargs that can be used to construct a TestReport or CollectReport instance. + """ + + def deserialize_repr_entry(entry_data): + data = entry_data["data"] + entry_type = entry_data["type"] + if entry_type == "ReprEntry": + reprfuncargs = None + reprfileloc = None + reprlocals = None + if data["reprfuncargs"]: + reprfuncargs = ReprFuncArgs(**data["reprfuncargs"]) + if data["reprfileloc"]: + reprfileloc = ReprFileLocation(**data["reprfileloc"]) + if data["reprlocals"]: + reprlocals = ReprLocals(data["reprlocals"]["lines"]) + + reprentry = ReprEntry( + lines=data["lines"], + reprfuncargs=reprfuncargs, + reprlocals=reprlocals, + reprfileloc=reprfileloc, + style=data["style"], + ) # type: Union[ReprEntry, ReprEntryNative] + elif entry_type == "ReprEntryNative": + reprentry = ReprEntryNative(data["lines"]) + else: + _report_unserialization_failure(entry_type, TestReport, reportdict) + return reprentry + + def deserialize_repr_traceback(repr_traceback_dict): + repr_traceback_dict["reprentries"] = [ + deserialize_repr_entry(x) for x in repr_traceback_dict["reprentries"] + ] + return ReprTraceback(**repr_traceback_dict) + + def deserialize_repr_crash(repr_crash_dict: Optional[dict]): + if repr_crash_dict is not None: + return ReprFileLocation(**repr_crash_dict) + else: + return None + + if ( + reportdict["longrepr"] + and "reprcrash" in reportdict["longrepr"] + and "reprtraceback" in reportdict["longrepr"] + ): + + reprtraceback = deserialize_repr_traceback( + reportdict["longrepr"]["reprtraceback"] + ) + reprcrash = deserialize_repr_crash(reportdict["longrepr"]["reprcrash"]) + if reportdict["longrepr"]["chain"]: + chain = [] + for repr_traceback_data, repr_crash_data, description in reportdict[ + "longrepr" + ]["chain"]: + chain.append( + ( + deserialize_repr_traceback(repr_traceback_data), + deserialize_repr_crash(repr_crash_data), + description, + ) + ) + exception_info = ExceptionChainRepr( + chain + ) # type: Union[ExceptionChainRepr,ReprExceptionInfo] + else: + exception_info = ReprExceptionInfo(reprtraceback, reprcrash) + + for section in reportdict["longrepr"]["sections"]: + exception_info.addsection(*section) + reportdict["longrepr"] = exception_info + + return reportdict diff --git a/contrib/python/pytest/py3/_pytest/resultlog.py b/contrib/python/pytest/py3/_pytest/resultlog.py new file mode 100644 index 00000000000..3cfa9e0e96a --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/resultlog.py @@ -0,0 +1,102 @@ +""" log machine-parseable test session result information in a plain +text file. +""" +import os + +import py + +from _pytest.store import StoreKey + + +resultlog_key = StoreKey["ResultLog"]() + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting", "resultlog plugin options") + group.addoption( + "--resultlog", + "--result-log", + action="store", + metavar="path", + default=None, + help="DEPRECATED path for machine-readable result log.", + ) + + +def pytest_configure(config): + resultlog = config.option.resultlog + # prevent opening resultlog on slave nodes (xdist) + if resultlog and not hasattr(config, "slaveinput"): + dirname = os.path.dirname(os.path.abspath(resultlog)) + if not os.path.isdir(dirname): + os.makedirs(dirname) + logfile = open(resultlog, "w", 1) # line buffered + config._store[resultlog_key] = ResultLog(config, logfile) + config.pluginmanager.register(config._store[resultlog_key]) + + from _pytest.deprecated import RESULT_LOG + from _pytest.warnings import _issue_warning_captured + + _issue_warning_captured(RESULT_LOG, config.hook, stacklevel=2) + + +def pytest_unconfigure(config): + resultlog = config._store.get(resultlog_key, None) + if resultlog: + resultlog.logfile.close() + del config._store[resultlog_key] + config.pluginmanager.unregister(resultlog) + + +class ResultLog: + def __init__(self, config, logfile): + self.config = config + self.logfile = logfile # preferably line buffered + + def write_log_entry(self, testpath, lettercode, longrepr): + print("{} {}".format(lettercode, testpath), file=self.logfile) + for line in longrepr.splitlines(): + print(" %s" % line, file=self.logfile) + + def log_outcome(self, report, lettercode, longrepr): + testpath = getattr(report, "nodeid", None) + if testpath is None: + testpath = report.fspath + self.write_log_entry(testpath, lettercode, longrepr) + + def pytest_runtest_logreport(self, report): + if report.when != "call" and report.passed: + return + res = self.config.hook.pytest_report_teststatus( + report=report, config=self.config + ) + code = res[1] + if code == "x": + longrepr = str(report.longrepr) + elif code == "X": + longrepr = "" + elif report.passed: + longrepr = "" + elif report.skipped: + longrepr = str(report.longrepr[2]) + else: + longrepr = str(report.longrepr) + self.log_outcome(report, code, longrepr) + + def pytest_collectreport(self, report): + if not report.passed: + if report.failed: + code = "F" + longrepr = str(report.longrepr) + else: + assert report.skipped + code = "S" + longrepr = "%s:%d: %s" % report.longrepr + self.log_outcome(report, code, longrepr) + + def pytest_internalerror(self, excrepr): + reprcrash = getattr(excrepr, "reprcrash", None) + path = getattr(reprcrash, "path", None) + if path is None: + path = "cwd:%s" % py.path.local() + self.write_log_entry(path, "!", str(excrepr)) diff --git a/contrib/python/pytest/py3/_pytest/runner.py b/contrib/python/pytest/py3/_pytest/runner.py new file mode 100644 index 00000000000..412ea44a87d --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/runner.py @@ -0,0 +1,386 @@ +""" basic collect and runtest protocol implementations """ +import bdb +import os +import sys +from time import time +from typing import Callable +from typing import Dict +from typing import List +from typing import Optional +from typing import Tuple + +import attr + +from .reports import CollectErrorRepr +from .reports import CollectReport +from .reports import TestReport +from _pytest._code.code import ExceptionChainRepr +from _pytest._code.code import ExceptionInfo +from _pytest.compat import TYPE_CHECKING +from _pytest.nodes import Collector +from _pytest.nodes import Node +from _pytest.outcomes import Exit +from _pytest.outcomes import Skipped +from _pytest.outcomes import TEST_OUTCOME + +if TYPE_CHECKING: + from typing import Type + from typing_extensions import Literal + +# +# pytest plugin hooks + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting", "reporting", after="general") + group.addoption( + "--durations", + action="store", + type=int, + default=None, + metavar="N", + help="show N slowest setup/test durations (N=0 for all).", + ) + + +def pytest_terminal_summary(terminalreporter): + durations = terminalreporter.config.option.durations + verbose = terminalreporter.config.getvalue("verbose") + if durations is None: + return + tr = terminalreporter + dlist = [] + for replist in tr.stats.values(): + for rep in replist: + if hasattr(rep, "duration"): + dlist.append(rep) + if not dlist: + return + dlist.sort(key=lambda x: x.duration) + dlist.reverse() + if not durations: + tr.write_sep("=", "slowest test durations") + else: + tr.write_sep("=", "slowest %s test durations" % durations) + dlist = dlist[:durations] + + for rep in dlist: + if verbose < 2 and rep.duration < 0.005: + tr.write_line("") + tr.write_line("(0.00 durations hidden. Use -vv to show these durations.)") + break + tr.write_line("{:02.2f}s {:<8} {}".format(rep.duration, rep.when, rep.nodeid)) + + +def pytest_sessionstart(session): + session._setupstate = SetupState() + + +def pytest_sessionfinish(session): + session._setupstate.teardown_all() + + +def pytest_runtest_protocol(item, nextitem): + item.ihook.pytest_runtest_logstart(nodeid=item.nodeid, location=item.location) + runtestprotocol(item, nextitem=nextitem) + item.ihook.pytest_runtest_logfinish(nodeid=item.nodeid, location=item.location) + return True + + +def runtestprotocol(item, log=True, nextitem=None): + hasrequest = hasattr(item, "_request") + if hasrequest and not item._request: + item._initrequest() + rep = call_and_report(item, "setup", log) + reports = [rep] + if rep.passed: + if item.config.getoption("setupshow", False): + show_test_item(item) + if not item.config.getoption("setuponly", False): + reports.append(call_and_report(item, "call", log)) + reports.append(call_and_report(item, "teardown", log, nextitem=nextitem)) + # after all teardown hooks have been called + # want funcargs and request info to go away + if hasrequest: + item._request = False + item.funcargs = None + return reports + + +def show_test_item(item): + """Show test function, parameters and the fixtures of the test item.""" + tw = item.config.get_terminal_writer() + tw.line() + tw.write(" " * 8) + tw.write(item.nodeid) + used_fixtures = sorted(getattr(item, "fixturenames", [])) + if used_fixtures: + tw.write(" (fixtures used: {})".format(", ".join(used_fixtures))) + + +def pytest_runtest_setup(item): + _update_current_test_var(item, "setup") + item.session._setupstate.prepare(item) + + +def pytest_runtest_call(item): + _update_current_test_var(item, "call") + try: + del sys.last_type + del sys.last_value + del sys.last_traceback + except AttributeError: + pass + try: + item.runtest() + except Exception as e: + # Store trace info to allow postmortem debugging + sys.last_type = type(e) + sys.last_value = e + assert e.__traceback__ is not None + # Skip *this* frame + sys.last_traceback = e.__traceback__.tb_next + raise e + + +def pytest_runtest_teardown(item, nextitem): + _update_current_test_var(item, "teardown") + item.session._setupstate.teardown_exact(item, nextitem) + _update_current_test_var(item, None) + + +def _update_current_test_var(item, when): + """ + Update PYTEST_CURRENT_TEST to reflect the current item and stage. + + If ``when`` is None, delete PYTEST_CURRENT_TEST from the environment. + """ + var_name = "PYTEST_CURRENT_TEST" + if when: + value = "{} ({})".format(item.nodeid, when) + # don't allow null bytes on environment variables (see #2644, #2957) + value = value.replace("\x00", "(null)") + os.environ[var_name] = value + else: + os.environ.pop(var_name) + + +def pytest_report_teststatus(report): + if report.when in ("setup", "teardown"): + if report.failed: + # category, shortletter, verbose-word + return "error", "E", "ERROR" + elif report.skipped: + return "skipped", "s", "SKIPPED" + else: + return "", "", "" + + +# +# Implementation + + +def call_and_report( + item, when: "Literal['setup', 'call', 'teardown']", log=True, **kwds +): + call = call_runtest_hook(item, when, **kwds) + hook = item.ihook + report = hook.pytest_runtest_makereport(item=item, call=call) + if log: + hook.pytest_runtest_logreport(report=report) + if check_interactive_exception(call, report): + hook.pytest_exception_interact(node=item, call=call, report=report) + return report + + +def check_interactive_exception(call, report): + return call.excinfo and not ( + hasattr(report, "wasxfail") + or call.excinfo.errisinstance(Skipped) + or call.excinfo.errisinstance(bdb.BdbQuit) + ) + + +def call_runtest_hook(item, when: "Literal['setup', 'call', 'teardown']", **kwds): + if when == "setup": + ihook = item.ihook.pytest_runtest_setup + elif when == "call": + ihook = item.ihook.pytest_runtest_call + elif when == "teardown": + ihook = item.ihook.pytest_runtest_teardown + else: + assert False, "Unhandled runtest hook case: {}".format(when) + reraise = (Exit,) # type: Tuple[Type[BaseException], ...] + if not item.config.getoption("usepdb", False): + reraise += (KeyboardInterrupt,) + return CallInfo.from_call( + lambda: ihook(item=item, **kwds), when=when, reraise=reraise + ) + + +@attr.s(repr=False) +class CallInfo: + """ Result/Exception info a function invocation. """ + + _result = attr.ib() + excinfo = attr.ib(type=Optional[ExceptionInfo]) + start = attr.ib() + stop = attr.ib() + when = attr.ib() + + @property + def result(self): + if self.excinfo is not None: + raise AttributeError("{!r} has no valid result".format(self)) + return self._result + + @classmethod + def from_call(cls, func, when, reraise=None) -> "CallInfo": + #: context of invocation: one of "setup", "call", + #: "teardown", "memocollect" + start = time() + excinfo = None + try: + result = func() + except: # noqa + excinfo = ExceptionInfo.from_current() + if reraise is not None and excinfo.errisinstance(reraise): + raise + result = None + stop = time() + return cls(start=start, stop=stop, when=when, result=result, excinfo=excinfo) + + def __repr__(self): + if self.excinfo is None: + return "<CallInfo when={!r} result: {!r}>".format(self.when, self._result) + return "<CallInfo when={!r} excinfo={!r}>".format(self.when, self.excinfo) + + +def pytest_runtest_makereport(item, call): + return TestReport.from_item_and_call(item, call) + + +def pytest_make_collect_report(collector: Collector) -> CollectReport: + call = CallInfo.from_call(lambda: list(collector.collect()), "collect") + longrepr = None + if not call.excinfo: + outcome = "passed" + else: + skip_exceptions = [Skipped] + unittest = sys.modules.get("unittest") + if unittest is not None: + # Type ignored because unittest is loaded dynamically. + skip_exceptions.append(unittest.SkipTest) # type: ignore + if call.excinfo.errisinstance(tuple(skip_exceptions)): + outcome = "skipped" + r_ = collector._repr_failure_py(call.excinfo, "line") + assert isinstance(r_, ExceptionChainRepr), repr(r_) + r = r_.reprcrash + assert r + longrepr = (str(r.path), r.lineno, r.message) + else: + outcome = "failed" + errorinfo = collector.repr_failure(call.excinfo) + if not hasattr(errorinfo, "toterminal"): + errorinfo = CollectErrorRepr(errorinfo) + longrepr = errorinfo + rep = CollectReport( + collector.nodeid, outcome, longrepr, getattr(call, "result", None) + ) + rep.call = call # type: ignore # see collect_one_node + return rep + + +class SetupState: + """ shared state for setting up/tearing down test items or collectors. """ + + def __init__(self): + self.stack = [] # type: List[Node] + self._finalizers = {} # type: Dict[Node, List[Callable[[], None]]] + + def addfinalizer(self, finalizer, colitem): + """ attach a finalizer to the given colitem. """ + assert colitem and not isinstance(colitem, tuple) + assert callable(finalizer) + # assert colitem in self.stack # some unit tests don't setup stack :/ + self._finalizers.setdefault(colitem, []).append(finalizer) + + def _pop_and_teardown(self): + colitem = self.stack.pop() + self._teardown_with_finalization(colitem) + + def _callfinalizers(self, colitem): + finalizers = self._finalizers.pop(colitem, None) + exc = None + while finalizers: + fin = finalizers.pop() + try: + fin() + except TEST_OUTCOME as e: + # XXX Only first exception will be seen by user, + # ideally all should be reported. + if exc is None: + exc = e + if exc: + raise exc + + def _teardown_with_finalization(self, colitem): + self._callfinalizers(colitem) + colitem.teardown() + for colitem in self._finalizers: + assert colitem in self.stack + + def teardown_all(self): + while self.stack: + self._pop_and_teardown() + for key in list(self._finalizers): + self._teardown_with_finalization(key) + assert not self._finalizers + + def teardown_exact(self, item, nextitem): + needed_collectors = nextitem and nextitem.listchain() or [] + self._teardown_towards(needed_collectors) + + def _teardown_towards(self, needed_collectors): + exc = None + while self.stack: + if self.stack == needed_collectors[: len(self.stack)]: + break + try: + self._pop_and_teardown() + except TEST_OUTCOME as e: + # XXX Only first exception will be seen by user, + # ideally all should be reported. + if exc is None: + exc = e + if exc: + raise exc + + def prepare(self, colitem): + """ setup objects along the collector chain to the test-method + and teardown previously setup objects.""" + needed_collectors = colitem.listchain() + self._teardown_towards(needed_collectors) + + # check if the last collection node has raised an error + for col in self.stack: + if hasattr(col, "_prepare_exc"): + exc = col._prepare_exc + raise exc + for col in needed_collectors[len(self.stack) :]: + self.stack.append(col) + try: + col.setup() + except TEST_OUTCOME as e: + col._prepare_exc = e + raise e + + +def collect_one_node(collector): + ihook = collector.ihook + ihook.pytest_collectstart(collector=collector) + rep = ihook.pytest_make_collect_report(collector=collector) + call = rep.__dict__.pop("call", None) + if call and check_interactive_exception(call, rep): + ihook.pytest_exception_interact(node=collector, call=call, report=rep) + return rep diff --git a/contrib/python/pytest/py3/_pytest/setuponly.py b/contrib/python/pytest/py3/_pytest/setuponly.py new file mode 100644 index 00000000000..aa5a95ff920 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/setuponly.py @@ -0,0 +1,78 @@ +import pytest + + +def pytest_addoption(parser): + group = parser.getgroup("debugconfig") + group.addoption( + "--setuponly", + "--setup-only", + action="store_true", + help="only setup fixtures, do not execute tests.", + ) + group.addoption( + "--setupshow", + "--setup-show", + action="store_true", + help="show setup of fixtures while executing tests.", + ) + + +@pytest.hookimpl(hookwrapper=True) +def pytest_fixture_setup(fixturedef, request): + yield + if request.config.option.setupshow: + if hasattr(request, "param"): + # Save the fixture parameter so ._show_fixture_action() can + # display it now and during the teardown (in .finish()). + if fixturedef.ids: + if callable(fixturedef.ids): + fixturedef.cached_param = fixturedef.ids(request.param) + else: + fixturedef.cached_param = fixturedef.ids[request.param_index] + else: + fixturedef.cached_param = request.param + _show_fixture_action(fixturedef, "SETUP") + + +def pytest_fixture_post_finalizer(fixturedef) -> None: + if fixturedef.cached_result is not None: + config = fixturedef._fixturemanager.config + if config.option.setupshow: + _show_fixture_action(fixturedef, "TEARDOWN") + if hasattr(fixturedef, "cached_param"): + del fixturedef.cached_param + + +def _show_fixture_action(fixturedef, msg): + config = fixturedef._fixturemanager.config + capman = config.pluginmanager.getplugin("capturemanager") + if capman: + capman.suspend_global_capture() + + tw = config.get_terminal_writer() + tw.line() + tw.write(" " * 2 * fixturedef.scopenum) + tw.write( + "{step} {scope} {fixture}".format( + step=msg.ljust(8), # align the output to TEARDOWN + scope=fixturedef.scope[0].upper(), + fixture=fixturedef.argname, + ) + ) + + if msg == "SETUP": + deps = sorted(arg for arg in fixturedef.argnames if arg != "request") + if deps: + tw.write(" (fixtures used: {})".format(", ".join(deps))) + + if hasattr(fixturedef, "cached_param"): + tw.write("[{}]".format(fixturedef.cached_param)) + + if capman: + capman.resume_global_capture() + + +@pytest.hookimpl(tryfirst=True) +def pytest_cmdline_main(config): + if config.option.setuponly: + config.option.setupshow = True diff --git a/contrib/python/pytest/py3/_pytest/setupplan.py b/contrib/python/pytest/py3/_pytest/setupplan.py new file mode 100644 index 00000000000..6fdd3aed064 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/setupplan.py @@ -0,0 +1,28 @@ +import pytest + + +def pytest_addoption(parser): + group = parser.getgroup("debugconfig") + group.addoption( + "--setupplan", + "--setup-plan", + action="store_true", + help="show what fixtures and tests would be executed but " + "don't execute anything.", + ) + + +@pytest.hookimpl(tryfirst=True) +def pytest_fixture_setup(fixturedef, request): + # Will return a dummy fixture if the setuponly option is provided. + if request.config.option.setupplan: + my_cache_key = fixturedef.cache_key(request) + fixturedef.cached_result = (None, my_cache_key, None) + return fixturedef.cached_result + + +@pytest.hookimpl(tryfirst=True) +def pytest_cmdline_main(config): + if config.option.setupplan: + config.option.setuponly = True + config.option.setupshow = True diff --git a/contrib/python/pytest/py3/_pytest/skipping.py b/contrib/python/pytest/py3/_pytest/skipping.py new file mode 100644 index 00000000000..fe8742c6675 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/skipping.py @@ -0,0 +1,183 @@ +""" support for skip/xfail functions and markers. """ +from _pytest.config import hookimpl +from _pytest.mark.evaluate import MarkEvaluator +from _pytest.outcomes import fail +from _pytest.outcomes import skip +from _pytest.outcomes import xfail +from _pytest.store import StoreKey + + +skipped_by_mark_key = StoreKey[bool]() +evalxfail_key = StoreKey[MarkEvaluator]() +unexpectedsuccess_key = StoreKey[str]() + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group.addoption( + "--runxfail", + action="store_true", + dest="runxfail", + default=False, + help="report the results of xfail tests as if they were not marked", + ) + + parser.addini( + "xfail_strict", + "default for the strict parameter of xfail " + "markers when not given explicitly (default: False)", + default=False, + type="bool", + ) + + +def pytest_configure(config): + if config.option.runxfail: + # yay a hack + import pytest + + old = pytest.xfail + config._cleanup.append(lambda: setattr(pytest, "xfail", old)) + + def nop(*args, **kwargs): + pass + + nop.Exception = xfail.Exception + setattr(pytest, "xfail", nop) + + config.addinivalue_line( + "markers", + "skip(reason=None): skip the given test function with an optional reason. " + 'Example: skip(reason="no way of currently testing this") skips the ' + "test.", + ) + config.addinivalue_line( + "markers", + "skipif(condition): skip the given test function if eval(condition) " + "results in a True value. Evaluation happens within the " + "module global context. Example: skipif('sys.platform == \"win32\"') " + "skips the test if we are on the win32 platform. see " + "https://docs.pytest.org/en/latest/skipping.html", + ) + config.addinivalue_line( + "markers", + "xfail(condition, reason=None, run=True, raises=None, strict=False): " + "mark the test function as an expected failure if eval(condition) " + "has a True value. Optionally specify a reason for better reporting " + "and run=False if you don't even want to execute the test function. " + "If only specific exception(s) are expected, you can list them in " + "raises, and if the test fails in other ways, it will be reported as " + "a true failure. See https://docs.pytest.org/en/latest/skipping.html", + ) + + +@hookimpl(tryfirst=True) +def pytest_runtest_setup(item): + # Check if skip or skipif are specified as pytest marks + item._store[skipped_by_mark_key] = False + eval_skipif = MarkEvaluator(item, "skipif") + if eval_skipif.istrue(): + item._store[skipped_by_mark_key] = True + skip(eval_skipif.getexplanation()) + + for skip_info in item.iter_markers(name="skip"): + item._store[skipped_by_mark_key] = True + if "reason" in skip_info.kwargs: + skip(skip_info.kwargs["reason"]) + elif skip_info.args: + skip(skip_info.args[0]) + else: + skip("unconditional skip") + + item._store[evalxfail_key] = MarkEvaluator(item, "xfail") + check_xfail_no_run(item) + + +@hookimpl(hookwrapper=True) +def pytest_pyfunc_call(pyfuncitem): + check_xfail_no_run(pyfuncitem) + outcome = yield + passed = outcome.excinfo is None + if passed: + check_strict_xfail(pyfuncitem) + + +def check_xfail_no_run(item): + """check xfail(run=False)""" + if not item.config.option.runxfail: + evalxfail = item._store[evalxfail_key] + if evalxfail.istrue(): + if not evalxfail.get("run", True): + xfail("[NOTRUN] " + evalxfail.getexplanation()) + + +def check_strict_xfail(pyfuncitem): + """check xfail(strict=True) for the given PASSING test""" + evalxfail = pyfuncitem._store[evalxfail_key] + if evalxfail.istrue(): + strict_default = pyfuncitem.config.getini("xfail_strict") + is_strict_xfail = evalxfail.get("strict", strict_default) + if is_strict_xfail: + del pyfuncitem._store[evalxfail_key] + explanation = evalxfail.getexplanation() + fail("[XPASS(strict)] " + explanation, pytrace=False) + + +@hookimpl(hookwrapper=True) +def pytest_runtest_makereport(item, call): + outcome = yield + rep = outcome.get_result() + evalxfail = item._store.get(evalxfail_key, None) + # unittest special case, see setting of unexpectedsuccess_key + if unexpectedsuccess_key in item._store and rep.when == "call": + reason = item._store[unexpectedsuccess_key] + if reason: + rep.longrepr = "Unexpected success: {}".format(reason) + else: + rep.longrepr = "Unexpected success" + rep.outcome = "failed" + + elif item.config.option.runxfail: + pass # don't interfere + elif call.excinfo and call.excinfo.errisinstance(xfail.Exception): + rep.wasxfail = "reason: " + call.excinfo.value.msg + rep.outcome = "skipped" + elif evalxfail and not rep.skipped and evalxfail.wasvalid() and evalxfail.istrue(): + if call.excinfo: + if evalxfail.invalidraise(call.excinfo.value): + rep.outcome = "failed" + else: + rep.outcome = "skipped" + rep.wasxfail = evalxfail.getexplanation() + elif call.when == "call": + strict_default = item.config.getini("xfail_strict") + is_strict_xfail = evalxfail.get("strict", strict_default) + explanation = evalxfail.getexplanation() + if is_strict_xfail: + rep.outcome = "failed" + rep.longrepr = "[XPASS(strict)] {}".format(explanation) + else: + rep.outcome = "passed" + rep.wasxfail = explanation + elif ( + item._store.get(skipped_by_mark_key, True) + and rep.skipped + and type(rep.longrepr) is tuple + ): + # skipped by mark.skipif; change the location of the failure + # to point to the item definition, otherwise it will display + # the location of where the skip exception was raised within pytest + _, _, reason = rep.longrepr + filename, line = item.location[:2] + rep.longrepr = filename, line + 1, reason + + +# called by terminalreporter progress reporting + + +def pytest_report_teststatus(report): + if hasattr(report, "wasxfail"): + if report.skipped: + return "xfailed", "x", "XFAIL" + elif report.passed: + return "xpassed", "X", "XPASS" diff --git a/contrib/python/pytest/py3/_pytest/stepwise.py b/contrib/python/pytest/py3/_pytest/stepwise.py new file mode 100644 index 00000000000..6fa21cd1c65 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/stepwise.py @@ -0,0 +1,108 @@ +import pytest + + +def pytest_addoption(parser): + group = parser.getgroup("general") + group.addoption( + "--sw", + "--stepwise", + action="store_true", + dest="stepwise", + help="exit on test failure and continue from last failing test next time", + ) + group.addoption( + "--stepwise-skip", + action="store_true", + dest="stepwise_skip", + help="ignore the first failing test but stop on the next failing test", + ) + + +@pytest.hookimpl +def pytest_configure(config): + config.pluginmanager.register(StepwisePlugin(config), "stepwiseplugin") + + +class StepwisePlugin: + def __init__(self, config): + self.config = config + self.active = config.getvalue("stepwise") + self.session = None + self.report_status = "" + + if self.active: + self.lastfailed = config.cache.get("cache/stepwise", None) + self.skip = config.getvalue("stepwise_skip") + + def pytest_sessionstart(self, session): + self.session = session + + def pytest_collection_modifyitems(self, session, config, items): + if not self.active: + return + if not self.lastfailed: + self.report_status = "no previously failed tests, not skipping." + return + + already_passed = [] + found = False + + # Make a list of all tests that have been run before the last failing one. + for item in items: + if item.nodeid == self.lastfailed: + found = True + break + else: + already_passed.append(item) + + # If the previously failed test was not found among the test items, + # do not skip any tests. + if not found: + self.report_status = "previously failed test not found, not skipping." + already_passed = [] + else: + self.report_status = "skipping {} already passed items.".format( + len(already_passed) + ) + + for item in already_passed: + items.remove(item) + + config.hook.pytest_deselected(items=already_passed) + + def pytest_runtest_logreport(self, report): + if not self.active: + return + + if report.failed: + if self.skip: + # Remove test from the failed ones (if it exists) and unset the skip option + # to make sure the following tests will not be skipped. + if report.nodeid == self.lastfailed: + self.lastfailed = None + + self.skip = False + else: + # Mark test as the last failing and interrupt the test session. + self.lastfailed = report.nodeid + self.session.shouldstop = ( + "Test failed, continuing from this test next run." + ) + + else: + # If the test was actually run and did pass. + if report.when == "call": + # Remove test from the failed ones, if exists. + if report.nodeid == self.lastfailed: + self.lastfailed = None + + def pytest_report_collectionfinish(self): + if self.active and self.config.getoption("verbose") >= 0 and self.report_status: + return "stepwise: %s" % self.report_status + + def pytest_sessionfinish(self, session): + if self.active: + self.config.cache.set("cache/stepwise", self.lastfailed) + else: + # Clear the list of failing tests if the plugin is not active. + self.config.cache.set("cache/stepwise", []) diff --git a/contrib/python/pytest/py3/_pytest/store.py b/contrib/python/pytest/py3/_pytest/store.py new file mode 100644 index 00000000000..eed50d103aa --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/store.py @@ -0,0 +1,125 @@ +from typing import Any +from typing import cast +from typing import Dict +from typing import Generic +from typing import TypeVar +from typing import Union + + +__all__ = ["Store", "StoreKey"] + + +T = TypeVar("T") +D = TypeVar("D") + + +class StoreKey(Generic[T]): + """StoreKey is an object used as a key to a Store. + + A StoreKey is associated with the type T of the value of the key. + + A StoreKey is unique and cannot conflict with another key. + """ + + __slots__ = () + + +class Store: + """Store is a type-safe heterogenous mutable mapping that + allows keys and value types to be defined separately from + where it is defined. + + Usually you will be given an object which has a ``Store``: + + .. code-block:: python + + store: Store = some_object.store + + If a module wants to store data in this Store, it creates StoreKeys + for its keys (at the module level): + + .. code-block:: python + + some_str_key = StoreKey[str]() + some_bool_key = StoreKey[bool]() + + To store information: + + .. code-block:: python + + # Value type must match the key. + store[some_str_key] = "value" + store[some_bool_key] = True + + To retrieve the information: + + .. code-block:: python + + # The static type of some_str is str. + some_str = store[some_str_key] + # The static type of some_bool is bool. + some_bool = store[some_bool_key] + + Why use this? + ------------- + + Problem: module Internal defines an object. Module External, which + module Internal doesn't know about, receives the object and wants to + attach information to it, to be retrieved later given the object. + + Bad solution 1: Module External assigns private attributes directly on + the object. This doesn't work well because the type checker doesn't + know about these attributes and it complains about undefined attributes. + + Bad solution 2: module Internal adds a ``Dict[str, Any]`` attribute to + the object. Module External stores its data in private keys of this dict. + This doesn't work well because retrieved values are untyped. + + Good solution: module Internal adds a ``Store`` to the object. Module + External mints StoreKeys for its own keys. Module External stores and + retrieves its data using its keys. + """ + + __slots__ = ("_store",) + + def __init__(self) -> None: + self._store = {} # type: Dict[StoreKey[Any], object] + + def __setitem__(self, key: StoreKey[T], value: T) -> None: + """Set a value for key.""" + self._store[key] = value + + def __getitem__(self, key: StoreKey[T]) -> T: + """Get the value for key. + + Raises KeyError if the key wasn't set before. + """ + return cast(T, self._store[key]) + + def get(self, key: StoreKey[T], default: D) -> Union[T, D]: + """Get the value for key, or return default if the key wasn't set + before.""" + try: + return self[key] + except KeyError: + return default + + def setdefault(self, key: StoreKey[T], default: T) -> T: + """Return the value of key if already set, otherwise set the value + of key to default and return default.""" + try: + return self[key] + except KeyError: + self[key] = default + return default + + def __delitem__(self, key: StoreKey[T]) -> None: + """Delete the value for key. + + Raises KeyError if the key wasn't set before. + """ + del self._store[key] + + def __contains__(self, key: StoreKey[T]) -> bool: + """Returns whether key was set.""" + return key in self._store diff --git a/contrib/python/pytest/py3/_pytest/terminal.py b/contrib/python/pytest/py3/_pytest/terminal.py new file mode 100644 index 00000000000..812afd258b1 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/terminal.py @@ -0,0 +1,1221 @@ +""" terminal reporting of the full testing process. + +This is a good source for looking at the various reporting hooks. +""" +import argparse +import collections +import datetime +import platform +import sys +import time +import warnings +from functools import partial +from typing import Any +from typing import Callable +from typing import Dict +from typing import List +from typing import Mapping +from typing import Optional +from typing import Set +from typing import Tuple + +import attr +import pluggy +import py +from more_itertools import collapse + +import pytest +from _pytest import nodes +from _pytest._io import TerminalWriter +from _pytest.config import Config +from _pytest.config import ExitCode +from _pytest.deprecated import TERMINALWRITER_WRITER +from _pytest.main import Session +from _pytest.reports import CollectReport +from _pytest.reports import TestReport + +REPORT_COLLECTING_RESOLUTION = 0.5 + +KNOWN_TYPES = ( + "failed", + "passed", + "skipped", + "deselected", + "xfailed", + "xpassed", + "warnings", + "error", +) + +_REPORTCHARS_DEFAULT = "fE" + + +class MoreQuietAction(argparse.Action): + """ + a modified copy of the argparse count action which counts down and updates + the legacy quiet attribute at the same time + + used to unify verbosity handling + """ + + def __init__(self, option_strings, dest, default=None, required=False, help=None): + super().__init__( + option_strings=option_strings, + dest=dest, + nargs=0, + default=default, + required=required, + help=help, + ) + + def __call__(self, parser, namespace, values, option_string=None): + new_count = getattr(namespace, self.dest, 0) - 1 + setattr(namespace, self.dest, new_count) + # todo Deprecate config.quiet + namespace.quiet = getattr(namespace, "quiet", 0) + 1 + + +def pytest_addoption(parser): + group = parser.getgroup("terminal reporting", "reporting", after="general") + group._addoption( + "-v", + "--verbose", + action="count", + default=0, + dest="verbose", + help="increase verbosity.", + ) + group._addoption( + "-q", + "--quiet", + action=MoreQuietAction, + default=0, + dest="verbose", + help="decrease verbosity.", + ) + group._addoption( + "--verbosity", + dest="verbose", + type=int, + default=0, + help="set verbosity. Default is 0.", + ) + group._addoption( + "-r", + action="store", + dest="reportchars", + default=_REPORTCHARS_DEFAULT, + metavar="chars", + help="show extra test summary info as specified by chars: (f)ailed, " + "(E)rror, (s)kipped, (x)failed, (X)passed, " + "(p)assed, (P)assed with output, (a)ll except passed (p/P), or (A)ll. " + "(w)arnings are enabled by default (see --disable-warnings), " + "'N' can be used to reset the list. (default: 'fE').", + ) + group._addoption( + "--disable-warnings", + "--disable-pytest-warnings", + default=False, + dest="disable_warnings", + action="store_true", + help="disable warnings summary", + ) + group._addoption( + "-l", + "--showlocals", + action="store_true", + dest="showlocals", + default=False, + help="show locals in tracebacks (disabled by default).", + ) + group._addoption( + "--tb", + metavar="style", + action="store", + dest="tbstyle", + default="auto", + choices=["auto", "long", "short", "no", "line", "native"], + help="traceback print mode (auto/long/short/line/native/no).", + ) + group._addoption( + "--show-capture", + action="store", + dest="showcapture", + choices=["no", "stdout", "stderr", "log", "all"], + default="all", + help="Controls how captured stdout/stderr/log is shown on failed tests. " + "Default is 'all'.", + ) + group._addoption( + "--fulltrace", + "--full-trace", + action="store_true", + default=False, + help="don't cut any tracebacks (default is to cut).", + ) + group._addoption( + "--color", + metavar="color", + action="store", + dest="color", + default="auto", + choices=["yes", "no", "auto"], + help="color terminal output (yes/no/auto).", + ) + + parser.addini( + "console_output_style", + help='console output: "classic", or with additional progress information ("progress" (percentage) | "count").', + default="progress", + ) + + +def pytest_configure(config: Config) -> None: + reporter = TerminalReporter(config, sys.stdout) + config.pluginmanager.register(reporter, "terminalreporter") + if config.option.debug or config.option.traceconfig: + + def mywriter(tags, args): + msg = " ".join(map(str, args)) + reporter.write_line("[traceconfig] " + msg) + + config.trace.root.setprocessor("pytest:config", mywriter) + + +def getreportopt(config: Config) -> str: + reportchars = config.option.reportchars + + old_aliases = {"F", "S"} + reportopts = "" + for char in reportchars: + if char in old_aliases: + char = char.lower() + if char == "a": + reportopts = "sxXEf" + elif char == "A": + reportopts = "PpsxXEf" + elif char == "N": + reportopts = "" + elif char not in reportopts: + reportopts += char + + if not config.option.disable_warnings and "w" not in reportopts: + reportopts = "w" + reportopts + elif config.option.disable_warnings and "w" in reportopts: + reportopts = reportopts.replace("w", "") + + return reportopts + + +@pytest.hookimpl(trylast=True) # after _pytest.runner +def pytest_report_teststatus(report: TestReport) -> Tuple[str, str, str]: + letter = "F" + if report.passed: + letter = "." + elif report.skipped: + letter = "s" + + outcome = report.outcome + if report.when in ("collect", "setup", "teardown") and outcome == "failed": + outcome = "error" + letter = "E" + + return outcome, letter, outcome.upper() + + +@attr.s +class WarningReport: + """ + Simple structure to hold warnings information captured by ``pytest_warning_captured``. + + :ivar str message: user friendly message about the warning + :ivar str|None nodeid: node id that generated the warning (see ``get_location``). + :ivar tuple|py.path.local fslocation: + file system location of the source of the warning (see ``get_location``). + """ + + message = attr.ib(type=str) + nodeid = attr.ib(type=Optional[str], default=None) + fslocation = attr.ib(default=None) + count_towards_summary = True + + def get_location(self, config): + """ + Returns the more user-friendly information about the location + of a warning, or None. + """ + if self.nodeid: + return self.nodeid + if self.fslocation: + if isinstance(self.fslocation, tuple) and len(self.fslocation) >= 2: + filename, linenum = self.fslocation[:2] + relpath = py.path.local(filename).relto(config.invocation_dir) + if not relpath: + relpath = str(filename) + return "{}:{}".format(relpath, linenum) + else: + return str(self.fslocation) + return None + + +class TerminalReporter: + def __init__(self, config: Config, file=None) -> None: + import _pytest.config + + self.config = config + self._numcollected = 0 + self._session = None # type: Optional[Session] + self._showfspath = None + + self.stats = {} # type: Dict[str, List[Any]] + self._main_color = None # type: Optional[str] + self._known_types = None # type: Optional[List] + self.startdir = config.invocation_dir + if file is None: + file = sys.stdout + self._tw = _pytest.config.create_terminal_writer(config, file) + self._screen_width = self._tw.fullwidth + self.currentfspath = None # type: Any + self.reportchars = getreportopt(config) + self.hasmarkup = self._tw.hasmarkup + self.isatty = file.isatty() + self._progress_nodeids_reported = set() # type: Set[str] + self._show_progress_info = self._determine_show_progress_info() + self._collect_report_last_write = None # type: Optional[float] + + @property + def writer(self) -> TerminalWriter: + warnings.warn(TERMINALWRITER_WRITER, stacklevel=2) + return self._tw + + @writer.setter + def writer(self, value: TerminalWriter): + warnings.warn(TERMINALWRITER_WRITER, stacklevel=2) + self._tw = value + + def _determine_show_progress_info(self): + """Return True if we should display progress information based on the current config""" + # do not show progress if we are not capturing output (#3038) + if self.config.getoption("capture", "no") == "no": + return False + # do not show progress if we are showing fixture setup/teardown + if self.config.getoption("setupshow", False): + return False + cfg = self.config.getini("console_output_style") + if cfg in ("progress", "count"): + return cfg + return False + + @property + def verbosity(self): + return self.config.option.verbose + + @property + def showheader(self): + return self.verbosity >= 0 + + @property + def showfspath(self): + if self._showfspath is None: + return self.verbosity >= 0 + return self._showfspath + + @showfspath.setter + def showfspath(self, value): + self._showfspath = value + + @property + def showlongtestinfo(self): + return self.verbosity > 0 + + def hasopt(self, char): + char = {"xfailed": "x", "skipped": "s"}.get(char, char) + return char in self.reportchars + + def write_fspath_result(self, nodeid, res, **markup): + fspath = self.config.rootdir.join(nodeid.split("::")[0]) + # NOTE: explicitly check for None to work around py bug, and for less + # overhead in general (https://github.com/pytest-dev/py/pull/207). + if self.currentfspath is None or fspath != self.currentfspath: + if self.currentfspath is not None and self._show_progress_info: + self._write_progress_information_filling_space() + self.currentfspath = fspath + fspath = self.startdir.bestrelpath(fspath) + self._tw.line() + self._tw.write(fspath + " ") + self._tw.write(res, **markup) + + def write_ensure_prefix(self, prefix, extra="", **kwargs): + if self.currentfspath != prefix: + self._tw.line() + self.currentfspath = prefix + self._tw.write(prefix) + if extra: + self._tw.write(extra, **kwargs) + self.currentfspath = -2 + + def ensure_newline(self): + if self.currentfspath: + self._tw.line() + self.currentfspath = None + + def write(self, content, **markup): + self._tw.write(content, **markup) + + def write_line(self, line, **markup): + if not isinstance(line, str): + line = str(line, errors="replace") + self.ensure_newline() + self._tw.line(line, **markup) + + def rewrite(self, line, **markup): + """ + Rewinds the terminal cursor to the beginning and writes the given line. + + :kwarg erase: if True, will also add spaces until the full terminal width to ensure + previous lines are properly erased. + + The rest of the keyword arguments are markup instructions. + """ + erase = markup.pop("erase", False) + if erase: + fill_count = self._tw.fullwidth - len(line) - 1 + fill = " " * fill_count + else: + fill = "" + line = str(line) + self._tw.write("\r" + line + fill, **markup) + + def write_sep(self, sep, title=None, **markup): + self.ensure_newline() + self._tw.sep(sep, title, **markup) + + def section(self, title, sep="=", **kw): + self._tw.sep(sep, title, **kw) + + def line(self, msg, **kw): + self._tw.line(msg, **kw) + + def _add_stats(self, category: str, items: List) -> None: + set_main_color = category not in self.stats + self.stats.setdefault(category, []).extend(items[:]) + if set_main_color: + self._set_main_color() + + def pytest_internalerror(self, excrepr): + for line in str(excrepr).split("\n"): + self.write_line("INTERNALERROR> " + line) + return 1 + + def pytest_warning_captured(self, warning_message, item): + # from _pytest.nodes import get_fslocation_from_item + from _pytest.warnings import warning_record_to_str + + fslocation = warning_message.filename, warning_message.lineno + message = warning_record_to_str(warning_message) + + nodeid = item.nodeid if item is not None else "" + warning_report = WarningReport( + fslocation=fslocation, message=message, nodeid=nodeid + ) + self._add_stats("warnings", [warning_report]) + + def pytest_plugin_registered(self, plugin): + if self.config.option.traceconfig: + msg = "PLUGIN registered: {}".format(plugin) + # XXX this event may happen during setup/teardown time + # which unfortunately captures our output here + # which garbles our output if we use self.write_line + self.write_line(msg) + + def pytest_deselected(self, items): + self._add_stats("deselected", items) + + def pytest_runtest_logstart(self, nodeid, location): + # ensure that the path is printed before the + # 1st test of a module starts running + if self.showlongtestinfo: + line = self._locationline(nodeid, *location) + self.write_ensure_prefix(line, "") + elif self.showfspath: + fsid = nodeid.split("::")[0] + self.write_fspath_result(fsid, "") + + def pytest_runtest_logreport(self, report: TestReport) -> None: + self._tests_ran = True + rep = report + res = self.config.hook.pytest_report_teststatus(report=rep, config=self.config) + category, letter, word = res + if isinstance(word, tuple): + word, markup = word + else: + markup = None + self._add_stats(category, [rep]) + if not letter and not word: + # probably passed setup/teardown + return + running_xdist = hasattr(rep, "node") + if markup is None: + was_xfail = hasattr(report, "wasxfail") + if rep.passed and not was_xfail: + markup = {"green": True} + elif rep.passed and was_xfail: + markup = {"yellow": True} + elif rep.failed: + markup = {"red": True} + elif rep.skipped: + markup = {"yellow": True} + else: + markup = {} + if self.verbosity <= 0: + if not running_xdist and self.showfspath: + self.write_fspath_result(rep.nodeid, letter, **markup) + else: + self._tw.write(letter, **markup) + else: + self._progress_nodeids_reported.add(rep.nodeid) + line = self._locationline(rep.nodeid, *rep.location) + if not running_xdist: + self.write_ensure_prefix(line, word, **markup) + if self._show_progress_info: + self._write_progress_information_filling_space() + else: + self.ensure_newline() + self._tw.write("[%s]" % rep.node.gateway.id) # type: ignore + if self._show_progress_info: + self._tw.write( + self._get_progress_information_message() + " ", cyan=True + ) + else: + self._tw.write(" ") + self._tw.write(word, **markup) + self._tw.write(" " + line) + self.currentfspath = -2 + + @property + def _is_last_item(self): + return len(self._progress_nodeids_reported) == self._session.testscollected + + def pytest_runtest_logfinish(self, nodeid): + assert self._session + if self.verbosity <= 0 and self._show_progress_info: + if self._show_progress_info == "count": + num_tests = self._session.testscollected + progress_length = len(" [{}/{}]".format(str(num_tests), str(num_tests))) + else: + progress_length = len(" [100%]") + + self._progress_nodeids_reported.add(nodeid) + + if self._is_last_item: + self._write_progress_information_filling_space() + else: + main_color, _ = self._get_main_color() + w = self._width_of_current_line + past_edge = w + progress_length + 1 >= self._screen_width + if past_edge: + msg = self._get_progress_information_message() + self._tw.write(msg + "\n", **{main_color: True}) + + def _get_progress_information_message(self) -> str: + assert self._session + collected = self._session.testscollected + if self._show_progress_info == "count": + if collected: + progress = self._progress_nodeids_reported + counter_format = "{{:{}d}}".format(len(str(collected))) + format_string = " [{}/{{}}]".format(counter_format) + return format_string.format(len(progress), collected) + return " [ {} / {} ]".format(collected, collected) + else: + if collected: + return " [{:3d}%]".format( + len(self._progress_nodeids_reported) * 100 // collected + ) + return " [100%]" + + def _write_progress_information_filling_space(self): + color, _ = self._get_main_color() + msg = self._get_progress_information_message() + w = self._width_of_current_line + fill = self._tw.fullwidth - w - 1 + self.write(msg.rjust(fill), **{color: True}) + + @property + def _width_of_current_line(self): + """Return the width of current line, using the superior implementation of py-1.6 when available""" + try: + return self._tw.width_of_current_line + except AttributeError: + # py < 1.6.0 + return self._tw.chars_on_current_line + + def pytest_collection(self) -> None: + if self.isatty: + if self.config.option.verbose >= 0: + self.write("collecting ... ", bold=True) + self._collect_report_last_write = time.time() + elif self.config.option.verbose >= 1: + self.write("collecting ... ", bold=True) + + def pytest_collectreport(self, report: CollectReport) -> None: + if report.failed: + self._add_stats("error", [report]) + elif report.skipped: + self._add_stats("skipped", [report]) + items = [x for x in report.result if isinstance(x, pytest.Item)] + self._numcollected += len(items) + if self.isatty: + self.report_collect() + + def report_collect(self, final=False): + if self.config.option.verbose < 0: + return + + if not final: + # Only write "collecting" report every 0.5s. + t = time.time() + if ( + self._collect_report_last_write is not None + and self._collect_report_last_write > t - REPORT_COLLECTING_RESOLUTION + ): + return + self._collect_report_last_write = t + + errors = len(self.stats.get("error", [])) + skipped = len(self.stats.get("skipped", [])) + deselected = len(self.stats.get("deselected", [])) + selected = self._numcollected - errors - skipped - deselected + if final: + line = "collected " + else: + line = "collecting " + line += ( + str(self._numcollected) + " item" + ("" if self._numcollected == 1 else "s") + ) + if errors: + line += " / %d error%s" % (errors, "s" if errors != 1 else "") + if deselected: + line += " / %d deselected" % deselected + if skipped: + line += " / %d skipped" % skipped + if self._numcollected > selected > 0: + line += " / %d selected" % selected + if self.isatty: + self.rewrite(line, bold=True, erase=True) + if final: + self.write("\n") + else: + self.write_line(line) + + @pytest.hookimpl(trylast=True) + def pytest_sessionstart(self, session: Session) -> None: + self._session = session + self._sessionstarttime = time.time() + if not self.showheader: + return + self.write_sep("=", "test session starts", bold=True) + verinfo = platform.python_version() + msg = "platform {} -- Python {}".format(sys.platform, verinfo) + pypy_version_info = getattr(sys, "pypy_version_info", None) + if pypy_version_info: + verinfo = ".".join(map(str, pypy_version_info[:3])) + msg += "[pypy-{}-{}]".format(verinfo, pypy_version_info[3]) + msg += ", pytest-{}, py-{}, pluggy-{}".format( + pytest.__version__, py.__version__, pluggy.__version__ + ) + if ( + self.verbosity > 0 + or self.config.option.debug + or getattr(self.config.option, "pastebin", None) + ): + msg += " -- " + str(sys.executable) + self.write_line(msg) + lines = self.config.hook.pytest_report_header( + config=self.config, startdir=self.startdir + ) + self._write_report_lines_from_hooks(lines) + + def _write_report_lines_from_hooks(self, lines): + lines.reverse() + for line in collapse(lines): + self.write_line(line) + + def pytest_report_header(self, config): + line = "rootdir: %s" % config.rootdir + + if config.inifile: + line += ", inifile: " + config.rootdir.bestrelpath(config.inifile) + + testpaths = config.getini("testpaths") + if testpaths and config.args == testpaths: + rel_paths = [config.rootdir.bestrelpath(x) for x in testpaths] + line += ", testpaths: {}".format(", ".join(rel_paths)) + result = [line] + + plugininfo = config.pluginmanager.list_plugin_distinfo() + if plugininfo: + result.append("plugins: %s" % ", ".join(_plugin_nameversions(plugininfo))) + return result + + def pytest_collection_finish(self, session): + self.report_collect(True) + + if self.config.getoption("collectonly"): + self._printcollecteditems(session.items) + + lines = self.config.hook.pytest_report_collectionfinish( + config=self.config, startdir=self.startdir, items=session.items + ) + self._write_report_lines_from_hooks(lines) + + if self.config.getoption("collectonly"): + failed = self.stats.get("failed") + if failed: + self._tw.sep("!", "collection failures") + for rep in failed: + rep.toterminal(self._tw) + + def _printcollecteditems(self, items): + # to print out items and their parent collectors + # we take care to leave out Instances aka () + # because later versions are going to get rid of them anyway + if self.config.option.verbose < 0: + if self.config.option.verbose < -1: + counts = {} # type: Dict[str, int] + for item in items: + name = item.nodeid.split("::", 1)[0] + counts[name] = counts.get(name, 0) + 1 + for name, count in sorted(counts.items()): + self._tw.line("%s: %d" % (name, count)) + else: + for item in items: + self._tw.line(item.nodeid) + return + stack = [] + indent = "" + for item in items: + needed_collectors = item.listchain()[1:] # strip root node + while stack: + if stack == needed_collectors[: len(stack)]: + break + stack.pop() + for col in needed_collectors[len(stack) :]: + stack.append(col) + if col.name == "()": # Skip Instances. + continue + indent = (len(stack) - 1) * " " + self._tw.line("{}{}".format(indent, col)) + if self.config.option.verbose >= 1: + if hasattr(col, "_obj") and col._obj.__doc__: + for line in col._obj.__doc__.strip().splitlines(): + self._tw.line("{}{}".format(indent + " ", line.strip())) + + @pytest.hookimpl(hookwrapper=True) + def pytest_sessionfinish(self, session: Session, exitstatus: ExitCode): + outcome = yield + outcome.get_result() + self._tw.line("") + summary_exit_codes = ( + ExitCode.OK, + ExitCode.TESTS_FAILED, + ExitCode.INTERRUPTED, + ExitCode.USAGE_ERROR, + ExitCode.NO_TESTS_COLLECTED, + ) + if exitstatus in summary_exit_codes: + self.config.hook.pytest_terminal_summary( + terminalreporter=self, exitstatus=exitstatus, config=self.config + ) + if session.shouldfail: + self.write_sep("!", session.shouldfail, red=True) + if exitstatus == ExitCode.INTERRUPTED: + self._report_keyboardinterrupt() + del self._keyboardinterrupt_memo + elif session.shouldstop: + self.write_sep("!", session.shouldstop, red=True) + self.summary_stats() + + @pytest.hookimpl(hookwrapper=True) + def pytest_terminal_summary(self): + self.summary_errors() + self.summary_failures() + self.summary_warnings() + self.summary_passes() + yield + self.short_test_summary() + # Display any extra warnings from teardown here (if any). + self.summary_warnings() + + def pytest_keyboard_interrupt(self, excinfo): + self._keyboardinterrupt_memo = excinfo.getrepr(funcargs=True) + + def pytest_unconfigure(self): + if hasattr(self, "_keyboardinterrupt_memo"): + self._report_keyboardinterrupt() + + def _report_keyboardinterrupt(self): + excrepr = self._keyboardinterrupt_memo + msg = excrepr.reprcrash.message + self.write_sep("!", msg) + if "KeyboardInterrupt" in msg: + if self.config.option.fulltrace: + excrepr.toterminal(self._tw) + else: + excrepr.reprcrash.toterminal(self._tw) + self._tw.line( + "(to show a full traceback on KeyboardInterrupt use --full-trace)", + yellow=True, + ) + + def _locationline(self, nodeid, fspath, lineno, domain): + def mkrel(nodeid): + line = self.config.cwd_relative_nodeid(nodeid) + if domain and line.endswith(domain): + line = line[: -len(domain)] + values = domain.split("[") + values[0] = values[0].replace(".", "::") # don't replace '.' in params + line += "[".join(values) + return line + + # collect_fspath comes from testid which has a "/"-normalized path + + if fspath: + res = mkrel(nodeid) + if self.verbosity >= 2 and nodeid.split("::")[0] != fspath.replace( + "\\", nodes.SEP + ): + res += " <- " + self.startdir.bestrelpath(fspath) + else: + res = "[location]" + return res + " " + + def _getfailureheadline(self, rep): + head_line = rep.head_line + if head_line: + return head_line + return "test session" # XXX? + + def _getcrashline(self, rep): + try: + return str(rep.longrepr.reprcrash) + except AttributeError: + try: + return str(rep.longrepr)[:50] + except AttributeError: + return "" + + # + # summaries for sessionfinish + # + def getreports(self, name): + values = [] + for x in self.stats.get(name, []): + if not hasattr(x, "_pdbshown"): + values.append(x) + return values + + def summary_warnings(self): + if self.hasopt("w"): + all_warnings = self.stats.get( + "warnings" + ) # type: Optional[List[WarningReport]] + if not all_warnings: + return + + final = hasattr(self, "_already_displayed_warnings") + if final: + warning_reports = all_warnings[self._already_displayed_warnings :] + else: + warning_reports = all_warnings + self._already_displayed_warnings = len(warning_reports) + if not warning_reports: + return + + reports_grouped_by_message = ( + collections.OrderedDict() + ) # type: collections.OrderedDict[str, List[WarningReport]] + for wr in warning_reports: + reports_grouped_by_message.setdefault(wr.message, []).append(wr) + + def collapsed_location_report(reports: List[WarningReport]): + locations = [] + for w in warning_reports: + location = w.get_location(self.config) + if location: + locations.append(location) + + if len(locations) < 10: + return "\n".join(map(str, locations)) + + counts_by_filename = collections.Counter( + str(loc).split("::", 1)[0] for loc in locations + ) + return "\n".join( + "{0}: {1} test{2} with warning{2}".format( + k, v, "s" if v > 1 else "" + ) + for k, v in counts_by_filename.items() + ) + + title = "warnings summary (final)" if final else "warnings summary" + self.write_sep("=", title, yellow=True, bold=False) + for message, warning_reports in reports_grouped_by_message.items(): + maybe_location = collapsed_location_report(warning_reports) + if maybe_location: + self._tw.line(maybe_location) + lines = message.splitlines() + indented = "\n".join(" " + x for x in lines) + message = indented.rstrip() + else: + message = message.rstrip() + self._tw.line(message) + self._tw.line() + self._tw.line("-- Docs: https://docs.pytest.org/en/latest/warnings.html") + + def summary_passes(self): + if self.config.option.tbstyle != "no": + if self.hasopt("P"): + reports = self.getreports("passed") + if not reports: + return + self.write_sep("=", "PASSES") + for rep in reports: + if rep.sections: + msg = self._getfailureheadline(rep) + self.write_sep("_", msg, green=True, bold=True) + self._outrep_summary(rep) + self._handle_teardown_sections(rep.nodeid) + + def _get_teardown_reports(self, nodeid: str) -> List[TestReport]: + return [ + report + for report in self.getreports("") + if report.when == "teardown" and report.nodeid == nodeid + ] + + def _handle_teardown_sections(self, nodeid: str) -> None: + for report in self._get_teardown_reports(nodeid): + self.print_teardown_sections(report) + + def print_teardown_sections(self, rep: TestReport) -> None: + showcapture = self.config.option.showcapture + if showcapture == "no": + return + for secname, content in rep.sections: + if showcapture != "all" and showcapture not in secname: + continue + if "teardown" in secname: + self._tw.sep("-", secname) + if content[-1:] == "\n": + content = content[:-1] + self._tw.line(content) + + def summary_failures(self): + if self.config.option.tbstyle != "no": + reports = self.getreports("failed") + if not reports: + return + self.write_sep("=", "FAILURES") + if self.config.option.tbstyle == "line": + for rep in reports: + line = self._getcrashline(rep) + self.write_line(line) + else: + for rep in reports: + msg = self._getfailureheadline(rep) + self.write_sep("_", msg, red=True, bold=True) + self._outrep_summary(rep) + self._handle_teardown_sections(rep.nodeid) + + def summary_errors(self): + if self.config.option.tbstyle != "no": + reports = self.getreports("error") + if not reports: + return + self.write_sep("=", "ERRORS") + for rep in self.stats["error"]: + msg = self._getfailureheadline(rep) + if rep.when == "collect": + msg = "ERROR collecting " + msg + else: + msg = "ERROR at {} of {}".format(rep.when, msg) + self.write_sep("_", msg, red=True, bold=True) + self._outrep_summary(rep) + + def _outrep_summary(self, rep): + rep.toterminal(self._tw) + showcapture = self.config.option.showcapture + if showcapture == "no": + return + for secname, content in rep.sections: + if showcapture != "all" and showcapture not in secname: + continue + self._tw.sep("-", secname) + if content[-1:] == "\n": + content = content[:-1] + self._tw.line(content) + + def summary_stats(self): + if self.verbosity < -1: + return + + session_duration = time.time() - self._sessionstarttime + (parts, main_color) = self.build_summary_stats_line() + line_parts = [] + + display_sep = self.verbosity >= 0 + if display_sep: + fullwidth = self._tw.fullwidth + for text, markup in parts: + with_markup = self._tw.markup(text, **markup) + if display_sep: + fullwidth += len(with_markup) - len(text) + line_parts.append(with_markup) + msg = ", ".join(line_parts) + + main_markup = {main_color: True} + duration = " in {}".format(format_session_duration(session_duration)) + duration_with_markup = self._tw.markup(duration, **main_markup) + if display_sep: + fullwidth += len(duration_with_markup) - len(duration) + msg += duration_with_markup + + if display_sep: + markup_for_end_sep = self._tw.markup("", **main_markup) + if markup_for_end_sep.endswith("\x1b[0m"): + markup_for_end_sep = markup_for_end_sep[:-4] + fullwidth += len(markup_for_end_sep) + msg += markup_for_end_sep + + if display_sep: + self.write_sep("=", msg, fullwidth=fullwidth, **main_markup) + else: + self.write_line(msg, **main_markup) + + def short_test_summary(self) -> None: + if not self.reportchars: + return + + def show_simple(stat, lines: List[str]) -> None: + failed = self.stats.get(stat, []) + if not failed: + return + termwidth = self._tw.fullwidth + config = self.config + for rep in failed: + line = _get_line_with_reprcrash_message(config, rep, termwidth) + lines.append(line) + + def show_xfailed(lines: List[str]) -> None: + xfailed = self.stats.get("xfailed", []) + for rep in xfailed: + verbose_word = rep._get_verbose_word(self.config) + pos = _get_pos(self.config, rep) + lines.append("{} {}".format(verbose_word, pos)) + reason = rep.wasxfail + if reason: + lines.append(" " + str(reason)) + + def show_xpassed(lines: List[str]) -> None: + xpassed = self.stats.get("xpassed", []) + for rep in xpassed: + verbose_word = rep._get_verbose_word(self.config) + pos = _get_pos(self.config, rep) + reason = rep.wasxfail + lines.append("{} {} {}".format(verbose_word, pos, reason)) + + def show_skipped(lines: List[str]) -> None: + skipped = self.stats.get("skipped", []) + fskips = _folded_skips(skipped) if skipped else [] + if not fskips: + return + verbose_word = skipped[0]._get_verbose_word(self.config) + for num, fspath, lineno, reason in fskips: + if reason.startswith("Skipped: "): + reason = reason[9:] + if lineno is not None: + lines.append( + "%s [%d] %s:%d: %s" + % (verbose_word, num, fspath, lineno, reason) + ) + else: + lines.append("%s [%d] %s: %s" % (verbose_word, num, fspath, reason)) + + REPORTCHAR_ACTIONS = { + "x": show_xfailed, + "X": show_xpassed, + "f": partial(show_simple, "failed"), + "s": show_skipped, + "p": partial(show_simple, "passed"), + "E": partial(show_simple, "error"), + } # type: Mapping[str, Callable[[List[str]], None]] + + lines = [] # type: List[str] + for char in self.reportchars: + action = REPORTCHAR_ACTIONS.get(char) + if action: # skipping e.g. "P" (passed with output) here. + action(lines) + + if lines: + self.write_sep("=", "short test summary info") + for line in lines: + self.write_line(line) + + def _get_main_color(self) -> Tuple[str, List[str]]: + if self._main_color is None or self._known_types is None or self._is_last_item: + self._set_main_color() + assert self._main_color + assert self._known_types + return self._main_color, self._known_types + + def _determine_main_color(self, unknown_type_seen: bool) -> str: + stats = self.stats + if "failed" in stats or "error" in stats: + main_color = "red" + elif "warnings" in stats or "xpassed" in stats or unknown_type_seen: + main_color = "yellow" + elif "passed" in stats or not self._is_last_item: + main_color = "green" + else: + main_color = "yellow" + return main_color + + def _set_main_color(self) -> None: + unknown_types = [] # type: List[str] + for found_type in self.stats.keys(): + if found_type: # setup/teardown reports have an empty key, ignore them + if found_type not in KNOWN_TYPES and found_type not in unknown_types: + unknown_types.append(found_type) + self._known_types = list(KNOWN_TYPES) + unknown_types + self._main_color = self._determine_main_color(bool(unknown_types)) + + def build_summary_stats_line(self) -> Tuple[List[Tuple[str, Dict[str, bool]]], str]: + main_color, known_types = self._get_main_color() + + parts = [] + for key in known_types: + reports = self.stats.get(key, None) + if reports: + count = sum( + 1 for rep in reports if getattr(rep, "count_towards_summary", True) + ) + color = _color_for_type.get(key, _color_for_type_default) + markup = {color: True, "bold": color == main_color} + parts.append(("%d %s" % _make_plural(count, key), markup)) + + if not parts: + parts = [("no tests ran", {_color_for_type_default: True})] + + return parts, main_color + + +def _get_pos(config, rep): + nodeid = config.cwd_relative_nodeid(rep.nodeid) + return nodeid + + +def _get_line_with_reprcrash_message(config, rep, termwidth): + """Get summary line for a report, trying to add reprcrash message.""" + from wcwidth import wcswidth + + verbose_word = rep._get_verbose_word(config) + pos = _get_pos(config, rep) + + line = "{} {}".format(verbose_word, pos) + len_line = wcswidth(line) + ellipsis, len_ellipsis = "...", 3 + if len_line > termwidth - len_ellipsis: + # No space for an additional message. + return line + + try: + msg = rep.longrepr.reprcrash.message + except AttributeError: + pass + else: + # Only use the first line. + i = msg.find("\n") + if i != -1: + msg = msg[:i] + len_msg = wcswidth(msg) + + sep, len_sep = " - ", 3 + max_len_msg = termwidth - len_line - len_sep + if max_len_msg >= len_ellipsis: + if len_msg > max_len_msg: + max_len_msg -= len_ellipsis + msg = msg[:max_len_msg] + while wcswidth(msg) > max_len_msg: + msg = msg[:-1] + msg += ellipsis + line += sep + msg + return line + + +def _folded_skips(skipped): + d = {} + for event in skipped: + key = event.longrepr + assert len(key) == 3, (event, key) + keywords = getattr(event, "keywords", {}) + # folding reports with global pytestmark variable + # this is workaround, because for now we cannot identify the scope of a skip marker + # TODO: revisit after marks scope would be fixed + if ( + event.when == "setup" + and "skip" in keywords + and "pytestmark" not in keywords + ): + key = (key[0], None, key[2]) + d.setdefault(key, []).append(event) + values = [] + for key, events in d.items(): + values.append((len(events),) + key) + return values + + +_color_for_type = { + "failed": "red", + "error": "red", + "warnings": "yellow", + "passed": "green", +} +_color_for_type_default = "yellow" + + +def _make_plural(count, noun): + # No need to pluralize words such as `failed` or `passed`. + if noun not in ["error", "warnings"]: + return count, noun + + # The `warnings` key is plural. To avoid API breakage, we keep it that way but + # set it to singular here so we can determine plurality in the same way as we do + # for `error`. + noun = noun.replace("warnings", "warning") + + return count, noun + "s" if count != 1 else noun + + +def _plugin_nameversions(plugininfo) -> List[str]: + values = [] # type: List[str] + for plugin, dist in plugininfo: + # gets us name and version! + name = "{dist.project_name}-{dist.version}".format(dist=dist) + # questionable convenience, but it keeps things short + if name.startswith("pytest-"): + name = name[7:] + # we decided to print python package names + # they can have more than one plugin + if name not in values: + values.append(name) + return values + + +def format_session_duration(seconds: float) -> str: + """Format the given seconds in a human readable manner to show in the final summary""" + if seconds < 60: + return "{:.2f}s".format(seconds) + else: + dt = datetime.timedelta(seconds=int(seconds)) + return "{:.2f}s ({})".format(seconds, dt) diff --git a/contrib/python/pytest/py3/_pytest/tmpdir.py b/contrib/python/pytest/py3/_pytest/tmpdir.py new file mode 100644 index 00000000000..85c5b838101 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/tmpdir.py @@ -0,0 +1,203 @@ +""" support for providing temporary directories to test functions. """ +import os +import re +import tempfile +from typing import Optional + +import attr +import py + +import pytest +from .pathlib import ensure_reset_dir +from .pathlib import LOCK_TIMEOUT +from .pathlib import make_numbered_dir +from .pathlib import make_numbered_dir_with_cleanup +from .pathlib import Path +from _pytest.fixtures import FixtureRequest +from _pytest.monkeypatch import MonkeyPatch + + +@attr.s +class TempPathFactory: + """Factory for temporary directories under the common base temp directory. + + The base directory can be configured using the ``--basetemp`` option.""" + + _given_basetemp = attr.ib( + type=Path, + # using os.path.abspath() to get absolute path instead of resolve() as it + # does not work the same in all platforms (see #4427) + # Path.absolute() exists, but it is not public (see https://bugs.python.org/issue25012) + # Ignore type because of https://github.com/python/mypy/issues/6172. + converter=attr.converters.optional( + lambda p: Path(os.path.abspath(str(p))) # type: ignore + ), + ) + _trace = attr.ib() + _basetemp = attr.ib(type=Optional[Path], default=None) + + @classmethod + def from_config(cls, config) -> "TempPathFactory": + """ + :param config: a pytest configuration + """ + return cls( + given_basetemp=config.option.basetemp, trace=config.trace.get("tmpdir") + ) + + def _ensure_relative_to_basetemp(self, basename: str): + basename = os.path.normpath(basename) + if (self.getbasetemp() / basename).resolve().parent != self.getbasetemp(): + raise ValueError( + "{} is not a normalized and relative path".format(basename) + ) + return basename + + def mktemp(self, basename: str, numbered: bool = True) -> Path: + """Creates a new temporary directory managed by the factory. + + :param basename: + Directory base name, must be a relative path. + + :param numbered: + If True, ensure the directory is unique by adding a number + prefix greater than any existing one: ``basename="foo"`` and ``numbered=True`` + means that this function will create directories named ``"foo-0"``, + ``"foo-1"``, ``"foo-2"`` and so on. + + :return: + The path to the new directory. + """ + basename = self._ensure_relative_to_basetemp(basename) + if not numbered: + p = self.getbasetemp().joinpath(basename) + p.mkdir() + else: + p = make_numbered_dir(root=self.getbasetemp(), prefix=basename) + self._trace("mktemp", p) + return p + + def getbasetemp(self) -> Path: + """ return base temporary directory. """ + if self._basetemp is not None: + return self._basetemp + + if self._given_basetemp is not None: + basetemp = self._given_basetemp + ensure_reset_dir(basetemp) + basetemp = basetemp.resolve() + else: + from_env = os.environ.get("PYTEST_DEBUG_TEMPROOT") + temproot = Path(from_env or tempfile.gettempdir()).resolve() + user = get_user() or "unknown" + # use a sub-directory in the temproot to speed-up + # make_numbered_dir() call + rootdir = temproot.joinpath("pytest-of-{}".format(user)) + rootdir.mkdir(exist_ok=True) + basetemp = make_numbered_dir_with_cleanup( + prefix="pytest-", root=rootdir, keep=3, lock_timeout=LOCK_TIMEOUT + ) + assert basetemp is not None, basetemp + self._basetemp = t = basetemp + self._trace("new basetemp", t) + return t + + +@attr.s +class TempdirFactory: + """ + backward comptibility wrapper that implements + :class:``py.path.local`` for :class:``TempPathFactory`` + """ + + _tmppath_factory = attr.ib(type=TempPathFactory) + + def mktemp(self, basename: str, numbered: bool = True) -> py.path.local: + """ + Same as :meth:`TempPathFactory.mkdir`, but returns a ``py.path.local`` object. + """ + return py.path.local(self._tmppath_factory.mktemp(basename, numbered).resolve()) + + def getbasetemp(self): + """backward compat wrapper for ``_tmppath_factory.getbasetemp``""" + return py.path.local(self._tmppath_factory.getbasetemp().resolve()) + + +def get_user() -> Optional[str]: + """Return the current user name, or None if getuser() does not work + in the current environment (see #1010). + """ + import getpass + + try: + return getpass.getuser() + except (ImportError, KeyError): + return None + + +def pytest_configure(config) -> None: + """Create a TempdirFactory and attach it to the config object. + + This is to comply with existing plugins which expect the handler to be + available at pytest_configure time, but ideally should be moved entirely + to the tmpdir_factory session fixture. + """ + mp = MonkeyPatch() + tmppath_handler = TempPathFactory.from_config(config) + t = TempdirFactory(tmppath_handler) + config._cleanup.append(mp.undo) + mp.setattr(config, "_tmp_path_factory", tmppath_handler, raising=False) + mp.setattr(config, "_tmpdirhandler", t, raising=False) + + +@pytest.fixture(scope="session") +def tmpdir_factory(request: FixtureRequest) -> TempdirFactory: + """Return a :class:`_pytest.tmpdir.TempdirFactory` instance for the test session. + """ + # Set dynamically by pytest_configure() above. + return request.config._tmpdirhandler # type: ignore + + +@pytest.fixture(scope="session") +def tmp_path_factory(request: FixtureRequest) -> TempPathFactory: + """Return a :class:`_pytest.tmpdir.TempPathFactory` instance for the test session. + """ + # Set dynamically by pytest_configure() above. + return request.config._tmp_path_factory # type: ignore + + +def _mk_tmp(request: FixtureRequest, factory: TempPathFactory) -> Path: + name = request.node.name + name = re.sub(r"[\W]", "_", name) + MAXVAL = 30 + name = name[:MAXVAL] + return factory.mktemp(name, numbered=True) + + +@pytest.fixture +def tmpdir(tmp_path): + """Return a temporary directory path object + which is unique to each test function invocation, + created as a sub directory of the base temporary + directory. The returned object is a `py.path.local`_ + path object. + + .. _`py.path.local`: https://py.readthedocs.io/en/latest/path.html + """ + return py.path.local(tmp_path) + + +@pytest.fixture +def tmp_path(request: FixtureRequest, tmp_path_factory: TempPathFactory) -> Path: + """Return a temporary directory path object + which is unique to each test function invocation, + created as a sub directory of the base temporary + directory. The returned object is a :class:`pathlib.Path` + object. + + .. note:: + + in python < 3.6 this is a pathlib2.Path + """ + + return _mk_tmp(request, tmp_path_factory) diff --git a/contrib/python/pytest/py3/_pytest/unittest.py b/contrib/python/pytest/py3/_pytest/unittest.py new file mode 100644 index 00000000000..36158c62d2f --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/unittest.py @@ -0,0 +1,308 @@ +""" discovery and running of std-library "unittest" style tests. """ +import sys +import traceback + +import _pytest._code +import pytest +from _pytest.compat import getimfunc +from _pytest.compat import is_async_function +from _pytest.config import hookimpl +from _pytest.outcomes import exit +from _pytest.outcomes import fail +from _pytest.outcomes import skip +from _pytest.outcomes import xfail +from _pytest.python import Class +from _pytest.python import Function +from _pytest.runner import CallInfo +from _pytest.skipping import skipped_by_mark_key +from _pytest.skipping import unexpectedsuccess_key + + +def pytest_pycollect_makeitem(collector, name, obj): + # has unittest been imported and is obj a subclass of its TestCase? + try: + if not issubclass(obj, sys.modules["unittest"].TestCase): + return + except Exception: + return + # yes, so let's collect it + return UnitTestCase.from_parent(collector, name=name, obj=obj) + + +class UnitTestCase(Class): + # marker for fixturemanger.getfixtureinfo() + # to declare that our children do not support funcargs + nofuncargs = True + + def collect(self): + from unittest import TestLoader + + cls = self.obj + if not getattr(cls, "__test__", True): + return + + skipped = _is_skipped(cls) + if not skipped: + self._inject_setup_teardown_fixtures(cls) + self._inject_setup_class_fixture() + + self.session._fixturemanager.parsefactories(self, unittest=True) + loader = TestLoader() + foundsomething = False + for name in loader.getTestCaseNames(self.obj): + x = getattr(self.obj, name) + if not getattr(x, "__test__", True): + continue + funcobj = getimfunc(x) + yield TestCaseFunction.from_parent(self, name=name, callobj=funcobj) + foundsomething = True + + if not foundsomething: + runtest = getattr(self.obj, "runTest", None) + if runtest is not None: + ut = sys.modules.get("twisted.trial.unittest", None) + if ut is None or runtest != ut.TestCase.runTest: + # TODO: callobj consistency + yield TestCaseFunction.from_parent(self, name="runTest") + + def _inject_setup_teardown_fixtures(self, cls): + """Injects a hidden auto-use fixture to invoke setUpClass/setup_method and corresponding + teardown functions (#517)""" + class_fixture = _make_xunit_fixture( + cls, "setUpClass", "tearDownClass", scope="class", pass_self=False + ) + if class_fixture: + cls.__pytest_class_setup = class_fixture + + method_fixture = _make_xunit_fixture( + cls, "setup_method", "teardown_method", scope="function", pass_self=True + ) + if method_fixture: + cls.__pytest_method_setup = method_fixture + + +def _make_xunit_fixture(obj, setup_name, teardown_name, scope, pass_self): + setup = getattr(obj, setup_name, None) + teardown = getattr(obj, teardown_name, None) + if setup is None and teardown is None: + return None + + @pytest.fixture(scope=scope, autouse=True) + def fixture(self, request): + if _is_skipped(self): + reason = self.__unittest_skip_why__ + pytest.skip(reason) + if setup is not None: + if pass_self: + setup(self, request.function) + else: + setup() + yield + if teardown is not None: + if pass_self: + teardown(self, request.function) + else: + teardown() + + return fixture + + +class TestCaseFunction(Function): + nofuncargs = True + _excinfo = None + _testcase = None + + def setup(self): + # a bound method to be called during teardown() if set (see 'runtest()') + self._explicit_tearDown = None + self._testcase = self.parent.obj(self.name) + self._obj = getattr(self._testcase, self.name) + if hasattr(self, "_request"): + self._request._fillfixtures() + + def teardown(self): + if self._explicit_tearDown is not None: + self._explicit_tearDown() + self._explicit_tearDown = None + self._testcase = None + self._obj = None + + def startTest(self, testcase): + pass + + def _addexcinfo(self, rawexcinfo): + # unwrap potential exception info (see twisted trial support below) + rawexcinfo = getattr(rawexcinfo, "_rawexcinfo", rawexcinfo) + try: + excinfo = _pytest._code.ExceptionInfo(rawexcinfo) + # invoke the attributes to trigger storing the traceback + # trial causes some issue there + excinfo.value + excinfo.traceback + except TypeError: + try: + try: + values = traceback.format_exception(*rawexcinfo) + values.insert( + 0, + "NOTE: Incompatible Exception Representation, " + "displaying natively:\n\n", + ) + fail("".join(values), pytrace=False) + except (fail.Exception, KeyboardInterrupt): + raise + except: # noqa + fail( + "ERROR: Unknown Incompatible Exception " + "representation:\n%r" % (rawexcinfo,), + pytrace=False, + ) + except KeyboardInterrupt: + raise + except fail.Exception: + excinfo = _pytest._code.ExceptionInfo.from_current() + self.__dict__.setdefault("_excinfo", []).append(excinfo) + + def addError(self, testcase, rawexcinfo): + try: + if isinstance(rawexcinfo[1], exit.Exception): + exit(rawexcinfo[1].msg) + except TypeError: + pass + self._addexcinfo(rawexcinfo) + + def addFailure(self, testcase, rawexcinfo): + self._addexcinfo(rawexcinfo) + + def addSkip(self, testcase, reason): + try: + skip(reason) + except skip.Exception: + self._store[skipped_by_mark_key] = True + self._addexcinfo(sys.exc_info()) + + def addExpectedFailure(self, testcase, rawexcinfo, reason=""): + try: + xfail(str(reason)) + except xfail.Exception: + self._addexcinfo(sys.exc_info()) + + def addUnexpectedSuccess(self, testcase, reason=""): + self._store[unexpectedsuccess_key] = reason + + def addSuccess(self, testcase): + pass + + def stopTest(self, testcase): + pass + + def _expecting_failure(self, test_method) -> bool: + """Return True if the given unittest method (or the entire class) is marked + with @expectedFailure""" + expecting_failure_method = getattr( + test_method, "__unittest_expecting_failure__", False + ) + expecting_failure_class = getattr(self, "__unittest_expecting_failure__", False) + return bool(expecting_failure_class or expecting_failure_method) + + def runtest(self): + from _pytest.debugging import maybe_wrap_pytest_function_for_tracing + + maybe_wrap_pytest_function_for_tracing(self) + + # let the unittest framework handle async functions + if is_async_function(self.obj): + self._testcase(self) + else: + # when --pdb is given, we want to postpone calling tearDown() otherwise + # when entering the pdb prompt, tearDown() would have probably cleaned up + # instance variables, which makes it difficult to debug + # arguably we could always postpone tearDown(), but this changes the moment where the + # TestCase instance interacts with the results object, so better to only do it + # when absolutely needed + if self.config.getoption("usepdb") and not _is_skipped(self.obj): + self._explicit_tearDown = self._testcase.tearDown + setattr(self._testcase, "tearDown", lambda *args: None) + + # we need to update the actual bound method with self.obj, because + # wrap_pytest_function_for_tracing replaces self.obj by a wrapper + setattr(self._testcase, self.name, self.obj) + try: + self._testcase(result=self) + finally: + delattr(self._testcase, self.name) + + def _prunetraceback(self, excinfo): + Function._prunetraceback(self, excinfo) + traceback = excinfo.traceback.filter( + lambda x: not x.frame.f_globals.get("__unittest") + ) + if traceback: + excinfo.traceback = traceback + + +@hookimpl(tryfirst=True) +def pytest_runtest_makereport(item, call): + if isinstance(item, TestCaseFunction): + if item._excinfo: + call.excinfo = item._excinfo.pop(0) + try: + del call.result + except AttributeError: + pass + + unittest = sys.modules.get("unittest") + if unittest and call.excinfo and call.excinfo.errisinstance(unittest.SkipTest): + # let's substitute the excinfo with a pytest.skip one + call2 = CallInfo.from_call( + lambda: pytest.skip(str(call.excinfo.value)), call.when + ) + call.excinfo = call2.excinfo + + +# twisted trial support + + +@hookimpl(hookwrapper=True) +def pytest_runtest_protocol(item): + if isinstance(item, TestCaseFunction) and "twisted.trial.unittest" in sys.modules: + ut = sys.modules["twisted.python.failure"] + Failure__init__ = ut.Failure.__init__ + check_testcase_implements_trial_reporter() + + def excstore( + self, exc_value=None, exc_type=None, exc_tb=None, captureVars=None + ): + if exc_value is None: + self._rawexcinfo = sys.exc_info() + else: + if exc_type is None: + exc_type = type(exc_value) + self._rawexcinfo = (exc_type, exc_value, exc_tb) + try: + Failure__init__( + self, exc_value, exc_type, exc_tb, captureVars=captureVars + ) + except TypeError: + Failure__init__(self, exc_value, exc_type, exc_tb) + + ut.Failure.__init__ = excstore + yield + ut.Failure.__init__ = Failure__init__ + else: + yield + + +def check_testcase_implements_trial_reporter(done=[]): + if done: + return + from zope.interface import classImplements + from twisted.trial.itrial import IReporter + + classImplements(TestCaseFunction, IReporter) + done.append(1) + + +def _is_skipped(obj) -> bool: + """Return True if the given object has been marked with @unittest.skip""" + return bool(getattr(obj, "__unittest_skip__", False)) diff --git a/contrib/python/pytest/py3/_pytest/warning_types.py b/contrib/python/pytest/py3/_pytest/warning_types.py new file mode 100644 index 00000000000..2e03c578c02 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/warning_types.py @@ -0,0 +1,133 @@ +from typing import Any +from typing import Generic +from typing import TypeVar + +import attr + +from _pytest.compat import TYPE_CHECKING + +if TYPE_CHECKING: + from typing import Type # noqa: F401 (used in type string) + + +class PytestWarning(UserWarning): + """ + Bases: :class:`UserWarning`. + + Base class for all warnings emitted by pytest. + """ + + __module__ = "pytest" + + +class PytestAssertRewriteWarning(PytestWarning): + """ + Bases: :class:`PytestWarning`. + + Warning emitted by the pytest assert rewrite module. + """ + + __module__ = "pytest" + + +class PytestCacheWarning(PytestWarning): + """ + Bases: :class:`PytestWarning`. + + Warning emitted by the cache plugin in various situations. + """ + + __module__ = "pytest" + + +class PytestConfigWarning(PytestWarning): + """ + Bases: :class:`PytestWarning`. + + Warning emitted for configuration issues. + """ + + __module__ = "pytest" + + +class PytestCollectionWarning(PytestWarning): + """ + Bases: :class:`PytestWarning`. + + Warning emitted when pytest is not able to collect a file or symbol in a module. + """ + + __module__ = "pytest" + + +class PytestDeprecationWarning(PytestWarning, DeprecationWarning): + """ + Bases: :class:`pytest.PytestWarning`, :class:`DeprecationWarning`. + + Warning class for features that will be removed in a future version. + """ + + __module__ = "pytest" + + +class PytestExperimentalApiWarning(PytestWarning, FutureWarning): + """ + Bases: :class:`pytest.PytestWarning`, :class:`FutureWarning`. + + Warning category used to denote experiments in pytest. Use sparingly as the API might change or even be + removed completely in future version + """ + + __module__ = "pytest" + + @classmethod + def simple(cls, apiname: str) -> "PytestExperimentalApiWarning": + return cls( + "{apiname} is an experimental api that may change over time".format( + apiname=apiname + ) + ) + + +class PytestUnhandledCoroutineWarning(PytestWarning): + """ + Bases: :class:`PytestWarning`. + + Warning emitted when pytest encounters a test function which is a coroutine, + but it was not handled by any async-aware plugin. Coroutine test functions + are not natively supported. + """ + + __module__ = "pytest" + + +class PytestUnknownMarkWarning(PytestWarning): + """ + Bases: :class:`PytestWarning`. + + Warning emitted on use of unknown markers. + See https://docs.pytest.org/en/latest/mark.html for details. + """ + + __module__ = "pytest" + + +_W = TypeVar("_W", bound=PytestWarning) + + +@attr.s +class UnformattedWarning(Generic[_W]): + """Used to hold warnings that need to format their message at runtime, as opposed to a direct message. + + Using this class avoids to keep all the warning types and messages in this module, avoiding misuse. + """ + + category = attr.ib(type="Type[_W]") + template = attr.ib(type=str) + + def format(self, **kwargs: Any) -> _W: + """Returns an instance of the warning category, formatted with given kwargs""" + return self.category(self.template.format(**kwargs)) + + +PYTESTER_COPY_EXAMPLE = PytestExperimentalApiWarning.simple("testdir.copy_example") diff --git a/contrib/python/pytest/py3/_pytest/warnings.py b/contrib/python/pytest/py3/_pytest/warnings.py new file mode 100644 index 00000000000..2a4d189d573 --- /dev/null +++ b/contrib/python/pytest/py3/_pytest/warnings.py @@ -0,0 +1,169 @@ +import sys +import warnings +from contextlib import contextmanager +from typing import Generator + +import pytest +from _pytest.main import Session + + +def _setoption(wmod, arg): + """ + Copy of the warning._setoption function but does not escape arguments. + """ + parts = arg.split(":") + if len(parts) > 5: + raise wmod._OptionError("too many fields (max 5): {!r}".format(arg)) + while len(parts) < 5: + parts.append("") + action, message, category, module, lineno = [s.strip() for s in parts] + action = wmod._getaction(action) + category = wmod._getcategory(category) + if lineno: + try: + lineno = int(lineno) + if lineno < 0: + raise ValueError + except (ValueError, OverflowError): + raise wmod._OptionError("invalid lineno {!r}".format(lineno)) + else: + lineno = 0 + wmod.filterwarnings(action, message, category, module, lineno) + + +def pytest_addoption(parser): + group = parser.getgroup("pytest-warnings") + group.addoption( + "-W", + "--pythonwarnings", + action="append", + help="set which warnings to report, see -W option of python itself.", + ) + parser.addini( + "filterwarnings", + type="linelist", + help="Each line specifies a pattern for " + "warnings.filterwarnings. " + "Processed after -W/--pythonwarnings.", + ) + + +def pytest_configure(config): + config.addinivalue_line( + "markers", + "filterwarnings(warning): add a warning filter to the given test. " + "see https://docs.pytest.org/en/latest/warnings.html#pytest-mark-filterwarnings ", + ) + + +@contextmanager +def catch_warnings_for_item(config, ihook, when, item): + """ + Context manager that catches warnings generated in the contained execution block. + + ``item`` can be None if we are not in the context of an item execution. + + Each warning captured triggers the ``pytest_warning_captured`` hook. + """ + cmdline_filters = config.getoption("pythonwarnings") or [] + inifilters = config.getini("filterwarnings") + with warnings.catch_warnings(record=True) as log: + # mypy can't infer that record=True means log is not None; help it. + assert log is not None + + if not sys.warnoptions: + # if user is not explicitly configuring warning filters, show deprecation warnings by default (#2908) + warnings.filterwarnings("always", category=DeprecationWarning) + warnings.filterwarnings("always", category=PendingDeprecationWarning) + + # filters should have this precedence: mark, cmdline options, ini + # filters should be applied in the inverse order of precedence + for arg in inifilters: + _setoption(warnings, arg) + + for arg in cmdline_filters: + warnings._setoption(arg) + + if item is not None: + for mark in item.iter_markers(name="filterwarnings"): + for arg in mark.args: + _setoption(warnings, arg) + + yield + + for warning_message in log: + ihook.pytest_warning_captured.call_historic( + kwargs=dict(warning_message=warning_message, when=when, item=item) + ) + + +def warning_record_to_str(warning_message): + """Convert a warnings.WarningMessage to a string.""" + warn_msg = warning_message.message + msg = warnings.formatwarning( + warn_msg, + warning_message.category, + warning_message.filename, + warning_message.lineno, + warning_message.line, + ) + return msg + + +@pytest.hookimpl(hookwrapper=True, tryfirst=True) +def pytest_runtest_protocol(item): + with catch_warnings_for_item( + config=item.config, ihook=item.ihook, when="runtest", item=item + ): + yield + + +@pytest.hookimpl(hookwrapper=True, tryfirst=True) +def pytest_collection(session: Session) -> Generator[None, None, None]: + config = session.config + with catch_warnings_for_item( + config=config, ihook=config.hook, when="collect", item=None + ): + yield + + +@pytest.hookimpl(hookwrapper=True) +def pytest_terminal_summary(terminalreporter): + config = terminalreporter.config + with catch_warnings_for_item( + config=config, ihook=config.hook, when="config", item=None + ): + yield + + +@pytest.hookimpl(hookwrapper=True) +def pytest_sessionfinish(session): + config = session.config + with catch_warnings_for_item( + config=config, ihook=config.hook, when="config", item=None + ): + yield + + +def _issue_warning_captured(warning, hook, stacklevel): + """ + This function should be used instead of calling ``warnings.warn`` directly when we are in the "configure" stage: + at this point the actual options might not have been set, so we manually trigger the pytest_warning_captured + hook so we can display these warnings in the terminal. This is a hack until we can sort out #2891. + + :param warning: the warning instance. + :param hook: the hook caller + :param stacklevel: stacklevel forwarded to warnings.warn + """ + with warnings.catch_warnings(record=True) as records: + warnings.simplefilter("always", type(warning)) + warnings.warn(warning, stacklevel=stacklevel) + # Mypy can't infer that record=True means records is not None; help it. + assert records is not None + frame = sys._getframe(stacklevel - 1) + location = frame.f_code.co_filename, frame.f_lineno, frame.f_code.co_name + hook.pytest_warning_captured.call_historic( + kwargs=dict( + warning_message=records[0], when="config", item=None, location=location + ) + ) diff --git a/contrib/python/pytest/py3/patches/03-limit-id.patch b/contrib/python/pytest/py3/patches/03-limit-id.patch new file mode 100644 index 00000000000..ba1c1995177 --- /dev/null +++ b/contrib/python/pytest/py3/patches/03-limit-id.patch @@ -0,0 +1,36 @@ +--- contrib/python/pytest/py3/_pytest/python.py (index) ++++ contrib/python/pytest/py3/_pytest/python.py (working tree) +@@ -1192,6 +1192,33 @@ def _idval(val, argname, idx, idfn, item, config): + return str(argname) + str(idx) + + ++def limit_idval(limit): ++ import functools ++ ++ names = {} ++ limit -= 6 ++ assert limit > 0 ++ ++ def decorator(func): ++ @functools.wraps(func) ++ def wrapper(*args, **kw): ++ idval = func(*args, **kw) ++ if len(idval) > limit: ++ prefix = idval[:limit] ++ # There might be same prefix for the different test cases - take item into account ++ name = "{}-{}".format(kw.get('item', ''), prefix) ++ idx = names.setdefault(name, -1) + 1 ++ names[name] = idx ++ idval = "{}-{}".format(prefix, idx) ++ return idval ++ ++ return wrapper ++ ++ return decorator ++ ++ ++# XXX limit testnames in the name of sanity and readability ++@limit_idval(limit=500) + def _idvalset( + idx: int, + parameterset: ParameterSet, diff --git a/contrib/python/pytest/py3/patches/04-support-cyrillic-id.patch b/contrib/python/pytest/py3/patches/04-support-cyrillic-id.patch new file mode 100644 index 00000000000..c45fd08282a --- /dev/null +++ b/contrib/python/pytest/py3/patches/04-support-cyrillic-id.patch @@ -0,0 +1,11 @@ +--- contrib/python/pytest/py3/_pytest/compat.py (index) ++++ contrib/python/pytest/py3/_pytest/compat.py (working tree) +@@ -255,7 +255,7 @@ if _PY3: + if isinstance(val, bytes): + ret = _bytes_to_ascii(val) + else: +- ret = val.encode("unicode_escape").decode("ascii") ++ ret = val + return _translate_non_printable(ret) + + diff --git a/contrib/python/pytest/py3/patches/05-support-readline.patch b/contrib/python/pytest/py3/patches/05-support-readline.patch new file mode 100644 index 00000000000..11d6b94f0dd --- /dev/null +++ b/contrib/python/pytest/py3/patches/05-support-readline.patch @@ -0,0 +1,69 @@ +--- contrib/python/pytest/py3/_pytest/debugging.py (index) ++++ contrib/python/pytest/py3/_pytest/debugging.py (working tree) +@@ -1,6 +1,7 @@ from __future__ import absolute_import + """ interactive debugging with PDB, the Python Debugger. """ + import argparse + import functools ++import os + import sys + + from _pytest import outcomes +@@ -9,6 +10,42 @@ from _pytest import outcomes + from _pytest.config.exceptions import UsageError + + ++def import_readline(): ++ try: ++ import readline ++ except ImportError: ++ sys.path.append('/usr/lib/python2.7/lib-dynload') ++ ++ try: ++ import readline ++ except ImportError as e: ++ print('can not import readline:', e) ++ ++ import subprocess ++ try: ++ subprocess.check_call('stty icrnl'.split()) ++ except OSError as e: ++ print('can not restore Enter, use Control+J:', e) ++ ++ ++def tty(): ++ if os.isatty(1): ++ return ++ ++ fd = os.open('/dev/tty', os.O_RDWR) ++ os.dup2(fd, 0) ++ os.dup2(fd, 1) ++ os.dup2(fd, 2) ++ os.close(fd) ++ ++ old_sys_path = sys.path ++ sys.path = list(sys.path) ++ try: ++ import_readline() ++ finally: ++ sys.path = old_sys_path ++ ++ + def _validate_usepdb_cls(value): + """Validate syntax of --pdbcls option.""" + try: +@@ -250,6 +287,7 @@ class pytestPDB(object): + @classmethod + def set_trace(cls, *args, **kwargs) -> None: + """Invoke debugging via ``Pdb.set_trace``, dropping any IO capturing.""" ++ tty() + frame = sys._getframe().f_back + _pdb = cls._init_pdb("set_trace", *args, **kwargs) + _pdb.set_trace(frame) +@@ -292,6 +330,7 @@ class PdbInvoke(object): + out, err = capman.read_global_capture() + sys.stdout.write(out) + sys.stdout.write(err) ++ tty() + _enter_pdb(node, call.excinfo, report) + + def pytest_internalerror(self, excrepr, excinfo): diff --git a/contrib/python/pytest/py3/patches/06-support-ya-markers.patch b/contrib/python/pytest/py3/patches/06-support-ya-markers.patch new file mode 100644 index 00000000000..373d89c866c --- /dev/null +++ b/contrib/python/pytest/py3/patches/06-support-ya-markers.patch @@ -0,0 +1,14 @@ +--- contrib/python/pytest/py3/_pytest/mark/structures.py (index) ++++ contrib/python/pytest/py3/_pytest/mark/structures.py (working tree) +@@ -326,7 +326,10 @@ class MarkGenerator(object): + # example lines: "skipif(condition): skip the given test if..." + # or "hypothesis: tests which use Hypothesis", so to get the + # marker name we split on both `:` and `(`. +- marker = line.split(":")[0].split("(")[0].strip() ++ if line == "ya:external": ++ marker = line ++ else: ++ marker = line.split(":")[0].split("(")[0].strip() + self._markers.add(marker) + + # If the name is not in the set of known marks after updating, diff --git a/contrib/python/pytest/py3/patches/07-disable-translate-non-printable.patch b/contrib/python/pytest/py3/patches/07-disable-translate-non-printable.patch new file mode 100644 index 00000000000..1d0b80c6d40 --- /dev/null +++ b/contrib/python/pytest/py3/patches/07-disable-translate-non-printable.patch @@ -0,0 +1,11 @@ +--- contrib/python/pytest/py3/_pytest/compat.py (index) ++++ contrib/python/pytest/py3/_pytest/compat.py (working tree) +@@ -256,7 +256,7 @@ if _PY3: + ret = _bytes_to_ascii(val) + else: + ret = val +- return _translate_non_printable(ret) ++ return ret + + + @attr.s diff --git a/contrib/python/pytest/py3/patches/08-fix-win-peerdir.patch b/contrib/python/pytest/py3/patches/08-fix-win-peerdir.patch new file mode 100644 index 00000000000..d6a56ef6e0c --- /dev/null +++ b/contrib/python/pytest/py3/patches/08-fix-win-peerdir.patch @@ -0,0 +1,15 @@ +--- contrib/python/pytest/py3/ya.make (index) ++++ contrib/python/pytest/py3/ya.make (working tree) +@@ -15,6 +15,12 @@ PEERDIR( + contrib/python/wcwidth + ) + ++IF (OS_WINDOWS) ++ PEERDIR( ++ contrib/python/atomicwrites ++ ) ++ENDIF() ++ + NO_LINT() + + NO_CHECK_IMPORTS( diff --git a/contrib/python/pytest/py3/pytest/__init__.py b/contrib/python/pytest/py3/pytest/__init__.py new file mode 100644 index 00000000000..33bc3d0fbe5 --- /dev/null +++ b/contrib/python/pytest/py3/pytest/__init__.py @@ -0,0 +1,99 @@ +# PYTHON_ARGCOMPLETE_OK +""" +pytest: unit and functional testing with Python. +""" +from _pytest import __version__ +from _pytest.assertion import register_assert_rewrite +from _pytest.compat import _setup_collect_fakemodule +from _pytest.config import cmdline +from _pytest.config import ExitCode +from _pytest.config import hookimpl +from _pytest.config import hookspec +from _pytest.config import main +from _pytest.config import UsageError +from _pytest.debugging import pytestPDB as __pytestPDB +from _pytest.fixtures import fillfixtures as _fillfuncargs +from _pytest.fixtures import fixture +from _pytest.fixtures import yield_fixture +from _pytest.freeze_support import freeze_includes +from _pytest.main import Session +from _pytest.mark import MARK_GEN as mark +from _pytest.mark import param +from _pytest.nodes import Collector +from _pytest.nodes import File +from _pytest.nodes import Item +from _pytest.outcomes import exit +from _pytest.outcomes import fail +from _pytest.outcomes import importorskip +from _pytest.outcomes import skip +from _pytest.outcomes import xfail +from _pytest.python import Class +from _pytest.python import Function +from _pytest.python import Instance +from _pytest.python import Module +from _pytest.python import Package +from _pytest.python_api import approx +from _pytest.python_api import raises +from _pytest.recwarn import deprecated_call +from _pytest.recwarn import warns +from _pytest.warning_types import PytestAssertRewriteWarning +from _pytest.warning_types import PytestCacheWarning +from _pytest.warning_types import PytestCollectionWarning +from _pytest.warning_types import PytestConfigWarning +from _pytest.warning_types import PytestDeprecationWarning +from _pytest.warning_types import PytestExperimentalApiWarning +from _pytest.warning_types import PytestUnhandledCoroutineWarning +from _pytest.warning_types import PytestUnknownMarkWarning +from _pytest.warning_types import PytestWarning + + +set_trace = __pytestPDB.set_trace + +__all__ = [ + "__version__", + "_fillfuncargs", + "approx", + "Class", + "cmdline", + "Collector", + "deprecated_call", + "exit", + "ExitCode", + "fail", + "File", + "fixture", + "freeze_includes", + "Function", + "hookimpl", + "hookspec", + "importorskip", + "Instance", + "Item", + "main", + "mark", + "Module", + "Package", + "param", + "PytestAssertRewriteWarning", + "PytestCacheWarning", + "PytestCollectionWarning", + "PytestConfigWarning", + "PytestDeprecationWarning", + "PytestExperimentalApiWarning", + "PytestUnhandledCoroutineWarning", + "PytestUnknownMarkWarning", + "PytestWarning", + "raises", + "register_assert_rewrite", + "Session", + "set_trace", + "skip", + "UsageError", + "warns", + "xfail", + "yield_fixture", +] + + +_setup_collect_fakemodule() +del _setup_collect_fakemodule diff --git a/contrib/python/pytest/py3/pytest/__main__.py b/contrib/python/pytest/py3/pytest/__main__.py new file mode 100644 index 00000000000..01b2f6ccfe9 --- /dev/null +++ b/contrib/python/pytest/py3/pytest/__main__.py @@ -0,0 +1,7 @@ +""" +pytest entry point +""" +import pytest + +if __name__ == "__main__": + raise SystemExit(pytest.main()) diff --git a/contrib/python/pytest/py3/ya.make b/contrib/python/pytest/py3/ya.make new file mode 100644 index 00000000000..88de1914cbf --- /dev/null +++ b/contrib/python/pytest/py3/ya.make @@ -0,0 +1,101 @@ +PY3_LIBRARY() + +OWNER(dmitko g:python-contrib) + +VERSION(5.4.3) + +LICENSE(MIT) + +PEERDIR( + contrib/python/attrs + contrib/python/more-itertools + contrib/python/packaging + contrib/python/pluggy + contrib/python/py + contrib/python/wcwidth +) + +IF (OS_WINDOWS) + PEERDIR( + contrib/python/atomicwrites + ) +ENDIF() + +NO_LINT() + +NO_CHECK_IMPORTS( + __tests__.* # all test modules get imported when tests are run + _pytest.* +) + +PY_SRCS( + TOP_LEVEL + _pytest/__init__.py + _pytest/_argcomplete.py + _pytest/_code/__init__.py + _pytest/_code/code.py + _pytest/_code/source.py + _pytest/_io/__init__.py + _pytest/_io/saferepr.py + _pytest/_version.py + _pytest/assertion/__init__.py + _pytest/assertion/rewrite.py + _pytest/assertion/truncate.py + _pytest/assertion/util.py + _pytest/cacheprovider.py + _pytest/capture.py + _pytest/compat.py + _pytest/config/__init__.py + _pytest/config/argparsing.py + _pytest/config/exceptions.py + _pytest/config/findpaths.py + _pytest/debugging.py + _pytest/deprecated.py + _pytest/doctest.py + _pytest/faulthandler.py + _pytest/fixtures.py + _pytest/freeze_support.py + _pytest/helpconfig.py + _pytest/hookspec.py + _pytest/junitxml.py + _pytest/logging.py + _pytest/main.py + _pytest/mark/__init__.py + _pytest/mark/evaluate.py + _pytest/mark/legacy.py + _pytest/mark/structures.py + _pytest/monkeypatch.py + _pytest/nodes.py + _pytest/nose.py + _pytest/outcomes.py + _pytest/pastebin.py + _pytest/pathlib.py + _pytest/pytester.py + _pytest/python.py + _pytest/python_api.py + _pytest/recwarn.py + _pytest/reports.py + _pytest/resultlog.py + _pytest/runner.py + _pytest/setuponly.py + _pytest/setupplan.py + _pytest/skipping.py + _pytest/stepwise.py + _pytest/store.py + _pytest/terminal.py + _pytest/tmpdir.py + _pytest/unittest.py + _pytest/warning_types.py + _pytest/warnings.py + pytest/__init__.py + pytest/__main__.py +) + +RESOURCE_FILES( + PREFIX contrib/python/pytest/py3/ + .dist-info/METADATA + .dist-info/entry_points.txt + .dist-info/top_level.txt +) + +END() diff --git a/contrib/python/pytest/ya.make b/contrib/python/pytest/ya.make new file mode 100644 index 00000000000..e4d27ea57a1 --- /dev/null +++ b/contrib/python/pytest/ya.make @@ -0,0 +1,20 @@ +PY23_LIBRARY() + +LICENSE(Service-Py23-Proxy) + +OWNER(g:python-contrib) + +IF (PYTHON2) + PEERDIR(contrib/python/pytest/py2) +ELSE() + PEERDIR(contrib/python/pytest/py3) +ENDIF() + +NO_LINT() + +END() + +RECURSE( + py2 + py3 +) |