aboutsummaryrefslogtreecommitdiffstats
path: root/contrib/python/pytest/py2
diff options
context:
space:
mode:
authorDevtools Arcadia <arcadia-devtools@yandex-team.ru>2022-02-07 18:08:42 +0300
committerDevtools Arcadia <arcadia-devtools@mous.vla.yp-c.yandex.net>2022-02-07 18:08:42 +0300
commit1110808a9d39d4b808aef724c861a2e1a38d2a69 (patch)
treee26c9fed0de5d9873cce7e00bc214573dc2195b7 /contrib/python/pytest/py2
downloadydb-1110808a9d39d4b808aef724c861a2e1a38d2a69.tar.gz
intermediate changes
ref:cde9a383711a11544ce7e107a78147fb96cc4029
Diffstat (limited to 'contrib/python/pytest/py2')
-rw-r--r--contrib/python/pytest/py2/.dist-info/METADATA195
-rw-r--r--contrib/python/pytest/py2/.dist-info/entry_points.txt4
-rw-r--r--contrib/python/pytest/py2/.dist-info/top_level.txt2
-rw-r--r--contrib/python/pytest/py2/AUTHORS263
-rw-r--r--contrib/python/pytest/py2/LICENSE21
-rw-r--r--contrib/python/pytest/py2/README.rst138
-rw-r--r--contrib/python/pytest/py2/_pytest/__init__.py9
-rw-r--r--contrib/python/pytest/py2/_pytest/_argcomplete.py110
-rw-r--r--contrib/python/pytest/py2/_pytest/_code/__init__.py15
-rw-r--r--contrib/python/pytest/py2/_pytest/_code/_py2traceback.py95
-rw-r--r--contrib/python/pytest/py2/_pytest/_code/code.py1093
-rw-r--r--contrib/python/pytest/py2/_pytest/_code/source.py324
-rw-r--r--contrib/python/pytest/py2/_pytest/_io/__init__.py0
-rw-r--r--contrib/python/pytest/py2/_pytest/_io/saferepr.py83
-rw-r--r--contrib/python/pytest/py2/_pytest/_version.py4
-rw-r--r--contrib/python/pytest/py2/_pytest/assertion/__init__.py156
-rw-r--r--contrib/python/pytest/py2/_pytest/assertion/rewrite.py1072
-rw-r--r--contrib/python/pytest/py2/_pytest/assertion/truncate.py102
-rw-r--r--contrib/python/pytest/py2/_pytest/assertion/util.py421
-rw-r--r--contrib/python/pytest/py2/_pytest/cacheprovider.py438
-rw-r--r--contrib/python/pytest/py2/_pytest/capture.py850
-rw-r--r--contrib/python/pytest/py2/_pytest/compat.py473
-rw-r--r--contrib/python/pytest/py2/_pytest/config/__init__.py1203
-rw-r--r--contrib/python/pytest/py2/_pytest/config/argparsing.py410
-rw-r--r--contrib/python/pytest/py2/_pytest/config/exceptions.py10
-rw-r--r--contrib/python/pytest/py2/_pytest/config/findpaths.py153
-rw-r--r--contrib/python/pytest/py2/_pytest/debugging.py373
-rw-r--r--contrib/python/pytest/py2/_pytest/deprecated.py96
-rw-r--r--contrib/python/pytest/py2/_pytest/doctest.py583
-rw-r--r--contrib/python/pytest/py2/_pytest/fixtures.py1356
-rw-r--r--contrib/python/pytest/py2/_pytest/freeze_support.py48
-rw-r--r--contrib/python/pytest/py2/_pytest/helpconfig.py247
-rw-r--r--contrib/python/pytest/py2/_pytest/hookspec.py639
-rw-r--r--contrib/python/pytest/py2/_pytest/junitxml.py707
-rw-r--r--contrib/python/pytest/py2/_pytest/logging.py708
-rw-r--r--contrib/python/pytest/py2/_pytest/main.py780
-rw-r--r--contrib/python/pytest/py2/_pytest/mark/__init__.py166
-rw-r--r--contrib/python/pytest/py2/_pytest/mark/evaluate.py126
-rw-r--r--contrib/python/pytest/py2/_pytest/mark/legacy.py103
-rw-r--r--contrib/python/pytest/py2/_pytest/mark/structures.py413
-rw-r--r--contrib/python/pytest/py2/_pytest/monkeypatch.py336
-rw-r--r--contrib/python/pytest/py2/_pytest/nodes.py429
-rw-r--r--contrib/python/pytest/py2/_pytest/nose.py70
-rw-r--r--contrib/python/pytest/py2/_pytest/outcomes.py187
-rw-r--r--contrib/python/pytest/py2/_pytest/pastebin.py110
-rw-r--r--contrib/python/pytest/py2/_pytest/pathlib.py380
-rw-r--r--contrib/python/pytest/py2/_pytest/pytester.py1413
-rw-r--r--contrib/python/pytest/py2/_pytest/python.py1507
-rw-r--r--contrib/python/pytest/py2/_pytest/python_api.py743
-rw-r--r--contrib/python/pytest/py2/_pytest/recwarn.py251
-rw-r--r--contrib/python/pytest/py2/_pytest/reports.py435
-rw-r--r--contrib/python/pytest/py2/_pytest/resultlog.py102
-rw-r--r--contrib/python/pytest/py2/_pytest/runner.py376
-rw-r--r--contrib/python/pytest/py2/_pytest/setuponly.py89
-rw-r--r--contrib/python/pytest/py2/_pytest/setupplan.py32
-rw-r--r--contrib/python/pytest/py2/_pytest/skipping.py186
-rw-r--r--contrib/python/pytest/py2/_pytest/stepwise.py109
-rw-r--r--contrib/python/pytest/py2/_pytest/terminal.py1090
-rw-r--r--contrib/python/pytest/py2/_pytest/tmpdir.py197
-rw-r--r--contrib/python/pytest/py2/_pytest/unittest.py291
-rw-r--r--contrib/python/pytest/py2/_pytest/warning_types.py112
-rw-r--r--contrib/python/pytest/py2/_pytest/warnings.py180
-rw-r--r--contrib/python/pytest/py2/patches/01-disable-warnings.patch12
-rw-r--r--contrib/python/pytest/py2/patches/03-limit-id.patch36
-rw-r--r--contrib/python/pytest/py2/patches/04-fix-id-encoding.patch57
-rw-r--r--contrib/python/pytest/py2/patches/04-support-cyrillic-id.patch26
-rw-r--r--contrib/python/pytest/py2/patches/05-support-readline.patch69
-rw-r--r--contrib/python/pytest/py2/patches/06-support-ya-markers.patch14
-rw-r--r--contrib/python/pytest/py2/patches/07-disable-translate-non-printable.patch20
-rw-r--r--contrib/python/pytest/py2/patches/08-backport-pr-6607.patch17
-rw-r--r--contrib/python/pytest/py2/pytest.py107
-rw-r--r--contrib/python/pytest/py2/ya.make100
72 files changed, 23072 insertions, 0 deletions
diff --git a/contrib/python/pytest/py2/.dist-info/METADATA b/contrib/python/pytest/py2/.dist-info/METADATA
new file mode 100644
index 00000000000..251bfce1eef
--- /dev/null
+++ b/contrib/python/pytest/py2/.dist-info/METADATA
@@ -0,0 +1,195 @@
+Metadata-Version: 2.1
+Name: pytest
+Version: 4.6.11
+Summary: pytest: simple powerful testing with Python
+Home-page: https://docs.pytest.org/en/latest/
+Author: Holger Krekel, Bruno Oliveira, Ronny Pfannschmidt, Floris Bruynooghe, Brianna Laugher, Florian Bruhin and others
+License: MIT license
+Project-URL: Source, https://github.com/pytest-dev/pytest
+Project-URL: Tracker, https://github.com/pytest-dev/pytest/issues
+Keywords: test,unittest
+Platform: unix
+Platform: linux
+Platform: osx
+Platform: cygwin
+Platform: win32
+Classifier: Development Status :: 6 - Mature
+Classifier: Intended Audience :: Developers
+Classifier: License :: OSI Approved :: MIT License
+Classifier: Operating System :: POSIX
+Classifier: Operating System :: Microsoft :: Windows
+Classifier: Operating System :: MacOS :: MacOS X
+Classifier: Topic :: Software Development :: Testing
+Classifier: Topic :: Software Development :: Libraries
+Classifier: Topic :: Utilities
+Classifier: Programming Language :: Python :: 2
+Classifier: Programming Language :: Python :: 2.7
+Classifier: Programming Language :: Python :: 3
+Classifier: Programming Language :: Python :: 3.4
+Classifier: Programming Language :: Python :: 3.5
+Classifier: Programming Language :: Python :: 3.6
+Classifier: Programming Language :: Python :: 3.7
+Classifier: Programming Language :: Python :: 3.8
+Classifier: Programming Language :: Python :: 3.9
+Requires-Python: !=3.0.*,!=3.1.*,!=3.2.*,!=3.3.*,>=2.7
+Requires-Dist: py (>=1.5.0)
+Requires-Dist: six (>=1.10.0)
+Requires-Dist: packaging
+Requires-Dist: attrs (>=17.4.0)
+Requires-Dist: atomicwrites (>=1.0)
+Requires-Dist: pluggy (<1.0,>=0.12)
+Requires-Dist: wcwidth
+Requires-Dist: funcsigs (>=1.0) ; python_version < "3.0"
+Requires-Dist: pathlib2 (>=2.2.0) ; python_version < "3.6"
+Requires-Dist: importlib-metadata (>=0.12) ; python_version < "3.8"
+Requires-Dist: more-itertools (<6.0.0,>=4.0.0) ; python_version <= "2.7"
+Requires-Dist: more-itertools (>=4.0.0) ; python_version > "2.7"
+Requires-Dist: colorama ; sys_platform == "win32" and python_version != "3.4"
+Requires-Dist: colorama (<=0.4.1) ; sys_platform == "win32" and python_version == "3.4"
+Provides-Extra: testing
+Requires-Dist: argcomplete ; extra == 'testing'
+Requires-Dist: hypothesis (>=3.56) ; extra == 'testing'
+Requires-Dist: nose ; extra == 'testing'
+Requires-Dist: requests ; extra == 'testing'
+Requires-Dist: mock ; (python_version == "2.7") and extra == 'testing'
+
+.. image:: https://docs.pytest.org/en/latest/_static/pytest1.png
+ :target: https://docs.pytest.org/en/latest/
+ :align: center
+ :alt: pytest
+
+
+------
+
+.. image:: https://img.shields.io/pypi/v/pytest.svg
+ :target: https://pypi.org/project/pytest/
+
+.. image:: https://img.shields.io/conda/vn/conda-forge/pytest.svg
+ :target: https://anaconda.org/conda-forge/pytest
+
+.. image:: https://img.shields.io/pypi/pyversions/pytest.svg
+ :target: https://pypi.org/project/pytest/
+
+.. image:: https://codecov.io/gh/pytest-dev/pytest/branch/master/graph/badge.svg
+ :target: https://codecov.io/gh/pytest-dev/pytest
+ :alt: Code coverage Status
+
+.. image:: https://travis-ci.org/pytest-dev/pytest.svg?branch=master
+ :target: https://travis-ci.org/pytest-dev/pytest
+
+.. image:: https://dev.azure.com/pytest-dev/pytest/_apis/build/status/pytest-CI?branchName=master
+ :target: https://dev.azure.com/pytest-dev/pytest
+
+.. image:: https://img.shields.io/badge/code%20style-black-000000.svg
+ :target: https://github.com/python/black
+
+.. image:: https://www.codetriage.com/pytest-dev/pytest/badges/users.svg
+ :target: https://www.codetriage.com/pytest-dev/pytest
+
+The ``pytest`` framework makes it easy to write small tests, yet
+scales to support complex functional testing for applications and libraries.
+
+An example of a simple test:
+
+.. code-block:: python
+
+ # content of test_sample.py
+ def inc(x):
+ return x + 1
+
+
+ def test_answer():
+ assert inc(3) == 5
+
+
+To execute it::
+
+ $ pytest
+ ============================= test session starts =============================
+ collected 1 items
+
+ test_sample.py F
+
+ ================================== FAILURES ===================================
+ _________________________________ test_answer _________________________________
+
+ def test_answer():
+ > assert inc(3) == 5
+ E assert 4 == 5
+ E + where 4 = inc(3)
+
+ test_sample.py:5: AssertionError
+ ========================== 1 failed in 0.04 seconds ===========================
+
+
+Due to ``pytest``'s detailed assertion introspection, only plain ``assert`` statements are used. See `getting-started <https://docs.pytest.org/en/latest/getting-started.html#our-first-test-run>`_ for more examples.
+
+
+Features
+--------
+
+- Detailed info on failing `assert statements <https://docs.pytest.org/en/latest/assert.html>`_ (no need to remember ``self.assert*`` names);
+
+- `Auto-discovery
+ <https://docs.pytest.org/en/latest/goodpractices.html#python-test-discovery>`_
+ of test modules and functions;
+
+- `Modular fixtures <https://docs.pytest.org/en/latest/fixture.html>`_ for
+ managing small or parametrized long-lived test resources;
+
+- Can run `unittest <https://docs.pytest.org/en/latest/unittest.html>`_ (or trial),
+ `nose <https://docs.pytest.org/en/latest/nose.html>`_ test suites out of the box;
+
+- Python 2.7, Python 3.4+, PyPy 2.3, Jython 2.5 (untested);
+
+- Rich plugin architecture, with over 315+ `external plugins <http://plugincompat.herokuapp.com>`_ and thriving community;
+
+
+Documentation
+-------------
+
+For full documentation, including installation, tutorials and PDF documents, please see https://docs.pytest.org/en/latest/.
+
+
+Bugs/Requests
+-------------
+
+Please use the `GitHub issue tracker <https://github.com/pytest-dev/pytest/issues>`_ to submit bugs or request features.
+
+
+Changelog
+---------
+
+Consult the `Changelog <https://docs.pytest.org/en/latest/changelog.html>`__ page for fixes and enhancements of each version.
+
+
+Support pytest
+--------------
+
+You can support pytest by obtaining a `Tideflift subscription`_.
+
+Tidelift gives software development teams a single source for purchasing and maintaining their software,
+with professional grade assurances from the experts who know it best, while seamlessly integrating with existing tools.
+
+
+.. _`Tideflift subscription`: https://tidelift.com/subscription/pkg/pypi-pytest?utm_source=pypi-pytest&utm_medium=referral&utm_campaign=readme
+
+
+Security
+^^^^^^^^
+
+pytest has never been associated with a security vunerability, but in any case, to report a
+security vulnerability please use the `Tidelift security contact <https://tidelift.com/security>`_.
+Tidelift will coordinate the fix and disclosure.
+
+
+License
+-------
+
+Copyright Holger Krekel and others, 2004-2020.
+
+Distributed under the terms of the `MIT`_ license, pytest is free and open source software.
+
+.. _`MIT`: https://github.com/pytest-dev/pytest/blob/master/LICENSE
+
+
diff --git a/contrib/python/pytest/py2/.dist-info/entry_points.txt b/contrib/python/pytest/py2/.dist-info/entry_points.txt
new file mode 100644
index 00000000000..d8e4fd298fe
--- /dev/null
+++ b/contrib/python/pytest/py2/.dist-info/entry_points.txt
@@ -0,0 +1,4 @@
+[console_scripts]
+py.test = pytest:main
+pytest = pytest:main
+
diff --git a/contrib/python/pytest/py2/.dist-info/top_level.txt b/contrib/python/pytest/py2/.dist-info/top_level.txt
new file mode 100644
index 00000000000..e94857af964
--- /dev/null
+++ b/contrib/python/pytest/py2/.dist-info/top_level.txt
@@ -0,0 +1,2 @@
+_pytest
+pytest
diff --git a/contrib/python/pytest/py2/AUTHORS b/contrib/python/pytest/py2/AUTHORS
new file mode 100644
index 00000000000..80fce539294
--- /dev/null
+++ b/contrib/python/pytest/py2/AUTHORS
@@ -0,0 +1,263 @@
+Holger Krekel, holger at merlinux eu
+merlinux GmbH, Germany, office at merlinux eu
+
+Contributors include::
+
+Aaron Coleman
+Abdeali JK
+Abhijeet Kasurde
+Adam Johnson
+Adam Uhlir
+Ahn Ki-Wook
+Akiomi Kamakura
+Alan Velasco
+Alexander Johnson
+Alexei Kozlenok
+Allan Feldman
+Aly Sivji
+Anatoly Bubenkoff
+Anders Hovmöller
+Andras Mitzki
+Andras Tim
+Andrea Cimatoribus
+Andreas Zeidler
+Andrey Paramonov
+Andrzej Ostrowski
+Andy Freeland
+Anthon van der Neut
+Anthony Shaw
+Anthony Sottile
+Anton Lodder
+Antony Lee
+Arel Cordero
+Armin Rigo
+Aron Coyle
+Aron Curzon
+Aviral Verma
+Aviv Palivoda
+Barney Gale
+Ben Webb
+Benjamin Peterson
+Bernard Pratz
+Bob Ippolito
+Brian Dorsey
+Brian Maissy
+Brian Okken
+Brianna Laugher
+Bruno Oliveira
+Cal Leeming
+Carl Friedrich Bolz
+Carlos Jenkins
+Ceridwen
+Charles Cloud
+Charnjit SiNGH (CCSJ)
+Chris Lamb
+Christian Boelsen
+Christian Fetzer
+Christian Theunert
+Christian Tismer
+Christopher Gilling
+Christopher Dignam
+Claudio Madotto
+CrazyMerlyn
+Cyrus Maden
+Damian Skrzypczak
+Dhiren Serai
+Daniel Grana
+Daniel Hahler
+Daniel Nuri
+Daniel Wandschneider
+Danielle Jenkins
+Dave Hunt
+David Díaz-Barquero
+David Mohr
+David Szotten
+David Vierra
+Daw-Ran Liou
+Denis Kirisov
+Diego Russo
+Dmitry Dygalo
+Dmitry Pribysh
+Duncan Betts
+Edison Gustavo Muenz
+Edoardo Batini
+Eduardo Schettino
+Eli Boyarski
+Elizaveta Shashkova
+Endre Galaczi
+Eric Hunsberger
+Eric Siegerman
+Erik M. Bray
+Evan Kepner
+Fabien Zarifian
+Fabio Zadrozny
+Feng Ma
+Fernando Mezzabotta Rey
+Florian Bruhin
+Floris Bruynooghe
+Gabriel Reis
+George Kussumoto
+Georgy Dyuldin
+Graham Horler
+Greg Price
+Grig Gheorghiu
+Grigorii Eremeev (budulianin)
+Guido Wesdorp
+Guoqiang Zhang
+Harald Armin Massa
+Henk-Jaap Wagenaar
+Hugo van Kemenade
+Hui Wang (coldnight)
+Ian Bicking
+Ian Lesperance
+Ilya Konstantinov
+Ionuț Turturică
+Iwan Briquemont
+Jaap Broekhuizen
+Jan Balster
+Janne Vanhala
+Jason R. Coombs
+Javier Domingo Cansino
+Javier Romero
+Jeff Rackauckas
+Jeff Widman
+Jenni Rinker
+John Eddie Ayson
+John Towler
+Jon Sonesen
+Jonas Obrist
+Jordan Guymon
+Jordan Moldow
+Jordan Speicher
+Joseph Hunkeler
+Joshua Bronson
+Jurko Gospodnetić
+Justyna Janczyszyn
+Kale Kundert
+Katarzyna Jachim
+Katerina Koukiou
+Kevin Cox
+Kevin J. Foley
+Kodi B. Arfer
+Kostis Anagnostopoulos
+Kristoffer Nordström
+Kyle Altendorf
+Lawrence Mitchell
+Lee Kamentsky
+Lev Maximov
+Llandy Riveron Del Risco
+Loic Esteve
+Lukas Bednar
+Luke Murphy
+Maciek Fijalkowski
+Maho
+Maik Figura
+Mandeep Bhutani
+Manuel Krebber
+Marc Schlaich
+Marcelo Duarte Trevisani
+Marcin Bachry
+Mark Abramowitz
+Markus Unterwaditzer
+Martijn Faassen
+Martin Altmayer
+Martin K. Scherer
+Martin Prusse
+Mathieu Clabaut
+Matt Bachmann
+Matt Duck
+Matt Williams
+Matthias Hafner
+Maxim Filipenko
+mbyt
+Michael Aquilina
+Michael Birtwell
+Michael Droettboom
+Michael Seifert
+Michal Wajszczuk
+Mihai Capotă
+Mike Hoyle (hoylemd)
+Mike Lundy
+Miro Hrončok
+Nathaniel Waisbrot
+Ned Batchelder
+Neven Mundar
+Nicholas Devenish
+Nicholas Murphy
+Niclas Olofsson
+Nicolas Delaby
+Nikolay Kondratyev
+Oleg Pidsadnyi
+Oleg Sushchenko
+Oliver Bestwalter
+Omar Kohl
+Omer Hadari
+Ondřej Súkup
+Oscar Benjamin
+Patrick Hayes
+Paweł Adamczak
+Pedro Algarvio
+Pieter Mulder
+Piotr Banaszkiewicz
+Pulkit Goyal
+Punyashloka Biswal
+Quentin Pradet
+Ralf Schmitt
+Ran Benita
+Raphael Castaneda
+Raphael Pierzina
+Raquel Alegre
+Ravi Chandra
+Roberto Polli
+Roland Puntaier
+Romain Dorgueil
+Roman Bolshakov
+Ronny Pfannschmidt
+Ross Lawley
+Russel Winder
+Ryan Wooden
+Samuel Dion-Girardeau
+Samuel Searles-Bryant
+Samuele Pedroni
+Sankt Petersbug
+Segev Finer
+Serhii Mozghovyi
+Simon Gomizelj
+Skylar Downes
+Srinivas Reddy Thatiparthy
+Stefan Farmbauer
+Stefan Zimmermann
+Stefano Taschini
+Steffen Allner
+Stephan Obermann
+Sven-Hendrik Haase
+Tadek Teleżyński
+Takafumi Arakaki
+Tarcisio Fischer
+Tareq Alayan
+Ted Xiao
+Thomas Grainger
+Thomas Hisch
+Tim Strazny
+Tom Dalton
+Tom Viner
+Tomer Keren
+Trevor Bekolay
+Tyler Goodlet
+Tzu-ping Chung
+Vasily Kuznetsov
+Victor Maryama
+Victor Uriarte
+Vidar T. Fauske
+Virgil Dupras
+Vitaly Lashmanov
+Vlad Dragos
+Volodymyr Piskun
+Wil Cooley
+William Lee
+Wim Glenn
+Wouter van Ackooy
+Xuan Luong
+Xuecong Liao
+Zac Hatfield-Dodds
+Zoltán Máté
diff --git a/contrib/python/pytest/py2/LICENSE b/contrib/python/pytest/py2/LICENSE
new file mode 100644
index 00000000000..d14fb7ff4b3
--- /dev/null
+++ b/contrib/python/pytest/py2/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2004-2020 Holger Krekel and others
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/contrib/python/pytest/py2/README.rst b/contrib/python/pytest/py2/README.rst
new file mode 100644
index 00000000000..69408978703
--- /dev/null
+++ b/contrib/python/pytest/py2/README.rst
@@ -0,0 +1,138 @@
+.. image:: https://docs.pytest.org/en/latest/_static/pytest1.png
+ :target: https://docs.pytest.org/en/latest/
+ :align: center
+ :alt: pytest
+
+
+------
+
+.. image:: https://img.shields.io/pypi/v/pytest.svg
+ :target: https://pypi.org/project/pytest/
+
+.. image:: https://img.shields.io/conda/vn/conda-forge/pytest.svg
+ :target: https://anaconda.org/conda-forge/pytest
+
+.. image:: https://img.shields.io/pypi/pyversions/pytest.svg
+ :target: https://pypi.org/project/pytest/
+
+.. image:: https://codecov.io/gh/pytest-dev/pytest/branch/master/graph/badge.svg
+ :target: https://codecov.io/gh/pytest-dev/pytest
+ :alt: Code coverage Status
+
+.. image:: https://travis-ci.org/pytest-dev/pytest.svg?branch=master
+ :target: https://travis-ci.org/pytest-dev/pytest
+
+.. image:: https://dev.azure.com/pytest-dev/pytest/_apis/build/status/pytest-CI?branchName=master
+ :target: https://dev.azure.com/pytest-dev/pytest
+
+.. image:: https://img.shields.io/badge/code%20style-black-000000.svg
+ :target: https://github.com/python/black
+
+.. image:: https://www.codetriage.com/pytest-dev/pytest/badges/users.svg
+ :target: https://www.codetriage.com/pytest-dev/pytest
+
+The ``pytest`` framework makes it easy to write small tests, yet
+scales to support complex functional testing for applications and libraries.
+
+An example of a simple test:
+
+.. code-block:: python
+
+ # content of test_sample.py
+ def inc(x):
+ return x + 1
+
+
+ def test_answer():
+ assert inc(3) == 5
+
+
+To execute it::
+
+ $ pytest
+ ============================= test session starts =============================
+ collected 1 items
+
+ test_sample.py F
+
+ ================================== FAILURES ===================================
+ _________________________________ test_answer _________________________________
+
+ def test_answer():
+ > assert inc(3) == 5
+ E assert 4 == 5
+ E + where 4 = inc(3)
+
+ test_sample.py:5: AssertionError
+ ========================== 1 failed in 0.04 seconds ===========================
+
+
+Due to ``pytest``'s detailed assertion introspection, only plain ``assert`` statements are used. See `getting-started <https://docs.pytest.org/en/latest/getting-started.html#our-first-test-run>`_ for more examples.
+
+
+Features
+--------
+
+- Detailed info on failing `assert statements <https://docs.pytest.org/en/latest/assert.html>`_ (no need to remember ``self.assert*`` names);
+
+- `Auto-discovery
+ <https://docs.pytest.org/en/latest/goodpractices.html#python-test-discovery>`_
+ of test modules and functions;
+
+- `Modular fixtures <https://docs.pytest.org/en/latest/fixture.html>`_ for
+ managing small or parametrized long-lived test resources;
+
+- Can run `unittest <https://docs.pytest.org/en/latest/unittest.html>`_ (or trial),
+ `nose <https://docs.pytest.org/en/latest/nose.html>`_ test suites out of the box;
+
+- Python 2.7, Python 3.4+, PyPy 2.3, Jython 2.5 (untested);
+
+- Rich plugin architecture, with over 315+ `external plugins <http://plugincompat.herokuapp.com>`_ and thriving community;
+
+
+Documentation
+-------------
+
+For full documentation, including installation, tutorials and PDF documents, please see https://docs.pytest.org/en/latest/.
+
+
+Bugs/Requests
+-------------
+
+Please use the `GitHub issue tracker <https://github.com/pytest-dev/pytest/issues>`_ to submit bugs or request features.
+
+
+Changelog
+---------
+
+Consult the `Changelog <https://docs.pytest.org/en/latest/changelog.html>`__ page for fixes and enhancements of each version.
+
+
+Support pytest
+--------------
+
+You can support pytest by obtaining a `Tideflift subscription`_.
+
+Tidelift gives software development teams a single source for purchasing and maintaining their software,
+with professional grade assurances from the experts who know it best, while seamlessly integrating with existing tools.
+
+
+.. _`Tideflift subscription`: https://tidelift.com/subscription/pkg/pypi-pytest?utm_source=pypi-pytest&utm_medium=referral&utm_campaign=readme
+
+
+Security
+^^^^^^^^
+
+pytest has never been associated with a security vunerability, but in any case, to report a
+security vulnerability please use the `Tidelift security contact <https://tidelift.com/security>`_.
+Tidelift will coordinate the fix and disclosure.
+
+
+License
+-------
+
+Copyright Holger Krekel and others, 2004-2020.
+
+Distributed under the terms of the `MIT`_ license, pytest is free and open source software.
+
+.. _`MIT`: https://github.com/pytest-dev/pytest/blob/master/LICENSE
diff --git a/contrib/python/pytest/py2/_pytest/__init__.py b/contrib/python/pytest/py2/_pytest/__init__.py
new file mode 100644
index 00000000000..17cc20b615a
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/__init__.py
@@ -0,0 +1,9 @@
+# -*- coding: utf-8 -*-
+__all__ = ["__version__"]
+
+try:
+ from ._version import version as __version__
+except ImportError:
+ # broken installation, we don't even try
+ # unknown only works because we do poor mans version compare
+ __version__ = "unknown"
diff --git a/contrib/python/pytest/py2/_pytest/_argcomplete.py b/contrib/python/pytest/py2/_pytest/_argcomplete.py
new file mode 100644
index 00000000000..c6cf1d8fddd
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/_argcomplete.py
@@ -0,0 +1,110 @@
+# -*- coding: utf-8 -*-
+"""allow bash-completion for argparse with argcomplete if installed
+needs argcomplete>=0.5.6 for python 3.2/3.3 (older versions fail
+to find the magic string, so _ARGCOMPLETE env. var is never set, and
+this does not need special code.
+
+Function try_argcomplete(parser) should be called directly before
+the call to ArgumentParser.parse_args().
+
+The filescompleter is what you normally would use on the positional
+arguments specification, in order to get "dirname/" after "dirn<TAB>"
+instead of the default "dirname ":
+
+ optparser.add_argument(Config._file_or_dir, nargs='*'
+ ).completer=filescompleter
+
+Other, application specific, completers should go in the file
+doing the add_argument calls as they need to be specified as .completer
+attributes as well. (If argcomplete is not installed, the function the
+attribute points to will not be used).
+
+SPEEDUP
+=======
+The generic argcomplete script for bash-completion
+(/etc/bash_completion.d/python-argcomplete.sh )
+uses a python program to determine startup script generated by pip.
+You can speed up completion somewhat by changing this script to include
+ # PYTHON_ARGCOMPLETE_OK
+so the the python-argcomplete-check-easy-install-script does not
+need to be called to find the entry point of the code and see if that is
+marked with PYTHON_ARGCOMPLETE_OK
+
+INSTALL/DEBUGGING
+=================
+To include this support in another application that has setup.py generated
+scripts:
+- add the line:
+ # PYTHON_ARGCOMPLETE_OK
+ near the top of the main python entry point
+- include in the file calling parse_args():
+ from _argcomplete import try_argcomplete, filescompleter
+ , call try_argcomplete just before parse_args(), and optionally add
+ filescompleter to the positional arguments' add_argument()
+If things do not work right away:
+- switch on argcomplete debugging with (also helpful when doing custom
+ completers):
+ export _ARC_DEBUG=1
+- run:
+ python-argcomplete-check-easy-install-script $(which appname)
+ echo $?
+ will echo 0 if the magic line has been found, 1 if not
+- sometimes it helps to find early on errors using:
+ _ARGCOMPLETE=1 _ARC_DEBUG=1 appname
+ which should throw a KeyError: 'COMPLINE' (which is properly set by the
+ global argcomplete script).
+"""
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import os
+import sys
+from glob import glob
+
+
+class FastFilesCompleter(object):
+ "Fast file completer class"
+
+ def __init__(self, directories=True):
+ self.directories = directories
+
+ def __call__(self, prefix, **kwargs):
+ """only called on non option completions"""
+ if os.path.sep in prefix[1:]:
+ prefix_dir = len(os.path.dirname(prefix) + os.path.sep)
+ else:
+ prefix_dir = 0
+ completion = []
+ globbed = []
+ if "*" not in prefix and "?" not in prefix:
+ # we are on unix, otherwise no bash
+ if not prefix or prefix[-1] == os.path.sep:
+ globbed.extend(glob(prefix + ".*"))
+ prefix += "*"
+ globbed.extend(glob(prefix))
+ for x in sorted(globbed):
+ if os.path.isdir(x):
+ x += "/"
+ # append stripping the prefix (like bash, not like compgen)
+ completion.append(x[prefix_dir:])
+ return completion
+
+
+if os.environ.get("_ARGCOMPLETE"):
+ try:
+ import argcomplete.completers
+ except ImportError:
+ sys.exit(-1)
+ filescompleter = FastFilesCompleter()
+
+ def try_argcomplete(parser):
+ argcomplete.autocomplete(parser, always_complete_options=False)
+
+
+else:
+
+ def try_argcomplete(parser):
+ pass
+
+ filescompleter = None
diff --git a/contrib/python/pytest/py2/_pytest/_code/__init__.py b/contrib/python/pytest/py2/_pytest/_code/__init__.py
new file mode 100644
index 00000000000..1394b2b10e6
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/_code/__init__.py
@@ -0,0 +1,15 @@
+# -*- coding: utf-8 -*-
+""" python inspection/code generation API """
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+from .code import Code # noqa
+from .code import ExceptionInfo # noqa
+from .code import filter_traceback # noqa
+from .code import Frame # noqa
+from .code import getrawcode # noqa
+from .code import Traceback # noqa
+from .source import compile_ as compile # noqa
+from .source import getfslineno # noqa
+from .source import Source # noqa
diff --git a/contrib/python/pytest/py2/_pytest/_code/_py2traceback.py b/contrib/python/pytest/py2/_pytest/_code/_py2traceback.py
new file mode 100644
index 00000000000..faacc02166e
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/_code/_py2traceback.py
@@ -0,0 +1,95 @@
+# -*- coding: utf-8 -*-
+# copied from python-2.7.3's traceback.py
+# CHANGES:
+# - some_str is replaced, trying to create unicode strings
+#
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+from __future__ import unicode_literals
+
+import types
+
+from six import text_type
+
+
+def format_exception_only(etype, value):
+ """Format the exception part of a traceback.
+
+ The arguments are the exception type and value such as given by
+ sys.last_type and sys.last_value. The return value is a list of
+ strings, each ending in a newline.
+
+ Normally, the list contains a single string; however, for
+ SyntaxError exceptions, it contains several lines that (when
+ printed) display detailed information about where the syntax
+ error occurred.
+
+ The message indicating which exception occurred is always the last
+ string in the list.
+
+ """
+
+ # An instance should not have a meaningful value parameter, but
+ # sometimes does, particularly for string exceptions, such as
+ # >>> raise string1, string2 # deprecated
+ #
+ # Clear these out first because issubtype(string1, SyntaxError)
+ # would throw another exception and mask the original problem.
+ if (
+ isinstance(etype, BaseException)
+ or isinstance(etype, types.InstanceType)
+ or etype is None
+ or type(etype) is str
+ ):
+ return [_format_final_exc_line(etype, value)]
+
+ stype = etype.__name__
+
+ if not issubclass(etype, SyntaxError):
+ return [_format_final_exc_line(stype, value)]
+
+ # It was a syntax error; show exactly where the problem was found.
+ lines = []
+ try:
+ msg, (filename, lineno, offset, badline) = value.args
+ except Exception:
+ pass
+ else:
+ filename = filename or "<string>"
+ lines.append(' File "{}", line {}\n'.format(filename, lineno))
+ if badline is not None:
+ if isinstance(badline, bytes): # python 2 only
+ badline = badline.decode("utf-8", "replace")
+ lines.append(" {}\n".format(badline.strip()))
+ if offset is not None:
+ caretspace = badline.rstrip("\n")[:offset].lstrip()
+ # non-space whitespace (likes tabs) must be kept for alignment
+ caretspace = ((c.isspace() and c or " ") for c in caretspace)
+ # only three spaces to account for offset1 == pos 0
+ lines.append(" {}^\n".format("".join(caretspace)))
+ value = msg
+
+ lines.append(_format_final_exc_line(stype, value))
+ return lines
+
+
+def _format_final_exc_line(etype, value):
+ """Return a list of a single line -- normal case for format_exception_only"""
+ valuestr = _some_str(value)
+ if value is None or not valuestr:
+ line = "{}\n".format(etype)
+ else:
+ line = "{}: {}\n".format(etype, valuestr)
+ return line
+
+
+def _some_str(value):
+ try:
+ return text_type(value)
+ except Exception:
+ try:
+ return bytes(value).decode("UTF-8", "replace")
+ except Exception:
+ pass
+ return "<unprintable {} object>".format(type(value).__name__)
diff --git a/contrib/python/pytest/py2/_pytest/_code/code.py b/contrib/python/pytest/py2/_pytest/_code/code.py
new file mode 100644
index 00000000000..175d6fda01d
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/_code/code.py
@@ -0,0 +1,1093 @@
+# -*- coding: utf-8 -*-
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import inspect
+import re
+import sys
+import traceback
+from inspect import CO_VARARGS
+from inspect import CO_VARKEYWORDS
+from weakref import ref
+
+import attr
+import pluggy
+import py
+from six import text_type
+
+import _pytest
+from _pytest._io.saferepr import safeformat
+from _pytest._io.saferepr import saferepr
+from _pytest.compat import _PY2
+from _pytest.compat import _PY3
+from _pytest.compat import PY35
+from _pytest.compat import safe_str
+
+if _PY3:
+ from traceback import format_exception_only
+else:
+ from ._py2traceback import format_exception_only
+
+
+class Code(object):
+ """ wrapper around Python code objects """
+
+ def __init__(self, rawcode):
+ if not hasattr(rawcode, "co_filename"):
+ rawcode = getrawcode(rawcode)
+ try:
+ self.filename = rawcode.co_filename
+ self.firstlineno = rawcode.co_firstlineno - 1
+ self.name = rawcode.co_name
+ except AttributeError:
+ raise TypeError("not a code object: %r" % (rawcode,))
+ self.raw = rawcode
+
+ def __eq__(self, other):
+ return self.raw == other.raw
+
+ __hash__ = None
+
+ def __ne__(self, other):
+ return not self == other
+
+ @property
+ def path(self):
+ """ return a path object pointing to source code (note that it
+ might not point to an actually existing file). """
+ try:
+ p = py.path.local(self.raw.co_filename)
+ # maybe don't try this checking
+ if not p.check():
+ raise OSError("py.path check failed.")
+ except OSError:
+ # XXX maybe try harder like the weird logic
+ # in the standard lib [linecache.updatecache] does?
+ p = self.raw.co_filename
+
+ return p
+
+ @property
+ def fullsource(self):
+ """ return a _pytest._code.Source object for the full source file of the code
+ """
+ from _pytest._code import source
+
+ full, _ = source.findsource(self.raw)
+ return full
+
+ def source(self):
+ """ return a _pytest._code.Source object for the code object's source only
+ """
+ # return source only for that part of code
+ import _pytest._code
+
+ return _pytest._code.Source(self.raw)
+
+ def getargs(self, var=False):
+ """ return a tuple with the argument names for the code object
+
+ if 'var' is set True also return the names of the variable and
+ keyword arguments when present
+ """
+ # handfull shortcut for getting args
+ raw = self.raw
+ argcount = raw.co_argcount
+ if var:
+ argcount += raw.co_flags & CO_VARARGS
+ argcount += raw.co_flags & CO_VARKEYWORDS
+ return raw.co_varnames[:argcount]
+
+
+class Frame(object):
+ """Wrapper around a Python frame holding f_locals and f_globals
+ in which expressions can be evaluated."""
+
+ def __init__(self, frame):
+ self.lineno = frame.f_lineno - 1
+ self.f_globals = frame.f_globals
+ self.f_locals = frame.f_locals
+ self.raw = frame
+ self.code = Code(frame.f_code)
+
+ @property
+ def statement(self):
+ """ statement this frame is at """
+ import _pytest._code
+
+ if self.code.fullsource is None:
+ return _pytest._code.Source("")
+ return self.code.fullsource.getstatement(self.lineno)
+
+ def eval(self, code, **vars):
+ """ evaluate 'code' in the frame
+
+ 'vars' are optional additional local variables
+
+ returns the result of the evaluation
+ """
+ f_locals = self.f_locals.copy()
+ f_locals.update(vars)
+ return eval(code, self.f_globals, f_locals)
+
+ def exec_(self, code, **vars):
+ """ exec 'code' in the frame
+
+ 'vars' are optiona; additional local variables
+ """
+ f_locals = self.f_locals.copy()
+ f_locals.update(vars)
+ exec(code, self.f_globals, f_locals)
+
+ def repr(self, object):
+ """ return a 'safe' (non-recursive, one-line) string repr for 'object'
+ """
+ return saferepr(object)
+
+ def is_true(self, object):
+ return object
+
+ def getargs(self, var=False):
+ """ return a list of tuples (name, value) for all arguments
+
+ if 'var' is set True also include the variable and keyword
+ arguments when present
+ """
+ retval = []
+ for arg in self.code.getargs(var):
+ try:
+ retval.append((arg, self.f_locals[arg]))
+ except KeyError:
+ pass # this can occur when using Psyco
+ return retval
+
+
+class TracebackEntry(object):
+ """ a single entry in a traceback """
+
+ _repr_style = None
+ exprinfo = None
+
+ def __init__(self, rawentry, excinfo=None):
+ self._excinfo = excinfo
+ self._rawentry = rawentry
+ self.lineno = rawentry.tb_lineno - 1
+
+ def set_repr_style(self, mode):
+ assert mode in ("short", "long")
+ self._repr_style = mode
+
+ @property
+ def frame(self):
+ import _pytest._code
+
+ return _pytest._code.Frame(self._rawentry.tb_frame)
+
+ @property
+ def relline(self):
+ return self.lineno - self.frame.code.firstlineno
+
+ def __repr__(self):
+ return "<TracebackEntry %s:%d>" % (self.frame.code.path, self.lineno + 1)
+
+ @property
+ def statement(self):
+ """ _pytest._code.Source object for the current statement """
+ source = self.frame.code.fullsource
+ return source.getstatement(self.lineno)
+
+ @property
+ def path(self):
+ """ path to the source code """
+ return self.frame.code.path
+
+ def getlocals(self):
+ return self.frame.f_locals
+
+ locals = property(getlocals, None, None, "locals of underlaying frame")
+
+ def getfirstlinesource(self):
+ # on Jython this firstlineno can be -1 apparently
+ return max(self.frame.code.firstlineno, 0)
+
+ def getsource(self, astcache=None):
+ """ return failing source code. """
+ # we use the passed in astcache to not reparse asttrees
+ # within exception info printing
+ from _pytest._code.source import getstatementrange_ast
+
+ source = self.frame.code.fullsource
+ if source is None:
+ return None
+ key = astnode = None
+ if astcache is not None:
+ key = self.frame.code.path
+ if key is not None:
+ astnode = astcache.get(key, None)
+ start = self.getfirstlinesource()
+ try:
+ astnode, _, end = getstatementrange_ast(
+ self.lineno, source, astnode=astnode
+ )
+ except SyntaxError:
+ end = self.lineno + 1
+ else:
+ if key is not None:
+ astcache[key] = astnode
+ return source[start:end]
+
+ source = property(getsource)
+
+ def ishidden(self):
+ """ return True if the current frame has a var __tracebackhide__
+ resolving to True.
+
+ If __tracebackhide__ is a callable, it gets called with the
+ ExceptionInfo instance and can decide whether to hide the traceback.
+
+ mostly for internal use
+ """
+ f = self.frame
+ tbh = f.f_locals.get(
+ "__tracebackhide__", f.f_globals.get("__tracebackhide__", False)
+ )
+ if tbh and callable(tbh):
+ return tbh(None if self._excinfo is None else self._excinfo())
+ return tbh
+
+ def __str__(self):
+ try:
+ fn = str(self.path)
+ except py.error.Error:
+ fn = "???"
+ name = self.frame.code.name
+ try:
+ line = str(self.statement).lstrip()
+ except KeyboardInterrupt:
+ raise
+ except: # noqa
+ line = "???"
+ return " File %r:%d in %s\n %s\n" % (fn, self.lineno + 1, name, line)
+
+ def name(self):
+ return self.frame.code.raw.co_name
+
+ name = property(name, None, None, "co_name of underlaying code")
+
+
+class Traceback(list):
+ """ Traceback objects encapsulate and offer higher level
+ access to Traceback entries.
+ """
+
+ Entry = TracebackEntry
+
+ def __init__(self, tb, excinfo=None):
+ """ initialize from given python traceback object and ExceptionInfo """
+ self._excinfo = excinfo
+ if hasattr(tb, "tb_next"):
+
+ def f(cur):
+ while cur is not None:
+ yield self.Entry(cur, excinfo=excinfo)
+ cur = cur.tb_next
+
+ list.__init__(self, f(tb))
+ else:
+ list.__init__(self, tb)
+
+ def cut(self, path=None, lineno=None, firstlineno=None, excludepath=None):
+ """ return a Traceback instance wrapping part of this Traceback
+
+ by provding any combination of path, lineno and firstlineno, the
+ first frame to start the to-be-returned traceback is determined
+
+ this allows cutting the first part of a Traceback instance e.g.
+ for formatting reasons (removing some uninteresting bits that deal
+ with handling of the exception/traceback)
+ """
+ for x in self:
+ code = x.frame.code
+ codepath = code.path
+ if (
+ (path is None or codepath == path)
+ and (
+ excludepath is None
+ or not hasattr(codepath, "relto")
+ or not codepath.relto(excludepath)
+ )
+ and (lineno is None or x.lineno == lineno)
+ and (firstlineno is None or x.frame.code.firstlineno == firstlineno)
+ ):
+ return Traceback(x._rawentry, self._excinfo)
+ return self
+
+ def __getitem__(self, key):
+ val = super(Traceback, self).__getitem__(key)
+ if isinstance(key, type(slice(0))):
+ val = self.__class__(val)
+ return val
+
+ def filter(self, fn=lambda x: not x.ishidden()):
+ """ return a Traceback instance with certain items removed
+
+ fn is a function that gets a single argument, a TracebackEntry
+ instance, and should return True when the item should be added
+ to the Traceback, False when not
+
+ by default this removes all the TracebackEntries which are hidden
+ (see ishidden() above)
+ """
+ return Traceback(filter(fn, self), self._excinfo)
+
+ def getcrashentry(self):
+ """ return last non-hidden traceback entry that lead
+ to the exception of a traceback.
+ """
+ for i in range(-1, -len(self) - 1, -1):
+ entry = self[i]
+ if not entry.ishidden():
+ return entry
+ return self[-1]
+
+ def recursionindex(self):
+ """ return the index of the frame/TracebackEntry where recursion
+ originates if appropriate, None if no recursion occurred
+ """
+ cache = {}
+ for i, entry in enumerate(self):
+ # id for the code.raw is needed to work around
+ # the strange metaprogramming in the decorator lib from pypi
+ # which generates code objects that have hash/value equality
+ # XXX needs a test
+ key = entry.frame.code.path, id(entry.frame.code.raw), entry.lineno
+ # print "checking for recursion at", key
+ values = cache.setdefault(key, [])
+ if values:
+ f = entry.frame
+ loc = f.f_locals
+ for otherloc in values:
+ if f.is_true(
+ f.eval(
+ co_equal,
+ __recursioncache_locals_1=loc,
+ __recursioncache_locals_2=otherloc,
+ )
+ ):
+ return i
+ values.append(entry.frame.f_locals)
+ return None
+
+
+co_equal = compile(
+ "__recursioncache_locals_1 == __recursioncache_locals_2", "?", "eval"
+)
+
+
+@attr.s(repr=False)
+class ExceptionInfo(object):
+ """ wraps sys.exc_info() objects and offers
+ help for navigating the traceback.
+ """
+
+ _assert_start_repr = (
+ "AssertionError(u'assert " if _PY2 else "AssertionError('assert "
+ )
+
+ _excinfo = attr.ib()
+ _striptext = attr.ib(default="")
+ _traceback = attr.ib(default=None)
+
+ @classmethod
+ def from_current(cls, exprinfo=None):
+ """returns an ExceptionInfo matching the current traceback
+
+ .. warning::
+
+ Experimental API
+
+
+ :param exprinfo: a text string helping to determine if we should
+ strip ``AssertionError`` from the output, defaults
+ to the exception message/``__str__()``
+ """
+ tup = sys.exc_info()
+ assert tup[0] is not None, "no current exception"
+ _striptext = ""
+ if exprinfo is None and isinstance(tup[1], AssertionError):
+ exprinfo = getattr(tup[1], "msg", None)
+ if exprinfo is None:
+ exprinfo = saferepr(tup[1])
+ if exprinfo and exprinfo.startswith(cls._assert_start_repr):
+ _striptext = "AssertionError: "
+
+ return cls(tup, _striptext)
+
+ @classmethod
+ def for_later(cls):
+ """return an unfilled ExceptionInfo
+ """
+ return cls(None)
+
+ @property
+ def type(self):
+ """the exception class"""
+ return self._excinfo[0]
+
+ @property
+ def value(self):
+ """the exception value"""
+ return self._excinfo[1]
+
+ @property
+ def tb(self):
+ """the exception raw traceback"""
+ return self._excinfo[2]
+
+ @property
+ def typename(self):
+ """the type name of the exception"""
+ return self.type.__name__
+
+ @property
+ def traceback(self):
+ """the traceback"""
+ if self._traceback is None:
+ self._traceback = Traceback(self.tb, excinfo=ref(self))
+ return self._traceback
+
+ @traceback.setter
+ def traceback(self, value):
+ self._traceback = value
+
+ def __repr__(self):
+ if self._excinfo is None:
+ return "<ExceptionInfo for raises contextmanager>"
+ return "<ExceptionInfo %s tblen=%d>" % (self.typename, len(self.traceback))
+
+ def exconly(self, tryshort=False):
+ """ return the exception as a string
+
+ when 'tryshort' resolves to True, and the exception is a
+ _pytest._code._AssertionError, only the actual exception part of
+ the exception representation is returned (so 'AssertionError: ' is
+ removed from the beginning)
+ """
+ lines = format_exception_only(self.type, self.value)
+ text = "".join(lines)
+ text = text.rstrip()
+ if tryshort:
+ if text.startswith(self._striptext):
+ text = text[len(self._striptext) :]
+ return text
+
+ def errisinstance(self, exc):
+ """ return True if the exception is an instance of exc """
+ return isinstance(self.value, exc)
+
+ def _getreprcrash(self):
+ exconly = self.exconly(tryshort=True)
+ entry = self.traceback.getcrashentry()
+ path, lineno = entry.frame.code.raw.co_filename, entry.lineno
+ return ReprFileLocation(path, lineno + 1, exconly)
+
+ def getrepr(
+ self,
+ showlocals=False,
+ style="long",
+ abspath=False,
+ tbfilter=True,
+ funcargs=False,
+ truncate_locals=True,
+ chain=True,
+ ):
+ """
+ Return str()able representation of this exception info.
+
+ :param bool showlocals:
+ Show locals per traceback entry.
+ Ignored if ``style=="native"``.
+
+ :param str style: long|short|no|native traceback style
+
+ :param bool abspath:
+ If paths should be changed to absolute or left unchanged.
+
+ :param bool tbfilter:
+ Hide entries that contain a local variable ``__tracebackhide__==True``.
+ Ignored if ``style=="native"``.
+
+ :param bool funcargs:
+ Show fixtures ("funcargs" for legacy purposes) per traceback entry.
+
+ :param bool truncate_locals:
+ With ``showlocals==True``, make sure locals can be safely represented as strings.
+
+ :param bool chain: if chained exceptions in Python 3 should be shown.
+
+ .. versionchanged:: 3.9
+
+ Added the ``chain`` parameter.
+ """
+ if style == "native":
+ return ReprExceptionInfo(
+ ReprTracebackNative(
+ traceback.format_exception(
+ self.type, self.value, self.traceback[0]._rawentry
+ )
+ ),
+ self._getreprcrash(),
+ )
+
+ fmt = FormattedExcinfo(
+ showlocals=showlocals,
+ style=style,
+ abspath=abspath,
+ tbfilter=tbfilter,
+ funcargs=funcargs,
+ truncate_locals=truncate_locals,
+ chain=chain,
+ )
+ return fmt.repr_excinfo(self)
+
+ def __str__(self):
+ if self._excinfo is None:
+ return repr(self)
+ entry = self.traceback[-1]
+ loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly())
+ return str(loc)
+
+ def __unicode__(self):
+ entry = self.traceback[-1]
+ loc = ReprFileLocation(entry.path, entry.lineno + 1, self.exconly())
+ return text_type(loc)
+
+ def match(self, regexp):
+ """
+ Check whether the regular expression 'regexp' is found in the string
+ representation of the exception using ``re.search``. If it matches
+ then True is returned (so that it is possible to write
+ ``assert excinfo.match()``). If it doesn't match an AssertionError is
+ raised.
+ """
+ __tracebackhide__ = True
+ value = (
+ text_type(self.value) if isinstance(regexp, text_type) else str(self.value)
+ )
+ if not re.search(regexp, value):
+ raise AssertionError(
+ u"Pattern {!r} not found in {!r}".format(regexp, value)
+ )
+ return True
+
+
+@attr.s
+class FormattedExcinfo(object):
+ """ presenting information about failing Functions and Generators. """
+
+ # for traceback entries
+ flow_marker = ">"
+ fail_marker = "E"
+
+ showlocals = attr.ib(default=False)
+ style = attr.ib(default="long")
+ abspath = attr.ib(default=True)
+ tbfilter = attr.ib(default=True)
+ funcargs = attr.ib(default=False)
+ truncate_locals = attr.ib(default=True)
+ chain = attr.ib(default=True)
+ astcache = attr.ib(default=attr.Factory(dict), init=False, repr=False)
+
+ def _getindent(self, source):
+ # figure out indent for given source
+ try:
+ s = str(source.getstatement(len(source) - 1))
+ except KeyboardInterrupt:
+ raise
+ except: # noqa
+ try:
+ s = str(source[-1])
+ except KeyboardInterrupt:
+ raise
+ except: # noqa
+ return 0
+ return 4 + (len(s) - len(s.lstrip()))
+
+ def _getentrysource(self, entry):
+ source = entry.getsource(self.astcache)
+ if source is not None:
+ source = source.deindent()
+ return source
+
+ def repr_args(self, entry):
+ if self.funcargs:
+ args = []
+ for argname, argvalue in entry.frame.getargs(var=True):
+ args.append((argname, saferepr(argvalue)))
+ return ReprFuncArgs(args)
+
+ def get_source(self, source, line_index=-1, excinfo=None, short=False):
+ """ return formatted and marked up source lines. """
+ import _pytest._code
+
+ lines = []
+ if source is None or line_index >= len(source.lines):
+ source = _pytest._code.Source("???")
+ line_index = 0
+ if line_index < 0:
+ line_index += len(source)
+ space_prefix = " "
+ if short:
+ lines.append(space_prefix + source.lines[line_index].strip())
+ else:
+ for line in source.lines[:line_index]:
+ lines.append(space_prefix + line)
+ lines.append(self.flow_marker + " " + source.lines[line_index])
+ for line in source.lines[line_index + 1 :]:
+ lines.append(space_prefix + line)
+ if excinfo is not None:
+ indent = 4 if short else self._getindent(source)
+ lines.extend(self.get_exconly(excinfo, indent=indent, markall=True))
+ return lines
+
+ def get_exconly(self, excinfo, indent=4, markall=False):
+ lines = []
+ indent = " " * indent
+ # get the real exception information out
+ exlines = excinfo.exconly(tryshort=True).split("\n")
+ failindent = self.fail_marker + indent[1:]
+ for line in exlines:
+ lines.append(failindent + line)
+ if not markall:
+ failindent = indent
+ return lines
+
+ def repr_locals(self, locals):
+ if self.showlocals:
+ lines = []
+ keys = [loc for loc in locals if loc[0] != "@"]
+ keys.sort()
+ for name in keys:
+ value = locals[name]
+ if name == "__builtins__":
+ lines.append("__builtins__ = <builtins>")
+ else:
+ # This formatting could all be handled by the
+ # _repr() function, which is only reprlib.Repr in
+ # disguise, so is very configurable.
+ if self.truncate_locals:
+ str_repr = saferepr(value)
+ else:
+ str_repr = safeformat(value)
+ # if len(str_repr) < 70 or not isinstance(value,
+ # (list, tuple, dict)):
+ lines.append("%-10s = %s" % (name, str_repr))
+ # else:
+ # self._line("%-10s =\\" % (name,))
+ # # XXX
+ # pprint.pprint(value, stream=self.excinfowriter)
+ return ReprLocals(lines)
+
+ def repr_traceback_entry(self, entry, excinfo=None):
+ import _pytest._code
+
+ source = self._getentrysource(entry)
+ if source is None:
+ source = _pytest._code.Source("???")
+ line_index = 0
+ else:
+ # entry.getfirstlinesource() can be -1, should be 0 on jython
+ line_index = entry.lineno - max(entry.getfirstlinesource(), 0)
+
+ lines = []
+ style = entry._repr_style
+ if style is None:
+ style = self.style
+ if style in ("short", "long"):
+ short = style == "short"
+ reprargs = self.repr_args(entry) if not short else None
+ s = self.get_source(source, line_index, excinfo, short=short)
+ lines.extend(s)
+ if short:
+ message = "in %s" % (entry.name)
+ else:
+ message = excinfo and excinfo.typename or ""
+ path = self._makepath(entry.path)
+ filelocrepr = ReprFileLocation(path, entry.lineno + 1, message)
+ localsrepr = None
+ if not short:
+ localsrepr = self.repr_locals(entry.locals)
+ return ReprEntry(lines, reprargs, localsrepr, filelocrepr, style)
+ if excinfo:
+ lines.extend(self.get_exconly(excinfo, indent=4))
+ return ReprEntry(lines, None, None, None, style)
+
+ def _makepath(self, path):
+ if not self.abspath:
+ try:
+ np = py.path.local().bestrelpath(path)
+ except OSError:
+ return path
+ if len(np) < len(str(path)):
+ path = np
+ return path
+
+ def repr_traceback(self, excinfo):
+ traceback = excinfo.traceback
+ if self.tbfilter:
+ traceback = traceback.filter()
+
+ if is_recursion_error(excinfo):
+ traceback, extraline = self._truncate_recursive_traceback(traceback)
+ else:
+ extraline = None
+
+ last = traceback[-1]
+ entries = []
+ for index, entry in enumerate(traceback):
+ einfo = (last == entry) and excinfo or None
+ reprentry = self.repr_traceback_entry(entry, einfo)
+ entries.append(reprentry)
+ return ReprTraceback(entries, extraline, style=self.style)
+
+ def _truncate_recursive_traceback(self, traceback):
+ """
+ Truncate the given recursive traceback trying to find the starting point
+ of the recursion.
+
+ The detection is done by going through each traceback entry and finding the
+ point in which the locals of the frame are equal to the locals of a previous frame (see ``recursionindex()``.
+
+ Handle the situation where the recursion process might raise an exception (for example
+ comparing numpy arrays using equality raises a TypeError), in which case we do our best to
+ warn the user of the error and show a limited traceback.
+ """
+ try:
+ recursionindex = traceback.recursionindex()
+ except Exception as e:
+ max_frames = 10
+ extraline = (
+ "!!! Recursion error detected, but an error occurred locating the origin of recursion.\n"
+ " The following exception happened when comparing locals in the stack frame:\n"
+ " {exc_type}: {exc_msg}\n"
+ " Displaying first and last {max_frames} stack frames out of {total}."
+ ).format(
+ exc_type=type(e).__name__,
+ exc_msg=safe_str(e),
+ max_frames=max_frames,
+ total=len(traceback),
+ )
+ traceback = traceback[:max_frames] + traceback[-max_frames:]
+ else:
+ if recursionindex is not None:
+ extraline = "!!! Recursion detected (same locals & position)"
+ traceback = traceback[: recursionindex + 1]
+ else:
+ extraline = None
+
+ return traceback, extraline
+
+ def repr_excinfo(self, excinfo):
+ if _PY2:
+ reprtraceback = self.repr_traceback(excinfo)
+ reprcrash = excinfo._getreprcrash()
+
+ return ReprExceptionInfo(reprtraceback, reprcrash)
+ else:
+ repr_chain = []
+ e = excinfo.value
+ descr = None
+ seen = set()
+ while e is not None and id(e) not in seen:
+ seen.add(id(e))
+ if excinfo:
+ reprtraceback = self.repr_traceback(excinfo)
+ reprcrash = excinfo._getreprcrash()
+ else:
+ # fallback to native repr if the exception doesn't have a traceback:
+ # ExceptionInfo objects require a full traceback to work
+ reprtraceback = ReprTracebackNative(
+ traceback.format_exception(type(e), e, None)
+ )
+ reprcrash = None
+
+ repr_chain += [(reprtraceback, reprcrash, descr)]
+ if e.__cause__ is not None and self.chain:
+ e = e.__cause__
+ excinfo = (
+ ExceptionInfo((type(e), e, e.__traceback__))
+ if e.__traceback__
+ else None
+ )
+ descr = "The above exception was the direct cause of the following exception:"
+ elif (
+ e.__context__ is not None
+ and not e.__suppress_context__
+ and self.chain
+ ):
+ e = e.__context__
+ excinfo = (
+ ExceptionInfo((type(e), e, e.__traceback__))
+ if e.__traceback__
+ else None
+ )
+ descr = "During handling of the above exception, another exception occurred:"
+ else:
+ e = None
+ repr_chain.reverse()
+ return ExceptionChainRepr(repr_chain)
+
+
+class TerminalRepr(object):
+ def __str__(self):
+ s = self.__unicode__()
+ if _PY2:
+ s = s.encode("utf-8")
+ return s
+
+ def __unicode__(self):
+ # FYI this is called from pytest-xdist's serialization of exception
+ # information.
+ io = py.io.TextIO()
+ tw = py.io.TerminalWriter(file=io)
+ self.toterminal(tw)
+ return io.getvalue().strip()
+
+ def __repr__(self):
+ return "<%s instance at %0x>" % (self.__class__, id(self))
+
+
+class ExceptionRepr(TerminalRepr):
+ def __init__(self):
+ self.sections = []
+
+ def addsection(self, name, content, sep="-"):
+ self.sections.append((name, content, sep))
+
+ def toterminal(self, tw):
+ for name, content, sep in self.sections:
+ tw.sep(sep, name)
+ tw.line(content)
+
+
+class ExceptionChainRepr(ExceptionRepr):
+ def __init__(self, chain):
+ super(ExceptionChainRepr, self).__init__()
+ self.chain = chain
+ # reprcrash and reprtraceback of the outermost (the newest) exception
+ # in the chain
+ self.reprtraceback = chain[-1][0]
+ self.reprcrash = chain[-1][1]
+
+ def toterminal(self, tw):
+ for element in self.chain:
+ element[0].toterminal(tw)
+ if element[2] is not None:
+ tw.line("")
+ tw.line(element[2], yellow=True)
+ super(ExceptionChainRepr, self).toterminal(tw)
+
+
+class ReprExceptionInfo(ExceptionRepr):
+ def __init__(self, reprtraceback, reprcrash):
+ super(ReprExceptionInfo, self).__init__()
+ self.reprtraceback = reprtraceback
+ self.reprcrash = reprcrash
+
+ def toterminal(self, tw):
+ self.reprtraceback.toterminal(tw)
+ super(ReprExceptionInfo, self).toterminal(tw)
+
+
+class ReprTraceback(TerminalRepr):
+ entrysep = "_ "
+
+ def __init__(self, reprentries, extraline, style):
+ self.reprentries = reprentries
+ self.extraline = extraline
+ self.style = style
+
+ def toterminal(self, tw):
+ # the entries might have different styles
+ for i, entry in enumerate(self.reprentries):
+ if entry.style == "long":
+ tw.line("")
+ entry.toterminal(tw)
+ if i < len(self.reprentries) - 1:
+ next_entry = self.reprentries[i + 1]
+ if (
+ entry.style == "long"
+ or entry.style == "short"
+ and next_entry.style == "long"
+ ):
+ tw.sep(self.entrysep)
+
+ if self.extraline:
+ tw.line(self.extraline)
+
+
+class ReprTracebackNative(ReprTraceback):
+ def __init__(self, tblines):
+ self.style = "native"
+ self.reprentries = [ReprEntryNative(tblines)]
+ self.extraline = None
+
+
+class ReprEntryNative(TerminalRepr):
+ style = "native"
+
+ def __init__(self, tblines):
+ self.lines = tblines
+
+ def toterminal(self, tw):
+ tw.write("".join(self.lines))
+
+
+class ReprEntry(TerminalRepr):
+ def __init__(self, lines, reprfuncargs, reprlocals, filelocrepr, style):
+ self.lines = lines
+ self.reprfuncargs = reprfuncargs
+ self.reprlocals = reprlocals
+ self.reprfileloc = filelocrepr
+ self.style = style
+
+ def toterminal(self, tw):
+ if self.style == "short":
+ self.reprfileloc.toterminal(tw)
+ for line in self.lines:
+ red = line.startswith("E ")
+ tw.line(line, bold=True, red=red)
+ # tw.line("")
+ return
+ if self.reprfuncargs:
+ self.reprfuncargs.toterminal(tw)
+ for line in self.lines:
+ red = line.startswith("E ")
+ tw.line(line, bold=True, red=red)
+ if self.reprlocals:
+ tw.line("")
+ self.reprlocals.toterminal(tw)
+ if self.reprfileloc:
+ if self.lines:
+ tw.line("")
+ self.reprfileloc.toterminal(tw)
+
+ def __str__(self):
+ return "%s\n%s\n%s" % ("\n".join(self.lines), self.reprlocals, self.reprfileloc)
+
+
+class ReprFileLocation(TerminalRepr):
+ def __init__(self, path, lineno, message):
+ self.path = str(path)
+ self.lineno = lineno
+ self.message = message
+
+ def toterminal(self, tw):
+ # filename and lineno output for each entry,
+ # using an output format that most editors unterstand
+ msg = self.message
+ i = msg.find("\n")
+ if i != -1:
+ msg = msg[:i]
+ tw.write(self.path, bold=True, red=True)
+ tw.line(":%s: %s" % (self.lineno, msg))
+
+
+class ReprLocals(TerminalRepr):
+ def __init__(self, lines):
+ self.lines = lines
+
+ def toterminal(self, tw):
+ for line in self.lines:
+ tw.line(line)
+
+
+class ReprFuncArgs(TerminalRepr):
+ def __init__(self, args):
+ self.args = args
+
+ def toterminal(self, tw):
+ if self.args:
+ linesofar = ""
+ for name, value in self.args:
+ ns = "%s = %s" % (safe_str(name), safe_str(value))
+ if len(ns) + len(linesofar) + 2 > tw.fullwidth:
+ if linesofar:
+ tw.line(linesofar)
+ linesofar = ns
+ else:
+ if linesofar:
+ linesofar += ", " + ns
+ else:
+ linesofar = ns
+ if linesofar:
+ tw.line(linesofar)
+ tw.line("")
+
+
+def getrawcode(obj, trycall=True):
+ """ return code object for given function. """
+ try:
+ return obj.__code__
+ except AttributeError:
+ obj = getattr(obj, "im_func", obj)
+ obj = getattr(obj, "func_code", obj)
+ obj = getattr(obj, "f_code", obj)
+ obj = getattr(obj, "__code__", obj)
+ if trycall and not hasattr(obj, "co_firstlineno"):
+ if hasattr(obj, "__call__") and not inspect.isclass(obj):
+ x = getrawcode(obj.__call__, trycall=False)
+ if hasattr(x, "co_firstlineno"):
+ return x
+ return obj
+
+
+if PY35: # RecursionError introduced in 3.5
+
+ def is_recursion_error(excinfo):
+ return excinfo.errisinstance(RecursionError) # noqa
+
+
+else:
+
+ def is_recursion_error(excinfo):
+ if not excinfo.errisinstance(RuntimeError):
+ return False
+ try:
+ return "maximum recursion depth exceeded" in str(excinfo.value)
+ except UnicodeError:
+ return False
+
+
+# relative paths that we use to filter traceback entries from appearing to the user;
+# see filter_traceback
+# note: if we need to add more paths than what we have now we should probably use a list
+# for better maintenance
+
+_PLUGGY_DIR = py.path.local(pluggy.__file__.rstrip("oc"))
+# pluggy is either a package or a single module depending on the version
+if _PLUGGY_DIR.basename == "__init__.py":
+ _PLUGGY_DIR = _PLUGGY_DIR.dirpath()
+_PYTEST_DIR = py.path.local(_pytest.__file__).dirpath()
+_PY_DIR = py.path.local(py.__file__).dirpath()
+
+
+def filter_traceback(entry):
+ """Return True if a TracebackEntry instance should be removed from tracebacks:
+ * dynamically generated code (no code to show up for it);
+ * internal traceback from pytest or its internal libraries, py and pluggy.
+ """
+ # entry.path might sometimes return a str object when the entry
+ # points to dynamically generated code
+ # see https://bitbucket.org/pytest-dev/py/issues/71
+ raw_filename = entry.frame.code.raw.co_filename
+ is_generated = "<" in raw_filename and ">" in raw_filename
+ if is_generated:
+ return False
+ # entry.path might point to a non-existing file, in which case it will
+ # also return a str object. see #1133
+ p = py.path.local(entry.path)
+ return (
+ not p.relto(_PLUGGY_DIR) and not p.relto(_PYTEST_DIR) and not p.relto(_PY_DIR)
+ )
diff --git a/contrib/python/pytest/py2/_pytest/_code/source.py b/contrib/python/pytest/py2/_pytest/_code/source.py
new file mode 100644
index 00000000000..b35e97b9cec
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/_code/source.py
@@ -0,0 +1,324 @@
+# -*- coding: utf-8 -*-
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import ast
+import inspect
+import linecache
+import sys
+import textwrap
+import tokenize
+import warnings
+from ast import PyCF_ONLY_AST as _AST_FLAG
+from bisect import bisect_right
+
+import py
+import six
+
+
+class Source(object):
+ """ an immutable object holding a source code fragment,
+ possibly deindenting it.
+ """
+
+ _compilecounter = 0
+
+ def __init__(self, *parts, **kwargs):
+ self.lines = lines = []
+ de = kwargs.get("deindent", True)
+ for part in parts:
+ if not part:
+ partlines = []
+ elif isinstance(part, Source):
+ partlines = part.lines
+ elif isinstance(part, (tuple, list)):
+ partlines = [x.rstrip("\n") for x in part]
+ elif isinstance(part, six.string_types):
+ partlines = part.split("\n")
+ else:
+ partlines = getsource(part, deindent=de).lines
+ if de:
+ partlines = deindent(partlines)
+ lines.extend(partlines)
+
+ def __eq__(self, other):
+ try:
+ return self.lines == other.lines
+ except AttributeError:
+ if isinstance(other, str):
+ return str(self) == other
+ return False
+
+ __hash__ = None
+
+ def __getitem__(self, key):
+ if isinstance(key, int):
+ return self.lines[key]
+ else:
+ if key.step not in (None, 1):
+ raise IndexError("cannot slice a Source with a step")
+ newsource = Source()
+ newsource.lines = self.lines[key.start : key.stop]
+ return newsource
+
+ def __len__(self):
+ return len(self.lines)
+
+ def strip(self):
+ """ return new source object with trailing
+ and leading blank lines removed.
+ """
+ start, end = 0, len(self)
+ while start < end and not self.lines[start].strip():
+ start += 1
+ while end > start and not self.lines[end - 1].strip():
+ end -= 1
+ source = Source()
+ source.lines[:] = self.lines[start:end]
+ return source
+
+ def putaround(self, before="", after="", indent=" " * 4):
+ """ return a copy of the source object with
+ 'before' and 'after' wrapped around it.
+ """
+ before = Source(before)
+ after = Source(after)
+ newsource = Source()
+ lines = [(indent + line) for line in self.lines]
+ newsource.lines = before.lines + lines + after.lines
+ return newsource
+
+ def indent(self, indent=" " * 4):
+ """ return a copy of the source object with
+ all lines indented by the given indent-string.
+ """
+ newsource = Source()
+ newsource.lines = [(indent + line) for line in self.lines]
+ return newsource
+
+ def getstatement(self, lineno):
+ """ return Source statement which contains the
+ given linenumber (counted from 0).
+ """
+ start, end = self.getstatementrange(lineno)
+ return self[start:end]
+
+ def getstatementrange(self, lineno):
+ """ return (start, end) tuple which spans the minimal
+ statement region which containing the given lineno.
+ """
+ if not (0 <= lineno < len(self)):
+ raise IndexError("lineno out of range")
+ ast, start, end = getstatementrange_ast(lineno, self)
+ return start, end
+
+ def deindent(self):
+ """return a new source object deindented."""
+ newsource = Source()
+ newsource.lines[:] = deindent(self.lines)
+ return newsource
+
+ def isparseable(self, deindent=True):
+ """ return True if source is parseable, heuristically
+ deindenting it by default.
+ """
+ if deindent:
+ source = str(self.deindent())
+ else:
+ source = str(self)
+ try:
+ ast.parse(source)
+ except (SyntaxError, ValueError, TypeError):
+ return False
+ else:
+ return True
+
+ def __str__(self):
+ return "\n".join(self.lines)
+
+ def compile(
+ self, filename=None, mode="exec", flag=0, dont_inherit=0, _genframe=None
+ ):
+ """ return compiled code object. if filename is None
+ invent an artificial filename which displays
+ the source/line position of the caller frame.
+ """
+ if not filename or py.path.local(filename).check(file=0):
+ if _genframe is None:
+ _genframe = sys._getframe(1) # the caller
+ fn, lineno = _genframe.f_code.co_filename, _genframe.f_lineno
+ base = "<%d-codegen " % self._compilecounter
+ self.__class__._compilecounter += 1
+ if not filename:
+ filename = base + "%s:%d>" % (fn, lineno)
+ else:
+ filename = base + "%r %s:%d>" % (filename, fn, lineno)
+ source = "\n".join(self.lines) + "\n"
+ try:
+ co = compile(source, filename, mode, flag)
+ except SyntaxError:
+ ex = sys.exc_info()[1]
+ # re-represent syntax errors from parsing python strings
+ msglines = self.lines[: ex.lineno]
+ if ex.offset:
+ msglines.append(" " * ex.offset + "^")
+ msglines.append("(code was compiled probably from here: %s)" % filename)
+ newex = SyntaxError("\n".join(msglines))
+ newex.offset = ex.offset
+ newex.lineno = ex.lineno
+ newex.text = ex.text
+ raise newex
+ else:
+ if flag & _AST_FLAG:
+ return co
+ lines = [(x + "\n") for x in self.lines]
+ linecache.cache[filename] = (1, None, lines, filename)
+ return co
+
+
+#
+# public API shortcut functions
+#
+
+
+def compile_(source, filename=None, mode="exec", flags=0, dont_inherit=0):
+ """ compile the given source to a raw code object,
+ and maintain an internal cache which allows later
+ retrieval of the source code for the code object
+ and any recursively created code objects.
+ """
+ if isinstance(source, ast.AST):
+ # XXX should Source support having AST?
+ return compile(source, filename, mode, flags, dont_inherit)
+ _genframe = sys._getframe(1) # the caller
+ s = Source(source)
+ co = s.compile(filename, mode, flags, _genframe=_genframe)
+ return co
+
+
+def getfslineno(obj):
+ """ Return source location (path, lineno) for the given object.
+ If the source cannot be determined return ("", -1).
+
+ The line number is 0-based.
+ """
+ from .code import Code
+
+ try:
+ code = Code(obj)
+ except TypeError:
+ try:
+ fn = inspect.getsourcefile(obj) or inspect.getfile(obj)
+ except TypeError:
+ return "", -1
+
+ fspath = fn and py.path.local(fn) or None
+ lineno = -1
+ if fspath:
+ try:
+ _, lineno = findsource(obj)
+ except IOError:
+ pass
+ else:
+ fspath = code.path
+ lineno = code.firstlineno
+ assert isinstance(lineno, int)
+ return fspath, lineno
+
+
+#
+# helper functions
+#
+
+
+def findsource(obj):
+ try:
+ sourcelines, lineno = inspect.findsource(obj)
+ except Exception:
+ return None, -1
+ source = Source()
+ source.lines = [line.rstrip() for line in sourcelines]
+ return source, lineno
+
+
+def getsource(obj, **kwargs):
+ from .code import getrawcode
+
+ obj = getrawcode(obj)
+ try:
+ strsrc = inspect.getsource(obj)
+ except IndentationError:
+ strsrc = '"Buggy python version consider upgrading, cannot get source"'
+ assert isinstance(strsrc, str)
+ return Source(strsrc, **kwargs)
+
+
+def deindent(lines):
+ return textwrap.dedent("\n".join(lines)).splitlines()
+
+
+def get_statement_startend2(lineno, node):
+ import ast
+
+ # flatten all statements and except handlers into one lineno-list
+ # AST's line numbers start indexing at 1
+ values = []
+ for x in ast.walk(node):
+ if isinstance(x, (ast.stmt, ast.ExceptHandler)):
+ values.append(x.lineno - 1)
+ for name in ("finalbody", "orelse"):
+ val = getattr(x, name, None)
+ if val:
+ # treat the finally/orelse part as its own statement
+ values.append(val[0].lineno - 1 - 1)
+ values.sort()
+ insert_index = bisect_right(values, lineno)
+ start = values[insert_index - 1]
+ if insert_index >= len(values):
+ end = None
+ else:
+ end = values[insert_index]
+ return start, end
+
+
+def getstatementrange_ast(lineno, source, assertion=False, astnode=None):
+ if astnode is None:
+ content = str(source)
+ # See #4260:
+ # don't produce duplicate warnings when compiling source to find ast
+ with warnings.catch_warnings():
+ warnings.simplefilter("ignore")
+ astnode = compile(content, "source", "exec", _AST_FLAG)
+
+ start, end = get_statement_startend2(lineno, astnode)
+ # we need to correct the end:
+ # - ast-parsing strips comments
+ # - there might be empty lines
+ # - we might have lesser indented code blocks at the end
+ if end is None:
+ end = len(source.lines)
+
+ if end > start + 1:
+ # make sure we don't span differently indented code blocks
+ # by using the BlockFinder helper used which inspect.getsource() uses itself
+ block_finder = inspect.BlockFinder()
+ # if we start with an indented line, put blockfinder to "started" mode
+ block_finder.started = source.lines[start][0].isspace()
+ it = ((x + "\n") for x in source.lines[start:end])
+ try:
+ for tok in tokenize.generate_tokens(lambda: next(it)):
+ block_finder.tokeneater(*tok)
+ except (inspect.EndOfBlock, IndentationError):
+ end = block_finder.last + start
+ except Exception:
+ pass
+
+ # the end might still point to a comment or empty line, correct it
+ while end:
+ line = source.lines[end - 1].lstrip()
+ if line.startswith("#") or not line:
+ end -= 1
+ else:
+ break
+ return astnode, start, end
diff --git a/contrib/python/pytest/py2/_pytest/_io/__init__.py b/contrib/python/pytest/py2/_pytest/_io/__init__.py
new file mode 100644
index 00000000000..e69de29bb2d
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/_io/__init__.py
diff --git a/contrib/python/pytest/py2/_pytest/_io/saferepr.py b/contrib/python/pytest/py2/_pytest/_io/saferepr.py
new file mode 100644
index 00000000000..9b412dccad9
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/_io/saferepr.py
@@ -0,0 +1,83 @@
+# -*- coding: utf-8 -*-
+import pprint
+
+from six.moves import reprlib
+
+
+def _call_and_format_exception(call, x, *args):
+ try:
+ # Try the vanilla repr and make sure that the result is a string
+ return call(x, *args)
+ except Exception as exc:
+ exc_name = type(exc).__name__
+ try:
+ exc_info = str(exc)
+ except Exception:
+ exc_info = "unknown"
+ return '<[%s("%s") raised in repr()] %s object at 0x%x>' % (
+ exc_name,
+ exc_info,
+ x.__class__.__name__,
+ id(x),
+ )
+
+
+class SafeRepr(reprlib.Repr):
+ """subclass of repr.Repr that limits the resulting size of repr()
+ and includes information on exceptions raised during the call.
+ """
+
+ def repr(self, x):
+ return self._callhelper(reprlib.Repr.repr, self, x)
+
+ def repr_unicode(self, x, level):
+ # Strictly speaking wrong on narrow builds
+ def repr(u):
+ if "'" not in u:
+ return u"'%s'" % u
+ elif '"' not in u:
+ return u'"%s"' % u
+ else:
+ return u"'%s'" % u.replace("'", r"\'")
+
+ s = repr(x[: self.maxstring])
+ if len(s) > self.maxstring:
+ i = max(0, (self.maxstring - 3) // 2)
+ j = max(0, self.maxstring - 3 - i)
+ s = repr(x[:i] + x[len(x) - j :])
+ s = s[:i] + "..." + s[len(s) - j :]
+ return s
+
+ def repr_instance(self, x, level):
+ return self._callhelper(repr, x)
+
+ def _callhelper(self, call, x, *args):
+ s = _call_and_format_exception(call, x, *args)
+ if len(s) > self.maxsize:
+ i = max(0, (self.maxsize - 3) // 2)
+ j = max(0, self.maxsize - 3 - i)
+ s = s[:i] + "..." + s[len(s) - j :]
+ return s
+
+
+def safeformat(obj):
+ """return a pretty printed string for the given object.
+ Failing __repr__ functions of user instances will be represented
+ with a short exception info.
+ """
+ return _call_and_format_exception(pprint.pformat, obj)
+
+
+def saferepr(obj, maxsize=240):
+ """return a size-limited safe repr-string for the given object.
+ Failing __repr__ functions of user instances will be represented
+ with a short exception info and 'saferepr' generally takes
+ care to never raise exceptions itself. This function is a wrapper
+ around the Repr/reprlib functionality of the standard 2.6 lib.
+ """
+ # review exception handling
+ srepr = SafeRepr()
+ srepr.maxstring = maxsize
+ srepr.maxsize = maxsize
+ srepr.maxother = 160
+ return srepr.repr(obj)
diff --git a/contrib/python/pytest/py2/_pytest/_version.py b/contrib/python/pytest/py2/_pytest/_version.py
new file mode 100644
index 00000000000..3d587586fcc
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/_version.py
@@ -0,0 +1,4 @@
+# coding: utf-8
+# file generated by setuptools_scm
+# don't change, don't track in version control
+version = '4.6.11'
diff --git a/contrib/python/pytest/py2/_pytest/assertion/__init__.py b/contrib/python/pytest/py2/_pytest/assertion/__init__.py
new file mode 100644
index 00000000000..6b6abb863a3
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/assertion/__init__.py
@@ -0,0 +1,156 @@
+# -*- coding: utf-8 -*-
+"""
+support for presenting detailed information in failing assertions.
+"""
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import sys
+
+import six
+
+from _pytest.assertion import rewrite
+from _pytest.assertion import truncate
+from _pytest.assertion import util
+
+
+def pytest_addoption(parser):
+ group = parser.getgroup("debugconfig")
+ group.addoption(
+ "--assert",
+ action="store",
+ dest="assertmode",
+ choices=("rewrite", "plain"),
+ default="rewrite",
+ metavar="MODE",
+ help="""Control assertion debugging tools. 'plain'
+ performs no assertion debugging. 'rewrite'
+ (the default) rewrites assert statements in
+ test modules on import to provide assert
+ expression information.""",
+ )
+
+
+def register_assert_rewrite(*names):
+ """Register one or more module names to be rewritten on import.
+
+ This function will make sure that this module or all modules inside
+ the package will get their assert statements rewritten.
+ Thus you should make sure to call this before the module is
+ actually imported, usually in your __init__.py if you are a plugin
+ using a package.
+
+ :raise TypeError: if the given module names are not strings.
+ """
+ for name in names:
+ if not isinstance(name, str):
+ msg = "expected module names as *args, got {0} instead"
+ raise TypeError(msg.format(repr(names)))
+ for hook in sys.meta_path:
+ if isinstance(hook, rewrite.AssertionRewritingHook):
+ importhook = hook
+ break
+ else:
+ importhook = DummyRewriteHook()
+ importhook.mark_rewrite(*names)
+
+
+class DummyRewriteHook(object):
+ """A no-op import hook for when rewriting is disabled."""
+
+ def mark_rewrite(self, *names):
+ pass
+
+
+class AssertionState(object):
+ """State for the assertion plugin."""
+
+ def __init__(self, config, mode):
+ self.mode = mode
+ self.trace = config.trace.root.get("assertion")
+ self.hook = None
+
+
+def install_importhook(config):
+ """Try to install the rewrite hook, raise SystemError if it fails."""
+ # Jython has an AST bug that make the assertion rewriting hook malfunction.
+ if sys.platform.startswith("java"):
+ raise SystemError("rewrite not supported")
+
+ config._assertstate = AssertionState(config, "rewrite")
+ config._assertstate.hook = hook = rewrite.AssertionRewritingHook(config)
+ sys.meta_path.insert(0, hook)
+ config._assertstate.trace("installed rewrite import hook")
+
+ def undo():
+ hook = config._assertstate.hook
+ if hook is not None and hook in sys.meta_path:
+ sys.meta_path.remove(hook)
+
+ config.add_cleanup(undo)
+ return hook
+
+
+def pytest_collection(session):
+ # this hook is only called when test modules are collected
+ # so for example not in the master process of pytest-xdist
+ # (which does not collect test modules)
+ assertstate = getattr(session.config, "_assertstate", None)
+ if assertstate:
+ if assertstate.hook is not None:
+ assertstate.hook.set_session(session)
+
+
+def pytest_runtest_setup(item):
+ """Setup the pytest_assertrepr_compare hook
+
+ The newinterpret and rewrite modules will use util._reprcompare if
+ it exists to use custom reporting via the
+ pytest_assertrepr_compare hook. This sets up this custom
+ comparison for the test.
+ """
+
+ def callbinrepr(op, left, right):
+ """Call the pytest_assertrepr_compare hook and prepare the result
+
+ This uses the first result from the hook and then ensures the
+ following:
+ * Overly verbose explanations are truncated unless configured otherwise
+ (eg. if running in verbose mode).
+ * Embedded newlines are escaped to help util.format_explanation()
+ later.
+ * If the rewrite mode is used embedded %-characters are replaced
+ to protect later % formatting.
+
+ The result can be formatted by util.format_explanation() for
+ pretty printing.
+ """
+ hook_result = item.ihook.pytest_assertrepr_compare(
+ config=item.config, op=op, left=left, right=right
+ )
+ for new_expl in hook_result:
+ if new_expl:
+ new_expl = truncate.truncate_if_required(new_expl, item)
+ new_expl = [line.replace("\n", "\\n") for line in new_expl]
+ res = six.text_type("\n~").join(new_expl)
+ if item.config.getvalue("assertmode") == "rewrite":
+ res = res.replace("%", "%%")
+ return res
+
+ util._reprcompare = callbinrepr
+
+
+def pytest_runtest_teardown(item):
+ util._reprcompare = None
+
+
+def pytest_sessionfinish(session):
+ assertstate = getattr(session.config, "_assertstate", None)
+ if assertstate:
+ if assertstate.hook is not None:
+ assertstate.hook.set_session(None)
+
+
+# Expose this plugin's implementation for the pytest_assertrepr_compare hook
+pytest_assertrepr_compare = util.assertrepr_compare
diff --git a/contrib/python/pytest/py2/_pytest/assertion/rewrite.py b/contrib/python/pytest/py2/_pytest/assertion/rewrite.py
new file mode 100644
index 00000000000..6cfd81a32f5
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/assertion/rewrite.py
@@ -0,0 +1,1072 @@
+# -*- coding: utf-8 -*-
+"""Rewrite assertion AST to produce nice error messages"""
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import warnings
+warnings.filterwarnings("ignore", category=DeprecationWarning, module="_pytest.assertion.rewrite")
+
+import ast
+import errno
+import imp
+import itertools
+import marshal
+import os
+import re
+import string
+import struct
+import sys
+import types
+
+import atomicwrites
+import py
+import six
+
+from _pytest._io.saferepr import saferepr
+from _pytest.assertion import util
+from _pytest.assertion.util import ( # noqa: F401
+ format_explanation as _format_explanation,
+)
+from _pytest.compat import spec_from_file_location
+from _pytest.pathlib import fnmatch_ex
+from _pytest.pathlib import PurePath
+
+# pytest caches rewritten pycs in __pycache__.
+if hasattr(imp, "get_tag"):
+ PYTEST_TAG = imp.get_tag() + "-PYTEST"
+else:
+ if hasattr(sys, "pypy_version_info"):
+ impl = "pypy"
+ elif sys.platform == "java":
+ impl = "jython"
+ else:
+ impl = "cpython"
+ ver = sys.version_info
+ PYTEST_TAG = "%s-%s%s-PYTEST" % (impl, ver[0], ver[1])
+ del ver, impl
+
+PYC_EXT = ".py" + (__debug__ and "c" or "o")
+PYC_TAIL = "." + PYTEST_TAG + PYC_EXT
+
+ASCII_IS_DEFAULT_ENCODING = sys.version_info[0] < 3
+
+if sys.version_info >= (3, 5):
+ ast_Call = ast.Call
+else:
+
+ def ast_Call(a, b, c):
+ return ast.Call(a, b, c, None, None)
+
+
+class AssertionRewritingHook(object):
+ """PEP302 Import hook which rewrites asserts."""
+
+ def __init__(self, config):
+ self.config = config
+ try:
+ self.fnpats = config.getini("python_files")
+ except ValueError:
+ self.fnpats = ["test_*.py", "*_test.py"]
+ self.session = None
+ self.modules = {}
+ self._rewritten_names = set()
+ self._must_rewrite = set()
+ # flag to guard against trying to rewrite a pyc file while we are already writing another pyc file,
+ # which might result in infinite recursion (#3506)
+ self._writing_pyc = False
+ self._basenames_to_check_rewrite = {"conftest"}
+ self._marked_for_rewrite_cache = {}
+ self._session_paths_checked = False
+
+ def set_session(self, session):
+ self.session = session
+ self._session_paths_checked = False
+
+ def _imp_find_module(self, name, path=None):
+ """Indirection so we can mock calls to find_module originated from the hook during testing"""
+ return imp.find_module(name, path)
+
+ def find_module(self, name, path=None):
+ if self._writing_pyc:
+ return None
+ state = self.config._assertstate
+ if self._early_rewrite_bailout(name, state):
+ return None
+ state.trace("find_module called for: %s" % name)
+ names = name.rsplit(".", 1)
+ lastname = names[-1]
+ pth = None
+ if path is not None:
+ # Starting with Python 3.3, path is a _NamespacePath(), which
+ # causes problems if not converted to list.
+ path = list(path)
+ if len(path) == 1:
+ pth = path[0]
+ if pth is None:
+ try:
+ fd, fn, desc = self._imp_find_module(lastname, path)
+ except ImportError:
+ return None
+ if fd is not None:
+ fd.close()
+ tp = desc[2]
+ if tp == imp.PY_COMPILED:
+ if hasattr(imp, "source_from_cache"):
+ try:
+ fn = imp.source_from_cache(fn)
+ except ValueError:
+ # Python 3 doesn't like orphaned but still-importable
+ # .pyc files.
+ fn = fn[:-1]
+ else:
+ fn = fn[:-1]
+ elif tp != imp.PY_SOURCE:
+ # Don't know what this is.
+ return None
+ else:
+ fn = os.path.join(pth, name.rpartition(".")[2] + ".py")
+
+ fn_pypath = py.path.local(fn)
+ if not self._should_rewrite(name, fn_pypath, state):
+ return None
+
+ self._rewritten_names.add(name)
+
+ # The requested module looks like a test file, so rewrite it. This is
+ # the most magical part of the process: load the source, rewrite the
+ # asserts, and load the rewritten source. We also cache the rewritten
+ # module code in a special pyc. We must be aware of the possibility of
+ # concurrent pytest processes rewriting and loading pycs. To avoid
+ # tricky race conditions, we maintain the following invariant: The
+ # cached pyc is always a complete, valid pyc. Operations on it must be
+ # atomic. POSIX's atomic rename comes in handy.
+ write = not sys.dont_write_bytecode
+ cache_dir = os.path.join(fn_pypath.dirname, "__pycache__")
+ if write:
+ try:
+ os.mkdir(cache_dir)
+ except OSError:
+ e = sys.exc_info()[1].errno
+ if e == errno.EEXIST:
+ # Either the __pycache__ directory already exists (the
+ # common case) or it's blocked by a non-dir node. In the
+ # latter case, we'll ignore it in _write_pyc.
+ pass
+ elif e in [errno.ENOENT, errno.ENOTDIR]:
+ # One of the path components was not a directory, likely
+ # because we're in a zip file.
+ write = False
+ elif e in [errno.EACCES, errno.EROFS, errno.EPERM]:
+ state.trace("read only directory: %r" % fn_pypath.dirname)
+ write = False
+ else:
+ raise
+ cache_name = fn_pypath.basename[:-3] + PYC_TAIL
+ pyc = os.path.join(cache_dir, cache_name)
+ # Notice that even if we're in a read-only directory, I'm going
+ # to check for a cached pyc. This may not be optimal...
+ co = _read_pyc(fn_pypath, pyc, state.trace)
+ if co is None:
+ state.trace("rewriting %r" % (fn,))
+ source_stat, co = _rewrite_test(self.config, fn_pypath)
+ if co is None:
+ # Probably a SyntaxError in the test.
+ return None
+ if write:
+ self._writing_pyc = True
+ try:
+ _write_pyc(state, co, source_stat, pyc)
+ finally:
+ self._writing_pyc = False
+ else:
+ state.trace("found cached rewritten pyc for %r" % (fn,))
+ self.modules[name] = co, pyc
+ return self
+
+ def _early_rewrite_bailout(self, name, state):
+ """
+ This is a fast way to get out of rewriting modules. Profiling has
+ shown that the call to imp.find_module (inside of the find_module
+ from this class) is a major slowdown, so, this method tries to
+ filter what we're sure won't be rewritten before getting to it.
+ """
+ if self.session is not None and not self._session_paths_checked:
+ self._session_paths_checked = True
+ for path in self.session._initialpaths:
+ # Make something as c:/projects/my_project/path.py ->
+ # ['c:', 'projects', 'my_project', 'path.py']
+ parts = str(path).split(os.path.sep)
+ # add 'path' to basenames to be checked.
+ self._basenames_to_check_rewrite.add(os.path.splitext(parts[-1])[0])
+
+ # Note: conftest already by default in _basenames_to_check_rewrite.
+ parts = name.split(".")
+ if parts[-1] in self._basenames_to_check_rewrite:
+ return False
+
+ # For matching the name it must be as if it was a filename.
+ path = PurePath(os.path.sep.join(parts) + ".py")
+
+ for pat in self.fnpats:
+ # if the pattern contains subdirectories ("tests/**.py" for example) we can't bail out based
+ # on the name alone because we need to match against the full path
+ if os.path.dirname(pat):
+ return False
+ if fnmatch_ex(pat, path):
+ return False
+
+ if self._is_marked_for_rewrite(name, state):
+ return False
+
+ state.trace("early skip of rewriting module: %s" % (name,))
+ return True
+
+ def _should_rewrite(self, name, fn_pypath, state):
+ # always rewrite conftest files
+ fn = str(fn_pypath)
+ if fn_pypath.basename == "conftest.py":
+ state.trace("rewriting conftest file: %r" % (fn,))
+ return True
+
+ if self.session is not None:
+ if self.session.isinitpath(fn):
+ state.trace("matched test file (was specified on cmdline): %r" % (fn,))
+ return True
+
+ # modules not passed explicitly on the command line are only
+ # rewritten if they match the naming convention for test files
+ for pat in self.fnpats:
+ if fn_pypath.fnmatch(pat):
+ state.trace("matched test file %r" % (fn,))
+ return True
+
+ return self._is_marked_for_rewrite(name, state)
+
+ def _is_marked_for_rewrite(self, name, state):
+ try:
+ return self._marked_for_rewrite_cache[name]
+ except KeyError:
+ for marked in self._must_rewrite:
+ if name == marked or name.startswith(marked + "."):
+ state.trace("matched marked file %r (from %r)" % (name, marked))
+ self._marked_for_rewrite_cache[name] = True
+ return True
+
+ self._marked_for_rewrite_cache[name] = False
+ return False
+
+ def mark_rewrite(self, *names):
+ """Mark import names as needing to be rewritten.
+
+ The named module or package as well as any nested modules will
+ be rewritten on import.
+ """
+ already_imported = (
+ set(names).intersection(sys.modules).difference(self._rewritten_names)
+ )
+ for name in already_imported:
+ if not AssertionRewriter.is_rewrite_disabled(
+ sys.modules[name].__doc__ or ""
+ ):
+ self._warn_already_imported(name)
+ self._must_rewrite.update(names)
+ self._marked_for_rewrite_cache.clear()
+
+ def _warn_already_imported(self, name):
+ from _pytest.warning_types import PytestAssertRewriteWarning
+ from _pytest.warnings import _issue_warning_captured
+
+ _issue_warning_captured(
+ PytestAssertRewriteWarning(
+ "Module already imported so cannot be rewritten: %s" % name
+ ),
+ self.config.hook,
+ stacklevel=5,
+ )
+
+ def load_module(self, name):
+ co, pyc = self.modules.pop(name)
+ if name in sys.modules:
+ # If there is an existing module object named 'fullname' in
+ # sys.modules, the loader must use that existing module. (Otherwise,
+ # the reload() builtin will not work correctly.)
+ mod = sys.modules[name]
+ else:
+ # I wish I could just call imp.load_compiled here, but __file__ has to
+ # be set properly. In Python 3.2+, this all would be handled correctly
+ # by load_compiled.
+ mod = sys.modules[name] = imp.new_module(name)
+ try:
+ mod.__file__ = co.co_filename
+ # Normally, this attribute is 3.2+.
+ mod.__cached__ = pyc
+ mod.__loader__ = self
+ # Normally, this attribute is 3.4+
+ mod.__spec__ = spec_from_file_location(name, co.co_filename, loader=self)
+ exec(co, mod.__dict__)
+ except: # noqa
+ if name in sys.modules:
+ del sys.modules[name]
+ raise
+ return sys.modules[name]
+
+ def is_package(self, name):
+ try:
+ fd, fn, desc = self._imp_find_module(name)
+ except ImportError:
+ return False
+ if fd is not None:
+ fd.close()
+ tp = desc[2]
+ return tp == imp.PKG_DIRECTORY
+
+ def get_data(self, pathname):
+ """Optional PEP302 get_data API.
+ """
+ with open(pathname, "rb") as f:
+ return f.read()
+
+
+def _write_pyc(state, co, source_stat, pyc):
+ # Technically, we don't have to have the same pyc format as
+ # (C)Python, since these "pycs" should never be seen by builtin
+ # import. However, there's little reason deviate, and I hope
+ # sometime to be able to use imp.load_compiled to load them. (See
+ # the comment in load_module above.)
+ try:
+ with atomicwrites.atomic_write(pyc, mode="wb", overwrite=True) as fp:
+ fp.write(imp.get_magic())
+ # as of now, bytecode header expects 32-bit numbers for size and mtime (#4903)
+ mtime = int(source_stat.mtime) & 0xFFFFFFFF
+ size = source_stat.size & 0xFFFFFFFF
+ # "<LL" stands for 2 unsigned longs, little-ending
+ fp.write(struct.pack("<LL", mtime, size))
+ fp.write(marshal.dumps(co))
+ except EnvironmentError as e:
+ state.trace("error writing pyc file at %s: errno=%s" % (pyc, e.errno))
+ # we ignore any failure to write the cache file
+ # there are many reasons, permission-denied, __pycache__ being a
+ # file etc.
+ return False
+ return True
+
+
+RN = "\r\n".encode("utf-8")
+N = "\n".encode("utf-8")
+
+cookie_re = re.compile(r"^[ \t\f]*#.*coding[:=][ \t]*[-\w.]+")
+BOM_UTF8 = "\xef\xbb\xbf"
+
+
+def _rewrite_test(config, fn):
+ """Try to read and rewrite *fn* and return the code object."""
+ state = config._assertstate
+ try:
+ stat = fn.stat()
+ source = fn.read("rb")
+ except EnvironmentError:
+ return None, None
+ if ASCII_IS_DEFAULT_ENCODING:
+ # ASCII is the default encoding in Python 2. Without a coding
+ # declaration, Python 2 will complain about any bytes in the file
+ # outside the ASCII range. Sadly, this behavior does not extend to
+ # compile() or ast.parse(), which prefer to interpret the bytes as
+ # latin-1. (At least they properly handle explicit coding cookies.) To
+ # preserve this error behavior, we could force ast.parse() to use ASCII
+ # as the encoding by inserting a coding cookie. Unfortunately, that
+ # messes up line numbers. Thus, we have to check ourselves if anything
+ # is outside the ASCII range in the case no encoding is explicitly
+ # declared. For more context, see issue #269. Yay for Python 3 which
+ # gets this right.
+ end1 = source.find("\n")
+ end2 = source.find("\n", end1 + 1)
+ if (
+ not source.startswith(BOM_UTF8)
+ and cookie_re.match(source[0:end1]) is None
+ and cookie_re.match(source[end1 + 1 : end2]) is None
+ ):
+ if hasattr(state, "_indecode"):
+ # encodings imported us again, so don't rewrite.
+ return None, None
+ state._indecode = True
+ try:
+ try:
+ source.decode("ascii")
+ except UnicodeDecodeError:
+ # Let it fail in real import.
+ return None, None
+ finally:
+ del state._indecode
+ try:
+ tree = ast.parse(source, filename=fn.strpath)
+ except SyntaxError:
+ # Let this pop up again in the real import.
+ state.trace("failed to parse: %r" % (fn,))
+ return None, None
+ rewrite_asserts(tree, fn, config)
+ try:
+ co = compile(tree, fn.strpath, "exec", dont_inherit=True)
+ except SyntaxError:
+ # It's possible that this error is from some bug in the
+ # assertion rewriting, but I don't know of a fast way to tell.
+ state.trace("failed to compile: %r" % (fn,))
+ return None, None
+ return stat, co
+
+
+def _read_pyc(source, pyc, trace=lambda x: None):
+ """Possibly read a pytest pyc containing rewritten code.
+
+ Return rewritten code if successful or None if not.
+ """
+ try:
+ fp = open(pyc, "rb")
+ except IOError:
+ return None
+ with fp:
+ try:
+ mtime = int(source.mtime())
+ size = source.size()
+ data = fp.read(12)
+ except EnvironmentError as e:
+ trace("_read_pyc(%s): EnvironmentError %s" % (source, e))
+ return None
+ # Check for invalid or out of date pyc file.
+ if (
+ len(data) != 12
+ or data[:4] != imp.get_magic()
+ or struct.unpack("<LL", data[4:]) != (mtime & 0xFFFFFFFF, size & 0xFFFFFFFF)
+ ):
+ trace("_read_pyc(%s): invalid or out of date pyc" % source)
+ return None
+ try:
+ co = marshal.load(fp)
+ except Exception as e:
+ trace("_read_pyc(%s): marshal.load error %s" % (source, e))
+ return None
+ if not isinstance(co, types.CodeType):
+ trace("_read_pyc(%s): not a code object" % source)
+ return None
+ return co
+
+
+def rewrite_asserts(mod, module_path=None, config=None):
+ """Rewrite the assert statements in mod."""
+ AssertionRewriter(module_path, config).run(mod)
+
+
+def _saferepr(obj):
+ """Get a safe repr of an object for assertion error messages.
+
+ The assertion formatting (util.format_explanation()) requires
+ newlines to be escaped since they are a special character for it.
+ Normally assertion.util.format_explanation() does this but for a
+ custom repr it is possible to contain one of the special escape
+ sequences, especially '\n{' and '\n}' are likely to be present in
+ JSON reprs.
+
+ """
+ r = saferepr(obj)
+ # only occurs in python2.x, repr must return text in python3+
+ if isinstance(r, bytes):
+ # Represent unprintable bytes as `\x##`
+ r = u"".join(
+ u"\\x{:x}".format(ord(c)) if c not in string.printable else c.decode()
+ for c in r
+ )
+ return r.replace(u"\n", u"\\n")
+
+
+def _format_assertmsg(obj):
+ """Format the custom assertion message given.
+
+ For strings this simply replaces newlines with '\n~' so that
+ util.format_explanation() will preserve them instead of escaping
+ newlines. For other objects saferepr() is used first.
+
+ """
+ # reprlib appears to have a bug which means that if a string
+ # contains a newline it gets escaped, however if an object has a
+ # .__repr__() which contains newlines it does not get escaped.
+ # However in either case we want to preserve the newline.
+ replaces = [(u"\n", u"\n~"), (u"%", u"%%")]
+ if not isinstance(obj, six.string_types):
+ obj = saferepr(obj)
+ replaces.append((u"\\n", u"\n~"))
+
+ if isinstance(obj, bytes):
+ replaces = [(r1.encode(), r2.encode()) for r1, r2 in replaces]
+
+ for r1, r2 in replaces:
+ obj = obj.replace(r1, r2)
+
+ return obj
+
+
+def _should_repr_global_name(obj):
+ if callable(obj):
+ return False
+
+ try:
+ return not hasattr(obj, "__name__")
+ except Exception:
+ return True
+
+
+def _format_boolop(explanations, is_or):
+ explanation = "(" + (is_or and " or " or " and ").join(explanations) + ")"
+ if isinstance(explanation, six.text_type):
+ return explanation.replace(u"%", u"%%")
+ else:
+ return explanation.replace(b"%", b"%%")
+
+
+def _call_reprcompare(ops, results, expls, each_obj):
+ for i, res, expl in zip(range(len(ops)), results, expls):
+ try:
+ done = not res
+ except Exception:
+ done = True
+ if done:
+ break
+ if util._reprcompare is not None:
+ custom = util._reprcompare(ops[i], each_obj[i], each_obj[i + 1])
+ if custom is not None:
+ return custom
+ return expl
+
+
+unary_map = {ast.Not: "not %s", ast.Invert: "~%s", ast.USub: "-%s", ast.UAdd: "+%s"}
+
+binop_map = {
+ ast.BitOr: "|",
+ ast.BitXor: "^",
+ ast.BitAnd: "&",
+ ast.LShift: "<<",
+ ast.RShift: ">>",
+ ast.Add: "+",
+ ast.Sub: "-",
+ ast.Mult: "*",
+ ast.Div: "/",
+ ast.FloorDiv: "//",
+ ast.Mod: "%%", # escaped for string formatting
+ ast.Eq: "==",
+ ast.NotEq: "!=",
+ ast.Lt: "<",
+ ast.LtE: "<=",
+ ast.Gt: ">",
+ ast.GtE: ">=",
+ ast.Pow: "**",
+ ast.Is: "is",
+ ast.IsNot: "is not",
+ ast.In: "in",
+ ast.NotIn: "not in",
+}
+# Python 3.5+ compatibility
+try:
+ binop_map[ast.MatMult] = "@"
+except AttributeError:
+ pass
+
+# Python 3.4+ compatibility
+if hasattr(ast, "NameConstant"):
+ _NameConstant = ast.NameConstant
+else:
+
+ def _NameConstant(c):
+ return ast.Name(str(c), ast.Load())
+
+
+def set_location(node, lineno, col_offset):
+ """Set node location information recursively."""
+
+ def _fix(node, lineno, col_offset):
+ if "lineno" in node._attributes:
+ node.lineno = lineno
+ if "col_offset" in node._attributes:
+ node.col_offset = col_offset
+ for child in ast.iter_child_nodes(node):
+ _fix(child, lineno, col_offset)
+
+ _fix(node, lineno, col_offset)
+ return node
+
+
+class AssertionRewriter(ast.NodeVisitor):
+ """Assertion rewriting implementation.
+
+ The main entrypoint is to call .run() with an ast.Module instance,
+ this will then find all the assert statements and rewrite them to
+ provide intermediate values and a detailed assertion error. See
+ http://pybites.blogspot.be/2011/07/behind-scenes-of-pytests-new-assertion.html
+ for an overview of how this works.
+
+ The entry point here is .run() which will iterate over all the
+ statements in an ast.Module and for each ast.Assert statement it
+ finds call .visit() with it. Then .visit_Assert() takes over and
+ is responsible for creating new ast statements to replace the
+ original assert statement: it rewrites the test of an assertion
+ to provide intermediate values and replace it with an if statement
+ which raises an assertion error with a detailed explanation in
+ case the expression is false.
+
+ For this .visit_Assert() uses the visitor pattern to visit all the
+ AST nodes of the ast.Assert.test field, each visit call returning
+ an AST node and the corresponding explanation string. During this
+ state is kept in several instance attributes:
+
+ :statements: All the AST statements which will replace the assert
+ statement.
+
+ :variables: This is populated by .variable() with each variable
+ used by the statements so that they can all be set to None at
+ the end of the statements.
+
+ :variable_counter: Counter to create new unique variables needed
+ by statements. Variables are created using .variable() and
+ have the form of "@py_assert0".
+
+ :on_failure: The AST statements which will be executed if the
+ assertion test fails. This is the code which will construct
+ the failure message and raises the AssertionError.
+
+ :explanation_specifiers: A dict filled by .explanation_param()
+ with %-formatting placeholders and their corresponding
+ expressions to use in the building of an assertion message.
+ This is used by .pop_format_context() to build a message.
+
+ :stack: A stack of the explanation_specifiers dicts maintained by
+ .push_format_context() and .pop_format_context() which allows
+ to build another %-formatted string while already building one.
+
+ This state is reset on every new assert statement visited and used
+ by the other visitors.
+
+ """
+
+ def __init__(self, module_path, config):
+ super(AssertionRewriter, self).__init__()
+ self.module_path = module_path
+ self.config = config
+
+ def run(self, mod):
+ """Find all assert statements in *mod* and rewrite them."""
+ if not mod.body:
+ # Nothing to do.
+ return
+ # Insert some special imports at the top of the module but after any
+ # docstrings and __future__ imports.
+ aliases = [
+ ast.alias(six.moves.builtins.__name__, "@py_builtins"),
+ ast.alias("_pytest.assertion.rewrite", "@pytest_ar"),
+ ]
+ doc = getattr(mod, "docstring", None)
+ expect_docstring = doc is None
+ if doc is not None and self.is_rewrite_disabled(doc):
+ return
+ pos = 0
+ lineno = 1
+ for item in mod.body:
+ if (
+ expect_docstring
+ and isinstance(item, ast.Expr)
+ and isinstance(item.value, ast.Str)
+ ):
+ doc = item.value.s
+ if self.is_rewrite_disabled(doc):
+ return
+ expect_docstring = False
+ elif (
+ not isinstance(item, ast.ImportFrom)
+ or item.level > 0
+ or item.module != "__future__"
+ ):
+ lineno = item.lineno
+ break
+ pos += 1
+ else:
+ lineno = item.lineno
+ imports = [
+ ast.Import([alias], lineno=lineno, col_offset=0) for alias in aliases
+ ]
+ mod.body[pos:pos] = imports
+ # Collect asserts.
+ nodes = [mod]
+ while nodes:
+ node = nodes.pop()
+ for name, field in ast.iter_fields(node):
+ if isinstance(field, list):
+ new = []
+ for i, child in enumerate(field):
+ if isinstance(child, ast.Assert):
+ # Transform assert.
+ new.extend(self.visit(child))
+ else:
+ new.append(child)
+ if isinstance(child, ast.AST):
+ nodes.append(child)
+ setattr(node, name, new)
+ elif (
+ isinstance(field, ast.AST)
+ # Don't recurse into expressions as they can't contain
+ # asserts.
+ and not isinstance(field, ast.expr)
+ ):
+ nodes.append(field)
+
+ @staticmethod
+ def is_rewrite_disabled(docstring):
+ return "PYTEST_DONT_REWRITE" in docstring
+
+ def variable(self):
+ """Get a new variable."""
+ # Use a character invalid in python identifiers to avoid clashing.
+ name = "@py_assert" + str(next(self.variable_counter))
+ self.variables.append(name)
+ return name
+
+ def assign(self, expr):
+ """Give *expr* a name."""
+ name = self.variable()
+ self.statements.append(ast.Assign([ast.Name(name, ast.Store())], expr))
+ return ast.Name(name, ast.Load())
+
+ def display(self, expr):
+ """Call saferepr on the expression."""
+ return self.helper("_saferepr", expr)
+
+ def helper(self, name, *args):
+ """Call a helper in this module."""
+ py_name = ast.Name("@pytest_ar", ast.Load())
+ attr = ast.Attribute(py_name, name, ast.Load())
+ return ast_Call(attr, list(args), [])
+
+ def builtin(self, name):
+ """Return the builtin called *name*."""
+ builtin_name = ast.Name("@py_builtins", ast.Load())
+ return ast.Attribute(builtin_name, name, ast.Load())
+
+ def explanation_param(self, expr):
+ """Return a new named %-formatting placeholder for expr.
+
+ This creates a %-formatting placeholder for expr in the
+ current formatting context, e.g. ``%(py0)s``. The placeholder
+ and expr are placed in the current format context so that it
+ can be used on the next call to .pop_format_context().
+
+ """
+ specifier = "py" + str(next(self.variable_counter))
+ self.explanation_specifiers[specifier] = expr
+ return "%(" + specifier + ")s"
+
+ def push_format_context(self):
+ """Create a new formatting context.
+
+ The format context is used for when an explanation wants to
+ have a variable value formatted in the assertion message. In
+ this case the value required can be added using
+ .explanation_param(). Finally .pop_format_context() is used
+ to format a string of %-formatted values as added by
+ .explanation_param().
+
+ """
+ self.explanation_specifiers = {}
+ self.stack.append(self.explanation_specifiers)
+
+ def pop_format_context(self, expl_expr):
+ """Format the %-formatted string with current format context.
+
+ The expl_expr should be an ast.Str instance constructed from
+ the %-placeholders created by .explanation_param(). This will
+ add the required code to format said string to .on_failure and
+ return the ast.Name instance of the formatted string.
+
+ """
+ current = self.stack.pop()
+ if self.stack:
+ self.explanation_specifiers = self.stack[-1]
+ keys = [ast.Str(key) for key in current.keys()]
+ format_dict = ast.Dict(keys, list(current.values()))
+ form = ast.BinOp(expl_expr, ast.Mod(), format_dict)
+ name = "@py_format" + str(next(self.variable_counter))
+ self.on_failure.append(ast.Assign([ast.Name(name, ast.Store())], form))
+ return ast.Name(name, ast.Load())
+
+ def generic_visit(self, node):
+ """Handle expressions we don't have custom code for."""
+ assert isinstance(node, ast.expr)
+ res = self.assign(node)
+ return res, self.explanation_param(self.display(res))
+
+ def visit_Assert(self, assert_):
+ """Return the AST statements to replace the ast.Assert instance.
+
+ This rewrites the test of an assertion to provide
+ intermediate values and replace it with an if statement which
+ raises an assertion error with a detailed explanation in case
+ the expression is false.
+
+ """
+ if isinstance(assert_.test, ast.Tuple) and len(assert_.test.elts) >= 1:
+ from _pytest.warning_types import PytestAssertRewriteWarning
+ import warnings
+
+ warnings.warn_explicit(
+ PytestAssertRewriteWarning(
+ "assertion is always true, perhaps remove parentheses?"
+ ),
+ category=None,
+ filename=str(self.module_path),
+ lineno=assert_.lineno,
+ )
+
+ self.statements = []
+ self.variables = []
+ self.variable_counter = itertools.count()
+ self.stack = []
+ self.on_failure = []
+ self.push_format_context()
+ # Rewrite assert into a bunch of statements.
+ top_condition, explanation = self.visit(assert_.test)
+ # If in a test module, check if directly asserting None, in order to warn [Issue #3191]
+ if self.module_path is not None:
+ self.statements.append(
+ self.warn_about_none_ast(
+ top_condition, module_path=self.module_path, lineno=assert_.lineno
+ )
+ )
+ # Create failure message.
+ body = self.on_failure
+ negation = ast.UnaryOp(ast.Not(), top_condition)
+ self.statements.append(ast.If(negation, body, []))
+ if assert_.msg:
+ assertmsg = self.helper("_format_assertmsg", assert_.msg)
+ explanation = "\n>assert " + explanation
+ else:
+ assertmsg = ast.Str("")
+ explanation = "assert " + explanation
+ template = ast.BinOp(assertmsg, ast.Add(), ast.Str(explanation))
+ msg = self.pop_format_context(template)
+ fmt = self.helper("_format_explanation", msg)
+ err_name = ast.Name("AssertionError", ast.Load())
+ exc = ast_Call(err_name, [fmt], [])
+ if sys.version_info[0] >= 3:
+ raise_ = ast.Raise(exc, None)
+ else:
+ raise_ = ast.Raise(exc, None, None)
+ body.append(raise_)
+ # Clear temporary variables by setting them to None.
+ if self.variables:
+ variables = [ast.Name(name, ast.Store()) for name in self.variables]
+ clear = ast.Assign(variables, _NameConstant(None))
+ self.statements.append(clear)
+ # Fix line numbers.
+ for stmt in self.statements:
+ set_location(stmt, assert_.lineno, assert_.col_offset)
+ return self.statements
+
+ def warn_about_none_ast(self, node, module_path, lineno):
+ """
+ Returns an AST issuing a warning if the value of node is `None`.
+ This is used to warn the user when asserting a function that asserts
+ internally already.
+ See issue #3191 for more details.
+ """
+
+ # Using parse because it is different between py2 and py3.
+ AST_NONE = ast.parse("None").body[0].value
+ val_is_none = ast.Compare(node, [ast.Is()], [AST_NONE])
+ send_warning = ast.parse(
+ """
+from _pytest.warning_types import PytestAssertRewriteWarning
+from warnings import warn_explicit
+warn_explicit(
+ PytestAssertRewriteWarning('asserting the value None, please use "assert is None"'),
+ category=None,
+ filename={filename!r},
+ lineno={lineno},
+)
+ """.format(
+ filename=module_path.strpath, lineno=lineno
+ )
+ ).body
+ return ast.If(val_is_none, send_warning, [])
+
+ def visit_Name(self, name):
+ # Display the repr of the name if it's a local variable or
+ # _should_repr_global_name() thinks it's acceptable.
+ locs = ast_Call(self.builtin("locals"), [], [])
+ inlocs = ast.Compare(ast.Str(name.id), [ast.In()], [locs])
+ dorepr = self.helper("_should_repr_global_name", name)
+ test = ast.BoolOp(ast.Or(), [inlocs, dorepr])
+ expr = ast.IfExp(test, self.display(name), ast.Str(name.id))
+ return name, self.explanation_param(expr)
+
+ def visit_BoolOp(self, boolop):
+ res_var = self.variable()
+ expl_list = self.assign(ast.List([], ast.Load()))
+ app = ast.Attribute(expl_list, "append", ast.Load())
+ is_or = int(isinstance(boolop.op, ast.Or))
+ body = save = self.statements
+ fail_save = self.on_failure
+ levels = len(boolop.values) - 1
+ self.push_format_context()
+ # Process each operand, short-circuting if needed.
+ for i, v in enumerate(boolop.values):
+ if i:
+ fail_inner = []
+ # cond is set in a prior loop iteration below
+ self.on_failure.append(ast.If(cond, fail_inner, [])) # noqa
+ self.on_failure = fail_inner
+ self.push_format_context()
+ res, expl = self.visit(v)
+ body.append(ast.Assign([ast.Name(res_var, ast.Store())], res))
+ expl_format = self.pop_format_context(ast.Str(expl))
+ call = ast_Call(app, [expl_format], [])
+ self.on_failure.append(ast.Expr(call))
+ if i < levels:
+ cond = res
+ if is_or:
+ cond = ast.UnaryOp(ast.Not(), cond)
+ inner = []
+ self.statements.append(ast.If(cond, inner, []))
+ self.statements = body = inner
+ self.statements = save
+ self.on_failure = fail_save
+ expl_template = self.helper("_format_boolop", expl_list, ast.Num(is_or))
+ expl = self.pop_format_context(expl_template)
+ return ast.Name(res_var, ast.Load()), self.explanation_param(expl)
+
+ def visit_UnaryOp(self, unary):
+ pattern = unary_map[unary.op.__class__]
+ operand_res, operand_expl = self.visit(unary.operand)
+ res = self.assign(ast.UnaryOp(unary.op, operand_res))
+ return res, pattern % (operand_expl,)
+
+ def visit_BinOp(self, binop):
+ symbol = binop_map[binop.op.__class__]
+ left_expr, left_expl = self.visit(binop.left)
+ right_expr, right_expl = self.visit(binop.right)
+ explanation = "(%s %s %s)" % (left_expl, symbol, right_expl)
+ res = self.assign(ast.BinOp(left_expr, binop.op, right_expr))
+ return res, explanation
+
+ def visit_Call_35(self, call):
+ """
+ visit `ast.Call` nodes on Python3.5 and after
+ """
+ new_func, func_expl = self.visit(call.func)
+ arg_expls = []
+ new_args = []
+ new_kwargs = []
+ for arg in call.args:
+ res, expl = self.visit(arg)
+ arg_expls.append(expl)
+ new_args.append(res)
+ for keyword in call.keywords:
+ res, expl = self.visit(keyword.value)
+ new_kwargs.append(ast.keyword(keyword.arg, res))
+ if keyword.arg:
+ arg_expls.append(keyword.arg + "=" + expl)
+ else: # **args have `arg` keywords with an .arg of None
+ arg_expls.append("**" + expl)
+
+ expl = "%s(%s)" % (func_expl, ", ".join(arg_expls))
+ new_call = ast.Call(new_func, new_args, new_kwargs)
+ res = self.assign(new_call)
+ res_expl = self.explanation_param(self.display(res))
+ outer_expl = "%s\n{%s = %s\n}" % (res_expl, res_expl, expl)
+ return res, outer_expl
+
+ def visit_Starred(self, starred):
+ # From Python 3.5, a Starred node can appear in a function call
+ res, expl = self.visit(starred.value)
+ new_starred = ast.Starred(res, starred.ctx)
+ return new_starred, "*" + expl
+
+ def visit_Call_legacy(self, call):
+ """
+ visit `ast.Call nodes on 3.4 and below`
+ """
+ new_func, func_expl = self.visit(call.func)
+ arg_expls = []
+ new_args = []
+ new_kwargs = []
+ new_star = new_kwarg = None
+ for arg in call.args:
+ res, expl = self.visit(arg)
+ new_args.append(res)
+ arg_expls.append(expl)
+ for keyword in call.keywords:
+ res, expl = self.visit(keyword.value)
+ new_kwargs.append(ast.keyword(keyword.arg, res))
+ arg_expls.append(keyword.arg + "=" + expl)
+ if call.starargs:
+ new_star, expl = self.visit(call.starargs)
+ arg_expls.append("*" + expl)
+ if call.kwargs:
+ new_kwarg, expl = self.visit(call.kwargs)
+ arg_expls.append("**" + expl)
+ expl = "%s(%s)" % (func_expl, ", ".join(arg_expls))
+ new_call = ast.Call(new_func, new_args, new_kwargs, new_star, new_kwarg)
+ res = self.assign(new_call)
+ res_expl = self.explanation_param(self.display(res))
+ outer_expl = "%s\n{%s = %s\n}" % (res_expl, res_expl, expl)
+ return res, outer_expl
+
+ # ast.Call signature changed on 3.5,
+ # conditionally change which methods is named
+ # visit_Call depending on Python version
+ if sys.version_info >= (3, 5):
+ visit_Call = visit_Call_35
+ else:
+ visit_Call = visit_Call_legacy
+
+ def visit_Attribute(self, attr):
+ if not isinstance(attr.ctx, ast.Load):
+ return self.generic_visit(attr)
+ value, value_expl = self.visit(attr.value)
+ res = self.assign(ast.Attribute(value, attr.attr, ast.Load()))
+ res_expl = self.explanation_param(self.display(res))
+ pat = "%s\n{%s = %s.%s\n}"
+ expl = pat % (res_expl, res_expl, value_expl, attr.attr)
+ return res, expl
+
+ def visit_Compare(self, comp):
+ self.push_format_context()
+ left_res, left_expl = self.visit(comp.left)
+ if isinstance(comp.left, (ast.Compare, ast.BoolOp)):
+ left_expl = "({})".format(left_expl)
+ res_variables = [self.variable() for i in range(len(comp.ops))]
+ load_names = [ast.Name(v, ast.Load()) for v in res_variables]
+ store_names = [ast.Name(v, ast.Store()) for v in res_variables]
+ it = zip(range(len(comp.ops)), comp.ops, comp.comparators)
+ expls = []
+ syms = []
+ results = [left_res]
+ for i, op, next_operand in it:
+ next_res, next_expl = self.visit(next_operand)
+ if isinstance(next_operand, (ast.Compare, ast.BoolOp)):
+ next_expl = "({})".format(next_expl)
+ results.append(next_res)
+ sym = binop_map[op.__class__]
+ syms.append(ast.Str(sym))
+ expl = "%s %s %s" % (left_expl, sym, next_expl)
+ expls.append(ast.Str(expl))
+ res_expr = ast.Compare(left_res, [op], [next_res])
+ self.statements.append(ast.Assign([store_names[i]], res_expr))
+ left_res, left_expl = next_res, next_expl
+ # Use pytest.assertion.util._reprcompare if that's available.
+ expl_call = self.helper(
+ "_call_reprcompare",
+ ast.Tuple(syms, ast.Load()),
+ ast.Tuple(load_names, ast.Load()),
+ ast.Tuple(expls, ast.Load()),
+ ast.Tuple(results, ast.Load()),
+ )
+ if len(comp.ops) > 1:
+ res = ast.BoolOp(ast.And(), load_names)
+ else:
+ res = load_names[0]
+ return res, self.explanation_param(self.pop_format_context(expl_call))
diff --git a/contrib/python/pytest/py2/_pytest/assertion/truncate.py b/contrib/python/pytest/py2/_pytest/assertion/truncate.py
new file mode 100644
index 00000000000..525896ea9ad
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/assertion/truncate.py
@@ -0,0 +1,102 @@
+# -*- coding: utf-8 -*-
+"""
+Utilities for truncating assertion output.
+
+Current default behaviour is to truncate assertion explanations at
+~8 terminal lines, unless running in "-vv" mode or running on CI.
+"""
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import os
+
+import six
+
+DEFAULT_MAX_LINES = 8
+DEFAULT_MAX_CHARS = 8 * 80
+USAGE_MSG = "use '-vv' to show"
+
+
+def truncate_if_required(explanation, item, max_length=None):
+ """
+ Truncate this assertion explanation if the given test item is eligible.
+ """
+ if _should_truncate_item(item):
+ return _truncate_explanation(explanation)
+ return explanation
+
+
+def _should_truncate_item(item):
+ """
+ Whether or not this test item is eligible for truncation.
+ """
+ verbose = item.config.option.verbose
+ return verbose < 2 and not _running_on_ci()
+
+
+def _running_on_ci():
+ """Check if we're currently running on a CI system."""
+ env_vars = ["CI", "BUILD_NUMBER"]
+ return any(var in os.environ for var in env_vars)
+
+
+def _truncate_explanation(input_lines, max_lines=None, max_chars=None):
+ """
+ Truncate given list of strings that makes up the assertion explanation.
+
+ Truncates to either 8 lines, or 640 characters - whichever the input reaches
+ first. The remaining lines will be replaced by a usage message.
+ """
+
+ if max_lines is None:
+ max_lines = DEFAULT_MAX_LINES
+ if max_chars is None:
+ max_chars = DEFAULT_MAX_CHARS
+
+ # Check if truncation required
+ input_char_count = len("".join(input_lines))
+ if len(input_lines) <= max_lines and input_char_count <= max_chars:
+ return input_lines
+
+ # Truncate first to max_lines, and then truncate to max_chars if max_chars
+ # is exceeded.
+ truncated_explanation = input_lines[:max_lines]
+ truncated_explanation = _truncate_by_char_count(truncated_explanation, max_chars)
+
+ # Add ellipsis to final line
+ truncated_explanation[-1] = truncated_explanation[-1] + "..."
+
+ # Append useful message to explanation
+ truncated_line_count = len(input_lines) - len(truncated_explanation)
+ truncated_line_count += 1 # Account for the part-truncated final line
+ msg = "...Full output truncated"
+ if truncated_line_count == 1:
+ msg += " ({} line hidden)".format(truncated_line_count)
+ else:
+ msg += " ({} lines hidden)".format(truncated_line_count)
+ msg += ", {}".format(USAGE_MSG)
+ truncated_explanation.extend([six.text_type(""), six.text_type(msg)])
+ return truncated_explanation
+
+
+def _truncate_by_char_count(input_lines, max_chars):
+ # Check if truncation required
+ if len("".join(input_lines)) <= max_chars:
+ return input_lines
+
+ # Find point at which input length exceeds total allowed length
+ iterated_char_count = 0
+ for iterated_index, input_line in enumerate(input_lines):
+ if iterated_char_count + len(input_line) > max_chars:
+ break
+ iterated_char_count += len(input_line)
+
+ # Create truncated explanation with modified final line
+ truncated_result = input_lines[:iterated_index]
+ final_line = input_lines[iterated_index]
+ if final_line:
+ final_line_truncate_point = max_chars - iterated_char_count
+ final_line = final_line[:final_line_truncate_point]
+ truncated_result.append(final_line)
+ return truncated_result
diff --git a/contrib/python/pytest/py2/_pytest/assertion/util.py b/contrib/python/pytest/py2/_pytest/assertion/util.py
new file mode 100644
index 00000000000..c382f1c6091
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/assertion/util.py
@@ -0,0 +1,421 @@
+# -*- coding: utf-8 -*-
+"""Utilities for assertion debugging"""
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import pprint
+
+import six
+
+import _pytest._code
+from ..compat import Sequence
+from _pytest import outcomes
+from _pytest._io.saferepr import saferepr
+from _pytest.compat import ATTRS_EQ_FIELD
+
+# The _reprcompare attribute on the util module is used by the new assertion
+# interpretation code and assertion rewriter to detect this plugin was
+# loaded and in turn call the hooks defined here as part of the
+# DebugInterpreter.
+_reprcompare = None
+
+
+# the re-encoding is needed for python2 repr
+# with non-ascii characters (see issue 877 and 1379)
+def ecu(s):
+ if isinstance(s, bytes):
+ return s.decode("UTF-8", "replace")
+ else:
+ return s
+
+
+def format_explanation(explanation):
+ """This formats an explanation
+
+ Normally all embedded newlines are escaped, however there are
+ three exceptions: \n{, \n} and \n~. The first two are intended
+ cover nested explanations, see function and attribute explanations
+ for examples (.visit_Call(), visit_Attribute()). The last one is
+ for when one explanation needs to span multiple lines, e.g. when
+ displaying diffs.
+ """
+ explanation = ecu(explanation)
+ lines = _split_explanation(explanation)
+ result = _format_lines(lines)
+ return u"\n".join(result)
+
+
+def _split_explanation(explanation):
+ """Return a list of individual lines in the explanation
+
+ This will return a list of lines split on '\n{', '\n}' and '\n~'.
+ Any other newlines will be escaped and appear in the line as the
+ literal '\n' characters.
+ """
+ raw_lines = (explanation or u"").split("\n")
+ lines = [raw_lines[0]]
+ for values in raw_lines[1:]:
+ if values and values[0] in ["{", "}", "~", ">"]:
+ lines.append(values)
+ else:
+ lines[-1] += "\\n" + values
+ return lines
+
+
+def _format_lines(lines):
+ """Format the individual lines
+
+ This will replace the '{', '}' and '~' characters of our mini
+ formatting language with the proper 'where ...', 'and ...' and ' +
+ ...' text, taking care of indentation along the way.
+
+ Return a list of formatted lines.
+ """
+ result = lines[:1]
+ stack = [0]
+ stackcnt = [0]
+ for line in lines[1:]:
+ if line.startswith("{"):
+ if stackcnt[-1]:
+ s = u"and "
+ else:
+ s = u"where "
+ stack.append(len(result))
+ stackcnt[-1] += 1
+ stackcnt.append(0)
+ result.append(u" +" + u" " * (len(stack) - 1) + s + line[1:])
+ elif line.startswith("}"):
+ stack.pop()
+ stackcnt.pop()
+ result[stack[-1]] += line[1:]
+ else:
+ assert line[0] in ["~", ">"]
+ stack[-1] += 1
+ indent = len(stack) if line.startswith("~") else len(stack) - 1
+ result.append(u" " * indent + line[1:])
+ assert len(stack) == 1
+ return result
+
+
+# Provide basestring in python3
+try:
+ basestring = basestring
+except NameError:
+ basestring = str
+
+
+def issequence(x):
+ return isinstance(x, Sequence) and not isinstance(x, basestring)
+
+
+def istext(x):
+ return isinstance(x, basestring)
+
+
+def isdict(x):
+ return isinstance(x, dict)
+
+
+def isset(x):
+ return isinstance(x, (set, frozenset))
+
+
+def isdatacls(obj):
+ return getattr(obj, "__dataclass_fields__", None) is not None
+
+
+def isattrs(obj):
+ return getattr(obj, "__attrs_attrs__", None) is not None
+
+
+def isiterable(obj):
+ try:
+ iter(obj)
+ return not istext(obj)
+ except TypeError:
+ return False
+
+
+def assertrepr_compare(config, op, left, right):
+ """Return specialised explanations for some operators/operands"""
+ width = 80 - 15 - len(op) - 2 # 15 chars indentation, 1 space around op
+ left_repr = saferepr(left, maxsize=int(width // 2))
+ right_repr = saferepr(right, maxsize=width - len(left_repr))
+
+ summary = u"%s %s %s" % (ecu(left_repr), op, ecu(right_repr))
+
+ verbose = config.getoption("verbose")
+ explanation = None
+ try:
+ if op == "==":
+ if istext(left) and istext(right):
+ explanation = _diff_text(left, right, verbose)
+ else:
+ if issequence(left) and issequence(right):
+ explanation = _compare_eq_sequence(left, right, verbose)
+ elif isset(left) and isset(right):
+ explanation = _compare_eq_set(left, right, verbose)
+ elif isdict(left) and isdict(right):
+ explanation = _compare_eq_dict(left, right, verbose)
+ elif type(left) == type(right) and (isdatacls(left) or isattrs(left)):
+ type_fn = (isdatacls, isattrs)
+ explanation = _compare_eq_cls(left, right, verbose, type_fn)
+ elif verbose > 0:
+ explanation = _compare_eq_verbose(left, right)
+ if isiterable(left) and isiterable(right):
+ expl = _compare_eq_iterable(left, right, verbose)
+ if explanation is not None:
+ explanation.extend(expl)
+ else:
+ explanation = expl
+ elif op == "not in":
+ if istext(left) and istext(right):
+ explanation = _notin_text(left, right, verbose)
+ except outcomes.Exit:
+ raise
+ except Exception:
+ explanation = [
+ u"(pytest_assertion plugin: representation of details failed. "
+ u"Probably an object has a faulty __repr__.)",
+ six.text_type(_pytest._code.ExceptionInfo.from_current()),
+ ]
+
+ if not explanation:
+ return None
+
+ return [summary] + explanation
+
+
+def _diff_text(left, right, verbose=0):
+ """Return the explanation for the diff between text or bytes.
+
+ Unless --verbose is used this will skip leading and trailing
+ characters which are identical to keep the diff minimal.
+
+ If the input are bytes they will be safely converted to text.
+ """
+ from difflib import ndiff
+
+ explanation = []
+
+ def escape_for_readable_diff(binary_text):
+ """
+ Ensures that the internal string is always valid unicode, converting any bytes safely to valid unicode.
+ This is done using repr() which then needs post-processing to fix the encompassing quotes and un-escape
+ newlines and carriage returns (#429).
+ """
+ r = six.text_type(repr(binary_text)[1:-1])
+ r = r.replace(r"\n", "\n")
+ r = r.replace(r"\r", "\r")
+ return r
+
+ if isinstance(left, bytes):
+ left = escape_for_readable_diff(left)
+ if isinstance(right, bytes):
+ right = escape_for_readable_diff(right)
+ if verbose < 1:
+ i = 0 # just in case left or right has zero length
+ for i in range(min(len(left), len(right))):
+ if left[i] != right[i]:
+ break
+ if i > 42:
+ i -= 10 # Provide some context
+ explanation = [
+ u"Skipping %s identical leading characters in diff, use -v to show" % i
+ ]
+ left = left[i:]
+ right = right[i:]
+ if len(left) == len(right):
+ for i in range(len(left)):
+ if left[-i] != right[-i]:
+ break
+ if i > 42:
+ i -= 10 # Provide some context
+ explanation += [
+ u"Skipping {} identical trailing "
+ u"characters in diff, use -v to show".format(i)
+ ]
+ left = left[:-i]
+ right = right[:-i]
+ keepends = True
+ if left.isspace() or right.isspace():
+ left = repr(str(left))
+ right = repr(str(right))
+ explanation += [u"Strings contain only whitespace, escaping them using repr()"]
+ explanation += [
+ line.strip("\n")
+ for line in ndiff(left.splitlines(keepends), right.splitlines(keepends))
+ ]
+ return explanation
+
+
+def _compare_eq_verbose(left, right):
+ keepends = True
+ left_lines = repr(left).splitlines(keepends)
+ right_lines = repr(right).splitlines(keepends)
+
+ explanation = []
+ explanation += [u"-" + line for line in left_lines]
+ explanation += [u"+" + line for line in right_lines]
+
+ return explanation
+
+
+def _compare_eq_iterable(left, right, verbose=0):
+ if not verbose:
+ return [u"Use -v to get the full diff"]
+ # dynamic import to speedup pytest
+ import difflib
+
+ try:
+ left_formatting = pprint.pformat(left).splitlines()
+ right_formatting = pprint.pformat(right).splitlines()
+ explanation = [u"Full diff:"]
+ except Exception:
+ # hack: PrettyPrinter.pformat() in python 2 fails when formatting items that can't be sorted(), ie, calling
+ # sorted() on a list would raise. See issue #718.
+ # As a workaround, the full diff is generated by using the repr() string of each item of each container.
+ left_formatting = sorted(repr(x) for x in left)
+ right_formatting = sorted(repr(x) for x in right)
+ explanation = [u"Full diff (fallback to calling repr on each item):"]
+ explanation.extend(
+ line.strip() for line in difflib.ndiff(left_formatting, right_formatting)
+ )
+ return explanation
+
+
+def _compare_eq_sequence(left, right, verbose=0):
+ explanation = []
+ len_left = len(left)
+ len_right = len(right)
+ for i in range(min(len_left, len_right)):
+ if left[i] != right[i]:
+ explanation += [u"At index %s diff: %r != %r" % (i, left[i], right[i])]
+ break
+ len_diff = len_left - len_right
+
+ if len_diff:
+ if len_diff > 0:
+ dir_with_more = "Left"
+ extra = saferepr(left[len_right])
+ else:
+ len_diff = 0 - len_diff
+ dir_with_more = "Right"
+ extra = saferepr(right[len_left])
+
+ if len_diff == 1:
+ explanation += [u"%s contains one more item: %s" % (dir_with_more, extra)]
+ else:
+ explanation += [
+ u"%s contains %d more items, first extra item: %s"
+ % (dir_with_more, len_diff, extra)
+ ]
+ return explanation
+
+
+def _compare_eq_set(left, right, verbose=0):
+ explanation = []
+ diff_left = left - right
+ diff_right = right - left
+ if diff_left:
+ explanation.append(u"Extra items in the left set:")
+ for item in diff_left:
+ explanation.append(saferepr(item))
+ if diff_right:
+ explanation.append(u"Extra items in the right set:")
+ for item in diff_right:
+ explanation.append(saferepr(item))
+ return explanation
+
+
+def _compare_eq_dict(left, right, verbose=0):
+ explanation = []
+ set_left = set(left)
+ set_right = set(right)
+ common = set_left.intersection(set_right)
+ same = {k: left[k] for k in common if left[k] == right[k]}
+ if same and verbose < 2:
+ explanation += [u"Omitting %s identical items, use -vv to show" % len(same)]
+ elif same:
+ explanation += [u"Common items:"]
+ explanation += pprint.pformat(same).splitlines()
+ diff = {k for k in common if left[k] != right[k]}
+ if diff:
+ explanation += [u"Differing items:"]
+ for k in diff:
+ explanation += [saferepr({k: left[k]}) + " != " + saferepr({k: right[k]})]
+ extra_left = set_left - set_right
+ len_extra_left = len(extra_left)
+ if len_extra_left:
+ explanation.append(
+ u"Left contains %d more item%s:"
+ % (len_extra_left, "" if len_extra_left == 1 else "s")
+ )
+ explanation.extend(
+ pprint.pformat({k: left[k] for k in extra_left}).splitlines()
+ )
+ extra_right = set_right - set_left
+ len_extra_right = len(extra_right)
+ if len_extra_right:
+ explanation.append(
+ u"Right contains %d more item%s:"
+ % (len_extra_right, "" if len_extra_right == 1 else "s")
+ )
+ explanation.extend(
+ pprint.pformat({k: right[k] for k in extra_right}).splitlines()
+ )
+ return explanation
+
+
+def _compare_eq_cls(left, right, verbose, type_fns):
+ isdatacls, isattrs = type_fns
+ if isdatacls(left):
+ all_fields = left.__dataclass_fields__
+ fields_to_check = [field for field, info in all_fields.items() if info.compare]
+ elif isattrs(left):
+ all_fields = left.__attrs_attrs__
+ fields_to_check = [
+ field.name for field in all_fields if getattr(field, ATTRS_EQ_FIELD)
+ ]
+
+ same = []
+ diff = []
+ for field in fields_to_check:
+ if getattr(left, field) == getattr(right, field):
+ same.append(field)
+ else:
+ diff.append(field)
+
+ explanation = []
+ if same and verbose < 2:
+ explanation.append(u"Omitting %s identical items, use -vv to show" % len(same))
+ elif same:
+ explanation += [u"Matching attributes:"]
+ explanation += pprint.pformat(same).splitlines()
+ if diff:
+ explanation += [u"Differing attributes:"]
+ for field in diff:
+ explanation += [
+ (u"%s: %r != %r") % (field, getattr(left, field), getattr(right, field))
+ ]
+ return explanation
+
+
+def _notin_text(term, text, verbose=0):
+ index = text.find(term)
+ head = text[:index]
+ tail = text[index + len(term) :]
+ correct_text = head + tail
+ diff = _diff_text(correct_text, text, verbose)
+ newdiff = [u"%s is contained here:" % saferepr(term, maxsize=42)]
+ for line in diff:
+ if line.startswith(u"Skipping"):
+ continue
+ if line.startswith(u"- "):
+ continue
+ if line.startswith(u"+ "):
+ newdiff.append(u" " + line[2:])
+ else:
+ newdiff.append(line)
+ return newdiff
diff --git a/contrib/python/pytest/py2/_pytest/cacheprovider.py b/contrib/python/pytest/py2/_pytest/cacheprovider.py
new file mode 100644
index 00000000000..f5c55454849
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/cacheprovider.py
@@ -0,0 +1,438 @@
+# -*- coding: utf-8 -*-
+"""
+merged implementation of the cache provider
+
+the name cache was not chosen to ensure pluggy automatically
+ignores the external pytest-cache
+"""
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import json
+import os
+from collections import OrderedDict
+
+import attr
+import py
+import six
+
+import pytest
+from .compat import _PY2 as PY2
+from .pathlib import Path
+from .pathlib import resolve_from_str
+from .pathlib import rm_rf
+
+README_CONTENT = u"""\
+# pytest cache directory #
+
+This directory contains data from the pytest's cache plugin,
+which provides the `--lf` and `--ff` options, as well as the `cache` fixture.
+
+**Do not** commit this to version control.
+
+See [the docs](https://docs.pytest.org/en/latest/cache.html) for more information.
+"""
+
+CACHEDIR_TAG_CONTENT = b"""\
+Signature: 8a477f597d28d172789f06886806bc55
+# This file is a cache directory tag created by pytest.
+# For information about cache directory tags, see:
+# http://www.bford.info/cachedir/spec.html
+"""
+
+
+@attr.s
+class Cache(object):
+ _cachedir = attr.ib(repr=False)
+ _config = attr.ib(repr=False)
+
+ @classmethod
+ def for_config(cls, config):
+ cachedir = cls.cache_dir_from_config(config)
+ if config.getoption("cacheclear") and cachedir.exists():
+ rm_rf(cachedir)
+ cachedir.mkdir()
+ return cls(cachedir, config)
+
+ @staticmethod
+ def cache_dir_from_config(config):
+ return resolve_from_str(config.getini("cache_dir"), config.rootdir)
+
+ def warn(self, fmt, **args):
+ from _pytest.warnings import _issue_warning_captured
+ from _pytest.warning_types import PytestCacheWarning
+
+ _issue_warning_captured(
+ PytestCacheWarning(fmt.format(**args) if args else fmt),
+ self._config.hook,
+ stacklevel=3,
+ )
+
+ def makedir(self, name):
+ """ return a directory path object with the given name. If the
+ directory does not yet exist, it will be created. You can use it
+ to manage files likes e. g. store/retrieve database
+ dumps across test sessions.
+
+ :param name: must be a string not containing a ``/`` separator.
+ Make sure the name contains your plugin or application
+ identifiers to prevent clashes with other cache users.
+ """
+ name = Path(name)
+ if len(name.parts) > 1:
+ raise ValueError("name is not allowed to contain path separators")
+ res = self._cachedir.joinpath("d", name)
+ res.mkdir(exist_ok=True, parents=True)
+ return py.path.local(res)
+
+ def _getvaluepath(self, key):
+ return self._cachedir.joinpath("v", Path(key))
+
+ def get(self, key, default):
+ """ return cached value for the given key. If no value
+ was yet cached or the value cannot be read, the specified
+ default is returned.
+
+ :param key: must be a ``/`` separated value. Usually the first
+ name is the name of your plugin or your application.
+ :param default: must be provided in case of a cache-miss or
+ invalid cache values.
+
+ """
+ path = self._getvaluepath(key)
+ try:
+ with path.open("r") as f:
+ return json.load(f)
+ except (ValueError, IOError, OSError):
+ return default
+
+ def set(self, key, value):
+ """ save value for the given key.
+
+ :param key: must be a ``/`` separated value. Usually the first
+ name is the name of your plugin or your application.
+ :param value: must be of any combination of basic
+ python types, including nested types
+ like e. g. lists of dictionaries.
+ """
+ path = self._getvaluepath(key)
+ try:
+ if path.parent.is_dir():
+ cache_dir_exists_already = True
+ else:
+ cache_dir_exists_already = self._cachedir.exists()
+ path.parent.mkdir(exist_ok=True, parents=True)
+ except (IOError, OSError):
+ self.warn("could not create cache path {path}", path=path)
+ return
+ if not cache_dir_exists_already:
+ self._ensure_supporting_files()
+ try:
+ f = path.open("wb" if PY2 else "w")
+ except (IOError, OSError):
+ self.warn("cache could not write path {path}", path=path)
+ else:
+ with f:
+ json.dump(value, f, indent=2, sort_keys=True)
+
+ def _ensure_supporting_files(self):
+ """Create supporting files in the cache dir that are not really part of the cache."""
+ readme_path = self._cachedir / "README.md"
+ readme_path.write_text(README_CONTENT)
+
+ gitignore_path = self._cachedir.joinpath(".gitignore")
+ msg = u"# Created by pytest automatically.\n*"
+ gitignore_path.write_text(msg, encoding="UTF-8")
+
+ cachedir_tag_path = self._cachedir.joinpath("CACHEDIR.TAG")
+ cachedir_tag_path.write_bytes(CACHEDIR_TAG_CONTENT)
+
+
+class LFPlugin(object):
+ """ Plugin which implements the --lf (run last-failing) option """
+
+ def __init__(self, config):
+ self.config = config
+ active_keys = "lf", "failedfirst"
+ self.active = any(config.getoption(key) for key in active_keys)
+ self.lastfailed = config.cache.get("cache/lastfailed", {})
+ self._previously_failed_count = None
+ self._report_status = None
+ self._skipped_files = 0 # count skipped files during collection due to --lf
+
+ def last_failed_paths(self):
+ """Returns a set with all Paths()s of the previously failed nodeids (cached).
+ """
+ try:
+ return self._last_failed_paths
+ except AttributeError:
+ rootpath = Path(self.config.rootdir)
+ result = {rootpath / nodeid.split("::")[0] for nodeid in self.lastfailed}
+ result = {x for x in result if x.exists()}
+ self._last_failed_paths = result
+ return result
+
+ def pytest_ignore_collect(self, path):
+ """
+ Ignore this file path if we are in --lf mode and it is not in the list of
+ previously failed files.
+ """
+ if self.active and self.config.getoption("lf") and path.isfile():
+ last_failed_paths = self.last_failed_paths()
+ if last_failed_paths:
+ skip_it = Path(path) not in self.last_failed_paths()
+ if skip_it:
+ self._skipped_files += 1
+ return skip_it
+
+ def pytest_report_collectionfinish(self):
+ if self.active and self.config.getoption("verbose") >= 0:
+ return "run-last-failure: %s" % self._report_status
+
+ def pytest_runtest_logreport(self, report):
+ if (report.when == "call" and report.passed) or report.skipped:
+ self.lastfailed.pop(report.nodeid, None)
+ elif report.failed:
+ self.lastfailed[report.nodeid] = True
+
+ def pytest_collectreport(self, report):
+ passed = report.outcome in ("passed", "skipped")
+ if passed:
+ if report.nodeid in self.lastfailed:
+ self.lastfailed.pop(report.nodeid)
+ self.lastfailed.update((item.nodeid, True) for item in report.result)
+ else:
+ self.lastfailed[report.nodeid] = True
+
+ def pytest_collection_modifyitems(self, session, config, items):
+ if not self.active:
+ return
+
+ if self.lastfailed:
+ previously_failed = []
+ previously_passed = []
+ for item in items:
+ if item.nodeid in self.lastfailed:
+ previously_failed.append(item)
+ else:
+ previously_passed.append(item)
+ self._previously_failed_count = len(previously_failed)
+
+ if not previously_failed:
+ # Running a subset of all tests with recorded failures
+ # only outside of it.
+ self._report_status = "%d known failures not in selected tests" % (
+ len(self.lastfailed),
+ )
+ else:
+ if self.config.getoption("lf"):
+ items[:] = previously_failed
+ config.hook.pytest_deselected(items=previously_passed)
+ else: # --failedfirst
+ items[:] = previously_failed + previously_passed
+
+ noun = "failure" if self._previously_failed_count == 1 else "failures"
+ suffix = " first" if self.config.getoption("failedfirst") else ""
+ self._report_status = "rerun previous {count} {noun}{suffix}".format(
+ count=self._previously_failed_count, suffix=suffix, noun=noun
+ )
+
+ if self._skipped_files > 0:
+ files_noun = "file" if self._skipped_files == 1 else "files"
+ self._report_status += " (skipped {files} {files_noun})".format(
+ files=self._skipped_files, files_noun=files_noun
+ )
+ else:
+ self._report_status = "no previously failed tests, "
+ if self.config.getoption("last_failed_no_failures") == "none":
+ self._report_status += "deselecting all items."
+ config.hook.pytest_deselected(items=items)
+ items[:] = []
+ else:
+ self._report_status += "not deselecting items."
+
+ def pytest_sessionfinish(self, session):
+ config = self.config
+ if config.getoption("cacheshow") or hasattr(config, "slaveinput"):
+ return
+
+ saved_lastfailed = config.cache.get("cache/lastfailed", {})
+ if saved_lastfailed != self.lastfailed:
+ config.cache.set("cache/lastfailed", self.lastfailed)
+
+
+class NFPlugin(object):
+ """ Plugin which implements the --nf (run new-first) option """
+
+ def __init__(self, config):
+ self.config = config
+ self.active = config.option.newfirst
+ self.cached_nodeids = config.cache.get("cache/nodeids", [])
+
+ def pytest_collection_modifyitems(self, session, config, items):
+ if self.active:
+ new_items = OrderedDict()
+ other_items = OrderedDict()
+ for item in items:
+ if item.nodeid not in self.cached_nodeids:
+ new_items[item.nodeid] = item
+ else:
+ other_items[item.nodeid] = item
+
+ items[:] = self._get_increasing_order(
+ six.itervalues(new_items)
+ ) + self._get_increasing_order(six.itervalues(other_items))
+ self.cached_nodeids = [x.nodeid for x in items if isinstance(x, pytest.Item)]
+
+ def _get_increasing_order(self, items):
+ return sorted(items, key=lambda item: item.fspath.mtime(), reverse=True)
+
+ def pytest_sessionfinish(self, session):
+ config = self.config
+ if config.getoption("cacheshow") or hasattr(config, "slaveinput"):
+ return
+
+ config.cache.set("cache/nodeids", self.cached_nodeids)
+
+
+def pytest_addoption(parser):
+ group = parser.getgroup("general")
+ group.addoption(
+ "--lf",
+ "--last-failed",
+ action="store_true",
+ dest="lf",
+ help="rerun only the tests that failed "
+ "at the last run (or all if none failed)",
+ )
+ group.addoption(
+ "--ff",
+ "--failed-first",
+ action="store_true",
+ dest="failedfirst",
+ help="run all tests but run the last failures first. "
+ "This may re-order tests and thus lead to "
+ "repeated fixture setup/teardown",
+ )
+ group.addoption(
+ "--nf",
+ "--new-first",
+ action="store_true",
+ dest="newfirst",
+ help="run tests from new files first, then the rest of the tests "
+ "sorted by file mtime",
+ )
+ group.addoption(
+ "--cache-show",
+ action="append",
+ nargs="?",
+ dest="cacheshow",
+ help=(
+ "show cache contents, don't perform collection or tests. "
+ "Optional argument: glob (default: '*')."
+ ),
+ )
+ group.addoption(
+ "--cache-clear",
+ action="store_true",
+ dest="cacheclear",
+ help="remove all cache contents at start of test run.",
+ )
+ cache_dir_default = ".pytest_cache"
+ if "TOX_ENV_DIR" in os.environ:
+ cache_dir_default = os.path.join(os.environ["TOX_ENV_DIR"], cache_dir_default)
+ parser.addini("cache_dir", default=cache_dir_default, help="cache directory path.")
+ group.addoption(
+ "--lfnf",
+ "--last-failed-no-failures",
+ action="store",
+ dest="last_failed_no_failures",
+ choices=("all", "none"),
+ default="all",
+ help="which tests to run with no previously (known) failures.",
+ )
+
+
+def pytest_cmdline_main(config):
+ if config.option.cacheshow:
+ from _pytest.main import wrap_session
+
+ return wrap_session(config, cacheshow)
+
+
+@pytest.hookimpl(tryfirst=True)
+def pytest_configure(config):
+ config.cache = Cache.for_config(config)
+ config.pluginmanager.register(LFPlugin(config), "lfplugin")
+ config.pluginmanager.register(NFPlugin(config), "nfplugin")
+
+
+@pytest.fixture
+def cache(request):
+ """
+ Return a cache object that can persist state between testing sessions.
+
+ cache.get(key, default)
+ cache.set(key, value)
+
+ Keys must be a ``/`` separated value, where the first part is usually the
+ name of your plugin or application to avoid clashes with other cache users.
+
+ Values can be any object handled by the json stdlib module.
+ """
+ return request.config.cache
+
+
+def pytest_report_header(config):
+ """Display cachedir with --cache-show and if non-default."""
+ if config.option.verbose > 0 or config.getini("cache_dir") != ".pytest_cache":
+ cachedir = config.cache._cachedir
+ # TODO: evaluate generating upward relative paths
+ # starting with .., ../.. if sensible
+
+ try:
+ displaypath = cachedir.relative_to(config.rootdir)
+ except ValueError:
+ displaypath = cachedir
+ return "cachedir: {}".format(displaypath)
+
+
+def cacheshow(config, session):
+ from pprint import pformat
+
+ tw = py.io.TerminalWriter()
+ tw.line("cachedir: " + str(config.cache._cachedir))
+ if not config.cache._cachedir.is_dir():
+ tw.line("cache is empty")
+ return 0
+
+ glob = config.option.cacheshow[0]
+ if glob is None:
+ glob = "*"
+
+ dummy = object()
+ basedir = config.cache._cachedir
+ vdir = basedir / "v"
+ tw.sep("-", "cache values for %r" % glob)
+ for valpath in sorted(x for x in vdir.rglob(glob) if x.is_file()):
+ key = valpath.relative_to(vdir)
+ val = config.cache.get(key, dummy)
+ if val is dummy:
+ tw.line("%s contains unreadable content, will be ignored" % key)
+ else:
+ tw.line("%s contains:" % key)
+ for line in pformat(val).splitlines():
+ tw.line(" " + line)
+
+ ddir = basedir / "d"
+ if ddir.is_dir():
+ contents = sorted(ddir.rglob(glob))
+ tw.sep("-", "cache directories for %r" % glob)
+ for p in contents:
+ # if p.check(dir=1):
+ # print("%s/" % p.relto(basedir))
+ if p.is_file():
+ key = p.relative_to(basedir)
+ tw.line("{} is a file of length {:d}".format(key, p.stat().st_size))
+ return 0
diff --git a/contrib/python/pytest/py2/_pytest/capture.py b/contrib/python/pytest/py2/_pytest/capture.py
new file mode 100644
index 00000000000..68c17772f39
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/capture.py
@@ -0,0 +1,850 @@
+# -*- coding: utf-8 -*-
+"""
+per-test stdout/stderr capturing mechanism.
+
+"""
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import collections
+import contextlib
+import io
+import os
+import sys
+from io import UnsupportedOperation
+from tempfile import TemporaryFile
+
+import six
+
+import pytest
+from _pytest.compat import _PY3
+from _pytest.compat import CaptureIO
+
+patchsysdict = {0: "stdin", 1: "stdout", 2: "stderr"}
+
+
+def pytest_addoption(parser):
+ group = parser.getgroup("general")
+ group._addoption(
+ "--capture",
+ action="store",
+ default="fd" if hasattr(os, "dup") else "sys",
+ metavar="method",
+ choices=["fd", "sys", "no"],
+ help="per-test capturing method: one of fd|sys|no.",
+ )
+ group._addoption(
+ "-s",
+ action="store_const",
+ const="no",
+ dest="capture",
+ help="shortcut for --capture=no.",
+ )
+
+
+@pytest.hookimpl(hookwrapper=True)
+def pytest_load_initial_conftests(early_config, parser, args):
+ ns = early_config.known_args_namespace
+ if ns.capture == "fd":
+ _py36_windowsconsoleio_workaround(sys.stdout)
+ _colorama_workaround()
+ _readline_workaround()
+ pluginmanager = early_config.pluginmanager
+ capman = CaptureManager(ns.capture)
+ pluginmanager.register(capman, "capturemanager")
+
+ # make sure that capturemanager is properly reset at final shutdown
+ early_config.add_cleanup(capman.stop_global_capturing)
+
+ # finally trigger conftest loading but while capturing (issue93)
+ capman.start_global_capturing()
+ outcome = yield
+ capman.suspend_global_capture()
+ if outcome.excinfo is not None:
+ out, err = capman.read_global_capture()
+ sys.stdout.write(out)
+ sys.stderr.write(err)
+
+
+class CaptureManager(object):
+ """
+ Capture plugin, manages that the appropriate capture method is enabled/disabled during collection and each
+ test phase (setup, call, teardown). After each of those points, the captured output is obtained and
+ attached to the collection/runtest report.
+
+ There are two levels of capture:
+ * global: which is enabled by default and can be suppressed by the ``-s`` option. This is always enabled/disabled
+ during collection and each test phase.
+ * fixture: when a test function or one of its fixture depend on the ``capsys`` or ``capfd`` fixtures. In this
+ case special handling is needed to ensure the fixtures take precedence over the global capture.
+ """
+
+ def __init__(self, method):
+ self._method = method
+ self._global_capturing = None
+ self._current_item = None
+
+ def __repr__(self):
+ return "<CaptureManager _method=%r _global_capturing=%r _current_item=%r>" % (
+ self._method,
+ self._global_capturing,
+ self._current_item,
+ )
+
+ def _getcapture(self, method):
+ if method == "fd":
+ return MultiCapture(out=True, err=True, Capture=FDCapture)
+ elif method == "sys":
+ return MultiCapture(out=True, err=True, Capture=SysCapture)
+ elif method == "no":
+ return MultiCapture(out=False, err=False, in_=False)
+ raise ValueError("unknown capturing method: %r" % method) # pragma: no cover
+
+ def is_capturing(self):
+ if self.is_globally_capturing():
+ return "global"
+ capture_fixture = getattr(self._current_item, "_capture_fixture", None)
+ if capture_fixture is not None:
+ return (
+ "fixture %s" % self._current_item._capture_fixture.request.fixturename
+ )
+ return False
+
+ # Global capturing control
+
+ def is_globally_capturing(self):
+ return self._method != "no"
+
+ def start_global_capturing(self):
+ assert self._global_capturing is None
+ self._global_capturing = self._getcapture(self._method)
+ self._global_capturing.start_capturing()
+
+ def stop_global_capturing(self):
+ if self._global_capturing is not None:
+ self._global_capturing.pop_outerr_to_orig()
+ self._global_capturing.stop_capturing()
+ self._global_capturing = None
+
+ def resume_global_capture(self):
+ # During teardown of the python process, and on rare occasions, capture
+ # attributes can be `None` while trying to resume global capture.
+ if self._global_capturing is not None:
+ self._global_capturing.resume_capturing()
+
+ def suspend_global_capture(self, in_=False):
+ cap = getattr(self, "_global_capturing", None)
+ if cap is not None:
+ cap.suspend_capturing(in_=in_)
+
+ def suspend(self, in_=False):
+ # Need to undo local capsys-et-al if it exists before disabling global capture.
+ self.suspend_fixture(self._current_item)
+ self.suspend_global_capture(in_)
+
+ def resume(self):
+ self.resume_global_capture()
+ self.resume_fixture(self._current_item)
+
+ def read_global_capture(self):
+ return self._global_capturing.readouterr()
+
+ # Fixture Control (it's just forwarding, think about removing this later)
+
+ def activate_fixture(self, item):
+ """If the current item is using ``capsys`` or ``capfd``, activate them so they take precedence over
+ the global capture.
+ """
+ fixture = getattr(item, "_capture_fixture", None)
+ if fixture is not None:
+ fixture._start()
+
+ def deactivate_fixture(self, item):
+ """Deactivates the ``capsys`` or ``capfd`` fixture of this item, if any."""
+ fixture = getattr(item, "_capture_fixture", None)
+ if fixture is not None:
+ fixture.close()
+
+ def suspend_fixture(self, item):
+ fixture = getattr(item, "_capture_fixture", None)
+ if fixture is not None:
+ fixture._suspend()
+
+ def resume_fixture(self, item):
+ fixture = getattr(item, "_capture_fixture", None)
+ if fixture is not None:
+ fixture._resume()
+
+ # Helper context managers
+
+ @contextlib.contextmanager
+ def global_and_fixture_disabled(self):
+ """Context manager to temporarily disable global and current fixture capturing."""
+ self.suspend()
+ try:
+ yield
+ finally:
+ self.resume()
+
+ @contextlib.contextmanager
+ def item_capture(self, when, item):
+ self.resume_global_capture()
+ self.activate_fixture(item)
+ try:
+ yield
+ finally:
+ self.deactivate_fixture(item)
+ self.suspend_global_capture(in_=False)
+
+ out, err = self.read_global_capture()
+ item.add_report_section(when, "stdout", out)
+ item.add_report_section(when, "stderr", err)
+
+ # Hooks
+
+ @pytest.hookimpl(hookwrapper=True)
+ def pytest_make_collect_report(self, collector):
+ if isinstance(collector, pytest.File):
+ self.resume_global_capture()
+ outcome = yield
+ self.suspend_global_capture()
+ out, err = self.read_global_capture()
+ rep = outcome.get_result()
+ if out:
+ rep.sections.append(("Captured stdout", out))
+ if err:
+ rep.sections.append(("Captured stderr", err))
+ else:
+ yield
+
+ @pytest.hookimpl(hookwrapper=True)
+ def pytest_runtest_protocol(self, item):
+ self._current_item = item
+ yield
+ self._current_item = None
+
+ @pytest.hookimpl(hookwrapper=True)
+ def pytest_runtest_setup(self, item):
+ with self.item_capture("setup", item):
+ yield
+
+ @pytest.hookimpl(hookwrapper=True)
+ def pytest_runtest_call(self, item):
+ with self.item_capture("call", item):
+ yield
+
+ @pytest.hookimpl(hookwrapper=True)
+ def pytest_runtest_teardown(self, item):
+ with self.item_capture("teardown", item):
+ yield
+
+ @pytest.hookimpl(tryfirst=True)
+ def pytest_keyboard_interrupt(self, excinfo):
+ self.stop_global_capturing()
+
+ @pytest.hookimpl(tryfirst=True)
+ def pytest_internalerror(self, excinfo):
+ self.stop_global_capturing()
+
+
+capture_fixtures = {"capfd", "capfdbinary", "capsys", "capsysbinary"}
+
+
+def _ensure_only_one_capture_fixture(request, name):
+ fixtures = set(request.fixturenames) & capture_fixtures - {name}
+ if fixtures:
+ fixtures = sorted(fixtures)
+ fixtures = fixtures[0] if len(fixtures) == 1 else fixtures
+ raise request.raiseerror(
+ "cannot use {} and {} at the same time".format(fixtures, name)
+ )
+
+
+@pytest.fixture
+def capsys(request):
+ """Enable text capturing of writes to ``sys.stdout`` and ``sys.stderr``.
+
+ The captured output is made available via ``capsys.readouterr()`` method
+ calls, which return a ``(out, err)`` namedtuple.
+ ``out`` and ``err`` will be ``text`` objects.
+ """
+ _ensure_only_one_capture_fixture(request, "capsys")
+ with _install_capture_fixture_on_item(request, SysCapture) as fixture:
+ yield fixture
+
+
+@pytest.fixture
+def capsysbinary(request):
+ """Enable bytes capturing of writes to ``sys.stdout`` and ``sys.stderr``.
+
+ The captured output is made available via ``capsysbinary.readouterr()``
+ method calls, which return a ``(out, err)`` namedtuple.
+ ``out`` and ``err`` will be ``bytes`` objects.
+ """
+ _ensure_only_one_capture_fixture(request, "capsysbinary")
+ # Currently, the implementation uses the python3 specific `.buffer`
+ # property of CaptureIO.
+ if sys.version_info < (3,):
+ raise request.raiseerror("capsysbinary is only supported on Python 3")
+ with _install_capture_fixture_on_item(request, SysCaptureBinary) as fixture:
+ yield fixture
+
+
+@pytest.fixture
+def capfd(request):
+ """Enable text capturing of writes to file descriptors ``1`` and ``2``.
+
+ The captured output is made available via ``capfd.readouterr()`` method
+ calls, which return a ``(out, err)`` namedtuple.
+ ``out`` and ``err`` will be ``text`` objects.
+ """
+ _ensure_only_one_capture_fixture(request, "capfd")
+ if not hasattr(os, "dup"):
+ pytest.skip(
+ "capfd fixture needs os.dup function which is not available in this system"
+ )
+ with _install_capture_fixture_on_item(request, FDCapture) as fixture:
+ yield fixture
+
+
+@pytest.fixture
+def capfdbinary(request):
+ """Enable bytes capturing of writes to file descriptors ``1`` and ``2``.
+
+ The captured output is made available via ``capfd.readouterr()`` method
+ calls, which return a ``(out, err)`` namedtuple.
+ ``out`` and ``err`` will be ``byte`` objects.
+ """
+ _ensure_only_one_capture_fixture(request, "capfdbinary")
+ if not hasattr(os, "dup"):
+ pytest.skip(
+ "capfdbinary fixture needs os.dup function which is not available in this system"
+ )
+ with _install_capture_fixture_on_item(request, FDCaptureBinary) as fixture:
+ yield fixture
+
+
+@contextlib.contextmanager
+def _install_capture_fixture_on_item(request, capture_class):
+ """
+ Context manager which creates a ``CaptureFixture`` instance and "installs" it on
+ the item/node of the given request. Used by ``capsys`` and ``capfd``.
+
+ The CaptureFixture is added as attribute of the item because it needs to accessed
+ by ``CaptureManager`` during its ``pytest_runtest_*`` hooks.
+ """
+ request.node._capture_fixture = fixture = CaptureFixture(capture_class, request)
+ capmanager = request.config.pluginmanager.getplugin("capturemanager")
+ # Need to active this fixture right away in case it is being used by another fixture (setup phase).
+ # If this fixture is being used only by a test function (call phase), then we wouldn't need this
+ # activation, but it doesn't hurt.
+ capmanager.activate_fixture(request.node)
+ yield fixture
+ fixture.close()
+ del request.node._capture_fixture
+
+
+class CaptureFixture(object):
+ """
+ Object returned by :py:func:`capsys`, :py:func:`capsysbinary`, :py:func:`capfd` and :py:func:`capfdbinary`
+ fixtures.
+ """
+
+ def __init__(self, captureclass, request):
+ self.captureclass = captureclass
+ self.request = request
+ self._capture = None
+ self._captured_out = self.captureclass.EMPTY_BUFFER
+ self._captured_err = self.captureclass.EMPTY_BUFFER
+
+ def _start(self):
+ if self._capture is None:
+ self._capture = MultiCapture(
+ out=True, err=True, in_=False, Capture=self.captureclass
+ )
+ self._capture.start_capturing()
+
+ def close(self):
+ if self._capture is not None:
+ out, err = self._capture.pop_outerr_to_orig()
+ self._captured_out += out
+ self._captured_err += err
+ self._capture.stop_capturing()
+ self._capture = None
+
+ def readouterr(self):
+ """Read and return the captured output so far, resetting the internal buffer.
+
+ :return: captured content as a namedtuple with ``out`` and ``err`` string attributes
+ """
+ captured_out, captured_err = self._captured_out, self._captured_err
+ if self._capture is not None:
+ out, err = self._capture.readouterr()
+ captured_out += out
+ captured_err += err
+ self._captured_out = self.captureclass.EMPTY_BUFFER
+ self._captured_err = self.captureclass.EMPTY_BUFFER
+ return CaptureResult(captured_out, captured_err)
+
+ def _suspend(self):
+ """Suspends this fixture's own capturing temporarily."""
+ if self._capture is not None:
+ self._capture.suspend_capturing()
+
+ def _resume(self):
+ """Resumes this fixture's own capturing temporarily."""
+ if self._capture is not None:
+ self._capture.resume_capturing()
+
+ @contextlib.contextmanager
+ def disabled(self):
+ """Temporarily disables capture while inside the 'with' block."""
+ capmanager = self.request.config.pluginmanager.getplugin("capturemanager")
+ with capmanager.global_and_fixture_disabled():
+ yield
+
+
+def safe_text_dupfile(f, mode, default_encoding="UTF8"):
+ """ return an open text file object that's a duplicate of f on the
+ FD-level if possible.
+ """
+ encoding = getattr(f, "encoding", None)
+ try:
+ fd = f.fileno()
+ except Exception:
+ if "b" not in getattr(f, "mode", "") and hasattr(f, "encoding"):
+ # we seem to have a text stream, let's just use it
+ return f
+ else:
+ newfd = os.dup(fd)
+ if "b" not in mode:
+ mode += "b"
+ f = os.fdopen(newfd, mode, 0) # no buffering
+ return EncodedFile(f, encoding or default_encoding)
+
+
+class EncodedFile(object):
+ errors = "strict" # possibly needed by py3 code (issue555)
+
+ def __init__(self, buffer, encoding):
+ self.buffer = buffer
+ self.encoding = encoding
+
+ def write(self, obj):
+ if isinstance(obj, six.text_type):
+ obj = obj.encode(self.encoding, "replace")
+ elif _PY3:
+ raise TypeError(
+ "write() argument must be str, not {}".format(type(obj).__name__)
+ )
+ self.buffer.write(obj)
+
+ def writelines(self, linelist):
+ data = "".join(linelist)
+ self.write(data)
+
+ @property
+ def name(self):
+ """Ensure that file.name is a string."""
+ return repr(self.buffer)
+
+ @property
+ def mode(self):
+ return self.buffer.mode.replace("b", "")
+
+ def __getattr__(self, name):
+ return getattr(object.__getattribute__(self, "buffer"), name)
+
+
+CaptureResult = collections.namedtuple("CaptureResult", ["out", "err"])
+
+
+class MultiCapture(object):
+ out = err = in_ = None
+ _state = None
+
+ def __init__(self, out=True, err=True, in_=True, Capture=None):
+ if in_:
+ self.in_ = Capture(0)
+ if out:
+ self.out = Capture(1)
+ if err:
+ self.err = Capture(2)
+
+ def __repr__(self):
+ return "<MultiCapture out=%r err=%r in_=%r _state=%r _in_suspended=%r>" % (
+ self.out,
+ self.err,
+ self.in_,
+ self._state,
+ getattr(self, "_in_suspended", "<UNSET>"),
+ )
+
+ def start_capturing(self):
+ self._state = "started"
+ if self.in_:
+ self.in_.start()
+ if self.out:
+ self.out.start()
+ if self.err:
+ self.err.start()
+
+ def pop_outerr_to_orig(self):
+ """ pop current snapshot out/err capture and flush to orig streams. """
+ out, err = self.readouterr()
+ if out:
+ self.out.writeorg(out)
+ if err:
+ self.err.writeorg(err)
+ return out, err
+
+ def suspend_capturing(self, in_=False):
+ self._state = "suspended"
+ if self.out:
+ self.out.suspend()
+ if self.err:
+ self.err.suspend()
+ if in_ and self.in_:
+ self.in_.suspend()
+ self._in_suspended = True
+
+ def resume_capturing(self):
+ self._state = "resumed"
+ if self.out:
+ self.out.resume()
+ if self.err:
+ self.err.resume()
+ if hasattr(self, "_in_suspended"):
+ self.in_.resume()
+ del self._in_suspended
+
+ def stop_capturing(self):
+ """ stop capturing and reset capturing streams """
+ if self._state == "stopped":
+ raise ValueError("was already stopped")
+ self._state = "stopped"
+ if self.out:
+ self.out.done()
+ if self.err:
+ self.err.done()
+ if self.in_:
+ self.in_.done()
+
+ def readouterr(self):
+ """ return snapshot unicode value of stdout/stderr capturings. """
+ return CaptureResult(
+ self.out.snap() if self.out is not None else "",
+ self.err.snap() if self.err is not None else "",
+ )
+
+
+class NoCapture(object):
+ EMPTY_BUFFER = None
+ __init__ = start = done = suspend = resume = lambda *args: None
+
+
+class FDCaptureBinary(object):
+ """Capture IO to/from a given os-level filedescriptor.
+
+ snap() produces `bytes`
+ """
+
+ EMPTY_BUFFER = b""
+ _state = None
+
+ def __init__(self, targetfd, tmpfile=None):
+ self.targetfd = targetfd
+ try:
+ self.targetfd_save = os.dup(self.targetfd)
+ except OSError:
+ self.start = lambda: None
+ self.done = lambda: None
+ else:
+ if targetfd == 0:
+ assert not tmpfile, "cannot set tmpfile with stdin"
+ tmpfile = open(os.devnull, "r")
+ self.syscapture = SysCapture(targetfd)
+ else:
+ if tmpfile is None:
+ f = TemporaryFile()
+ with f:
+ tmpfile = safe_text_dupfile(f, mode="wb+")
+ if targetfd in patchsysdict:
+ self.syscapture = SysCapture(targetfd, tmpfile)
+ else:
+ self.syscapture = NoCapture()
+ self.tmpfile = tmpfile
+ self.tmpfile_fd = tmpfile.fileno()
+
+ def __repr__(self):
+ return "<FDCapture %s oldfd=%s _state=%r>" % (
+ self.targetfd,
+ getattr(self, "targetfd_save", None),
+ self._state,
+ )
+
+ def start(self):
+ """ Start capturing on targetfd using memorized tmpfile. """
+ try:
+ os.fstat(self.targetfd_save)
+ except (AttributeError, OSError):
+ raise ValueError("saved filedescriptor not valid anymore")
+ os.dup2(self.tmpfile_fd, self.targetfd)
+ self.syscapture.start()
+ self._state = "started"
+
+ def snap(self):
+ self.tmpfile.seek(0)
+ res = self.tmpfile.read()
+ self.tmpfile.seek(0)
+ self.tmpfile.truncate()
+ return res
+
+ def done(self):
+ """ stop capturing, restore streams, return original capture file,
+ seeked to position zero. """
+ targetfd_save = self.__dict__.pop("targetfd_save")
+ os.dup2(targetfd_save, self.targetfd)
+ os.close(targetfd_save)
+ self.syscapture.done()
+ _attempt_to_close_capture_file(self.tmpfile)
+ self._state = "done"
+
+ def suspend(self):
+ self.syscapture.suspend()
+ os.dup2(self.targetfd_save, self.targetfd)
+ self._state = "suspended"
+
+ def resume(self):
+ self.syscapture.resume()
+ os.dup2(self.tmpfile_fd, self.targetfd)
+ self._state = "resumed"
+
+ def writeorg(self, data):
+ """ write to original file descriptor. """
+ if isinstance(data, six.text_type):
+ data = data.encode("utf8") # XXX use encoding of original stream
+ os.write(self.targetfd_save, data)
+
+
+class FDCapture(FDCaptureBinary):
+ """Capture IO to/from a given os-level filedescriptor.
+
+ snap() produces text
+ """
+
+ EMPTY_BUFFER = str()
+
+ def snap(self):
+ res = super(FDCapture, self).snap()
+ enc = getattr(self.tmpfile, "encoding", None)
+ if enc and isinstance(res, bytes):
+ res = six.text_type(res, enc, "replace")
+ return res
+
+
+class SysCapture(object):
+
+ EMPTY_BUFFER = str()
+ _state = None
+
+ def __init__(self, fd, tmpfile=None):
+ name = patchsysdict[fd]
+ self._old = getattr(sys, name)
+ self.name = name
+ if tmpfile is None:
+ if name == "stdin":
+ tmpfile = DontReadFromInput()
+ else:
+ tmpfile = CaptureIO()
+ self.tmpfile = tmpfile
+
+ def __repr__(self):
+ return "<SysCapture %s _old=%r, tmpfile=%r _state=%r>" % (
+ self.name,
+ self._old,
+ self.tmpfile,
+ self._state,
+ )
+
+ def start(self):
+ setattr(sys, self.name, self.tmpfile)
+ self._state = "started"
+
+ def snap(self):
+ res = self.tmpfile.getvalue()
+ self.tmpfile.seek(0)
+ self.tmpfile.truncate()
+ return res
+
+ def done(self):
+ setattr(sys, self.name, self._old)
+ del self._old
+ _attempt_to_close_capture_file(self.tmpfile)
+ self._state = "done"
+
+ def suspend(self):
+ setattr(sys, self.name, self._old)
+ self._state = "suspended"
+
+ def resume(self):
+ setattr(sys, self.name, self.tmpfile)
+ self._state = "resumed"
+
+ def writeorg(self, data):
+ self._old.write(data)
+ self._old.flush()
+
+
+class SysCaptureBinary(SysCapture):
+ EMPTY_BUFFER = b""
+
+ def snap(self):
+ res = self.tmpfile.buffer.getvalue()
+ self.tmpfile.seek(0)
+ self.tmpfile.truncate()
+ return res
+
+
+class DontReadFromInput(six.Iterator):
+ """Temporary stub class. Ideally when stdin is accessed, the
+ capturing should be turned off, with possibly all data captured
+ so far sent to the screen. This should be configurable, though,
+ because in automated test runs it is better to crash than
+ hang indefinitely.
+ """
+
+ encoding = None
+
+ def read(self, *args):
+ raise IOError("reading from stdin while output is captured")
+
+ readline = read
+ readlines = read
+ __next__ = read
+
+ def __iter__(self):
+ return self
+
+ def fileno(self):
+ raise UnsupportedOperation("redirected stdin is pseudofile, has no fileno()")
+
+ def isatty(self):
+ return False
+
+ def close(self):
+ pass
+
+ @property
+ def buffer(self):
+ if sys.version_info >= (3, 0):
+ return self
+ else:
+ raise AttributeError("redirected stdin has no attribute buffer")
+
+
+def _colorama_workaround():
+ """
+ Ensure colorama is imported so that it attaches to the correct stdio
+ handles on Windows.
+
+ colorama uses the terminal on import time. So if something does the
+ first import of colorama while I/O capture is active, colorama will
+ fail in various ways.
+ """
+ if sys.platform.startswith("win32"):
+ try:
+ import colorama # noqa: F401
+ except ImportError:
+ pass
+
+
+def _readline_workaround():
+ """
+ Ensure readline is imported so that it attaches to the correct stdio
+ handles on Windows.
+
+ Pdb uses readline support where available--when not running from the Python
+ prompt, the readline module is not imported until running the pdb REPL. If
+ running pytest with the --pdb option this means the readline module is not
+ imported until after I/O capture has been started.
+
+ This is a problem for pyreadline, which is often used to implement readline
+ support on Windows, as it does not attach to the correct handles for stdout
+ and/or stdin if they have been redirected by the FDCapture mechanism. This
+ workaround ensures that readline is imported before I/O capture is setup so
+ that it can attach to the actual stdin/out for the console.
+
+ See https://github.com/pytest-dev/pytest/pull/1281
+ """
+ if sys.platform.startswith("win32"):
+ try:
+ import readline # noqa: F401
+ except ImportError:
+ pass
+
+
+def _py36_windowsconsoleio_workaround(stream):
+ """
+ Python 3.6 implemented unicode console handling for Windows. This works
+ by reading/writing to the raw console handle using
+ ``{Read,Write}ConsoleW``.
+
+ The problem is that we are going to ``dup2`` over the stdio file
+ descriptors when doing ``FDCapture`` and this will ``CloseHandle`` the
+ handles used by Python to write to the console. Though there is still some
+ weirdness and the console handle seems to only be closed randomly and not
+ on the first call to ``CloseHandle``, or maybe it gets reopened with the
+ same handle value when we suspend capturing.
+
+ The workaround in this case will reopen stdio with a different fd which
+ also means a different handle by replicating the logic in
+ "Py_lifecycle.c:initstdio/create_stdio".
+
+ :param stream: in practice ``sys.stdout`` or ``sys.stderr``, but given
+ here as parameter for unittesting purposes.
+
+ See https://github.com/pytest-dev/py/issues/103
+ """
+ if not sys.platform.startswith("win32") or sys.version_info[:2] < (3, 6):
+ return
+
+ # bail out if ``stream`` doesn't seem like a proper ``io`` stream (#2666)
+ if not hasattr(stream, "buffer"):
+ return
+
+ buffered = hasattr(stream.buffer, "raw")
+ raw_stdout = stream.buffer.raw if buffered else stream.buffer
+
+ if not isinstance(raw_stdout, io._WindowsConsoleIO):
+ return
+
+ def _reopen_stdio(f, mode):
+ if not buffered and mode[0] == "w":
+ buffering = 0
+ else:
+ buffering = -1
+
+ return io.TextIOWrapper(
+ open(os.dup(f.fileno()), mode, buffering),
+ f.encoding,
+ f.errors,
+ f.newlines,
+ f.line_buffering,
+ )
+
+ sys.stdin = _reopen_stdio(sys.stdin, "rb")
+ sys.stdout = _reopen_stdio(sys.stdout, "wb")
+ sys.stderr = _reopen_stdio(sys.stderr, "wb")
+
+
+def _attempt_to_close_capture_file(f):
+ """Suppress IOError when closing the temporary file used for capturing streams in py27 (#2370)"""
+ if six.PY2:
+ try:
+ f.close()
+ except IOError:
+ pass
+ else:
+ f.close()
diff --git a/contrib/python/pytest/py2/_pytest/compat.py b/contrib/python/pytest/py2/_pytest/compat.py
new file mode 100644
index 00000000000..e5c3b84667e
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/compat.py
@@ -0,0 +1,473 @@
+# -*- coding: utf-8 -*-
+"""
+python version compatibility code
+"""
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import codecs
+import functools
+import inspect
+import re
+import sys
+from contextlib import contextmanager
+
+import attr
+import py
+import six
+from six import text_type
+
+import _pytest
+from _pytest._io.saferepr import saferepr
+from _pytest.outcomes import fail
+from _pytest.outcomes import TEST_OUTCOME
+
+try:
+ import enum
+except ImportError: # pragma: no cover
+ # Only available in Python 3.4+ or as a backport
+ enum = None
+
+_PY3 = sys.version_info > (3, 0)
+_PY2 = not _PY3
+
+
+if _PY3:
+ from inspect import signature, Parameter as Parameter
+else:
+ from funcsigs import signature, Parameter as Parameter
+
+NOTSET = object()
+
+PY35 = sys.version_info[:2] >= (3, 5)
+PY36 = sys.version_info[:2] >= (3, 6)
+MODULE_NOT_FOUND_ERROR = "ModuleNotFoundError" if PY36 else "ImportError"
+
+
+if _PY3:
+ from collections.abc import MutableMapping as MappingMixin
+ from collections.abc import Iterable, Mapping, Sequence, Sized
+else:
+ # those raise DeprecationWarnings in Python >=3.7
+ from collections import MutableMapping as MappingMixin # noqa
+ from collections import Iterable, Mapping, Sequence, Sized # noqa
+
+
+if sys.version_info >= (3, 4):
+ from importlib.util import spec_from_file_location
+else:
+
+ def spec_from_file_location(*_, **__):
+ return None
+
+
+if sys.version_info >= (3, 8):
+ from importlib import metadata as importlib_metadata # noqa
+else:
+ import importlib_metadata # noqa
+
+
+def _format_args(func):
+ return str(signature(func))
+
+
+isfunction = inspect.isfunction
+isclass = inspect.isclass
+# used to work around a python2 exception info leak
+exc_clear = getattr(sys, "exc_clear", lambda: None)
+# The type of re.compile objects is not exposed in Python.
+REGEX_TYPE = type(re.compile(""))
+
+
+def is_generator(func):
+ genfunc = inspect.isgeneratorfunction(func)
+ return genfunc and not iscoroutinefunction(func)
+
+
+def iscoroutinefunction(func):
+ """Return True if func is a decorated coroutine function.
+
+ Note: copied and modified from Python 3.5's builtin couroutines.py to avoid import asyncio directly,
+ which in turns also initializes the "logging" module as side-effect (see issue #8).
+ """
+ return getattr(func, "_is_coroutine", False) or (
+ hasattr(inspect, "iscoroutinefunction") and inspect.iscoroutinefunction(func)
+ )
+
+
+def getlocation(function, curdir):
+ function = get_real_func(function)
+ fn = py.path.local(inspect.getfile(function))
+ lineno = function.__code__.co_firstlineno
+ if fn.relto(curdir):
+ fn = fn.relto(curdir)
+ return "%s:%d" % (fn, lineno + 1)
+
+
+def num_mock_patch_args(function):
+ """ return number of arguments used up by mock arguments (if any) """
+ patchings = getattr(function, "patchings", None)
+ if not patchings:
+ return 0
+ mock_modules = [sys.modules.get("mock"), sys.modules.get("unittest.mock")]
+ if any(mock_modules):
+ sentinels = [m.DEFAULT for m in mock_modules if m is not None]
+ return len(
+ [p for p in patchings if not p.attribute_name and p.new in sentinels]
+ )
+ return len(patchings)
+
+
+def getfuncargnames(function, is_method=False, cls=None):
+ """Returns the names of a function's mandatory arguments.
+
+ This should return the names of all function arguments that:
+ * Aren't bound to an instance or type as in instance or class methods.
+ * Don't have default values.
+ * Aren't bound with functools.partial.
+ * Aren't replaced with mocks.
+
+ The is_method and cls arguments indicate that the function should
+ be treated as a bound method even though it's not unless, only in
+ the case of cls, the function is a static method.
+
+ @RonnyPfannschmidt: This function should be refactored when we
+ revisit fixtures. The fixture mechanism should ask the node for
+ the fixture names, and not try to obtain directly from the
+ function object well after collection has occurred.
+
+ """
+ # The parameters attribute of a Signature object contains an
+ # ordered mapping of parameter names to Parameter instances. This
+ # creates a tuple of the names of the parameters that don't have
+ # defaults.
+ try:
+ parameters = signature(function).parameters
+ except (ValueError, TypeError) as e:
+ fail(
+ "Could not determine arguments of {!r}: {}".format(function, e),
+ pytrace=False,
+ )
+
+ arg_names = tuple(
+ p.name
+ for p in parameters.values()
+ if (
+ p.kind is Parameter.POSITIONAL_OR_KEYWORD
+ or p.kind is Parameter.KEYWORD_ONLY
+ )
+ and p.default is Parameter.empty
+ )
+ # If this function should be treated as a bound method even though
+ # it's passed as an unbound method or function, remove the first
+ # parameter name.
+ if is_method or (
+ cls and not isinstance(cls.__dict__.get(function.__name__, None), staticmethod)
+ ):
+ arg_names = arg_names[1:]
+ # Remove any names that will be replaced with mocks.
+ if hasattr(function, "__wrapped__"):
+ arg_names = arg_names[num_mock_patch_args(function) :]
+ return arg_names
+
+
+@contextmanager
+def dummy_context_manager():
+ """Context manager that does nothing, useful in situations where you might need an actual context manager or not
+ depending on some condition. Using this allow to keep the same code"""
+ yield
+
+
+def get_default_arg_names(function):
+ # Note: this code intentionally mirrors the code at the beginning of getfuncargnames,
+ # to get the arguments which were excluded from its result because they had default values
+ return tuple(
+ p.name
+ for p in signature(function).parameters.values()
+ if p.kind in (Parameter.POSITIONAL_OR_KEYWORD, Parameter.KEYWORD_ONLY)
+ and p.default is not Parameter.empty
+ )
+
+
+_non_printable_ascii_translate_table = {
+ i: u"\\x{:02x}".format(i) for i in range(128) if i not in range(32, 127)
+}
+_non_printable_ascii_translate_table.update(
+ {ord("\t"): u"\\t", ord("\r"): u"\\r", ord("\n"): u"\\n"}
+)
+
+
+def _translate_non_printable(s):
+ return s.translate(_non_printable_ascii_translate_table)
+
+
+if _PY3:
+ STRING_TYPES = bytes, str
+ UNICODE_TYPES = six.text_type
+
+ if PY35:
+
+ def _bytes_to_ascii(val):
+ return val.decode("ascii", "backslashreplace")
+
+ else:
+
+ def _bytes_to_ascii(val):
+ if val:
+ # source: http://goo.gl/bGsnwC
+ encoded_bytes, _ = codecs.escape_encode(val)
+ return encoded_bytes.decode("ascii")
+ else:
+ # empty bytes crashes codecs.escape_encode (#1087)
+ return ""
+
+ def ascii_escaped(val):
+ """If val is pure ascii, returns it as a str(). Otherwise, escapes
+ bytes objects into a sequence of escaped bytes:
+
+ b'\xc3\xb4\xc5\xd6' -> u'\\xc3\\xb4\\xc5\\xd6'
+
+ and escapes unicode objects into a sequence of escaped unicode
+ ids, e.g.:
+
+ '4\\nV\\U00043efa\\x0eMXWB\\x1e\\u3028\\u15fd\\xcd\\U0007d944'
+
+ note:
+ the obvious "v.decode('unicode-escape')" will return
+ valid utf-8 unicode if it finds them in bytes, but we
+ want to return escaped bytes for any byte, even if they match
+ a utf-8 string.
+
+ """
+ if isinstance(val, bytes):
+ ret = _bytes_to_ascii(val)
+ else:
+ ret = val
+ return ret
+
+
+else:
+ STRING_TYPES = six.string_types
+ UNICODE_TYPES = six.text_type
+
+ def ascii_escaped(val):
+ """In py2 bytes and str are the same type, so return if it's a bytes
+ object, return it unchanged if it is a full ascii string,
+ otherwise escape it into its binary form.
+
+ If it's a unicode string, change the unicode characters into
+ unicode escapes.
+
+ """
+ if isinstance(val, bytes):
+ try:
+ ret = val.decode("utf-8")
+ except UnicodeDecodeError:
+ ret = val.decode("utf-8", "ignore")
+ else:
+ ret = val.encode("utf-8", "replace").decode("utf-8")
+ return ret
+
+
+class _PytestWrapper(object):
+ """Dummy wrapper around a function object for internal use only.
+
+ Used to correctly unwrap the underlying function object
+ when we are creating fixtures, because we wrap the function object ourselves with a decorator
+ to issue warnings when the fixture function is called directly.
+ """
+
+ def __init__(self, obj):
+ self.obj = obj
+
+
+def get_real_func(obj):
+ """ gets the real function object of the (possibly) wrapped object by
+ functools.wraps or functools.partial.
+ """
+ start_obj = obj
+ for i in range(100):
+ # __pytest_wrapped__ is set by @pytest.fixture when wrapping the fixture function
+ # to trigger a warning if it gets called directly instead of by pytest: we don't
+ # want to unwrap further than this otherwise we lose useful wrappings like @mock.patch (#3774)
+ new_obj = getattr(obj, "__pytest_wrapped__", None)
+ if isinstance(new_obj, _PytestWrapper):
+ obj = new_obj.obj
+ break
+ new_obj = getattr(obj, "__wrapped__", None)
+ if new_obj is None:
+ break
+ obj = new_obj
+ else:
+ raise ValueError(
+ ("could not find real function of {start}\nstopped at {current}").format(
+ start=saferepr(start_obj), current=saferepr(obj)
+ )
+ )
+ if isinstance(obj, functools.partial):
+ obj = obj.func
+ return obj
+
+
+def get_real_method(obj, holder):
+ """
+ Attempts to obtain the real function object that might be wrapping ``obj``, while at the same time
+ returning a bound method to ``holder`` if the original object was a bound method.
+ """
+ try:
+ is_method = hasattr(obj, "__func__")
+ obj = get_real_func(obj)
+ except Exception:
+ return obj
+ if is_method and hasattr(obj, "__get__") and callable(obj.__get__):
+ obj = obj.__get__(holder)
+ return obj
+
+
+def getfslineno(obj):
+ # xxx let decorators etc specify a sane ordering
+ obj = get_real_func(obj)
+ if hasattr(obj, "place_as"):
+ obj = obj.place_as
+ fslineno = _pytest._code.getfslineno(obj)
+ assert isinstance(fslineno[1], int), obj
+ return fslineno
+
+
+def getimfunc(func):
+ try:
+ return func.__func__
+ except AttributeError:
+ return func
+
+
+def safe_getattr(object, name, default):
+ """ Like getattr but return default upon any Exception or any OutcomeException.
+
+ Attribute access can potentially fail for 'evil' Python objects.
+ See issue #214.
+ It catches OutcomeException because of #2490 (issue #580), new outcomes are derived from BaseException
+ instead of Exception (for more details check #2707)
+ """
+ try:
+ return getattr(object, name, default)
+ except TEST_OUTCOME:
+ return default
+
+
+def safe_isclass(obj):
+ """Ignore any exception via isinstance on Python 3."""
+ try:
+ return isclass(obj)
+ except Exception:
+ return False
+
+
+def _is_unittest_unexpected_success_a_failure():
+ """Return if the test suite should fail if an @expectedFailure unittest test PASSES.
+
+ From https://docs.python.org/3/library/unittest.html?highlight=unittest#unittest.TestResult.wasSuccessful:
+ Changed in version 3.4: Returns False if there were any
+ unexpectedSuccesses from tests marked with the expectedFailure() decorator.
+ """
+ return sys.version_info >= (3, 4)
+
+
+if _PY3:
+
+ def safe_str(v):
+ """returns v as string"""
+ try:
+ return str(v)
+ except UnicodeEncodeError:
+ return str(v, encoding="utf-8")
+
+
+else:
+
+ def safe_str(v):
+ """returns v as string, converting to utf-8 if necessary"""
+ try:
+ return str(v)
+ except UnicodeError:
+ if not isinstance(v, text_type):
+ v = text_type(v)
+ errors = "replace"
+ return v.encode("utf-8", errors)
+
+
+COLLECT_FAKEMODULE_ATTRIBUTES = (
+ "Collector",
+ "Module",
+ "Function",
+ "Instance",
+ "Session",
+ "Item",
+ "Class",
+ "File",
+ "_fillfuncargs",
+)
+
+
+def _setup_collect_fakemodule():
+ from types import ModuleType
+ import pytest
+
+ pytest.collect = ModuleType("pytest.collect")
+ pytest.collect.__all__ = [] # used for setns
+ for attribute in COLLECT_FAKEMODULE_ATTRIBUTES:
+ setattr(pytest.collect, attribute, getattr(pytest, attribute))
+
+
+if _PY2:
+ # Without this the test_dupfile_on_textio will fail, otherwise CaptureIO could directly inherit from StringIO.
+ from py.io import TextIO
+
+ class CaptureIO(TextIO):
+ @property
+ def encoding(self):
+ return getattr(self, "_encoding", "UTF-8")
+
+
+else:
+ import io
+
+ class CaptureIO(io.TextIOWrapper):
+ def __init__(self):
+ super(CaptureIO, self).__init__(
+ io.BytesIO(), encoding="UTF-8", newline="", write_through=True
+ )
+
+ def getvalue(self):
+ return self.buffer.getvalue().decode("UTF-8")
+
+
+class FuncargnamesCompatAttr(object):
+ """ helper class so that Metafunc, Function and FixtureRequest
+ don't need to each define the "funcargnames" compatibility attribute.
+ """
+
+ @property
+ def funcargnames(self):
+ """ alias attribute for ``fixturenames`` for pre-2.3 compatibility"""
+ return self.fixturenames
+
+
+if six.PY2:
+
+ def lru_cache(*_, **__):
+ def dec(fn):
+ return fn
+
+ return dec
+
+
+else:
+ from functools import lru_cache # noqa: F401
+
+
+if getattr(attr, "__version_info__", ()) >= (19, 2):
+ ATTRS_EQ_FIELD = "eq"
+else:
+ ATTRS_EQ_FIELD = "cmp"
diff --git a/contrib/python/pytest/py2/_pytest/config/__init__.py b/contrib/python/pytest/py2/_pytest/config/__init__.py
new file mode 100644
index 00000000000..0737ff9d51c
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/config/__init__.py
@@ -0,0 +1,1203 @@
+# -*- coding: utf-8 -*-
+""" command line options, ini-file and conftest.py processing. """
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import argparse
+import copy
+import inspect
+import os
+import shlex
+import sys
+import types
+import warnings
+
+import attr
+import py
+import six
+from packaging.version import Version
+from pluggy import HookimplMarker
+from pluggy import HookspecMarker
+from pluggy import PluginManager
+
+import _pytest._code
+import _pytest.assertion
+import _pytest.hookspec # the extension point definitions
+from .exceptions import PrintHelp
+from .exceptions import UsageError
+from .findpaths import determine_setup
+from .findpaths import exists
+from _pytest import deprecated
+from _pytest._code import ExceptionInfo
+from _pytest._code import filter_traceback
+from _pytest.compat import importlib_metadata
+from _pytest.compat import lru_cache
+from _pytest.compat import safe_str
+from _pytest.outcomes import fail
+from _pytest.outcomes import Skipped
+from _pytest.pathlib import Path
+from _pytest.warning_types import PytestConfigWarning
+
+hookimpl = HookimplMarker("pytest")
+hookspec = HookspecMarker("pytest")
+
+
+class ConftestImportFailure(Exception):
+ def __init__(self, path, excinfo):
+ Exception.__init__(self, path, excinfo)
+ self.path = path
+ self.excinfo = excinfo
+
+
+def main(args=None, plugins=None):
+ """ return exit code, after performing an in-process test run.
+
+ :arg args: list of command line arguments.
+
+ :arg plugins: list of plugin objects to be auto-registered during
+ initialization.
+ """
+ from _pytest.main import EXIT_USAGEERROR
+
+ try:
+ try:
+ config = _prepareconfig(args, plugins)
+ except ConftestImportFailure as e:
+ exc_info = ExceptionInfo(e.excinfo)
+ tw = py.io.TerminalWriter(sys.stderr)
+ tw.line(
+ "ImportError while loading conftest '{e.path}'.".format(e=e), red=True
+ )
+ exc_info.traceback = exc_info.traceback.filter(filter_traceback)
+ exc_repr = (
+ exc_info.getrepr(style="short", chain=False)
+ if exc_info.traceback
+ else exc_info.exconly()
+ )
+ formatted_tb = safe_str(exc_repr)
+ for line in formatted_tb.splitlines():
+ tw.line(line.rstrip(), red=True)
+ return 4
+ else:
+ try:
+ return config.hook.pytest_cmdline_main(config=config)
+ finally:
+ config._ensure_unconfigure()
+ except UsageError as e:
+ tw = py.io.TerminalWriter(sys.stderr)
+ for msg in e.args:
+ tw.line("ERROR: {}\n".format(msg), red=True)
+ return EXIT_USAGEERROR
+
+
+class cmdline(object): # compatibility namespace
+ main = staticmethod(main)
+
+
+def filename_arg(path, optname):
+ """ Argparse type validator for filename arguments.
+
+ :path: path of filename
+ :optname: name of the option
+ """
+ if os.path.isdir(path):
+ raise UsageError("{} must be a filename, given: {}".format(optname, path))
+ return path
+
+
+def directory_arg(path, optname):
+ """Argparse type validator for directory arguments.
+
+ :path: path of directory
+ :optname: name of the option
+ """
+ if not os.path.isdir(path):
+ raise UsageError("{} must be a directory, given: {}".format(optname, path))
+ return path
+
+
+# Plugins that cannot be disabled via "-p no:X" currently.
+essential_plugins = (
+ "mark",
+ "main",
+ "runner",
+ "fixtures",
+ "helpconfig", # Provides -p.
+)
+
+default_plugins = essential_plugins + (
+ "python",
+ "terminal",
+ "debugging",
+ "unittest",
+ "capture",
+ "skipping",
+ "tmpdir",
+ "monkeypatch",
+ "recwarn",
+ "pastebin",
+ "nose",
+ "assertion",
+ "junitxml",
+ "resultlog",
+ "doctest",
+ "cacheprovider",
+ "freeze_support",
+ "setuponly",
+ "setupplan",
+ "stepwise",
+ "warnings",
+ "logging",
+ "reports",
+)
+
+builtin_plugins = set(default_plugins)
+builtin_plugins.add("pytester")
+
+
+def get_config(args=None, plugins=None):
+ # subsequent calls to main will create a fresh instance
+ pluginmanager = PytestPluginManager()
+ config = Config(
+ pluginmanager,
+ invocation_params=Config.InvocationParams(
+ args=args, plugins=plugins, dir=Path().resolve()
+ ),
+ )
+
+ if args is not None:
+ # Handle any "-p no:plugin" args.
+ pluginmanager.consider_preparse(args)
+
+ for spec in default_plugins:
+ pluginmanager.import_plugin(spec)
+ return config
+
+
+def get_plugin_manager():
+ """
+ Obtain a new instance of the
+ :py:class:`_pytest.config.PytestPluginManager`, with default plugins
+ already loaded.
+
+ This function can be used by integration with other tools, like hooking
+ into pytest to run tests into an IDE.
+ """
+ return get_config().pluginmanager
+
+
+def _prepareconfig(args=None, plugins=None):
+ warning = None
+ if args is None:
+ args = sys.argv[1:]
+ elif isinstance(args, py.path.local):
+ args = [str(args)]
+ elif not isinstance(args, (tuple, list)):
+ msg = "`args` parameter expected to be a list or tuple of strings, got: {!r} (type: {})"
+ raise TypeError(msg.format(args, type(args)))
+
+ config = get_config(args, plugins)
+ pluginmanager = config.pluginmanager
+ try:
+ if plugins:
+ for plugin in plugins:
+ if isinstance(plugin, six.string_types):
+ pluginmanager.consider_pluginarg(plugin)
+ else:
+ pluginmanager.register(plugin)
+ if warning:
+ from _pytest.warnings import _issue_warning_captured
+
+ _issue_warning_captured(warning, hook=config.hook, stacklevel=4)
+ return pluginmanager.hook.pytest_cmdline_parse(
+ pluginmanager=pluginmanager, args=args
+ )
+ except BaseException:
+ config._ensure_unconfigure()
+ raise
+
+
+class PytestPluginManager(PluginManager):
+ """
+ Overwrites :py:class:`pluggy.PluginManager <pluggy.PluginManager>` to add pytest-specific
+ functionality:
+
+ * loading plugins from the command line, ``PYTEST_PLUGINS`` env variable and
+ ``pytest_plugins`` global variables found in plugins being loaded;
+ * ``conftest.py`` loading during start-up;
+ """
+
+ def __init__(self):
+ super(PytestPluginManager, self).__init__("pytest")
+ self._conftest_plugins = set()
+
+ # state related to local conftest plugins
+ self._dirpath2confmods = {}
+ self._conftestpath2mod = {}
+ self._confcutdir = None
+ self._noconftest = False
+ self._duplicatepaths = set()
+
+ self.add_hookspecs(_pytest.hookspec)
+ self.register(self)
+ if os.environ.get("PYTEST_DEBUG"):
+ err = sys.stderr
+ encoding = getattr(err, "encoding", "utf8")
+ try:
+ err = py.io.dupfile(err, encoding=encoding)
+ except Exception:
+ pass
+ self.trace.root.setwriter(err.write)
+ self.enable_tracing()
+
+ # Config._consider_importhook will set a real object if required.
+ self.rewrite_hook = _pytest.assertion.DummyRewriteHook()
+ # Used to know when we are importing conftests after the pytest_configure stage
+ self._configured = False
+
+ def addhooks(self, module_or_class):
+ """
+ .. deprecated:: 2.8
+
+ Use :py:meth:`pluggy.PluginManager.add_hookspecs <PluginManager.add_hookspecs>`
+ instead.
+ """
+ warnings.warn(deprecated.PLUGIN_MANAGER_ADDHOOKS, stacklevel=2)
+ return self.add_hookspecs(module_or_class)
+
+ def parse_hookimpl_opts(self, plugin, name):
+ # pytest hooks are always prefixed with pytest_
+ # so we avoid accessing possibly non-readable attributes
+ # (see issue #1073)
+ if not name.startswith("pytest_"):
+ return
+ # ignore names which can not be hooks
+ if name == "pytest_plugins":
+ return
+
+ method = getattr(plugin, name)
+ opts = super(PytestPluginManager, self).parse_hookimpl_opts(plugin, name)
+
+ # consider only actual functions for hooks (#3775)
+ if not inspect.isroutine(method):
+ return
+
+ # collect unmarked hooks as long as they have the `pytest_' prefix
+ if opts is None and name.startswith("pytest_"):
+ opts = {}
+ if opts is not None:
+ # TODO: DeprecationWarning, people should use hookimpl
+ # https://github.com/pytest-dev/pytest/issues/4562
+ known_marks = {m.name for m in getattr(method, "pytestmark", [])}
+
+ for name in ("tryfirst", "trylast", "optionalhook", "hookwrapper"):
+ opts.setdefault(name, hasattr(method, name) or name in known_marks)
+ return opts
+
+ def parse_hookspec_opts(self, module_or_class, name):
+ opts = super(PytestPluginManager, self).parse_hookspec_opts(
+ module_or_class, name
+ )
+ if opts is None:
+ method = getattr(module_or_class, name)
+
+ if name.startswith("pytest_"):
+ # todo: deprecate hookspec hacks
+ # https://github.com/pytest-dev/pytest/issues/4562
+ known_marks = {m.name for m in getattr(method, "pytestmark", [])}
+ opts = {
+ "firstresult": hasattr(method, "firstresult")
+ or "firstresult" in known_marks,
+ "historic": hasattr(method, "historic")
+ or "historic" in known_marks,
+ }
+ return opts
+
+ def register(self, plugin, name=None):
+ if name in ["pytest_catchlog", "pytest_capturelog"]:
+ warnings.warn(
+ PytestConfigWarning(
+ "{} plugin has been merged into the core, "
+ "please remove it from your requirements.".format(
+ name.replace("_", "-")
+ )
+ )
+ )
+ return
+ ret = super(PytestPluginManager, self).register(plugin, name)
+ if ret:
+ self.hook.pytest_plugin_registered.call_historic(
+ kwargs=dict(plugin=plugin, manager=self)
+ )
+
+ if isinstance(plugin, types.ModuleType):
+ self.consider_module(plugin)
+ return ret
+
+ def getplugin(self, name):
+ # support deprecated naming because plugins (xdist e.g.) use it
+ return self.get_plugin(name)
+
+ def hasplugin(self, name):
+ """Return True if the plugin with the given name is registered."""
+ return bool(self.get_plugin(name))
+
+ def pytest_configure(self, config):
+ # XXX now that the pluginmanager exposes hookimpl(tryfirst...)
+ # we should remove tryfirst/trylast as markers
+ config.addinivalue_line(
+ "markers",
+ "tryfirst: mark a hook implementation function such that the "
+ "plugin machinery will try to call it first/as early as possible.",
+ )
+ config.addinivalue_line(
+ "markers",
+ "trylast: mark a hook implementation function such that the "
+ "plugin machinery will try to call it last/as late as possible.",
+ )
+ self._configured = True
+
+ #
+ # internal API for local conftest plugin handling
+ #
+ def _set_initial_conftests(self, namespace):
+ """ load initial conftest files given a preparsed "namespace".
+ As conftest files may add their own command line options
+ which have arguments ('--my-opt somepath') we might get some
+ false positives. All builtin and 3rd party plugins will have
+ been loaded, however, so common options will not confuse our logic
+ here.
+ """
+ current = py.path.local()
+ self._confcutdir = (
+ current.join(namespace.confcutdir, abs=True)
+ if namespace.confcutdir
+ else None
+ )
+ self._noconftest = namespace.noconftest
+ self._using_pyargs = namespace.pyargs
+ testpaths = namespace.file_or_dir
+ foundanchor = False
+ for path in testpaths:
+ path = str(path)
+ # remove node-id syntax
+ i = path.find("::")
+ if i != -1:
+ path = path[:i]
+ anchor = current.join(path, abs=1)
+ if exists(anchor): # we found some file object
+ self._try_load_conftest(anchor)
+ foundanchor = True
+ if not foundanchor:
+ self._try_load_conftest(current)
+
+ def _try_load_conftest(self, anchor):
+ self._getconftestmodules(anchor)
+ # let's also consider test* subdirs
+ if anchor.check(dir=1):
+ for x in anchor.listdir("test*"):
+ if x.check(dir=1):
+ self._getconftestmodules(x)
+
+ @lru_cache(maxsize=128)
+ def _getconftestmodules(self, path):
+ if self._noconftest:
+ return []
+
+ if path.isfile():
+ directory = path.dirpath()
+ else:
+ directory = path
+
+ if six.PY2: # py2 is not using lru_cache.
+ try:
+ return self._dirpath2confmods[directory]
+ except KeyError:
+ pass
+
+ # XXX these days we may rather want to use config.rootdir
+ # and allow users to opt into looking into the rootdir parent
+ # directories instead of requiring to specify confcutdir
+ clist = []
+ for parent in directory.realpath().parts():
+ if self._confcutdir and self._confcutdir.relto(parent):
+ continue
+ conftestpath = parent.join("conftest.py")
+ if conftestpath.isfile():
+ # Use realpath to avoid loading the same conftest twice
+ # with build systems that create build directories containing
+ # symlinks to actual files.
+ mod = self._importconftest(conftestpath.realpath())
+ clist.append(mod)
+ self._dirpath2confmods[directory] = clist
+ return clist
+
+ def _rget_with_confmod(self, name, path):
+ modules = self._getconftestmodules(path)
+ for mod in reversed(modules):
+ try:
+ return mod, getattr(mod, name)
+ except AttributeError:
+ continue
+ raise KeyError(name)
+
+ def _importconftest(self, conftestpath):
+ try:
+ return self._conftestpath2mod[conftestpath]
+ except KeyError:
+ pkgpath = conftestpath.pypkgpath()
+ if pkgpath is None:
+ _ensure_removed_sysmodule(conftestpath.purebasename)
+ try:
+ mod = conftestpath.pyimport()
+ if (
+ hasattr(mod, "pytest_plugins")
+ and self._configured
+ and not self._using_pyargs
+ ):
+ from _pytest.deprecated import (
+ PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST,
+ )
+
+ fail(
+ PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST.format(
+ conftestpath, self._confcutdir
+ ),
+ pytrace=False,
+ )
+ except Exception:
+ raise ConftestImportFailure(conftestpath, sys.exc_info())
+
+ self._conftest_plugins.add(mod)
+ self._conftestpath2mod[conftestpath] = mod
+ dirpath = conftestpath.dirpath()
+ if dirpath in self._dirpath2confmods:
+ for path, mods in self._dirpath2confmods.items():
+ if path and path.relto(dirpath) or path == dirpath:
+ assert mod not in mods
+ mods.append(mod)
+ self.trace("loaded conftestmodule %r" % (mod))
+ self.consider_conftest(mod)
+ return mod
+
+ #
+ # API for bootstrapping plugin loading
+ #
+ #
+
+ def consider_preparse(self, args):
+ i = 0
+ n = len(args)
+ while i < n:
+ opt = args[i]
+ i += 1
+ if isinstance(opt, six.string_types):
+ if opt == "-p":
+ try:
+ parg = args[i]
+ except IndexError:
+ return
+ i += 1
+ elif opt.startswith("-p"):
+ parg = opt[2:]
+ else:
+ continue
+ self.consider_pluginarg(parg)
+
+ def consider_pluginarg(self, arg):
+ if arg.startswith("no:"):
+ name = arg[3:]
+ if name in essential_plugins:
+ raise UsageError("plugin %s cannot be disabled" % name)
+
+ # PR #4304 : remove stepwise if cacheprovider is blocked
+ if name == "cacheprovider":
+ self.set_blocked("stepwise")
+ self.set_blocked("pytest_stepwise")
+
+ self.set_blocked(name)
+ if not name.startswith("pytest_"):
+ self.set_blocked("pytest_" + name)
+ else:
+ name = arg
+ # Unblock the plugin. None indicates that it has been blocked.
+ # There is no interface with pluggy for this.
+ if self._name2plugin.get(name, -1) is None:
+ del self._name2plugin[name]
+ if not name.startswith("pytest_"):
+ if self._name2plugin.get("pytest_" + name, -1) is None:
+ del self._name2plugin["pytest_" + name]
+ self.import_plugin(arg, consider_entry_points=True)
+
+ def consider_conftest(self, conftestmodule):
+ self.register(conftestmodule, name=conftestmodule.__file__)
+
+ def consider_env(self):
+ self._import_plugin_specs(os.environ.get("PYTEST_PLUGINS"))
+
+ def consider_module(self, mod):
+ self._import_plugin_specs(getattr(mod, "pytest_plugins", []))
+
+ def _import_plugin_specs(self, spec):
+ plugins = _get_plugin_specs_as_list(spec)
+ for import_spec in plugins:
+ self.import_plugin(import_spec)
+
+ def import_plugin(self, modname, consider_entry_points=False):
+ """
+ Imports a plugin with ``modname``. If ``consider_entry_points`` is True, entry point
+ names are also considered to find a plugin.
+ """
+ # most often modname refers to builtin modules, e.g. "pytester",
+ # "terminal" or "capture". Those plugins are registered under their
+ # basename for historic purposes but must be imported with the
+ # _pytest prefix.
+ assert isinstance(modname, six.string_types), (
+ "module name as text required, got %r" % modname
+ )
+ modname = str(modname)
+ if self.is_blocked(modname) or self.get_plugin(modname) is not None:
+ return
+
+ importspec = "_pytest." + modname if modname in builtin_plugins else modname
+ self.rewrite_hook.mark_rewrite(importspec)
+
+ if consider_entry_points:
+ loaded = self.load_setuptools_entrypoints("pytest11", name=modname)
+ if loaded:
+ return
+
+ try:
+ __import__(importspec)
+ except ImportError as e:
+ new_exc_message = 'Error importing plugin "%s": %s' % (
+ modname,
+ safe_str(e.args[0]),
+ )
+ new_exc = ImportError(new_exc_message)
+ tb = sys.exc_info()[2]
+
+ six.reraise(ImportError, new_exc, tb)
+
+ except Skipped as e:
+ from _pytest.warnings import _issue_warning_captured
+
+ _issue_warning_captured(
+ PytestConfigWarning("skipped plugin %r: %s" % (modname, e.msg)),
+ self.hook,
+ stacklevel=1,
+ )
+ else:
+ mod = sys.modules[importspec]
+ self.register(mod, modname)
+
+
+def _get_plugin_specs_as_list(specs):
+ """
+ Parses a list of "plugin specs" and returns a list of plugin names.
+
+ Plugin specs can be given as a list of strings separated by "," or already as a list/tuple in
+ which case it is returned as a list. Specs can also be `None` in which case an
+ empty list is returned.
+ """
+ if specs is not None and not isinstance(specs, types.ModuleType):
+ if isinstance(specs, six.string_types):
+ specs = specs.split(",") if specs else []
+ if not isinstance(specs, (list, tuple)):
+ raise UsageError(
+ "Plugin specs must be a ','-separated string or a "
+ "list/tuple of strings for plugin names. Given: %r" % specs
+ )
+ return list(specs)
+ return []
+
+
+def _ensure_removed_sysmodule(modname):
+ try:
+ del sys.modules[modname]
+ except KeyError:
+ pass
+
+
+class Notset(object):
+ def __repr__(self):
+ return "<NOTSET>"
+
+
+notset = Notset()
+
+
+def _iter_rewritable_modules(package_files):
+ """
+ Given an iterable of file names in a source distribution, return the "names" that should
+ be marked for assertion rewrite (for example the package "pytest_mock/__init__.py" should
+ be added as "pytest_mock" in the assertion rewrite mechanism.
+
+ This function has to deal with dist-info based distributions and egg based distributions
+ (which are still very much in use for "editable" installs).
+
+ Here are the file names as seen in a dist-info based distribution:
+
+ pytest_mock/__init__.py
+ pytest_mock/_version.py
+ pytest_mock/plugin.py
+ pytest_mock.egg-info/PKG-INFO
+
+ Here are the file names as seen in an egg based distribution:
+
+ src/pytest_mock/__init__.py
+ src/pytest_mock/_version.py
+ src/pytest_mock/plugin.py
+ src/pytest_mock.egg-info/PKG-INFO
+ LICENSE
+ setup.py
+
+ We have to take in account those two distribution flavors in order to determine which
+ names should be considered for assertion rewriting.
+
+ More information:
+ https://github.com/pytest-dev/pytest-mock/issues/167
+ """
+ package_files = list(package_files)
+ seen_some = False
+ for fn in package_files:
+ is_simple_module = "/" not in fn and fn.endswith(".py")
+ is_package = fn.count("/") == 1 and fn.endswith("__init__.py")
+ if is_simple_module:
+ module_name, _ = os.path.splitext(fn)
+ # we ignore "setup.py" at the root of the distribution
+ if module_name != "setup":
+ seen_some = True
+ yield module_name
+ elif is_package:
+ package_name = os.path.dirname(fn)
+ seen_some = True
+ yield package_name
+
+ if not seen_some:
+ # at this point we did not find any packages or modules suitable for assertion
+ # rewriting, so we try again by stripping the first path component (to account for
+ # "src" based source trees for example)
+ # this approach lets us have the common case continue to be fast, as egg-distributions
+ # are rarer
+ new_package_files = []
+ for fn in package_files:
+ parts = fn.split("/")
+ new_fn = "/".join(parts[1:])
+ if new_fn:
+ new_package_files.append(new_fn)
+ if new_package_files:
+ for _module in _iter_rewritable_modules(new_package_files):
+ yield _module
+
+
+class Config(object):
+ """
+ Access to configuration values, pluginmanager and plugin hooks.
+
+ :ivar PytestPluginManager pluginmanager: the plugin manager handles plugin registration and hook invocation.
+
+ :ivar argparse.Namespace option: access to command line option as attributes.
+
+ :ivar InvocationParams invocation_params:
+
+ Object containing the parameters regarding the ``pytest.main``
+ invocation.
+ Contains the followinig read-only attributes:
+ * ``args``: list of command-line arguments as passed to ``pytest.main()``.
+ * ``plugins``: list of extra plugins, might be None
+ * ``dir``: directory where ``pytest.main()`` was invoked from.
+ """
+
+ @attr.s(frozen=True)
+ class InvocationParams(object):
+ """Holds parameters passed during ``pytest.main()``
+
+ .. note::
+
+ Currently the environment variable PYTEST_ADDOPTS is also handled by
+ pytest implicitly, not being part of the invocation.
+
+ Plugins accessing ``InvocationParams`` must be aware of that.
+ """
+
+ args = attr.ib()
+ plugins = attr.ib()
+ dir = attr.ib()
+
+ def __init__(self, pluginmanager, invocation_params=None, *args):
+ from .argparsing import Parser, FILE_OR_DIR
+
+ if invocation_params is None:
+ invocation_params = self.InvocationParams(
+ args=(), plugins=None, dir=Path().resolve()
+ )
+
+ #: access to command line option as attributes.
+ #: (deprecated), use :py:func:`getoption() <_pytest.config.Config.getoption>` instead
+ self.option = argparse.Namespace()
+
+ self.invocation_params = invocation_params
+
+ _a = FILE_OR_DIR
+ self._parser = Parser(
+ usage="%%(prog)s [options] [%s] [%s] [...]" % (_a, _a),
+ processopt=self._processopt,
+ )
+ #: a pluginmanager instance
+ self.pluginmanager = pluginmanager
+ self.trace = self.pluginmanager.trace.root.get("config")
+ self.hook = self.pluginmanager.hook
+ self._inicache = {}
+ self._override_ini = ()
+ self._opt2dest = {}
+ self._cleanup = []
+ self.pluginmanager.register(self, "pytestconfig")
+ self._configured = False
+ self.hook.pytest_addoption.call_historic(kwargs=dict(parser=self._parser))
+
+ @property
+ def invocation_dir(self):
+ """Backward compatibility"""
+ return py.path.local(str(self.invocation_params.dir))
+
+ def add_cleanup(self, func):
+ """ Add a function to be called when the config object gets out of
+ use (usually coninciding with pytest_unconfigure)."""
+ self._cleanup.append(func)
+
+ def _do_configure(self):
+ assert not self._configured
+ self._configured = True
+ self.hook.pytest_configure.call_historic(kwargs=dict(config=self))
+
+ def _ensure_unconfigure(self):
+ if self._configured:
+ self._configured = False
+ self.hook.pytest_unconfigure(config=self)
+ self.hook.pytest_configure._call_history = []
+ while self._cleanup:
+ fin = self._cleanup.pop()
+ fin()
+
+ def get_terminal_writer(self):
+ return self.pluginmanager.get_plugin("terminalreporter")._tw
+
+ def pytest_cmdline_parse(self, pluginmanager, args):
+ try:
+ self.parse(args)
+ except UsageError:
+
+ # Handle --version and --help here in a minimal fashion.
+ # This gets done via helpconfig normally, but its
+ # pytest_cmdline_main is not called in case of errors.
+ if getattr(self.option, "version", False) or "--version" in args:
+ from _pytest.helpconfig import showversion
+
+ showversion(self)
+ elif (
+ getattr(self.option, "help", False) or "--help" in args or "-h" in args
+ ):
+ self._parser._getparser().print_help()
+ sys.stdout.write(
+ "\nNOTE: displaying only minimal help due to UsageError.\n\n"
+ )
+
+ raise
+
+ return self
+
+ def notify_exception(self, excinfo, option=None):
+ if option and getattr(option, "fulltrace", False):
+ style = "long"
+ else:
+ style = "native"
+ excrepr = excinfo.getrepr(
+ funcargs=True, showlocals=getattr(option, "showlocals", False), style=style
+ )
+ res = self.hook.pytest_internalerror(excrepr=excrepr, excinfo=excinfo)
+ if not any(res):
+ for line in str(excrepr).split("\n"):
+ sys.stderr.write("INTERNALERROR> %s\n" % line)
+ sys.stderr.flush()
+
+ def cwd_relative_nodeid(self, nodeid):
+ # nodeid's are relative to the rootpath, compute relative to cwd
+ if self.invocation_dir != self.rootdir:
+ fullpath = self.rootdir.join(nodeid)
+ nodeid = self.invocation_dir.bestrelpath(fullpath)
+ return nodeid
+
+ @classmethod
+ def fromdictargs(cls, option_dict, args):
+ """ constructor useable for subprocesses. """
+ config = get_config(args)
+ config.option.__dict__.update(option_dict)
+ config.parse(args, addopts=False)
+ for x in config.option.plugins:
+ config.pluginmanager.consider_pluginarg(x)
+ return config
+
+ def _processopt(self, opt):
+ for name in opt._short_opts + opt._long_opts:
+ self._opt2dest[name] = opt.dest
+
+ if hasattr(opt, "default") and opt.dest:
+ if not hasattr(self.option, opt.dest):
+ setattr(self.option, opt.dest, opt.default)
+
+ @hookimpl(trylast=True)
+ def pytest_load_initial_conftests(self, early_config):
+ self.pluginmanager._set_initial_conftests(early_config.known_args_namespace)
+
+ def _initini(self, args):
+ ns, unknown_args = self._parser.parse_known_and_unknown_args(
+ args, namespace=copy.copy(self.option)
+ )
+ r = determine_setup(
+ ns.inifilename,
+ ns.file_or_dir + unknown_args,
+ rootdir_cmd_arg=ns.rootdir or None,
+ config=self,
+ )
+ self.rootdir, self.inifile, self.inicfg = r
+ self._parser.extra_info["rootdir"] = self.rootdir
+ self._parser.extra_info["inifile"] = self.inifile
+ self._parser.addini("addopts", "extra command line options", "args")
+ self._parser.addini("minversion", "minimally required pytest version")
+ self._override_ini = ns.override_ini or ()
+
+ def _consider_importhook(self, args):
+ """Install the PEP 302 import hook if using assertion rewriting.
+
+ Needs to parse the --assert=<mode> option from the commandline
+ and find all the installed plugins to mark them for rewriting
+ by the importhook.
+ """
+ ns, unknown_args = self._parser.parse_known_and_unknown_args(args)
+ mode = getattr(ns, "assertmode", "plain")
+ if mode == "rewrite":
+ try:
+ hook = _pytest.assertion.install_importhook(self)
+ except SystemError:
+ mode = "plain"
+ else:
+ self._mark_plugins_for_rewrite(hook)
+ _warn_about_missing_assertion(mode)
+
+ def _mark_plugins_for_rewrite(self, hook):
+ """
+ Given an importhook, mark for rewrite any top-level
+ modules or packages in the distribution package for
+ all pytest plugins.
+ """
+ self.pluginmanager.rewrite_hook = hook
+
+ if os.environ.get("PYTEST_DISABLE_PLUGIN_AUTOLOAD"):
+ # We don't autoload from setuptools entry points, no need to continue.
+ return
+
+ package_files = (
+ str(file)
+ for dist in importlib_metadata.distributions()
+ if any(ep.group == "pytest11" for ep in dist.entry_points)
+ for file in dist.files or []
+ )
+
+ for name in _iter_rewritable_modules(package_files):
+ hook.mark_rewrite(name)
+
+ def _validate_args(self, args, via):
+ """Validate known args."""
+ self._parser._config_source_hint = via
+ try:
+ self._parser.parse_known_and_unknown_args(
+ args, namespace=copy.copy(self.option)
+ )
+ finally:
+ del self._parser._config_source_hint
+
+ return args
+
+ def _preparse(self, args, addopts=True):
+ if addopts:
+ env_addopts = os.environ.get("PYTEST_ADDOPTS", "")
+ if len(env_addopts):
+ args[:] = (
+ self._validate_args(shlex.split(env_addopts), "via PYTEST_ADDOPTS")
+ + args
+ )
+ self._initini(args)
+ if addopts:
+ args[:] = (
+ self._validate_args(self.getini("addopts"), "via addopts config") + args
+ )
+
+ self._checkversion()
+ self._consider_importhook(args)
+ self.pluginmanager.consider_preparse(args)
+ if not os.environ.get("PYTEST_DISABLE_PLUGIN_AUTOLOAD"):
+ # Don't autoload from setuptools entry point. Only explicitly specified
+ # plugins are going to be loaded.
+ self.pluginmanager.load_setuptools_entrypoints("pytest11")
+ self.pluginmanager.consider_env()
+ self.known_args_namespace = ns = self._parser.parse_known_args(
+ args, namespace=copy.copy(self.option)
+ )
+ if self.known_args_namespace.confcutdir is None and self.inifile:
+ confcutdir = py.path.local(self.inifile).dirname
+ self.known_args_namespace.confcutdir = confcutdir
+ try:
+ self.hook.pytest_load_initial_conftests(
+ early_config=self, args=args, parser=self._parser
+ )
+ except ConftestImportFailure:
+ e = sys.exc_info()[1]
+ if ns.help or ns.version:
+ # we don't want to prevent --help/--version to work
+ # so just let is pass and print a warning at the end
+ from _pytest.warnings import _issue_warning_captured
+
+ _issue_warning_captured(
+ PytestConfigWarning(
+ "could not load initial conftests: {}".format(e.path)
+ ),
+ self.hook,
+ stacklevel=2,
+ )
+ else:
+ raise
+
+ def _checkversion(self):
+ import pytest
+
+ minver = self.inicfg.get("minversion", None)
+ if minver:
+ if Version(minver) > Version(pytest.__version__):
+ raise pytest.UsageError(
+ "%s:%d: requires pytest-%s, actual pytest-%s'"
+ % (
+ self.inicfg.config.path,
+ self.inicfg.lineof("minversion"),
+ minver,
+ pytest.__version__,
+ )
+ )
+
+ def parse(self, args, addopts=True):
+ # parse given cmdline arguments into this config object.
+ assert not hasattr(
+ self, "args"
+ ), "can only parse cmdline args at most once per Config object"
+ self._origargs = args
+ self.hook.pytest_addhooks.call_historic(
+ kwargs=dict(pluginmanager=self.pluginmanager)
+ )
+ self._preparse(args, addopts=addopts)
+ # XXX deprecated hook:
+ self.hook.pytest_cmdline_preparse(config=self, args=args)
+ self._parser.after_preparse = True
+ try:
+ args = self._parser.parse_setoption(
+ args, self.option, namespace=self.option
+ )
+ if not args:
+ if self.invocation_dir == self.rootdir:
+ args = self.getini("testpaths")
+ if not args:
+ args = [str(self.invocation_dir)]
+ self.args = args
+ except PrintHelp:
+ pass
+
+ def addinivalue_line(self, name, line):
+ """ add a line to an ini-file option. The option must have been
+ declared but might not yet be set in which case the line becomes the
+ the first line in its value. """
+ x = self.getini(name)
+ assert isinstance(x, list)
+ x.append(line) # modifies the cached list inline
+
+ def getini(self, name):
+ """ return configuration value from an :ref:`ini file <inifiles>`. If the
+ specified name hasn't been registered through a prior
+ :py:func:`parser.addini <_pytest.config.Parser.addini>`
+ call (usually from a plugin), a ValueError is raised. """
+ try:
+ return self._inicache[name]
+ except KeyError:
+ self._inicache[name] = val = self._getini(name)
+ return val
+
+ def _getini(self, name):
+ try:
+ description, type, default = self._parser._inidict[name]
+ except KeyError:
+ raise ValueError("unknown configuration value: %r" % (name,))
+ value = self._get_override_ini_value(name)
+ if value is None:
+ try:
+ value = self.inicfg[name]
+ except KeyError:
+ if default is not None:
+ return default
+ if type is None:
+ return ""
+ return []
+ if type == "pathlist":
+ dp = py.path.local(self.inicfg.config.path).dirpath()
+ values = []
+ for relpath in shlex.split(value):
+ values.append(dp.join(relpath, abs=True))
+ return values
+ elif type == "args":
+ return shlex.split(value)
+ elif type == "linelist":
+ return [t for t in map(lambda x: x.strip(), value.split("\n")) if t]
+ elif type == "bool":
+ return bool(_strtobool(value.strip()))
+ else:
+ assert type is None
+ return value
+
+ def _getconftest_pathlist(self, name, path):
+ try:
+ mod, relroots = self.pluginmanager._rget_with_confmod(name, path)
+ except KeyError:
+ return None
+ modpath = py.path.local(mod.__file__).dirpath()
+ values = []
+ for relroot in relroots:
+ if not isinstance(relroot, py.path.local):
+ relroot = relroot.replace("/", py.path.local.sep)
+ relroot = modpath.join(relroot, abs=True)
+ values.append(relroot)
+ return values
+
+ def _get_override_ini_value(self, name):
+ value = None
+ # override_ini is a list of "ini=value" options
+ # always use the last item if multiple values are set for same ini-name,
+ # e.g. -o foo=bar1 -o foo=bar2 will set foo to bar2
+ for ini_config in self._override_ini:
+ try:
+ key, user_ini_value = ini_config.split("=", 1)
+ except ValueError:
+ raise UsageError("-o/--override-ini expects option=value style.")
+ else:
+ if key == name:
+ value = user_ini_value
+ return value
+
+ def getoption(self, name, default=notset, skip=False):
+ """ return command line option value.
+
+ :arg name: name of the option. You may also specify
+ the literal ``--OPT`` option instead of the "dest" option name.
+ :arg default: default value if no option of that name exists.
+ :arg skip: if True raise pytest.skip if option does not exists
+ or has a None value.
+ """
+ name = self._opt2dest.get(name, name)
+ try:
+ val = getattr(self.option, name)
+ if val is None and skip:
+ raise AttributeError(name)
+ return val
+ except AttributeError:
+ if default is not notset:
+ return default
+ if skip:
+ import pytest
+
+ pytest.skip("no %r option found" % (name,))
+ raise ValueError("no option named %r" % (name,))
+
+ def getvalue(self, name, path=None):
+ """ (deprecated, use getoption()) """
+ return self.getoption(name)
+
+ def getvalueorskip(self, name, path=None):
+ """ (deprecated, use getoption(skip=True)) """
+ return self.getoption(name, skip=True)
+
+
+def _assertion_supported():
+ try:
+ assert False
+ except AssertionError:
+ return True
+ else:
+ return False
+
+
+def _warn_about_missing_assertion(mode):
+ if not _assertion_supported():
+ if mode == "plain":
+ sys.stderr.write(
+ "WARNING: ASSERTIONS ARE NOT EXECUTED"
+ " and FAILING TESTS WILL PASS. Are you"
+ " using python -O?"
+ )
+ else:
+ sys.stderr.write(
+ "WARNING: assertions not in test modules or"
+ " plugins will be ignored"
+ " because assert statements are not executed "
+ "by the underlying Python interpreter "
+ "(are you using python -O?)\n"
+ )
+
+
+def setns(obj, dic):
+ import pytest
+
+ for name, value in dic.items():
+ if isinstance(value, dict):
+ mod = getattr(obj, name, None)
+ if mod is None:
+ modname = "pytest.%s" % name
+ mod = types.ModuleType(modname)
+ sys.modules[modname] = mod
+ mod.__all__ = []
+ setattr(obj, name, mod)
+ obj.__all__.append(name)
+ setns(mod, value)
+ else:
+ setattr(obj, name, value)
+ obj.__all__.append(name)
+ # if obj != pytest:
+ # pytest.__all__.append(name)
+ setattr(pytest, name, value)
+
+
+def create_terminal_writer(config, *args, **kwargs):
+ """Create a TerminalWriter instance configured according to the options
+ in the config object. Every code which requires a TerminalWriter object
+ and has access to a config object should use this function.
+ """
+ tw = py.io.TerminalWriter(*args, **kwargs)
+ if config.option.color == "yes":
+ tw.hasmarkup = True
+ if config.option.color == "no":
+ tw.hasmarkup = False
+ return tw
+
+
+def _strtobool(val):
+ """Convert a string representation of truth to true (1) or false (0).
+
+ True values are 'y', 'yes', 't', 'true', 'on', and '1'; false values
+ are 'n', 'no', 'f', 'false', 'off', and '0'. Raises ValueError if
+ 'val' is anything else.
+
+ .. note:: copied from distutils.util
+ """
+ val = val.lower()
+ if val in ("y", "yes", "t", "true", "on", "1"):
+ return 1
+ elif val in ("n", "no", "f", "false", "off", "0"):
+ return 0
+ else:
+ raise ValueError("invalid truth value %r" % (val,))
diff --git a/contrib/python/pytest/py2/_pytest/config/argparsing.py b/contrib/python/pytest/py2/_pytest/config/argparsing.py
new file mode 100644
index 00000000000..37fb772db99
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/config/argparsing.py
@@ -0,0 +1,410 @@
+# -*- coding: utf-8 -*-
+import argparse
+import warnings
+
+import py
+import six
+
+from _pytest.config.exceptions import UsageError
+
+FILE_OR_DIR = "file_or_dir"
+
+
+class Parser(object):
+ """ Parser for command line arguments and ini-file values.
+
+ :ivar extra_info: dict of generic param -> value to display in case
+ there's an error processing the command line arguments.
+ """
+
+ prog = None
+
+ def __init__(self, usage=None, processopt=None):
+ self._anonymous = OptionGroup("custom options", parser=self)
+ self._groups = []
+ self._processopt = processopt
+ self._usage = usage
+ self._inidict = {}
+ self._ininames = []
+ self.extra_info = {}
+
+ def processoption(self, option):
+ if self._processopt:
+ if option.dest:
+ self._processopt(option)
+
+ def getgroup(self, name, description="", after=None):
+ """ get (or create) a named option Group.
+
+ :name: name of the option group.
+ :description: long description for --help output.
+ :after: name of other group, used for ordering --help output.
+
+ The returned group object has an ``addoption`` method with the same
+ signature as :py:func:`parser.addoption
+ <_pytest.config.Parser.addoption>` but will be shown in the
+ respective group in the output of ``pytest. --help``.
+ """
+ for group in self._groups:
+ if group.name == name:
+ return group
+ group = OptionGroup(name, description, parser=self)
+ i = 0
+ for i, grp in enumerate(self._groups):
+ if grp.name == after:
+ break
+ self._groups.insert(i + 1, group)
+ return group
+
+ def addoption(self, *opts, **attrs):
+ """ register a command line option.
+
+ :opts: option names, can be short or long options.
+ :attrs: same attributes which the ``add_option()`` function of the
+ `argparse library
+ <http://docs.python.org/2/library/argparse.html>`_
+ accepts.
+
+ After command line parsing options are available on the pytest config
+ object via ``config.option.NAME`` where ``NAME`` is usually set
+ by passing a ``dest`` attribute, for example
+ ``addoption("--long", dest="NAME", ...)``.
+ """
+ self._anonymous.addoption(*opts, **attrs)
+
+ def parse(self, args, namespace=None):
+ from _pytest._argcomplete import try_argcomplete
+
+ self.optparser = self._getparser()
+ try_argcomplete(self.optparser)
+ args = [str(x) if isinstance(x, py.path.local) else x for x in args]
+ return self.optparser.parse_args(args, namespace=namespace)
+
+ def _getparser(self):
+ from _pytest._argcomplete import filescompleter
+
+ optparser = MyOptionParser(self, self.extra_info, prog=self.prog)
+ groups = self._groups + [self._anonymous]
+ for group in groups:
+ if group.options:
+ desc = group.description or group.name
+ arggroup = optparser.add_argument_group(desc)
+ for option in group.options:
+ n = option.names()
+ a = option.attrs()
+ arggroup.add_argument(*n, **a)
+ # bash like autocompletion for dirs (appending '/')
+ optparser.add_argument(FILE_OR_DIR, nargs="*").completer = filescompleter
+ return optparser
+
+ def parse_setoption(self, args, option, namespace=None):
+ parsedoption = self.parse(args, namespace=namespace)
+ for name, value in parsedoption.__dict__.items():
+ setattr(option, name, value)
+ return getattr(parsedoption, FILE_OR_DIR)
+
+ def parse_known_args(self, args, namespace=None):
+ """parses and returns a namespace object with known arguments at this
+ point.
+ """
+ return self.parse_known_and_unknown_args(args, namespace=namespace)[0]
+
+ def parse_known_and_unknown_args(self, args, namespace=None):
+ """parses and returns a namespace object with known arguments, and
+ the remaining arguments unknown at this point.
+ """
+ optparser = self._getparser()
+ args = [str(x) if isinstance(x, py.path.local) else x for x in args]
+ return optparser.parse_known_args(args, namespace=namespace)
+
+ def addini(self, name, help, type=None, default=None):
+ """ register an ini-file option.
+
+ :name: name of the ini-variable
+ :type: type of the variable, can be ``pathlist``, ``args``, ``linelist``
+ or ``bool``.
+ :default: default value if no ini-file option exists but is queried.
+
+ The value of ini-variables can be retrieved via a call to
+ :py:func:`config.getini(name) <_pytest.config.Config.getini>`.
+ """
+ assert type in (None, "pathlist", "args", "linelist", "bool")
+ self._inidict[name] = (help, type, default)
+ self._ininames.append(name)
+
+
+class ArgumentError(Exception):
+ """
+ Raised if an Argument instance is created with invalid or
+ inconsistent arguments.
+ """
+
+ def __init__(self, msg, option):
+ self.msg = msg
+ self.option_id = str(option)
+
+ def __str__(self):
+ if self.option_id:
+ return "option %s: %s" % (self.option_id, self.msg)
+ else:
+ return self.msg
+
+
+class Argument(object):
+ """class that mimics the necessary behaviour of optparse.Option
+
+ it's currently a least effort implementation
+ and ignoring choices and integer prefixes
+ https://docs.python.org/3/library/optparse.html#optparse-standard-option-types
+ """
+
+ _typ_map = {"int": int, "string": str, "float": float, "complex": complex}
+
+ def __init__(self, *names, **attrs):
+ """store parms in private vars for use in add_argument"""
+ self._attrs = attrs
+ self._short_opts = []
+ self._long_opts = []
+ self.dest = attrs.get("dest")
+ if "%default" in (attrs.get("help") or ""):
+ warnings.warn(
+ 'pytest now uses argparse. "%default" should be'
+ ' changed to "%(default)s" ',
+ DeprecationWarning,
+ stacklevel=3,
+ )
+ try:
+ typ = attrs["type"]
+ except KeyError:
+ pass
+ else:
+ # this might raise a keyerror as well, don't want to catch that
+ if isinstance(typ, six.string_types):
+ if typ == "choice":
+ warnings.warn(
+ "`type` argument to addoption() is the string %r."
+ " For choices this is optional and can be omitted, "
+ " but when supplied should be a type (for example `str` or `int`)."
+ " (options: %s)" % (typ, names),
+ DeprecationWarning,
+ stacklevel=4,
+ )
+ # argparse expects a type here take it from
+ # the type of the first element
+ attrs["type"] = type(attrs["choices"][0])
+ else:
+ warnings.warn(
+ "`type` argument to addoption() is the string %r, "
+ " but when supplied should be a type (for example `str` or `int`)."
+ " (options: %s)" % (typ, names),
+ DeprecationWarning,
+ stacklevel=4,
+ )
+ attrs["type"] = Argument._typ_map[typ]
+ # used in test_parseopt -> test_parse_defaultgetter
+ self.type = attrs["type"]
+ else:
+ self.type = typ
+ try:
+ # attribute existence is tested in Config._processopt
+ self.default = attrs["default"]
+ except KeyError:
+ pass
+ self._set_opt_strings(names)
+ if not self.dest:
+ if self._long_opts:
+ self.dest = self._long_opts[0][2:].replace("-", "_")
+ else:
+ try:
+ self.dest = self._short_opts[0][1:]
+ except IndexError:
+ raise ArgumentError("need a long or short option", self)
+
+ def names(self):
+ return self._short_opts + self._long_opts
+
+ def attrs(self):
+ # update any attributes set by processopt
+ attrs = "default dest help".split()
+ if self.dest:
+ attrs.append(self.dest)
+ for attr in attrs:
+ try:
+ self._attrs[attr] = getattr(self, attr)
+ except AttributeError:
+ pass
+ if self._attrs.get("help"):
+ a = self._attrs["help"]
+ a = a.replace("%default", "%(default)s")
+ # a = a.replace('%prog', '%(prog)s')
+ self._attrs["help"] = a
+ return self._attrs
+
+ def _set_opt_strings(self, opts):
+ """directly from optparse
+
+ might not be necessary as this is passed to argparse later on"""
+ for opt in opts:
+ if len(opt) < 2:
+ raise ArgumentError(
+ "invalid option string %r: "
+ "must be at least two characters long" % opt,
+ self,
+ )
+ elif len(opt) == 2:
+ if not (opt[0] == "-" and opt[1] != "-"):
+ raise ArgumentError(
+ "invalid short option string %r: "
+ "must be of the form -x, (x any non-dash char)" % opt,
+ self,
+ )
+ self._short_opts.append(opt)
+ else:
+ if not (opt[0:2] == "--" and opt[2] != "-"):
+ raise ArgumentError(
+ "invalid long option string %r: "
+ "must start with --, followed by non-dash" % opt,
+ self,
+ )
+ self._long_opts.append(opt)
+
+ def __repr__(self):
+ args = []
+ if self._short_opts:
+ args += ["_short_opts: " + repr(self._short_opts)]
+ if self._long_opts:
+ args += ["_long_opts: " + repr(self._long_opts)]
+ args += ["dest: " + repr(self.dest)]
+ if hasattr(self, "type"):
+ args += ["type: " + repr(self.type)]
+ if hasattr(self, "default"):
+ args += ["default: " + repr(self.default)]
+ return "Argument({})".format(", ".join(args))
+
+
+class OptionGroup(object):
+ def __init__(self, name, description="", parser=None):
+ self.name = name
+ self.description = description
+ self.options = []
+ self.parser = parser
+
+ def addoption(self, *optnames, **attrs):
+ """ add an option to this group.
+
+ if a shortened version of a long option is specified it will
+ be suppressed in the help. addoption('--twowords', '--two-words')
+ results in help showing '--two-words' only, but --twowords gets
+ accepted **and** the automatic destination is in args.twowords
+ """
+ conflict = set(optnames).intersection(
+ name for opt in self.options for name in opt.names()
+ )
+ if conflict:
+ raise ValueError("option names %s already added" % conflict)
+ option = Argument(*optnames, **attrs)
+ self._addoption_instance(option, shortupper=False)
+
+ def _addoption(self, *optnames, **attrs):
+ option = Argument(*optnames, **attrs)
+ self._addoption_instance(option, shortupper=True)
+
+ def _addoption_instance(self, option, shortupper=False):
+ if not shortupper:
+ for opt in option._short_opts:
+ if opt[0] == "-" and opt[1].islower():
+ raise ValueError("lowercase shortoptions reserved")
+ if self.parser:
+ self.parser.processoption(option)
+ self.options.append(option)
+
+
+class MyOptionParser(argparse.ArgumentParser):
+ def __init__(self, parser, extra_info=None, prog=None):
+ if not extra_info:
+ extra_info = {}
+ self._parser = parser
+ argparse.ArgumentParser.__init__(
+ self,
+ prog=prog,
+ usage=parser._usage,
+ add_help=False,
+ formatter_class=DropShorterLongHelpFormatter,
+ )
+ # extra_info is a dict of (param -> value) to display if there's
+ # an usage error to provide more contextual information to the user
+ self.extra_info = extra_info
+
+ def error(self, message):
+ """Transform argparse error message into UsageError."""
+ msg = "%s: error: %s" % (self.prog, message)
+
+ if hasattr(self._parser, "_config_source_hint"):
+ msg = "%s (%s)" % (msg, self._parser._config_source_hint)
+
+ raise UsageError(self.format_usage() + msg)
+
+ def parse_args(self, args=None, namespace=None):
+ """allow splitting of positional arguments"""
+ args, argv = self.parse_known_args(args, namespace)
+ if argv:
+ for arg in argv:
+ if arg and arg[0] == "-":
+ lines = ["unrecognized arguments: %s" % (" ".join(argv))]
+ for k, v in sorted(self.extra_info.items()):
+ lines.append(" %s: %s" % (k, v))
+ self.error("\n".join(lines))
+ getattr(args, FILE_OR_DIR).extend(argv)
+ return args
+
+
+class DropShorterLongHelpFormatter(argparse.HelpFormatter):
+ """shorten help for long options that differ only in extra hyphens
+
+ - collapse **long** options that are the same except for extra hyphens
+ - special action attribute map_long_option allows surpressing additional
+ long options
+ - shortcut if there are only two options and one of them is a short one
+ - cache result on action object as this is called at least 2 times
+ """
+
+ def _format_action_invocation(self, action):
+ orgstr = argparse.HelpFormatter._format_action_invocation(self, action)
+ if orgstr and orgstr[0] != "-": # only optional arguments
+ return orgstr
+ res = getattr(action, "_formatted_action_invocation", None)
+ if res:
+ return res
+ options = orgstr.split(", ")
+ if len(options) == 2 and (len(options[0]) == 2 or len(options[1]) == 2):
+ # a shortcut for '-h, --help' or '--abc', '-a'
+ action._formatted_action_invocation = orgstr
+ return orgstr
+ return_list = []
+ option_map = getattr(action, "map_long_option", {})
+ if option_map is None:
+ option_map = {}
+ short_long = {}
+ for option in options:
+ if len(option) == 2 or option[2] == " ":
+ continue
+ if not option.startswith("--"):
+ raise ArgumentError(
+ 'long optional argument without "--": [%s]' % (option), self
+ )
+ xxoption = option[2:]
+ if xxoption.split()[0] not in option_map:
+ shortened = xxoption.replace("-", "")
+ if shortened not in short_long or len(short_long[shortened]) < len(
+ xxoption
+ ):
+ short_long[shortened] = xxoption
+ # now short_long has been filled out to the longest with dashes
+ # **and** we keep the right option ordering from add_argument
+ for option in options:
+ if len(option) == 2 or option[2] == " ":
+ return_list.append(option)
+ if option[2:] == short_long.get(option.replace("-", "")):
+ return_list.append(option.replace(" ", "=", 1))
+ action._formatted_action_invocation = ", ".join(return_list)
+ return action._formatted_action_invocation
diff --git a/contrib/python/pytest/py2/_pytest/config/exceptions.py b/contrib/python/pytest/py2/_pytest/config/exceptions.py
new file mode 100644
index 00000000000..bf58fde5dbf
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/config/exceptions.py
@@ -0,0 +1,10 @@
+# -*- coding: utf-8 -*-
+class UsageError(Exception):
+ """ error in pytest usage or invocation"""
+
+
+class PrintHelp(Exception):
+ """Raised when pytest should print it's help to skip the rest of the
+ argument parsing and validation."""
+
+ pass
diff --git a/contrib/python/pytest/py2/_pytest/config/findpaths.py b/contrib/python/pytest/py2/_pytest/config/findpaths.py
new file mode 100644
index 00000000000..e6779b289bc
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/config/findpaths.py
@@ -0,0 +1,153 @@
+# -*- coding: utf-8 -*-
+import os
+
+import py
+
+from .exceptions import UsageError
+from _pytest.outcomes import fail
+
+
+def exists(path, ignore=EnvironmentError):
+ try:
+ return path.check()
+ except ignore:
+ return False
+
+
+def getcfg(args, config=None):
+ """
+ Search the list of arguments for a valid ini-file for pytest,
+ and return a tuple of (rootdir, inifile, cfg-dict).
+
+ note: config is optional and used only to issue warnings explicitly (#2891).
+ """
+ from _pytest.deprecated import CFG_PYTEST_SECTION
+
+ inibasenames = ["pytest.ini", "tox.ini", "setup.cfg"]
+ args = [x for x in args if not str(x).startswith("-")]
+ if not args:
+ args = [py.path.local()]
+ for arg in args:
+ arg = py.path.local(arg)
+ for base in arg.parts(reverse=True):
+ for inibasename in inibasenames:
+ p = base.join(inibasename)
+ if exists(p):
+ try:
+ iniconfig = py.iniconfig.IniConfig(p)
+ except py.iniconfig.ParseError as exc:
+ raise UsageError(str(exc))
+
+ if (
+ inibasename == "setup.cfg"
+ and "tool:pytest" in iniconfig.sections
+ ):
+ return base, p, iniconfig["tool:pytest"]
+ elif "pytest" in iniconfig.sections:
+ if inibasename == "setup.cfg" and config is not None:
+
+ fail(
+ CFG_PYTEST_SECTION.format(filename=inibasename),
+ pytrace=False,
+ )
+ return base, p, iniconfig["pytest"]
+ elif inibasename == "pytest.ini":
+ # allowed to be empty
+ return base, p, {}
+ return None, None, None
+
+
+def get_common_ancestor(paths):
+ common_ancestor = None
+ for path in paths:
+ if not path.exists():
+ continue
+ if common_ancestor is None:
+ common_ancestor = path
+ else:
+ if path.relto(common_ancestor) or path == common_ancestor:
+ continue
+ elif common_ancestor.relto(path):
+ common_ancestor = path
+ else:
+ shared = path.common(common_ancestor)
+ if shared is not None:
+ common_ancestor = shared
+ if common_ancestor is None:
+ common_ancestor = py.path.local()
+ elif common_ancestor.isfile():
+ common_ancestor = common_ancestor.dirpath()
+ return common_ancestor
+
+
+def get_dirs_from_args(args):
+ def is_option(x):
+ return str(x).startswith("-")
+
+ def get_file_part_from_node_id(x):
+ return str(x).split("::")[0]
+
+ def get_dir_from_path(path):
+ if path.isdir():
+ return path
+ return py.path.local(path.dirname)
+
+ # These look like paths but may not exist
+ possible_paths = (
+ py.path.local(get_file_part_from_node_id(arg))
+ for arg in args
+ if not is_option(arg)
+ )
+
+ return [get_dir_from_path(path) for path in possible_paths if path.exists()]
+
+
+def determine_setup(inifile, args, rootdir_cmd_arg=None, config=None):
+ dirs = get_dirs_from_args(args)
+ if inifile:
+ iniconfig = py.iniconfig.IniConfig(inifile)
+ is_cfg_file = str(inifile).endswith(".cfg")
+ sections = ["tool:pytest", "pytest"] if is_cfg_file else ["pytest"]
+ for section in sections:
+ try:
+ inicfg = iniconfig[section]
+ if is_cfg_file and section == "pytest" and config is not None:
+ from _pytest.deprecated import CFG_PYTEST_SECTION
+
+ fail(
+ CFG_PYTEST_SECTION.format(filename=str(inifile)), pytrace=False
+ )
+ break
+ except KeyError:
+ inicfg = None
+ if rootdir_cmd_arg is None:
+ rootdir = get_common_ancestor(dirs)
+ else:
+ ancestor = get_common_ancestor(dirs)
+ rootdir, inifile, inicfg = getcfg([ancestor], config=config)
+ if rootdir is None and rootdir_cmd_arg is None:
+ for possible_rootdir in ancestor.parts(reverse=True):
+ if possible_rootdir.join("setup.py").exists():
+ rootdir = possible_rootdir
+ break
+ else:
+ if dirs != [ancestor]:
+ rootdir, inifile, inicfg = getcfg(dirs, config=config)
+ if rootdir is None:
+ if config is not None:
+ cwd = config.invocation_dir
+ else:
+ cwd = py.path.local()
+ rootdir = get_common_ancestor([cwd, ancestor])
+ is_fs_root = os.path.splitdrive(str(rootdir))[1] == "/"
+ if is_fs_root:
+ rootdir = ancestor
+ if rootdir_cmd_arg:
+ rootdir = py.path.local(os.path.expandvars(rootdir_cmd_arg))
+ if not rootdir.isdir():
+ raise UsageError(
+ "Directory '{}' not found. Check your '--rootdir' option.".format(
+ rootdir
+ )
+ )
+ return rootdir, inifile, inicfg or {}
diff --git a/contrib/python/pytest/py2/_pytest/debugging.py b/contrib/python/pytest/py2/_pytest/debugging.py
new file mode 100644
index 00000000000..bc114c8683f
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/debugging.py
@@ -0,0 +1,373 @@
+# -*- coding: utf-8 -*-
+""" interactive debugging with PDB, the Python Debugger. """
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import os
+import argparse
+import pdb
+import sys
+from doctest import UnexpectedException
+
+from _pytest import outcomes
+from _pytest.config import hookimpl
+from _pytest.config.exceptions import UsageError
+
+
+def import_readline():
+ try:
+ import readline
+ except ImportError:
+ sys.path.append('/usr/lib/python2.7/lib-dynload')
+
+ try:
+ import readline
+ except ImportError as e:
+ print('can not import readline:', e)
+
+ import subprocess
+ try:
+ subprocess.check_call('stty icrnl'.split())
+ except OSError as e:
+ print('can not restore Enter, use Control+J:', e)
+
+
+def tty():
+ if os.isatty(1):
+ return
+
+ fd = os.open('/dev/tty', os.O_RDWR)
+ os.dup2(fd, 0)
+ os.dup2(fd, 1)
+ os.dup2(fd, 2)
+ os.close(fd)
+
+ old_sys_path = sys.path
+ sys.path = list(sys.path)
+ try:
+ import_readline()
+ finally:
+ sys.path = old_sys_path
+
+
+def _validate_usepdb_cls(value):
+ """Validate syntax of --pdbcls option."""
+ try:
+ modname, classname = value.split(":")
+ except ValueError:
+ raise argparse.ArgumentTypeError(
+ "{!r} is not in the format 'modname:classname'".format(value)
+ )
+ return (modname, classname)
+
+
+def pytest_addoption(parser):
+ group = parser.getgroup("general")
+ group._addoption(
+ "--pdb",
+ dest="usepdb",
+ action="store_true",
+ help="start the interactive Python debugger on errors or KeyboardInterrupt.",
+ )
+ group._addoption(
+ "--pdbcls",
+ dest="usepdb_cls",
+ metavar="modulename:classname",
+ type=_validate_usepdb_cls,
+ help="start a custom interactive Python debugger on errors. "
+ "For example: --pdbcls=IPython.terminal.debugger:TerminalPdb",
+ )
+ group._addoption(
+ "--trace",
+ dest="trace",
+ action="store_true",
+ help="Immediately break when running each test.",
+ )
+
+
+def pytest_configure(config):
+ if config.getvalue("trace"):
+ config.pluginmanager.register(PdbTrace(), "pdbtrace")
+ if config.getvalue("usepdb"):
+ config.pluginmanager.register(PdbInvoke(), "pdbinvoke")
+
+ pytestPDB._saved.append(
+ (pdb.set_trace, pytestPDB._pluginmanager, pytestPDB._config)
+ )
+ pdb.set_trace = pytestPDB.set_trace
+ pytestPDB._pluginmanager = config.pluginmanager
+ pytestPDB._config = config
+
+ # NOTE: not using pytest_unconfigure, since it might get called although
+ # pytest_configure was not (if another plugin raises UsageError).
+ def fin():
+ (
+ pdb.set_trace,
+ pytestPDB._pluginmanager,
+ pytestPDB._config,
+ ) = pytestPDB._saved.pop()
+
+ config._cleanup.append(fin)
+
+
+class pytestPDB(object):
+ """ Pseudo PDB that defers to the real pdb. """
+
+ _pluginmanager = None
+ _config = None
+ _saved = []
+ _recursive_debug = 0
+ _wrapped_pdb_cls = None
+
+ @classmethod
+ def _is_capturing(cls, capman):
+ if capman:
+ return capman.is_capturing()
+ return False
+
+ @classmethod
+ def _import_pdb_cls(cls, capman):
+ if not cls._config:
+ # Happens when using pytest.set_trace outside of a test.
+ return pdb.Pdb
+
+ usepdb_cls = cls._config.getvalue("usepdb_cls")
+
+ if cls._wrapped_pdb_cls and cls._wrapped_pdb_cls[0] == usepdb_cls:
+ return cls._wrapped_pdb_cls[1]
+
+ if usepdb_cls:
+ modname, classname = usepdb_cls
+
+ try:
+ __import__(modname)
+ mod = sys.modules[modname]
+
+ # Handle --pdbcls=pdb:pdb.Pdb (useful e.g. with pdbpp).
+ parts = classname.split(".")
+ pdb_cls = getattr(mod, parts[0])
+ for part in parts[1:]:
+ pdb_cls = getattr(pdb_cls, part)
+ except Exception as exc:
+ value = ":".join((modname, classname))
+ raise UsageError(
+ "--pdbcls: could not import {!r}: {}".format(value, exc)
+ )
+ else:
+ pdb_cls = pdb.Pdb
+
+ wrapped_cls = cls._get_pdb_wrapper_class(pdb_cls, capman)
+ cls._wrapped_pdb_cls = (usepdb_cls, wrapped_cls)
+ return wrapped_cls
+
+ @classmethod
+ def _get_pdb_wrapper_class(cls, pdb_cls, capman):
+ import _pytest.config
+
+ class PytestPdbWrapper(pdb_cls, object):
+ _pytest_capman = capman
+ _continued = False
+
+ def do_debug(self, arg):
+ cls._recursive_debug += 1
+ ret = super(PytestPdbWrapper, self).do_debug(arg)
+ cls._recursive_debug -= 1
+ return ret
+
+ def do_continue(self, arg):
+ ret = super(PytestPdbWrapper, self).do_continue(arg)
+ if cls._recursive_debug == 0:
+ tw = _pytest.config.create_terminal_writer(cls._config)
+ tw.line()
+
+ capman = self._pytest_capman
+ capturing = pytestPDB._is_capturing(capman)
+ if capturing:
+ if capturing == "global":
+ tw.sep(">", "PDB continue (IO-capturing resumed)")
+ else:
+ tw.sep(
+ ">",
+ "PDB continue (IO-capturing resumed for %s)"
+ % capturing,
+ )
+ capman.resume()
+ else:
+ tw.sep(">", "PDB continue")
+ cls._pluginmanager.hook.pytest_leave_pdb(config=cls._config, pdb=self)
+ self._continued = True
+ return ret
+
+ do_c = do_cont = do_continue
+
+ def do_quit(self, arg):
+ """Raise Exit outcome when quit command is used in pdb.
+
+ This is a bit of a hack - it would be better if BdbQuit
+ could be handled, but this would require to wrap the
+ whole pytest run, and adjust the report etc.
+ """
+ ret = super(PytestPdbWrapper, self).do_quit(arg)
+
+ if cls._recursive_debug == 0:
+ outcomes.exit("Quitting debugger")
+
+ return ret
+
+ do_q = do_quit
+ do_exit = do_quit
+
+ def setup(self, f, tb):
+ """Suspend on setup().
+
+ Needed after do_continue resumed, and entering another
+ breakpoint again.
+ """
+ ret = super(PytestPdbWrapper, self).setup(f, tb)
+ if not ret and self._continued:
+ # pdb.setup() returns True if the command wants to exit
+ # from the interaction: do not suspend capturing then.
+ if self._pytest_capman:
+ self._pytest_capman.suspend_global_capture(in_=True)
+ return ret
+
+ def get_stack(self, f, t):
+ stack, i = super(PytestPdbWrapper, self).get_stack(f, t)
+ if f is None:
+ # Find last non-hidden frame.
+ i = max(0, len(stack) - 1)
+ while i and stack[i][0].f_locals.get("__tracebackhide__", False):
+ i -= 1
+ return stack, i
+
+ return PytestPdbWrapper
+
+ @classmethod
+ def _init_pdb(cls, method, *args, **kwargs):
+ """ Initialize PDB debugging, dropping any IO capturing. """
+ import _pytest.config
+
+ if cls._pluginmanager is not None:
+ capman = cls._pluginmanager.getplugin("capturemanager")
+ else:
+ capman = None
+ if capman:
+ capman.suspend(in_=True)
+
+ if cls._config:
+ tw = _pytest.config.create_terminal_writer(cls._config)
+ tw.line()
+
+ if cls._recursive_debug == 0:
+ # Handle header similar to pdb.set_trace in py37+.
+ header = kwargs.pop("header", None)
+ if header is not None:
+ tw.sep(">", header)
+ else:
+ capturing = cls._is_capturing(capman)
+ if capturing == "global":
+ tw.sep(">", "PDB %s (IO-capturing turned off)" % (method,))
+ elif capturing:
+ tw.sep(
+ ">",
+ "PDB %s (IO-capturing turned off for %s)"
+ % (method, capturing),
+ )
+ else:
+ tw.sep(">", "PDB %s" % (method,))
+
+ _pdb = cls._import_pdb_cls(capman)(**kwargs)
+
+ if cls._pluginmanager:
+ cls._pluginmanager.hook.pytest_enter_pdb(config=cls._config, pdb=_pdb)
+ return _pdb
+
+ @classmethod
+ def set_trace(cls, *args, **kwargs):
+ """Invoke debugging via ``Pdb.set_trace``, dropping any IO capturing."""
+ tty()
+ frame = sys._getframe().f_back
+ _pdb = cls._init_pdb("set_trace", *args, **kwargs)
+ _pdb.set_trace(frame)
+
+
+class PdbInvoke(object):
+ def pytest_exception_interact(self, node, call, report):
+ capman = node.config.pluginmanager.getplugin("capturemanager")
+ if capman:
+ capman.suspend_global_capture(in_=True)
+ out, err = capman.read_global_capture()
+ sys.stdout.write(out)
+ sys.stdout.write(err)
+ tty()
+ _enter_pdb(node, call.excinfo, report)
+
+ def pytest_internalerror(self, excrepr, excinfo):
+ tb = _postmortem_traceback(excinfo)
+ post_mortem(tb)
+
+
+class PdbTrace(object):
+ @hookimpl(hookwrapper=True)
+ def pytest_pyfunc_call(self, pyfuncitem):
+ _test_pytest_function(pyfuncitem)
+ yield
+
+
+def _test_pytest_function(pyfuncitem):
+ _pdb = pytestPDB._init_pdb("runcall")
+ testfunction = pyfuncitem.obj
+ pyfuncitem.obj = _pdb.runcall
+ if "func" in pyfuncitem._fixtureinfo.argnames: # pragma: no branch
+ raise ValueError("--trace can't be used with a fixture named func!")
+ pyfuncitem.funcargs["func"] = testfunction
+ new_list = list(pyfuncitem._fixtureinfo.argnames)
+ new_list.append("func")
+ pyfuncitem._fixtureinfo.argnames = tuple(new_list)
+
+
+def _enter_pdb(node, excinfo, rep):
+ # XXX we re-use the TerminalReporter's terminalwriter
+ # because this seems to avoid some encoding related troubles
+ # for not completely clear reasons.
+ tw = node.config.pluginmanager.getplugin("terminalreporter")._tw
+ tw.line()
+
+ showcapture = node.config.option.showcapture
+
+ for sectionname, content in (
+ ("stdout", rep.capstdout),
+ ("stderr", rep.capstderr),
+ ("log", rep.caplog),
+ ):
+ if showcapture in (sectionname, "all") and content:
+ tw.sep(">", "captured " + sectionname)
+ if content[-1:] == "\n":
+ content = content[:-1]
+ tw.line(content)
+
+ tw.sep(">", "traceback")
+ rep.toterminal(tw)
+ tw.sep(">", "entering PDB")
+ tb = _postmortem_traceback(excinfo)
+ rep._pdbshown = True
+ post_mortem(tb)
+ return rep
+
+
+def _postmortem_traceback(excinfo):
+ if isinstance(excinfo.value, UnexpectedException):
+ # A doctest.UnexpectedException is not useful for post_mortem.
+ # Use the underlying exception instead:
+ return excinfo.value.exc_info[2]
+ else:
+ return excinfo._excinfo[2]
+
+
+def post_mortem(t):
+ p = pytestPDB._init_pdb("post_mortem")
+ p.reset()
+ p.interaction(None, t)
+ if p.quitting:
+ outcomes.exit("Quitting debugger")
diff --git a/contrib/python/pytest/py2/_pytest/deprecated.py b/contrib/python/pytest/py2/_pytest/deprecated.py
new file mode 100644
index 00000000000..12394aca3f5
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/deprecated.py
@@ -0,0 +1,96 @@
+# -*- coding: utf-8 -*-
+"""
+This module contains deprecation messages and bits of code used elsewhere in the codebase
+that is planned to be removed in the next pytest release.
+
+Keeping it in a central location makes it easy to track what is deprecated and should
+be removed when the time comes.
+
+All constants defined in this module should be either PytestWarning instances or UnformattedWarning
+in case of warnings which need to format their messages.
+"""
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+from _pytest.warning_types import PytestDeprecationWarning
+from _pytest.warning_types import RemovedInPytest4Warning
+from _pytest.warning_types import UnformattedWarning
+
+YIELD_TESTS = "yield tests were removed in pytest 4.0 - {name} will be ignored"
+
+
+FIXTURE_FUNCTION_CALL = (
+ 'Fixture "{name}" called directly. Fixtures are not meant to be called directly,\n'
+ "but are created automatically when test functions request them as parameters.\n"
+ "See https://docs.pytest.org/en/latest/fixture.html for more information about fixtures, and\n"
+ "https://docs.pytest.org/en/latest/deprecations.html#calling-fixtures-directly about how to update your code."
+)
+
+FIXTURE_NAMED_REQUEST = PytestDeprecationWarning(
+ "'request' is a reserved name for fixtures and will raise an error in future versions"
+)
+
+CFG_PYTEST_SECTION = "[pytest] section in {filename} files is no longer supported, change to [tool:pytest] instead."
+
+GETFUNCARGVALUE = RemovedInPytest4Warning(
+ "getfuncargvalue is deprecated, use getfixturevalue"
+)
+
+RAISES_MESSAGE_PARAMETER = PytestDeprecationWarning(
+ "The 'message' parameter is deprecated.\n"
+ "(did you mean to use `match='some regex'` to check the exception message?)\n"
+ "Please see:\n"
+ " https://docs.pytest.org/en/4.6-maintenance/deprecations.html#message-parameter-of-pytest-raises"
+)
+
+RESULT_LOG = PytestDeprecationWarning(
+ "--result-log is deprecated and scheduled for removal in pytest 5.0.\n"
+ "See https://docs.pytest.org/en/latest/deprecations.html#result-log-result-log for more information."
+)
+
+RAISES_EXEC = PytestDeprecationWarning(
+ "raises(..., 'code(as_a_string)') is deprecated, use the context manager form or use `exec()` directly\n\n"
+ "See https://docs.pytest.org/en/latest/deprecations.html#raises-warns-exec"
+)
+WARNS_EXEC = PytestDeprecationWarning(
+ "warns(..., 'code(as_a_string)') is deprecated, use the context manager form or use `exec()` directly.\n\n"
+ "See https://docs.pytest.org/en/latest/deprecations.html#raises-warns-exec"
+)
+
+PYTEST_PLUGINS_FROM_NON_TOP_LEVEL_CONFTEST = (
+ "Defining 'pytest_plugins' in a non-top-level conftest is no longer supported "
+ "because it affects the entire directory tree in a non-explicit way.\n"
+ " {}\n"
+ "Please move it to a top level conftest file at the rootdir:\n"
+ " {}\n"
+ "For more information, visit:\n"
+ " https://docs.pytest.org/en/latest/deprecations.html#pytest-plugins-in-non-top-level-conftest-files"
+)
+
+PYTEST_CONFIG_GLOBAL = PytestDeprecationWarning(
+ "the `pytest.config` global is deprecated. Please use `request.config` "
+ "or `pytest_configure` (if you're a pytest plugin) instead."
+)
+
+PYTEST_ENSURETEMP = RemovedInPytest4Warning(
+ "pytest/tmpdir_factory.ensuretemp is deprecated, \n"
+ "please use the tmp_path fixture or tmp_path_factory.mktemp"
+)
+
+PYTEST_LOGWARNING = PytestDeprecationWarning(
+ "pytest_logwarning is deprecated, no longer being called, and will be removed soon\n"
+ "please use pytest_warning_captured instead"
+)
+
+PYTEST_WARNS_UNKNOWN_KWARGS = UnformattedWarning(
+ PytestDeprecationWarning,
+ "pytest.warns() got unexpected keyword arguments: {args!r}.\n"
+ "This will be an error in future versions.",
+)
+
+PYTEST_PARAM_UNKNOWN_KWARGS = UnformattedWarning(
+ PytestDeprecationWarning,
+ "pytest.param() got unexpected keyword arguments: {args!r}.\n"
+ "This will be an error in future versions.",
+)
diff --git a/contrib/python/pytest/py2/_pytest/doctest.py b/contrib/python/pytest/py2/_pytest/doctest.py
new file mode 100644
index 00000000000..659d24aeebc
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/doctest.py
@@ -0,0 +1,583 @@
+# -*- coding: utf-8 -*-
+""" discover and run doctests in modules and test files."""
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import inspect
+import platform
+import sys
+import traceback
+import warnings
+from contextlib import contextmanager
+
+import pytest
+from _pytest._code.code import ExceptionInfo
+from _pytest._code.code import ReprFileLocation
+from _pytest._code.code import TerminalRepr
+from _pytest.compat import safe_getattr
+from _pytest.fixtures import FixtureRequest
+from _pytest.outcomes import Skipped
+from _pytest.warning_types import PytestWarning
+
+DOCTEST_REPORT_CHOICE_NONE = "none"
+DOCTEST_REPORT_CHOICE_CDIFF = "cdiff"
+DOCTEST_REPORT_CHOICE_NDIFF = "ndiff"
+DOCTEST_REPORT_CHOICE_UDIFF = "udiff"
+DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE = "only_first_failure"
+
+DOCTEST_REPORT_CHOICES = (
+ DOCTEST_REPORT_CHOICE_NONE,
+ DOCTEST_REPORT_CHOICE_CDIFF,
+ DOCTEST_REPORT_CHOICE_NDIFF,
+ DOCTEST_REPORT_CHOICE_UDIFF,
+ DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE,
+)
+
+# Lazy definition of runner class
+RUNNER_CLASS = None
+
+
+def pytest_addoption(parser):
+ parser.addini(
+ "doctest_optionflags",
+ "option flags for doctests",
+ type="args",
+ default=["ELLIPSIS"],
+ )
+ parser.addini(
+ "doctest_encoding", "encoding used for doctest files", default="utf-8"
+ )
+ group = parser.getgroup("collect")
+ group.addoption(
+ "--doctest-modules",
+ action="store_true",
+ default=False,
+ help="run doctests in all .py modules",
+ dest="doctestmodules",
+ )
+ group.addoption(
+ "--doctest-report",
+ type=str.lower,
+ default="udiff",
+ help="choose another output format for diffs on doctest failure",
+ choices=DOCTEST_REPORT_CHOICES,
+ dest="doctestreport",
+ )
+ group.addoption(
+ "--doctest-glob",
+ action="append",
+ default=[],
+ metavar="pat",
+ help="doctests file matching pattern, default: test*.txt",
+ dest="doctestglob",
+ )
+ group.addoption(
+ "--doctest-ignore-import-errors",
+ action="store_true",
+ default=False,
+ help="ignore doctest ImportErrors",
+ dest="doctest_ignore_import_errors",
+ )
+ group.addoption(
+ "--doctest-continue-on-failure",
+ action="store_true",
+ default=False,
+ help="for a given doctest, continue to run after the first failure",
+ dest="doctest_continue_on_failure",
+ )
+
+
+def pytest_collect_file(path, parent):
+ config = parent.config
+ if path.ext == ".py":
+ if config.option.doctestmodules and not _is_setup_py(config, path, parent):
+ return DoctestModule(path, parent)
+ elif _is_doctest(config, path, parent):
+ return DoctestTextfile(path, parent)
+
+
+def _is_setup_py(config, path, parent):
+ if path.basename != "setup.py":
+ return False
+ contents = path.read()
+ return "setuptools" in contents or "distutils" in contents
+
+
+def _is_doctest(config, path, parent):
+ if path.ext in (".txt", ".rst") and parent.session.isinitpath(path):
+ return True
+ globs = config.getoption("doctestglob") or ["test*.txt"]
+ for glob in globs:
+ if path.check(fnmatch=glob):
+ return True
+ return False
+
+
+class ReprFailDoctest(TerminalRepr):
+ def __init__(self, reprlocation_lines):
+ # List of (reprlocation, lines) tuples
+ self.reprlocation_lines = reprlocation_lines
+
+ def toterminal(self, tw):
+ for reprlocation, lines in self.reprlocation_lines:
+ for line in lines:
+ tw.line(line)
+ reprlocation.toterminal(tw)
+
+
+class MultipleDoctestFailures(Exception):
+ def __init__(self, failures):
+ super(MultipleDoctestFailures, self).__init__()
+ self.failures = failures
+
+
+def _init_runner_class():
+ import doctest
+
+ class PytestDoctestRunner(doctest.DebugRunner):
+ """
+ Runner to collect failures. Note that the out variable in this case is
+ a list instead of a stdout-like object
+ """
+
+ def __init__(
+ self, checker=None, verbose=None, optionflags=0, continue_on_failure=True
+ ):
+ doctest.DebugRunner.__init__(
+ self, checker=checker, verbose=verbose, optionflags=optionflags
+ )
+ self.continue_on_failure = continue_on_failure
+
+ def report_failure(self, out, test, example, got):
+ failure = doctest.DocTestFailure(test, example, got)
+ if self.continue_on_failure:
+ out.append(failure)
+ else:
+ raise failure
+
+ def report_unexpected_exception(self, out, test, example, exc_info):
+ if isinstance(exc_info[1], Skipped):
+ raise exc_info[1]
+ failure = doctest.UnexpectedException(test, example, exc_info)
+ if self.continue_on_failure:
+ out.append(failure)
+ else:
+ raise failure
+
+ return PytestDoctestRunner
+
+
+def _get_runner(checker=None, verbose=None, optionflags=0, continue_on_failure=True):
+ # We need this in order to do a lazy import on doctest
+ global RUNNER_CLASS
+ if RUNNER_CLASS is None:
+ RUNNER_CLASS = _init_runner_class()
+ return RUNNER_CLASS(
+ checker=checker,
+ verbose=verbose,
+ optionflags=optionflags,
+ continue_on_failure=continue_on_failure,
+ )
+
+
+class DoctestItem(pytest.Item):
+ def __init__(self, name, parent, runner=None, dtest=None):
+ super(DoctestItem, self).__init__(name, parent)
+ self.runner = runner
+ self.dtest = dtest
+ self.obj = None
+ self.fixture_request = None
+
+ def setup(self):
+ if self.dtest is not None:
+ self.fixture_request = _setup_fixtures(self)
+ globs = dict(getfixture=self.fixture_request.getfixturevalue)
+ for name, value in self.fixture_request.getfixturevalue(
+ "doctest_namespace"
+ ).items():
+ globs[name] = value
+ self.dtest.globs.update(globs)
+
+ def runtest(self):
+ _check_all_skipped(self.dtest)
+ self._disable_output_capturing_for_darwin()
+ failures = []
+ self.runner.run(self.dtest, out=failures)
+ if failures:
+ raise MultipleDoctestFailures(failures)
+
+ def _disable_output_capturing_for_darwin(self):
+ """
+ Disable output capturing. Otherwise, stdout is lost to doctest (#985)
+ """
+ if platform.system() != "Darwin":
+ return
+ capman = self.config.pluginmanager.getplugin("capturemanager")
+ if capman:
+ capman.suspend_global_capture(in_=True)
+ out, err = capman.read_global_capture()
+ sys.stdout.write(out)
+ sys.stderr.write(err)
+
+ def repr_failure(self, excinfo):
+ import doctest
+
+ failures = None
+ if excinfo.errisinstance((doctest.DocTestFailure, doctest.UnexpectedException)):
+ failures = [excinfo.value]
+ elif excinfo.errisinstance(MultipleDoctestFailures):
+ failures = excinfo.value.failures
+
+ if failures is not None:
+ reprlocation_lines = []
+ for failure in failures:
+ example = failure.example
+ test = failure.test
+ filename = test.filename
+ if test.lineno is None:
+ lineno = None
+ else:
+ lineno = test.lineno + example.lineno + 1
+ message = type(failure).__name__
+ reprlocation = ReprFileLocation(filename, lineno, message)
+ checker = _get_checker()
+ report_choice = _get_report_choice(
+ self.config.getoption("doctestreport")
+ )
+ if lineno is not None:
+ lines = failure.test.docstring.splitlines(False)
+ # add line numbers to the left of the error message
+ lines = [
+ "%03d %s" % (i + test.lineno + 1, x)
+ for (i, x) in enumerate(lines)
+ ]
+ # trim docstring error lines to 10
+ lines = lines[max(example.lineno - 9, 0) : example.lineno + 1]
+ else:
+ lines = [
+ "EXAMPLE LOCATION UNKNOWN, not showing all tests of that example"
+ ]
+ indent = ">>>"
+ for line in example.source.splitlines():
+ lines.append("??? %s %s" % (indent, line))
+ indent = "..."
+ if isinstance(failure, doctest.DocTestFailure):
+ lines += checker.output_difference(
+ example, failure.got, report_choice
+ ).split("\n")
+ else:
+ inner_excinfo = ExceptionInfo(failure.exc_info)
+ lines += ["UNEXPECTED EXCEPTION: %s" % repr(inner_excinfo.value)]
+ lines += traceback.format_exception(*failure.exc_info)
+ reprlocation_lines.append((reprlocation, lines))
+ return ReprFailDoctest(reprlocation_lines)
+ else:
+ return super(DoctestItem, self).repr_failure(excinfo)
+
+ def reportinfo(self):
+ return self.fspath, self.dtest.lineno, "[doctest] %s" % self.name
+
+
+def _get_flag_lookup():
+ import doctest
+
+ return dict(
+ DONT_ACCEPT_TRUE_FOR_1=doctest.DONT_ACCEPT_TRUE_FOR_1,
+ DONT_ACCEPT_BLANKLINE=doctest.DONT_ACCEPT_BLANKLINE,
+ NORMALIZE_WHITESPACE=doctest.NORMALIZE_WHITESPACE,
+ ELLIPSIS=doctest.ELLIPSIS,
+ IGNORE_EXCEPTION_DETAIL=doctest.IGNORE_EXCEPTION_DETAIL,
+ COMPARISON_FLAGS=doctest.COMPARISON_FLAGS,
+ ALLOW_UNICODE=_get_allow_unicode_flag(),
+ ALLOW_BYTES=_get_allow_bytes_flag(),
+ )
+
+
+def get_optionflags(parent):
+ optionflags_str = parent.config.getini("doctest_optionflags")
+ flag_lookup_table = _get_flag_lookup()
+ flag_acc = 0
+ for flag in optionflags_str:
+ flag_acc |= flag_lookup_table[flag]
+ return flag_acc
+
+
+def _get_continue_on_failure(config):
+ continue_on_failure = config.getvalue("doctest_continue_on_failure")
+ if continue_on_failure:
+ # We need to turn off this if we use pdb since we should stop at
+ # the first failure
+ if config.getvalue("usepdb"):
+ continue_on_failure = False
+ return continue_on_failure
+
+
+class DoctestTextfile(pytest.Module):
+ obj = None
+
+ def collect(self):
+ import doctest
+
+ # inspired by doctest.testfile; ideally we would use it directly,
+ # but it doesn't support passing a custom checker
+ encoding = self.config.getini("doctest_encoding")
+ text = self.fspath.read_text(encoding)
+ filename = str(self.fspath)
+ name = self.fspath.basename
+ globs = {"__name__": "__main__"}
+
+ optionflags = get_optionflags(self)
+
+ runner = _get_runner(
+ verbose=0,
+ optionflags=optionflags,
+ checker=_get_checker(),
+ continue_on_failure=_get_continue_on_failure(self.config),
+ )
+ _fix_spoof_python2(runner, encoding)
+
+ parser = doctest.DocTestParser()
+ test = parser.get_doctest(text, globs, name, filename, 0)
+ if test.examples:
+ yield DoctestItem(test.name, self, runner, test)
+
+
+def _check_all_skipped(test):
+ """raises pytest.skip() if all examples in the given DocTest have the SKIP
+ option set.
+ """
+ import doctest
+
+ all_skipped = all(x.options.get(doctest.SKIP, False) for x in test.examples)
+ if all_skipped:
+ pytest.skip("all tests skipped by +SKIP option")
+
+
+def _is_mocked(obj):
+ """
+ returns if a object is possibly a mock object by checking the existence of a highly improbable attribute
+ """
+ return (
+ safe_getattr(obj, "pytest_mock_example_attribute_that_shouldnt_exist", None)
+ is not None
+ )
+
+
+@contextmanager
+def _patch_unwrap_mock_aware():
+ """
+ contextmanager which replaces ``inspect.unwrap`` with a version
+ that's aware of mock objects and doesn't recurse on them
+ """
+ real_unwrap = getattr(inspect, "unwrap", None)
+ if real_unwrap is None:
+ yield
+ else:
+
+ def _mock_aware_unwrap(obj, stop=None):
+ try:
+ if stop is None or stop is _is_mocked:
+ return real_unwrap(obj, stop=_is_mocked)
+ return real_unwrap(obj, stop=lambda obj: _is_mocked(obj) or stop(obj))
+ except Exception as e:
+ warnings.warn(
+ "Got %r when unwrapping %r. This is usually caused "
+ "by a violation of Python's object protocol; see e.g. "
+ "https://github.com/pytest-dev/pytest/issues/5080" % (e, obj),
+ PytestWarning,
+ )
+ raise
+
+ inspect.unwrap = _mock_aware_unwrap
+ try:
+ yield
+ finally:
+ inspect.unwrap = real_unwrap
+
+
+class DoctestModule(pytest.Module):
+ def collect(self):
+ import doctest
+
+ class MockAwareDocTestFinder(doctest.DocTestFinder):
+ """
+ a hackish doctest finder that overrides stdlib internals to fix a stdlib bug
+
+ https://github.com/pytest-dev/pytest/issues/3456
+ https://bugs.python.org/issue25532
+ """
+
+ def _find(self, tests, obj, name, module, source_lines, globs, seen):
+ if _is_mocked(obj):
+ return
+ with _patch_unwrap_mock_aware():
+
+ doctest.DocTestFinder._find(
+ self, tests, obj, name, module, source_lines, globs, seen
+ )
+
+ if self.fspath.basename == "conftest.py":
+ module = self.config.pluginmanager._importconftest(self.fspath)
+ else:
+ try:
+ module = self.fspath.pyimport()
+ except ImportError:
+ if self.config.getvalue("doctest_ignore_import_errors"):
+ pytest.skip("unable to import module %r" % self.fspath)
+ else:
+ raise
+ # uses internal doctest module parsing mechanism
+ finder = MockAwareDocTestFinder()
+ optionflags = get_optionflags(self)
+ runner = _get_runner(
+ verbose=0,
+ optionflags=optionflags,
+ checker=_get_checker(),
+ continue_on_failure=_get_continue_on_failure(self.config),
+ )
+
+ for test in finder.find(module, module.__name__):
+ if test.examples: # skip empty doctests
+ yield DoctestItem(test.name, self, runner, test)
+
+
+def _setup_fixtures(doctest_item):
+ """
+ Used by DoctestTextfile and DoctestItem to setup fixture information.
+ """
+
+ def func():
+ pass
+
+ doctest_item.funcargs = {}
+ fm = doctest_item.session._fixturemanager
+ doctest_item._fixtureinfo = fm.getfixtureinfo(
+ node=doctest_item, func=func, cls=None, funcargs=False
+ )
+ fixture_request = FixtureRequest(doctest_item)
+ fixture_request._fillfixtures()
+ return fixture_request
+
+
+def _get_checker():
+ """
+ Returns a doctest.OutputChecker subclass that takes in account the
+ ALLOW_UNICODE option to ignore u'' prefixes in strings and ALLOW_BYTES
+ to strip b'' prefixes.
+ Useful when the same doctest should run in Python 2 and Python 3.
+
+ An inner class is used to avoid importing "doctest" at the module
+ level.
+ """
+ if hasattr(_get_checker, "LiteralsOutputChecker"):
+ return _get_checker.LiteralsOutputChecker()
+
+ import doctest
+ import re
+
+ class LiteralsOutputChecker(doctest.OutputChecker):
+ """
+ Copied from doctest_nose_plugin.py from the nltk project:
+ https://github.com/nltk/nltk
+
+ Further extended to also support byte literals.
+ """
+
+ _unicode_literal_re = re.compile(r"(\W|^)[uU]([rR]?[\'\"])", re.UNICODE)
+ _bytes_literal_re = re.compile(r"(\W|^)[bB]([rR]?[\'\"])", re.UNICODE)
+
+ def check_output(self, want, got, optionflags):
+ res = doctest.OutputChecker.check_output(self, want, got, optionflags)
+ if res:
+ return True
+
+ allow_unicode = optionflags & _get_allow_unicode_flag()
+ allow_bytes = optionflags & _get_allow_bytes_flag()
+ if not allow_unicode and not allow_bytes:
+ return False
+
+ else: # pragma: no cover
+
+ def remove_prefixes(regex, txt):
+ return re.sub(regex, r"\1\2", txt)
+
+ if allow_unicode:
+ want = remove_prefixes(self._unicode_literal_re, want)
+ got = remove_prefixes(self._unicode_literal_re, got)
+ if allow_bytes:
+ want = remove_prefixes(self._bytes_literal_re, want)
+ got = remove_prefixes(self._bytes_literal_re, got)
+ res = doctest.OutputChecker.check_output(self, want, got, optionflags)
+ return res
+
+ _get_checker.LiteralsOutputChecker = LiteralsOutputChecker
+ return _get_checker.LiteralsOutputChecker()
+
+
+def _get_allow_unicode_flag():
+ """
+ Registers and returns the ALLOW_UNICODE flag.
+ """
+ import doctest
+
+ return doctest.register_optionflag("ALLOW_UNICODE")
+
+
+def _get_allow_bytes_flag():
+ """
+ Registers and returns the ALLOW_BYTES flag.
+ """
+ import doctest
+
+ return doctest.register_optionflag("ALLOW_BYTES")
+
+
+def _get_report_choice(key):
+ """
+ This function returns the actual `doctest` module flag value, we want to do it as late as possible to avoid
+ importing `doctest` and all its dependencies when parsing options, as it adds overhead and breaks tests.
+ """
+ import doctest
+
+ return {
+ DOCTEST_REPORT_CHOICE_UDIFF: doctest.REPORT_UDIFF,
+ DOCTEST_REPORT_CHOICE_CDIFF: doctest.REPORT_CDIFF,
+ DOCTEST_REPORT_CHOICE_NDIFF: doctest.REPORT_NDIFF,
+ DOCTEST_REPORT_CHOICE_ONLY_FIRST_FAILURE: doctest.REPORT_ONLY_FIRST_FAILURE,
+ DOCTEST_REPORT_CHOICE_NONE: 0,
+ }[key]
+
+
+def _fix_spoof_python2(runner, encoding):
+ """
+ Installs a "SpoofOut" into the given DebugRunner so it properly deals with unicode output. This
+ should patch only doctests for text files because they don't have a way to declare their
+ encoding. Doctests in docstrings from Python modules don't have the same problem given that
+ Python already decoded the strings.
+
+ This fixes the problem related in issue #2434.
+ """
+ from _pytest.compat import _PY2
+
+ if not _PY2:
+ return
+
+ from doctest import _SpoofOut
+
+ class UnicodeSpoof(_SpoofOut):
+ def getvalue(self):
+ result = _SpoofOut.getvalue(self)
+ if encoding and isinstance(result, bytes):
+ result = result.decode(encoding)
+ return result
+
+ runner._fakeout = UnicodeSpoof()
+
+
+@pytest.fixture(scope="session")
+def doctest_namespace():
+ """
+ Fixture that returns a :py:class:`dict` that will be injected into the namespace of doctests.
+ """
+ return dict()
diff --git a/contrib/python/pytest/py2/_pytest/fixtures.py b/contrib/python/pytest/py2/_pytest/fixtures.py
new file mode 100644
index 00000000000..280a48608b6
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/fixtures.py
@@ -0,0 +1,1356 @@
+# -*- coding: utf-8 -*-
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import functools
+import inspect
+import itertools
+import sys
+import warnings
+from collections import defaultdict
+from collections import deque
+from collections import OrderedDict
+
+import attr
+import py
+import six
+
+import _pytest
+from _pytest import nodes
+from _pytest._code.code import FormattedExcinfo
+from _pytest._code.code import TerminalRepr
+from _pytest.compat import _format_args
+from _pytest.compat import _PytestWrapper
+from _pytest.compat import exc_clear
+from _pytest.compat import FuncargnamesCompatAttr
+from _pytest.compat import get_real_func
+from _pytest.compat import get_real_method
+from _pytest.compat import getfslineno
+from _pytest.compat import getfuncargnames
+from _pytest.compat import getimfunc
+from _pytest.compat import getlocation
+from _pytest.compat import is_generator
+from _pytest.compat import isclass
+from _pytest.compat import NOTSET
+from _pytest.compat import safe_getattr
+from _pytest.deprecated import FIXTURE_FUNCTION_CALL
+from _pytest.deprecated import FIXTURE_NAMED_REQUEST
+from _pytest.outcomes import fail
+from _pytest.outcomes import TEST_OUTCOME
+
+
+@attr.s(frozen=True)
+class PseudoFixtureDef(object):
+ cached_result = attr.ib()
+ scope = attr.ib()
+
+
+def pytest_sessionstart(session):
+ import _pytest.python
+ import _pytest.nodes
+
+ scopename2class.update(
+ {
+ "package": _pytest.python.Package,
+ "class": _pytest.python.Class,
+ "module": _pytest.python.Module,
+ "function": _pytest.nodes.Item,
+ "session": _pytest.main.Session,
+ }
+ )
+ session._fixturemanager = FixtureManager(session)
+
+
+scopename2class = {}
+
+
+scope2props = dict(session=())
+scope2props["package"] = ("fspath",)
+scope2props["module"] = ("fspath", "module")
+scope2props["class"] = scope2props["module"] + ("cls",)
+scope2props["instance"] = scope2props["class"] + ("instance",)
+scope2props["function"] = scope2props["instance"] + ("function", "keywords")
+
+
+def scopeproperty(name=None, doc=None):
+ def decoratescope(func):
+ scopename = name or func.__name__
+
+ def provide(self):
+ if func.__name__ in scope2props[self.scope]:
+ return func(self)
+ raise AttributeError(
+ "%s not available in %s-scoped context" % (scopename, self.scope)
+ )
+
+ return property(provide, None, None, func.__doc__)
+
+ return decoratescope
+
+
+def get_scope_package(node, fixturedef):
+ import pytest
+
+ cls = pytest.Package
+ current = node
+ fixture_package_name = "%s/%s" % (fixturedef.baseid, "__init__.py")
+ while current and (
+ type(current) is not cls or fixture_package_name != current.nodeid
+ ):
+ current = current.parent
+ if current is None:
+ return node.session
+ return current
+
+
+def get_scope_node(node, scope):
+ cls = scopename2class.get(scope)
+ if cls is None:
+ raise ValueError("unknown scope")
+ return node.getparent(cls)
+
+
+def add_funcarg_pseudo_fixture_def(collector, metafunc, fixturemanager):
+ # this function will transform all collected calls to a functions
+ # if they use direct funcargs (i.e. direct parametrization)
+ # because we want later test execution to be able to rely on
+ # an existing FixtureDef structure for all arguments.
+ # XXX we can probably avoid this algorithm if we modify CallSpec2
+ # to directly care for creating the fixturedefs within its methods.
+ if not metafunc._calls[0].funcargs:
+ return # this function call does not have direct parametrization
+ # collect funcargs of all callspecs into a list of values
+ arg2params = {}
+ arg2scope = {}
+ for callspec in metafunc._calls:
+ for argname, argvalue in callspec.funcargs.items():
+ assert argname not in callspec.params
+ callspec.params[argname] = argvalue
+ arg2params_list = arg2params.setdefault(argname, [])
+ callspec.indices[argname] = len(arg2params_list)
+ arg2params_list.append(argvalue)
+ if argname not in arg2scope:
+ scopenum = callspec._arg2scopenum.get(argname, scopenum_function)
+ arg2scope[argname] = scopes[scopenum]
+ callspec.funcargs.clear()
+
+ # register artificial FixtureDef's so that later at test execution
+ # time we can rely on a proper FixtureDef to exist for fixture setup.
+ arg2fixturedefs = metafunc._arg2fixturedefs
+ for argname, valuelist in arg2params.items():
+ # if we have a scope that is higher than function we need
+ # to make sure we only ever create an according fixturedef on
+ # a per-scope basis. We thus store and cache the fixturedef on the
+ # node related to the scope.
+ scope = arg2scope[argname]
+ node = None
+ if scope != "function":
+ node = get_scope_node(collector, scope)
+ if node is None:
+ assert scope == "class" and isinstance(collector, _pytest.python.Module)
+ # use module-level collector for class-scope (for now)
+ node = collector
+ if node and argname in node._name2pseudofixturedef:
+ arg2fixturedefs[argname] = [node._name2pseudofixturedef[argname]]
+ else:
+ fixturedef = FixtureDef(
+ fixturemanager,
+ "",
+ argname,
+ get_direct_param_fixture_func,
+ arg2scope[argname],
+ valuelist,
+ False,
+ False,
+ )
+ arg2fixturedefs[argname] = [fixturedef]
+ if node is not None:
+ node._name2pseudofixturedef[argname] = fixturedef
+
+
+def getfixturemarker(obj):
+ """ return fixturemarker or None if it doesn't exist or raised
+ exceptions."""
+ try:
+ return getattr(obj, "_pytestfixturefunction", None)
+ except TEST_OUTCOME:
+ # some objects raise errors like request (from flask import request)
+ # we don't expect them to be fixture functions
+ return None
+
+
+def get_parametrized_fixture_keys(item, scopenum):
+ """ return list of keys for all parametrized arguments which match
+ the specified scope. """
+ assert scopenum < scopenum_function # function
+ try:
+ cs = item.callspec
+ except AttributeError:
+ pass
+ else:
+ # cs.indices.items() is random order of argnames. Need to
+ # sort this so that different calls to
+ # get_parametrized_fixture_keys will be deterministic.
+ for argname, param_index in sorted(cs.indices.items()):
+ if cs._arg2scopenum[argname] != scopenum:
+ continue
+ if scopenum == 0: # session
+ key = (argname, param_index)
+ elif scopenum == 1: # package
+ key = (argname, param_index, item.fspath.dirpath())
+ elif scopenum == 2: # module
+ key = (argname, param_index, item.fspath)
+ elif scopenum == 3: # class
+ key = (argname, param_index, item.fspath, item.cls)
+ yield key
+
+
+# algorithm for sorting on a per-parametrized resource setup basis
+# it is called for scopenum==0 (session) first and performs sorting
+# down to the lower scopes such as to minimize number of "high scope"
+# setups and teardowns
+
+
+def reorder_items(items):
+ argkeys_cache = {}
+ items_by_argkey = {}
+ for scopenum in range(0, scopenum_function):
+ argkeys_cache[scopenum] = d = {}
+ items_by_argkey[scopenum] = item_d = defaultdict(deque)
+ for item in items:
+ keys = OrderedDict.fromkeys(get_parametrized_fixture_keys(item, scopenum))
+ if keys:
+ d[item] = keys
+ for key in keys:
+ item_d[key].append(item)
+ items = OrderedDict.fromkeys(items)
+ return list(reorder_items_atscope(items, argkeys_cache, items_by_argkey, 0))
+
+
+def fix_cache_order(item, argkeys_cache, items_by_argkey):
+ for scopenum in range(0, scopenum_function):
+ for key in argkeys_cache[scopenum].get(item, []):
+ items_by_argkey[scopenum][key].appendleft(item)
+
+
+def reorder_items_atscope(items, argkeys_cache, items_by_argkey, scopenum):
+ if scopenum >= scopenum_function or len(items) < 3:
+ return items
+ ignore = set()
+ items_deque = deque(items)
+ items_done = OrderedDict()
+ scoped_items_by_argkey = items_by_argkey[scopenum]
+ scoped_argkeys_cache = argkeys_cache[scopenum]
+ while items_deque:
+ no_argkey_group = OrderedDict()
+ slicing_argkey = None
+ while items_deque:
+ item = items_deque.popleft()
+ if item in items_done or item in no_argkey_group:
+ continue
+ argkeys = OrderedDict.fromkeys(
+ k for k in scoped_argkeys_cache.get(item, []) if k not in ignore
+ )
+ if not argkeys:
+ no_argkey_group[item] = None
+ else:
+ slicing_argkey, _ = argkeys.popitem()
+ # we don't have to remove relevant items from later in the deque because they'll just be ignored
+ matching_items = [
+ i for i in scoped_items_by_argkey[slicing_argkey] if i in items
+ ]
+ for i in reversed(matching_items):
+ fix_cache_order(i, argkeys_cache, items_by_argkey)
+ items_deque.appendleft(i)
+ break
+ if no_argkey_group:
+ no_argkey_group = reorder_items_atscope(
+ no_argkey_group, argkeys_cache, items_by_argkey, scopenum + 1
+ )
+ for item in no_argkey_group:
+ items_done[item] = None
+ ignore.add(slicing_argkey)
+ return items_done
+
+
+def fillfixtures(function):
+ """ fill missing funcargs for a test function. """
+ try:
+ request = function._request
+ except AttributeError:
+ # XXX this special code path is only expected to execute
+ # with the oejskit plugin. It uses classes with funcargs
+ # and we thus have to work a bit to allow this.
+ fm = function.session._fixturemanager
+ fi = fm.getfixtureinfo(function.parent, function.obj, None)
+ function._fixtureinfo = fi
+ request = function._request = FixtureRequest(function)
+ request._fillfixtures()
+ # prune out funcargs for jstests
+ newfuncargs = {}
+ for name in fi.argnames:
+ newfuncargs[name] = function.funcargs[name]
+ function.funcargs = newfuncargs
+ else:
+ request._fillfixtures()
+
+
+def get_direct_param_fixture_func(request):
+ return request.param
+
+
+@attr.s(slots=True)
+class FuncFixtureInfo(object):
+ # original function argument names
+ argnames = attr.ib(type=tuple)
+ # argnames that function immediately requires. These include argnames +
+ # fixture names specified via usefixtures and via autouse=True in fixture
+ # definitions.
+ initialnames = attr.ib(type=tuple)
+ names_closure = attr.ib() # List[str]
+ name2fixturedefs = attr.ib() # List[str, List[FixtureDef]]
+
+ def prune_dependency_tree(self):
+ """Recompute names_closure from initialnames and name2fixturedefs
+
+ Can only reduce names_closure, which means that the new closure will
+ always be a subset of the old one. The order is preserved.
+
+ This method is needed because direct parametrization may shadow some
+ of the fixtures that were included in the originally built dependency
+ tree. In this way the dependency tree can get pruned, and the closure
+ of argnames may get reduced.
+ """
+ closure = set()
+ working_set = set(self.initialnames)
+ while working_set:
+ argname = working_set.pop()
+ # argname may be smth not included in the original names_closure,
+ # in which case we ignore it. This currently happens with pseudo
+ # FixtureDefs which wrap 'get_direct_param_fixture_func(request)'.
+ # So they introduce the new dependency 'request' which might have
+ # been missing in the original tree (closure).
+ if argname not in closure and argname in self.names_closure:
+ closure.add(argname)
+ if argname in self.name2fixturedefs:
+ working_set.update(self.name2fixturedefs[argname][-1].argnames)
+
+ self.names_closure[:] = sorted(closure, key=self.names_closure.index)
+
+
+class FixtureRequest(FuncargnamesCompatAttr):
+ """ A request for a fixture from a test or fixture function.
+
+ A request object gives access to the requesting test context
+ and has an optional ``param`` attribute in case
+ the fixture is parametrized indirectly.
+ """
+
+ def __init__(self, pyfuncitem):
+ self._pyfuncitem = pyfuncitem
+ #: fixture for which this request is being performed
+ self.fixturename = None
+ #: Scope string, one of "function", "class", "module", "session"
+ self.scope = "function"
+ self._fixture_defs = {} # argname -> FixtureDef
+ fixtureinfo = pyfuncitem._fixtureinfo
+ self._arg2fixturedefs = fixtureinfo.name2fixturedefs.copy()
+ self._arg2index = {}
+ self._fixturemanager = pyfuncitem.session._fixturemanager
+
+ @property
+ def fixturenames(self):
+ """names of all active fixtures in this request"""
+ result = list(self._pyfuncitem._fixtureinfo.names_closure)
+ result.extend(set(self._fixture_defs).difference(result))
+ return result
+
+ @property
+ def node(self):
+ """ underlying collection node (depends on current request scope)"""
+ return self._getscopeitem(self.scope)
+
+ def _getnextfixturedef(self, argname):
+ fixturedefs = self._arg2fixturedefs.get(argname, None)
+ if fixturedefs is None:
+ # we arrive here because of a dynamic call to
+ # getfixturevalue(argname) usage which was naturally
+ # not known at parsing/collection time
+ parentid = self._pyfuncitem.parent.nodeid
+ fixturedefs = self._fixturemanager.getfixturedefs(argname, parentid)
+ self._arg2fixturedefs[argname] = fixturedefs
+ # fixturedefs list is immutable so we maintain a decreasing index
+ index = self._arg2index.get(argname, 0) - 1
+ if fixturedefs is None or (-index > len(fixturedefs)):
+ raise FixtureLookupError(argname, self)
+ self._arg2index[argname] = index
+ return fixturedefs[index]
+
+ @property
+ def config(self):
+ """ the pytest config object associated with this request. """
+ return self._pyfuncitem.config
+
+ @scopeproperty()
+ def function(self):
+ """ test function object if the request has a per-function scope. """
+ return self._pyfuncitem.obj
+
+ @scopeproperty("class")
+ def cls(self):
+ """ class (can be None) where the test function was collected. """
+ clscol = self._pyfuncitem.getparent(_pytest.python.Class)
+ if clscol:
+ return clscol.obj
+
+ @property
+ def instance(self):
+ """ instance (can be None) on which test function was collected. """
+ # unittest support hack, see _pytest.unittest.TestCaseFunction
+ try:
+ return self._pyfuncitem._testcase
+ except AttributeError:
+ function = getattr(self, "function", None)
+ return getattr(function, "__self__", None)
+
+ @scopeproperty()
+ def module(self):
+ """ python module object where the test function was collected. """
+ return self._pyfuncitem.getparent(_pytest.python.Module).obj
+
+ @scopeproperty()
+ def fspath(self):
+ """ the file system path of the test module which collected this test. """
+ return self._pyfuncitem.fspath
+
+ @property
+ def keywords(self):
+ """ keywords/markers dictionary for the underlying node. """
+ return self.node.keywords
+
+ @property
+ def session(self):
+ """ pytest session object. """
+ return self._pyfuncitem.session
+
+ def addfinalizer(self, finalizer):
+ """ add finalizer/teardown function to be called after the
+ last test within the requesting test context finished
+ execution. """
+ # XXX usually this method is shadowed by fixturedef specific ones
+ self._addfinalizer(finalizer, scope=self.scope)
+
+ def _addfinalizer(self, finalizer, scope):
+ colitem = self._getscopeitem(scope)
+ self._pyfuncitem.session._setupstate.addfinalizer(
+ finalizer=finalizer, colitem=colitem
+ )
+
+ def applymarker(self, marker):
+ """ Apply a marker to a single test function invocation.
+ This method is useful if you don't want to have a keyword/marker
+ on all function invocations.
+
+ :arg marker: a :py:class:`_pytest.mark.MarkDecorator` object
+ created by a call to ``pytest.mark.NAME(...)``.
+ """
+ self.node.add_marker(marker)
+
+ def raiseerror(self, msg):
+ """ raise a FixtureLookupError with the given message. """
+ raise self._fixturemanager.FixtureLookupError(None, self, msg)
+
+ def _fillfixtures(self):
+ item = self._pyfuncitem
+ fixturenames = getattr(item, "fixturenames", self.fixturenames)
+ for argname in fixturenames:
+ if argname not in item.funcargs:
+ item.funcargs[argname] = self.getfixturevalue(argname)
+
+ def getfixturevalue(self, argname):
+ """ Dynamically run a named fixture function.
+
+ Declaring fixtures via function argument is recommended where possible.
+ But if you can only decide whether to use another fixture at test
+ setup time, you may use this function to retrieve it inside a fixture
+ or test function body.
+ """
+ return self._get_active_fixturedef(argname).cached_result[0]
+
+ def getfuncargvalue(self, argname):
+ """ Deprecated, use getfixturevalue. """
+ from _pytest import deprecated
+
+ warnings.warn(deprecated.GETFUNCARGVALUE, stacklevel=2)
+ return self.getfixturevalue(argname)
+
+ def _get_active_fixturedef(self, argname):
+ try:
+ return self._fixture_defs[argname]
+ except KeyError:
+ try:
+ fixturedef = self._getnextfixturedef(argname)
+ except FixtureLookupError:
+ if argname == "request":
+ cached_result = (self, [0], None)
+ scope = "function"
+ return PseudoFixtureDef(cached_result, scope)
+ raise
+ # remove indent to prevent the python3 exception
+ # from leaking into the call
+ self._compute_fixture_value(fixturedef)
+ self._fixture_defs[argname] = fixturedef
+ return fixturedef
+
+ def _get_fixturestack(self):
+ current = self
+ values = []
+ while 1:
+ fixturedef = getattr(current, "_fixturedef", None)
+ if fixturedef is None:
+ values.reverse()
+ return values
+ values.append(fixturedef)
+ current = current._parent_request
+
+ def _compute_fixture_value(self, fixturedef):
+ """
+ Creates a SubRequest based on "self" and calls the execute method of the given fixturedef object. This will
+ force the FixtureDef object to throw away any previous results and compute a new fixture value, which
+ will be stored into the FixtureDef object itself.
+
+ :param FixtureDef fixturedef:
+ """
+ # prepare a subrequest object before calling fixture function
+ # (latter managed by fixturedef)
+ argname = fixturedef.argname
+ funcitem = self._pyfuncitem
+ scope = fixturedef.scope
+ try:
+ param = funcitem.callspec.getparam(argname)
+ except (AttributeError, ValueError):
+ param = NOTSET
+ param_index = 0
+ has_params = fixturedef.params is not None
+ fixtures_not_supported = getattr(funcitem, "nofuncargs", False)
+ if has_params and fixtures_not_supported:
+ msg = (
+ "{name} does not support fixtures, maybe unittest.TestCase subclass?\n"
+ "Node id: {nodeid}\n"
+ "Function type: {typename}"
+ ).format(
+ name=funcitem.name,
+ nodeid=funcitem.nodeid,
+ typename=type(funcitem).__name__,
+ )
+ fail(msg, pytrace=False)
+ if has_params:
+ frame = inspect.stack()[3]
+ frameinfo = inspect.getframeinfo(frame[0])
+ source_path = frameinfo.filename
+ source_lineno = frameinfo.lineno
+ source_path = py.path.local(source_path)
+ if source_path.relto(funcitem.config.rootdir):
+ source_path = source_path.relto(funcitem.config.rootdir)
+ msg = (
+ "The requested fixture has no parameter defined for test:\n"
+ " {}\n\n"
+ "Requested fixture '{}' defined in:\n{}"
+ "\n\nRequested here:\n{}:{}".format(
+ funcitem.nodeid,
+ fixturedef.argname,
+ getlocation(fixturedef.func, funcitem.config.rootdir),
+ source_path,
+ source_lineno,
+ )
+ )
+ fail(msg, pytrace=False)
+ else:
+ param_index = funcitem.callspec.indices[argname]
+ # if a parametrize invocation set a scope it will override
+ # the static scope defined with the fixture function
+ paramscopenum = funcitem.callspec._arg2scopenum.get(argname)
+ if paramscopenum is not None:
+ scope = scopes[paramscopenum]
+
+ subrequest = SubRequest(self, scope, param, param_index, fixturedef)
+
+ # check if a higher-level scoped fixture accesses a lower level one
+ subrequest._check_scope(argname, self.scope, scope)
+
+ # clear sys.exc_info before invoking the fixture (python bug?)
+ # if it's not explicitly cleared it will leak into the call
+ exc_clear()
+ try:
+ # call the fixture function
+ fixturedef.execute(request=subrequest)
+ finally:
+ self._schedule_finalizers(fixturedef, subrequest)
+
+ def _schedule_finalizers(self, fixturedef, subrequest):
+ # if fixture function failed it might have registered finalizers
+ self.session._setupstate.addfinalizer(
+ functools.partial(fixturedef.finish, request=subrequest), subrequest.node
+ )
+
+ def _check_scope(self, argname, invoking_scope, requested_scope):
+ if argname == "request":
+ return
+ if scopemismatch(invoking_scope, requested_scope):
+ # try to report something helpful
+ lines = self._factorytraceback()
+ fail(
+ "ScopeMismatch: You tried to access the %r scoped "
+ "fixture %r with a %r scoped request object, "
+ "involved factories\n%s"
+ % ((requested_scope, argname, invoking_scope, "\n".join(lines))),
+ pytrace=False,
+ )
+
+ def _factorytraceback(self):
+ lines = []
+ for fixturedef in self._get_fixturestack():
+ factory = fixturedef.func
+ fs, lineno = getfslineno(factory)
+ p = self._pyfuncitem.session.fspath.bestrelpath(fs)
+ args = _format_args(factory)
+ lines.append("%s:%d: def %s%s" % (p, lineno + 1, factory.__name__, args))
+ return lines
+
+ def _getscopeitem(self, scope):
+ if scope == "function":
+ # this might also be a non-function Item despite its attribute name
+ return self._pyfuncitem
+ if scope == "package":
+ node = get_scope_package(self._pyfuncitem, self._fixturedef)
+ else:
+ node = get_scope_node(self._pyfuncitem, scope)
+ if node is None and scope == "class":
+ # fallback to function item itself
+ node = self._pyfuncitem
+ assert node, 'Could not obtain a node for scope "{}" for function {!r}'.format(
+ scope, self._pyfuncitem
+ )
+ return node
+
+ def __repr__(self):
+ return "<FixtureRequest for %r>" % (self.node)
+
+
+class SubRequest(FixtureRequest):
+ """ a sub request for handling getting a fixture from a
+ test function/fixture. """
+
+ def __init__(self, request, scope, param, param_index, fixturedef):
+ self._parent_request = request
+ self.fixturename = fixturedef.argname
+ if param is not NOTSET:
+ self.param = param
+ self.param_index = param_index
+ self.scope = scope
+ self._fixturedef = fixturedef
+ self._pyfuncitem = request._pyfuncitem
+ self._fixture_defs = request._fixture_defs
+ self._arg2fixturedefs = request._arg2fixturedefs
+ self._arg2index = request._arg2index
+ self._fixturemanager = request._fixturemanager
+
+ def __repr__(self):
+ return "<SubRequest %r for %r>" % (self.fixturename, self._pyfuncitem)
+
+ def addfinalizer(self, finalizer):
+ self._fixturedef.addfinalizer(finalizer)
+
+ def _schedule_finalizers(self, fixturedef, subrequest):
+ # if the executing fixturedef was not explicitly requested in the argument list (via
+ # getfixturevalue inside the fixture call) then ensure this fixture def will be finished
+ # first
+ if fixturedef.argname not in self.funcargnames:
+ fixturedef.addfinalizer(
+ functools.partial(self._fixturedef.finish, request=self)
+ )
+ super(SubRequest, self)._schedule_finalizers(fixturedef, subrequest)
+
+
+scopes = "session package module class function".split()
+scopenum_function = scopes.index("function")
+
+
+def scopemismatch(currentscope, newscope):
+ return scopes.index(newscope) > scopes.index(currentscope)
+
+
+def scope2index(scope, descr, where=None):
+ """Look up the index of ``scope`` and raise a descriptive value error
+ if not defined.
+ """
+ try:
+ return scopes.index(scope)
+ except ValueError:
+ fail(
+ "{} {}got an unexpected scope value '{}'".format(
+ descr, "from {} ".format(where) if where else "", scope
+ ),
+ pytrace=False,
+ )
+
+
+class FixtureLookupError(LookupError):
+ """ could not return a requested Fixture (missing or invalid). """
+
+ def __init__(self, argname, request, msg=None):
+ self.argname = argname
+ self.request = request
+ self.fixturestack = request._get_fixturestack()
+ self.msg = msg
+
+ def formatrepr(self):
+ tblines = []
+ addline = tblines.append
+ stack = [self.request._pyfuncitem.obj]
+ stack.extend(map(lambda x: x.func, self.fixturestack))
+ msg = self.msg
+ if msg is not None:
+ # the last fixture raise an error, let's present
+ # it at the requesting side
+ stack = stack[:-1]
+ for function in stack:
+ fspath, lineno = getfslineno(function)
+ try:
+ lines, _ = inspect.getsourcelines(get_real_func(function))
+ except (IOError, IndexError, TypeError):
+ error_msg = "file %s, line %s: source code not available"
+ addline(error_msg % (fspath, lineno + 1))
+ else:
+ addline("file %s, line %s" % (fspath, lineno + 1))
+ for i, line in enumerate(lines):
+ line = line.rstrip()
+ addline(" " + line)
+ if line.lstrip().startswith("def"):
+ break
+
+ if msg is None:
+ fm = self.request._fixturemanager
+ available = set()
+ parentid = self.request._pyfuncitem.parent.nodeid
+ for name, fixturedefs in fm._arg2fixturedefs.items():
+ faclist = list(fm._matchfactories(fixturedefs, parentid))
+ if faclist:
+ available.add(name)
+ if self.argname in available:
+ msg = " recursive dependency involving fixture '{}' detected".format(
+ self.argname
+ )
+ else:
+ msg = "fixture '{}' not found".format(self.argname)
+ msg += "\n available fixtures: {}".format(", ".join(sorted(available)))
+ msg += "\n use 'pytest --fixtures [testpath]' for help on them."
+
+ return FixtureLookupErrorRepr(fspath, lineno, tblines, msg, self.argname)
+
+
+class FixtureLookupErrorRepr(TerminalRepr):
+ def __init__(self, filename, firstlineno, tblines, errorstring, argname):
+ self.tblines = tblines
+ self.errorstring = errorstring
+ self.filename = filename
+ self.firstlineno = firstlineno
+ self.argname = argname
+
+ def toterminal(self, tw):
+ # tw.line("FixtureLookupError: %s" %(self.argname), red=True)
+ for tbline in self.tblines:
+ tw.line(tbline.rstrip())
+ lines = self.errorstring.split("\n")
+ if lines:
+ tw.line(
+ "{} {}".format(FormattedExcinfo.fail_marker, lines[0].strip()),
+ red=True,
+ )
+ for line in lines[1:]:
+ tw.line(
+ "{} {}".format(FormattedExcinfo.flow_marker, line.strip()),
+ red=True,
+ )
+ tw.line()
+ tw.line("%s:%d" % (self.filename, self.firstlineno + 1))
+
+
+def fail_fixturefunc(fixturefunc, msg):
+ fs, lineno = getfslineno(fixturefunc)
+ location = "%s:%s" % (fs, lineno + 1)
+ source = _pytest._code.Source(fixturefunc)
+ fail(msg + ":\n\n" + str(source.indent()) + "\n" + location, pytrace=False)
+
+
+def call_fixture_func(fixturefunc, request, kwargs):
+ yieldctx = is_generator(fixturefunc)
+ if yieldctx:
+ it = fixturefunc(**kwargs)
+ res = next(it)
+ finalizer = functools.partial(_teardown_yield_fixture, fixturefunc, it)
+ request.addfinalizer(finalizer)
+ else:
+ res = fixturefunc(**kwargs)
+ return res
+
+
+def _teardown_yield_fixture(fixturefunc, it):
+ """Executes the teardown of a fixture function by advancing the iterator after the
+ yield and ensure the iteration ends (if not it means there is more than one yield in the function)"""
+ try:
+ next(it)
+ except StopIteration:
+ pass
+ else:
+ fail_fixturefunc(
+ fixturefunc, "yield_fixture function has more than one 'yield'"
+ )
+
+
+class FixtureDef(object):
+ """ A container for a factory definition. """
+
+ def __init__(
+ self,
+ fixturemanager,
+ baseid,
+ argname,
+ func,
+ scope,
+ params,
+ unittest=False,
+ ids=None,
+ ):
+ self._fixturemanager = fixturemanager
+ self.baseid = baseid or ""
+ self.has_location = baseid is not None
+ self.func = func
+ self.argname = argname
+ self.scope = scope
+ self.scopenum = scope2index(
+ scope or "function",
+ descr="Fixture '{}'".format(func.__name__),
+ where=baseid,
+ )
+ self.params = params
+ self.argnames = getfuncargnames(func, is_method=unittest)
+ self.unittest = unittest
+ self.ids = ids
+ self._finalizers = []
+
+ def addfinalizer(self, finalizer):
+ self._finalizers.append(finalizer)
+
+ def finish(self, request):
+ exceptions = []
+ try:
+ while self._finalizers:
+ try:
+ func = self._finalizers.pop()
+ func()
+ except: # noqa
+ exceptions.append(sys.exc_info())
+ if exceptions:
+ e = exceptions[0]
+ # Ensure to not keep frame references through traceback.
+ del exceptions
+ six.reraise(*e)
+ finally:
+ hook = self._fixturemanager.session.gethookproxy(request.node.fspath)
+ hook.pytest_fixture_post_finalizer(fixturedef=self, request=request)
+ # even if finalization fails, we invalidate
+ # the cached fixture value and remove
+ # all finalizers because they may be bound methods which will
+ # keep instances alive
+ if hasattr(self, "cached_result"):
+ del self.cached_result
+ self._finalizers = []
+
+ def execute(self, request):
+ # get required arguments and register our own finish()
+ # with their finalization
+ for argname in self.argnames:
+ fixturedef = request._get_active_fixturedef(argname)
+ if argname != "request":
+ fixturedef.addfinalizer(functools.partial(self.finish, request=request))
+
+ my_cache_key = request.param_index
+ cached_result = getattr(self, "cached_result", None)
+ if cached_result is not None:
+ result, cache_key, err = cached_result
+ if my_cache_key == cache_key:
+ if err is not None:
+ six.reraise(*err)
+ else:
+ return result
+ # we have a previous but differently parametrized fixture instance
+ # so we need to tear it down before creating a new one
+ self.finish(request)
+ assert not hasattr(self, "cached_result")
+
+ hook = self._fixturemanager.session.gethookproxy(request.node.fspath)
+ return hook.pytest_fixture_setup(fixturedef=self, request=request)
+
+ def __repr__(self):
+ return "<FixtureDef argname=%r scope=%r baseid=%r>" % (
+ self.argname,
+ self.scope,
+ self.baseid,
+ )
+
+
+def resolve_fixture_function(fixturedef, request):
+ """Gets the actual callable that can be called to obtain the fixture value, dealing with unittest-specific
+ instances and bound methods.
+ """
+ fixturefunc = fixturedef.func
+ if fixturedef.unittest:
+ if request.instance is not None:
+ # bind the unbound method to the TestCase instance
+ fixturefunc = fixturedef.func.__get__(request.instance)
+ else:
+ # the fixture function needs to be bound to the actual
+ # request.instance so that code working with "fixturedef" behaves
+ # as expected.
+ if request.instance is not None:
+ fixturefunc = getimfunc(fixturedef.func)
+ if fixturefunc != fixturedef.func:
+ fixturefunc = fixturefunc.__get__(request.instance)
+ return fixturefunc
+
+
+def pytest_fixture_setup(fixturedef, request):
+ """ Execution of fixture setup. """
+ kwargs = {}
+ for argname in fixturedef.argnames:
+ fixdef = request._get_active_fixturedef(argname)
+ result, arg_cache_key, exc = fixdef.cached_result
+ request._check_scope(argname, request.scope, fixdef.scope)
+ kwargs[argname] = result
+
+ fixturefunc = resolve_fixture_function(fixturedef, request)
+ my_cache_key = request.param_index
+ try:
+ result = call_fixture_func(fixturefunc, request, kwargs)
+ except TEST_OUTCOME:
+ fixturedef.cached_result = (None, my_cache_key, sys.exc_info())
+ raise
+ fixturedef.cached_result = (result, my_cache_key, None)
+ return result
+
+
+def _ensure_immutable_ids(ids):
+ if ids is None:
+ return
+ if callable(ids):
+ return ids
+ return tuple(ids)
+
+
+def wrap_function_to_error_out_if_called_directly(function, fixture_marker):
+ """Wrap the given fixture function so we can raise an error about it being called directly,
+ instead of used as an argument in a test function.
+ """
+ message = FIXTURE_FUNCTION_CALL.format(
+ name=fixture_marker.name or function.__name__
+ )
+
+ @six.wraps(function)
+ def result(*args, **kwargs):
+ fail(message, pytrace=False)
+
+ # keep reference to the original function in our own custom attribute so we don't unwrap
+ # further than this point and lose useful wrappings like @mock.patch (#3774)
+ result.__pytest_wrapped__ = _PytestWrapper(function)
+
+ return result
+
+
+@attr.s(frozen=True)
+class FixtureFunctionMarker(object):
+ scope = attr.ib()
+ params = attr.ib(converter=attr.converters.optional(tuple))
+ autouse = attr.ib(default=False)
+ ids = attr.ib(default=None, converter=_ensure_immutable_ids)
+ name = attr.ib(default=None)
+
+ def __call__(self, function):
+ if isclass(function):
+ raise ValueError("class fixtures not supported (maybe in the future)")
+
+ if getattr(function, "_pytestfixturefunction", False):
+ raise ValueError(
+ "fixture is being applied more than once to the same function"
+ )
+
+ function = wrap_function_to_error_out_if_called_directly(function, self)
+
+ name = self.name or function.__name__
+ if name == "request":
+ warnings.warn(FIXTURE_NAMED_REQUEST)
+ function._pytestfixturefunction = self
+ return function
+
+
+def fixture(scope="function", params=None, autouse=False, ids=None, name=None):
+ """Decorator to mark a fixture factory function.
+
+ This decorator can be used, with or without parameters, to define a
+ fixture function.
+
+ The name of the fixture function can later be referenced to cause its
+ invocation ahead of running tests: test
+ modules or classes can use the ``pytest.mark.usefixtures(fixturename)``
+ marker.
+
+ Test functions can directly use fixture names as input
+ arguments in which case the fixture instance returned from the fixture
+ function will be injected.
+
+ Fixtures can provide their values to test functions using ``return`` or ``yield``
+ statements. When using ``yield`` the code block after the ``yield`` statement is executed
+ as teardown code regardless of the test outcome, and must yield exactly once.
+
+ :arg scope: the scope for which this fixture is shared, one of
+ ``"function"`` (default), ``"class"``, ``"module"``,
+ ``"package"`` or ``"session"``.
+
+ ``"package"`` is considered **experimental** at this time.
+
+ :arg params: an optional list of parameters which will cause multiple
+ invocations of the fixture function and all of the tests
+ using it.
+ The current parameter is available in ``request.param``.
+
+ :arg autouse: if True, the fixture func is activated for all tests that
+ can see it. If False (the default) then an explicit
+ reference is needed to activate the fixture.
+
+ :arg ids: list of string ids each corresponding to the params
+ so that they are part of the test id. If no ids are provided
+ they will be generated automatically from the params.
+
+ :arg name: the name of the fixture. This defaults to the name of the
+ decorated function. If a fixture is used in the same module in
+ which it is defined, the function name of the fixture will be
+ shadowed by the function arg that requests the fixture; one way
+ to resolve this is to name the decorated function
+ ``fixture_<fixturename>`` and then use
+ ``@pytest.fixture(name='<fixturename>')``.
+ """
+ if callable(scope) and params is None and autouse is False:
+ # direct decoration
+ return FixtureFunctionMarker("function", params, autouse, name=name)(scope)
+ if params is not None and not isinstance(params, (list, tuple)):
+ params = list(params)
+ return FixtureFunctionMarker(scope, params, autouse, ids=ids, name=name)
+
+
+def yield_fixture(scope="function", params=None, autouse=False, ids=None, name=None):
+ """ (return a) decorator to mark a yield-fixture factory function.
+
+ .. deprecated:: 3.0
+ Use :py:func:`pytest.fixture` directly instead.
+ """
+ return fixture(scope=scope, params=params, autouse=autouse, ids=ids, name=name)
+
+
+defaultfuncargprefixmarker = fixture()
+
+
+@fixture(scope="session")
+def pytestconfig(request):
+ """Session-scoped fixture that returns the :class:`_pytest.config.Config` object.
+
+ Example::
+
+ def test_foo(pytestconfig):
+ if pytestconfig.getoption("verbose") > 0:
+ ...
+
+ """
+ return request.config
+
+
+def pytest_addoption(parser):
+ parser.addini(
+ "usefixtures",
+ type="args",
+ default=[],
+ help="list of default fixtures to be used with this project",
+ )
+
+
+class FixtureManager(object):
+ """
+ pytest fixtures definitions and information is stored and managed
+ from this class.
+
+ During collection fm.parsefactories() is called multiple times to parse
+ fixture function definitions into FixtureDef objects and internal
+ data structures.
+
+ During collection of test functions, metafunc-mechanics instantiate
+ a FuncFixtureInfo object which is cached per node/func-name.
+ This FuncFixtureInfo object is later retrieved by Function nodes
+ which themselves offer a fixturenames attribute.
+
+ The FuncFixtureInfo object holds information about fixtures and FixtureDefs
+ relevant for a particular function. An initial list of fixtures is
+ assembled like this:
+
+ - ini-defined usefixtures
+ - autouse-marked fixtures along the collection chain up from the function
+ - usefixtures markers at module/class/function level
+ - test function funcargs
+
+ Subsequently the funcfixtureinfo.fixturenames attribute is computed
+ as the closure of the fixtures needed to setup the initial fixtures,
+ i. e. fixtures needed by fixture functions themselves are appended
+ to the fixturenames list.
+
+ Upon the test-setup phases all fixturenames are instantiated, retrieved
+ by a lookup of their FuncFixtureInfo.
+ """
+
+ FixtureLookupError = FixtureLookupError
+ FixtureLookupErrorRepr = FixtureLookupErrorRepr
+
+ def __init__(self, session):
+ self.session = session
+ self.config = session.config
+ self._arg2fixturedefs = {}
+ self._holderobjseen = set()
+ self._arg2finish = {}
+ self._nodeid_and_autousenames = [("", self.config.getini("usefixtures"))]
+ session.config.pluginmanager.register(self, "funcmanage")
+
+ def _get_direct_parametrize_args(self, node):
+ """This function returns all the direct parametrization
+ arguments of a node, so we don't mistake them for fixtures
+
+ Check https://github.com/pytest-dev/pytest/issues/5036
+
+ This things are done later as well when dealing with parametrization
+ so this could be improved
+ """
+ from _pytest.mark import ParameterSet
+
+ parametrize_argnames = []
+ for marker in node.iter_markers(name="parametrize"):
+ if not marker.kwargs.get("indirect", False):
+ p_argnames, _ = ParameterSet._parse_parametrize_args(
+ *marker.args, **marker.kwargs
+ )
+ parametrize_argnames.extend(p_argnames)
+
+ return parametrize_argnames
+
+ def getfixtureinfo(self, node, func, cls, funcargs=True):
+ if funcargs and not getattr(node, "nofuncargs", False):
+ argnames = getfuncargnames(func, cls=cls)
+ else:
+ argnames = ()
+
+ usefixtures = itertools.chain.from_iterable(
+ mark.args for mark in node.iter_markers(name="usefixtures")
+ )
+ initialnames = tuple(usefixtures) + argnames
+ fm = node.session._fixturemanager
+ initialnames, names_closure, arg2fixturedefs = fm.getfixtureclosure(
+ initialnames, node, ignore_args=self._get_direct_parametrize_args(node)
+ )
+ return FuncFixtureInfo(argnames, initialnames, names_closure, arg2fixturedefs)
+
+ def pytest_plugin_registered(self, plugin):
+ nodeid = None
+ try:
+ p = py.path.local(plugin.__file__).realpath()
+ except AttributeError:
+ pass
+ else:
+ # construct the base nodeid which is later used to check
+ # what fixtures are visible for particular tests (as denoted
+ # by their test id)
+ if p.basename.startswith("conftest.py"):
+ nodeid = p.dirpath().relto(self.config.rootdir)
+ if p.sep != nodes.SEP:
+ nodeid = nodeid.replace(p.sep, nodes.SEP)
+
+ self.parsefactories(plugin, nodeid)
+
+ def _getautousenames(self, nodeid):
+ """ return a tuple of fixture names to be used. """
+ autousenames = []
+ for baseid, basenames in self._nodeid_and_autousenames:
+ if nodeid.startswith(baseid):
+ if baseid:
+ i = len(baseid)
+ nextchar = nodeid[i : i + 1]
+ if nextchar and nextchar not in ":/":
+ continue
+ autousenames.extend(basenames)
+ return autousenames
+
+ def getfixtureclosure(self, fixturenames, parentnode, ignore_args=()):
+ # collect the closure of all fixtures , starting with the given
+ # fixturenames as the initial set. As we have to visit all
+ # factory definitions anyway, we also return an arg2fixturedefs
+ # mapping so that the caller can reuse it and does not have
+ # to re-discover fixturedefs again for each fixturename
+ # (discovering matching fixtures for a given name/node is expensive)
+
+ parentid = parentnode.nodeid
+ fixturenames_closure = self._getautousenames(parentid)
+
+ def merge(otherlist):
+ for arg in otherlist:
+ if arg not in fixturenames_closure:
+ fixturenames_closure.append(arg)
+
+ merge(fixturenames)
+
+ # at this point, fixturenames_closure contains what we call "initialnames",
+ # which is a set of fixturenames the function immediately requests. We
+ # need to return it as well, so save this.
+ initialnames = tuple(fixturenames_closure)
+
+ arg2fixturedefs = {}
+ lastlen = -1
+ while lastlen != len(fixturenames_closure):
+ lastlen = len(fixturenames_closure)
+ for argname in fixturenames_closure:
+ if argname in ignore_args:
+ continue
+ if argname in arg2fixturedefs:
+ continue
+ fixturedefs = self.getfixturedefs(argname, parentid)
+ if fixturedefs:
+ arg2fixturedefs[argname] = fixturedefs
+ merge(fixturedefs[-1].argnames)
+
+ def sort_by_scope(arg_name):
+ try:
+ fixturedefs = arg2fixturedefs[arg_name]
+ except KeyError:
+ return scopes.index("function")
+ else:
+ return fixturedefs[-1].scopenum
+
+ fixturenames_closure.sort(key=sort_by_scope)
+ return initialnames, fixturenames_closure, arg2fixturedefs
+
+ def pytest_generate_tests(self, metafunc):
+ for argname in metafunc.fixturenames:
+ faclist = metafunc._arg2fixturedefs.get(argname)
+ if faclist:
+ fixturedef = faclist[-1]
+ if fixturedef.params is not None:
+ markers = list(metafunc.definition.iter_markers("parametrize"))
+ for parametrize_mark in markers:
+ if "argnames" in parametrize_mark.kwargs:
+ argnames = parametrize_mark.kwargs["argnames"]
+ else:
+ argnames = parametrize_mark.args[0]
+
+ if not isinstance(argnames, (tuple, list)):
+ argnames = [
+ x.strip() for x in argnames.split(",") if x.strip()
+ ]
+ if argname in argnames:
+ break
+ else:
+ metafunc.parametrize(
+ argname,
+ fixturedef.params,
+ indirect=True,
+ scope=fixturedef.scope,
+ ids=fixturedef.ids,
+ )
+ else:
+ continue # will raise FixtureLookupError at setup time
+
+ def pytest_collection_modifyitems(self, items):
+ # separate parametrized setups
+ items[:] = reorder_items(items)
+
+ def parsefactories(self, node_or_obj, nodeid=NOTSET, unittest=False):
+ if nodeid is not NOTSET:
+ holderobj = node_or_obj
+ else:
+ holderobj = node_or_obj.obj
+ nodeid = node_or_obj.nodeid
+ if holderobj in self._holderobjseen:
+ return
+
+ self._holderobjseen.add(holderobj)
+ autousenames = []
+ for name in dir(holderobj):
+ # The attribute can be an arbitrary descriptor, so the attribute
+ # access below can raise. safe_getatt() ignores such exceptions.
+ obj = safe_getattr(holderobj, name, None)
+ marker = getfixturemarker(obj)
+ if not isinstance(marker, FixtureFunctionMarker):
+ # magic globals with __getattr__ might have got us a wrong
+ # fixture attribute
+ continue
+
+ if marker.name:
+ name = marker.name
+
+ # during fixture definition we wrap the original fixture function
+ # to issue a warning if called directly, so here we unwrap it in order to not emit the warning
+ # when pytest itself calls the fixture function
+ if six.PY2 and unittest:
+ # hack on Python 2 because of the unbound methods
+ obj = get_real_func(obj)
+ else:
+ obj = get_real_method(obj, holderobj)
+
+ fixture_def = FixtureDef(
+ self,
+ nodeid,
+ name,
+ obj,
+ marker.scope,
+ marker.params,
+ unittest=unittest,
+ ids=marker.ids,
+ )
+
+ faclist = self._arg2fixturedefs.setdefault(name, [])
+ if fixture_def.has_location:
+ faclist.append(fixture_def)
+ else:
+ # fixturedefs with no location are at the front
+ # so this inserts the current fixturedef after the
+ # existing fixturedefs from external plugins but
+ # before the fixturedefs provided in conftests.
+ i = len([f for f in faclist if not f.has_location])
+ faclist.insert(i, fixture_def)
+ if marker.autouse:
+ autousenames.append(name)
+
+ if autousenames:
+ self._nodeid_and_autousenames.append((nodeid or "", autousenames))
+
+ def getfixturedefs(self, argname, nodeid):
+ """
+ Gets a list of fixtures which are applicable to the given node id.
+
+ :param str argname: name of the fixture to search for
+ :param str nodeid: full node id of the requesting test.
+ :return: list[FixtureDef]
+ """
+ try:
+ fixturedefs = self._arg2fixturedefs[argname]
+ except KeyError:
+ return None
+ return tuple(self._matchfactories(fixturedefs, nodeid))
+
+ def _matchfactories(self, fixturedefs, nodeid):
+ for fixturedef in fixturedefs:
+ if nodes.ischildnode(fixturedef.baseid, nodeid):
+ yield fixturedef
diff --git a/contrib/python/pytest/py2/_pytest/freeze_support.py b/contrib/python/pytest/py2/_pytest/freeze_support.py
new file mode 100644
index 00000000000..aeeec2a56b4
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/freeze_support.py
@@ -0,0 +1,48 @@
+# -*- coding: utf-8 -*-
+"""
+Provides a function to report all internal modules for using freezing tools
+pytest
+"""
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+
+def freeze_includes():
+ """
+ Returns a list of module names used by pytest that should be
+ included by cx_freeze.
+ """
+ import py
+ import _pytest
+
+ result = list(_iter_all_modules(py))
+ result += list(_iter_all_modules(_pytest))
+ return result
+
+
+def _iter_all_modules(package, prefix=""):
+ """
+ Iterates over the names of all modules that can be found in the given
+ package, recursively.
+ Example:
+ _iter_all_modules(_pytest) ->
+ ['_pytest.assertion.newinterpret',
+ '_pytest.capture',
+ '_pytest.core',
+ ...
+ ]
+ """
+ import os
+ import pkgutil
+
+ if type(package) is not str:
+ path, prefix = package.__path__[0], package.__name__ + "."
+ else:
+ path = package
+ for _, name, is_package in pkgutil.iter_modules([path]):
+ if is_package:
+ for m in _iter_all_modules(os.path.join(path, name), prefix=name + "."):
+ yield prefix + m
+ else:
+ yield prefix + name
diff --git a/contrib/python/pytest/py2/_pytest/helpconfig.py b/contrib/python/pytest/py2/_pytest/helpconfig.py
new file mode 100644
index 00000000000..56811601608
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/helpconfig.py
@@ -0,0 +1,247 @@
+# -*- coding: utf-8 -*-
+""" version info, help messages, tracing configuration. """
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import os
+import sys
+from argparse import Action
+
+import py
+
+import pytest
+from _pytest.config import PrintHelp
+
+
+class HelpAction(Action):
+ """This is an argparse Action that will raise an exception in
+ order to skip the rest of the argument parsing when --help is passed.
+ This prevents argparse from quitting due to missing required arguments
+ when any are defined, for example by ``pytest_addoption``.
+ This is similar to the way that the builtin argparse --help option is
+ implemented by raising SystemExit.
+ """
+
+ def __init__(self, option_strings, dest=None, default=False, help=None):
+ super(HelpAction, self).__init__(
+ option_strings=option_strings,
+ dest=dest,
+ const=True,
+ default=default,
+ nargs=0,
+ help=help,
+ )
+
+ def __call__(self, parser, namespace, values, option_string=None):
+ setattr(namespace, self.dest, self.const)
+
+ # We should only skip the rest of the parsing after preparse is done
+ if getattr(parser._parser, "after_preparse", False):
+ raise PrintHelp
+
+
+def pytest_addoption(parser):
+ group = parser.getgroup("debugconfig")
+ group.addoption(
+ "--version",
+ action="store_true",
+ help="display pytest lib version and import information.",
+ )
+ group._addoption(
+ "-h",
+ "--help",
+ action=HelpAction,
+ dest="help",
+ help="show help message and configuration info",
+ )
+ group._addoption(
+ "-p",
+ action="append",
+ dest="plugins",
+ default=[],
+ metavar="name",
+ help="early-load given plugin module name or entry point (multi-allowed). "
+ "To avoid loading of plugins, use the `no:` prefix, e.g. "
+ "`no:doctest`.",
+ )
+ group.addoption(
+ "--traceconfig",
+ "--trace-config",
+ action="store_true",
+ default=False,
+ help="trace considerations of conftest.py files.",
+ ),
+ group.addoption(
+ "--debug",
+ action="store_true",
+ dest="debug",
+ default=False,
+ help="store internal tracing debug information in 'pytestdebug.log'.",
+ )
+ group._addoption(
+ "-o",
+ "--override-ini",
+ dest="override_ini",
+ action="append",
+ help='override ini option with "option=value" style, e.g. `-o xfail_strict=True -o cache_dir=cache`.',
+ )
+
+
+@pytest.hookimpl(hookwrapper=True)
+def pytest_cmdline_parse():
+ outcome = yield
+ config = outcome.get_result()
+ if config.option.debug:
+ path = os.path.abspath("pytestdebug.log")
+ debugfile = open(path, "w")
+ debugfile.write(
+ "versions pytest-%s, py-%s, "
+ "python-%s\ncwd=%s\nargs=%s\n\n"
+ % (
+ pytest.__version__,
+ py.__version__,
+ ".".join(map(str, sys.version_info)),
+ os.getcwd(),
+ config._origargs,
+ )
+ )
+ config.trace.root.setwriter(debugfile.write)
+ undo_tracing = config.pluginmanager.enable_tracing()
+ sys.stderr.write("writing pytestdebug information to %s\n" % path)
+
+ def unset_tracing():
+ debugfile.close()
+ sys.stderr.write("wrote pytestdebug information to %s\n" % debugfile.name)
+ config.trace.root.setwriter(None)
+ undo_tracing()
+
+ config.add_cleanup(unset_tracing)
+
+
+def showversion(config):
+ p = py.path.local(pytest.__file__)
+ sys.stderr.write(
+ "This is pytest version %s, imported from %s\n" % (pytest.__version__, p)
+ )
+ plugininfo = getpluginversioninfo(config)
+ if plugininfo:
+ for line in plugininfo:
+ sys.stderr.write(line + "\n")
+
+
+def pytest_cmdline_main(config):
+ if config.option.version:
+ showversion(config)
+ return 0
+ elif config.option.help:
+ config._do_configure()
+ showhelp(config)
+ config._ensure_unconfigure()
+ return 0
+
+
+def showhelp(config):
+ import textwrap
+
+ reporter = config.pluginmanager.get_plugin("terminalreporter")
+ tw = reporter._tw
+ tw.write(config._parser.optparser.format_help())
+ tw.line()
+ tw.line(
+ "[pytest] ini-options in the first pytest.ini|tox.ini|setup.cfg file found:"
+ )
+ tw.line()
+
+ columns = tw.fullwidth # costly call
+ indent_len = 24 # based on argparse's max_help_position=24
+ indent = " " * indent_len
+ for name in config._parser._ininames:
+ help, type, default = config._parser._inidict[name]
+ if type is None:
+ type = "string"
+ spec = "%s (%s):" % (name, type)
+ tw.write(" %s" % spec)
+ spec_len = len(spec)
+ if spec_len > (indent_len - 3):
+ # Display help starting at a new line.
+ tw.line()
+ helplines = textwrap.wrap(
+ help,
+ columns,
+ initial_indent=indent,
+ subsequent_indent=indent,
+ break_on_hyphens=False,
+ )
+
+ for line in helplines:
+ tw.line(line)
+ else:
+ # Display help starting after the spec, following lines indented.
+ tw.write(" " * (indent_len - spec_len - 2))
+ wrapped = textwrap.wrap(help, columns - indent_len, break_on_hyphens=False)
+
+ tw.line(wrapped[0])
+ for line in wrapped[1:]:
+ tw.line(indent + line)
+
+ tw.line()
+ tw.line("environment variables:")
+ vars = [
+ ("PYTEST_ADDOPTS", "extra command line options"),
+ ("PYTEST_PLUGINS", "comma-separated plugins to load during startup"),
+ ("PYTEST_DISABLE_PLUGIN_AUTOLOAD", "set to disable plugin auto-loading"),
+ ("PYTEST_DEBUG", "set to enable debug tracing of pytest's internals"),
+ ]
+ for name, help in vars:
+ tw.line(" %-24s %s" % (name, help))
+ tw.line()
+ tw.line()
+
+ tw.line("to see available markers type: pytest --markers")
+ tw.line("to see available fixtures type: pytest --fixtures")
+ tw.line(
+ "(shown according to specified file_or_dir or current dir "
+ "if not specified; fixtures with leading '_' are only shown "
+ "with the '-v' option"
+ )
+
+ for warningreport in reporter.stats.get("warnings", []):
+ tw.line("warning : " + warningreport.message, red=True)
+ return
+
+
+conftest_options = [("pytest_plugins", "list of plugin names to load")]
+
+
+def getpluginversioninfo(config):
+ lines = []
+ plugininfo = config.pluginmanager.list_plugin_distinfo()
+ if plugininfo:
+ lines.append("setuptools registered plugins:")
+ for plugin, dist in plugininfo:
+ loc = getattr(plugin, "__file__", repr(plugin))
+ content = "%s-%s at %s" % (dist.project_name, dist.version, loc)
+ lines.append(" " + content)
+ return lines
+
+
+def pytest_report_header(config):
+ lines = []
+ if config.option.debug or config.option.traceconfig:
+ lines.append("using: pytest-%s pylib-%s" % (pytest.__version__, py.__version__))
+
+ verinfo = getpluginversioninfo(config)
+ if verinfo:
+ lines.extend(verinfo)
+
+ if config.option.traceconfig:
+ lines.append("active plugins:")
+ items = config.pluginmanager.list_name_plugin()
+ for name, plugin in items:
+ if hasattr(plugin, "__file__"):
+ r = plugin.__file__
+ else:
+ r = repr(plugin)
+ lines.append(" %-20s: %s" % (name, r))
+ return lines
diff --git a/contrib/python/pytest/py2/_pytest/hookspec.py b/contrib/python/pytest/py2/_pytest/hookspec.py
new file mode 100644
index 00000000000..7ab6154b176
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/hookspec.py
@@ -0,0 +1,639 @@
+# -*- coding: utf-8 -*-
+""" hook specifications for pytest plugins, invoked from main.py and builtin plugins. """
+from pluggy import HookspecMarker
+
+from _pytest.deprecated import PYTEST_LOGWARNING
+
+hookspec = HookspecMarker("pytest")
+
+# -------------------------------------------------------------------------
+# Initialization hooks called for every plugin
+# -------------------------------------------------------------------------
+
+
+@hookspec(historic=True)
+def pytest_addhooks(pluginmanager):
+ """called at plugin registration time to allow adding new hooks via a call to
+ ``pluginmanager.add_hookspecs(module_or_class, prefix)``.
+
+
+ :param _pytest.config.PytestPluginManager pluginmanager: pytest plugin manager
+
+ .. note::
+ This hook is incompatible with ``hookwrapper=True``.
+ """
+
+
+@hookspec(historic=True)
+def pytest_plugin_registered(plugin, manager):
+ """ a new pytest plugin got registered.
+
+ :param plugin: the plugin module or instance
+ :param _pytest.config.PytestPluginManager manager: pytest plugin manager
+
+ .. note::
+ This hook is incompatible with ``hookwrapper=True``.
+ """
+
+
+@hookspec(historic=True)
+def pytest_addoption(parser):
+ """register argparse-style options and ini-style config values,
+ called once at the beginning of a test run.
+
+ .. note::
+
+ This function should be implemented only in plugins or ``conftest.py``
+ files situated at the tests root directory due to how pytest
+ :ref:`discovers plugins during startup <pluginorder>`.
+
+ :arg _pytest.config.Parser parser: To add command line options, call
+ :py:func:`parser.addoption(...) <_pytest.config.Parser.addoption>`.
+ To add ini-file values call :py:func:`parser.addini(...)
+ <_pytest.config.Parser.addini>`.
+
+ Options can later be accessed through the
+ :py:class:`config <_pytest.config.Config>` object, respectively:
+
+ - :py:func:`config.getoption(name) <_pytest.config.Config.getoption>` to
+ retrieve the value of a command line option.
+
+ - :py:func:`config.getini(name) <_pytest.config.Config.getini>` to retrieve
+ a value read from an ini-style file.
+
+ The config object is passed around on many internal objects via the ``.config``
+ attribute or can be retrieved as the ``pytestconfig`` fixture.
+
+ .. note::
+ This hook is incompatible with ``hookwrapper=True``.
+ """
+
+
+@hookspec(historic=True)
+def pytest_configure(config):
+ """
+ Allows plugins and conftest files to perform initial configuration.
+
+ This hook is called for every plugin and initial conftest file
+ after command line options have been parsed.
+
+ After that, the hook is called for other conftest files as they are
+ imported.
+
+ .. note::
+ This hook is incompatible with ``hookwrapper=True``.
+
+ :arg _pytest.config.Config config: pytest config object
+ """
+
+
+# -------------------------------------------------------------------------
+# Bootstrapping hooks called for plugins registered early enough:
+# internal and 3rd party plugins.
+# -------------------------------------------------------------------------
+
+
+@hookspec(firstresult=True)
+def pytest_cmdline_parse(pluginmanager, args):
+ """return initialized config object, parsing the specified args.
+
+ Stops at first non-None result, see :ref:`firstresult`
+
+ .. note::
+ This hook will only be called for plugin classes passed to the ``plugins`` arg when using `pytest.main`_ to
+ perform an in-process test run.
+
+ :param _pytest.config.PytestPluginManager pluginmanager: pytest plugin manager
+ :param list[str] args: list of arguments passed on the command line
+ """
+
+
+def pytest_cmdline_preparse(config, args):
+ """(**Deprecated**) modify command line arguments before option parsing.
+
+ This hook is considered deprecated and will be removed in a future pytest version. Consider
+ using :func:`pytest_load_initial_conftests` instead.
+
+ .. note::
+ This hook will not be called for ``conftest.py`` files, only for setuptools plugins.
+
+ :param _pytest.config.Config config: pytest config object
+ :param list[str] args: list of arguments passed on the command line
+ """
+
+
+@hookspec(firstresult=True)
+def pytest_cmdline_main(config):
+ """ called for performing the main command line action. The default
+ implementation will invoke the configure hooks and runtest_mainloop.
+
+ .. note::
+ This hook will not be called for ``conftest.py`` files, only for setuptools plugins.
+
+ Stops at first non-None result, see :ref:`firstresult`
+
+ :param _pytest.config.Config config: pytest config object
+ """
+
+
+def pytest_load_initial_conftests(early_config, parser, args):
+ """ implements the loading of initial conftest files ahead
+ of command line option parsing.
+
+ .. note::
+ This hook will not be called for ``conftest.py`` files, only for setuptools plugins.
+
+ :param _pytest.config.Config early_config: pytest config object
+ :param list[str] args: list of arguments passed on the command line
+ :param _pytest.config.Parser parser: to add command line options
+ """
+
+
+# -------------------------------------------------------------------------
+# collection hooks
+# -------------------------------------------------------------------------
+
+
+@hookspec(firstresult=True)
+def pytest_collection(session):
+ """Perform the collection protocol for the given session.
+
+ Stops at first non-None result, see :ref:`firstresult`.
+
+ :param _pytest.main.Session session: the pytest session object
+ """
+
+
+def pytest_collection_modifyitems(session, config, items):
+ """ called after collection has been performed, may filter or re-order
+ the items in-place.
+
+ :param _pytest.main.Session session: the pytest session object
+ :param _pytest.config.Config config: pytest config object
+ :param List[_pytest.nodes.Item] items: list of item objects
+ """
+
+
+def pytest_collection_finish(session):
+ """ called after collection has been performed and modified.
+
+ :param _pytest.main.Session session: the pytest session object
+ """
+
+
+@hookspec(firstresult=True)
+def pytest_ignore_collect(path, config):
+ """ return True to prevent considering this path for collection.
+ This hook is consulted for all files and directories prior to calling
+ more specific hooks.
+
+ Stops at first non-None result, see :ref:`firstresult`
+
+ :param path: a :py:class:`py.path.local` - the path to analyze
+ :param _pytest.config.Config config: pytest config object
+ """
+
+
+@hookspec(firstresult=True)
+def pytest_collect_directory(path, parent):
+ """ called before traversing a directory for collection files.
+
+ Stops at first non-None result, see :ref:`firstresult`
+
+ :param path: a :py:class:`py.path.local` - the path to analyze
+ """
+
+
+def pytest_collect_file(path, parent):
+ """ return collection Node or None for the given path. Any new node
+ needs to have the specified ``parent`` as a parent.
+
+ :param path: a :py:class:`py.path.local` - the path to collect
+ """
+
+
+# logging hooks for collection
+
+
+def pytest_collectstart(collector):
+ """ collector starts collecting. """
+
+
+def pytest_itemcollected(item):
+ """ we just collected a test item. """
+
+
+def pytest_collectreport(report):
+ """ collector finished collecting. """
+
+
+def pytest_deselected(items):
+ """ called for test items deselected, e.g. by keyword. """
+
+
+@hookspec(firstresult=True)
+def pytest_make_collect_report(collector):
+ """ perform ``collector.collect()`` and return a CollectReport.
+
+ Stops at first non-None result, see :ref:`firstresult` """
+
+
+# -------------------------------------------------------------------------
+# Python test function related hooks
+# -------------------------------------------------------------------------
+
+
+@hookspec(firstresult=True)
+def pytest_pycollect_makemodule(path, parent):
+ """ return a Module collector or None for the given path.
+ This hook will be called for each matching test module path.
+ The pytest_collect_file hook needs to be used if you want to
+ create test modules for files that do not match as a test module.
+
+ Stops at first non-None result, see :ref:`firstresult`
+
+ :param path: a :py:class:`py.path.local` - the path of module to collect
+ """
+
+
+@hookspec(firstresult=True)
+def pytest_pycollect_makeitem(collector, name, obj):
+ """ return custom item/collector for a python object in a module, or None.
+
+ Stops at first non-None result, see :ref:`firstresult` """
+
+
+@hookspec(firstresult=True)
+def pytest_pyfunc_call(pyfuncitem):
+ """ call underlying test function.
+
+ Stops at first non-None result, see :ref:`firstresult` """
+
+
+def pytest_generate_tests(metafunc):
+ """ generate (multiple) parametrized calls to a test function."""
+
+
+@hookspec(firstresult=True)
+def pytest_make_parametrize_id(config, val, argname):
+ """Return a user-friendly string representation of the given ``val`` that will be used
+ by @pytest.mark.parametrize calls. Return None if the hook doesn't know about ``val``.
+ The parameter name is available as ``argname``, if required.
+
+ Stops at first non-None result, see :ref:`firstresult`
+
+ :param _pytest.config.Config config: pytest config object
+ :param val: the parametrized value
+ :param str argname: the automatic parameter name produced by pytest
+ """
+
+
+# -------------------------------------------------------------------------
+# generic runtest related hooks
+# -------------------------------------------------------------------------
+
+
+@hookspec(firstresult=True)
+def pytest_runtestloop(session):
+ """ called for performing the main runtest loop
+ (after collection finished).
+
+ Stops at first non-None result, see :ref:`firstresult`
+
+ :param _pytest.main.Session session: the pytest session object
+ """
+
+
+def pytest_itemstart(item, node):
+ """(**Deprecated**) use pytest_runtest_logstart. """
+
+
+@hookspec(firstresult=True)
+def pytest_runtest_protocol(item, nextitem):
+ """ implements the runtest_setup/call/teardown protocol for
+ the given test item, including capturing exceptions and calling
+ reporting hooks.
+
+ :arg item: test item for which the runtest protocol is performed.
+
+ :arg nextitem: the scheduled-to-be-next test item (or None if this
+ is the end my friend). This argument is passed on to
+ :py:func:`pytest_runtest_teardown`.
+
+ :return boolean: True if no further hook implementations should be invoked.
+
+
+ Stops at first non-None result, see :ref:`firstresult` """
+
+
+def pytest_runtest_logstart(nodeid, location):
+ """ signal the start of running a single test item.
+
+ This hook will be called **before** :func:`pytest_runtest_setup`, :func:`pytest_runtest_call` and
+ :func:`pytest_runtest_teardown` hooks.
+
+ :param str nodeid: full id of the item
+ :param location: a triple of ``(filename, linenum, testname)``
+ """
+
+
+def pytest_runtest_logfinish(nodeid, location):
+ """ signal the complete finish of running a single test item.
+
+ This hook will be called **after** :func:`pytest_runtest_setup`, :func:`pytest_runtest_call` and
+ :func:`pytest_runtest_teardown` hooks.
+
+ :param str nodeid: full id of the item
+ :param location: a triple of ``(filename, linenum, testname)``
+ """
+
+
+def pytest_runtest_setup(item):
+ """ called before ``pytest_runtest_call(item)``. """
+
+
+def pytest_runtest_call(item):
+ """ called to execute the test ``item``. """
+
+
+def pytest_runtest_teardown(item, nextitem):
+ """ called after ``pytest_runtest_call``.
+
+ :arg nextitem: the scheduled-to-be-next test item (None if no further
+ test item is scheduled). This argument can be used to
+ perform exact teardowns, i.e. calling just enough finalizers
+ so that nextitem only needs to call setup-functions.
+ """
+
+
+@hookspec(firstresult=True)
+def pytest_runtest_makereport(item, call):
+ """ return a :py:class:`_pytest.runner.TestReport` object
+ for the given :py:class:`pytest.Item <_pytest.main.Item>` and
+ :py:class:`_pytest.runner.CallInfo`.
+
+ Stops at first non-None result, see :ref:`firstresult` """
+
+
+def pytest_runtest_logreport(report):
+ """ process a test setup/call/teardown report relating to
+ the respective phase of executing a test. """
+
+
+@hookspec(firstresult=True)
+def pytest_report_to_serializable(config, report):
+ """
+ .. warning::
+ This hook is experimental and subject to change between pytest releases, even
+ bug fixes.
+
+ The intent is for this to be used by plugins maintained by the core-devs, such
+ as ``pytest-xdist``, ``pytest-subtests``, and as a replacement for the internal
+ 'resultlog' plugin.
+
+ In the future it might become part of the public hook API.
+
+ Serializes the given report object into a data structure suitable for sending
+ over the wire, e.g. converted to JSON.
+ """
+
+
+@hookspec(firstresult=True)
+def pytest_report_from_serializable(config, data):
+ """
+ .. warning::
+ This hook is experimental and subject to change between pytest releases, even
+ bug fixes.
+
+ The intent is for this to be used by plugins maintained by the core-devs, such
+ as ``pytest-xdist``, ``pytest-subtests``, and as a replacement for the internal
+ 'resultlog' plugin.
+
+ In the future it might become part of the public hook API.
+
+ Restores a report object previously serialized with pytest_report_to_serializable().
+ """
+
+
+# -------------------------------------------------------------------------
+# Fixture related hooks
+# -------------------------------------------------------------------------
+
+
+@hookspec(firstresult=True)
+def pytest_fixture_setup(fixturedef, request):
+ """ performs fixture setup execution.
+
+ :return: The return value of the call to the fixture function
+
+ Stops at first non-None result, see :ref:`firstresult`
+
+ .. note::
+ If the fixture function returns None, other implementations of
+ this hook function will continue to be called, according to the
+ behavior of the :ref:`firstresult` option.
+ """
+
+
+def pytest_fixture_post_finalizer(fixturedef, request):
+ """ called after fixture teardown, but before the cache is cleared so
+ the fixture result cache ``fixturedef.cached_result`` can
+ still be accessed."""
+
+
+# -------------------------------------------------------------------------
+# test session related hooks
+# -------------------------------------------------------------------------
+
+
+def pytest_sessionstart(session):
+ """ called after the ``Session`` object has been created and before performing collection
+ and entering the run test loop.
+
+ :param _pytest.main.Session session: the pytest session object
+ """
+
+
+def pytest_sessionfinish(session, exitstatus):
+ """ called after whole test run finished, right before returning the exit status to the system.
+
+ :param _pytest.main.Session session: the pytest session object
+ :param int exitstatus: the status which pytest will return to the system
+ """
+
+
+def pytest_unconfigure(config):
+ """ called before test process is exited.
+
+ :param _pytest.config.Config config: pytest config object
+ """
+
+
+# -------------------------------------------------------------------------
+# hooks for customizing the assert methods
+# -------------------------------------------------------------------------
+
+
+def pytest_assertrepr_compare(config, op, left, right):
+ """return explanation for comparisons in failing assert expressions.
+
+ Return None for no custom explanation, otherwise return a list
+ of strings. The strings will be joined by newlines but any newlines
+ *in* a string will be escaped. Note that all but the first line will
+ be indented slightly, the intention is for the first line to be a summary.
+
+ :param _pytest.config.Config config: pytest config object
+ """
+
+
+# -------------------------------------------------------------------------
+# hooks for influencing reporting (invoked from _pytest_terminal)
+# -------------------------------------------------------------------------
+
+
+def pytest_report_header(config, startdir):
+ """ return a string or list of strings to be displayed as header info for terminal reporting.
+
+ :param _pytest.config.Config config: pytest config object
+ :param startdir: py.path object with the starting dir
+
+ .. note::
+
+ This function should be implemented only in plugins or ``conftest.py``
+ files situated at the tests root directory due to how pytest
+ :ref:`discovers plugins during startup <pluginorder>`.
+ """
+
+
+def pytest_report_collectionfinish(config, startdir, items):
+ """
+ .. versionadded:: 3.2
+
+ return a string or list of strings to be displayed after collection has finished successfully.
+
+ This strings will be displayed after the standard "collected X items" message.
+
+ :param _pytest.config.Config config: pytest config object
+ :param startdir: py.path object with the starting dir
+ :param items: list of pytest items that are going to be executed; this list should not be modified.
+ """
+
+
+@hookspec(firstresult=True)
+def pytest_report_teststatus(report, config):
+ """ return result-category, shortletter and verbose word for reporting.
+
+ :param _pytest.config.Config config: pytest config object
+
+ Stops at first non-None result, see :ref:`firstresult` """
+
+
+def pytest_terminal_summary(terminalreporter, exitstatus, config):
+ """Add a section to terminal summary reporting.
+
+ :param _pytest.terminal.TerminalReporter terminalreporter: the internal terminal reporter object
+ :param int exitstatus: the exit status that will be reported back to the OS
+ :param _pytest.config.Config config: pytest config object
+
+ .. versionadded:: 4.2
+ The ``config`` parameter.
+ """
+
+
+@hookspec(historic=True, warn_on_impl=PYTEST_LOGWARNING)
+def pytest_logwarning(message, code, nodeid, fslocation):
+ """
+ .. deprecated:: 3.8
+
+ This hook is will stop working in a future release.
+
+ pytest no longer triggers this hook, but the
+ terminal writer still implements it to display warnings issued by
+ :meth:`_pytest.config.Config.warn` and :meth:`_pytest.nodes.Node.warn`. Calling those functions will be
+ an error in future releases.
+
+ process a warning specified by a message, a code string,
+ a nodeid and fslocation (both of which may be None
+ if the warning is not tied to a particular node/location).
+
+ .. note::
+ This hook is incompatible with ``hookwrapper=True``.
+ """
+
+
+@hookspec(historic=True)
+def pytest_warning_captured(warning_message, when, item):
+ """
+ Process a warning captured by the internal pytest warnings plugin.
+
+ :param warnings.WarningMessage warning_message:
+ The captured warning. This is the same object produced by :py:func:`warnings.catch_warnings`, and contains
+ the same attributes as the parameters of :py:func:`warnings.showwarning`.
+
+ :param str when:
+ Indicates when the warning was captured. Possible values:
+
+ * ``"config"``: during pytest configuration/initialization stage.
+ * ``"collect"``: during test collection.
+ * ``"runtest"``: during test execution.
+
+ :param pytest.Item|None item:
+ **DEPRECATED**: This parameter is incompatible with ``pytest-xdist``, and will always receive ``None``
+ in a future release.
+
+ The item being executed if ``when`` is ``"runtest"``, otherwise ``None``.
+ """
+
+
+# -------------------------------------------------------------------------
+# doctest hooks
+# -------------------------------------------------------------------------
+
+
+@hookspec(firstresult=True)
+def pytest_doctest_prepare_content(content):
+ """ return processed content for a given doctest
+
+ Stops at first non-None result, see :ref:`firstresult` """
+
+
+# -------------------------------------------------------------------------
+# error handling and internal debugging hooks
+# -------------------------------------------------------------------------
+
+
+def pytest_internalerror(excrepr, excinfo):
+ """ called for internal errors. """
+
+
+def pytest_keyboard_interrupt(excinfo):
+ """ called for keyboard interrupt. """
+
+
+def pytest_exception_interact(node, call, report):
+ """called when an exception was raised which can potentially be
+ interactively handled.
+
+ This hook is only called if an exception was raised
+ that is not an internal exception like ``skip.Exception``.
+ """
+
+
+def pytest_enter_pdb(config, pdb):
+ """ called upon pdb.set_trace(), can be used by plugins to take special
+ action just before the python debugger enters in interactive mode.
+
+ :param _pytest.config.Config config: pytest config object
+ :param pdb.Pdb pdb: Pdb instance
+ """
+
+
+def pytest_leave_pdb(config, pdb):
+ """ called when leaving pdb (e.g. with continue after pdb.set_trace()).
+
+ Can be used by plugins to take special action just after the python
+ debugger leaves interactive mode.
+
+ :param _pytest.config.Config config: pytest config object
+ :param pdb.Pdb pdb: Pdb instance
+ """
diff --git a/contrib/python/pytest/py2/_pytest/junitxml.py b/contrib/python/pytest/py2/_pytest/junitxml.py
new file mode 100644
index 00000000000..853dcb77449
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/junitxml.py
@@ -0,0 +1,707 @@
+# -*- coding: utf-8 -*-
+"""
+ report test results in JUnit-XML format,
+ for use with Jenkins and build integration servers.
+
+
+Based on initial code from Ross Lawley.
+
+Output conforms to https://github.com/jenkinsci/xunit-plugin/blob/master/
+src/main/resources/org/jenkinsci/plugins/xunit/types/model/xsd/junit-10.xsd
+"""
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import functools
+import os
+import platform
+import re
+import sys
+import time
+from datetime import datetime
+
+import py
+import six
+
+import pytest
+from _pytest import nodes
+from _pytest.config import filename_arg
+
+# Python 2.X and 3.X compatibility
+if sys.version_info[0] < 3:
+ from codecs import open
+
+
+class Junit(py.xml.Namespace):
+ pass
+
+
+# We need to get the subset of the invalid unicode ranges according to
+# XML 1.0 which are valid in this python build. Hence we calculate
+# this dynamically instead of hardcoding it. The spec range of valid
+# chars is: Char ::= #x9 | #xA | #xD | [#x20-#xD7FF] | [#xE000-#xFFFD]
+# | [#x10000-#x10FFFF]
+_legal_chars = (0x09, 0x0A, 0x0D)
+_legal_ranges = ((0x20, 0x7E), (0x80, 0xD7FF), (0xE000, 0xFFFD), (0x10000, 0x10FFFF))
+_legal_xml_re = [
+ u"%s-%s" % (six.unichr(low), six.unichr(high))
+ for (low, high) in _legal_ranges
+ if low < sys.maxunicode
+]
+_legal_xml_re = [six.unichr(x) for x in _legal_chars] + _legal_xml_re
+illegal_xml_re = re.compile(u"[^%s]" % u"".join(_legal_xml_re))
+del _legal_chars
+del _legal_ranges
+del _legal_xml_re
+
+_py_ext_re = re.compile(r"\.py$")
+
+
+def bin_xml_escape(arg):
+ def repl(matchobj):
+ i = ord(matchobj.group())
+ if i <= 0xFF:
+ return u"#x%02X" % i
+ else:
+ return u"#x%04X" % i
+
+ return py.xml.raw(illegal_xml_re.sub(repl, py.xml.escape(arg)))
+
+
+def merge_family(left, right):
+ result = {}
+ for kl, vl in left.items():
+ for kr, vr in right.items():
+ if not isinstance(vl, list):
+ raise TypeError(type(vl))
+ result[kl] = vl + vr
+ left.update(result)
+
+
+families = {}
+families["_base"] = {"testcase": ["classname", "name"]}
+families["_base_legacy"] = {"testcase": ["file", "line", "url"]}
+
+# xUnit 1.x inherits legacy attributes
+families["xunit1"] = families["_base"].copy()
+merge_family(families["xunit1"], families["_base_legacy"])
+
+# xUnit 2.x uses strict base attributes
+families["xunit2"] = families["_base"]
+
+
+class _NodeReporter(object):
+ def __init__(self, nodeid, xml):
+ self.id = nodeid
+ self.xml = xml
+ self.add_stats = self.xml.add_stats
+ self.family = self.xml.family
+ self.duration = 0
+ self.properties = []
+ self.nodes = []
+ self.testcase = None
+ self.attrs = {}
+
+ def append(self, node):
+ self.xml.add_stats(type(node).__name__)
+ self.nodes.append(node)
+
+ def add_property(self, name, value):
+ self.properties.append((str(name), bin_xml_escape(value)))
+
+ def add_attribute(self, name, value):
+ self.attrs[str(name)] = bin_xml_escape(value)
+
+ def make_properties_node(self):
+ """Return a Junit node containing custom properties, if any.
+ """
+ if self.properties:
+ return Junit.properties(
+ [
+ Junit.property(name=name, value=value)
+ for name, value in self.properties
+ ]
+ )
+ return ""
+
+ def record_testreport(self, testreport):
+ assert not self.testcase
+ names = mangle_test_address(testreport.nodeid)
+ existing_attrs = self.attrs
+ classnames = names[:-1]
+ if self.xml.prefix:
+ classnames.insert(0, self.xml.prefix)
+ attrs = {
+ "classname": ".".join(classnames),
+ "name": bin_xml_escape(names[-1]),
+ "file": testreport.location[0],
+ }
+ if testreport.location[1] is not None:
+ attrs["line"] = testreport.location[1]
+ if hasattr(testreport, "url"):
+ attrs["url"] = testreport.url
+ self.attrs = attrs
+ self.attrs.update(existing_attrs) # restore any user-defined attributes
+
+ # Preserve legacy testcase behavior
+ if self.family == "xunit1":
+ return
+
+ # Filter out attributes not permitted by this test family.
+ # Including custom attributes because they are not valid here.
+ temp_attrs = {}
+ for key in self.attrs.keys():
+ if key in families[self.family]["testcase"]:
+ temp_attrs[key] = self.attrs[key]
+ self.attrs = temp_attrs
+
+ def to_xml(self):
+ testcase = Junit.testcase(time="%.3f" % self.duration, **self.attrs)
+ testcase.append(self.make_properties_node())
+ for node in self.nodes:
+ testcase.append(node)
+ return testcase
+
+ def _add_simple(self, kind, message, data=None):
+ data = bin_xml_escape(data)
+ node = kind(data, message=message)
+ self.append(node)
+
+ def write_captured_output(self, report):
+ if not self.xml.log_passing_tests and report.passed:
+ return
+
+ content_out = report.capstdout
+ content_log = report.caplog
+ content_err = report.capstderr
+
+ if content_log or content_out:
+ if content_log and self.xml.logging == "system-out":
+ if content_out:
+ # syncing stdout and the log-output is not done yet. It's
+ # probably not worth the effort. Therefore, first the captured
+ # stdout is shown and then the captured logs.
+ content = "\n".join(
+ [
+ " Captured Stdout ".center(80, "-"),
+ content_out,
+ "",
+ " Captured Log ".center(80, "-"),
+ content_log,
+ ]
+ )
+ else:
+ content = content_log
+ else:
+ content = content_out
+
+ if content:
+ tag = getattr(Junit, "system-out")
+ self.append(tag(bin_xml_escape(content)))
+
+ if content_log or content_err:
+ if content_log and self.xml.logging == "system-err":
+ if content_err:
+ content = "\n".join(
+ [
+ " Captured Stderr ".center(80, "-"),
+ content_err,
+ "",
+ " Captured Log ".center(80, "-"),
+ content_log,
+ ]
+ )
+ else:
+ content = content_log
+ else:
+ content = content_err
+
+ if content:
+ tag = getattr(Junit, "system-err")
+ self.append(tag(bin_xml_escape(content)))
+
+ def append_pass(self, report):
+ self.add_stats("passed")
+
+ def append_failure(self, report):
+ # msg = str(report.longrepr.reprtraceback.extraline)
+ if hasattr(report, "wasxfail"):
+ self._add_simple(Junit.skipped, "xfail-marked test passes unexpectedly")
+ else:
+ if hasattr(report.longrepr, "reprcrash"):
+ message = report.longrepr.reprcrash.message
+ elif isinstance(report.longrepr, six.string_types):
+ message = report.longrepr
+ else:
+ message = str(report.longrepr)
+ message = bin_xml_escape(message)
+ fail = Junit.failure(message=message)
+ fail.append(bin_xml_escape(report.longrepr))
+ self.append(fail)
+
+ def append_collect_error(self, report):
+ # msg = str(report.longrepr.reprtraceback.extraline)
+ self.append(
+ Junit.error(bin_xml_escape(report.longrepr), message="collection failure")
+ )
+
+ def append_collect_skipped(self, report):
+ self._add_simple(Junit.skipped, "collection skipped", report.longrepr)
+
+ def append_error(self, report):
+ if report.when == "teardown":
+ msg = "test teardown failure"
+ else:
+ msg = "test setup failure"
+ self._add_simple(Junit.error, msg, report.longrepr)
+
+ def append_skipped(self, report):
+ if hasattr(report, "wasxfail"):
+ xfailreason = report.wasxfail
+ if xfailreason.startswith("reason: "):
+ xfailreason = xfailreason[8:]
+ self.append(
+ Junit.skipped(
+ "", type="pytest.xfail", message=bin_xml_escape(xfailreason)
+ )
+ )
+ else:
+ filename, lineno, skipreason = report.longrepr
+ if skipreason.startswith("Skipped: "):
+ skipreason = skipreason[9:]
+ details = "%s:%s: %s" % (filename, lineno, skipreason)
+
+ self.append(
+ Junit.skipped(
+ bin_xml_escape(details),
+ type="pytest.skip",
+ message=bin_xml_escape(skipreason),
+ )
+ )
+ self.write_captured_output(report)
+
+ def finalize(self):
+ data = self.to_xml().unicode(indent=0)
+ self.__dict__.clear()
+ self.to_xml = lambda: py.xml.raw(data)
+
+
+def _warn_incompatibility_with_xunit2(request, fixture_name):
+ """Emits a PytestWarning about the given fixture being incompatible with newer xunit revisions"""
+ from _pytest.warning_types import PytestWarning
+
+ xml = getattr(request.config, "_xml", None)
+ if xml is not None and xml.family not in ("xunit1", "legacy"):
+ request.node.warn(
+ PytestWarning(
+ "{fixture_name} is incompatible with junit_family '{family}' (use 'legacy' or 'xunit1')".format(
+ fixture_name=fixture_name, family=xml.family
+ )
+ )
+ )
+
+
+@pytest.fixture
+def record_property(request):
+ """Add an extra properties the calling test.
+ User properties become part of the test report and are available to the
+ configured reporters, like JUnit XML.
+ The fixture is callable with ``(name, value)``, with value being automatically
+ xml-encoded.
+
+ Example::
+
+ def test_function(record_property):
+ record_property("example_key", 1)
+ """
+ _warn_incompatibility_with_xunit2(request, "record_property")
+
+ def append_property(name, value):
+ request.node.user_properties.append((name, value))
+
+ return append_property
+
+
+@pytest.fixture
+def record_xml_attribute(request):
+ """Add extra xml attributes to the tag for the calling test.
+ The fixture is callable with ``(name, value)``, with value being
+ automatically xml-encoded
+ """
+ from _pytest.warning_types import PytestExperimentalApiWarning
+
+ request.node.warn(
+ PytestExperimentalApiWarning("record_xml_attribute is an experimental feature")
+ )
+
+ _warn_incompatibility_with_xunit2(request, "record_xml_attribute")
+
+ # Declare noop
+ def add_attr_noop(name, value):
+ pass
+
+ attr_func = add_attr_noop
+
+ xml = getattr(request.config, "_xml", None)
+ if xml is not None:
+ node_reporter = xml.node_reporter(request.node.nodeid)
+ attr_func = node_reporter.add_attribute
+
+ return attr_func
+
+
+def _check_record_param_type(param, v):
+ """Used by record_testsuite_property to check that the given parameter name is of the proper
+ type"""
+ __tracebackhide__ = True
+ if not isinstance(v, six.string_types):
+ msg = "{param} parameter needs to be a string, but {g} given"
+ raise TypeError(msg.format(param=param, g=type(v).__name__))
+
+
+@pytest.fixture(scope="session")
+def record_testsuite_property(request):
+ """
+ Records a new ``<property>`` tag as child of the root ``<testsuite>``. This is suitable to
+ writing global information regarding the entire test suite, and is compatible with ``xunit2`` JUnit family.
+
+ This is a ``session``-scoped fixture which is called with ``(name, value)``. Example:
+
+ .. code-block:: python
+
+ def test_foo(record_testsuite_property):
+ record_testsuite_property("ARCH", "PPC")
+ record_testsuite_property("STORAGE_TYPE", "CEPH")
+
+ ``name`` must be a string, ``value`` will be converted to a string and properly xml-escaped.
+ """
+
+ __tracebackhide__ = True
+
+ def record_func(name, value):
+ """noop function in case --junitxml was not passed in the command-line"""
+ __tracebackhide__ = True
+ _check_record_param_type("name", name)
+
+ xml = getattr(request.config, "_xml", None)
+ if xml is not None:
+ record_func = xml.add_global_property # noqa
+ return record_func
+
+
+def pytest_addoption(parser):
+ group = parser.getgroup("terminal reporting")
+ group.addoption(
+ "--junitxml",
+ "--junit-xml",
+ action="store",
+ dest="xmlpath",
+ metavar="path",
+ type=functools.partial(filename_arg, optname="--junitxml"),
+ default=None,
+ help="create junit-xml style report file at given path.",
+ )
+ group.addoption(
+ "--junitprefix",
+ "--junit-prefix",
+ action="store",
+ metavar="str",
+ default=None,
+ help="prepend prefix to classnames in junit-xml output",
+ )
+ parser.addini(
+ "junit_suite_name", "Test suite name for JUnit report", default="pytest"
+ )
+ parser.addini(
+ "junit_logging",
+ "Write captured log messages to JUnit report: "
+ "one of no|system-out|system-err",
+ default="no",
+ ) # choices=['no', 'stdout', 'stderr'])
+ parser.addini(
+ "junit_log_passing_tests",
+ "Capture log information for passing tests to JUnit report: ",
+ type="bool",
+ default=True,
+ )
+ parser.addini(
+ "junit_duration_report",
+ "Duration time to report: one of total|call",
+ default="total",
+ ) # choices=['total', 'call'])
+ parser.addini(
+ "junit_family",
+ "Emit XML for schema: one of legacy|xunit1|xunit2",
+ default="xunit1",
+ )
+
+
+def pytest_configure(config):
+ xmlpath = config.option.xmlpath
+ # prevent opening xmllog on slave nodes (xdist)
+ if xmlpath and not hasattr(config, "slaveinput"):
+ config._xml = LogXML(
+ xmlpath,
+ config.option.junitprefix,
+ config.getini("junit_suite_name"),
+ config.getini("junit_logging"),
+ config.getini("junit_duration_report"),
+ config.getini("junit_family"),
+ config.getini("junit_log_passing_tests"),
+ )
+ config.pluginmanager.register(config._xml)
+
+
+def pytest_unconfigure(config):
+ xml = getattr(config, "_xml", None)
+ if xml:
+ del config._xml
+ config.pluginmanager.unregister(xml)
+
+
+def mangle_test_address(address):
+ path, possible_open_bracket, params = address.partition("[")
+ names = path.split("::")
+ try:
+ names.remove("()")
+ except ValueError:
+ pass
+ # convert file path to dotted path
+ names[0] = names[0].replace(nodes.SEP, ".")
+ names[0] = _py_ext_re.sub("", names[0])
+ # put any params back
+ names[-1] += possible_open_bracket + params
+ return names
+
+
+class LogXML(object):
+ def __init__(
+ self,
+ logfile,
+ prefix,
+ suite_name="pytest",
+ logging="no",
+ report_duration="total",
+ family="xunit1",
+ log_passing_tests=True,
+ ):
+ logfile = os.path.expanduser(os.path.expandvars(logfile))
+ self.logfile = os.path.normpath(os.path.abspath(logfile))
+ self.prefix = prefix
+ self.suite_name = suite_name
+ self.logging = logging
+ self.log_passing_tests = log_passing_tests
+ self.report_duration = report_duration
+ self.family = family
+ self.stats = dict.fromkeys(["error", "passed", "failure", "skipped"], 0)
+ self.node_reporters = {} # nodeid -> _NodeReporter
+ self.node_reporters_ordered = []
+ self.global_properties = []
+
+ # List of reports that failed on call but teardown is pending.
+ self.open_reports = []
+ self.cnt_double_fail_tests = 0
+
+ # Replaces convenience family with real family
+ if self.family == "legacy":
+ self.family = "xunit1"
+
+ def finalize(self, report):
+ nodeid = getattr(report, "nodeid", report)
+ # local hack to handle xdist report order
+ slavenode = getattr(report, "node", None)
+ reporter = self.node_reporters.pop((nodeid, slavenode))
+ if reporter is not None:
+ reporter.finalize()
+
+ def node_reporter(self, report):
+ nodeid = getattr(report, "nodeid", report)
+ # local hack to handle xdist report order
+ slavenode = getattr(report, "node", None)
+
+ key = nodeid, slavenode
+
+ if key in self.node_reporters:
+ # TODO: breasks for --dist=each
+ return self.node_reporters[key]
+
+ reporter = _NodeReporter(nodeid, self)
+
+ self.node_reporters[key] = reporter
+ self.node_reporters_ordered.append(reporter)
+
+ return reporter
+
+ def add_stats(self, key):
+ if key in self.stats:
+ self.stats[key] += 1
+
+ def _opentestcase(self, report):
+ reporter = self.node_reporter(report)
+ reporter.record_testreport(report)
+ return reporter
+
+ def pytest_runtest_logreport(self, report):
+ """handle a setup/call/teardown report, generating the appropriate
+ xml tags as necessary.
+
+ note: due to plugins like xdist, this hook may be called in interlaced
+ order with reports from other nodes. for example:
+
+ usual call order:
+ -> setup node1
+ -> call node1
+ -> teardown node1
+ -> setup node2
+ -> call node2
+ -> teardown node2
+
+ possible call order in xdist:
+ -> setup node1
+ -> call node1
+ -> setup node2
+ -> call node2
+ -> teardown node2
+ -> teardown node1
+ """
+ close_report = None
+ if report.passed:
+ if report.when == "call": # ignore setup/teardown
+ reporter = self._opentestcase(report)
+ reporter.append_pass(report)
+ elif report.failed:
+ if report.when == "teardown":
+ # The following vars are needed when xdist plugin is used
+ report_wid = getattr(report, "worker_id", None)
+ report_ii = getattr(report, "item_index", None)
+ close_report = next(
+ (
+ rep
+ for rep in self.open_reports
+ if (
+ rep.nodeid == report.nodeid
+ and getattr(rep, "item_index", None) == report_ii
+ and getattr(rep, "worker_id", None) == report_wid
+ )
+ ),
+ None,
+ )
+ if close_report:
+ # We need to open new testcase in case we have failure in
+ # call and error in teardown in order to follow junit
+ # schema
+ self.finalize(close_report)
+ self.cnt_double_fail_tests += 1
+ reporter = self._opentestcase(report)
+ if report.when == "call":
+ reporter.append_failure(report)
+ self.open_reports.append(report)
+ if not self.log_passing_tests:
+ reporter.write_captured_output(report)
+ else:
+ reporter.append_error(report)
+ elif report.skipped:
+ reporter = self._opentestcase(report)
+ reporter.append_skipped(report)
+ self.update_testcase_duration(report)
+ if report.when == "teardown":
+ reporter = self._opentestcase(report)
+ reporter.write_captured_output(report)
+
+ for propname, propvalue in report.user_properties:
+ reporter.add_property(propname, propvalue)
+
+ self.finalize(report)
+ report_wid = getattr(report, "worker_id", None)
+ report_ii = getattr(report, "item_index", None)
+ close_report = next(
+ (
+ rep
+ for rep in self.open_reports
+ if (
+ rep.nodeid == report.nodeid
+ and getattr(rep, "item_index", None) == report_ii
+ and getattr(rep, "worker_id", None) == report_wid
+ )
+ ),
+ None,
+ )
+ if close_report:
+ self.open_reports.remove(close_report)
+
+ def update_testcase_duration(self, report):
+ """accumulates total duration for nodeid from given report and updates
+ the Junit.testcase with the new total if already created.
+ """
+ if self.report_duration == "total" or report.when == self.report_duration:
+ reporter = self.node_reporter(report)
+ reporter.duration += getattr(report, "duration", 0.0)
+
+ def pytest_collectreport(self, report):
+ if not report.passed:
+ reporter = self._opentestcase(report)
+ if report.failed:
+ reporter.append_collect_error(report)
+ else:
+ reporter.append_collect_skipped(report)
+
+ def pytest_internalerror(self, excrepr):
+ reporter = self.node_reporter("internal")
+ reporter.attrs.update(classname="pytest", name="internal")
+ reporter._add_simple(Junit.error, "internal error", excrepr)
+
+ def pytest_sessionstart(self):
+ self.suite_start_time = time.time()
+
+ def pytest_sessionfinish(self):
+ dirname = os.path.dirname(os.path.abspath(self.logfile))
+ if not os.path.isdir(dirname):
+ os.makedirs(dirname)
+ logfile = open(self.logfile, "w", encoding="utf-8")
+ suite_stop_time = time.time()
+ suite_time_delta = suite_stop_time - self.suite_start_time
+
+ numtests = (
+ self.stats["passed"]
+ + self.stats["failure"]
+ + self.stats["skipped"]
+ + self.stats["error"]
+ - self.cnt_double_fail_tests
+ )
+ logfile.write('<?xml version="1.0" encoding="utf-8"?>')
+
+ suite_node = Junit.testsuite(
+ self._get_global_properties_node(),
+ [x.to_xml() for x in self.node_reporters_ordered],
+ name=self.suite_name,
+ errors=self.stats["error"],
+ failures=self.stats["failure"],
+ skipped=self.stats["skipped"],
+ tests=numtests,
+ time="%.3f" % suite_time_delta,
+ timestamp=datetime.fromtimestamp(self.suite_start_time).isoformat(),
+ hostname=platform.node(),
+ )
+ logfile.write(Junit.testsuites([suite_node]).unicode(indent=0))
+ logfile.close()
+
+ def pytest_terminal_summary(self, terminalreporter):
+ terminalreporter.write_sep("-", "generated xml file: %s" % (self.logfile))
+
+ def add_global_property(self, name, value):
+ __tracebackhide__ = True
+ _check_record_param_type("name", name)
+ self.global_properties.append((name, bin_xml_escape(value)))
+
+ def _get_global_properties_node(self):
+ """Return a Junit node containing custom properties, if any.
+ """
+ if self.global_properties:
+ return Junit.properties(
+ [
+ Junit.property(name=name, value=value)
+ for name, value in self.global_properties
+ ]
+ )
+ return ""
diff --git a/contrib/python/pytest/py2/_pytest/logging.py b/contrib/python/pytest/py2/_pytest/logging.py
new file mode 100644
index 00000000000..2400737ee4e
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/logging.py
@@ -0,0 +1,708 @@
+# -*- coding: utf-8 -*-
+""" Access and control log capturing. """
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import logging
+import re
+from contextlib import contextmanager
+
+import py
+import six
+
+import pytest
+from _pytest.compat import dummy_context_manager
+from _pytest.config import create_terminal_writer
+from _pytest.pathlib import Path
+
+DEFAULT_LOG_FORMAT = "%(levelname)-8s %(name)s:%(filename)s:%(lineno)d %(message)s"
+DEFAULT_LOG_DATE_FORMAT = "%H:%M:%S"
+_ANSI_ESCAPE_SEQ = re.compile(r"\x1b\[[\d;]+m")
+
+
+def _remove_ansi_escape_sequences(text):
+ return _ANSI_ESCAPE_SEQ.sub("", text)
+
+
+class ColoredLevelFormatter(logging.Formatter):
+ """
+ Colorize the %(levelname)..s part of the log format passed to __init__.
+ """
+
+ LOGLEVEL_COLOROPTS = {
+ logging.CRITICAL: {"red"},
+ logging.ERROR: {"red", "bold"},
+ logging.WARNING: {"yellow"},
+ logging.WARN: {"yellow"},
+ logging.INFO: {"green"},
+ logging.DEBUG: {"purple"},
+ logging.NOTSET: set(),
+ }
+ LEVELNAME_FMT_REGEX = re.compile(r"%\(levelname\)([+-]?\d*s)")
+
+ def __init__(self, terminalwriter, *args, **kwargs):
+ super(ColoredLevelFormatter, self).__init__(*args, **kwargs)
+ if six.PY2:
+ self._original_fmt = self._fmt
+ else:
+ self._original_fmt = self._style._fmt
+ self._level_to_fmt_mapping = {}
+
+ levelname_fmt_match = self.LEVELNAME_FMT_REGEX.search(self._fmt)
+ if not levelname_fmt_match:
+ return
+ levelname_fmt = levelname_fmt_match.group()
+
+ for level, color_opts in self.LOGLEVEL_COLOROPTS.items():
+ formatted_levelname = levelname_fmt % {
+ "levelname": logging.getLevelName(level)
+ }
+
+ # add ANSI escape sequences around the formatted levelname
+ color_kwargs = {name: True for name in color_opts}
+ colorized_formatted_levelname = terminalwriter.markup(
+ formatted_levelname, **color_kwargs
+ )
+ self._level_to_fmt_mapping[level] = self.LEVELNAME_FMT_REGEX.sub(
+ colorized_formatted_levelname, self._fmt
+ )
+
+ def format(self, record):
+ fmt = self._level_to_fmt_mapping.get(record.levelno, self._original_fmt)
+ if six.PY2:
+ self._fmt = fmt
+ else:
+ self._style._fmt = fmt
+ return super(ColoredLevelFormatter, self).format(record)
+
+
+if not six.PY2:
+ # Formatter classes don't support format styles in PY2
+
+ class PercentStyleMultiline(logging.PercentStyle):
+ """A logging style with special support for multiline messages.
+
+ If the message of a record consists of multiple lines, this style
+ formats the message as if each line were logged separately.
+ """
+
+ @staticmethod
+ def _update_message(record_dict, message):
+ tmp = record_dict.copy()
+ tmp["message"] = message
+ return tmp
+
+ def format(self, record):
+ if "\n" in record.message:
+ lines = record.message.splitlines()
+ formatted = self._fmt % self._update_message(record.__dict__, lines[0])
+ # TODO optimize this by introducing an option that tells the
+ # logging framework that the indentation doesn't
+ # change. This allows to compute the indentation only once.
+ indentation = _remove_ansi_escape_sequences(formatted).find(lines[0])
+ lines[0] = formatted
+ return ("\n" + " " * indentation).join(lines)
+ else:
+ return self._fmt % record.__dict__
+
+
+def get_option_ini(config, *names):
+ for name in names:
+ ret = config.getoption(name) # 'default' arg won't work as expected
+ if ret is None:
+ ret = config.getini(name)
+ if ret:
+ return ret
+
+
+def pytest_addoption(parser):
+ """Add options to control log capturing."""
+ group = parser.getgroup("logging")
+
+ def add_option_ini(option, dest, default=None, type=None, **kwargs):
+ parser.addini(
+ dest, default=default, type=type, help="default value for " + option
+ )
+ group.addoption(option, dest=dest, **kwargs)
+
+ add_option_ini(
+ "--no-print-logs",
+ dest="log_print",
+ action="store_const",
+ const=False,
+ default=True,
+ type="bool",
+ help="disable printing caught logs on failed tests.",
+ )
+ add_option_ini(
+ "--log-level",
+ dest="log_level",
+ default=None,
+ help="logging level used by the logging module",
+ )
+ add_option_ini(
+ "--log-format",
+ dest="log_format",
+ default=DEFAULT_LOG_FORMAT,
+ help="log format as used by the logging module.",
+ )
+ add_option_ini(
+ "--log-date-format",
+ dest="log_date_format",
+ default=DEFAULT_LOG_DATE_FORMAT,
+ help="log date format as used by the logging module.",
+ )
+ parser.addini(
+ "log_cli",
+ default=False,
+ type="bool",
+ help='enable log display during test run (also known as "live logging").',
+ )
+ add_option_ini(
+ "--log-cli-level", dest="log_cli_level", default=None, help="cli logging level."
+ )
+ add_option_ini(
+ "--log-cli-format",
+ dest="log_cli_format",
+ default=None,
+ help="log format as used by the logging module.",
+ )
+ add_option_ini(
+ "--log-cli-date-format",
+ dest="log_cli_date_format",
+ default=None,
+ help="log date format as used by the logging module.",
+ )
+ add_option_ini(
+ "--log-file",
+ dest="log_file",
+ default=None,
+ help="path to a file when logging will be written to.",
+ )
+ add_option_ini(
+ "--log-file-level",
+ dest="log_file_level",
+ default=None,
+ help="log file logging level.",
+ )
+ add_option_ini(
+ "--log-file-format",
+ dest="log_file_format",
+ default=DEFAULT_LOG_FORMAT,
+ help="log format as used by the logging module.",
+ )
+ add_option_ini(
+ "--log-file-date-format",
+ dest="log_file_date_format",
+ default=DEFAULT_LOG_DATE_FORMAT,
+ help="log date format as used by the logging module.",
+ )
+
+
+@contextmanager
+def catching_logs(handler, formatter=None, level=None):
+ """Context manager that prepares the whole logging machinery properly."""
+ root_logger = logging.getLogger()
+
+ if formatter is not None:
+ handler.setFormatter(formatter)
+ if level is not None:
+ handler.setLevel(level)
+
+ # Adding the same handler twice would confuse logging system.
+ # Just don't do that.
+ add_new_handler = handler not in root_logger.handlers
+
+ if add_new_handler:
+ root_logger.addHandler(handler)
+ if level is not None:
+ orig_level = root_logger.level
+ root_logger.setLevel(min(orig_level, level))
+ try:
+ yield handler
+ finally:
+ if level is not None:
+ root_logger.setLevel(orig_level)
+ if add_new_handler:
+ root_logger.removeHandler(handler)
+
+
+class LogCaptureHandler(logging.StreamHandler):
+ """A logging handler that stores log records and the log text."""
+
+ def __init__(self):
+ """Creates a new log handler."""
+ logging.StreamHandler.__init__(self, py.io.TextIO())
+ self.records = []
+
+ def emit(self, record):
+ """Keep the log records in a list in addition to the log text."""
+ self.records.append(record)
+ logging.StreamHandler.emit(self, record)
+
+ def reset(self):
+ self.records = []
+ self.stream = py.io.TextIO()
+
+
+class LogCaptureFixture(object):
+ """Provides access and control of log capturing."""
+
+ def __init__(self, item):
+ """Creates a new funcarg."""
+ self._item = item
+ # dict of log name -> log level
+ self._initial_log_levels = {} # Dict[str, int]
+
+ def _finalize(self):
+ """Finalizes the fixture.
+
+ This restores the log levels changed by :meth:`set_level`.
+ """
+ # restore log levels
+ for logger_name, level in self._initial_log_levels.items():
+ logger = logging.getLogger(logger_name)
+ logger.setLevel(level)
+
+ @property
+ def handler(self):
+ """
+ :rtype: LogCaptureHandler
+ """
+ return self._item.catch_log_handler
+
+ def get_records(self, when):
+ """
+ Get the logging records for one of the possible test phases.
+
+ :param str when:
+ Which test phase to obtain the records from. Valid values are: "setup", "call" and "teardown".
+
+ :rtype: List[logging.LogRecord]
+ :return: the list of captured records at the given stage
+
+ .. versionadded:: 3.4
+ """
+ handler = self._item.catch_log_handlers.get(when)
+ if handler:
+ return handler.records
+ else:
+ return []
+
+ @property
+ def text(self):
+ """Returns the formatted log text."""
+ return _remove_ansi_escape_sequences(self.handler.stream.getvalue())
+
+ @property
+ def records(self):
+ """Returns the list of log records."""
+ return self.handler.records
+
+ @property
+ def record_tuples(self):
+ """Returns a list of a stripped down version of log records intended
+ for use in assertion comparison.
+
+ The format of the tuple is:
+
+ (logger_name, log_level, message)
+ """
+ return [(r.name, r.levelno, r.getMessage()) for r in self.records]
+
+ @property
+ def messages(self):
+ """Returns a list of format-interpolated log messages.
+
+ Unlike 'records', which contains the format string and parameters for interpolation, log messages in this list
+ are all interpolated.
+ Unlike 'text', which contains the output from the handler, log messages in this list are unadorned with
+ levels, timestamps, etc, making exact comparisons more reliable.
+
+ Note that traceback or stack info (from :func:`logging.exception` or the `exc_info` or `stack_info` arguments
+ to the logging functions) is not included, as this is added by the formatter in the handler.
+
+ .. versionadded:: 3.7
+ """
+ return [r.getMessage() for r in self.records]
+
+ def clear(self):
+ """Reset the list of log records and the captured log text."""
+ self.handler.reset()
+
+ def set_level(self, level, logger=None):
+ """Sets the level for capturing of logs. The level will be restored to its previous value at the end of
+ the test.
+
+ :param int level: the logger to level.
+ :param str logger: the logger to update the level. If not given, the root logger level is updated.
+
+ .. versionchanged:: 3.4
+ The levels of the loggers changed by this function will be restored to their initial values at the
+ end of the test.
+ """
+ logger_name = logger
+ logger = logging.getLogger(logger_name)
+ # save the original log-level to restore it during teardown
+ self._initial_log_levels.setdefault(logger_name, logger.level)
+ logger.setLevel(level)
+
+ @contextmanager
+ def at_level(self, level, logger=None):
+ """Context manager that sets the level for capturing of logs. After the end of the 'with' statement the
+ level is restored to its original value.
+
+ :param int level: the logger to level.
+ :param str logger: the logger to update the level. If not given, the root logger level is updated.
+ """
+ logger = logging.getLogger(logger)
+ orig_level = logger.level
+ logger.setLevel(level)
+ try:
+ yield
+ finally:
+ logger.setLevel(orig_level)
+
+
+@pytest.fixture
+def caplog(request):
+ """Access and control log capturing.
+
+ Captured logs are available through the following properties/methods::
+
+ * caplog.text -> string containing formatted log output
+ * caplog.records -> list of logging.LogRecord instances
+ * caplog.record_tuples -> list of (logger_name, level, message) tuples
+ * caplog.clear() -> clear captured records and formatted log output string
+ """
+ result = LogCaptureFixture(request.node)
+ yield result
+ result._finalize()
+
+
+def get_actual_log_level(config, *setting_names):
+ """Return the actual logging level."""
+
+ for setting_name in setting_names:
+ log_level = config.getoption(setting_name)
+ if log_level is None:
+ log_level = config.getini(setting_name)
+ if log_level:
+ break
+ else:
+ return
+
+ if isinstance(log_level, six.string_types):
+ log_level = log_level.upper()
+ try:
+ return int(getattr(logging, log_level, log_level))
+ except ValueError:
+ # Python logging does not recognise this as a logging level
+ raise pytest.UsageError(
+ "'{}' is not recognized as a logging level name for "
+ "'{}'. Please consider passing the "
+ "logging level num instead.".format(log_level, setting_name)
+ )
+
+
+# run after terminalreporter/capturemanager are configured
+@pytest.hookimpl(trylast=True)
+def pytest_configure(config):
+ config.pluginmanager.register(LoggingPlugin(config), "logging-plugin")
+
+
+class LoggingPlugin(object):
+ """Attaches to the logging module and captures log messages for each test.
+ """
+
+ def __init__(self, config):
+ """Creates a new plugin to capture log messages.
+
+ The formatter can be safely shared across all handlers so
+ create a single one for the entire test session here.
+ """
+ self._config = config
+
+ self.print_logs = get_option_ini(config, "log_print")
+ self.formatter = self._create_formatter(
+ get_option_ini(config, "log_format"),
+ get_option_ini(config, "log_date_format"),
+ )
+ self.log_level = get_actual_log_level(config, "log_level")
+
+ self.log_file_level = get_actual_log_level(config, "log_file_level")
+ self.log_file_format = get_option_ini(config, "log_file_format", "log_format")
+ self.log_file_date_format = get_option_ini(
+ config, "log_file_date_format", "log_date_format"
+ )
+ self.log_file_formatter = logging.Formatter(
+ self.log_file_format, datefmt=self.log_file_date_format
+ )
+
+ log_file = get_option_ini(config, "log_file")
+ if log_file:
+ self.log_file_handler = logging.FileHandler(
+ log_file, mode="w", encoding="UTF-8"
+ )
+ self.log_file_handler.setFormatter(self.log_file_formatter)
+ else:
+ self.log_file_handler = None
+
+ self.log_cli_handler = None
+
+ self.live_logs_context = lambda: dummy_context_manager()
+ # Note that the lambda for the live_logs_context is needed because
+ # live_logs_context can otherwise not be entered multiple times due
+ # to limitations of contextlib.contextmanager.
+
+ if self._log_cli_enabled():
+ self._setup_cli_logging()
+
+ def _create_formatter(self, log_format, log_date_format):
+ # color option doesn't exist if terminal plugin is disabled
+ color = getattr(self._config.option, "color", "no")
+ if color != "no" and ColoredLevelFormatter.LEVELNAME_FMT_REGEX.search(
+ log_format
+ ):
+ formatter = ColoredLevelFormatter(
+ create_terminal_writer(self._config), log_format, log_date_format
+ )
+ else:
+ formatter = logging.Formatter(log_format, log_date_format)
+
+ if not six.PY2:
+ formatter._style = PercentStyleMultiline(formatter._style._fmt)
+ return formatter
+
+ def _setup_cli_logging(self):
+ config = self._config
+ terminal_reporter = config.pluginmanager.get_plugin("terminalreporter")
+ if terminal_reporter is None:
+ # terminal reporter is disabled e.g. by pytest-xdist.
+ return
+
+ capture_manager = config.pluginmanager.get_plugin("capturemanager")
+ # if capturemanager plugin is disabled, live logging still works.
+ log_cli_handler = _LiveLoggingStreamHandler(terminal_reporter, capture_manager)
+
+ log_cli_formatter = self._create_formatter(
+ get_option_ini(config, "log_cli_format", "log_format"),
+ get_option_ini(config, "log_cli_date_format", "log_date_format"),
+ )
+
+ log_cli_level = get_actual_log_level(config, "log_cli_level", "log_level")
+ self.log_cli_handler = log_cli_handler
+ self.live_logs_context = lambda: catching_logs(
+ log_cli_handler, formatter=log_cli_formatter, level=log_cli_level
+ )
+
+ def set_log_path(self, fname):
+ """Public method, which can set filename parameter for
+ Logging.FileHandler(). Also creates parent directory if
+ it does not exist.
+
+ .. warning::
+ Please considered as an experimental API.
+ """
+ fname = Path(fname)
+
+ if not fname.is_absolute():
+ fname = Path(self._config.rootdir, fname)
+
+ if not fname.parent.exists():
+ fname.parent.mkdir(exist_ok=True, parents=True)
+
+ self.log_file_handler = logging.FileHandler(
+ str(fname), mode="w", encoding="UTF-8"
+ )
+ self.log_file_handler.setFormatter(self.log_file_formatter)
+
+ def _log_cli_enabled(self):
+ """Return True if log_cli should be considered enabled, either explicitly
+ or because --log-cli-level was given in the command-line.
+ """
+ return self._config.getoption(
+ "--log-cli-level"
+ ) is not None or self._config.getini("log_cli")
+
+ @pytest.hookimpl(hookwrapper=True, tryfirst=True)
+ def pytest_collection(self):
+ with self.live_logs_context():
+ if self.log_cli_handler:
+ self.log_cli_handler.set_when("collection")
+
+ if self.log_file_handler is not None:
+ with catching_logs(self.log_file_handler, level=self.log_file_level):
+ yield
+ else:
+ yield
+
+ @contextmanager
+ def _runtest_for(self, item, when):
+ with self._runtest_for_main(item, when):
+ if self.log_file_handler is not None:
+ with catching_logs(self.log_file_handler, level=self.log_file_level):
+ yield
+ else:
+ yield
+
+ @contextmanager
+ def _runtest_for_main(self, item, when):
+ """Implements the internals of pytest_runtest_xxx() hook."""
+ with catching_logs(
+ LogCaptureHandler(), formatter=self.formatter, level=self.log_level
+ ) as log_handler:
+ if self.log_cli_handler:
+ self.log_cli_handler.set_when(when)
+
+ if item is None:
+ yield # run the test
+ return
+
+ if not hasattr(item, "catch_log_handlers"):
+ item.catch_log_handlers = {}
+ item.catch_log_handlers[when] = log_handler
+ item.catch_log_handler = log_handler
+ try:
+ yield # run test
+ finally:
+ if when == "teardown":
+ del item.catch_log_handler
+ del item.catch_log_handlers
+
+ if self.print_logs:
+ # Add a captured log section to the report.
+ log = log_handler.stream.getvalue().strip()
+ item.add_report_section(when, "log", log)
+
+ @pytest.hookimpl(hookwrapper=True)
+ def pytest_runtest_setup(self, item):
+ with self._runtest_for(item, "setup"):
+ yield
+
+ @pytest.hookimpl(hookwrapper=True)
+ def pytest_runtest_call(self, item):
+ with self._runtest_for(item, "call"):
+ yield
+
+ @pytest.hookimpl(hookwrapper=True)
+ def pytest_runtest_teardown(self, item):
+ with self._runtest_for(item, "teardown"):
+ yield
+
+ @pytest.hookimpl(hookwrapper=True)
+ def pytest_runtest_logstart(self):
+ if self.log_cli_handler:
+ self.log_cli_handler.reset()
+ with self._runtest_for(None, "start"):
+ yield
+
+ @pytest.hookimpl(hookwrapper=True)
+ def pytest_runtest_logfinish(self):
+ with self._runtest_for(None, "finish"):
+ yield
+
+ @pytest.hookimpl(hookwrapper=True)
+ def pytest_runtest_logreport(self):
+ with self._runtest_for(None, "logreport"):
+ yield
+
+ @pytest.hookimpl(hookwrapper=True, tryfirst=True)
+ def pytest_sessionfinish(self):
+ with self.live_logs_context():
+ if self.log_cli_handler:
+ self.log_cli_handler.set_when("sessionfinish")
+ if self.log_file_handler is not None:
+ try:
+ with catching_logs(
+ self.log_file_handler, level=self.log_file_level
+ ):
+ yield
+ finally:
+ # Close the FileHandler explicitly.
+ # (logging.shutdown might have lost the weakref?!)
+ self.log_file_handler.close()
+ else:
+ yield
+
+ @pytest.hookimpl(hookwrapper=True, tryfirst=True)
+ def pytest_sessionstart(self):
+ with self.live_logs_context():
+ if self.log_cli_handler:
+ self.log_cli_handler.set_when("sessionstart")
+ if self.log_file_handler is not None:
+ with catching_logs(self.log_file_handler, level=self.log_file_level):
+ yield
+ else:
+ yield
+
+ @pytest.hookimpl(hookwrapper=True)
+ def pytest_runtestloop(self, session):
+ """Runs all collected test items."""
+
+ if session.config.option.collectonly:
+ yield
+ return
+
+ if self._log_cli_enabled() and self._config.getoption("verbose") < 1:
+ # setting verbose flag is needed to avoid messy test progress output
+ self._config.option.verbose = 1
+
+ with self.live_logs_context():
+ if self.log_file_handler is not None:
+ with catching_logs(self.log_file_handler, level=self.log_file_level):
+ yield # run all the tests
+ else:
+ yield # run all the tests
+
+
+class _LiveLoggingStreamHandler(logging.StreamHandler):
+ """
+ Custom StreamHandler used by the live logging feature: it will write a newline before the first log message
+ in each test.
+
+ During live logging we must also explicitly disable stdout/stderr capturing otherwise it will get captured
+ and won't appear in the terminal.
+ """
+
+ def __init__(self, terminal_reporter, capture_manager):
+ """
+ :param _pytest.terminal.TerminalReporter terminal_reporter:
+ :param _pytest.capture.CaptureManager capture_manager:
+ """
+ logging.StreamHandler.__init__(self, stream=terminal_reporter)
+ self.capture_manager = capture_manager
+ self.reset()
+ self.set_when(None)
+ self._test_outcome_written = False
+
+ def reset(self):
+ """Reset the handler; should be called before the start of each test"""
+ self._first_record_emitted = False
+
+ def set_when(self, when):
+ """Prepares for the given test phase (setup/call/teardown)"""
+ self._when = when
+ self._section_name_shown = False
+ if when == "start":
+ self._test_outcome_written = False
+
+ def emit(self, record):
+ ctx_manager = (
+ self.capture_manager.global_and_fixture_disabled()
+ if self.capture_manager
+ else dummy_context_manager()
+ )
+ with ctx_manager:
+ if not self._first_record_emitted:
+ self.stream.write("\n")
+ self._first_record_emitted = True
+ elif self._when in ("teardown", "finish"):
+ if not self._test_outcome_written:
+ self._test_outcome_written = True
+ self.stream.write("\n")
+ if not self._section_name_shown and self._when:
+ self.stream.section("live log " + self._when, sep="-", bold=True)
+ self._section_name_shown = True
+ logging.StreamHandler.emit(self, record)
diff --git a/contrib/python/pytest/py2/_pytest/main.py b/contrib/python/pytest/py2/_pytest/main.py
new file mode 100644
index 00000000000..a9d310cb62d
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/main.py
@@ -0,0 +1,780 @@
+# -*- coding: utf-8 -*-
+""" core implementation of testing process: init, session, runtest loop. """
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import contextlib
+import fnmatch
+import functools
+import os
+import pkgutil
+import sys
+import warnings
+
+import attr
+import py
+import six
+
+import _pytest._code
+from _pytest import nodes
+from _pytest.config import directory_arg
+from _pytest.config import hookimpl
+from _pytest.config import UsageError
+from _pytest.deprecated import PYTEST_CONFIG_GLOBAL
+from _pytest.outcomes import exit
+from _pytest.runner import collect_one_node
+
+# exitcodes for the command line
+EXIT_OK = 0
+EXIT_TESTSFAILED = 1
+EXIT_INTERRUPTED = 2
+EXIT_INTERNALERROR = 3
+EXIT_USAGEERROR = 4
+EXIT_NOTESTSCOLLECTED = 5
+
+
+def pytest_addoption(parser):
+ parser.addini(
+ "norecursedirs",
+ "directory patterns to avoid for recursion",
+ type="args",
+ default=[".*", "build", "dist", "CVS", "_darcs", "{arch}", "*.egg", "venv"],
+ )
+ parser.addini(
+ "testpaths",
+ "directories to search for tests when no files or directories are given in the "
+ "command line.",
+ type="args",
+ default=[],
+ )
+ group = parser.getgroup("general", "running and selection options")
+ group._addoption(
+ "-x",
+ "--exitfirst",
+ action="store_const",
+ dest="maxfail",
+ const=1,
+ help="exit instantly on first error or failed test.",
+ ),
+ group._addoption(
+ "--maxfail",
+ metavar="num",
+ action="store",
+ type=int,
+ dest="maxfail",
+ default=0,
+ help="exit after first num failures or errors.",
+ )
+ group._addoption(
+ "--strict-markers",
+ "--strict",
+ action="store_true",
+ help="markers not registered in the `markers` section of the configuration file raise errors.",
+ )
+ group._addoption(
+ "-c",
+ metavar="file",
+ type=str,
+ dest="inifilename",
+ help="load configuration from `file` instead of trying to locate one of the implicit "
+ "configuration files.",
+ )
+ group._addoption(
+ "--continue-on-collection-errors",
+ action="store_true",
+ default=False,
+ dest="continue_on_collection_errors",
+ help="Force test execution even if collection errors occur.",
+ )
+ group._addoption(
+ "--rootdir",
+ action="store",
+ dest="rootdir",
+ help="Define root directory for tests. Can be relative path: 'root_dir', './root_dir', "
+ "'root_dir/another_dir/'; absolute path: '/home/user/root_dir'; path with variables: "
+ "'$HOME/root_dir'.",
+ )
+
+ group = parser.getgroup("collect", "collection")
+ group.addoption(
+ "--collectonly",
+ "--collect-only",
+ action="store_true",
+ help="only collect tests, don't execute them.",
+ ),
+ group.addoption(
+ "--pyargs",
+ action="store_true",
+ help="try to interpret all arguments as python packages.",
+ )
+ group.addoption(
+ "--ignore",
+ action="append",
+ metavar="path",
+ help="ignore path during collection (multi-allowed).",
+ )
+ group.addoption(
+ "--ignore-glob",
+ action="append",
+ metavar="path",
+ help="ignore path pattern during collection (multi-allowed).",
+ )
+ group.addoption(
+ "--deselect",
+ action="append",
+ metavar="nodeid_prefix",
+ help="deselect item during collection (multi-allowed).",
+ )
+ # when changing this to --conf-cut-dir, config.py Conftest.setinitial
+ # needs upgrading as well
+ group.addoption(
+ "--confcutdir",
+ dest="confcutdir",
+ default=None,
+ metavar="dir",
+ type=functools.partial(directory_arg, optname="--confcutdir"),
+ help="only load conftest.py's relative to specified dir.",
+ )
+ group.addoption(
+ "--noconftest",
+ action="store_true",
+ dest="noconftest",
+ default=False,
+ help="Don't load any conftest.py files.",
+ )
+ group.addoption(
+ "--keepduplicates",
+ "--keep-duplicates",
+ action="store_true",
+ dest="keepduplicates",
+ default=False,
+ help="Keep duplicate tests.",
+ )
+ group.addoption(
+ "--collect-in-virtualenv",
+ action="store_true",
+ dest="collect_in_virtualenv",
+ default=False,
+ help="Don't ignore tests in a local virtualenv directory",
+ )
+
+ group = parser.getgroup("debugconfig", "test session debugging and configuration")
+ group.addoption(
+ "--basetemp",
+ dest="basetemp",
+ default=None,
+ metavar="dir",
+ help=(
+ "base temporary directory for this test run."
+ "(warning: this directory is removed if it exists)"
+ ),
+ )
+
+
+class _ConfigDeprecated(object):
+ def __init__(self, config):
+ self.__dict__["_config"] = config
+
+ def __getattr__(self, attr):
+ warnings.warn(PYTEST_CONFIG_GLOBAL, stacklevel=2)
+ return getattr(self._config, attr)
+
+ def __setattr__(self, attr, val):
+ warnings.warn(PYTEST_CONFIG_GLOBAL, stacklevel=2)
+ return setattr(self._config, attr, val)
+
+ def __repr__(self):
+ return "{}({!r})".format(type(self).__name__, self._config)
+
+
+def pytest_configure(config):
+ __import__("pytest").config = _ConfigDeprecated(config) # compatibility
+
+
+def wrap_session(config, doit):
+ """Skeleton command line program"""
+ session = Session(config)
+ session.exitstatus = EXIT_OK
+ initstate = 0
+ try:
+ try:
+ config._do_configure()
+ initstate = 1
+ config.hook.pytest_sessionstart(session=session)
+ initstate = 2
+ session.exitstatus = doit(config, session) or 0
+ except UsageError:
+ session.exitstatus = EXIT_USAGEERROR
+ raise
+ except Failed:
+ session.exitstatus = EXIT_TESTSFAILED
+ except (KeyboardInterrupt, exit.Exception):
+ excinfo = _pytest._code.ExceptionInfo.from_current()
+ exitstatus = EXIT_INTERRUPTED
+ if isinstance(excinfo.value, exit.Exception):
+ if excinfo.value.returncode is not None:
+ exitstatus = excinfo.value.returncode
+ if initstate < 2:
+ sys.stderr.write(
+ "{}: {}\n".format(excinfo.typename, excinfo.value.msg)
+ )
+ config.hook.pytest_keyboard_interrupt(excinfo=excinfo)
+ session.exitstatus = exitstatus
+ except: # noqa
+ excinfo = _pytest._code.ExceptionInfo.from_current()
+ config.notify_exception(excinfo, config.option)
+ session.exitstatus = EXIT_INTERNALERROR
+ if excinfo.errisinstance(SystemExit):
+ sys.stderr.write("mainloop: caught unexpected SystemExit!\n")
+
+ finally:
+ excinfo = None # Explicitly break reference cycle.
+ session.startdir.chdir()
+ if initstate >= 2:
+ config.hook.pytest_sessionfinish(
+ session=session, exitstatus=session.exitstatus
+ )
+ config._ensure_unconfigure()
+ return session.exitstatus
+
+
+def pytest_cmdline_main(config):
+ return wrap_session(config, _main)
+
+
+def _main(config, session):
+ """ default command line protocol for initialization, session,
+ running tests and reporting. """
+ config.hook.pytest_collection(session=session)
+ config.hook.pytest_runtestloop(session=session)
+
+ if session.testsfailed:
+ return EXIT_TESTSFAILED
+ elif session.testscollected == 0:
+ return EXIT_NOTESTSCOLLECTED
+
+
+def pytest_collection(session):
+ return session.perform_collect()
+
+
+def pytest_runtestloop(session):
+ if session.testsfailed and not session.config.option.continue_on_collection_errors:
+ raise session.Interrupted("%d errors during collection" % session.testsfailed)
+
+ if session.config.option.collectonly:
+ return True
+
+ for i, item in enumerate(session.items):
+ nextitem = session.items[i + 1] if i + 1 < len(session.items) else None
+ item.config.hook.pytest_runtest_protocol(item=item, nextitem=nextitem)
+ if session.shouldfail:
+ raise session.Failed(session.shouldfail)
+ if session.shouldstop:
+ raise session.Interrupted(session.shouldstop)
+ return True
+
+
+def _in_venv(path):
+ """Attempts to detect if ``path`` is the root of a Virtual Environment by
+ checking for the existence of the appropriate activate script"""
+ bindir = path.join("Scripts" if sys.platform.startswith("win") else "bin")
+ if not bindir.isdir():
+ return False
+ activates = (
+ "activate",
+ "activate.csh",
+ "activate.fish",
+ "Activate",
+ "Activate.bat",
+ "Activate.ps1",
+ )
+ return any([fname.basename in activates for fname in bindir.listdir()])
+
+
+def pytest_ignore_collect(path, config):
+ ignore_paths = config._getconftest_pathlist("collect_ignore", path=path.dirpath())
+ ignore_paths = ignore_paths or []
+ excludeopt = config.getoption("ignore")
+ if excludeopt:
+ ignore_paths.extend([py.path.local(x) for x in excludeopt])
+
+ if py.path.local(path) in ignore_paths:
+ return True
+
+ ignore_globs = config._getconftest_pathlist(
+ "collect_ignore_glob", path=path.dirpath()
+ )
+ ignore_globs = ignore_globs or []
+ excludeglobopt = config.getoption("ignore_glob")
+ if excludeglobopt:
+ ignore_globs.extend([py.path.local(x) for x in excludeglobopt])
+
+ if any(
+ fnmatch.fnmatch(six.text_type(path), six.text_type(glob))
+ for glob in ignore_globs
+ ):
+ return True
+
+ allow_in_venv = config.getoption("collect_in_virtualenv")
+ if not allow_in_venv and _in_venv(path):
+ return True
+
+ return False
+
+
+def pytest_collection_modifyitems(items, config):
+ deselect_prefixes = tuple(config.getoption("deselect") or [])
+ if not deselect_prefixes:
+ return
+
+ remaining = []
+ deselected = []
+ for colitem in items:
+ if colitem.nodeid.startswith(deselect_prefixes):
+ deselected.append(colitem)
+ else:
+ remaining.append(colitem)
+
+ if deselected:
+ config.hook.pytest_deselected(items=deselected)
+ items[:] = remaining
+
+
+@contextlib.contextmanager
+def _patched_find_module():
+ """Patch bug in pkgutil.ImpImporter.find_module
+
+ When using pkgutil.find_loader on python<3.4 it removes symlinks
+ from the path due to a call to os.path.realpath. This is not consistent
+ with actually doing the import (in these versions, pkgutil and __import__
+ did not share the same underlying code). This can break conftest
+ discovery for pytest where symlinks are involved.
+
+ The only supported python<3.4 by pytest is python 2.7.
+ """
+ if six.PY2: # python 3.4+ uses importlib instead
+
+ def find_module_patched(self, fullname, path=None):
+ # Note: we ignore 'path' argument since it is only used via meta_path
+ subname = fullname.split(".")[-1]
+ if subname != fullname and self.path is None:
+ return None
+ if self.path is None:
+ path = None
+ else:
+ # original: path = [os.path.realpath(self.path)]
+ path = [self.path]
+ try:
+ file, filename, etc = pkgutil.imp.find_module(subname, path)
+ except ImportError:
+ return None
+ return pkgutil.ImpLoader(fullname, file, filename, etc)
+
+ old_find_module = pkgutil.ImpImporter.find_module
+ pkgutil.ImpImporter.find_module = find_module_patched
+ try:
+ yield
+ finally:
+ pkgutil.ImpImporter.find_module = old_find_module
+ else:
+ yield
+
+
+class FSHookProxy(object):
+ def __init__(self, fspath, pm, remove_mods):
+ self.fspath = fspath
+ self.pm = pm
+ self.remove_mods = remove_mods
+
+ def __getattr__(self, name):
+ x = self.pm.subset_hook_caller(name, remove_plugins=self.remove_mods)
+ self.__dict__[name] = x
+ return x
+
+
+class NoMatch(Exception):
+ """ raised if matching cannot locate a matching names. """
+
+
+class Interrupted(KeyboardInterrupt):
+ """ signals an interrupted test run. """
+
+ __module__ = "builtins" # for py3
+
+
+class Failed(Exception):
+ """ signals a stop as failed test run. """
+
+
+@attr.s
+class _bestrelpath_cache(dict):
+ path = attr.ib()
+
+ def __missing__(self, path):
+ r = self.path.bestrelpath(path)
+ self[path] = r
+ return r
+
+
+class Session(nodes.FSCollector):
+ Interrupted = Interrupted
+ Failed = Failed
+
+ def __init__(self, config):
+ nodes.FSCollector.__init__(
+ self, config.rootdir, parent=None, config=config, session=self, nodeid=""
+ )
+ self.testsfailed = 0
+ self.testscollected = 0
+ self.shouldstop = False
+ self.shouldfail = False
+ self.trace = config.trace.root.get("collection")
+ self._norecursepatterns = config.getini("norecursedirs")
+ self.startdir = config.invocation_dir
+ self._initialpaths = frozenset()
+ # Keep track of any collected nodes in here, so we don't duplicate fixtures
+ self._node_cache = {}
+ self._bestrelpathcache = _bestrelpath_cache(config.rootdir)
+ # Dirnames of pkgs with dunder-init files.
+ self._pkg_roots = {}
+
+ self.config.pluginmanager.register(self, name="session")
+
+ def __repr__(self):
+ return "<%s %s exitstatus=%r testsfailed=%d testscollected=%d>" % (
+ self.__class__.__name__,
+ self.name,
+ getattr(self, "exitstatus", "<UNSET>"),
+ self.testsfailed,
+ self.testscollected,
+ )
+
+ def _node_location_to_relpath(self, node_path):
+ # bestrelpath is a quite slow function
+ return self._bestrelpathcache[node_path]
+
+ @hookimpl(tryfirst=True)
+ def pytest_collectstart(self):
+ if self.shouldfail:
+ raise self.Failed(self.shouldfail)
+ if self.shouldstop:
+ raise self.Interrupted(self.shouldstop)
+
+ @hookimpl(tryfirst=True)
+ def pytest_runtest_logreport(self, report):
+ if report.failed and not hasattr(report, "wasxfail"):
+ self.testsfailed += 1
+ maxfail = self.config.getvalue("maxfail")
+ if maxfail and self.testsfailed >= maxfail:
+ self.shouldfail = "stopping after %d failures" % (self.testsfailed)
+
+ pytest_collectreport = pytest_runtest_logreport
+
+ def isinitpath(self, path):
+ return path in self._initialpaths
+
+ def gethookproxy(self, fspath):
+ # check if we have the common case of running
+ # hooks with all conftest.py files
+ pm = self.config.pluginmanager
+ my_conftestmodules = pm._getconftestmodules(fspath)
+ remove_mods = pm._conftest_plugins.difference(my_conftestmodules)
+ if remove_mods:
+ # one or more conftests are not in use at this fspath
+ proxy = FSHookProxy(fspath, pm, remove_mods)
+ else:
+ # all plugis are active for this fspath
+ proxy = self.config.hook
+ return proxy
+
+ def perform_collect(self, args=None, genitems=True):
+ hook = self.config.hook
+ try:
+ items = self._perform_collect(args, genitems)
+ self.config.pluginmanager.check_pending()
+ hook.pytest_collection_modifyitems(
+ session=self, config=self.config, items=items
+ )
+ finally:
+ hook.pytest_collection_finish(session=self)
+ self.testscollected = len(items)
+ return items
+
+ def _perform_collect(self, args, genitems):
+ if args is None:
+ args = self.config.args
+ self.trace("perform_collect", self, args)
+ self.trace.root.indent += 1
+ self._notfound = []
+ initialpaths = []
+ self._initialparts = []
+ self.items = items = []
+ for arg in args:
+ parts = self._parsearg(arg)
+ self._initialparts.append(parts)
+ initialpaths.append(parts[0])
+ self._initialpaths = frozenset(initialpaths)
+ rep = collect_one_node(self)
+ self.ihook.pytest_collectreport(report=rep)
+ self.trace.root.indent -= 1
+ if self._notfound:
+ errors = []
+ for arg, exc in self._notfound:
+ line = "(no name %r in any of %r)" % (arg, exc.args[0])
+ errors.append("not found: %s\n%s" % (arg, line))
+ # XXX: test this
+ raise UsageError(*errors)
+ if not genitems:
+ return rep.result
+ else:
+ if rep.passed:
+ for node in rep.result:
+ self.items.extend(self.genitems(node))
+ return items
+
+ def collect(self):
+ for initialpart in self._initialparts:
+ arg = "::".join(map(str, initialpart))
+ self.trace("processing argument", arg)
+ self.trace.root.indent += 1
+ try:
+ for x in self._collect(arg):
+ yield x
+ except NoMatch:
+ # we are inside a make_report hook so
+ # we cannot directly pass through the exception
+ self._notfound.append((arg, sys.exc_info()[1]))
+
+ self.trace.root.indent -= 1
+
+ def _collect(self, arg):
+ from _pytest.python import Package
+
+ names = self._parsearg(arg)
+ argpath = names.pop(0)
+
+ # Start with a Session root, and delve to argpath item (dir or file)
+ # and stack all Packages found on the way.
+ # No point in finding packages when collecting doctests
+ if not self.config.getoption("doctestmodules", False):
+ pm = self.config.pluginmanager
+ for parent in reversed(argpath.parts()):
+ if pm._confcutdir and pm._confcutdir.relto(parent):
+ break
+
+ if parent.isdir():
+ pkginit = parent.join("__init__.py")
+ if pkginit.isfile():
+ if pkginit not in self._node_cache:
+ col = self._collectfile(pkginit, handle_dupes=False)
+ if col:
+ if isinstance(col[0], Package):
+ self._pkg_roots[parent] = col[0]
+ # always store a list in the cache, matchnodes expects it
+ self._node_cache[col[0].fspath] = [col[0]]
+
+ # If it's a directory argument, recurse and look for any Subpackages.
+ # Let the Package collector deal with subnodes, don't collect here.
+ if argpath.check(dir=1):
+ assert not names, "invalid arg %r" % (arg,)
+
+ seen_dirs = set()
+ for path in argpath.visit(
+ fil=self._visit_filter, rec=self._recurse, bf=True, sort=True
+ ):
+ dirpath = path.dirpath()
+ if dirpath not in seen_dirs:
+ # Collect packages first.
+ seen_dirs.add(dirpath)
+ pkginit = dirpath.join("__init__.py")
+ if pkginit.exists():
+ for x in self._collectfile(pkginit):
+ yield x
+ if isinstance(x, Package):
+ self._pkg_roots[dirpath] = x
+ if dirpath in self._pkg_roots:
+ # Do not collect packages here.
+ continue
+
+ for x in self._collectfile(path):
+ key = (type(x), x.fspath)
+ if key in self._node_cache:
+ yield self._node_cache[key]
+ else:
+ self._node_cache[key] = x
+ yield x
+ else:
+ assert argpath.check(file=1)
+
+ if argpath in self._node_cache:
+ col = self._node_cache[argpath]
+ else:
+ collect_root = self._pkg_roots.get(argpath.dirname, self)
+ col = collect_root._collectfile(argpath, handle_dupes=False)
+ if col:
+ self._node_cache[argpath] = col
+ m = self.matchnodes(col, names)
+ # If __init__.py was the only file requested, then the matched node will be
+ # the corresponding Package, and the first yielded item will be the __init__
+ # Module itself, so just use that. If this special case isn't taken, then all
+ # the files in the package will be yielded.
+ if argpath.basename == "__init__.py":
+ try:
+ yield next(m[0].collect())
+ except StopIteration:
+ # The package collects nothing with only an __init__.py
+ # file in it, which gets ignored by the default
+ # "python_files" option.
+ pass
+ return
+ for y in m:
+ yield y
+
+ def _collectfile(self, path, handle_dupes=True):
+ assert path.isfile(), "%r is not a file (isdir=%r, exists=%r, islink=%r)" % (
+ path,
+ path.isdir(),
+ path.exists(),
+ path.islink(),
+ )
+ ihook = self.gethookproxy(path)
+ if not self.isinitpath(path):
+ if ihook.pytest_ignore_collect(path=path, config=self.config):
+ return ()
+
+ if handle_dupes:
+ keepduplicates = self.config.getoption("keepduplicates")
+ if not keepduplicates:
+ duplicate_paths = self.config.pluginmanager._duplicatepaths
+ if path in duplicate_paths:
+ return ()
+ else:
+ duplicate_paths.add(path)
+
+ return ihook.pytest_collect_file(path=path, parent=self)
+
+ def _recurse(self, dirpath):
+ if dirpath.basename == "__pycache__":
+ return False
+ ihook = self.gethookproxy(dirpath.dirpath())
+ if ihook.pytest_ignore_collect(path=dirpath, config=self.config):
+ return False
+ for pat in self._norecursepatterns:
+ if dirpath.check(fnmatch=pat):
+ return False
+ ihook = self.gethookproxy(dirpath)
+ ihook.pytest_collect_directory(path=dirpath, parent=self)
+ return True
+
+ if six.PY2:
+
+ @staticmethod
+ def _visit_filter(f):
+ return f.check(file=1) and not f.strpath.endswith("*.pyc")
+
+ else:
+
+ @staticmethod
+ def _visit_filter(f):
+ return f.check(file=1)
+
+ def _tryconvertpyarg(self, x):
+ """Convert a dotted module name to path."""
+ try:
+ with _patched_find_module():
+ loader = pkgutil.find_loader(x)
+ except ImportError:
+ return x
+ if loader is None:
+ return x
+ # This method is sometimes invoked when AssertionRewritingHook, which
+ # does not define a get_filename method, is already in place:
+ try:
+ with _patched_find_module():
+ path = loader.get_filename(x)
+ except AttributeError:
+ # Retrieve path from AssertionRewritingHook:
+ path = loader.modules[x][0].co_filename
+ if loader.is_package(x):
+ path = os.path.dirname(path)
+ return path
+
+ def _parsearg(self, arg):
+ """ return (fspath, names) tuple after checking the file exists. """
+ parts = str(arg).split("::")
+ if self.config.option.pyargs:
+ parts[0] = self._tryconvertpyarg(parts[0])
+ relpath = parts[0].replace("/", os.sep)
+ path = self.config.invocation_dir.join(relpath, abs=True)
+ if not path.check():
+ if self.config.option.pyargs:
+ raise UsageError(
+ "file or package not found: " + arg + " (missing __init__.py?)"
+ )
+ raise UsageError("file not found: " + arg)
+ parts[0] = path.realpath()
+ return parts
+
+ def matchnodes(self, matching, names):
+ self.trace("matchnodes", matching, names)
+ self.trace.root.indent += 1
+ nodes = self._matchnodes(matching, names)
+ num = len(nodes)
+ self.trace("matchnodes finished -> ", num, "nodes")
+ self.trace.root.indent -= 1
+ if num == 0:
+ raise NoMatch(matching, names[:1])
+ return nodes
+
+ def _matchnodes(self, matching, names):
+ if not matching or not names:
+ return matching
+ name = names[0]
+ assert name
+ nextnames = names[1:]
+ resultnodes = []
+ for node in matching:
+ if isinstance(node, nodes.Item):
+ if not names:
+ resultnodes.append(node)
+ continue
+ assert isinstance(node, nodes.Collector)
+ key = (type(node), node.nodeid)
+ if key in self._node_cache:
+ rep = self._node_cache[key]
+ else:
+ rep = collect_one_node(node)
+ self._node_cache[key] = rep
+ if rep.passed:
+ has_matched = False
+ for x in rep.result:
+ # TODO: remove parametrized workaround once collection structure contains parametrization
+ if x.name == name or x.name.split("[")[0] == name:
+ resultnodes.extend(self.matchnodes([x], nextnames))
+ has_matched = True
+ # XXX accept IDs that don't have "()" for class instances
+ if not has_matched and len(rep.result) == 1 and x.name == "()":
+ nextnames.insert(0, name)
+ resultnodes.extend(self.matchnodes([x], nextnames))
+ else:
+ # report collection failures here to avoid failing to run some test
+ # specified in the command line because the module could not be
+ # imported (#134)
+ node.ihook.pytest_collectreport(report=rep)
+ return resultnodes
+
+ def genitems(self, node):
+ self.trace("genitems", node)
+ if isinstance(node, nodes.Item):
+ node.ihook.pytest_itemcollected(item=node)
+ yield node
+ else:
+ assert isinstance(node, nodes.Collector)
+ rep = collect_one_node(node)
+ if rep.passed:
+ for subnode in rep.result:
+ for x in self.genitems(subnode):
+ yield x
+ node.ihook.pytest_collectreport(report=rep)
diff --git a/contrib/python/pytest/py2/_pytest/mark/__init__.py b/contrib/python/pytest/py2/_pytest/mark/__init__.py
new file mode 100644
index 00000000000..6bc22fe27da
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/mark/__init__.py
@@ -0,0 +1,166 @@
+# -*- coding: utf-8 -*-
+""" generic mechanism for marking and selecting python functions. """
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+from .legacy import matchkeyword
+from .legacy import matchmark
+from .structures import EMPTY_PARAMETERSET_OPTION
+from .structures import get_empty_parameterset_mark
+from .structures import Mark
+from .structures import MARK_GEN
+from .structures import MarkDecorator
+from .structures import MarkGenerator
+from .structures import ParameterSet
+from _pytest.config import UsageError
+
+__all__ = ["Mark", "MarkDecorator", "MarkGenerator", "get_empty_parameterset_mark"]
+
+
+def param(*values, **kw):
+ """Specify a parameter in `pytest.mark.parametrize`_ calls or
+ :ref:`parametrized fixtures <fixture-parametrize-marks>`.
+
+ .. code-block:: python
+
+ @pytest.mark.parametrize("test_input,expected", [
+ ("3+5", 8),
+ pytest.param("6*9", 42, marks=pytest.mark.xfail),
+ ])
+ def test_eval(test_input, expected):
+ assert eval(test_input) == expected
+
+ :param values: variable args of the values of the parameter set, in order.
+ :keyword marks: a single mark or a list of marks to be applied to this parameter set.
+ :keyword str id: the id to attribute to this parameter set.
+ """
+ return ParameterSet.param(*values, **kw)
+
+
+def pytest_addoption(parser):
+ group = parser.getgroup("general")
+ group._addoption(
+ "-k",
+ action="store",
+ dest="keyword",
+ default="",
+ metavar="EXPRESSION",
+ help="only run tests which match the given substring expression. "
+ "An expression is a python evaluatable expression "
+ "where all names are substring-matched against test names "
+ "and their parent classes. Example: -k 'test_method or test_"
+ "other' matches all test functions and classes whose name "
+ "contains 'test_method' or 'test_other', while -k 'not test_method' "
+ "matches those that don't contain 'test_method' in their names. "
+ "-k 'not test_method and not test_other' will eliminate the matches. "
+ "Additionally keywords are matched to classes and functions "
+ "containing extra names in their 'extra_keyword_matches' set, "
+ "as well as functions which have names assigned directly to them.",
+ )
+
+ group._addoption(
+ "-m",
+ action="store",
+ dest="markexpr",
+ default="",
+ metavar="MARKEXPR",
+ help="only run tests matching given mark expression. "
+ "example: -m 'mark1 and not mark2'.",
+ )
+
+ group.addoption(
+ "--markers",
+ action="store_true",
+ help="show markers (builtin, plugin and per-project ones).",
+ )
+
+ parser.addini("markers", "markers for test functions", "linelist")
+ parser.addini(EMPTY_PARAMETERSET_OPTION, "default marker for empty parametersets")
+
+
+def pytest_cmdline_main(config):
+ import _pytest.config
+
+ if config.option.markers:
+ config._do_configure()
+ tw = _pytest.config.create_terminal_writer(config)
+ for line in config.getini("markers"):
+ parts = line.split(":", 1)
+ name = parts[0]
+ rest = parts[1] if len(parts) == 2 else ""
+ tw.write("@pytest.mark.%s:" % name, bold=True)
+ tw.line(rest)
+ tw.line()
+ config._ensure_unconfigure()
+ return 0
+
+
+pytest_cmdline_main.tryfirst = True
+
+
+def deselect_by_keyword(items, config):
+ keywordexpr = config.option.keyword.lstrip()
+ if not keywordexpr:
+ return
+
+ if keywordexpr.startswith("-"):
+ keywordexpr = "not " + keywordexpr[1:]
+ selectuntil = False
+ if keywordexpr[-1:] == ":":
+ selectuntil = True
+ keywordexpr = keywordexpr[:-1]
+
+ remaining = []
+ deselected = []
+ for colitem in items:
+ if keywordexpr and not matchkeyword(colitem, keywordexpr):
+ deselected.append(colitem)
+ else:
+ if selectuntil:
+ keywordexpr = None
+ remaining.append(colitem)
+
+ if deselected:
+ config.hook.pytest_deselected(items=deselected)
+ items[:] = remaining
+
+
+def deselect_by_mark(items, config):
+ matchexpr = config.option.markexpr
+ if not matchexpr:
+ return
+
+ remaining = []
+ deselected = []
+ for item in items:
+ if matchmark(item, matchexpr):
+ remaining.append(item)
+ else:
+ deselected.append(item)
+
+ if deselected:
+ config.hook.pytest_deselected(items=deselected)
+ items[:] = remaining
+
+
+def pytest_collection_modifyitems(items, config):
+ deselect_by_keyword(items, config)
+ deselect_by_mark(items, config)
+
+
+def pytest_configure(config):
+ config._old_mark_config = MARK_GEN._config
+ MARK_GEN._config = config
+
+ empty_parameterset = config.getini(EMPTY_PARAMETERSET_OPTION)
+
+ if empty_parameterset not in ("skip", "xfail", "fail_at_collect", None, ""):
+ raise UsageError(
+ "{!s} must be one of skip, xfail or fail_at_collect"
+ " but it is {!r}".format(EMPTY_PARAMETERSET_OPTION, empty_parameterset)
+ )
+
+
+def pytest_unconfigure(config):
+ MARK_GEN._config = getattr(config, "_old_mark_config", None)
diff --git a/contrib/python/pytest/py2/_pytest/mark/evaluate.py b/contrib/python/pytest/py2/_pytest/mark/evaluate.py
new file mode 100644
index 00000000000..506546e253a
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/mark/evaluate.py
@@ -0,0 +1,126 @@
+# -*- coding: utf-8 -*-
+import os
+import platform
+import sys
+import traceback
+
+import six
+
+from ..outcomes import fail
+from ..outcomes import TEST_OUTCOME
+
+
+def cached_eval(config, expr, d):
+ if not hasattr(config, "_evalcache"):
+ config._evalcache = {}
+ try:
+ return config._evalcache[expr]
+ except KeyError:
+ import _pytest._code
+
+ exprcode = _pytest._code.compile(expr, mode="eval")
+ config._evalcache[expr] = x = eval(exprcode, d)
+ return x
+
+
+class MarkEvaluator(object):
+ def __init__(self, item, name):
+ self.item = item
+ self._marks = None
+ self._mark = None
+ self._mark_name = name
+
+ def __bool__(self):
+ # dont cache here to prevent staleness
+ return bool(self._get_marks())
+
+ __nonzero__ = __bool__
+
+ def wasvalid(self):
+ return not hasattr(self, "exc")
+
+ def _get_marks(self):
+ return list(self.item.iter_markers(name=self._mark_name))
+
+ def invalidraise(self, exc):
+ raises = self.get("raises")
+ if not raises:
+ return
+ return not isinstance(exc, raises)
+
+ def istrue(self):
+ try:
+ return self._istrue()
+ except TEST_OUTCOME:
+ self.exc = sys.exc_info()
+ if isinstance(self.exc[1], SyntaxError):
+ msg = [" " * (self.exc[1].offset + 4) + "^"]
+ msg.append("SyntaxError: invalid syntax")
+ else:
+ msg = traceback.format_exception_only(*self.exc[:2])
+ fail(
+ "Error evaluating %r expression\n"
+ " %s\n"
+ "%s" % (self._mark_name, self.expr, "\n".join(msg)),
+ pytrace=False,
+ )
+
+ def _getglobals(self):
+ d = {"os": os, "sys": sys, "platform": platform, "config": self.item.config}
+ if hasattr(self.item, "obj"):
+ d.update(self.item.obj.__globals__)
+ return d
+
+ def _istrue(self):
+ if hasattr(self, "result"):
+ return self.result
+ self._marks = self._get_marks()
+
+ if self._marks:
+ self.result = False
+ for mark in self._marks:
+ self._mark = mark
+ if "condition" in mark.kwargs:
+ args = (mark.kwargs["condition"],)
+ else:
+ args = mark.args
+
+ for expr in args:
+ self.expr = expr
+ if isinstance(expr, six.string_types):
+ d = self._getglobals()
+ result = cached_eval(self.item.config, expr, d)
+ else:
+ if "reason" not in mark.kwargs:
+ # XXX better be checked at collection time
+ msg = (
+ "you need to specify reason=STRING "
+ "when using booleans as conditions."
+ )
+ fail(msg)
+ result = bool(expr)
+ if result:
+ self.result = True
+ self.reason = mark.kwargs.get("reason", None)
+ self.expr = expr
+ return self.result
+
+ if not args:
+ self.result = True
+ self.reason = mark.kwargs.get("reason", None)
+ return self.result
+ return False
+
+ def get(self, attr, default=None):
+ if self._mark is None:
+ return default
+ return self._mark.kwargs.get(attr, default)
+
+ def getexplanation(self):
+ expl = getattr(self, "reason", None) or self.get("reason", None)
+ if not expl:
+ if not hasattr(self, "expr"):
+ return ""
+ else:
+ return "condition: " + str(self.expr)
+ return expl
diff --git a/contrib/python/pytest/py2/_pytest/mark/legacy.py b/contrib/python/pytest/py2/_pytest/mark/legacy.py
new file mode 100644
index 00000000000..c56482f14d0
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/mark/legacy.py
@@ -0,0 +1,103 @@
+# -*- coding: utf-8 -*-
+"""
+this is a place where we put datastructures used by legacy apis
+we hope ot remove
+"""
+import keyword
+
+import attr
+
+from _pytest.config import UsageError
+
+
+@attr.s
+class MarkMapping(object):
+ """Provides a local mapping for markers where item access
+ resolves to True if the marker is present. """
+
+ own_mark_names = attr.ib()
+
+ @classmethod
+ def from_item(cls, item):
+ mark_names = {mark.name for mark in item.iter_markers()}
+ return cls(mark_names)
+
+ def __getitem__(self, name):
+ return name in self.own_mark_names
+
+
+class KeywordMapping(object):
+ """Provides a local mapping for keywords.
+ Given a list of names, map any substring of one of these names to True.
+ """
+
+ def __init__(self, names):
+ self._names = names
+
+ @classmethod
+ def from_item(cls, item):
+ mapped_names = set()
+
+ # Add the names of the current item and any parent items
+ import pytest
+
+ for item in item.listchain():
+ if not isinstance(item, pytest.Instance):
+ mapped_names.add(item.name)
+
+ # Add the names added as extra keywords to current or parent items
+ mapped_names.update(item.listextrakeywords())
+
+ # Add the names attached to the current function through direct assignment
+ if hasattr(item, "function"):
+ mapped_names.update(item.function.__dict__)
+
+ # add the markers to the keywords as we no longer handle them correctly
+ mapped_names.update(mark.name for mark in item.iter_markers())
+
+ return cls(mapped_names)
+
+ def __getitem__(self, subname):
+ for name in self._names:
+ if subname in name:
+ return True
+ return False
+
+
+python_keywords_allowed_list = ["or", "and", "not"]
+
+
+def matchmark(colitem, markexpr):
+ """Tries to match on any marker names, attached to the given colitem."""
+ try:
+ return eval(markexpr, {}, MarkMapping.from_item(colitem))
+ except SyntaxError as e:
+ raise SyntaxError(str(e) + "\nMarker expression must be valid Python!")
+
+
+def matchkeyword(colitem, keywordexpr):
+ """Tries to match given keyword expression to given collector item.
+
+ Will match on the name of colitem, including the names of its parents.
+ Only matches names of items which are either a :class:`Class` or a
+ :class:`Function`.
+ Additionally, matches on names in the 'extra_keyword_matches' set of
+ any item, as well as names directly assigned to test functions.
+ """
+ mapping = KeywordMapping.from_item(colitem)
+ if " " not in keywordexpr:
+ # special case to allow for simple "-k pass" and "-k 1.3"
+ return mapping[keywordexpr]
+ elif keywordexpr.startswith("not ") and " " not in keywordexpr[4:]:
+ return not mapping[keywordexpr[4:]]
+ for kwd in keywordexpr.split():
+ if keyword.iskeyword(kwd) and kwd not in python_keywords_allowed_list:
+ raise UsageError(
+ "Python keyword '{}' not accepted in expressions passed to '-k'".format(
+ kwd
+ )
+ )
+ try:
+ return eval(keywordexpr, {}, mapping)
+ except SyntaxError:
+ raise UsageError("Wrong expression passed to '-k': {}".format(keywordexpr))
diff --git a/contrib/python/pytest/py2/_pytest/mark/structures.py b/contrib/python/pytest/py2/_pytest/mark/structures.py
new file mode 100644
index 00000000000..aaebe927be7
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/mark/structures.py
@@ -0,0 +1,413 @@
+# -*- coding: utf-8 -*-
+import inspect
+import warnings
+from collections import namedtuple
+from operator import attrgetter
+
+import attr
+import six
+
+from ..compat import ascii_escaped
+from ..compat import ATTRS_EQ_FIELD
+from ..compat import getfslineno
+from ..compat import MappingMixin
+from ..compat import NOTSET
+from _pytest.deprecated import PYTEST_PARAM_UNKNOWN_KWARGS
+from _pytest.outcomes import fail
+from _pytest.warning_types import PytestUnknownMarkWarning
+
+EMPTY_PARAMETERSET_OPTION = "empty_parameter_set_mark"
+
+
+def alias(name, warning=None):
+ getter = attrgetter(name)
+
+ def warned(self):
+ warnings.warn(warning, stacklevel=2)
+ return getter(self)
+
+ return property(getter if warning is None else warned, doc="alias for " + name)
+
+
+def istestfunc(func):
+ return (
+ hasattr(func, "__call__")
+ and getattr(func, "__name__", "<lambda>") != "<lambda>"
+ )
+
+
+def get_empty_parameterset_mark(config, argnames, func):
+ from ..nodes import Collector
+
+ requested_mark = config.getini(EMPTY_PARAMETERSET_OPTION)
+ if requested_mark in ("", None, "skip"):
+ mark = MARK_GEN.skip
+ elif requested_mark == "xfail":
+ mark = MARK_GEN.xfail(run=False)
+ elif requested_mark == "fail_at_collect":
+ f_name = func.__name__
+ _, lineno = getfslineno(func)
+ raise Collector.CollectError(
+ "Empty parameter set in '%s' at line %d" % (f_name, lineno + 1)
+ )
+ else:
+ raise LookupError(requested_mark)
+ fs, lineno = getfslineno(func)
+ reason = "got empty parameter set %r, function %s at %s:%d" % (
+ argnames,
+ func.__name__,
+ fs,
+ lineno,
+ )
+ return mark(reason=reason)
+
+
+class ParameterSet(namedtuple("ParameterSet", "values, marks, id")):
+ @classmethod
+ def param(cls, *values, **kwargs):
+ marks = kwargs.pop("marks", ())
+ if isinstance(marks, MarkDecorator):
+ marks = (marks,)
+ else:
+ assert isinstance(marks, (tuple, list, set))
+
+ id_ = kwargs.pop("id", None)
+ if id_ is not None:
+ if not isinstance(id_, six.string_types):
+ raise TypeError(
+ "Expected id to be a string, got {}: {!r}".format(type(id_), id_)
+ )
+ id_ = ascii_escaped(id_)
+
+ if kwargs:
+ warnings.warn(
+ PYTEST_PARAM_UNKNOWN_KWARGS.format(args=sorted(kwargs)), stacklevel=3
+ )
+ return cls(values, marks, id_)
+
+ @classmethod
+ def extract_from(cls, parameterset, force_tuple=False):
+ """
+ :param parameterset:
+ a legacy style parameterset that may or may not be a tuple,
+ and may or may not be wrapped into a mess of mark objects
+
+ :param force_tuple:
+ enforce tuple wrapping so single argument tuple values
+ don't get decomposed and break tests
+ """
+
+ if isinstance(parameterset, cls):
+ return parameterset
+ if force_tuple:
+ return cls.param(parameterset)
+ else:
+ return cls(parameterset, marks=[], id=None)
+
+ @staticmethod
+ def _parse_parametrize_args(argnames, argvalues, *args, **kwargs):
+ if not isinstance(argnames, (tuple, list)):
+ argnames = [x.strip() for x in argnames.split(",") if x.strip()]
+ force_tuple = len(argnames) == 1
+ else:
+ force_tuple = False
+ return argnames, force_tuple
+
+ @staticmethod
+ def _parse_parametrize_parameters(argvalues, force_tuple):
+ return [
+ ParameterSet.extract_from(x, force_tuple=force_tuple) for x in argvalues
+ ]
+
+ @classmethod
+ def _for_parametrize(cls, argnames, argvalues, func, config, function_definition):
+ argnames, force_tuple = cls._parse_parametrize_args(argnames, argvalues)
+ parameters = cls._parse_parametrize_parameters(argvalues, force_tuple)
+ del argvalues
+
+ if parameters:
+ # check all parameter sets have the correct number of values
+ for param in parameters:
+ if len(param.values) != len(argnames):
+ msg = (
+ '{nodeid}: in "parametrize" the number of names ({names_len}):\n'
+ " {names}\n"
+ "must be equal to the number of values ({values_len}):\n"
+ " {values}"
+ )
+ fail(
+ msg.format(
+ nodeid=function_definition.nodeid,
+ values=param.values,
+ names=argnames,
+ names_len=len(argnames),
+ values_len=len(param.values),
+ ),
+ pytrace=False,
+ )
+ else:
+ # empty parameter set (likely computed at runtime): create a single
+ # parameter set with NOTSET values, with the "empty parameter set" mark applied to it
+ mark = get_empty_parameterset_mark(config, argnames, func)
+ parameters.append(
+ ParameterSet(values=(NOTSET,) * len(argnames), marks=[mark], id=None)
+ )
+ return argnames, parameters
+
+
+@attr.s(frozen=True)
+class Mark(object):
+ #: name of the mark
+ name = attr.ib(type=str)
+ #: positional arguments of the mark decorator
+ args = attr.ib() # List[object]
+ #: keyword arguments of the mark decorator
+ kwargs = attr.ib() # Dict[str, object]
+
+ def combined_with(self, other):
+ """
+ :param other: the mark to combine with
+ :type other: Mark
+ :rtype: Mark
+
+ combines by appending args and merging the mappings
+ """
+ assert self.name == other.name
+ return Mark(
+ self.name, self.args + other.args, dict(self.kwargs, **other.kwargs)
+ )
+
+
+@attr.s
+class MarkDecorator(object):
+ """ A decorator for test functions and test classes. When applied
+ it will create :class:`MarkInfo` objects which may be
+ :ref:`retrieved by hooks as item keywords <excontrolskip>`.
+ MarkDecorator instances are often created like this::
+
+ mark1 = pytest.mark.NAME # simple MarkDecorator
+ mark2 = pytest.mark.NAME(name1=value) # parametrized MarkDecorator
+
+ and can then be applied as decorators to test functions::
+
+ @mark2
+ def test_function():
+ pass
+
+ When a MarkDecorator instance is called it does the following:
+ 1. If called with a single class as its only positional argument and no
+ additional keyword arguments, it attaches itself to the class so it
+ gets applied automatically to all test cases found in that class.
+ 2. If called with a single function as its only positional argument and
+ no additional keyword arguments, it attaches a MarkInfo object to the
+ function, containing all the arguments already stored internally in
+ the MarkDecorator.
+ 3. When called in any other case, it performs a 'fake construction' call,
+ i.e. it returns a new MarkDecorator instance with the original
+ MarkDecorator's content updated with the arguments passed to this
+ call.
+
+ Note: The rules above prevent MarkDecorator objects from storing only a
+ single function or class reference as their positional argument with no
+ additional keyword or positional arguments.
+
+ """
+
+ mark = attr.ib(validator=attr.validators.instance_of(Mark))
+
+ name = alias("mark.name")
+ args = alias("mark.args")
+ kwargs = alias("mark.kwargs")
+
+ @property
+ def markname(self):
+ return self.name # for backward-compat (2.4.1 had this attr)
+
+ def __eq__(self, other):
+ return self.mark == other.mark if isinstance(other, MarkDecorator) else False
+
+ def __repr__(self):
+ return "<MarkDecorator %r>" % (self.mark,)
+
+ def with_args(self, *args, **kwargs):
+ """ return a MarkDecorator with extra arguments added
+
+ unlike call this can be used even if the sole argument is a callable/class
+
+ :return: MarkDecorator
+ """
+
+ mark = Mark(self.name, args, kwargs)
+ return self.__class__(self.mark.combined_with(mark))
+
+ def __call__(self, *args, **kwargs):
+ """ if passed a single callable argument: decorate it with mark info.
+ otherwise add *args/**kwargs in-place to mark information. """
+ if args and not kwargs:
+ func = args[0]
+ is_class = inspect.isclass(func)
+ if len(args) == 1 and (istestfunc(func) or is_class):
+ store_mark(func, self.mark)
+ return func
+ return self.with_args(*args, **kwargs)
+
+
+def get_unpacked_marks(obj):
+ """
+ obtain the unpacked marks that are stored on an object
+ """
+ mark_list = getattr(obj, "pytestmark", [])
+ if not isinstance(mark_list, list):
+ mark_list = [mark_list]
+ return normalize_mark_list(mark_list)
+
+
+def normalize_mark_list(mark_list):
+ """
+ normalizes marker decorating helpers to mark objects
+
+ :type mark_list: List[Union[Mark, Markdecorator]]
+ :rtype: List[Mark]
+ """
+ extracted = [
+ getattr(mark, "mark", mark) for mark in mark_list
+ ] # unpack MarkDecorator
+ for mark in extracted:
+ if not isinstance(mark, Mark):
+ raise TypeError("got {!r} instead of Mark".format(mark))
+ return [x for x in extracted if isinstance(x, Mark)]
+
+
+def store_mark(obj, mark):
+ """store a Mark on an object
+ this is used to implement the Mark declarations/decorators correctly
+ """
+ assert isinstance(mark, Mark), mark
+ # always reassign name to avoid updating pytestmark
+ # in a reference that was only borrowed
+ obj.pytestmark = get_unpacked_marks(obj) + [mark]
+
+
+class MarkGenerator(object):
+ """ Factory for :class:`MarkDecorator` objects - exposed as
+ a ``pytest.mark`` singleton instance. Example::
+
+ import pytest
+ @pytest.mark.slowtest
+ def test_function():
+ pass
+
+ will set a 'slowtest' :class:`MarkInfo` object
+ on the ``test_function`` object. """
+
+ _config = None
+ _markers = set()
+
+ def __getattr__(self, name):
+ if name[0] == "_":
+ raise AttributeError("Marker name must NOT start with underscore")
+
+ if self._config is not None:
+ # We store a set of markers as a performance optimisation - if a mark
+ # name is in the set we definitely know it, but a mark may be known and
+ # not in the set. We therefore start by updating the set!
+ if name not in self._markers:
+ for line in self._config.getini("markers"):
+ # example lines: "skipif(condition): skip the given test if..."
+ # or "hypothesis: tests which use Hypothesis", so to get the
+ # marker name we split on both `:` and `(`.
+ if line == "ya:external":
+ marker = line
+ else:
+ marker = line.split(":")[0].split("(")[0].strip()
+ self._markers.add(marker)
+
+ # If the name is not in the set of known marks after updating,
+ # then it really is time to issue a warning or an error.
+ if name not in self._markers:
+ if self._config.option.strict_markers:
+ fail(
+ "{!r} not found in `markers` configuration option".format(name),
+ pytrace=False,
+ )
+ else:
+ warnings.warn(
+ "Unknown pytest.mark.%s - is this a typo? You can register "
+ "custom marks to avoid this warning - for details, see "
+ "https://docs.pytest.org/en/latest/mark.html" % name,
+ PytestUnknownMarkWarning,
+ )
+
+ return MarkDecorator(Mark(name, (), {}))
+
+
+MARK_GEN = MarkGenerator()
+
+
+class NodeKeywords(MappingMixin):
+ def __init__(self, node):
+ self.node = node
+ self.parent = node.parent
+ self._markers = {node.name: True}
+
+ def __getitem__(self, key):
+ try:
+ return self._markers[key]
+ except KeyError:
+ if self.parent is None:
+ raise
+ return self.parent.keywords[key]
+
+ def __setitem__(self, key, value):
+ self._markers[key] = value
+
+ def __delitem__(self, key):
+ raise ValueError("cannot delete key in keywords dict")
+
+ def __iter__(self):
+ seen = self._seen()
+ return iter(seen)
+
+ def _seen(self):
+ seen = set(self._markers)
+ if self.parent is not None:
+ seen.update(self.parent.keywords)
+ return seen
+
+ def __len__(self):
+ return len(self._seen())
+
+ def __repr__(self):
+ return "<NodeKeywords for node %s>" % (self.node,)
+
+
+# mypy cannot find this overload, remove when on attrs>=19.2
+@attr.s(hash=False, **{ATTRS_EQ_FIELD: False}) # type: ignore
+class NodeMarkers(object):
+ """
+ internal structure for storing marks belonging to a node
+
+ ..warning::
+
+ unstable api
+
+ """
+
+ own_markers = attr.ib(default=attr.Factory(list))
+
+ def update(self, add_markers):
+ """update the own markers
+ """
+ self.own_markers.extend(add_markers)
+
+ def find(self, name):
+ """
+ find markers in own nodes or parent nodes
+ needs a better place
+ """
+ for mark in self.own_markers:
+ if mark.name == name:
+ yield mark
+
+ def __iter__(self):
+ return iter(self.own_markers)
diff --git a/contrib/python/pytest/py2/_pytest/monkeypatch.py b/contrib/python/pytest/py2/_pytest/monkeypatch.py
new file mode 100644
index 00000000000..e8671b0c702
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/monkeypatch.py
@@ -0,0 +1,336 @@
+# -*- coding: utf-8 -*-
+""" monkeypatching and mocking functionality. """
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import os
+import re
+import sys
+import warnings
+from contextlib import contextmanager
+
+import six
+
+import pytest
+from _pytest.fixtures import fixture
+from _pytest.pathlib import Path
+
+RE_IMPORT_ERROR_NAME = re.compile(r"^No module named (.*)$")
+
+
+@fixture
+def monkeypatch():
+ """The returned ``monkeypatch`` fixture provides these
+ helper methods to modify objects, dictionaries or os.environ::
+
+ monkeypatch.setattr(obj, name, value, raising=True)
+ monkeypatch.delattr(obj, name, raising=True)
+ monkeypatch.setitem(mapping, name, value)
+ monkeypatch.delitem(obj, name, raising=True)
+ monkeypatch.setenv(name, value, prepend=False)
+ monkeypatch.delenv(name, raising=True)
+ monkeypatch.syspath_prepend(path)
+ monkeypatch.chdir(path)
+
+ All modifications will be undone after the requesting
+ test function or fixture has finished. The ``raising``
+ parameter determines if a KeyError or AttributeError
+ will be raised if the set/deletion operation has no target.
+ """
+ mpatch = MonkeyPatch()
+ yield mpatch
+ mpatch.undo()
+
+
+def resolve(name):
+ # simplified from zope.dottedname
+ parts = name.split(".")
+
+ used = parts.pop(0)
+ found = __import__(used)
+ for part in parts:
+ used += "." + part
+ try:
+ found = getattr(found, part)
+ except AttributeError:
+ pass
+ else:
+ continue
+ # we use explicit un-nesting of the handling block in order
+ # to avoid nested exceptions on python 3
+ try:
+ __import__(used)
+ except ImportError as ex:
+ # str is used for py2 vs py3
+ expected = str(ex).split()[-1]
+ if expected == used:
+ raise
+ else:
+ raise ImportError("import error in %s: %s" % (used, ex))
+ found = annotated_getattr(found, part, used)
+ return found
+
+
+def annotated_getattr(obj, name, ann):
+ try:
+ obj = getattr(obj, name)
+ except AttributeError:
+ raise AttributeError(
+ "%r object at %s has no attribute %r" % (type(obj).__name__, ann, name)
+ )
+ return obj
+
+
+def derive_importpath(import_path, raising):
+ if not isinstance(import_path, six.string_types) or "." not in import_path:
+ raise TypeError("must be absolute import path string, not %r" % (import_path,))
+ module, attr = import_path.rsplit(".", 1)
+ target = resolve(module)
+ if raising:
+ annotated_getattr(target, attr, ann=module)
+ return attr, target
+
+
+class Notset(object):
+ def __repr__(self):
+ return "<notset>"
+
+
+notset = Notset()
+
+
+class MonkeyPatch(object):
+ """ Object returned by the ``monkeypatch`` fixture keeping a record of setattr/item/env/syspath changes.
+ """
+
+ def __init__(self):
+ self._setattr = []
+ self._setitem = []
+ self._cwd = None
+ self._savesyspath = None
+
+ @contextmanager
+ def context(self):
+ """
+ Context manager that returns a new :class:`MonkeyPatch` object which
+ undoes any patching done inside the ``with`` block upon exit:
+
+ .. code-block:: python
+
+ import functools
+ def test_partial(monkeypatch):
+ with monkeypatch.context() as m:
+ m.setattr(functools, "partial", 3)
+
+ Useful in situations where it is desired to undo some patches before the test ends,
+ such as mocking ``stdlib`` functions that might break pytest itself if mocked (for examples
+ of this see `#3290 <https://github.com/pytest-dev/pytest/issues/3290>`_.
+ """
+ m = MonkeyPatch()
+ try:
+ yield m
+ finally:
+ m.undo()
+
+ def setattr(self, target, name, value=notset, raising=True):
+ """ Set attribute value on target, memorizing the old value.
+ By default raise AttributeError if the attribute did not exist.
+
+ For convenience you can specify a string as ``target`` which
+ will be interpreted as a dotted import path, with the last part
+ being the attribute name. Example:
+ ``monkeypatch.setattr("os.getcwd", lambda: "/")``
+ would set the ``getcwd`` function of the ``os`` module.
+
+ The ``raising`` value determines if the setattr should fail
+ if the attribute is not already present (defaults to True
+ which means it will raise).
+ """
+ __tracebackhide__ = True
+ import inspect
+
+ if value is notset:
+ if not isinstance(target, six.string_types):
+ raise TypeError(
+ "use setattr(target, name, value) or "
+ "setattr(target, value) with target being a dotted "
+ "import string"
+ )
+ value = name
+ name, target = derive_importpath(target, raising)
+
+ oldval = getattr(target, name, notset)
+ if raising and oldval is notset:
+ raise AttributeError("%r has no attribute %r" % (target, name))
+
+ # avoid class descriptors like staticmethod/classmethod
+ if inspect.isclass(target):
+ oldval = target.__dict__.get(name, notset)
+ self._setattr.append((target, name, oldval))
+ setattr(target, name, value)
+
+ def delattr(self, target, name=notset, raising=True):
+ """ Delete attribute ``name`` from ``target``, by default raise
+ AttributeError it the attribute did not previously exist.
+
+ If no ``name`` is specified and ``target`` is a string
+ it will be interpreted as a dotted import path with the
+ last part being the attribute name.
+
+ If ``raising`` is set to False, no exception will be raised if the
+ attribute is missing.
+ """
+ __tracebackhide__ = True
+ import inspect
+
+ if name is notset:
+ if not isinstance(target, six.string_types):
+ raise TypeError(
+ "use delattr(target, name) or "
+ "delattr(target) with target being a dotted "
+ "import string"
+ )
+ name, target = derive_importpath(target, raising)
+
+ if not hasattr(target, name):
+ if raising:
+ raise AttributeError(name)
+ else:
+ oldval = getattr(target, name, notset)
+ # Avoid class descriptors like staticmethod/classmethod.
+ if inspect.isclass(target):
+ oldval = target.__dict__.get(name, notset)
+ self._setattr.append((target, name, oldval))
+ delattr(target, name)
+
+ def setitem(self, dic, name, value):
+ """ Set dictionary entry ``name`` to value. """
+ self._setitem.append((dic, name, dic.get(name, notset)))
+ dic[name] = value
+
+ def delitem(self, dic, name, raising=True):
+ """ Delete ``name`` from dict. Raise KeyError if it doesn't exist.
+
+ If ``raising`` is set to False, no exception will be raised if the
+ key is missing.
+ """
+ if name not in dic:
+ if raising:
+ raise KeyError(name)
+ else:
+ self._setitem.append((dic, name, dic.get(name, notset)))
+ del dic[name]
+
+ def _warn_if_env_name_is_not_str(self, name):
+ """On Python 2, warn if the given environment variable name is not a native str (#4056)"""
+ if six.PY2 and not isinstance(name, str):
+ warnings.warn(
+ pytest.PytestWarning(
+ "Environment variable name {!r} should be str".format(name)
+ )
+ )
+
+ def setenv(self, name, value, prepend=None):
+ """ Set environment variable ``name`` to ``value``. If ``prepend``
+ is a character, read the current environment variable value
+ and prepend the ``value`` adjoined with the ``prepend`` character."""
+ if not isinstance(value, str):
+ warnings.warn(
+ pytest.PytestWarning(
+ "Value of environment variable {name} type should be str, but got "
+ "{value!r} (type: {type}); converted to str implicitly".format(
+ name=name, value=value, type=type(value).__name__
+ )
+ ),
+ stacklevel=2,
+ )
+ value = str(value)
+ if prepend and name in os.environ:
+ value = value + prepend + os.environ[name]
+ self._warn_if_env_name_is_not_str(name)
+ self.setitem(os.environ, name, value)
+
+ def delenv(self, name, raising=True):
+ """ Delete ``name`` from the environment. Raise KeyError if it does
+ not exist.
+
+ If ``raising`` is set to False, no exception will be raised if the
+ environment variable is missing.
+ """
+ self._warn_if_env_name_is_not_str(name)
+ self.delitem(os.environ, name, raising=raising)
+
+ def syspath_prepend(self, path):
+ """ Prepend ``path`` to ``sys.path`` list of import locations. """
+ from pkg_resources import fixup_namespace_packages
+
+ if self._savesyspath is None:
+ self._savesyspath = sys.path[:]
+ sys.path.insert(0, str(path))
+
+ # https://github.com/pypa/setuptools/blob/d8b901bc/docs/pkg_resources.txt#L162-L171
+ fixup_namespace_packages(str(path))
+
+ # A call to syspathinsert() usually means that the caller wants to
+ # import some dynamically created files, thus with python3 we
+ # invalidate its import caches.
+ # This is especially important when any namespace package is in used,
+ # since then the mtime based FileFinder cache (that gets created in
+ # this case already) gets not invalidated when writing the new files
+ # quickly afterwards.
+ if sys.version_info >= (3, 3):
+ from importlib import invalidate_caches
+
+ invalidate_caches()
+
+ def chdir(self, path):
+ """ Change the current working directory to the specified path.
+ Path can be a string or a py.path.local object.
+ """
+ if self._cwd is None:
+ self._cwd = os.getcwd()
+ if hasattr(path, "chdir"):
+ path.chdir()
+ elif isinstance(path, Path):
+ # modern python uses the fspath protocol here LEGACY
+ os.chdir(str(path))
+ else:
+ os.chdir(path)
+
+ def undo(self):
+ """ Undo previous changes. This call consumes the
+ undo stack. Calling it a second time has no effect unless
+ you do more monkeypatching after the undo call.
+
+ There is generally no need to call `undo()`, since it is
+ called automatically during tear-down.
+
+ Note that the same `monkeypatch` fixture is used across a
+ single test function invocation. If `monkeypatch` is used both by
+ the test function itself and one of the test fixtures,
+ calling `undo()` will undo all of the changes made in
+ both functions.
+ """
+ for obj, name, value in reversed(self._setattr):
+ if value is not notset:
+ setattr(obj, name, value)
+ else:
+ delattr(obj, name)
+ self._setattr[:] = []
+ for dictionary, name, value in reversed(self._setitem):
+ if value is notset:
+ try:
+ del dictionary[name]
+ except KeyError:
+ pass # was already deleted, so we have the desired state
+ else:
+ dictionary[name] = value
+ self._setitem[:] = []
+ if self._savesyspath is not None:
+ sys.path[:] = self._savesyspath
+ self._savesyspath = None
+
+ if self._cwd is not None:
+ os.chdir(self._cwd)
+ self._cwd = None
diff --git a/contrib/python/pytest/py2/_pytest/nodes.py b/contrib/python/pytest/py2/_pytest/nodes.py
new file mode 100644
index 00000000000..206e9ae163e
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/nodes.py
@@ -0,0 +1,429 @@
+# -*- coding: utf-8 -*-
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import os
+import warnings
+
+import py
+import six
+
+import _pytest._code
+from _pytest.compat import getfslineno
+from _pytest.mark.structures import NodeKeywords
+from _pytest.outcomes import fail
+
+SEP = "/"
+
+tracebackcutdir = py.path.local(_pytest.__file__).dirpath()
+
+
+def _splitnode(nodeid):
+ """Split a nodeid into constituent 'parts'.
+
+ Node IDs are strings, and can be things like:
+ ''
+ 'testing/code'
+ 'testing/code/test_excinfo.py'
+ 'testing/code/test_excinfo.py::TestFormattedExcinfo'
+
+ Return values are lists e.g.
+ []
+ ['testing', 'code']
+ ['testing', 'code', 'test_excinfo.py']
+ ['testing', 'code', 'test_excinfo.py', 'TestFormattedExcinfo', '()']
+ """
+ if nodeid == "":
+ # If there is no root node at all, return an empty list so the caller's logic can remain sane
+ return []
+ parts = nodeid.split(SEP)
+ # Replace single last element 'test_foo.py::Bar' with multiple elements 'test_foo.py', 'Bar'
+ parts[-1:] = parts[-1].split("::")
+ return parts
+
+
+def ischildnode(baseid, nodeid):
+ """Return True if the nodeid is a child node of the baseid.
+
+ E.g. 'foo/bar::Baz' is a child of 'foo', 'foo/bar' and 'foo/bar::Baz', but not of 'foo/blorp'
+ """
+ base_parts = _splitnode(baseid)
+ node_parts = _splitnode(nodeid)
+ if len(node_parts) < len(base_parts):
+ return False
+ return node_parts[: len(base_parts)] == base_parts
+
+
+class Node(object):
+ """ base class for Collector and Item the test collection tree.
+ Collector subclasses have children, Items are terminal nodes."""
+
+ def __init__(
+ self, name, parent=None, config=None, session=None, fspath=None, nodeid=None
+ ):
+ #: a unique name within the scope of the parent node
+ self.name = name
+
+ #: the parent collector node.
+ self.parent = parent
+
+ #: the pytest config object
+ self.config = config or parent.config
+
+ #: the session this node is part of
+ self.session = session or parent.session
+
+ #: filesystem path where this node was collected from (can be None)
+ self.fspath = fspath or getattr(parent, "fspath", None)
+
+ #: keywords/markers collected from all scopes
+ self.keywords = NodeKeywords(self)
+
+ #: the marker objects belonging to this node
+ self.own_markers = []
+
+ #: allow adding of extra keywords to use for matching
+ self.extra_keyword_matches = set()
+
+ # used for storing artificial fixturedefs for direct parametrization
+ self._name2pseudofixturedef = {}
+
+ if nodeid is not None:
+ assert "::()" not in nodeid
+ self._nodeid = nodeid
+ else:
+ self._nodeid = self.parent.nodeid
+ if self.name != "()":
+ self._nodeid += "::" + self.name
+
+ @property
+ def ihook(self):
+ """ fspath sensitive hook proxy used to call pytest hooks"""
+ return self.session.gethookproxy(self.fspath)
+
+ def __repr__(self):
+ return "<%s %s>" % (self.__class__.__name__, getattr(self, "name", None))
+
+ def warn(self, warning):
+ """Issue a warning for this item.
+
+ Warnings will be displayed after the test session, unless explicitly suppressed
+
+ :param Warning warning: the warning instance to issue. Must be a subclass of PytestWarning.
+
+ :raise ValueError: if ``warning`` instance is not a subclass of PytestWarning.
+
+ Example usage:
+
+ .. code-block:: python
+
+ node.warn(PytestWarning("some message"))
+
+ """
+ from _pytest.warning_types import PytestWarning
+
+ if not isinstance(warning, PytestWarning):
+ raise ValueError(
+ "warning must be an instance of PytestWarning or subclass, got {!r}".format(
+ warning
+ )
+ )
+ path, lineno = get_fslocation_from_item(self)
+ warnings.warn_explicit(
+ warning,
+ category=None,
+ filename=str(path),
+ lineno=lineno + 1 if lineno is not None else None,
+ )
+
+ # methods for ordering nodes
+ @property
+ def nodeid(self):
+ """ a ::-separated string denoting its collection tree address. """
+ return self._nodeid
+
+ def __hash__(self):
+ return hash(self.nodeid)
+
+ def setup(self):
+ pass
+
+ def teardown(self):
+ pass
+
+ def listchain(self):
+ """ return list of all parent collectors up to self,
+ starting from root of collection tree. """
+ chain = []
+ item = self
+ while item is not None:
+ chain.append(item)
+ item = item.parent
+ chain.reverse()
+ return chain
+
+ def add_marker(self, marker, append=True):
+ """dynamically add a marker object to the node.
+
+ :type marker: ``str`` or ``pytest.mark.*`` object
+ :param marker:
+ ``append=True`` whether to append the marker,
+ if ``False`` insert at position ``0``.
+ """
+ from _pytest.mark import MarkDecorator, MARK_GEN
+
+ if isinstance(marker, six.string_types):
+ marker = getattr(MARK_GEN, marker)
+ elif not isinstance(marker, MarkDecorator):
+ raise ValueError("is not a string or pytest.mark.* Marker")
+ self.keywords[marker.name] = marker
+ if append:
+ self.own_markers.append(marker.mark)
+ else:
+ self.own_markers.insert(0, marker.mark)
+
+ def iter_markers(self, name=None):
+ """
+ :param name: if given, filter the results by the name attribute
+
+ iterate over all markers of the node
+ """
+ return (x[1] for x in self.iter_markers_with_node(name=name))
+
+ def iter_markers_with_node(self, name=None):
+ """
+ :param name: if given, filter the results by the name attribute
+
+ iterate over all markers of the node
+ returns sequence of tuples (node, mark)
+ """
+ for node in reversed(self.listchain()):
+ for mark in node.own_markers:
+ if name is None or getattr(mark, "name", None) == name:
+ yield node, mark
+
+ def get_closest_marker(self, name, default=None):
+ """return the first marker matching the name, from closest (for example function) to farther level (for example
+ module level).
+
+ :param default: fallback return value of no marker was found
+ :param name: name to filter by
+ """
+ return next(self.iter_markers(name=name), default)
+
+ def listextrakeywords(self):
+ """ Return a set of all extra keywords in self and any parents."""
+ extra_keywords = set()
+ for item in self.listchain():
+ extra_keywords.update(item.extra_keyword_matches)
+ return extra_keywords
+
+ def listnames(self):
+ return [x.name for x in self.listchain()]
+
+ def addfinalizer(self, fin):
+ """ register a function to be called when this node is finalized.
+
+ This method can only be called when this node is active
+ in a setup chain, for example during self.setup().
+ """
+ self.session._setupstate.addfinalizer(fin, self)
+
+ def getparent(self, cls):
+ """ get the next parent node (including ourself)
+ which is an instance of the given class"""
+ current = self
+ while current and not isinstance(current, cls):
+ current = current.parent
+ return current
+
+ def _prunetraceback(self, excinfo):
+ pass
+
+ def _repr_failure_py(self, excinfo, style=None):
+ if excinfo.errisinstance(fail.Exception):
+ if not excinfo.value.pytrace:
+ return six.text_type(excinfo.value)
+ fm = self.session._fixturemanager
+ if excinfo.errisinstance(fm.FixtureLookupError):
+ return excinfo.value.formatrepr()
+ tbfilter = True
+ if self.config.getoption("fulltrace", False):
+ style = "long"
+ else:
+ tb = _pytest._code.Traceback([excinfo.traceback[-1]])
+ self._prunetraceback(excinfo)
+ if len(excinfo.traceback) == 0:
+ excinfo.traceback = tb
+ tbfilter = False # prunetraceback already does it
+ if style == "auto":
+ style = "long"
+ # XXX should excinfo.getrepr record all data and toterminal() process it?
+ if style is None:
+ if self.config.getoption("tbstyle", "auto") == "short":
+ style = "short"
+ else:
+ style = "long"
+
+ if self.config.getoption("verbose", 0) > 1:
+ truncate_locals = False
+ else:
+ truncate_locals = True
+
+ try:
+ os.getcwd()
+ abspath = False
+ except OSError:
+ abspath = True
+
+ return excinfo.getrepr(
+ funcargs=True,
+ abspath=abspath,
+ showlocals=self.config.getoption("showlocals", False),
+ style=style,
+ tbfilter=tbfilter,
+ truncate_locals=truncate_locals,
+ )
+
+ repr_failure = _repr_failure_py
+
+
+def get_fslocation_from_item(item):
+ """Tries to extract the actual location from an item, depending on available attributes:
+
+ * "fslocation": a pair (path, lineno)
+ * "obj": a Python object that the item wraps.
+ * "fspath": just a path
+
+ :rtype: a tuple of (str|LocalPath, int) with filename and line number.
+ """
+ result = getattr(item, "location", None)
+ if result is not None:
+ return result[:2]
+ obj = getattr(item, "obj", None)
+ if obj is not None:
+ return getfslineno(obj)
+ return getattr(item, "fspath", "unknown location"), -1
+
+
+class Collector(Node):
+ """ Collector instances create children through collect()
+ and thus iteratively build a tree.
+ """
+
+ class CollectError(Exception):
+ """ an error during collection, contains a custom message. """
+
+ def collect(self):
+ """ returns a list of children (items and collectors)
+ for this collection node.
+ """
+ raise NotImplementedError("abstract")
+
+ def repr_failure(self, excinfo):
+ """ represent a collection failure. """
+ if excinfo.errisinstance(self.CollectError):
+ exc = excinfo.value
+ return str(exc.args[0])
+
+ # Respect explicit tbstyle option, but default to "short"
+ # (None._repr_failure_py defaults to "long" without "fulltrace" option).
+ tbstyle = self.config.getoption("tbstyle", "auto")
+ if tbstyle == "auto":
+ tbstyle = "short"
+
+ return self._repr_failure_py(excinfo, style=tbstyle)
+
+ def _prunetraceback(self, excinfo):
+ if hasattr(self, "fspath"):
+ traceback = excinfo.traceback
+ ntraceback = traceback.cut(path=self.fspath)
+ if ntraceback == traceback:
+ ntraceback = ntraceback.cut(excludepath=tracebackcutdir)
+ excinfo.traceback = ntraceback.filter()
+
+
+def _check_initialpaths_for_relpath(session, fspath):
+ for initial_path in session._initialpaths:
+ if fspath.common(initial_path) == initial_path:
+ return fspath.relto(initial_path)
+
+
+class FSCollector(Collector):
+ def __init__(self, fspath, parent=None, config=None, session=None, nodeid=None):
+ fspath = py.path.local(fspath) # xxx only for test_resultlog.py?
+ name = fspath.basename
+ if parent is not None:
+ rel = fspath.relto(parent.fspath)
+ if rel:
+ name = rel
+ name = name.replace(os.sep, SEP)
+ self.fspath = fspath
+
+ session = session or parent.session
+
+ if nodeid is None:
+ nodeid = self.fspath.relto(session.config.rootdir)
+
+ if not nodeid:
+ nodeid = _check_initialpaths_for_relpath(session, fspath)
+ if nodeid and os.sep != SEP:
+ nodeid = nodeid.replace(os.sep, SEP)
+
+ super(FSCollector, self).__init__(
+ name, parent, config, session, nodeid=nodeid, fspath=fspath
+ )
+
+
+class File(FSCollector):
+ """ base class for collecting tests from a file. """
+
+
+class Item(Node):
+ """ a basic test invocation item. Note that for a single function
+ there might be multiple test invocation items.
+ """
+
+ nextitem = None
+
+ def __init__(self, name, parent=None, config=None, session=None, nodeid=None):
+ super(Item, self).__init__(name, parent, config, session, nodeid=nodeid)
+ self._report_sections = []
+
+ #: user properties is a list of tuples (name, value) that holds user
+ #: defined properties for this test.
+ self.user_properties = []
+
+ def add_report_section(self, when, key, content):
+ """
+ Adds a new report section, similar to what's done internally to add stdout and
+ stderr captured output::
+
+ item.add_report_section("call", "stdout", "report section contents")
+
+ :param str when:
+ One of the possible capture states, ``"setup"``, ``"call"``, ``"teardown"``.
+ :param str key:
+ Name of the section, can be customized at will. Pytest uses ``"stdout"`` and
+ ``"stderr"`` internally.
+
+ :param str content:
+ The full contents as a string.
+ """
+ if content:
+ self._report_sections.append((when, key, content))
+
+ def reportinfo(self):
+ return self.fspath, None, ""
+
+ @property
+ def location(self):
+ try:
+ return self._location
+ except AttributeError:
+ location = self.reportinfo()
+ fspath = self.session._node_location_to_relpath(location[0])
+ location = (fspath, location[1], str(location[2]))
+ self._location = location
+ return location
diff --git a/contrib/python/pytest/py2/_pytest/nose.py b/contrib/python/pytest/py2/_pytest/nose.py
new file mode 100644
index 00000000000..fbab91da249
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/nose.py
@@ -0,0 +1,70 @@
+# -*- coding: utf-8 -*-
+""" run test suites written for nose. """
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import sys
+
+import six
+
+import pytest
+from _pytest import python
+from _pytest import runner
+from _pytest import unittest
+from _pytest.config import hookimpl
+
+
+def get_skip_exceptions():
+ skip_classes = set()
+ for module_name in ("unittest", "unittest2", "nose"):
+ mod = sys.modules.get(module_name)
+ if hasattr(mod, "SkipTest"):
+ skip_classes.add(mod.SkipTest)
+ return tuple(skip_classes)
+
+
+def pytest_runtest_makereport(item, call):
+ if call.excinfo and call.excinfo.errisinstance(get_skip_exceptions()):
+ # let's substitute the excinfo with a pytest.skip one
+ call2 = runner.CallInfo.from_call(
+ lambda: pytest.skip(six.text_type(call.excinfo.value)), call.when
+ )
+ call.excinfo = call2.excinfo
+
+
+@hookimpl(trylast=True)
+def pytest_runtest_setup(item):
+ if is_potential_nosetest(item):
+ if not call_optional(item.obj, "setup"):
+ # call module level setup if there is no object level one
+ call_optional(item.parent.obj, "setup")
+ # XXX this implies we only call teardown when setup worked
+ item.session._setupstate.addfinalizer((lambda: teardown_nose(item)), item)
+
+
+def teardown_nose(item):
+ if is_potential_nosetest(item):
+ if not call_optional(item.obj, "teardown"):
+ call_optional(item.parent.obj, "teardown")
+ # if hasattr(item.parent, '_nosegensetup'):
+ # #call_optional(item._nosegensetup, 'teardown')
+ # del item.parent._nosegensetup
+
+
+def is_potential_nosetest(item):
+ # extra check needed since we do not do nose style setup/teardown
+ # on direct unittest style classes
+ return isinstance(item, python.Function) and not isinstance(
+ item, unittest.TestCaseFunction
+ )
+
+
+def call_optional(obj, name):
+ method = getattr(obj, name, None)
+ isfixture = hasattr(method, "_pytestfixturefunction")
+ if method is not None and not isfixture and callable(method):
+ # If there's any problems allow the exception to raise rather than
+ # silently ignoring them
+ method()
+ return True
diff --git a/contrib/python/pytest/py2/_pytest/outcomes.py b/contrib/python/pytest/py2/_pytest/outcomes.py
new file mode 100644
index 00000000000..4620f957c7d
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/outcomes.py
@@ -0,0 +1,187 @@
+# -*- coding: utf-8 -*-
+"""
+exception classes and constants handling test outcomes
+as well as functions creating them
+"""
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import sys
+
+from packaging.version import Version
+
+
+class OutcomeException(BaseException):
+ """ OutcomeException and its subclass instances indicate and
+ contain info about test and collection outcomes.
+ """
+
+ def __init__(self, msg=None, pytrace=True):
+ BaseException.__init__(self, msg)
+ self.msg = msg
+ self.pytrace = pytrace
+
+ def __repr__(self):
+ if self.msg:
+ val = self.msg
+ if isinstance(val, bytes):
+ val = val.decode("UTF-8", errors="replace")
+ return val
+ return "<%s instance>" % (self.__class__.__name__,)
+
+ __str__ = __repr__
+
+
+TEST_OUTCOME = (OutcomeException, Exception)
+
+
+class Skipped(OutcomeException):
+ # XXX hackish: on 3k we fake to live in the builtins
+ # in order to have Skipped exception printing shorter/nicer
+ __module__ = "builtins"
+
+ def __init__(self, msg=None, pytrace=True, allow_module_level=False):
+ OutcomeException.__init__(self, msg=msg, pytrace=pytrace)
+ self.allow_module_level = allow_module_level
+
+
+class Failed(OutcomeException):
+ """ raised from an explicit call to pytest.fail() """
+
+ __module__ = "builtins"
+
+
+class Exit(Exception):
+ """ raised for immediate program exits (no tracebacks/summaries)"""
+
+ def __init__(self, msg="unknown reason", returncode=None):
+ self.msg = msg
+ self.returncode = returncode
+ super(Exit, self).__init__(msg)
+
+
+# exposed helper methods
+
+
+def exit(msg, returncode=None):
+ """
+ Exit testing process.
+
+ :param str msg: message to display upon exit.
+ :param int returncode: return code to be used when exiting pytest.
+ """
+ __tracebackhide__ = True
+ raise Exit(msg, returncode)
+
+
+exit.Exception = Exit
+
+
+def skip(msg="", **kwargs):
+ """
+ Skip an executing test with the given message.
+
+ This function should be called only during testing (setup, call or teardown) or
+ during collection by using the ``allow_module_level`` flag. This function can
+ be called in doctests as well.
+
+ :kwarg bool allow_module_level: allows this function to be called at
+ module level, skipping the rest of the module. Default to False.
+
+ .. note::
+ It is better to use the :ref:`pytest.mark.skipif ref` marker when possible to declare a test to be
+ skipped under certain conditions like mismatching platforms or
+ dependencies.
+ Similarly, use the ``# doctest: +SKIP`` directive (see `doctest.SKIP
+ <https://docs.python.org/3/library/doctest.html#doctest.SKIP>`_)
+ to skip a doctest statically.
+ """
+ __tracebackhide__ = True
+ allow_module_level = kwargs.pop("allow_module_level", False)
+ if kwargs:
+ raise TypeError("unexpected keyword arguments: {}".format(sorted(kwargs)))
+ raise Skipped(msg=msg, allow_module_level=allow_module_level)
+
+
+skip.Exception = Skipped
+
+
+def fail(msg="", pytrace=True):
+ """
+ Explicitly fail an executing test with the given message.
+
+ :param str msg: the message to show the user as reason for the failure.
+ :param bool pytrace: if false the msg represents the full failure information and no
+ python traceback will be reported.
+ """
+ __tracebackhide__ = True
+ raise Failed(msg=msg, pytrace=pytrace)
+
+
+fail.Exception = Failed
+
+
+class XFailed(fail.Exception):
+ """ raised from an explicit call to pytest.xfail() """
+
+
+def xfail(reason=""):
+ """
+ Imperatively xfail an executing test or setup functions with the given reason.
+
+ This function should be called only during testing (setup, call or teardown).
+
+ .. note::
+ It is better to use the :ref:`pytest.mark.xfail ref` marker when possible to declare a test to be
+ xfailed under certain conditions like known bugs or missing features.
+ """
+ __tracebackhide__ = True
+ raise XFailed(reason)
+
+
+xfail.Exception = XFailed
+
+
+def importorskip(modname, minversion=None, reason=None):
+ """Imports and returns the requested module ``modname``, or skip the current test
+ if the module cannot be imported.
+
+ :param str modname: the name of the module to import
+ :param str minversion: if given, the imported module ``__version__`` attribute must be
+ at least this minimal version, otherwise the test is still skipped.
+ :param str reason: if given, this reason is shown as the message when the module
+ cannot be imported.
+ """
+ import warnings
+
+ __tracebackhide__ = True
+ compile(modname, "", "eval") # to catch syntaxerrors
+ import_exc = None
+
+ with warnings.catch_warnings():
+ # make sure to ignore ImportWarnings that might happen because
+ # of existing directories with the same name we're trying to
+ # import but without a __init__.py file
+ warnings.simplefilter("ignore")
+ try:
+ __import__(modname)
+ except ImportError as exc:
+ # Do not raise chained exception here(#1485)
+ import_exc = exc
+ if import_exc:
+ if reason is None:
+ reason = "could not import %r: %s" % (modname, import_exc)
+ raise Skipped(reason, allow_module_level=True)
+ mod = sys.modules[modname]
+ if minversion is None:
+ return mod
+ verattr = getattr(mod, "__version__", None)
+ if minversion is not None:
+ if verattr is None or Version(verattr) < Version(minversion):
+ raise Skipped(
+ "module %r has __version__ %r, required is: %r"
+ % (modname, verattr, minversion),
+ allow_module_level=True,
+ )
+ return mod
diff --git a/contrib/python/pytest/py2/_pytest/pastebin.py b/contrib/python/pytest/py2/_pytest/pastebin.py
new file mode 100644
index 00000000000..7a3e80231c2
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/pastebin.py
@@ -0,0 +1,110 @@
+# -*- coding: utf-8 -*-
+""" submit failure or test session information to a pastebin service. """
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import sys
+import tempfile
+
+import six
+
+import pytest
+
+
+def pytest_addoption(parser):
+ group = parser.getgroup("terminal reporting")
+ group._addoption(
+ "--pastebin",
+ metavar="mode",
+ action="store",
+ dest="pastebin",
+ default=None,
+ choices=["failed", "all"],
+ help="send failed|all info to bpaste.net pastebin service.",
+ )
+
+
+@pytest.hookimpl(trylast=True)
+def pytest_configure(config):
+ if config.option.pastebin == "all":
+ tr = config.pluginmanager.getplugin("terminalreporter")
+ # if no terminal reporter plugin is present, nothing we can do here;
+ # this can happen when this function executes in a slave node
+ # when using pytest-xdist, for example
+ if tr is not None:
+ # pastebin file will be utf-8 encoded binary file
+ config._pastebinfile = tempfile.TemporaryFile("w+b")
+ oldwrite = tr._tw.write
+
+ def tee_write(s, **kwargs):
+ oldwrite(s, **kwargs)
+ if isinstance(s, six.text_type):
+ s = s.encode("utf-8")
+ config._pastebinfile.write(s)
+
+ tr._tw.write = tee_write
+
+
+def pytest_unconfigure(config):
+ if hasattr(config, "_pastebinfile"):
+ # get terminal contents and delete file
+ config._pastebinfile.seek(0)
+ sessionlog = config._pastebinfile.read()
+ config._pastebinfile.close()
+ del config._pastebinfile
+ # undo our patching in the terminal reporter
+ tr = config.pluginmanager.getplugin("terminalreporter")
+ del tr._tw.__dict__["write"]
+ # write summary
+ tr.write_sep("=", "Sending information to Paste Service")
+ pastebinurl = create_new_paste(sessionlog)
+ tr.write_line("pastebin session-log: %s\n" % pastebinurl)
+
+
+def create_new_paste(contents):
+ """
+ Creates a new paste using bpaste.net service.
+
+ :contents: paste contents as utf-8 encoded bytes
+ :returns: url to the pasted contents
+ """
+ import re
+
+ if sys.version_info < (3, 0):
+ from urllib import urlopen, urlencode
+ else:
+ from urllib.request import urlopen
+ from urllib.parse import urlencode
+
+ params = {"code": contents, "lexer": "text", "expiry": "1week"}
+ url = "https://bpaste.net"
+ response = urlopen(url, data=urlencode(params).encode("ascii")).read()
+ m = re.search(r'href="/raw/(\w+)"', response.decode("utf-8"))
+ if m:
+ return "%s/show/%s" % (url, m.group(1))
+ else:
+ return "bad response: " + response
+
+
+def pytest_terminal_summary(terminalreporter):
+ import _pytest.config
+
+ if terminalreporter.config.option.pastebin != "failed":
+ return
+ tr = terminalreporter
+ if "failed" in tr.stats:
+ terminalreporter.write_sep("=", "Sending information to Paste Service")
+ for rep in terminalreporter.stats.get("failed"):
+ try:
+ msg = rep.longrepr.reprtraceback.reprentries[-1].reprfileloc
+ except AttributeError:
+ msg = tr._getfailureheadline(rep)
+ tw = _pytest.config.create_terminal_writer(
+ terminalreporter.config, stringio=True
+ )
+ rep.toterminal(tw)
+ s = tw.stringio.getvalue()
+ assert len(s)
+ pastebinurl = create_new_paste(s)
+ tr.write_line("%s --> %s" % (msg, pastebinurl))
diff --git a/contrib/python/pytest/py2/_pytest/pathlib.py b/contrib/python/pytest/py2/_pytest/pathlib.py
new file mode 100644
index 00000000000..42071f43104
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/pathlib.py
@@ -0,0 +1,380 @@
+# -*- coding: utf-8 -*-
+from __future__ import absolute_import
+
+import atexit
+import errno
+import fnmatch
+import itertools
+import operator
+import os
+import shutil
+import sys
+import uuid
+import warnings
+from functools import partial
+from functools import reduce
+from os.path import expanduser
+from os.path import expandvars
+from os.path import isabs
+from os.path import sep
+from posixpath import sep as posix_sep
+
+import six
+from six.moves import map
+
+from .compat import PY36
+from _pytest.warning_types import PytestWarning
+
+if PY36:
+ from pathlib import Path, PurePath
+else:
+ from pathlib2 import Path, PurePath
+
+__all__ = ["Path", "PurePath"]
+
+
+LOCK_TIMEOUT = 60 * 60 * 3
+
+get_lock_path = operator.methodcaller("joinpath", ".lock")
+
+
+def ensure_reset_dir(path):
+ """
+ ensures the given path is an empty directory
+ """
+ if path.exists():
+ rm_rf(path)
+ path.mkdir()
+
+
+def on_rm_rf_error(func, path, exc, **kwargs):
+ """Handles known read-only errors during rmtree.
+
+ The returned value is used only by our own tests.
+ """
+ start_path = kwargs["start_path"]
+ exctype, excvalue = exc[:2]
+
+ # another process removed the file in the middle of the "rm_rf" (xdist for example)
+ # more context: https://github.com/pytest-dev/pytest/issues/5974#issuecomment-543799018
+ if isinstance(excvalue, OSError) and excvalue.errno == errno.ENOENT:
+ return False
+
+ if not isinstance(excvalue, OSError) or excvalue.errno not in (
+ errno.EACCES,
+ errno.EPERM,
+ ):
+ warnings.warn(
+ PytestWarning(
+ "(rm_rf) error removing {}\n{}: {}".format(path, exctype, excvalue)
+ )
+ )
+ return False
+
+ if func not in (os.rmdir, os.remove, os.unlink):
+ warnings.warn(
+ PytestWarning(
+ "(rm_rf) unknown function {} when removing {}:\n{}: {}".format(
+ path, func, exctype, excvalue
+ )
+ )
+ )
+ return False
+
+ # Chmod + retry.
+ import stat
+
+ def chmod_rw(p):
+ mode = os.stat(p).st_mode
+ os.chmod(p, mode | stat.S_IRUSR | stat.S_IWUSR)
+
+ # For files, we need to recursively go upwards in the directories to
+ # ensure they all are also writable.
+ p = Path(path)
+ if p.is_file():
+ for parent in p.parents:
+ chmod_rw(str(parent))
+ # stop when we reach the original path passed to rm_rf
+ if parent == start_path:
+ break
+ chmod_rw(str(path))
+
+ func(path)
+ return True
+
+
+def rm_rf(path):
+ """Remove the path contents recursively, even if some elements
+ are read-only.
+ """
+ onerror = partial(on_rm_rf_error, start_path=path)
+ shutil.rmtree(str(path), onerror=onerror)
+
+
+def find_prefixed(root, prefix):
+ """finds all elements in root that begin with the prefix, case insensitive"""
+ l_prefix = prefix.lower()
+ for x in root.iterdir():
+ if x.name.lower().startswith(l_prefix):
+ yield x
+
+
+def extract_suffixes(iter, prefix):
+ """
+ :param iter: iterator over path names
+ :param prefix: expected prefix of the path names
+ :returns: the parts of the paths following the prefix
+ """
+ p_len = len(prefix)
+ for p in iter:
+ yield p.name[p_len:]
+
+
+def find_suffixes(root, prefix):
+ """combines find_prefixes and extract_suffixes
+ """
+ return extract_suffixes(find_prefixed(root, prefix), prefix)
+
+
+def parse_num(maybe_num):
+ """parses number path suffixes, returns -1 on error"""
+ try:
+ return int(maybe_num)
+ except ValueError:
+ return -1
+
+
+if six.PY2:
+
+ def _max(iterable, default):
+ """needed due to python2.7 lacking the default argument for max"""
+ return reduce(max, iterable, default)
+
+
+else:
+ _max = max
+
+
+def _force_symlink(root, target, link_to):
+ """helper to create the current symlink
+
+ it's full of race conditions that are reasonably ok to ignore
+ for the context of best effort linking to the latest testrun
+
+ the presumption being thatin case of much parallelism
+ the inaccuracy is going to be acceptable
+ """
+ current_symlink = root.joinpath(target)
+ try:
+ current_symlink.unlink()
+ except OSError:
+ pass
+ try:
+ current_symlink.symlink_to(link_to)
+ except Exception:
+ pass
+
+
+def make_numbered_dir(root, prefix):
+ """create a directory with an increased number as suffix for the given prefix"""
+ for i in range(10):
+ # try up to 10 times to create the folder
+ max_existing = _max(map(parse_num, find_suffixes(root, prefix)), default=-1)
+ new_number = max_existing + 1
+ new_path = root.joinpath("{}{}".format(prefix, new_number))
+ try:
+ new_path.mkdir()
+ except Exception:
+ pass
+ else:
+ _force_symlink(root, prefix + "current", new_path)
+ return new_path
+ else:
+ raise EnvironmentError(
+ "could not create numbered dir with prefix "
+ "{prefix} in {root} after 10 tries".format(prefix=prefix, root=root)
+ )
+
+
+def create_cleanup_lock(p):
+ """crates a lock to prevent premature folder cleanup"""
+ lock_path = get_lock_path(p)
+ try:
+ fd = os.open(str(lock_path), os.O_WRONLY | os.O_CREAT | os.O_EXCL, 0o644)
+ except OSError as e:
+ if e.errno == errno.EEXIST:
+ six.raise_from(
+ EnvironmentError("cannot create lockfile in {path}".format(path=p)), e
+ )
+ else:
+ raise
+ else:
+ pid = os.getpid()
+ spid = str(pid)
+ if not isinstance(spid, bytes):
+ spid = spid.encode("ascii")
+ os.write(fd, spid)
+ os.close(fd)
+ if not lock_path.is_file():
+ raise EnvironmentError("lock path got renamed after successful creation")
+ return lock_path
+
+
+def register_cleanup_lock_removal(lock_path, register=atexit.register):
+ """registers a cleanup function for removing a lock, by default on atexit"""
+ pid = os.getpid()
+
+ def cleanup_on_exit(lock_path=lock_path, original_pid=pid):
+ current_pid = os.getpid()
+ if current_pid != original_pid:
+ # fork
+ return
+ try:
+ lock_path.unlink()
+ except (OSError, IOError):
+ pass
+
+ return register(cleanup_on_exit)
+
+
+def maybe_delete_a_numbered_dir(path):
+ """removes a numbered directory if its lock can be obtained and it does not seem to be in use"""
+ lock_path = None
+ try:
+ lock_path = create_cleanup_lock(path)
+ parent = path.parent
+
+ garbage = parent.joinpath("garbage-{}".format(uuid.uuid4()))
+ path.rename(garbage)
+ rm_rf(garbage)
+ except (OSError, EnvironmentError):
+ # known races:
+ # * other process did a cleanup at the same time
+ # * deletable folder was found
+ # * process cwd (Windows)
+ return
+ finally:
+ # if we created the lock, ensure we remove it even if we failed
+ # to properly remove the numbered dir
+ if lock_path is not None:
+ try:
+ lock_path.unlink()
+ except (OSError, IOError):
+ pass
+
+
+def ensure_deletable(path, consider_lock_dead_if_created_before):
+ """checks if a lock exists and breaks it if its considered dead"""
+ if path.is_symlink():
+ return False
+ lock = get_lock_path(path)
+ if not lock.exists():
+ return True
+ try:
+ lock_time = lock.stat().st_mtime
+ except Exception:
+ return False
+ else:
+ if lock_time < consider_lock_dead_if_created_before:
+ lock.unlink()
+ return True
+ else:
+ return False
+
+
+def try_cleanup(path, consider_lock_dead_if_created_before):
+ """tries to cleanup a folder if we can ensure it's deletable"""
+ if ensure_deletable(path, consider_lock_dead_if_created_before):
+ maybe_delete_a_numbered_dir(path)
+
+
+def cleanup_candidates(root, prefix, keep):
+ """lists candidates for numbered directories to be removed - follows py.path"""
+ max_existing = _max(map(parse_num, find_suffixes(root, prefix)), default=-1)
+ max_delete = max_existing - keep
+ paths = find_prefixed(root, prefix)
+ paths, paths2 = itertools.tee(paths)
+ numbers = map(parse_num, extract_suffixes(paths2, prefix))
+ for path, number in zip(paths, numbers):
+ if number <= max_delete:
+ yield path
+
+
+def cleanup_numbered_dir(root, prefix, keep, consider_lock_dead_if_created_before):
+ """cleanup for lock driven numbered directories"""
+ for path in cleanup_candidates(root, prefix, keep):
+ try_cleanup(path, consider_lock_dead_if_created_before)
+ for path in root.glob("garbage-*"):
+ try_cleanup(path, consider_lock_dead_if_created_before)
+
+
+def make_numbered_dir_with_cleanup(root, prefix, keep, lock_timeout):
+ """creates a numbered dir with a cleanup lock and removes old ones"""
+ e = None
+ for i in range(10):
+ try:
+ p = make_numbered_dir(root, prefix)
+ lock_path = create_cleanup_lock(p)
+ register_cleanup_lock_removal(lock_path)
+ except Exception as exc:
+ e = exc
+ else:
+ consider_lock_dead_if_created_before = p.stat().st_mtime - lock_timeout
+ cleanup_numbered_dir(
+ root=root,
+ prefix=prefix,
+ keep=keep,
+ consider_lock_dead_if_created_before=consider_lock_dead_if_created_before,
+ )
+ return p
+ assert e is not None
+ raise e
+
+
+def resolve_from_str(input, root):
+ assert not isinstance(input, Path), "would break on py2"
+ root = Path(root)
+ input = expanduser(input)
+ input = expandvars(input)
+ if isabs(input):
+ return Path(input)
+ else:
+ return root.joinpath(input)
+
+
+def fnmatch_ex(pattern, path):
+ """FNMatcher port from py.path.common which works with PurePath() instances.
+
+ The difference between this algorithm and PurePath.match() is that the latter matches "**" glob expressions
+ for each part of the path, while this algorithm uses the whole path instead.
+
+ For example:
+ "tests/foo/bar/doc/test_foo.py" matches pattern "tests/**/doc/test*.py" with this algorithm, but not with
+ PurePath.match().
+
+ This algorithm was ported to keep backward-compatibility with existing settings which assume paths match according
+ this logic.
+
+ References:
+ * https://bugs.python.org/issue29249
+ * https://bugs.python.org/issue34731
+ """
+ path = PurePath(path)
+ iswin32 = sys.platform.startswith("win")
+
+ if iswin32 and sep not in pattern and posix_sep in pattern:
+ # Running on Windows, the pattern has no Windows path separators,
+ # and the pattern has one or more Posix path separators. Replace
+ # the Posix path separators with the Windows path separator.
+ pattern = pattern.replace(posix_sep, sep)
+
+ if sep not in pattern:
+ name = path.name
+ else:
+ name = six.text_type(path)
+ return fnmatch.fnmatch(name, pattern)
+
+
+def parts(s):
+ parts = s.split(sep)
+ return {sep.join(parts[: i + 1]) or sep for i in range(len(parts))}
diff --git a/contrib/python/pytest/py2/_pytest/pytester.py b/contrib/python/pytest/py2/_pytest/pytester.py
new file mode 100644
index 00000000000..f1d739c9917
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/pytester.py
@@ -0,0 +1,1413 @@
+# -*- coding: utf-8 -*-
+"""(disabled by default) support for testing pytest and pytest plugins."""
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import codecs
+import gc
+import os
+import platform
+import re
+import subprocess
+import sys
+import time
+import traceback
+from fnmatch import fnmatch
+from weakref import WeakKeyDictionary
+
+import py
+import six
+
+import pytest
+from _pytest._code import Source
+from _pytest._io.saferepr import saferepr
+from _pytest.assertion.rewrite import AssertionRewritingHook
+from _pytest.capture import MultiCapture
+from _pytest.capture import SysCapture
+from _pytest.compat import safe_str
+from _pytest.compat import Sequence
+from _pytest.main import EXIT_INTERRUPTED
+from _pytest.main import EXIT_OK
+from _pytest.main import Session
+from _pytest.monkeypatch import MonkeyPatch
+from _pytest.pathlib import Path
+
+IGNORE_PAM = [ # filenames added when obtaining details about the current user
+ u"/var/lib/sss/mc/passwd"
+]
+
+
+def pytest_addoption(parser):
+ parser.addoption(
+ "--lsof",
+ action="store_true",
+ dest="lsof",
+ default=False,
+ help="run FD checks if lsof is available",
+ )
+
+ parser.addoption(
+ "--runpytest",
+ default="inprocess",
+ dest="runpytest",
+ choices=("inprocess", "subprocess"),
+ help=(
+ "run pytest sub runs in tests using an 'inprocess' "
+ "or 'subprocess' (python -m main) method"
+ ),
+ )
+
+ parser.addini(
+ "pytester_example_dir", help="directory to take the pytester example files from"
+ )
+
+
+def pytest_configure(config):
+ if config.getvalue("lsof"):
+ checker = LsofFdLeakChecker()
+ if checker.matching_platform():
+ config.pluginmanager.register(checker)
+
+ config.addinivalue_line(
+ "markers",
+ "pytester_example_path(*path_segments): join the given path "
+ "segments to `pytester_example_dir` for this test.",
+ )
+
+
+def raise_on_kwargs(kwargs):
+ __tracebackhide__ = True
+ if kwargs: # pragma: no branch
+ raise TypeError(
+ "Unexpected keyword arguments: {}".format(", ".join(sorted(kwargs)))
+ )
+
+
+class LsofFdLeakChecker(object):
+ def get_open_files(self):
+ out = self._exec_lsof()
+ open_files = self._parse_lsof_output(out)
+ return open_files
+
+ def _exec_lsof(self):
+ pid = os.getpid()
+ # py3: use subprocess.DEVNULL directly.
+ with open(os.devnull, "wb") as devnull:
+ return subprocess.check_output(
+ ("lsof", "-Ffn0", "-p", str(pid)), stderr=devnull
+ ).decode()
+
+ def _parse_lsof_output(self, out):
+ def isopen(line):
+ return line.startswith("f") and (
+ "deleted" not in line
+ and "mem" not in line
+ and "txt" not in line
+ and "cwd" not in line
+ )
+
+ open_files = []
+
+ for line in out.split("\n"):
+ if isopen(line):
+ fields = line.split("\0")
+ fd = fields[0][1:]
+ filename = fields[1][1:]
+ if filename in IGNORE_PAM:
+ continue
+ if filename.startswith("/"):
+ open_files.append((fd, filename))
+
+ return open_files
+
+ def matching_platform(self):
+ try:
+ subprocess.check_output(("lsof", "-v"))
+ except (OSError, subprocess.CalledProcessError):
+ return False
+ else:
+ return True
+
+ @pytest.hookimpl(hookwrapper=True, tryfirst=True)
+ def pytest_runtest_protocol(self, item):
+ lines1 = self.get_open_files()
+ yield
+ if hasattr(sys, "pypy_version_info"):
+ gc.collect()
+ lines2 = self.get_open_files()
+
+ new_fds = {t[0] for t in lines2} - {t[0] for t in lines1}
+ leaked_files = [t for t in lines2 if t[0] in new_fds]
+ if leaked_files:
+ error = []
+ error.append("***** %s FD leakage detected" % len(leaked_files))
+ error.extend([str(f) for f in leaked_files])
+ error.append("*** Before:")
+ error.extend([str(f) for f in lines1])
+ error.append("*** After:")
+ error.extend([str(f) for f in lines2])
+ error.append(error[0])
+ error.append("*** function %s:%s: %s " % item.location)
+ error.append("See issue #2366")
+ item.warn(pytest.PytestWarning("\n".join(error)))
+
+
+# used at least by pytest-xdist plugin
+
+
+@pytest.fixture
+def _pytest(request):
+ """Return a helper which offers a gethookrecorder(hook) method which
+ returns a HookRecorder instance which helps to make assertions about called
+ hooks.
+
+ """
+ return PytestArg(request)
+
+
+class PytestArg(object):
+ def __init__(self, request):
+ self.request = request
+
+ def gethookrecorder(self, hook):
+ hookrecorder = HookRecorder(hook._pm)
+ self.request.addfinalizer(hookrecorder.finish_recording)
+ return hookrecorder
+
+
+def get_public_names(values):
+ """Only return names from iterator values without a leading underscore."""
+ return [x for x in values if x[0] != "_"]
+
+
+class ParsedCall(object):
+ def __init__(self, name, kwargs):
+ self.__dict__.update(kwargs)
+ self._name = name
+
+ def __repr__(self):
+ d = self.__dict__.copy()
+ del d["_name"]
+ return "<ParsedCall %r(**%r)>" % (self._name, d)
+
+
+class HookRecorder(object):
+ """Record all hooks called in a plugin manager.
+
+ This wraps all the hook calls in the plugin manager, recording each call
+ before propagating the normal calls.
+
+ """
+
+ def __init__(self, pluginmanager):
+ self._pluginmanager = pluginmanager
+ self.calls = []
+
+ def before(hook_name, hook_impls, kwargs):
+ self.calls.append(ParsedCall(hook_name, kwargs))
+
+ def after(outcome, hook_name, hook_impls, kwargs):
+ pass
+
+ self._undo_wrapping = pluginmanager.add_hookcall_monitoring(before, after)
+
+ def finish_recording(self):
+ self._undo_wrapping()
+
+ def getcalls(self, names):
+ if isinstance(names, str):
+ names = names.split()
+ return [call for call in self.calls if call._name in names]
+
+ def assert_contains(self, entries):
+ __tracebackhide__ = True
+ i = 0
+ entries = list(entries)
+ backlocals = sys._getframe(1).f_locals
+ while entries:
+ name, check = entries.pop(0)
+ for ind, call in enumerate(self.calls[i:]):
+ if call._name == name:
+ print("NAMEMATCH", name, call)
+ if eval(check, backlocals, call.__dict__):
+ print("CHECKERMATCH", repr(check), "->", call)
+ else:
+ print("NOCHECKERMATCH", repr(check), "-", call)
+ continue
+ i += ind + 1
+ break
+ print("NONAMEMATCH", name, "with", call)
+ else:
+ pytest.fail("could not find %r check %r" % (name, check))
+
+ def popcall(self, name):
+ __tracebackhide__ = True
+ for i, call in enumerate(self.calls):
+ if call._name == name:
+ del self.calls[i]
+ return call
+ lines = ["could not find call %r, in:" % (name,)]
+ lines.extend([" %s" % x for x in self.calls])
+ pytest.fail("\n".join(lines))
+
+ def getcall(self, name):
+ values = self.getcalls(name)
+ assert len(values) == 1, (name, values)
+ return values[0]
+
+ # functionality for test reports
+
+ def getreports(self, names="pytest_runtest_logreport pytest_collectreport"):
+ return [x.report for x in self.getcalls(names)]
+
+ def matchreport(
+ self,
+ inamepart="",
+ names="pytest_runtest_logreport pytest_collectreport",
+ when=None,
+ ):
+ """return a testreport whose dotted import path matches"""
+ values = []
+ for rep in self.getreports(names=names):
+ if not when and rep.when != "call" and rep.passed:
+ # setup/teardown passing reports - let's ignore those
+ continue
+ if when and rep.when != when:
+ continue
+ if not inamepart or inamepart in rep.nodeid.split("::"):
+ values.append(rep)
+ if not values:
+ raise ValueError(
+ "could not find test report matching %r: "
+ "no test reports at all!" % (inamepart,)
+ )
+ if len(values) > 1:
+ raise ValueError(
+ "found 2 or more testreports matching %r: %s" % (inamepart, values)
+ )
+ return values[0]
+
+ def getfailures(self, names="pytest_runtest_logreport pytest_collectreport"):
+ return [rep for rep in self.getreports(names) if rep.failed]
+
+ def getfailedcollections(self):
+ return self.getfailures("pytest_collectreport")
+
+ def listoutcomes(self):
+ passed = []
+ skipped = []
+ failed = []
+ for rep in self.getreports("pytest_collectreport pytest_runtest_logreport"):
+ if rep.passed:
+ if rep.when == "call":
+ passed.append(rep)
+ elif rep.skipped:
+ skipped.append(rep)
+ else:
+ assert rep.failed, "Unexpected outcome: {!r}".format(rep)
+ failed.append(rep)
+ return passed, skipped, failed
+
+ def countoutcomes(self):
+ return [len(x) for x in self.listoutcomes()]
+
+ def assertoutcome(self, passed=0, skipped=0, failed=0):
+ realpassed, realskipped, realfailed = self.listoutcomes()
+ assert passed == len(realpassed)
+ assert skipped == len(realskipped)
+ assert failed == len(realfailed)
+
+ def clear(self):
+ self.calls[:] = []
+
+
+@pytest.fixture
+def linecomp(request):
+ return LineComp()
+
+
+@pytest.fixture(name="LineMatcher")
+def LineMatcher_fixture(request):
+ return LineMatcher
+
+
+@pytest.fixture
+def testdir(request, tmpdir_factory):
+ return Testdir(request, tmpdir_factory)
+
+
+@pytest.fixture
+def _sys_snapshot():
+ snappaths = SysPathsSnapshot()
+ snapmods = SysModulesSnapshot()
+ yield
+ snapmods.restore()
+ snappaths.restore()
+
+
+@pytest.fixture
+def _config_for_test():
+ from _pytest.config import get_config
+
+ config = get_config()
+ yield config
+ config._ensure_unconfigure() # cleanup, e.g. capman closing tmpfiles.
+
+
+rex_outcome = re.compile(r"(\d+) ([\w-]+)")
+
+
+class RunResult(object):
+ """The result of running a command.
+
+ Attributes:
+
+ :ret: the return value
+ :outlines: list of lines captured from stdout
+ :errlines: list of lines captures from stderr
+ :stdout: :py:class:`LineMatcher` of stdout, use ``stdout.str()`` to
+ reconstruct stdout or the commonly used ``stdout.fnmatch_lines()``
+ method
+ :stderr: :py:class:`LineMatcher` of stderr
+ :duration: duration in seconds
+
+ """
+
+ def __init__(self, ret, outlines, errlines, duration):
+ self.ret = ret
+ self.outlines = outlines
+ self.errlines = errlines
+ self.stdout = LineMatcher(outlines)
+ self.stderr = LineMatcher(errlines)
+ self.duration = duration
+
+ def __repr__(self):
+ return (
+ "<RunResult ret=%r len(stdout.lines)=%d len(stderr.lines)=%d duration=%.2fs>"
+ % (self.ret, len(self.stdout.lines), len(self.stderr.lines), self.duration)
+ )
+
+ def parseoutcomes(self):
+ """Return a dictionary of outcomestring->num from parsing the terminal
+ output that the test process produced.
+
+ """
+ for line in reversed(self.outlines):
+ if "seconds" in line:
+ outcomes = rex_outcome.findall(line)
+ if outcomes:
+ d = {}
+ for num, cat in outcomes:
+ d[cat] = int(num)
+ return d
+ raise ValueError("Pytest terminal report not found")
+
+ def assert_outcomes(
+ self, passed=0, skipped=0, failed=0, error=0, xpassed=0, xfailed=0
+ ):
+ """Assert that the specified outcomes appear with the respective
+ numbers (0 means it didn't occur) in the text output from a test run.
+
+ """
+ d = self.parseoutcomes()
+ obtained = {
+ "passed": d.get("passed", 0),
+ "skipped": d.get("skipped", 0),
+ "failed": d.get("failed", 0),
+ "error": d.get("error", 0),
+ "xpassed": d.get("xpassed", 0),
+ "xfailed": d.get("xfailed", 0),
+ }
+ expected = {
+ "passed": passed,
+ "skipped": skipped,
+ "failed": failed,
+ "error": error,
+ "xpassed": xpassed,
+ "xfailed": xfailed,
+ }
+ assert obtained == expected
+
+
+class CwdSnapshot(object):
+ def __init__(self):
+ self.__saved = os.getcwd()
+
+ def restore(self):
+ os.chdir(self.__saved)
+
+
+class SysModulesSnapshot(object):
+ def __init__(self, preserve=None):
+ self.__preserve = preserve
+ self.__saved = dict(sys.modules)
+
+ def restore(self):
+ if self.__preserve:
+ self.__saved.update(
+ (k, m) for k, m in sys.modules.items() if self.__preserve(k)
+ )
+ sys.modules.clear()
+ sys.modules.update(self.__saved)
+
+
+class SysPathsSnapshot(object):
+ def __init__(self):
+ self.__saved = list(sys.path), list(sys.meta_path)
+
+ def restore(self):
+ sys.path[:], sys.meta_path[:] = self.__saved
+
+
+class Testdir(object):
+ """Temporary test directory with tools to test/run pytest itself.
+
+ This is based on the ``tmpdir`` fixture but provides a number of methods
+ which aid with testing pytest itself. Unless :py:meth:`chdir` is used all
+ methods will use :py:attr:`tmpdir` as their current working directory.
+
+ Attributes:
+
+ :tmpdir: The :py:class:`py.path.local` instance of the temporary directory.
+
+ :plugins: A list of plugins to use with :py:meth:`parseconfig` and
+ :py:meth:`runpytest`. Initially this is an empty list but plugins can
+ be added to the list. The type of items to add to the list depends on
+ the method using them so refer to them for details.
+
+ """
+
+ CLOSE_STDIN = object
+
+ class TimeoutExpired(Exception):
+ pass
+
+ def __init__(self, request, tmpdir_factory):
+ self.request = request
+ self._mod_collections = WeakKeyDictionary()
+ name = request.function.__name__
+ self.tmpdir = tmpdir_factory.mktemp(name, numbered=True)
+ self.test_tmproot = tmpdir_factory.mktemp("tmp-" + name, numbered=True)
+ self.plugins = []
+ self._cwd_snapshot = CwdSnapshot()
+ self._sys_path_snapshot = SysPathsSnapshot()
+ self._sys_modules_snapshot = self.__take_sys_modules_snapshot()
+ self.chdir()
+ self.request.addfinalizer(self.finalize)
+ method = self.request.config.getoption("--runpytest")
+ if method == "inprocess":
+ self._runpytest_method = self.runpytest_inprocess
+ elif method == "subprocess":
+ self._runpytest_method = self.runpytest_subprocess
+
+ mp = self.monkeypatch = MonkeyPatch()
+ mp.setenv("PYTEST_DEBUG_TEMPROOT", str(self.test_tmproot))
+ # Ensure no unexpected caching via tox.
+ mp.delenv("TOX_ENV_DIR", raising=False)
+ # Discard outer pytest options.
+ mp.delenv("PYTEST_ADDOPTS", raising=False)
+
+ # Environment (updates) for inner runs.
+ tmphome = str(self.tmpdir)
+ self._env_run_update = {"HOME": tmphome, "USERPROFILE": tmphome}
+
+ def __repr__(self):
+ return "<Testdir %r>" % (self.tmpdir,)
+
+ def __str__(self):
+ return str(self.tmpdir)
+
+ def finalize(self):
+ """Clean up global state artifacts.
+
+ Some methods modify the global interpreter state and this tries to
+ clean this up. It does not remove the temporary directory however so
+ it can be looked at after the test run has finished.
+
+ """
+ self._sys_modules_snapshot.restore()
+ self._sys_path_snapshot.restore()
+ self._cwd_snapshot.restore()
+ self.monkeypatch.undo()
+
+ def __take_sys_modules_snapshot(self):
+ # some zope modules used by twisted-related tests keep internal state
+ # and can't be deleted; we had some trouble in the past with
+ # `zope.interface` for example
+ def preserve_module(name):
+ return name.startswith("zope")
+
+ return SysModulesSnapshot(preserve=preserve_module)
+
+ def make_hook_recorder(self, pluginmanager):
+ """Create a new :py:class:`HookRecorder` for a PluginManager."""
+ pluginmanager.reprec = reprec = HookRecorder(pluginmanager)
+ self.request.addfinalizer(reprec.finish_recording)
+ return reprec
+
+ def chdir(self):
+ """Cd into the temporary directory.
+
+ This is done automatically upon instantiation.
+
+ """
+ self.tmpdir.chdir()
+
+ def _makefile(self, ext, args, kwargs, encoding="utf-8"):
+ items = list(kwargs.items())
+
+ def to_text(s):
+ return s.decode(encoding) if isinstance(s, bytes) else six.text_type(s)
+
+ if args:
+ source = u"\n".join(to_text(x) for x in args)
+ basename = self.request.function.__name__
+ items.insert(0, (basename, source))
+
+ ret = None
+ for basename, value in items:
+ p = self.tmpdir.join(basename).new(ext=ext)
+ p.dirpath().ensure_dir()
+ source = Source(value)
+ source = u"\n".join(to_text(line) for line in source.lines)
+ p.write(source.strip().encode(encoding), "wb")
+ if ret is None:
+ ret = p
+ return ret
+
+ def makefile(self, ext, *args, **kwargs):
+ r"""Create new file(s) in the testdir.
+
+ :param str ext: The extension the file(s) should use, including the dot, e.g. `.py`.
+ :param list[str] args: All args will be treated as strings and joined using newlines.
+ The result will be written as contents to the file. The name of the
+ file will be based on the test function requesting this fixture.
+ :param kwargs: Each keyword is the name of a file, while the value of it will
+ be written as contents of the file.
+
+ Examples:
+
+ .. code-block:: python
+
+ testdir.makefile(".txt", "line1", "line2")
+
+ testdir.makefile(".ini", pytest="[pytest]\naddopts=-rs\n")
+
+ """
+ return self._makefile(ext, args, kwargs)
+
+ def makeconftest(self, source):
+ """Write a contest.py file with 'source' as contents."""
+ return self.makepyfile(conftest=source)
+
+ def makeini(self, source):
+ """Write a tox.ini file with 'source' as contents."""
+ return self.makefile(".ini", tox=source)
+
+ def getinicfg(self, source):
+ """Return the pytest section from the tox.ini config file."""
+ p = self.makeini(source)
+ return py.iniconfig.IniConfig(p)["pytest"]
+
+ def makepyfile(self, *args, **kwargs):
+ """Shortcut for .makefile() with a .py extension."""
+ return self._makefile(".py", args, kwargs)
+
+ def maketxtfile(self, *args, **kwargs):
+ """Shortcut for .makefile() with a .txt extension."""
+ return self._makefile(".txt", args, kwargs)
+
+ def syspathinsert(self, path=None):
+ """Prepend a directory to sys.path, defaults to :py:attr:`tmpdir`.
+
+ This is undone automatically when this object dies at the end of each
+ test.
+ """
+ if path is None:
+ path = self.tmpdir
+
+ self.monkeypatch.syspath_prepend(str(path))
+
+ def mkdir(self, name):
+ """Create a new (sub)directory."""
+ return self.tmpdir.mkdir(name)
+
+ def mkpydir(self, name):
+ """Create a new python package.
+
+ This creates a (sub)directory with an empty ``__init__.py`` file so it
+ gets recognised as a python package.
+
+ """
+ p = self.mkdir(name)
+ p.ensure("__init__.py")
+ return p
+
+ def copy_example(self, name=None):
+ import warnings
+ from _pytest.warning_types import PYTESTER_COPY_EXAMPLE
+
+ warnings.warn(PYTESTER_COPY_EXAMPLE, stacklevel=2)
+ example_dir = self.request.config.getini("pytester_example_dir")
+ if example_dir is None:
+ raise ValueError("pytester_example_dir is unset, can't copy examples")
+ example_dir = self.request.config.rootdir.join(example_dir)
+
+ for extra_element in self.request.node.iter_markers("pytester_example_path"):
+ assert extra_element.args
+ example_dir = example_dir.join(*extra_element.args)
+
+ if name is None:
+ func_name = self.request.function.__name__
+ maybe_dir = example_dir / func_name
+ maybe_file = example_dir / (func_name + ".py")
+
+ if maybe_dir.isdir():
+ example_path = maybe_dir
+ elif maybe_file.isfile():
+ example_path = maybe_file
+ else:
+ raise LookupError(
+ "{} cant be found as module or package in {}".format(
+ func_name, example_dir.bestrelpath(self.request.config.rootdir)
+ )
+ )
+ else:
+ example_path = example_dir.join(name)
+
+ if example_path.isdir() and not example_path.join("__init__.py").isfile():
+ example_path.copy(self.tmpdir)
+ return self.tmpdir
+ elif example_path.isfile():
+ result = self.tmpdir.join(example_path.basename)
+ example_path.copy(result)
+ return result
+ else:
+ raise LookupError(
+ 'example "{}" is not found as a file or directory'.format(example_path)
+ )
+
+ Session = Session
+
+ def getnode(self, config, arg):
+ """Return the collection node of a file.
+
+ :param config: :py:class:`_pytest.config.Config` instance, see
+ :py:meth:`parseconfig` and :py:meth:`parseconfigure` to create the
+ configuration
+
+ :param arg: a :py:class:`py.path.local` instance of the file
+
+ """
+ session = Session(config)
+ assert "::" not in str(arg)
+ p = py.path.local(arg)
+ config.hook.pytest_sessionstart(session=session)
+ res = session.perform_collect([str(p)], genitems=False)[0]
+ config.hook.pytest_sessionfinish(session=session, exitstatus=EXIT_OK)
+ return res
+
+ def getpathnode(self, path):
+ """Return the collection node of a file.
+
+ This is like :py:meth:`getnode` but uses :py:meth:`parseconfigure` to
+ create the (configured) pytest Config instance.
+
+ :param path: a :py:class:`py.path.local` instance of the file
+
+ """
+ config = self.parseconfigure(path)
+ session = Session(config)
+ x = session.fspath.bestrelpath(path)
+ config.hook.pytest_sessionstart(session=session)
+ res = session.perform_collect([x], genitems=False)[0]
+ config.hook.pytest_sessionfinish(session=session, exitstatus=EXIT_OK)
+ return res
+
+ def genitems(self, colitems):
+ """Generate all test items from a collection node.
+
+ This recurses into the collection node and returns a list of all the
+ test items contained within.
+
+ """
+ session = colitems[0].session
+ result = []
+ for colitem in colitems:
+ result.extend(session.genitems(colitem))
+ return result
+
+ def runitem(self, source):
+ """Run the "test_func" Item.
+
+ The calling test instance (class containing the test method) must
+ provide a ``.getrunner()`` method which should return a runner which
+ can run the test protocol for a single item, e.g.
+ :py:func:`_pytest.runner.runtestprotocol`.
+
+ """
+ # used from runner functional tests
+ item = self.getitem(source)
+ # the test class where we are called from wants to provide the runner
+ testclassinstance = self.request.instance
+ runner = testclassinstance.getrunner()
+ return runner(item)
+
+ def inline_runsource(self, source, *cmdlineargs):
+ """Run a test module in process using ``pytest.main()``.
+
+ This run writes "source" into a temporary file and runs
+ ``pytest.main()`` on it, returning a :py:class:`HookRecorder` instance
+ for the result.
+
+ :param source: the source code of the test module
+
+ :param cmdlineargs: any extra command line arguments to use
+
+ :return: :py:class:`HookRecorder` instance of the result
+
+ """
+ p = self.makepyfile(source)
+ values = list(cmdlineargs) + [p]
+ return self.inline_run(*values)
+
+ def inline_genitems(self, *args):
+ """Run ``pytest.main(['--collectonly'])`` in-process.
+
+ Runs the :py:func:`pytest.main` function to run all of pytest inside
+ the test process itself like :py:meth:`inline_run`, but returns a
+ tuple of the collected items and a :py:class:`HookRecorder` instance.
+
+ """
+ rec = self.inline_run("--collect-only", *args)
+ items = [x.item for x in rec.getcalls("pytest_itemcollected")]
+ return items, rec
+
+ def inline_run(self, *args, **kwargs):
+ """Run ``pytest.main()`` in-process, returning a HookRecorder.
+
+ Runs the :py:func:`pytest.main` function to run all of pytest inside
+ the test process itself. This means it can return a
+ :py:class:`HookRecorder` instance which gives more detailed results
+ from that run than can be done by matching stdout/stderr from
+ :py:meth:`runpytest`.
+
+ :param args: command line arguments to pass to :py:func:`pytest.main`
+
+ :param plugins: (keyword-only) extra plugin instances the
+ ``pytest.main()`` instance should use
+
+ :return: a :py:class:`HookRecorder` instance
+ """
+ plugins = kwargs.pop("plugins", [])
+ no_reraise_ctrlc = kwargs.pop("no_reraise_ctrlc", None)
+ raise_on_kwargs(kwargs)
+
+ finalizers = []
+ try:
+ # Do not load user config (during runs only).
+ mp_run = MonkeyPatch()
+ for k, v in self._env_run_update.items():
+ mp_run.setenv(k, v)
+ finalizers.append(mp_run.undo)
+
+ # When running pytest inline any plugins active in the main test
+ # process are already imported. So this disables the warning which
+ # will trigger to say they can no longer be rewritten, which is
+ # fine as they have already been rewritten.
+ orig_warn = AssertionRewritingHook._warn_already_imported
+
+ def revert_warn_already_imported():
+ AssertionRewritingHook._warn_already_imported = orig_warn
+
+ finalizers.append(revert_warn_already_imported)
+ AssertionRewritingHook._warn_already_imported = lambda *a: None
+
+ # Any sys.module or sys.path changes done while running pytest
+ # inline should be reverted after the test run completes to avoid
+ # clashing with later inline tests run within the same pytest test,
+ # e.g. just because they use matching test module names.
+ finalizers.append(self.__take_sys_modules_snapshot().restore)
+ finalizers.append(SysPathsSnapshot().restore)
+
+ # Important note:
+ # - our tests should not leave any other references/registrations
+ # laying around other than possibly loaded test modules
+ # referenced from sys.modules, as nothing will clean those up
+ # automatically
+
+ rec = []
+
+ class Collect(object):
+ def pytest_configure(x, config):
+ rec.append(self.make_hook_recorder(config.pluginmanager))
+
+ plugins.append(Collect())
+ ret = pytest.main(list(args), plugins=plugins)
+ if len(rec) == 1:
+ reprec = rec.pop()
+ else:
+
+ class reprec(object):
+ pass
+
+ reprec.ret = ret
+
+ # typically we reraise keyboard interrupts from the child run
+ # because it's our user requesting interruption of the testing
+ if ret == EXIT_INTERRUPTED and not no_reraise_ctrlc:
+ calls = reprec.getcalls("pytest_keyboard_interrupt")
+ if calls and calls[-1].excinfo.type == KeyboardInterrupt:
+ raise KeyboardInterrupt()
+ return reprec
+ finally:
+ for finalizer in finalizers:
+ finalizer()
+
+ def runpytest_inprocess(self, *args, **kwargs):
+ """Return result of running pytest in-process, providing a similar
+ interface to what self.runpytest() provides.
+ """
+ syspathinsert = kwargs.pop("syspathinsert", False)
+
+ if syspathinsert:
+ self.syspathinsert()
+ now = time.time()
+ capture = MultiCapture(Capture=SysCapture)
+ capture.start_capturing()
+ try:
+ try:
+ reprec = self.inline_run(*args, **kwargs)
+ except SystemExit as e:
+
+ class reprec(object):
+ ret = e.args[0]
+
+ except Exception:
+ traceback.print_exc()
+
+ class reprec(object):
+ ret = 3
+
+ finally:
+ out, err = capture.readouterr()
+ capture.stop_capturing()
+ sys.stdout.write(out)
+ sys.stderr.write(err)
+
+ res = RunResult(reprec.ret, out.split("\n"), err.split("\n"), time.time() - now)
+ res.reprec = reprec
+ return res
+
+ def runpytest(self, *args, **kwargs):
+ """Run pytest inline or in a subprocess, depending on the command line
+ option "--runpytest" and return a :py:class:`RunResult`.
+
+ """
+ args = self._ensure_basetemp(args)
+ return self._runpytest_method(*args, **kwargs)
+
+ def _ensure_basetemp(self, args):
+ args = list(args)
+ for x in args:
+ if safe_str(x).startswith("--basetemp"):
+ break
+ else:
+ args.append("--basetemp=%s" % self.tmpdir.dirpath("basetemp"))
+ return args
+
+ def parseconfig(self, *args):
+ """Return a new pytest Config instance from given commandline args.
+
+ This invokes the pytest bootstrapping code in _pytest.config to create
+ a new :py:class:`_pytest.core.PluginManager` and call the
+ pytest_cmdline_parse hook to create a new
+ :py:class:`_pytest.config.Config` instance.
+
+ If :py:attr:`plugins` has been populated they should be plugin modules
+ to be registered with the PluginManager.
+
+ """
+ args = self._ensure_basetemp(args)
+
+ import _pytest.config
+
+ config = _pytest.config._prepareconfig(args, self.plugins)
+ # we don't know what the test will do with this half-setup config
+ # object and thus we make sure it gets unconfigured properly in any
+ # case (otherwise capturing could still be active, for example)
+ self.request.addfinalizer(config._ensure_unconfigure)
+ return config
+
+ def parseconfigure(self, *args):
+ """Return a new pytest configured Config instance.
+
+ This returns a new :py:class:`_pytest.config.Config` instance like
+ :py:meth:`parseconfig`, but also calls the pytest_configure hook.
+
+ """
+ config = self.parseconfig(*args)
+ config._do_configure()
+ self.request.addfinalizer(config._ensure_unconfigure)
+ return config
+
+ def getitem(self, source, funcname="test_func"):
+ """Return the test item for a test function.
+
+ This writes the source to a python file and runs pytest's collection on
+ the resulting module, returning the test item for the requested
+ function name.
+
+ :param source: the module source
+
+ :param funcname: the name of the test function for which to return a
+ test item
+
+ """
+ items = self.getitems(source)
+ for item in items:
+ if item.name == funcname:
+ return item
+ assert 0, "%r item not found in module:\n%s\nitems: %s" % (
+ funcname,
+ source,
+ items,
+ )
+
+ def getitems(self, source):
+ """Return all test items collected from the module.
+
+ This writes the source to a python file and runs pytest's collection on
+ the resulting module, returning all test items contained within.
+
+ """
+ modcol = self.getmodulecol(source)
+ return self.genitems([modcol])
+
+ def getmodulecol(self, source, configargs=(), withinit=False):
+ """Return the module collection node for ``source``.
+
+ This writes ``source`` to a file using :py:meth:`makepyfile` and then
+ runs the pytest collection on it, returning the collection node for the
+ test module.
+
+ :param source: the source code of the module to collect
+
+ :param configargs: any extra arguments to pass to
+ :py:meth:`parseconfigure`
+
+ :param withinit: whether to also write an ``__init__.py`` file to the
+ same directory to ensure it is a package
+
+ """
+ if isinstance(source, Path):
+ path = self.tmpdir.join(str(source))
+ assert not withinit, "not supported for paths"
+ else:
+ kw = {self.request.function.__name__: Source(source).strip()}
+ path = self.makepyfile(**kw)
+ if withinit:
+ self.makepyfile(__init__="#")
+ self.config = config = self.parseconfigure(path, *configargs)
+ return self.getnode(config, path)
+
+ def collect_by_name(self, modcol, name):
+ """Return the collection node for name from the module collection.
+
+ This will search a module collection node for a collection node
+ matching the given name.
+
+ :param modcol: a module collection node; see :py:meth:`getmodulecol`
+
+ :param name: the name of the node to return
+
+ """
+ if modcol not in self._mod_collections:
+ self._mod_collections[modcol] = list(modcol.collect())
+ for colitem in self._mod_collections[modcol]:
+ if colitem.name == name:
+ return colitem
+
+ def popen(
+ self,
+ cmdargs,
+ stdout=subprocess.PIPE,
+ stderr=subprocess.PIPE,
+ stdin=CLOSE_STDIN,
+ **kw
+ ):
+ """Invoke subprocess.Popen.
+
+ This calls subprocess.Popen making sure the current working directory
+ is in the PYTHONPATH.
+
+ You probably want to use :py:meth:`run` instead.
+
+ """
+ env = os.environ.copy()
+ env["PYTHONPATH"] = os.pathsep.join(
+ filter(None, [os.getcwd(), env.get("PYTHONPATH", "")])
+ )
+ env.update(self._env_run_update)
+ kw["env"] = env
+
+ if stdin is Testdir.CLOSE_STDIN:
+ kw["stdin"] = subprocess.PIPE
+ elif isinstance(stdin, bytes):
+ kw["stdin"] = subprocess.PIPE
+ else:
+ kw["stdin"] = stdin
+
+ popen = subprocess.Popen(cmdargs, stdout=stdout, stderr=stderr, **kw)
+ if stdin is Testdir.CLOSE_STDIN:
+ popen.stdin.close()
+ elif isinstance(stdin, bytes):
+ popen.stdin.write(stdin)
+
+ return popen
+
+ def run(self, *cmdargs, **kwargs):
+ """Run a command with arguments.
+
+ Run a process using subprocess.Popen saving the stdout and stderr.
+
+ :param args: the sequence of arguments to pass to `subprocess.Popen()`
+ :param timeout: the period in seconds after which to timeout and raise
+ :py:class:`Testdir.TimeoutExpired`
+ :param stdin: optional standard input. Bytes are being send, closing
+ the pipe, otherwise it is passed through to ``popen``.
+ Defaults to ``CLOSE_STDIN``, which translates to using a pipe
+ (``subprocess.PIPE``) that gets closed.
+
+ Returns a :py:class:`RunResult`.
+
+ """
+ __tracebackhide__ = True
+
+ timeout = kwargs.pop("timeout", None)
+ stdin = kwargs.pop("stdin", Testdir.CLOSE_STDIN)
+ raise_on_kwargs(kwargs)
+
+ cmdargs = [
+ str(arg) if isinstance(arg, py.path.local) else arg for arg in cmdargs
+ ]
+ p1 = self.tmpdir.join("stdout")
+ p2 = self.tmpdir.join("stderr")
+ print("running:", *cmdargs)
+ print(" in:", py.path.local())
+ f1 = codecs.open(str(p1), "w", encoding="utf8")
+ f2 = codecs.open(str(p2), "w", encoding="utf8")
+ try:
+ now = time.time()
+ popen = self.popen(
+ cmdargs,
+ stdin=stdin,
+ stdout=f1,
+ stderr=f2,
+ close_fds=(sys.platform != "win32"),
+ )
+ if isinstance(stdin, bytes):
+ popen.stdin.close()
+
+ def handle_timeout():
+ __tracebackhide__ = True
+
+ timeout_message = (
+ "{seconds} second timeout expired running:"
+ " {command}".format(seconds=timeout, command=cmdargs)
+ )
+
+ popen.kill()
+ popen.wait()
+ raise self.TimeoutExpired(timeout_message)
+
+ if timeout is None:
+ ret = popen.wait()
+ elif not six.PY2:
+ try:
+ ret = popen.wait(timeout)
+ except subprocess.TimeoutExpired:
+ handle_timeout()
+ else:
+ end = time.time() + timeout
+
+ resolution = min(0.1, timeout / 10)
+
+ while True:
+ ret = popen.poll()
+ if ret is not None:
+ break
+
+ if time.time() > end:
+ handle_timeout()
+
+ time.sleep(resolution)
+ finally:
+ f1.close()
+ f2.close()
+ f1 = codecs.open(str(p1), "r", encoding="utf8")
+ f2 = codecs.open(str(p2), "r", encoding="utf8")
+ try:
+ out = f1.read().splitlines()
+ err = f2.read().splitlines()
+ finally:
+ f1.close()
+ f2.close()
+ self._dump_lines(out, sys.stdout)
+ self._dump_lines(err, sys.stderr)
+ return RunResult(ret, out, err, time.time() - now)
+
+ def _dump_lines(self, lines, fp):
+ try:
+ for line in lines:
+ print(line, file=fp)
+ except UnicodeEncodeError:
+ print("couldn't print to %s because of encoding" % (fp,))
+
+ def _getpytestargs(self):
+ return sys.executable, "-mpytest"
+
+ def runpython(self, script):
+ """Run a python script using sys.executable as interpreter.
+
+ Returns a :py:class:`RunResult`.
+
+ """
+ return self.run(sys.executable, script)
+
+ def runpython_c(self, command):
+ """Run python -c "command", return a :py:class:`RunResult`."""
+ return self.run(sys.executable, "-c", command)
+
+ def runpytest_subprocess(self, *args, **kwargs):
+ """Run pytest as a subprocess with given arguments.
+
+ Any plugins added to the :py:attr:`plugins` list will be added using the
+ ``-p`` command line option. Additionally ``--basetemp`` is used to put
+ any temporary files and directories in a numbered directory prefixed
+ with "runpytest-" to not conflict with the normal numbered pytest
+ location for temporary files and directories.
+
+ :param args: the sequence of arguments to pass to the pytest subprocess
+ :param timeout: the period in seconds after which to timeout and raise
+ :py:class:`Testdir.TimeoutExpired`
+
+ Returns a :py:class:`RunResult`.
+ """
+ __tracebackhide__ = True
+ timeout = kwargs.pop("timeout", None)
+ raise_on_kwargs(kwargs)
+
+ p = py.path.local.make_numbered_dir(
+ prefix="runpytest-", keep=None, rootdir=self.tmpdir
+ )
+ args = ("--basetemp=%s" % p,) + args
+ plugins = [x for x in self.plugins if isinstance(x, str)]
+ if plugins:
+ args = ("-p", plugins[0]) + args
+ args = self._getpytestargs() + args
+ return self.run(*args, timeout=timeout)
+
+ def spawn_pytest(self, string, expect_timeout=10.0):
+ """Run pytest using pexpect.
+
+ This makes sure to use the right pytest and sets up the temporary
+ directory locations.
+
+ The pexpect child is returned.
+
+ """
+ basetemp = self.tmpdir.mkdir("temp-pexpect")
+ invoke = " ".join(map(str, self._getpytestargs()))
+ cmd = "%s --basetemp=%s %s" % (invoke, basetemp, string)
+ return self.spawn(cmd, expect_timeout=expect_timeout)
+
+ def spawn(self, cmd, expect_timeout=10.0):
+ """Run a command using pexpect.
+
+ The pexpect child is returned.
+
+ """
+ pexpect = pytest.importorskip("pexpect", "3.0")
+ if hasattr(sys, "pypy_version_info") and "64" in platform.machine():
+ pytest.skip("pypy-64 bit not supported")
+ if sys.platform.startswith("freebsd"):
+ pytest.xfail("pexpect does not work reliably on freebsd")
+ logfile = self.tmpdir.join("spawn.out").open("wb")
+
+ # Do not load user config.
+ env = os.environ.copy()
+ env.update(self._env_run_update)
+
+ child = pexpect.spawn(cmd, logfile=logfile, env=env)
+ self.request.addfinalizer(logfile.close)
+ child.timeout = expect_timeout
+ return child
+
+
+def getdecoded(out):
+ try:
+ return out.decode("utf-8")
+ except UnicodeDecodeError:
+ return "INTERNAL not-utf8-decodeable, truncated string:\n%s" % (saferepr(out),)
+
+
+class LineComp(object):
+ def __init__(self):
+ self.stringio = py.io.TextIO()
+
+ def assert_contains_lines(self, lines2):
+ """Assert that lines2 are contained (linearly) in lines1.
+
+ Return a list of extralines found.
+
+ """
+ __tracebackhide__ = True
+ val = self.stringio.getvalue()
+ self.stringio.truncate(0)
+ self.stringio.seek(0)
+ lines1 = val.split("\n")
+ return LineMatcher(lines1).fnmatch_lines(lines2)
+
+
+class LineMatcher(object):
+ """Flexible matching of text.
+
+ This is a convenience class to test large texts like the output of
+ commands.
+
+ The constructor takes a list of lines without their trailing newlines, i.e.
+ ``text.splitlines()``.
+
+ """
+
+ def __init__(self, lines):
+ self.lines = lines
+ self._log_output = []
+
+ def str(self):
+ """Return the entire original text."""
+ return "\n".join(self.lines)
+
+ def _getlines(self, lines2):
+ if isinstance(lines2, str):
+ lines2 = Source(lines2)
+ if isinstance(lines2, Source):
+ lines2 = lines2.strip().lines
+ return lines2
+
+ def fnmatch_lines_random(self, lines2):
+ """Check lines exist in the output using in any order.
+
+ Lines are checked using ``fnmatch.fnmatch``. The argument is a list of
+ lines which have to occur in the output, in any order.
+
+ """
+ self._match_lines_random(lines2, fnmatch)
+
+ def re_match_lines_random(self, lines2):
+ """Check lines exist in the output using ``re.match``, in any order.
+
+ The argument is a list of lines which have to occur in the output, in
+ any order.
+
+ """
+ self._match_lines_random(lines2, lambda name, pat: re.match(pat, name))
+
+ def _match_lines_random(self, lines2, match_func):
+ """Check lines exist in the output.
+
+ The argument is a list of lines which have to occur in the output, in
+ any order. Each line can contain glob whildcards.
+
+ """
+ lines2 = self._getlines(lines2)
+ for line in lines2:
+ for x in self.lines:
+ if line == x or match_func(x, line):
+ self._log("matched: ", repr(line))
+ break
+ else:
+ self._log("line %r not found in output" % line)
+ raise ValueError(self._log_text)
+
+ def get_lines_after(self, fnline):
+ """Return all lines following the given line in the text.
+
+ The given line can contain glob wildcards.
+
+ """
+ for i, line in enumerate(self.lines):
+ if fnline == line or fnmatch(line, fnline):
+ return self.lines[i + 1 :]
+ raise ValueError("line %r not found in output" % fnline)
+
+ def _log(self, *args):
+ self._log_output.append(" ".join(str(x) for x in args))
+
+ @property
+ def _log_text(self):
+ return "\n".join(self._log_output)
+
+ def fnmatch_lines(self, lines2):
+ """Search captured text for matching lines using ``fnmatch.fnmatch``.
+
+ The argument is a list of lines which have to match and can use glob
+ wildcards. If they do not match a pytest.fail() is called. The
+ matches and non-matches are also printed on stdout.
+
+ """
+ __tracebackhide__ = True
+ self._match_lines(lines2, fnmatch, "fnmatch")
+
+ def re_match_lines(self, lines2):
+ """Search captured text for matching lines using ``re.match``.
+
+ The argument is a list of lines which have to match using ``re.match``.
+ If they do not match a pytest.fail() is called.
+
+ The matches and non-matches are also printed on stdout.
+
+ """
+ __tracebackhide__ = True
+ self._match_lines(lines2, lambda name, pat: re.match(pat, name), "re.match")
+
+ def _match_lines(self, lines2, match_func, match_nickname):
+ """Underlying implementation of ``fnmatch_lines`` and ``re_match_lines``.
+
+ :param list[str] lines2: list of string patterns to match. The actual
+ format depends on ``match_func``
+ :param match_func: a callable ``match_func(line, pattern)`` where line
+ is the captured line from stdout/stderr and pattern is the matching
+ pattern
+ :param str match_nickname: the nickname for the match function that
+ will be logged to stdout when a match occurs
+
+ """
+ assert isinstance(lines2, Sequence)
+ lines2 = self._getlines(lines2)
+ lines1 = self.lines[:]
+ nextline = None
+ extralines = []
+ __tracebackhide__ = True
+ for line in lines2:
+ nomatchprinted = False
+ while lines1:
+ nextline = lines1.pop(0)
+ if line == nextline:
+ self._log("exact match:", repr(line))
+ break
+ elif match_func(nextline, line):
+ self._log("%s:" % match_nickname, repr(line))
+ self._log(" with:", repr(nextline))
+ break
+ else:
+ if not nomatchprinted:
+ self._log("nomatch:", repr(line))
+ nomatchprinted = True
+ self._log(" and:", repr(nextline))
+ extralines.append(nextline)
+ else:
+ self._log("remains unmatched: %r" % (line,))
+ pytest.fail(self._log_text)
diff --git a/contrib/python/pytest/py2/_pytest/python.py b/contrib/python/pytest/py2/_pytest/python.py
new file mode 100644
index 00000000000..f7c368b0c4b
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/python.py
@@ -0,0 +1,1507 @@
+# -*- coding: utf-8 -*-
+""" Python test discovery, setup and run of test functions. """
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import collections
+import fnmatch
+import inspect
+import os
+import sys
+import warnings
+from functools import partial
+from textwrap import dedent
+
+import py
+import six
+
+import _pytest
+from _pytest import deprecated
+from _pytest import fixtures
+from _pytest import nodes
+from _pytest._code import filter_traceback
+from _pytest.compat import ascii_escaped
+from _pytest.compat import enum
+from _pytest.compat import get_default_arg_names
+from _pytest.compat import get_real_func
+from _pytest.compat import getfslineno
+from _pytest.compat import getimfunc
+from _pytest.compat import getlocation
+from _pytest.compat import is_generator
+from _pytest.compat import isclass
+from _pytest.compat import isfunction
+from _pytest.compat import NOTSET
+from _pytest.compat import REGEX_TYPE
+from _pytest.compat import safe_getattr
+from _pytest.compat import safe_isclass
+from _pytest.compat import safe_str
+from _pytest.compat import STRING_TYPES
+from _pytest.config import hookimpl
+from _pytest.main import FSHookProxy
+from _pytest.mark import MARK_GEN
+from _pytest.mark.structures import get_unpacked_marks
+from _pytest.mark.structures import normalize_mark_list
+from _pytest.outcomes import fail
+from _pytest.outcomes import skip
+from _pytest.pathlib import parts
+from _pytest.warning_types import PytestCollectionWarning
+from _pytest.warning_types import PytestUnhandledCoroutineWarning
+
+
+def pyobj_property(name):
+ def get(self):
+ node = self.getparent(getattr(__import__("pytest"), name))
+ if node is not None:
+ return node.obj
+
+ doc = "python %s object this node was collected from (can be None)." % (
+ name.lower(),
+ )
+ return property(get, None, None, doc)
+
+
+def pytest_addoption(parser):
+ group = parser.getgroup("general")
+ group.addoption(
+ "--fixtures",
+ "--funcargs",
+ action="store_true",
+ dest="showfixtures",
+ default=False,
+ help="show available fixtures, sorted by plugin appearance "
+ "(fixtures with leading '_' are only shown with '-v')",
+ )
+ group.addoption(
+ "--fixtures-per-test",
+ action="store_true",
+ dest="show_fixtures_per_test",
+ default=False,
+ help="show fixtures per test",
+ )
+ parser.addini(
+ "python_files",
+ type="args",
+ # NOTE: default is also used in AssertionRewritingHook.
+ default=["test_*.py", "*_test.py"],
+ help="glob-style file patterns for Python test module discovery",
+ )
+ parser.addini(
+ "python_classes",
+ type="args",
+ default=["Test"],
+ help="prefixes or glob names for Python test class discovery",
+ )
+ parser.addini(
+ "python_functions",
+ type="args",
+ default=["test"],
+ help="prefixes or glob names for Python test function and method discovery",
+ )
+ parser.addini(
+ "disable_test_id_escaping_and_forfeit_all_rights_to_community_support",
+ type="bool",
+ default=False,
+ help="disable string escape non-ascii characters, might cause unwanted "
+ "side effects(use at your own risk)",
+ )
+
+ group.addoption(
+ "--import-mode",
+ default="prepend",
+ choices=["prepend", "append"],
+ dest="importmode",
+ help="prepend/append to sys.path when importing test modules, "
+ "default is to prepend.",
+ )
+
+
+def pytest_cmdline_main(config):
+ if config.option.showfixtures:
+ showfixtures(config)
+ return 0
+ if config.option.show_fixtures_per_test:
+ show_fixtures_per_test(config)
+ return 0
+
+
+def pytest_generate_tests(metafunc):
+ # those alternative spellings are common - raise a specific error to alert
+ # the user
+ alt_spellings = ["parameterize", "parametrise", "parameterise"]
+ for mark_name in alt_spellings:
+ if metafunc.definition.get_closest_marker(mark_name):
+ msg = "{0} has '{1}' mark, spelling should be 'parametrize'"
+ fail(msg.format(metafunc.function.__name__, mark_name), pytrace=False)
+ for marker in metafunc.definition.iter_markers(name="parametrize"):
+ metafunc.parametrize(*marker.args, **marker.kwargs)
+
+
+def pytest_configure(config):
+ config.addinivalue_line(
+ "markers",
+ "parametrize(argnames, argvalues): call a test function multiple "
+ "times passing in different arguments in turn. argvalues generally "
+ "needs to be a list of values if argnames specifies only one name "
+ "or a list of tuples of values if argnames specifies multiple names. "
+ "Example: @parametrize('arg1', [1,2]) would lead to two calls of the "
+ "decorated test function, one with arg1=1 and another with arg1=2."
+ "see https://docs.pytest.org/en/latest/parametrize.html for more info "
+ "and examples.",
+ )
+ config.addinivalue_line(
+ "markers",
+ "usefixtures(fixturename1, fixturename2, ...): mark tests as needing "
+ "all of the specified fixtures. see "
+ "https://docs.pytest.org/en/latest/fixture.html#usefixtures ",
+ )
+
+
+@hookimpl(trylast=True)
+def pytest_pyfunc_call(pyfuncitem):
+ testfunction = pyfuncitem.obj
+ iscoroutinefunction = getattr(inspect, "iscoroutinefunction", None)
+ if iscoroutinefunction is not None and iscoroutinefunction(testfunction):
+ msg = "Coroutine functions are not natively supported and have been skipped.\n"
+ msg += "You need to install a suitable plugin for your async framework, for example:\n"
+ msg += " - pytest-asyncio\n"
+ msg += " - pytest-trio\n"
+ msg += " - pytest-tornasync"
+ warnings.warn(PytestUnhandledCoroutineWarning(msg.format(pyfuncitem.nodeid)))
+ skip(msg="coroutine function and no async plugin installed (see warnings)")
+ funcargs = pyfuncitem.funcargs
+ testargs = {arg: funcargs[arg] for arg in pyfuncitem._fixtureinfo.argnames}
+ testfunction(**testargs)
+ return True
+
+
+def pytest_collect_file(path, parent):
+ ext = path.ext
+ if ext == ".py":
+ if not parent.session.isinitpath(path):
+ if not path_matches_patterns(
+ path, parent.config.getini("python_files") + ["__init__.py"]
+ ):
+ return
+ ihook = parent.session.gethookproxy(path)
+ return ihook.pytest_pycollect_makemodule(path=path, parent=parent)
+
+
+def path_matches_patterns(path, patterns):
+ """Returns True if the given py.path.local matches one of the patterns in the list of globs given"""
+ return any(path.fnmatch(pattern) for pattern in patterns)
+
+
+def pytest_pycollect_makemodule(path, parent):
+ if path.basename == "__init__.py":
+ return Package(path, parent)
+ return Module(path, parent)
+
+
+@hookimpl(hookwrapper=True)
+def pytest_pycollect_makeitem(collector, name, obj):
+ outcome = yield
+ res = outcome.get_result()
+ if res is not None:
+ return
+ # nothing was collected elsewhere, let's do it here
+ if safe_isclass(obj):
+ if collector.istestclass(obj, name):
+ outcome.force_result(Class(name, parent=collector))
+ elif collector.istestfunction(obj, name):
+ # mock seems to store unbound methods (issue473), normalize it
+ obj = getattr(obj, "__func__", obj)
+ # We need to try and unwrap the function if it's a functools.partial
+ # or a funtools.wrapped.
+ # We musn't if it's been wrapped with mock.patch (python 2 only)
+ if not (isfunction(obj) or isfunction(get_real_func(obj))):
+ filename, lineno = getfslineno(obj)
+ warnings.warn_explicit(
+ message=PytestCollectionWarning(
+ "cannot collect %r because it is not a function." % name
+ ),
+ category=None,
+ filename=str(filename),
+ lineno=lineno + 1,
+ )
+ elif getattr(obj, "__test__", True):
+ if is_generator(obj):
+ res = Function(name, parent=collector)
+ reason = deprecated.YIELD_TESTS.format(name=name)
+ res.add_marker(MARK_GEN.xfail(run=False, reason=reason))
+ res.warn(PytestCollectionWarning(reason))
+ else:
+ res = list(collector._genfunctions(name, obj))
+ outcome.force_result(res)
+
+
+def pytest_make_parametrize_id(config, val, argname=None):
+ return None
+
+
+class PyobjContext(object):
+ module = pyobj_property("Module")
+ cls = pyobj_property("Class")
+ instance = pyobj_property("Instance")
+
+
+class PyobjMixin(PyobjContext):
+ _ALLOW_MARKERS = True
+
+ def __init__(self, *k, **kw):
+ super(PyobjMixin, self).__init__(*k, **kw)
+
+ @property
+ def obj(self):
+ """Underlying Python object."""
+ obj = getattr(self, "_obj", None)
+ if obj is None:
+ self._obj = obj = self._getobj()
+ # XXX evil hack
+ # used to avoid Instance collector marker duplication
+ if self._ALLOW_MARKERS:
+ self.own_markers.extend(get_unpacked_marks(self.obj))
+ return obj
+
+ @obj.setter
+ def obj(self, value):
+ self._obj = value
+
+ def _getobj(self):
+ """Gets the underlying Python object. May be overwritten by subclasses."""
+ return getattr(self.parent.obj, self.name)
+
+ def getmodpath(self, stopatmodule=True, includemodule=False):
+ """ return python path relative to the containing module. """
+ chain = self.listchain()
+ chain.reverse()
+ parts = []
+ for node in chain:
+ if isinstance(node, Instance):
+ continue
+ name = node.name
+ if isinstance(node, Module):
+ name = os.path.splitext(name)[0]
+ if stopatmodule:
+ if includemodule:
+ parts.append(name)
+ break
+ parts.append(name)
+ parts.reverse()
+ s = ".".join(parts)
+ return s.replace(".[", "[")
+
+ def reportinfo(self):
+ # XXX caching?
+ obj = self.obj
+ compat_co_firstlineno = getattr(obj, "compat_co_firstlineno", None)
+ if isinstance(compat_co_firstlineno, int):
+ # nose compatibility
+ fspath = sys.modules[obj.__module__].__file__
+ if fspath.endswith(".pyc"):
+ fspath = fspath[:-1]
+ lineno = compat_co_firstlineno
+ else:
+ fspath, lineno = getfslineno(obj)
+ modpath = self.getmodpath()
+ assert isinstance(lineno, int)
+ return fspath, lineno, modpath
+
+
+class PyCollector(PyobjMixin, nodes.Collector):
+ def funcnamefilter(self, name):
+ return self._matches_prefix_or_glob_option("python_functions", name)
+
+ def isnosetest(self, obj):
+ """ Look for the __test__ attribute, which is applied by the
+ @nose.tools.istest decorator
+ """
+ # We explicitly check for "is True" here to not mistakenly treat
+ # classes with a custom __getattr__ returning something truthy (like a
+ # function) as test classes.
+ return safe_getattr(obj, "__test__", False) is True
+
+ def classnamefilter(self, name):
+ return self._matches_prefix_or_glob_option("python_classes", name)
+
+ def istestfunction(self, obj, name):
+ if self.funcnamefilter(name) or self.isnosetest(obj):
+ if isinstance(obj, staticmethod):
+ # static methods need to be unwrapped
+ obj = safe_getattr(obj, "__func__", False)
+ return (
+ safe_getattr(obj, "__call__", False)
+ and fixtures.getfixturemarker(obj) is None
+ )
+ else:
+ return False
+
+ def istestclass(self, obj, name):
+ return self.classnamefilter(name) or self.isnosetest(obj)
+
+ def _matches_prefix_or_glob_option(self, option_name, name):
+ """
+ checks if the given name matches the prefix or glob-pattern defined
+ in ini configuration.
+ """
+ for option in self.config.getini(option_name):
+ if name.startswith(option):
+ return True
+ # check that name looks like a glob-string before calling fnmatch
+ # because this is called for every name in each collected module,
+ # and fnmatch is somewhat expensive to call
+ elif ("*" in option or "?" in option or "[" in option) and fnmatch.fnmatch(
+ name, option
+ ):
+ return True
+ return False
+
+ def collect(self):
+ if not getattr(self.obj, "__test__", True):
+ return []
+
+ # NB. we avoid random getattrs and peek in the __dict__ instead
+ # (XXX originally introduced from a PyPy need, still true?)
+ dicts = [getattr(self.obj, "__dict__", {})]
+ for basecls in inspect.getmro(self.obj.__class__):
+ dicts.append(basecls.__dict__)
+ seen = {}
+ values = []
+ for dic in dicts:
+ for name, obj in list(dic.items()):
+ if name in seen:
+ continue
+ seen[name] = True
+ res = self._makeitem(name, obj)
+ if res is None:
+ continue
+ if not isinstance(res, list):
+ res = [res]
+ values.extend(res)
+ values.sort(key=lambda item: item.reportinfo()[:2])
+ return values
+
+ def _makeitem(self, name, obj):
+ # assert self.ihook.fspath == self.fspath, self
+ return self.ihook.pytest_pycollect_makeitem(collector=self, name=name, obj=obj)
+
+ def _genfunctions(self, name, funcobj):
+ module = self.getparent(Module).obj
+ clscol = self.getparent(Class)
+ cls = clscol and clscol.obj or None
+ fm = self.session._fixturemanager
+
+ definition = FunctionDefinition(name=name, parent=self, callobj=funcobj)
+ fixtureinfo = fm.getfixtureinfo(definition, funcobj, cls)
+
+ metafunc = Metafunc(
+ definition, fixtureinfo, self.config, cls=cls, module=module
+ )
+ methods = []
+ if hasattr(module, "pytest_generate_tests"):
+ methods.append(module.pytest_generate_tests)
+ if hasattr(cls, "pytest_generate_tests"):
+ methods.append(cls().pytest_generate_tests)
+ if methods:
+ self.ihook.pytest_generate_tests.call_extra(
+ methods, dict(metafunc=metafunc)
+ )
+ else:
+ self.ihook.pytest_generate_tests(metafunc=metafunc)
+
+ if not metafunc._calls:
+ yield Function(name, parent=self, fixtureinfo=fixtureinfo)
+ else:
+ # add funcargs() as fixturedefs to fixtureinfo.arg2fixturedefs
+ fixtures.add_funcarg_pseudo_fixture_def(self, metafunc, fm)
+
+ # add_funcarg_pseudo_fixture_def may have shadowed some fixtures
+ # with direct parametrization, so make sure we update what the
+ # function really needs.
+ fixtureinfo.prune_dependency_tree()
+
+ for callspec in metafunc._calls:
+ subname = "%s[%s]" % (name, callspec.id)
+ yield Function(
+ name=subname,
+ parent=self,
+ callspec=callspec,
+ callobj=funcobj,
+ fixtureinfo=fixtureinfo,
+ keywords={callspec.id: True},
+ originalname=name,
+ )
+
+
+class Module(nodes.File, PyCollector):
+ """ Collector for test classes and functions. """
+
+ def _getobj(self):
+ return self._importtestmodule()
+
+ def collect(self):
+ self._inject_setup_module_fixture()
+ self._inject_setup_function_fixture()
+ self.session._fixturemanager.parsefactories(self)
+ return super(Module, self).collect()
+
+ def _inject_setup_module_fixture(self):
+ """Injects a hidden autouse, module scoped fixture into the collected module object
+ that invokes setUpModule/tearDownModule if either or both are available.
+
+ Using a fixture to invoke this methods ensures we play nicely and unsurprisingly with
+ other fixtures (#517).
+ """
+ setup_module = _get_non_fixture_func(self.obj, "setUpModule")
+ if setup_module is None:
+ setup_module = _get_non_fixture_func(self.obj, "setup_module")
+
+ teardown_module = _get_non_fixture_func(self.obj, "tearDownModule")
+ if teardown_module is None:
+ teardown_module = _get_non_fixture_func(self.obj, "teardown_module")
+
+ if setup_module is None and teardown_module is None:
+ return
+
+ @fixtures.fixture(autouse=True, scope="module")
+ def xunit_setup_module_fixture(request):
+ if setup_module is not None:
+ _call_with_optional_argument(setup_module, request.module)
+ yield
+ if teardown_module is not None:
+ _call_with_optional_argument(teardown_module, request.module)
+
+ self.obj.__pytest_setup_module = xunit_setup_module_fixture
+
+ def _inject_setup_function_fixture(self):
+ """Injects a hidden autouse, function scoped fixture into the collected module object
+ that invokes setup_function/teardown_function if either or both are available.
+
+ Using a fixture to invoke this methods ensures we play nicely and unsurprisingly with
+ other fixtures (#517).
+ """
+ setup_function = _get_non_fixture_func(self.obj, "setup_function")
+ teardown_function = _get_non_fixture_func(self.obj, "teardown_function")
+ if setup_function is None and teardown_function is None:
+ return
+
+ @fixtures.fixture(autouse=True, scope="function")
+ def xunit_setup_function_fixture(request):
+ if request.instance is not None:
+ # in this case we are bound to an instance, so we need to let
+ # setup_method handle this
+ yield
+ return
+ if setup_function is not None:
+ _call_with_optional_argument(setup_function, request.function)
+ yield
+ if teardown_function is not None:
+ _call_with_optional_argument(teardown_function, request.function)
+
+ self.obj.__pytest_setup_function = xunit_setup_function_fixture
+
+ def _importtestmodule(self):
+ # we assume we are only called once per module
+ importmode = self.config.getoption("--import-mode")
+ try:
+ mod = self.fspath.pyimport(ensuresyspath=importmode)
+ except SyntaxError:
+ raise self.CollectError(
+ _pytest._code.ExceptionInfo.from_current().getrepr(style="short")
+ )
+ except self.fspath.ImportMismatchError:
+ e = sys.exc_info()[1]
+ raise self.CollectError(
+ "import file mismatch:\n"
+ "imported module %r has this __file__ attribute:\n"
+ " %s\n"
+ "which is not the same as the test file we want to collect:\n"
+ " %s\n"
+ "HINT: remove __pycache__ / .pyc files and/or use a "
+ "unique basename for your test file modules" % e.args
+ )
+ except ImportError:
+ from _pytest._code.code import ExceptionInfo
+
+ exc_info = ExceptionInfo.from_current()
+ if self.config.getoption("verbose") < 2:
+ exc_info.traceback = exc_info.traceback.filter(filter_traceback)
+ exc_repr = (
+ exc_info.getrepr(style="short")
+ if exc_info.traceback
+ else exc_info.exconly()
+ )
+ formatted_tb = safe_str(exc_repr)
+ raise self.CollectError(
+ "ImportError while importing test module '{fspath}'.\n"
+ "Hint: make sure your test modules/packages have valid Python names.\n"
+ "Traceback:\n"
+ "{traceback}".format(fspath=self.fspath, traceback=formatted_tb)
+ )
+ except _pytest.runner.Skipped as e:
+ if e.allow_module_level:
+ raise
+ raise self.CollectError(
+ "Using pytest.skip outside of a test is not allowed. "
+ "To decorate a test function, use the @pytest.mark.skip "
+ "or @pytest.mark.skipif decorators instead, and to skip a "
+ "module use `pytestmark = pytest.mark.{skip,skipif}."
+ )
+ self.config.pluginmanager.consider_module(mod)
+ return mod
+
+
+class Package(Module):
+ def __init__(self, fspath, parent=None, config=None, session=None, nodeid=None):
+ session = parent.session
+ nodes.FSCollector.__init__(
+ self, fspath, parent=parent, config=config, session=session, nodeid=nodeid
+ )
+ self.name = fspath.dirname
+ self.trace = session.trace
+ self._norecursepatterns = session._norecursepatterns
+ self.fspath = fspath
+
+ def setup(self):
+ # not using fixtures to call setup_module here because autouse fixtures
+ # from packages are not called automatically (#4085)
+ setup_module = _get_non_fixture_func(self.obj, "setUpModule")
+ if setup_module is None:
+ setup_module = _get_non_fixture_func(self.obj, "setup_module")
+ if setup_module is not None:
+ _call_with_optional_argument(setup_module, self.obj)
+
+ teardown_module = _get_non_fixture_func(self.obj, "tearDownModule")
+ if teardown_module is None:
+ teardown_module = _get_non_fixture_func(self.obj, "teardown_module")
+ if teardown_module is not None:
+ func = partial(_call_with_optional_argument, teardown_module, self.obj)
+ self.addfinalizer(func)
+
+ def _recurse(self, dirpath):
+ if dirpath.basename == "__pycache__":
+ return False
+ ihook = self.gethookproxy(dirpath.dirpath())
+ if ihook.pytest_ignore_collect(path=dirpath, config=self.config):
+ return
+ for pat in self._norecursepatterns:
+ if dirpath.check(fnmatch=pat):
+ return False
+ ihook = self.gethookproxy(dirpath)
+ ihook.pytest_collect_directory(path=dirpath, parent=self)
+ return True
+
+ def gethookproxy(self, fspath):
+ # check if we have the common case of running
+ # hooks with all conftest.py filesall conftest.py
+ pm = self.config.pluginmanager
+ my_conftestmodules = pm._getconftestmodules(fspath)
+ remove_mods = pm._conftest_plugins.difference(my_conftestmodules)
+ if remove_mods:
+ # one or more conftests are not in use at this fspath
+ proxy = FSHookProxy(fspath, pm, remove_mods)
+ else:
+ # all plugis are active for this fspath
+ proxy = self.config.hook
+ return proxy
+
+ def _collectfile(self, path, handle_dupes=True):
+ assert path.isfile(), "%r is not a file (isdir=%r, exists=%r, islink=%r)" % (
+ path,
+ path.isdir(),
+ path.exists(),
+ path.islink(),
+ )
+ ihook = self.gethookproxy(path)
+ if not self.isinitpath(path):
+ if ihook.pytest_ignore_collect(path=path, config=self.config):
+ return ()
+
+ if handle_dupes:
+ keepduplicates = self.config.getoption("keepduplicates")
+ if not keepduplicates:
+ duplicate_paths = self.config.pluginmanager._duplicatepaths
+ if path in duplicate_paths:
+ return ()
+ else:
+ duplicate_paths.add(path)
+
+ if self.fspath == path: # __init__.py
+ return [self]
+
+ return ihook.pytest_collect_file(path=path, parent=self)
+
+ def isinitpath(self, path):
+ return path in self.session._initialpaths
+
+ def collect(self):
+ this_path = self.fspath.dirpath()
+ init_module = this_path.join("__init__.py")
+ if init_module.check(file=1) and path_matches_patterns(
+ init_module, self.config.getini("python_files")
+ ):
+ yield Module(init_module, self)
+ pkg_prefixes = set()
+ for path in this_path.visit(rec=self._recurse, bf=True, sort=True):
+ # We will visit our own __init__.py file, in which case we skip it.
+ is_file = path.isfile()
+ if is_file:
+ if path.basename == "__init__.py" and path.dirpath() == this_path:
+ continue
+
+ parts_ = parts(path.strpath)
+ if any(
+ pkg_prefix in parts_ and pkg_prefix.join("__init__.py") != path
+ for pkg_prefix in pkg_prefixes
+ ):
+ continue
+
+ if is_file:
+ for x in self._collectfile(path):
+ yield x
+ elif not path.isdir():
+ # Broken symlink or invalid/missing file.
+ continue
+ elif path.join("__init__.py").check(file=1):
+ pkg_prefixes.add(path)
+
+
+def _get_xunit_setup_teardown(holder, attr_name, param_obj=None):
+ """
+ Return a callable to perform xunit-style setup or teardown if
+ the function exists in the ``holder`` object.
+ The ``param_obj`` parameter is the parameter which will be passed to the function
+ when the callable is called without arguments, defaults to the ``holder`` object.
+ Return ``None`` if a suitable callable is not found.
+ """
+ # TODO: only needed because of Package!
+ param_obj = param_obj if param_obj is not None else holder
+ result = _get_non_fixture_func(holder, attr_name)
+ if result is not None:
+ arg_count = result.__code__.co_argcount
+ if inspect.ismethod(result):
+ arg_count -= 1
+ if arg_count:
+ return lambda: result(param_obj)
+ else:
+ return result
+
+
+def _call_with_optional_argument(func, arg):
+ """Call the given function with the given argument if func accepts one argument, otherwise
+ calls func without arguments"""
+ arg_count = func.__code__.co_argcount
+ if inspect.ismethod(func):
+ arg_count -= 1
+ if arg_count:
+ func(arg)
+ else:
+ func()
+
+
+def _get_non_fixture_func(obj, name):
+ """Return the attribute from the given object to be used as a setup/teardown
+ xunit-style function, but only if not marked as a fixture to
+ avoid calling it twice.
+ """
+ meth = getattr(obj, name, None)
+ if fixtures.getfixturemarker(meth) is None:
+ return meth
+
+
+class Class(PyCollector):
+ """ Collector for test methods. """
+
+ def collect(self):
+ if not safe_getattr(self.obj, "__test__", True):
+ return []
+ if hasinit(self.obj):
+ self.warn(
+ PytestCollectionWarning(
+ "cannot collect test class %r because it has a "
+ "__init__ constructor (from: %s)"
+ % (self.obj.__name__, self.parent.nodeid)
+ )
+ )
+ return []
+ elif hasnew(self.obj):
+ self.warn(
+ PytestCollectionWarning(
+ "cannot collect test class %r because it has a "
+ "__new__ constructor (from: %s)"
+ % (self.obj.__name__, self.parent.nodeid)
+ )
+ )
+ return []
+
+ self._inject_setup_class_fixture()
+ self._inject_setup_method_fixture()
+
+ return [Instance(name="()", parent=self)]
+
+ def _inject_setup_class_fixture(self):
+ """Injects a hidden autouse, class scoped fixture into the collected class object
+ that invokes setup_class/teardown_class if either or both are available.
+
+ Using a fixture to invoke this methods ensures we play nicely and unsurprisingly with
+ other fixtures (#517).
+ """
+ setup_class = _get_non_fixture_func(self.obj, "setup_class")
+ teardown_class = getattr(self.obj, "teardown_class", None)
+ if setup_class is None and teardown_class is None:
+ return
+
+ @fixtures.fixture(autouse=True, scope="class")
+ def xunit_setup_class_fixture(cls):
+ if setup_class is not None:
+ func = getimfunc(setup_class)
+ _call_with_optional_argument(func, self.obj)
+ yield
+ if teardown_class is not None:
+ func = getimfunc(teardown_class)
+ _call_with_optional_argument(func, self.obj)
+
+ self.obj.__pytest_setup_class = xunit_setup_class_fixture
+
+ def _inject_setup_method_fixture(self):
+ """Injects a hidden autouse, function scoped fixture into the collected class object
+ that invokes setup_method/teardown_method if either or both are available.
+
+ Using a fixture to invoke this methods ensures we play nicely and unsurprisingly with
+ other fixtures (#517).
+ """
+ setup_method = _get_non_fixture_func(self.obj, "setup_method")
+ teardown_method = getattr(self.obj, "teardown_method", None)
+ if setup_method is None and teardown_method is None:
+ return
+
+ @fixtures.fixture(autouse=True, scope="function")
+ def xunit_setup_method_fixture(self, request):
+ method = request.function
+ if setup_method is not None:
+ func = getattr(self, "setup_method")
+ _call_with_optional_argument(func, method)
+ yield
+ if teardown_method is not None:
+ func = getattr(self, "teardown_method")
+ _call_with_optional_argument(func, method)
+
+ self.obj.__pytest_setup_method = xunit_setup_method_fixture
+
+
+class Instance(PyCollector):
+ _ALLOW_MARKERS = False # hack, destroy later
+ # instances share the object with their parents in a way
+ # that duplicates markers instances if not taken out
+ # can be removed at node structure reorganization time
+
+ def _getobj(self):
+ return self.parent.obj()
+
+ def collect(self):
+ self.session._fixturemanager.parsefactories(self)
+ return super(Instance, self).collect()
+
+ def newinstance(self):
+ self.obj = self._getobj()
+ return self.obj
+
+
+class FunctionMixin(PyobjMixin):
+ """ mixin for the code common to Function and Generator.
+ """
+
+ def setup(self):
+ """ perform setup for this test function. """
+ if isinstance(self.parent, Instance):
+ self.parent.newinstance()
+ self.obj = self._getobj()
+
+ def _prunetraceback(self, excinfo):
+ if hasattr(self, "_obj") and not self.config.getoption("fulltrace", False):
+ code = _pytest._code.Code(get_real_func(self.obj))
+ path, firstlineno = code.path, code.firstlineno
+ traceback = excinfo.traceback
+ ntraceback = traceback.cut(path=path, firstlineno=firstlineno)
+ if ntraceback == traceback:
+ ntraceback = ntraceback.cut(path=path)
+ if ntraceback == traceback:
+ ntraceback = ntraceback.filter(filter_traceback)
+ if not ntraceback:
+ ntraceback = traceback
+
+ excinfo.traceback = ntraceback.filter()
+ # issue364: mark all but first and last frames to
+ # only show a single-line message for each frame
+ if self.config.getoption("tbstyle", "auto") == "auto":
+ if len(excinfo.traceback) > 2:
+ for entry in excinfo.traceback[1:-1]:
+ entry.set_repr_style("short")
+
+ def repr_failure(self, excinfo, outerr=None):
+ assert outerr is None, "XXX outerr usage is deprecated"
+ style = self.config.getoption("tbstyle", "auto")
+ if style == "auto":
+ style = "long"
+ return self._repr_failure_py(excinfo, style=style)
+
+
+def hasinit(obj):
+ init = getattr(obj, "__init__", None)
+ if init:
+ return init != object.__init__
+
+
+def hasnew(obj):
+ new = getattr(obj, "__new__", None)
+ if new:
+ return new != object.__new__
+
+
+class CallSpec2(object):
+ def __init__(self, metafunc):
+ self.metafunc = metafunc
+ self.funcargs = {}
+ self._idlist = []
+ self.params = {}
+ self._globalid = NOTSET
+ self._globalparam = NOTSET
+ self._arg2scopenum = {} # used for sorting parametrized resources
+ self.marks = []
+ self.indices = {}
+
+ def copy(self):
+ cs = CallSpec2(self.metafunc)
+ cs.funcargs.update(self.funcargs)
+ cs.params.update(self.params)
+ cs.marks.extend(self.marks)
+ cs.indices.update(self.indices)
+ cs._arg2scopenum.update(self._arg2scopenum)
+ cs._idlist = list(self._idlist)
+ cs._globalid = self._globalid
+ cs._globalparam = self._globalparam
+ return cs
+
+ def _checkargnotcontained(self, arg):
+ if arg in self.params or arg in self.funcargs:
+ raise ValueError("duplicate %r" % (arg,))
+
+ def getparam(self, name):
+ try:
+ return self.params[name]
+ except KeyError:
+ if self._globalparam is NOTSET:
+ raise ValueError(name)
+ return self._globalparam
+
+ @property
+ def id(self):
+ return "-".join(map(safe_str, self._idlist))
+
+ def setmulti2(self, valtypes, argnames, valset, id, marks, scopenum, param_index):
+ for arg, val in zip(argnames, valset):
+ self._checkargnotcontained(arg)
+ valtype_for_arg = valtypes[arg]
+ getattr(self, valtype_for_arg)[arg] = val
+ self.indices[arg] = param_index
+ self._arg2scopenum[arg] = scopenum
+ self._idlist.append(id)
+ self.marks.extend(normalize_mark_list(marks))
+
+ def setall(self, funcargs, id, param):
+ for x in funcargs:
+ self._checkargnotcontained(x)
+ self.funcargs.update(funcargs)
+ if id is not NOTSET:
+ self._idlist.append(id)
+ if param is not NOTSET:
+ assert self._globalparam is NOTSET
+ self._globalparam = param
+ for arg in funcargs:
+ self._arg2scopenum[arg] = fixtures.scopenum_function
+
+
+class Metafunc(fixtures.FuncargnamesCompatAttr):
+ """
+ Metafunc objects are passed to the :func:`pytest_generate_tests <_pytest.hookspec.pytest_generate_tests>` hook.
+ They help to inspect a test function and to generate tests according to
+ test configuration or values specified in the class or module where a
+ test function is defined.
+ """
+
+ def __init__(self, definition, fixtureinfo, config, cls=None, module=None):
+ assert (
+ isinstance(definition, FunctionDefinition)
+ or type(definition).__name__ == "DefinitionMock"
+ )
+ self.definition = definition
+
+ #: access to the :class:`_pytest.config.Config` object for the test session
+ self.config = config
+
+ #: the module object where the test function is defined in.
+ self.module = module
+
+ #: underlying python test function
+ self.function = definition.obj
+
+ #: set of fixture names required by the test function
+ self.fixturenames = fixtureinfo.names_closure
+
+ #: class object where the test function is defined in or ``None``.
+ self.cls = cls
+
+ self._calls = []
+ self._ids = set()
+ self._arg2fixturedefs = fixtureinfo.name2fixturedefs
+
+ def parametrize(self, argnames, argvalues, indirect=False, ids=None, scope=None):
+ """ Add new invocations to the underlying test function using the list
+ of argvalues for the given argnames. Parametrization is performed
+ during the collection phase. If you need to setup expensive resources
+ see about setting indirect to do it rather at test setup time.
+
+ :arg argnames: a comma-separated string denoting one or more argument
+ names, or a list/tuple of argument strings.
+
+ :arg argvalues: The list of argvalues determines how often a
+ test is invoked with different argument values. If only one
+ argname was specified argvalues is a list of values. If N
+ argnames were specified, argvalues must be a list of N-tuples,
+ where each tuple-element specifies a value for its respective
+ argname.
+
+ :arg indirect: The list of argnames or boolean. A list of arguments'
+ names (subset of argnames). If True the list contains all names from
+ the argnames. Each argvalue corresponding to an argname in this list will
+ be passed as request.param to its respective argname fixture
+ function so that it can perform more expensive setups during the
+ setup phase of a test rather than at collection time.
+
+ :arg ids: list of string ids, or a callable.
+ If strings, each is corresponding to the argvalues so that they are
+ part of the test id. If None is given as id of specific test, the
+ automatically generated id for that argument will be used.
+ If callable, it should take one argument (a single argvalue) and return
+ a string or return None. If None, the automatically generated id for that
+ argument will be used.
+ If no ids are provided they will be generated automatically from
+ the argvalues.
+
+ :arg scope: if specified it denotes the scope of the parameters.
+ The scope is used for grouping tests by parameter instances.
+ It will also override any fixture-function defined scope, allowing
+ to set a dynamic scope using test context or configuration.
+ """
+ from _pytest.fixtures import scope2index
+ from _pytest.mark import ParameterSet
+
+ argnames, parameters = ParameterSet._for_parametrize(
+ argnames,
+ argvalues,
+ self.function,
+ self.config,
+ function_definition=self.definition,
+ )
+ del argvalues
+
+ if scope is None:
+ scope = _find_parametrized_scope(argnames, self._arg2fixturedefs, indirect)
+
+ self._validate_if_using_arg_names(argnames, indirect)
+
+ arg_values_types = self._resolve_arg_value_types(argnames, indirect)
+
+ ids = self._resolve_arg_ids(argnames, ids, parameters, item=self.definition)
+
+ scopenum = scope2index(
+ scope, descr="parametrize() call in {}".format(self.function.__name__)
+ )
+
+ # create the new calls: if we are parametrize() multiple times (by applying the decorator
+ # more than once) then we accumulate those calls generating the cartesian product
+ # of all calls
+ newcalls = []
+ for callspec in self._calls or [CallSpec2(self)]:
+ for param_index, (param_id, param_set) in enumerate(zip(ids, parameters)):
+ newcallspec = callspec.copy()
+ newcallspec.setmulti2(
+ arg_values_types,
+ argnames,
+ param_set.values,
+ param_id,
+ param_set.marks,
+ scopenum,
+ param_index,
+ )
+ newcalls.append(newcallspec)
+ self._calls = newcalls
+
+ def _resolve_arg_ids(self, argnames, ids, parameters, item):
+ """Resolves the actual ids for the given argnames, based on the ``ids`` parameter given
+ to ``parametrize``.
+
+ :param List[str] argnames: list of argument names passed to ``parametrize()``.
+ :param ids: the ids parameter of the parametrized call (see docs).
+ :param List[ParameterSet] parameters: the list of parameter values, same size as ``argnames``.
+ :param Item item: the item that generated this parametrized call.
+ :rtype: List[str]
+ :return: the list of ids for each argname given
+ """
+ from _pytest._io.saferepr import saferepr
+
+ idfn = None
+ if callable(ids):
+ idfn = ids
+ ids = None
+ if ids:
+ func_name = self.function.__name__
+ if len(ids) != len(parameters):
+ msg = "In {}: {} parameter sets specified, with different number of ids: {}"
+ fail(msg.format(func_name, len(parameters), len(ids)), pytrace=False)
+ for id_value in ids:
+ if id_value is not None and not isinstance(id_value, six.string_types):
+ msg = "In {}: ids must be list of strings, found: {} (type: {!r})"
+ fail(
+ msg.format(func_name, saferepr(id_value), type(id_value)),
+ pytrace=False,
+ )
+ ids = idmaker(argnames, parameters, idfn, ids, self.config, item=item)
+ return ids
+
+ def _resolve_arg_value_types(self, argnames, indirect):
+ """Resolves if each parametrized argument must be considered a parameter to a fixture or a "funcarg"
+ to the function, based on the ``indirect`` parameter of the parametrized() call.
+
+ :param List[str] argnames: list of argument names passed to ``parametrize()``.
+ :param indirect: same ``indirect`` parameter of ``parametrize()``.
+ :rtype: Dict[str, str]
+ A dict mapping each arg name to either:
+ * "params" if the argname should be the parameter of a fixture of the same name.
+ * "funcargs" if the argname should be a parameter to the parametrized test function.
+ """
+ valtypes = {}
+ if indirect is True:
+ valtypes = dict.fromkeys(argnames, "params")
+ elif indirect is False:
+ valtypes = dict.fromkeys(argnames, "funcargs")
+ elif isinstance(indirect, (tuple, list)):
+ valtypes = dict.fromkeys(argnames, "funcargs")
+ for arg in indirect:
+ if arg not in argnames:
+ fail(
+ "In {}: indirect fixture '{}' doesn't exist".format(
+ self.function.__name__, arg
+ ),
+ pytrace=False,
+ )
+ valtypes[arg] = "params"
+ return valtypes
+
+ def _validate_if_using_arg_names(self, argnames, indirect):
+ """
+ Check if all argnames are being used, by default values, or directly/indirectly.
+
+ :param List[str] argnames: list of argument names passed to ``parametrize()``.
+ :param indirect: same ``indirect`` parameter of ``parametrize()``.
+ :raise ValueError: if validation fails.
+ """
+ default_arg_names = set(get_default_arg_names(self.function))
+ func_name = self.function.__name__
+ for arg in argnames:
+ if arg not in self.fixturenames:
+ if arg in default_arg_names:
+ fail(
+ "In {}: function already takes an argument '{}' with a default value".format(
+ func_name, arg
+ ),
+ pytrace=False,
+ )
+ else:
+ if isinstance(indirect, (tuple, list)):
+ name = "fixture" if arg in indirect else "argument"
+ else:
+ name = "fixture" if indirect else "argument"
+ fail(
+ "In {}: function uses no {} '{}'".format(func_name, name, arg),
+ pytrace=False,
+ )
+
+
+def _find_parametrized_scope(argnames, arg2fixturedefs, indirect):
+ """Find the most appropriate scope for a parametrized call based on its arguments.
+
+ When there's at least one direct argument, always use "function" scope.
+
+ When a test function is parametrized and all its arguments are indirect
+ (e.g. fixtures), return the most narrow scope based on the fixtures used.
+
+ Related to issue #1832, based on code posted by @Kingdread.
+ """
+ from _pytest.fixtures import scopes
+
+ if isinstance(indirect, (list, tuple)):
+ all_arguments_are_fixtures = len(indirect) == len(argnames)
+ else:
+ all_arguments_are_fixtures = bool(indirect)
+
+ if all_arguments_are_fixtures:
+ fixturedefs = arg2fixturedefs or {}
+ used_scopes = [
+ fixturedef[0].scope
+ for name, fixturedef in fixturedefs.items()
+ if name in argnames
+ ]
+ if used_scopes:
+ # Takes the most narrow scope from used fixtures
+ for scope in reversed(scopes):
+ if scope in used_scopes:
+ return scope
+
+ return "function"
+
+
+def _ascii_escaped_by_config(val, config):
+ if config is None:
+ escape_option = False
+ else:
+ escape_option = config.getini(
+ "disable_test_id_escaping_and_forfeit_all_rights_to_community_support"
+ )
+ return val if escape_option else ascii_escaped(val)
+
+
+def _idval(val, argname, idx, idfn, item, config):
+ if idfn:
+ try:
+ generated_id = idfn(val)
+ if generated_id is not None:
+ val = generated_id
+ except Exception as e:
+ # See issue https://github.com/pytest-dev/pytest/issues/2169
+ msg = "{}: error raised while trying to determine id of parameter '{}' at position {}\n"
+ msg = msg.format(item.nodeid, argname, idx)
+ # we only append the exception type and message because on Python 2 reraise does nothing
+ msg += " {}: {}\n".format(type(e).__name__, e)
+ six.raise_from(ValueError(msg), e)
+ elif config:
+ hook_id = config.hook.pytest_make_parametrize_id(
+ config=config, val=val, argname=argname
+ )
+ if hook_id:
+ return hook_id
+
+ if isinstance(val, STRING_TYPES):
+ return _ascii_escaped_by_config(val, config)
+ elif val is None or isinstance(val, (float, int, bool)):
+ return str(val)
+ elif isinstance(val, REGEX_TYPE):
+ return ascii_escaped(val.pattern)
+ elif enum is not None and isinstance(val, enum.Enum):
+ return str(val)
+ elif (isclass(val) or isfunction(val)) and hasattr(val, "__name__"):
+ return val.__name__
+ return str(argname) + str(idx)
+
+
+def limit_idval(limit):
+ import functools
+
+ names = {}
+ limit -= 6
+ assert limit > 0
+
+ def decorator(func):
+ @functools.wraps(func)
+ def wrapper(*args, **kw):
+ idval = func(*args, **kw)
+ if len(idval) > limit:
+ prefix = idval[:limit]
+ # There might be same prefix for the different test cases - take item into account
+ name = "{}-{}".format(kw.get('item', ''), safe_str(prefix))
+ idx = names.setdefault(name, -1) + 1
+ names[name] = idx
+ idval = "{}-{}".format(safe_str(prefix), idx)
+ return idval
+
+ return wrapper
+
+ return decorator
+
+
+# XXX limit testnames in the name of sanity and readability
+@limit_idval(limit=500)
+def _idvalset(idx, parameterset, argnames, idfn, ids, item, config):
+ if parameterset.id is not None:
+ return parameterset.id
+ if ids is None or (idx >= len(ids) or ids[idx] is None):
+ this_id = [
+ _idval(val, argname, idx, idfn, item=item, config=config)
+ for val, argname in zip(parameterset.values, argnames)
+ ]
+ return "-".join(this_id)
+ else:
+ return _ascii_escaped_by_config(ids[idx], config)
+
+
+def idmaker(argnames, parametersets, idfn=None, ids=None, config=None, item=None):
+ ids = [
+ _idvalset(valindex, parameterset, argnames, idfn, ids, config=config, item=item)
+ for valindex, parameterset in enumerate(parametersets)
+ ]
+ if len(set(ids)) != len(ids):
+ # The ids are not unique
+ duplicates = [testid for testid in ids if ids.count(testid) > 1]
+ counters = collections.defaultdict(lambda: 0)
+ for index, testid in enumerate(ids):
+ if testid in duplicates:
+ ids[index] = testid + str(counters[testid])
+ counters[testid] += 1
+ return ids
+
+
+def show_fixtures_per_test(config):
+ from _pytest.main import wrap_session
+
+ return wrap_session(config, _show_fixtures_per_test)
+
+
+def _show_fixtures_per_test(config, session):
+ import _pytest.config
+
+ session.perform_collect()
+ curdir = py.path.local()
+ tw = _pytest.config.create_terminal_writer(config)
+ verbose = config.getvalue("verbose")
+
+ def get_best_relpath(func):
+ loc = getlocation(func, curdir)
+ return curdir.bestrelpath(loc)
+
+ def write_fixture(fixture_def):
+ argname = fixture_def.argname
+ if verbose <= 0 and argname.startswith("_"):
+ return
+ if verbose > 0:
+ bestrel = get_best_relpath(fixture_def.func)
+ funcargspec = "{} -- {}".format(argname, bestrel)
+ else:
+ funcargspec = argname
+ tw.line(funcargspec, green=True)
+ fixture_doc = fixture_def.func.__doc__
+ if fixture_doc:
+ write_docstring(tw, fixture_doc)
+ else:
+ tw.line(" no docstring available", red=True)
+
+ def write_item(item):
+ try:
+ info = item._fixtureinfo
+ except AttributeError:
+ # doctests items have no _fixtureinfo attribute
+ return
+ if not info.name2fixturedefs:
+ # this test item does not use any fixtures
+ return
+ tw.line()
+ tw.sep("-", "fixtures used by {}".format(item.name))
+ tw.sep("-", "({})".format(get_best_relpath(item.function)))
+ # dict key not used in loop but needed for sorting
+ for _, fixturedefs in sorted(info.name2fixturedefs.items()):
+ assert fixturedefs is not None
+ if not fixturedefs:
+ continue
+ # last item is expected to be the one used by the test item
+ write_fixture(fixturedefs[-1])
+
+ for session_item in session.items:
+ write_item(session_item)
+
+
+def showfixtures(config):
+ from _pytest.main import wrap_session
+
+ return wrap_session(config, _showfixtures_main)
+
+
+def _showfixtures_main(config, session):
+ import _pytest.config
+
+ session.perform_collect()
+ curdir = py.path.local()
+ tw = _pytest.config.create_terminal_writer(config)
+ verbose = config.getvalue("verbose")
+
+ fm = session._fixturemanager
+
+ available = []
+ seen = set()
+
+ for argname, fixturedefs in fm._arg2fixturedefs.items():
+ assert fixturedefs is not None
+ if not fixturedefs:
+ continue
+ for fixturedef in fixturedefs:
+ loc = getlocation(fixturedef.func, curdir)
+ if (fixturedef.argname, loc) in seen:
+ continue
+ seen.add((fixturedef.argname, loc))
+ available.append(
+ (
+ len(fixturedef.baseid),
+ fixturedef.func.__module__,
+ curdir.bestrelpath(loc),
+ fixturedef.argname,
+ fixturedef,
+ )
+ )
+
+ available.sort()
+ currentmodule = None
+ for baseid, module, bestrel, argname, fixturedef in available:
+ if currentmodule != module:
+ if not module.startswith("_pytest."):
+ tw.line()
+ tw.sep("-", "fixtures defined from %s" % (module,))
+ currentmodule = module
+ if verbose <= 0 and argname[0] == "_":
+ continue
+ tw.write(argname, green=True)
+ if fixturedef.scope != "function":
+ tw.write(" [%s scope]" % fixturedef.scope, cyan=True)
+ if verbose > 0:
+ tw.write(" -- %s" % bestrel, yellow=True)
+ tw.write("\n")
+ loc = getlocation(fixturedef.func, curdir)
+ doc = fixturedef.func.__doc__ or ""
+ if doc:
+ write_docstring(tw, doc)
+ else:
+ tw.line(" %s: no docstring available" % (loc,), red=True)
+ tw.line()
+
+
+def write_docstring(tw, doc, indent=" "):
+ doc = doc.rstrip()
+ if "\n" in doc:
+ firstline, rest = doc.split("\n", 1)
+ else:
+ firstline, rest = doc, ""
+
+ if firstline.strip():
+ tw.line(indent + firstline.strip())
+
+ if rest:
+ for line in dedent(rest).split("\n"):
+ tw.write(indent + line + "\n")
+
+
+class Function(FunctionMixin, nodes.Item, fixtures.FuncargnamesCompatAttr):
+ """ a Function Item is responsible for setting up and executing a
+ Python test function.
+ """
+
+ # disable since functions handle it themselves
+ _ALLOW_MARKERS = False
+
+ def __init__(
+ self,
+ name,
+ parent,
+ args=None,
+ config=None,
+ callspec=None,
+ callobj=NOTSET,
+ keywords=None,
+ session=None,
+ fixtureinfo=None,
+ originalname=None,
+ ):
+ super(Function, self).__init__(name, parent, config=config, session=session)
+ self._args = args
+ if callobj is not NOTSET:
+ self.obj = callobj
+
+ self.keywords.update(self.obj.__dict__)
+ self.own_markers.extend(get_unpacked_marks(self.obj))
+ if callspec:
+ self.callspec = callspec
+ # this is total hostile and a mess
+ # keywords are broken by design by now
+ # this will be redeemed later
+ for mark in callspec.marks:
+ # feel free to cry, this was broken for years before
+ # and keywords cant fix it per design
+ self.keywords[mark.name] = mark
+ self.own_markers.extend(normalize_mark_list(callspec.marks))
+ if keywords:
+ self.keywords.update(keywords)
+
+ # todo: this is a hell of a hack
+ # https://github.com/pytest-dev/pytest/issues/4569
+
+ self.keywords.update(
+ dict.fromkeys(
+ [
+ mark.name
+ for mark in self.iter_markers()
+ if mark.name not in self.keywords
+ ],
+ True,
+ )
+ )
+
+ if fixtureinfo is None:
+ fixtureinfo = self.session._fixturemanager.getfixtureinfo(
+ self, self.obj, self.cls, funcargs=True
+ )
+ self._fixtureinfo = fixtureinfo
+ self.fixturenames = fixtureinfo.names_closure
+ self._initrequest()
+
+ #: original function name, without any decorations (for example
+ #: parametrization adds a ``"[...]"`` suffix to function names).
+ #:
+ #: .. versionadded:: 3.0
+ self.originalname = originalname
+
+ def _initrequest(self):
+ self.funcargs = {}
+ self._request = fixtures.FixtureRequest(self)
+
+ @property
+ def function(self):
+ "underlying python 'function' object"
+ return getimfunc(self.obj)
+
+ def _getobj(self):
+ name = self.name
+ i = name.find("[") # parametrization
+ if i != -1:
+ name = name[:i]
+ return getattr(self.parent.obj, name)
+
+ @property
+ def _pyfuncitem(self):
+ "(compatonly) for code expecting pytest-2.2 style request objects"
+ return self
+
+ def runtest(self):
+ """ execute the underlying test function. """
+ self.ihook.pytest_pyfunc_call(pyfuncitem=self)
+
+ def setup(self):
+ super(Function, self).setup()
+ fixtures.fillfixtures(self)
+
+
+class FunctionDefinition(Function):
+ """
+ internal hack until we get actual definition nodes instead of the
+ crappy metafunc hack
+ """
+
+ def runtest(self):
+ raise RuntimeError("function definitions are not supposed to be used")
+
+ setup = runtest
diff --git a/contrib/python/pytest/py2/_pytest/python_api.py b/contrib/python/pytest/py2/_pytest/python_api.py
new file mode 100644
index 00000000000..f6e475c3a24
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/python_api.py
@@ -0,0 +1,743 @@
+# -*- coding: utf-8 -*-
+from __future__ import absolute_import
+
+import math
+import pprint
+import sys
+import warnings
+from decimal import Decimal
+from numbers import Number
+
+from more_itertools.more import always_iterable
+from six.moves import filterfalse
+from six.moves import zip
+
+import _pytest._code
+from _pytest import deprecated
+from _pytest.compat import isclass
+from _pytest.compat import Iterable
+from _pytest.compat import Mapping
+from _pytest.compat import Sized
+from _pytest.compat import STRING_TYPES
+from _pytest.outcomes import fail
+
+BASE_TYPE = (type, STRING_TYPES)
+
+
+def _cmp_raises_type_error(self, other):
+ """__cmp__ implementation which raises TypeError. Used
+ by Approx base classes to implement only == and != and raise a
+ TypeError for other comparisons.
+
+ Needed in Python 2 only, Python 3 all it takes is not implementing the
+ other operators at all.
+ """
+ __tracebackhide__ = True
+ raise TypeError(
+ "Comparison operators other than == and != not supported by approx objects"
+ )
+
+
+def _non_numeric_type_error(value, at):
+ at_str = " at {}".format(at) if at else ""
+ return TypeError(
+ "cannot make approximate comparisons to non-numeric values: {!r} {}".format(
+ value, at_str
+ )
+ )
+
+
+# builtin pytest.approx helper
+
+
+class ApproxBase(object):
+ """
+ Provide shared utilities for making approximate comparisons between numbers
+ or sequences of numbers.
+ """
+
+ # Tell numpy to use our `__eq__` operator instead of its.
+ __array_ufunc__ = None
+ __array_priority__ = 100
+
+ def __init__(self, expected, rel=None, abs=None, nan_ok=False):
+ __tracebackhide__ = True
+ self.expected = expected
+ self.abs = abs
+ self.rel = rel
+ self.nan_ok = nan_ok
+ self._check_type()
+
+ def __repr__(self):
+ raise NotImplementedError
+
+ def __eq__(self, actual):
+ return all(
+ a == self._approx_scalar(x) for a, x in self._yield_comparisons(actual)
+ )
+
+ __hash__ = None
+
+ def __ne__(self, actual):
+ return not (actual == self)
+
+ if sys.version_info[0] == 2:
+ __cmp__ = _cmp_raises_type_error
+
+ def _approx_scalar(self, x):
+ return ApproxScalar(x, rel=self.rel, abs=self.abs, nan_ok=self.nan_ok)
+
+ def _yield_comparisons(self, actual):
+ """
+ Yield all the pairs of numbers to be compared. This is used to
+ implement the `__eq__` method.
+ """
+ raise NotImplementedError
+
+ def _check_type(self):
+ """
+ Raise a TypeError if the expected value is not a valid type.
+ """
+ # This is only a concern if the expected value is a sequence. In every
+ # other case, the approx() function ensures that the expected value has
+ # a numeric type. For this reason, the default is to do nothing. The
+ # classes that deal with sequences should reimplement this method to
+ # raise if there are any non-numeric elements in the sequence.
+ pass
+
+
+def _recursive_list_map(f, x):
+ if isinstance(x, list):
+ return list(_recursive_list_map(f, xi) for xi in x)
+ else:
+ return f(x)
+
+
+class ApproxNumpy(ApproxBase):
+ """
+ Perform approximate comparisons where the expected value is numpy array.
+ """
+
+ def __repr__(self):
+ list_scalars = _recursive_list_map(self._approx_scalar, self.expected.tolist())
+ return "approx({!r})".format(list_scalars)
+
+ if sys.version_info[0] == 2:
+ __cmp__ = _cmp_raises_type_error
+
+ def __eq__(self, actual):
+ import numpy as np
+
+ # self.expected is supposed to always be an array here
+
+ if not np.isscalar(actual):
+ try:
+ actual = np.asarray(actual)
+ except: # noqa
+ raise TypeError("cannot compare '{}' to numpy.ndarray".format(actual))
+
+ if not np.isscalar(actual) and actual.shape != self.expected.shape:
+ return False
+
+ return ApproxBase.__eq__(self, actual)
+
+ def _yield_comparisons(self, actual):
+ import numpy as np
+
+ # `actual` can either be a numpy array or a scalar, it is treated in
+ # `__eq__` before being passed to `ApproxBase.__eq__`, which is the
+ # only method that calls this one.
+
+ if np.isscalar(actual):
+ for i in np.ndindex(self.expected.shape):
+ yield actual, self.expected[i].item()
+ else:
+ for i in np.ndindex(self.expected.shape):
+ yield actual[i].item(), self.expected[i].item()
+
+
+class ApproxMapping(ApproxBase):
+ """
+ Perform approximate comparisons where the expected value is a mapping with
+ numeric values (the keys can be anything).
+ """
+
+ def __repr__(self):
+ return "approx({!r})".format(
+ {k: self._approx_scalar(v) for k, v in self.expected.items()}
+ )
+
+ def __eq__(self, actual):
+ if set(actual.keys()) != set(self.expected.keys()):
+ return False
+
+ return ApproxBase.__eq__(self, actual)
+
+ def _yield_comparisons(self, actual):
+ for k in self.expected.keys():
+ yield actual[k], self.expected[k]
+
+ def _check_type(self):
+ __tracebackhide__ = True
+ for key, value in self.expected.items():
+ if isinstance(value, type(self.expected)):
+ msg = "pytest.approx() does not support nested dictionaries: key={!r} value={!r}\n full mapping={}"
+ raise TypeError(msg.format(key, value, pprint.pformat(self.expected)))
+ elif not isinstance(value, Number):
+ raise _non_numeric_type_error(self.expected, at="key={!r}".format(key))
+
+
+class ApproxSequencelike(ApproxBase):
+ """
+ Perform approximate comparisons where the expected value is a sequence of
+ numbers.
+ """
+
+ def __repr__(self):
+ seq_type = type(self.expected)
+ if seq_type not in (tuple, list, set):
+ seq_type = list
+ return "approx({!r})".format(
+ seq_type(self._approx_scalar(x) for x in self.expected)
+ )
+
+ def __eq__(self, actual):
+ if len(actual) != len(self.expected):
+ return False
+ return ApproxBase.__eq__(self, actual)
+
+ def _yield_comparisons(self, actual):
+ return zip(actual, self.expected)
+
+ def _check_type(self):
+ __tracebackhide__ = True
+ for index, x in enumerate(self.expected):
+ if isinstance(x, type(self.expected)):
+ msg = "pytest.approx() does not support nested data structures: {!r} at index {}\n full sequence: {}"
+ raise TypeError(msg.format(x, index, pprint.pformat(self.expected)))
+ elif not isinstance(x, Number):
+ raise _non_numeric_type_error(
+ self.expected, at="index {}".format(index)
+ )
+
+
+class ApproxScalar(ApproxBase):
+ """
+ Perform approximate comparisons where the expected value is a single number.
+ """
+
+ DEFAULT_ABSOLUTE_TOLERANCE = 1e-12
+ DEFAULT_RELATIVE_TOLERANCE = 1e-6
+
+ def __repr__(self):
+ """
+ Return a string communicating both the expected value and the tolerance
+ for the comparison being made, e.g. '1.0 +- 1e-6'. Use the unicode
+ plus/minus symbol if this is python3 (it's too hard to get right for
+ python2).
+ """
+ if isinstance(self.expected, complex):
+ return str(self.expected)
+
+ # Infinities aren't compared using tolerances, so don't show a
+ # tolerance.
+ if math.isinf(self.expected):
+ return str(self.expected)
+
+ # If a sensible tolerance can't be calculated, self.tolerance will
+ # raise a ValueError. In this case, display '???'.
+ try:
+ vetted_tolerance = "{:.1e}".format(self.tolerance)
+ except ValueError:
+ vetted_tolerance = "???"
+
+ if sys.version_info[0] == 2:
+ return "{} +- {}".format(self.expected, vetted_tolerance)
+ else:
+ return u"{} \u00b1 {}".format(self.expected, vetted_tolerance)
+
+ def __eq__(self, actual):
+ """
+ Return true if the given value is equal to the expected value within
+ the pre-specified tolerance.
+ """
+ if _is_numpy_array(actual):
+ # Call ``__eq__()`` manually to prevent infinite-recursion with
+ # numpy<1.13. See #3748.
+ return all(self.__eq__(a) for a in actual.flat)
+
+ # Short-circuit exact equality.
+ if actual == self.expected:
+ return True
+
+ # Allow the user to control whether NaNs are considered equal to each
+ # other or not. The abs() calls are for compatibility with complex
+ # numbers.
+ if math.isnan(abs(self.expected)):
+ return self.nan_ok and math.isnan(abs(actual))
+
+ # Infinity shouldn't be approximately equal to anything but itself, but
+ # if there's a relative tolerance, it will be infinite and infinity
+ # will seem approximately equal to everything. The equal-to-itself
+ # case would have been short circuited above, so here we can just
+ # return false if the expected value is infinite. The abs() call is
+ # for compatibility with complex numbers.
+ if math.isinf(abs(self.expected)):
+ return False
+
+ # Return true if the two numbers are within the tolerance.
+ return abs(self.expected - actual) <= self.tolerance
+
+ __hash__ = None
+
+ @property
+ def tolerance(self):
+ """
+ Return the tolerance for the comparison. This could be either an
+ absolute tolerance or a relative tolerance, depending on what the user
+ specified or which would be larger.
+ """
+
+ def set_default(x, default):
+ return x if x is not None else default
+
+ # Figure out what the absolute tolerance should be. ``self.abs`` is
+ # either None or a value specified by the user.
+ absolute_tolerance = set_default(self.abs, self.DEFAULT_ABSOLUTE_TOLERANCE)
+
+ if absolute_tolerance < 0:
+ raise ValueError(
+ "absolute tolerance can't be negative: {}".format(absolute_tolerance)
+ )
+ if math.isnan(absolute_tolerance):
+ raise ValueError("absolute tolerance can't be NaN.")
+
+ # If the user specified an absolute tolerance but not a relative one,
+ # just return the absolute tolerance.
+ if self.rel is None:
+ if self.abs is not None:
+ return absolute_tolerance
+
+ # Figure out what the relative tolerance should be. ``self.rel`` is
+ # either None or a value specified by the user. This is done after
+ # we've made sure the user didn't ask for an absolute tolerance only,
+ # because we don't want to raise errors about the relative tolerance if
+ # we aren't even going to use it.
+ relative_tolerance = set_default(
+ self.rel, self.DEFAULT_RELATIVE_TOLERANCE
+ ) * abs(self.expected)
+
+ if relative_tolerance < 0:
+ raise ValueError(
+ "relative tolerance can't be negative: {}".format(absolute_tolerance)
+ )
+ if math.isnan(relative_tolerance):
+ raise ValueError("relative tolerance can't be NaN.")
+
+ # Return the larger of the relative and absolute tolerances.
+ return max(relative_tolerance, absolute_tolerance)
+
+
+class ApproxDecimal(ApproxScalar):
+ """
+ Perform approximate comparisons where the expected value is a decimal.
+ """
+
+ DEFAULT_ABSOLUTE_TOLERANCE = Decimal("1e-12")
+ DEFAULT_RELATIVE_TOLERANCE = Decimal("1e-6")
+
+
+def approx(expected, rel=None, abs=None, nan_ok=False):
+ """
+ Assert that two numbers (or two sets of numbers) are equal to each other
+ within some tolerance.
+
+ Due to the `intricacies of floating-point arithmetic`__, numbers that we
+ would intuitively expect to be equal are not always so::
+
+ >>> 0.1 + 0.2 == 0.3
+ False
+
+ __ https://docs.python.org/3/tutorial/floatingpoint.html
+
+ This problem is commonly encountered when writing tests, e.g. when making
+ sure that floating-point values are what you expect them to be. One way to
+ deal with this problem is to assert that two floating-point numbers are
+ equal to within some appropriate tolerance::
+
+ >>> abs((0.1 + 0.2) - 0.3) < 1e-6
+ True
+
+ However, comparisons like this are tedious to write and difficult to
+ understand. Furthermore, absolute comparisons like the one above are
+ usually discouraged because there's no tolerance that works well for all
+ situations. ``1e-6`` is good for numbers around ``1``, but too small for
+ very big numbers and too big for very small ones. It's better to express
+ the tolerance as a fraction of the expected value, but relative comparisons
+ like that are even more difficult to write correctly and concisely.
+
+ The ``approx`` class performs floating-point comparisons using a syntax
+ that's as intuitive as possible::
+
+ >>> from pytest import approx
+ >>> 0.1 + 0.2 == approx(0.3)
+ True
+
+ The same syntax also works for sequences of numbers::
+
+ >>> (0.1 + 0.2, 0.2 + 0.4) == approx((0.3, 0.6))
+ True
+
+ Dictionary *values*::
+
+ >>> {'a': 0.1 + 0.2, 'b': 0.2 + 0.4} == approx({'a': 0.3, 'b': 0.6})
+ True
+
+ ``numpy`` arrays::
+
+ >>> import numpy as np # doctest: +SKIP
+ >>> np.array([0.1, 0.2]) + np.array([0.2, 0.4]) == approx(np.array([0.3, 0.6])) # doctest: +SKIP
+ True
+
+ And for a ``numpy`` array against a scalar::
+
+ >>> import numpy as np # doctest: +SKIP
+ >>> np.array([0.1, 0.2]) + np.array([0.2, 0.1]) == approx(0.3) # doctest: +SKIP
+ True
+
+ By default, ``approx`` considers numbers within a relative tolerance of
+ ``1e-6`` (i.e. one part in a million) of its expected value to be equal.
+ This treatment would lead to surprising results if the expected value was
+ ``0.0``, because nothing but ``0.0`` itself is relatively close to ``0.0``.
+ To handle this case less surprisingly, ``approx`` also considers numbers
+ within an absolute tolerance of ``1e-12`` of its expected value to be
+ equal. Infinity and NaN are special cases. Infinity is only considered
+ equal to itself, regardless of the relative tolerance. NaN is not
+ considered equal to anything by default, but you can make it be equal to
+ itself by setting the ``nan_ok`` argument to True. (This is meant to
+ facilitate comparing arrays that use NaN to mean "no data".)
+
+ Both the relative and absolute tolerances can be changed by passing
+ arguments to the ``approx`` constructor::
+
+ >>> 1.0001 == approx(1)
+ False
+ >>> 1.0001 == approx(1, rel=1e-3)
+ True
+ >>> 1.0001 == approx(1, abs=1e-3)
+ True
+
+ If you specify ``abs`` but not ``rel``, the comparison will not consider
+ the relative tolerance at all. In other words, two numbers that are within
+ the default relative tolerance of ``1e-6`` will still be considered unequal
+ if they exceed the specified absolute tolerance. If you specify both
+ ``abs`` and ``rel``, the numbers will be considered equal if either
+ tolerance is met::
+
+ >>> 1 + 1e-8 == approx(1)
+ True
+ >>> 1 + 1e-8 == approx(1, abs=1e-12)
+ False
+ >>> 1 + 1e-8 == approx(1, rel=1e-6, abs=1e-12)
+ True
+
+ If you're thinking about using ``approx``, then you might want to know how
+ it compares to other good ways of comparing floating-point numbers. All of
+ these algorithms are based on relative and absolute tolerances and should
+ agree for the most part, but they do have meaningful differences:
+
+ - ``math.isclose(a, b, rel_tol=1e-9, abs_tol=0.0)``: True if the relative
+ tolerance is met w.r.t. either ``a`` or ``b`` or if the absolute
+ tolerance is met. Because the relative tolerance is calculated w.r.t.
+ both ``a`` and ``b``, this test is symmetric (i.e. neither ``a`` nor
+ ``b`` is a "reference value"). You have to specify an absolute tolerance
+ if you want to compare to ``0.0`` because there is no tolerance by
+ default. Only available in python>=3.5. `More information...`__
+
+ __ https://docs.python.org/3/library/math.html#math.isclose
+
+ - ``numpy.isclose(a, b, rtol=1e-5, atol=1e-8)``: True if the difference
+ between ``a`` and ``b`` is less that the sum of the relative tolerance
+ w.r.t. ``b`` and the absolute tolerance. Because the relative tolerance
+ is only calculated w.r.t. ``b``, this test is asymmetric and you can
+ think of ``b`` as the reference value. Support for comparing sequences
+ is provided by ``numpy.allclose``. `More information...`__
+
+ __ http://docs.scipy.org/doc/numpy-1.10.0/reference/generated/numpy.isclose.html
+
+ - ``unittest.TestCase.assertAlmostEqual(a, b)``: True if ``a`` and ``b``
+ are within an absolute tolerance of ``1e-7``. No relative tolerance is
+ considered and the absolute tolerance cannot be changed, so this function
+ is not appropriate for very large or very small numbers. Also, it's only
+ available in subclasses of ``unittest.TestCase`` and it's ugly because it
+ doesn't follow PEP8. `More information...`__
+
+ __ https://docs.python.org/3/library/unittest.html#unittest.TestCase.assertAlmostEqual
+
+ - ``a == pytest.approx(b, rel=1e-6, abs=1e-12)``: True if the relative
+ tolerance is met w.r.t. ``b`` or if the absolute tolerance is met.
+ Because the relative tolerance is only calculated w.r.t. ``b``, this test
+ is asymmetric and you can think of ``b`` as the reference value. In the
+ special case that you explicitly specify an absolute tolerance but not a
+ relative tolerance, only the absolute tolerance is considered.
+
+ .. warning::
+
+ .. versionchanged:: 3.2
+
+ In order to avoid inconsistent behavior, ``TypeError`` is
+ raised for ``>``, ``>=``, ``<`` and ``<=`` comparisons.
+ The example below illustrates the problem::
+
+ assert approx(0.1) > 0.1 + 1e-10 # calls approx(0.1).__gt__(0.1 + 1e-10)
+ assert 0.1 + 1e-10 > approx(0.1) # calls approx(0.1).__lt__(0.1 + 1e-10)
+
+ In the second example one expects ``approx(0.1).__le__(0.1 + 1e-10)``
+ to be called. But instead, ``approx(0.1).__lt__(0.1 + 1e-10)`` is used to
+ comparison. This is because the call hierarchy of rich comparisons
+ follows a fixed behavior. `More information...`__
+
+ __ https://docs.python.org/3/reference/datamodel.html#object.__ge__
+ """
+
+ # Delegate the comparison to a class that knows how to deal with the type
+ # of the expected value (e.g. int, float, list, dict, numpy.array, etc).
+ #
+ # The primary responsibility of these classes is to implement ``__eq__()``
+ # and ``__repr__()``. The former is used to actually check if some
+ # "actual" value is equivalent to the given expected value within the
+ # allowed tolerance. The latter is used to show the user the expected
+ # value and tolerance, in the case that a test failed.
+ #
+ # The actual logic for making approximate comparisons can be found in
+ # ApproxScalar, which is used to compare individual numbers. All of the
+ # other Approx classes eventually delegate to this class. The ApproxBase
+ # class provides some convenient methods and overloads, but isn't really
+ # essential.
+
+ __tracebackhide__ = True
+
+ if isinstance(expected, Decimal):
+ cls = ApproxDecimal
+ elif isinstance(expected, Number):
+ cls = ApproxScalar
+ elif isinstance(expected, Mapping):
+ cls = ApproxMapping
+ elif _is_numpy_array(expected):
+ cls = ApproxNumpy
+ elif (
+ isinstance(expected, Iterable)
+ and isinstance(expected, Sized)
+ and not isinstance(expected, STRING_TYPES)
+ ):
+ cls = ApproxSequencelike
+ else:
+ raise _non_numeric_type_error(expected, at=None)
+
+ return cls(expected, rel, abs, nan_ok)
+
+
+def _is_numpy_array(obj):
+ """
+ Return true if the given object is a numpy array. Make a special effort to
+ avoid importing numpy unless it's really necessary.
+ """
+ import sys
+
+ np = sys.modules.get("numpy")
+ if np is not None:
+ return isinstance(obj, np.ndarray)
+ return False
+
+
+# builtin pytest.raises helper
+
+
+def raises(expected_exception, *args, **kwargs):
+ r"""
+ Assert that a code block/function call raises ``expected_exception``
+ or raise a failure exception otherwise.
+
+ :kwparam match: if specified, a string containing a regular expression,
+ or a regular expression object, that is tested against the string
+ representation of the exception using ``re.search``. To match a literal
+ string that may contain `special characters`__, the pattern can
+ first be escaped with ``re.escape``.
+
+ __ https://docs.python.org/3/library/re.html#regular-expression-syntax
+
+ :kwparam message: **(deprecated since 4.1)** if specified, provides a custom failure message
+ if the exception is not raised. See :ref:`the deprecation docs <raises message deprecated>` for a workaround.
+
+ .. currentmodule:: _pytest._code
+
+ Use ``pytest.raises`` as a context manager, which will capture the exception of the given
+ type::
+
+ >>> with raises(ZeroDivisionError):
+ ... 1/0
+
+ If the code block does not raise the expected exception (``ZeroDivisionError`` in the example
+ above), or no exception at all, the check will fail instead.
+
+ You can also use the keyword argument ``match`` to assert that the
+ exception matches a text or regex::
+
+ >>> with raises(ValueError, match='must be 0 or None'):
+ ... raise ValueError("value must be 0 or None")
+
+ >>> with raises(ValueError, match=r'must be \d+$'):
+ ... raise ValueError("value must be 42")
+
+ The context manager produces an :class:`ExceptionInfo` object which can be used to inspect the
+ details of the captured exception::
+
+ >>> with raises(ValueError) as exc_info:
+ ... raise ValueError("value must be 42")
+ >>> assert exc_info.type is ValueError
+ >>> assert exc_info.value.args[0] == "value must be 42"
+
+ .. deprecated:: 4.1
+
+ In the context manager form you may use the keyword argument
+ ``message`` to specify a custom failure message that will be displayed
+ in case the ``pytest.raises`` check fails. This has been deprecated as it
+ is considered error prone as users often mean to use ``match`` instead.
+ See :ref:`the deprecation docs <raises message deprecated>` for a workaround.
+
+ .. note::
+
+ When using ``pytest.raises`` as a context manager, it's worthwhile to
+ note that normal context manager rules apply and that the exception
+ raised *must* be the final line in the scope of the context manager.
+ Lines of code after that, within the scope of the context manager will
+ not be executed. For example::
+
+ >>> value = 15
+ >>> with raises(ValueError) as exc_info:
+ ... if value > 10:
+ ... raise ValueError("value must be <= 10")
+ ... assert exc_info.type is ValueError # this will not execute
+
+ Instead, the following approach must be taken (note the difference in
+ scope)::
+
+ >>> with raises(ValueError) as exc_info:
+ ... if value > 10:
+ ... raise ValueError("value must be <= 10")
+ ...
+ >>> assert exc_info.type is ValueError
+
+ **Using with** ``pytest.mark.parametrize``
+
+ When using :ref:`pytest.mark.parametrize ref`
+ it is possible to parametrize tests such that
+ some runs raise an exception and others do not.
+
+ See :ref:`parametrizing_conditional_raising` for an example.
+
+ **Legacy form**
+
+ It is possible to specify a callable by passing a to-be-called lambda::
+
+ >>> raises(ZeroDivisionError, lambda: 1/0)
+ <ExceptionInfo ...>
+
+ or you can specify an arbitrary callable with arguments::
+
+ >>> def f(x): return 1/x
+ ...
+ >>> raises(ZeroDivisionError, f, 0)
+ <ExceptionInfo ...>
+ >>> raises(ZeroDivisionError, f, x=0)
+ <ExceptionInfo ...>
+
+ The form above is fully supported but discouraged for new code because the
+ context manager form is regarded as more readable and less error-prone.
+
+ .. note::
+ Similar to caught exception objects in Python, explicitly clearing
+ local references to returned ``ExceptionInfo`` objects can
+ help the Python interpreter speed up its garbage collection.
+
+ Clearing those references breaks a reference cycle
+ (``ExceptionInfo`` --> caught exception --> frame stack raising
+ the exception --> current frame stack --> local variables -->
+ ``ExceptionInfo``) which makes Python keep all objects referenced
+ from that cycle (including all local variables in the current
+ frame) alive until the next cyclic garbage collection run. See the
+ official Python ``try`` statement documentation for more detailed
+ information.
+
+ """
+ __tracebackhide__ = True
+ for exc in filterfalse(isclass, always_iterable(expected_exception, BASE_TYPE)):
+ msg = (
+ "exceptions must be old-style classes or"
+ " derived from BaseException, not %s"
+ )
+ raise TypeError(msg % type(exc))
+
+ message = "DID NOT RAISE {}".format(expected_exception)
+ match_expr = None
+
+ if not args:
+ if "message" in kwargs:
+ message = kwargs.pop("message")
+ warnings.warn(deprecated.RAISES_MESSAGE_PARAMETER, stacklevel=2)
+ if "match" in kwargs:
+ match_expr = kwargs.pop("match")
+ if kwargs:
+ msg = "Unexpected keyword arguments passed to pytest.raises: "
+ msg += ", ".join(sorted(kwargs))
+ raise TypeError(msg)
+ return RaisesContext(expected_exception, message, match_expr)
+ elif isinstance(args[0], str):
+ warnings.warn(deprecated.RAISES_EXEC, stacklevel=2)
+ (code,) = args
+ assert isinstance(code, str)
+ frame = sys._getframe(1)
+ loc = frame.f_locals.copy()
+ loc.update(kwargs)
+ # print "raises frame scope: %r" % frame.f_locals
+ try:
+ code = _pytest._code.Source(code).compile(_genframe=frame)
+ exec(code, frame.f_globals, loc)
+ # XXX didn't mean f_globals == f_locals something special?
+ # this is destroyed here ...
+ except expected_exception:
+ return _pytest._code.ExceptionInfo.from_current()
+ else:
+ func = args[0]
+ try:
+ func(*args[1:], **kwargs)
+ except expected_exception:
+ return _pytest._code.ExceptionInfo.from_current()
+ fail(message)
+
+
+raises.Exception = fail.Exception
+
+
+class RaisesContext(object):
+ def __init__(self, expected_exception, message, match_expr):
+ self.expected_exception = expected_exception
+ self.message = message
+ self.match_expr = match_expr
+ self.excinfo = None
+
+ def __enter__(self):
+ self.excinfo = _pytest._code.ExceptionInfo.for_later()
+ return self.excinfo
+
+ def __exit__(self, *tp):
+ __tracebackhide__ = True
+ if tp[0] is None:
+ fail(self.message)
+ self.excinfo.__init__(tp)
+ suppress_exception = issubclass(self.excinfo.type, self.expected_exception)
+ if sys.version_info[0] == 2 and suppress_exception:
+ sys.exc_clear()
+ if self.match_expr is not None and suppress_exception:
+ self.excinfo.match(self.match_expr)
+ return suppress_exception
diff --git a/contrib/python/pytest/py2/_pytest/recwarn.py b/contrib/python/pytest/py2/_pytest/recwarn.py
new file mode 100644
index 00000000000..7abf2e93550
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/recwarn.py
@@ -0,0 +1,251 @@
+# -*- coding: utf-8 -*-
+""" recording warnings during test function execution. """
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import inspect
+import re
+import sys
+import warnings
+
+import six
+
+import _pytest._code
+from _pytest.deprecated import PYTEST_WARNS_UNKNOWN_KWARGS
+from _pytest.deprecated import WARNS_EXEC
+from _pytest.fixtures import yield_fixture
+from _pytest.outcomes import fail
+
+
+@yield_fixture
+def recwarn():
+ """Return a :class:`WarningsRecorder` instance that records all warnings emitted by test functions.
+
+ See http://docs.python.org/library/warnings.html for information
+ on warning categories.
+ """
+ wrec = WarningsRecorder()
+ with wrec:
+ warnings.simplefilter("default")
+ yield wrec
+
+
+def deprecated_call(func=None, *args, **kwargs):
+ """context manager that can be used to ensure a block of code triggers a
+ ``DeprecationWarning`` or ``PendingDeprecationWarning``::
+
+ >>> import warnings
+ >>> def api_call_v2():
+ ... warnings.warn('use v3 of this api', DeprecationWarning)
+ ... return 200
+
+ >>> with deprecated_call():
+ ... assert api_call_v2() == 200
+
+ ``deprecated_call`` can also be used by passing a function and ``*args`` and ``*kwargs``,
+ in which case it will ensure calling ``func(*args, **kwargs)`` produces one of the warnings
+ types above.
+ """
+ __tracebackhide__ = True
+ if func is not None:
+ args = (func,) + args
+ return warns((DeprecationWarning, PendingDeprecationWarning), *args, **kwargs)
+
+
+def warns(expected_warning, *args, **kwargs):
+ r"""Assert that code raises a particular class of warning.
+
+ Specifically, the parameter ``expected_warning`` can be a warning class or
+ sequence of warning classes, and the inside the ``with`` block must issue a warning of that class or
+ classes.
+
+ This helper produces a list of :class:`warnings.WarningMessage` objects,
+ one for each warning raised.
+
+ This function can be used as a context manager, or any of the other ways
+ ``pytest.raises`` can be used::
+
+ >>> with warns(RuntimeWarning):
+ ... warnings.warn("my warning", RuntimeWarning)
+
+ In the context manager form you may use the keyword argument ``match`` to assert
+ that the exception matches a text or regex::
+
+ >>> with warns(UserWarning, match='must be 0 or None'):
+ ... warnings.warn("value must be 0 or None", UserWarning)
+
+ >>> with warns(UserWarning, match=r'must be \d+$'):
+ ... warnings.warn("value must be 42", UserWarning)
+
+ >>> with warns(UserWarning, match=r'must be \d+$'):
+ ... warnings.warn("this is not here", UserWarning)
+ Traceback (most recent call last):
+ ...
+ Failed: DID NOT WARN. No warnings of type ...UserWarning... was emitted...
+
+ """
+ __tracebackhide__ = True
+ if not args:
+ match_expr = kwargs.pop("match", None)
+ if kwargs:
+ warnings.warn(
+ PYTEST_WARNS_UNKNOWN_KWARGS.format(args=sorted(kwargs)), stacklevel=2
+ )
+ return WarningsChecker(expected_warning, match_expr=match_expr)
+ elif isinstance(args[0], str):
+ warnings.warn(WARNS_EXEC, stacklevel=2)
+ (code,) = args
+ assert isinstance(code, str)
+ frame = sys._getframe(1)
+ loc = frame.f_locals.copy()
+ loc.update(kwargs)
+
+ with WarningsChecker(expected_warning):
+ code = _pytest._code.Source(code).compile()
+ exec(code, frame.f_globals, loc)
+ else:
+ func = args[0]
+ with WarningsChecker(expected_warning):
+ return func(*args[1:], **kwargs)
+
+
+class WarningsRecorder(warnings.catch_warnings):
+ """A context manager to record raised warnings.
+
+ Adapted from `warnings.catch_warnings`.
+ """
+
+ def __init__(self):
+ super(WarningsRecorder, self).__init__(record=True)
+ self._entered = False
+ self._list = []
+
+ @property
+ def list(self):
+ """The list of recorded warnings."""
+ return self._list
+
+ def __getitem__(self, i):
+ """Get a recorded warning by index."""
+ return self._list[i]
+
+ def __iter__(self):
+ """Iterate through the recorded warnings."""
+ return iter(self._list)
+
+ def __len__(self):
+ """The number of recorded warnings."""
+ return len(self._list)
+
+ def pop(self, cls=Warning):
+ """Pop the first recorded warning, raise exception if not exists."""
+ for i, w in enumerate(self._list):
+ if issubclass(w.category, cls):
+ return self._list.pop(i)
+ __tracebackhide__ = True
+ raise AssertionError("%r not found in warning list" % cls)
+
+ def clear(self):
+ """Clear the list of recorded warnings."""
+ self._list[:] = []
+
+ def __enter__(self):
+ if self._entered:
+ __tracebackhide__ = True
+ raise RuntimeError("Cannot enter %r twice" % self)
+ self._list = super(WarningsRecorder, self).__enter__()
+ warnings.simplefilter("always")
+ # python3 keeps track of a "filter version", when the filters are
+ # updated previously seen warnings can be re-warned. python2 has no
+ # concept of this so we must reset the warnings registry manually.
+ # trivial patching of `warnings.warn` seems to be enough somehow?
+ if six.PY2:
+
+ def warn(message, category=None, stacklevel=1):
+ # duplicate the stdlib logic due to
+ # bad handing in the c version of warnings
+ if isinstance(message, Warning):
+ category = message.__class__
+ # Check category argument
+ if category is None:
+ category = UserWarning
+ assert issubclass(category, Warning)
+
+ # emulate resetting the warn registry
+ f_globals = sys._getframe(stacklevel).f_globals
+ if "__warningregistry__" in f_globals:
+ orig = f_globals["__warningregistry__"]
+ f_globals["__warningregistry__"] = None
+ try:
+ return self._saved_warn(message, category, stacklevel + 1)
+ finally:
+ f_globals["__warningregistry__"] = orig
+ else:
+ return self._saved_warn(message, category, stacklevel + 1)
+
+ warnings.warn, self._saved_warn = warn, warnings.warn
+ return self
+
+ def __exit__(self, *exc_info):
+ if not self._entered:
+ __tracebackhide__ = True
+ raise RuntimeError("Cannot exit %r without entering first" % self)
+ # see above where `self._saved_warn` is assigned
+ if six.PY2:
+ warnings.warn = self._saved_warn
+ super(WarningsRecorder, self).__exit__(*exc_info)
+
+ # Built-in catch_warnings does not reset entered state so we do it
+ # manually here for this context manager to become reusable.
+ self._entered = False
+
+
+class WarningsChecker(WarningsRecorder):
+ def __init__(self, expected_warning=None, match_expr=None):
+ super(WarningsChecker, self).__init__()
+
+ msg = "exceptions must be old-style classes or derived from Warning, not %s"
+ if isinstance(expected_warning, tuple):
+ for exc in expected_warning:
+ if not inspect.isclass(exc):
+ raise TypeError(msg % type(exc))
+ elif inspect.isclass(expected_warning):
+ expected_warning = (expected_warning,)
+ elif expected_warning is not None:
+ raise TypeError(msg % type(expected_warning))
+
+ self.expected_warning = expected_warning
+ self.match_expr = match_expr
+
+ def __exit__(self, *exc_info):
+ super(WarningsChecker, self).__exit__(*exc_info)
+
+ __tracebackhide__ = True
+
+ # only check if we're not currently handling an exception
+ if all(a is None for a in exc_info):
+ if self.expected_warning is not None:
+ if not any(issubclass(r.category, self.expected_warning) for r in self):
+ __tracebackhide__ = True
+ fail(
+ "DID NOT WARN. No warnings of type {} was emitted. "
+ "The list of emitted warnings is: {}.".format(
+ self.expected_warning, [each.message for each in self]
+ )
+ )
+ elif self.match_expr is not None:
+ for r in self:
+ if issubclass(r.category, self.expected_warning):
+ if re.compile(self.match_expr).search(str(r.message)):
+ break
+ else:
+ fail(
+ "DID NOT WARN. No warnings of type {} matching"
+ " ('{}') was emitted. The list of emitted warnings"
+ " is: {}.".format(
+ self.expected_warning,
+ self.match_expr,
+ [each.message for each in self],
+ )
+ )
diff --git a/contrib/python/pytest/py2/_pytest/reports.py b/contrib/python/pytest/py2/_pytest/reports.py
new file mode 100644
index 00000000000..0bba6762c33
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/reports.py
@@ -0,0 +1,435 @@
+# -*- coding: utf-8 -*-
+from pprint import pprint
+
+import py
+import six
+
+from _pytest._code.code import ExceptionInfo
+from _pytest._code.code import ReprEntry
+from _pytest._code.code import ReprEntryNative
+from _pytest._code.code import ReprExceptionInfo
+from _pytest._code.code import ReprFileLocation
+from _pytest._code.code import ReprFuncArgs
+from _pytest._code.code import ReprLocals
+from _pytest._code.code import ReprTraceback
+from _pytest._code.code import TerminalRepr
+from _pytest.outcomes import skip
+from _pytest.pathlib import Path
+
+
+def getslaveinfoline(node):
+ try:
+ return node._slaveinfocache
+ except AttributeError:
+ d = node.slaveinfo
+ ver = "%s.%s.%s" % d["version_info"][:3]
+ node._slaveinfocache = s = "[%s] %s -- Python %s %s" % (
+ d["id"],
+ d["sysplatform"],
+ ver,
+ d["executable"],
+ )
+ return s
+
+
+class BaseReport(object):
+ when = None
+ location = None
+
+ def __init__(self, **kw):
+ self.__dict__.update(kw)
+
+ def toterminal(self, out):
+ if hasattr(self, "node"):
+ out.line(getslaveinfoline(self.node))
+
+ longrepr = self.longrepr
+ if longrepr is None:
+ return
+
+ if hasattr(longrepr, "toterminal"):
+ longrepr.toterminal(out)
+ else:
+ try:
+ out.line(longrepr)
+ except UnicodeEncodeError:
+ out.line("<unprintable longrepr>")
+
+ def get_sections(self, prefix):
+ for name, content in self.sections:
+ if name.startswith(prefix):
+ yield prefix, content
+
+ @property
+ def longreprtext(self):
+ """
+ Read-only property that returns the full string representation
+ of ``longrepr``.
+
+ .. versionadded:: 3.0
+ """
+ tw = py.io.TerminalWriter(stringio=True)
+ tw.hasmarkup = False
+ self.toterminal(tw)
+ exc = tw.stringio.getvalue()
+ return exc.strip()
+
+ @property
+ def caplog(self):
+ """Return captured log lines, if log capturing is enabled
+
+ .. versionadded:: 3.5
+ """
+ return "\n".join(
+ content for (prefix, content) in self.get_sections("Captured log")
+ )
+
+ @property
+ def capstdout(self):
+ """Return captured text from stdout, if capturing is enabled
+
+ .. versionadded:: 3.0
+ """
+ return "".join(
+ content for (prefix, content) in self.get_sections("Captured stdout")
+ )
+
+ @property
+ def capstderr(self):
+ """Return captured text from stderr, if capturing is enabled
+
+ .. versionadded:: 3.0
+ """
+ return "".join(
+ content for (prefix, content) in self.get_sections("Captured stderr")
+ )
+
+ passed = property(lambda x: x.outcome == "passed")
+ failed = property(lambda x: x.outcome == "failed")
+ skipped = property(lambda x: x.outcome == "skipped")
+
+ @property
+ def fspath(self):
+ return self.nodeid.split("::")[0]
+
+ @property
+ def count_towards_summary(self):
+ """
+ **Experimental**
+
+ Returns True if this report should be counted towards the totals shown at the end of the
+ test session: "1 passed, 1 failure, etc".
+
+ .. note::
+
+ This function is considered **experimental**, so beware that it is subject to changes
+ even in patch releases.
+ """
+ return True
+
+ @property
+ def head_line(self):
+ """
+ **Experimental**
+
+ Returns the head line shown with longrepr output for this report, more commonly during
+ traceback representation during failures::
+
+ ________ Test.foo ________
+
+
+ In the example above, the head_line is "Test.foo".
+
+ .. note::
+
+ This function is considered **experimental**, so beware that it is subject to changes
+ even in patch releases.
+ """
+ if self.location is not None:
+ fspath, lineno, domain = self.location
+ return domain
+
+ def _get_verbose_word(self, config):
+ _category, _short, verbose = config.hook.pytest_report_teststatus(
+ report=self, config=config
+ )
+ return verbose
+
+ def _to_json(self):
+ """
+ This was originally the serialize_report() function from xdist (ca03269).
+
+ Returns the contents of this report as a dict of builtin entries, suitable for
+ serialization.
+
+ Experimental method.
+ """
+
+ def disassembled_report(rep):
+ reprtraceback = rep.longrepr.reprtraceback.__dict__.copy()
+ reprcrash = rep.longrepr.reprcrash.__dict__.copy()
+
+ new_entries = []
+ for entry in reprtraceback["reprentries"]:
+ entry_data = {
+ "type": type(entry).__name__,
+ "data": entry.__dict__.copy(),
+ }
+ for key, value in entry_data["data"].items():
+ if hasattr(value, "__dict__"):
+ entry_data["data"][key] = value.__dict__.copy()
+ new_entries.append(entry_data)
+
+ reprtraceback["reprentries"] = new_entries
+
+ return {
+ "reprcrash": reprcrash,
+ "reprtraceback": reprtraceback,
+ "sections": rep.longrepr.sections,
+ }
+
+ d = self.__dict__.copy()
+ if hasattr(self.longrepr, "toterminal"):
+ if hasattr(self.longrepr, "reprtraceback") and hasattr(
+ self.longrepr, "reprcrash"
+ ):
+ d["longrepr"] = disassembled_report(self)
+ else:
+ d["longrepr"] = six.text_type(self.longrepr)
+ else:
+ d["longrepr"] = self.longrepr
+ for name in d:
+ if isinstance(d[name], (py.path.local, Path)):
+ d[name] = str(d[name])
+ elif name == "result":
+ d[name] = None # for now
+ return d
+
+ @classmethod
+ def _from_json(cls, reportdict):
+ """
+ This was originally the serialize_report() function from xdist (ca03269).
+
+ Factory method that returns either a TestReport or CollectReport, depending on the calling
+ class. It's the callers responsibility to know which class to pass here.
+
+ Experimental method.
+ """
+ if reportdict["longrepr"]:
+ if (
+ "reprcrash" in reportdict["longrepr"]
+ and "reprtraceback" in reportdict["longrepr"]
+ ):
+
+ reprtraceback = reportdict["longrepr"]["reprtraceback"]
+ reprcrash = reportdict["longrepr"]["reprcrash"]
+
+ unserialized_entries = []
+ reprentry = None
+ for entry_data in reprtraceback["reprentries"]:
+ data = entry_data["data"]
+ entry_type = entry_data["type"]
+ if entry_type == "ReprEntry":
+ reprfuncargs = None
+ reprfileloc = None
+ reprlocals = None
+ if data["reprfuncargs"]:
+ reprfuncargs = ReprFuncArgs(**data["reprfuncargs"])
+ if data["reprfileloc"]:
+ reprfileloc = ReprFileLocation(**data["reprfileloc"])
+ if data["reprlocals"]:
+ reprlocals = ReprLocals(data["reprlocals"]["lines"])
+
+ reprentry = ReprEntry(
+ lines=data["lines"],
+ reprfuncargs=reprfuncargs,
+ reprlocals=reprlocals,
+ filelocrepr=reprfileloc,
+ style=data["style"],
+ )
+ elif entry_type == "ReprEntryNative":
+ reprentry = ReprEntryNative(data["lines"])
+ else:
+ _report_unserialization_failure(entry_type, cls, reportdict)
+ unserialized_entries.append(reprentry)
+ reprtraceback["reprentries"] = unserialized_entries
+
+ exception_info = ReprExceptionInfo(
+ reprtraceback=ReprTraceback(**reprtraceback),
+ reprcrash=ReprFileLocation(**reprcrash),
+ )
+
+ for section in reportdict["longrepr"]["sections"]:
+ exception_info.addsection(*section)
+ reportdict["longrepr"] = exception_info
+
+ return cls(**reportdict)
+
+
+def _report_unserialization_failure(type_name, report_class, reportdict):
+ url = "https://github.com/pytest-dev/pytest/issues"
+ stream = py.io.TextIO()
+ pprint("-" * 100, stream=stream)
+ pprint("INTERNALERROR: Unknown entry type returned: %s" % type_name, stream=stream)
+ pprint("report_name: %s" % report_class, stream=stream)
+ pprint(reportdict, stream=stream)
+ pprint("Please report this bug at %s" % url, stream=stream)
+ pprint("-" * 100, stream=stream)
+ raise RuntimeError(stream.getvalue())
+
+
+class TestReport(BaseReport):
+ """ Basic test report object (also used for setup and teardown calls if
+ they fail).
+ """
+
+ __test__ = False
+
+ def __init__(
+ self,
+ nodeid,
+ location,
+ keywords,
+ outcome,
+ longrepr,
+ when,
+ sections=(),
+ duration=0,
+ user_properties=None,
+ **extra
+ ):
+ #: normalized collection node id
+ self.nodeid = nodeid
+
+ #: a (filesystempath, lineno, domaininfo) tuple indicating the
+ #: actual location of a test item - it might be different from the
+ #: collected one e.g. if a method is inherited from a different module.
+ self.location = location
+
+ #: a name -> value dictionary containing all keywords and
+ #: markers associated with a test invocation.
+ self.keywords = keywords
+
+ #: test outcome, always one of "passed", "failed", "skipped".
+ self.outcome = outcome
+
+ #: None or a failure representation.
+ self.longrepr = longrepr
+
+ #: one of 'setup', 'call', 'teardown' to indicate runtest phase.
+ self.when = when
+
+ #: user properties is a list of tuples (name, value) that holds user
+ #: defined properties of the test
+ self.user_properties = list(user_properties or [])
+
+ #: list of pairs ``(str, str)`` of extra information which needs to
+ #: marshallable. Used by pytest to add captured text
+ #: from ``stdout`` and ``stderr``, but may be used by other plugins
+ #: to add arbitrary information to reports.
+ self.sections = list(sections)
+
+ #: time it took to run just the test
+ self.duration = duration
+
+ self.__dict__.update(extra)
+
+ def __repr__(self):
+ return "<%s %r when=%r outcome=%r>" % (
+ self.__class__.__name__,
+ self.nodeid,
+ self.when,
+ self.outcome,
+ )
+
+ @classmethod
+ def from_item_and_call(cls, item, call):
+ """
+ Factory method to create and fill a TestReport with standard item and call info.
+ """
+ when = call.when
+ duration = call.stop - call.start
+ keywords = {x: 1 for x in item.keywords}
+ excinfo = call.excinfo
+ sections = []
+ if not call.excinfo:
+ outcome = "passed"
+ longrepr = None
+ else:
+ if not isinstance(excinfo, ExceptionInfo):
+ outcome = "failed"
+ longrepr = excinfo
+ elif excinfo.errisinstance(skip.Exception):
+ outcome = "skipped"
+ r = excinfo._getreprcrash()
+ longrepr = (str(r.path), r.lineno, r.message)
+ else:
+ outcome = "failed"
+ if call.when == "call":
+ longrepr = item.repr_failure(excinfo)
+ else: # exception in setup or teardown
+ longrepr = item._repr_failure_py(
+ excinfo, style=item.config.getoption("tbstyle", "auto")
+ )
+ for rwhen, key, content in item._report_sections:
+ sections.append(("Captured %s %s" % (key, rwhen), content))
+ return cls(
+ item.nodeid,
+ item.location,
+ keywords,
+ outcome,
+ longrepr,
+ when,
+ sections,
+ duration,
+ user_properties=item.user_properties,
+ )
+
+
+class CollectReport(BaseReport):
+ when = "collect"
+
+ def __init__(self, nodeid, outcome, longrepr, result, sections=(), **extra):
+ self.nodeid = nodeid
+ self.outcome = outcome
+ self.longrepr = longrepr
+ self.result = result or []
+ self.sections = list(sections)
+ self.__dict__.update(extra)
+
+ @property
+ def location(self):
+ return (self.fspath, None, self.fspath)
+
+ def __repr__(self):
+ return "<CollectReport %r lenresult=%s outcome=%r>" % (
+ self.nodeid,
+ len(self.result),
+ self.outcome,
+ )
+
+
+class CollectErrorRepr(TerminalRepr):
+ def __init__(self, msg):
+ self.longrepr = msg
+
+ def toterminal(self, out):
+ out.line(self.longrepr, red=True)
+
+
+def pytest_report_to_serializable(report):
+ if isinstance(report, (TestReport, CollectReport)):
+ data = report._to_json()
+ data["_report_type"] = report.__class__.__name__
+ return data
+
+
+def pytest_report_from_serializable(data):
+ if "_report_type" in data:
+ if data["_report_type"] == "TestReport":
+ return TestReport._from_json(data)
+ elif data["_report_type"] == "CollectReport":
+ return CollectReport._from_json(data)
+ assert False, "Unknown report_type unserialize data: {}".format(
+ data["_report_type"]
+ )
diff --git a/contrib/python/pytest/py2/_pytest/resultlog.py b/contrib/python/pytest/py2/_pytest/resultlog.py
new file mode 100644
index 00000000000..bd30b5071e9
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/resultlog.py
@@ -0,0 +1,102 @@
+# -*- coding: utf-8 -*-
+""" log machine-parseable test session result information in a plain
+text file.
+"""
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import os
+
+import py
+
+
+def pytest_addoption(parser):
+ group = parser.getgroup("terminal reporting", "resultlog plugin options")
+ group.addoption(
+ "--resultlog",
+ "--result-log",
+ action="store",
+ metavar="path",
+ default=None,
+ help="DEPRECATED path for machine-readable result log.",
+ )
+
+
+def pytest_configure(config):
+ resultlog = config.option.resultlog
+ # prevent opening resultlog on slave nodes (xdist)
+ if resultlog and not hasattr(config, "slaveinput"):
+ dirname = os.path.dirname(os.path.abspath(resultlog))
+ if not os.path.isdir(dirname):
+ os.makedirs(dirname)
+ logfile = open(resultlog, "w", 1) # line buffered
+ config._resultlog = ResultLog(config, logfile)
+ config.pluginmanager.register(config._resultlog)
+
+ from _pytest.deprecated import RESULT_LOG
+ from _pytest.warnings import _issue_warning_captured
+
+ _issue_warning_captured(RESULT_LOG, config.hook, stacklevel=2)
+
+
+def pytest_unconfigure(config):
+ resultlog = getattr(config, "_resultlog", None)
+ if resultlog:
+ resultlog.logfile.close()
+ del config._resultlog
+ config.pluginmanager.unregister(resultlog)
+
+
+class ResultLog(object):
+ def __init__(self, config, logfile):
+ self.config = config
+ self.logfile = logfile # preferably line buffered
+
+ def write_log_entry(self, testpath, lettercode, longrepr):
+ print("%s %s" % (lettercode, testpath), file=self.logfile)
+ for line in longrepr.splitlines():
+ print(" %s" % line, file=self.logfile)
+
+ def log_outcome(self, report, lettercode, longrepr):
+ testpath = getattr(report, "nodeid", None)
+ if testpath is None:
+ testpath = report.fspath
+ self.write_log_entry(testpath, lettercode, longrepr)
+
+ def pytest_runtest_logreport(self, report):
+ if report.when != "call" and report.passed:
+ return
+ res = self.config.hook.pytest_report_teststatus(
+ report=report, config=self.config
+ )
+ code = res[1]
+ if code == "x":
+ longrepr = str(report.longrepr)
+ elif code == "X":
+ longrepr = ""
+ elif report.passed:
+ longrepr = ""
+ elif report.failed:
+ longrepr = str(report.longrepr)
+ elif report.skipped:
+ longrepr = str(report.longrepr[2])
+ self.log_outcome(report, code, longrepr)
+
+ def pytest_collectreport(self, report):
+ if not report.passed:
+ if report.failed:
+ code = "F"
+ longrepr = str(report.longrepr)
+ else:
+ assert report.skipped
+ code = "S"
+ longrepr = "%s:%d: %s" % report.longrepr
+ self.log_outcome(report, code, longrepr)
+
+ def pytest_internalerror(self, excrepr):
+ reprcrash = getattr(excrepr, "reprcrash", None)
+ path = getattr(reprcrash, "path", None)
+ if path is None:
+ path = "cwd:%s" % py.path.local()
+ self.write_log_entry(path, "!", str(excrepr))
diff --git a/contrib/python/pytest/py2/_pytest/runner.py b/contrib/python/pytest/py2/_pytest/runner.py
new file mode 100644
index 00000000000..34ae9177388
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/runner.py
@@ -0,0 +1,376 @@
+# -*- coding: utf-8 -*-
+""" basic collect and runtest protocol implementations """
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import bdb
+import os
+import sys
+from time import time
+
+import attr
+import six
+
+from .reports import CollectErrorRepr
+from .reports import CollectReport
+from .reports import TestReport
+from _pytest._code.code import ExceptionInfo
+from _pytest.compat import safe_str
+from _pytest.outcomes import Exit
+from _pytest.outcomes import Skipped
+from _pytest.outcomes import TEST_OUTCOME
+
+#
+# pytest plugin hooks
+
+
+def pytest_addoption(parser):
+ group = parser.getgroup("terminal reporting", "reporting", after="general")
+ group.addoption(
+ "--durations",
+ action="store",
+ type=int,
+ default=None,
+ metavar="N",
+ help="show N slowest setup/test durations (N=0 for all).",
+ ),
+
+
+def pytest_terminal_summary(terminalreporter):
+ durations = terminalreporter.config.option.durations
+ verbose = terminalreporter.config.getvalue("verbose")
+ if durations is None:
+ return
+ tr = terminalreporter
+ dlist = []
+ for replist in tr.stats.values():
+ for rep in replist:
+ if hasattr(rep, "duration"):
+ dlist.append(rep)
+ if not dlist:
+ return
+ dlist.sort(key=lambda x: x.duration)
+ dlist.reverse()
+ if not durations:
+ tr.write_sep("=", "slowest test durations")
+ else:
+ tr.write_sep("=", "slowest %s test durations" % durations)
+ dlist = dlist[:durations]
+
+ for rep in dlist:
+ if verbose < 2 and rep.duration < 0.005:
+ tr.write_line("")
+ tr.write_line("(0.00 durations hidden. Use -vv to show these durations.)")
+ break
+ tr.write_line("%02.2fs %-8s %s" % (rep.duration, rep.when, rep.nodeid))
+
+
+def pytest_sessionstart(session):
+ session._setupstate = SetupState()
+
+
+def pytest_sessionfinish(session):
+ session._setupstate.teardown_all()
+
+
+def pytest_runtest_protocol(item, nextitem):
+ item.ihook.pytest_runtest_logstart(nodeid=item.nodeid, location=item.location)
+ runtestprotocol(item, nextitem=nextitem)
+ item.ihook.pytest_runtest_logfinish(nodeid=item.nodeid, location=item.location)
+ return True
+
+
+def runtestprotocol(item, log=True, nextitem=None):
+ hasrequest = hasattr(item, "_request")
+ if hasrequest and not item._request:
+ item._initrequest()
+ rep = call_and_report(item, "setup", log)
+ reports = [rep]
+ if rep.passed:
+ if item.config.getoption("setupshow", False):
+ show_test_item(item)
+ if not item.config.getoption("setuponly", False):
+ reports.append(call_and_report(item, "call", log))
+ reports.append(call_and_report(item, "teardown", log, nextitem=nextitem))
+ # after all teardown hooks have been called
+ # want funcargs and request info to go away
+ if hasrequest:
+ item._request = False
+ item.funcargs = None
+ return reports
+
+
+def show_test_item(item):
+ """Show test function, parameters and the fixtures of the test item."""
+ tw = item.config.get_terminal_writer()
+ tw.line()
+ tw.write(" " * 8)
+ tw.write(item._nodeid)
+ used_fixtures = sorted(item._fixtureinfo.name2fixturedefs.keys())
+ if used_fixtures:
+ tw.write(" (fixtures used: {})".format(", ".join(used_fixtures)))
+
+
+def pytest_runtest_setup(item):
+ _update_current_test_var(item, "setup")
+ item.session._setupstate.prepare(item)
+
+
+def pytest_runtest_call(item):
+ _update_current_test_var(item, "call")
+ sys.last_type, sys.last_value, sys.last_traceback = (None, None, None)
+ try:
+ item.runtest()
+ except Exception:
+ # Store trace info to allow postmortem debugging
+ type, value, tb = sys.exc_info()
+ tb = tb.tb_next # Skip *this* frame
+ sys.last_type = type
+ sys.last_value = value
+ sys.last_traceback = tb
+ del type, value, tb # Get rid of these in this frame
+ raise
+
+
+def pytest_runtest_teardown(item, nextitem):
+ _update_current_test_var(item, "teardown")
+ item.session._setupstate.teardown_exact(item, nextitem)
+ _update_current_test_var(item, None)
+
+
+def _update_current_test_var(item, when):
+ """
+ Update PYTEST_CURRENT_TEST to reflect the current item and stage.
+
+ If ``when`` is None, delete PYTEST_CURRENT_TEST from the environment.
+ """
+ var_name = "PYTEST_CURRENT_TEST"
+ if when:
+ value = "{} ({})".format(item.nodeid, when)
+ # don't allow null bytes on environment variables (see #2644, #2957)
+ value = value.replace("\x00", "(null)")
+ os.environ[var_name] = value
+ else:
+ os.environ.pop(var_name)
+
+
+def pytest_report_teststatus(report):
+ if report.when in ("setup", "teardown"):
+ if report.failed:
+ # category, shortletter, verbose-word
+ return "error", "E", "ERROR"
+ elif report.skipped:
+ return "skipped", "s", "SKIPPED"
+ else:
+ return "", "", ""
+
+
+#
+# Implementation
+
+
+def call_and_report(item, when, log=True, **kwds):
+ call = call_runtest_hook(item, when, **kwds)
+ hook = item.ihook
+ report = hook.pytest_runtest_makereport(item=item, call=call)
+ if log:
+ hook.pytest_runtest_logreport(report=report)
+ if check_interactive_exception(call, report):
+ hook.pytest_exception_interact(node=item, call=call, report=report)
+ return report
+
+
+def check_interactive_exception(call, report):
+ return call.excinfo and not (
+ hasattr(report, "wasxfail")
+ or call.excinfo.errisinstance(Skipped)
+ or call.excinfo.errisinstance(bdb.BdbQuit)
+ )
+
+
+def call_runtest_hook(item, when, **kwds):
+ hookname = "pytest_runtest_" + when
+ ihook = getattr(item.ihook, hookname)
+ reraise = (Exit,)
+ if not item.config.getoption("usepdb", False):
+ reraise += (KeyboardInterrupt,)
+ return CallInfo.from_call(
+ lambda: ihook(item=item, **kwds), when=when, reraise=reraise
+ )
+
+
+@attr.s(repr=False)
+class CallInfo(object):
+ """ Result/Exception info a function invocation. """
+
+ _result = attr.ib()
+ # Optional[ExceptionInfo]
+ excinfo = attr.ib()
+ start = attr.ib()
+ stop = attr.ib()
+ when = attr.ib()
+
+ @property
+ def result(self):
+ if self.excinfo is not None:
+ raise AttributeError("{!r} has no valid result".format(self))
+ return self._result
+
+ @classmethod
+ def from_call(cls, func, when, reraise=None):
+ #: context of invocation: one of "setup", "call",
+ #: "teardown", "memocollect"
+ start = time()
+ excinfo = None
+ try:
+ result = func()
+ except: # noqa
+ excinfo = ExceptionInfo.from_current()
+ if reraise is not None and excinfo.errisinstance(reraise):
+ raise
+ result = None
+ stop = time()
+ return cls(start=start, stop=stop, when=when, result=result, excinfo=excinfo)
+
+ def __repr__(self):
+ if self.excinfo is not None:
+ status = "exception"
+ value = self.excinfo.value
+ else:
+ # TODO: investigate unification
+ value = repr(self._result)
+ status = "result"
+ return "<CallInfo when={when!r} {status}: {value}>".format(
+ when=self.when, value=safe_str(value), status=status
+ )
+
+
+def pytest_runtest_makereport(item, call):
+ return TestReport.from_item_and_call(item, call)
+
+
+def pytest_make_collect_report(collector):
+ call = CallInfo.from_call(lambda: list(collector.collect()), "collect")
+ longrepr = None
+ if not call.excinfo:
+ outcome = "passed"
+ else:
+ from _pytest import nose
+
+ skip_exceptions = (Skipped,) + nose.get_skip_exceptions()
+ if call.excinfo.errisinstance(skip_exceptions):
+ outcome = "skipped"
+ r = collector._repr_failure_py(call.excinfo, "line").reprcrash
+ longrepr = (str(r.path), r.lineno, r.message)
+ else:
+ outcome = "failed"
+ errorinfo = collector.repr_failure(call.excinfo)
+ if not hasattr(errorinfo, "toterminal"):
+ errorinfo = CollectErrorRepr(errorinfo)
+ longrepr = errorinfo
+ rep = CollectReport(
+ collector.nodeid, outcome, longrepr, getattr(call, "result", None)
+ )
+ rep.call = call # see collect_one_node
+ return rep
+
+
+class SetupState(object):
+ """ shared state for setting up/tearing down test items or collectors. """
+
+ def __init__(self):
+ self.stack = []
+ self._finalizers = {}
+
+ def addfinalizer(self, finalizer, colitem):
+ """ attach a finalizer to the given colitem.
+ if colitem is None, this will add a finalizer that
+ is called at the end of teardown_all().
+ """
+ assert colitem and not isinstance(colitem, tuple)
+ assert callable(finalizer)
+ # assert colitem in self.stack # some unit tests don't setup stack :/
+ self._finalizers.setdefault(colitem, []).append(finalizer)
+
+ def _pop_and_teardown(self):
+ colitem = self.stack.pop()
+ self._teardown_with_finalization(colitem)
+
+ def _callfinalizers(self, colitem):
+ finalizers = self._finalizers.pop(colitem, None)
+ exc = None
+ while finalizers:
+ fin = finalizers.pop()
+ try:
+ fin()
+ except TEST_OUTCOME:
+ # XXX Only first exception will be seen by user,
+ # ideally all should be reported.
+ if exc is None:
+ exc = sys.exc_info()
+ if exc:
+ six.reraise(*exc)
+
+ def _teardown_with_finalization(self, colitem):
+ self._callfinalizers(colitem)
+ if hasattr(colitem, "teardown"):
+ colitem.teardown()
+ for colitem in self._finalizers:
+ assert (
+ colitem is None or colitem in self.stack or isinstance(colitem, tuple)
+ )
+
+ def teardown_all(self):
+ while self.stack:
+ self._pop_and_teardown()
+ for key in list(self._finalizers):
+ self._teardown_with_finalization(key)
+ assert not self._finalizers
+
+ def teardown_exact(self, item, nextitem):
+ needed_collectors = nextitem and nextitem.listchain() or []
+ self._teardown_towards(needed_collectors)
+
+ def _teardown_towards(self, needed_collectors):
+ exc = None
+ while self.stack:
+ if self.stack == needed_collectors[: len(self.stack)]:
+ break
+ try:
+ self._pop_and_teardown()
+ except TEST_OUTCOME:
+ # XXX Only first exception will be seen by user,
+ # ideally all should be reported.
+ if exc is None:
+ exc = sys.exc_info()
+ if exc:
+ six.reraise(*exc)
+
+ def prepare(self, colitem):
+ """ setup objects along the collector chain to the test-method
+ and teardown previously setup objects."""
+ needed_collectors = colitem.listchain()
+ self._teardown_towards(needed_collectors)
+
+ # check if the last collection node has raised an error
+ for col in self.stack:
+ if hasattr(col, "_prepare_exc"):
+ six.reraise(*col._prepare_exc)
+ for col in needed_collectors[len(self.stack) :]:
+ self.stack.append(col)
+ try:
+ col.setup()
+ except TEST_OUTCOME:
+ col._prepare_exc = sys.exc_info()
+ raise
+
+
+def collect_one_node(collector):
+ ihook = collector.ihook
+ ihook.pytest_collectstart(collector=collector)
+ rep = ihook.pytest_make_collect_report(collector=collector)
+ call = rep.__dict__.pop("call", None)
+ if call and check_interactive_exception(call, rep):
+ ihook.pytest_exception_interact(node=collector, call=call, report=rep)
+ return rep
diff --git a/contrib/python/pytest/py2/_pytest/setuponly.py b/contrib/python/pytest/py2/_pytest/setuponly.py
new file mode 100644
index 00000000000..0859011241a
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/setuponly.py
@@ -0,0 +1,89 @@
+# -*- coding: utf-8 -*-
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import sys
+
+import pytest
+
+
+def pytest_addoption(parser):
+ group = parser.getgroup("debugconfig")
+ group.addoption(
+ "--setuponly",
+ "--setup-only",
+ action="store_true",
+ help="only setup fixtures, do not execute tests.",
+ )
+ group.addoption(
+ "--setupshow",
+ "--setup-show",
+ action="store_true",
+ help="show setup of fixtures while executing tests.",
+ )
+
+
+@pytest.hookimpl(hookwrapper=True)
+def pytest_fixture_setup(fixturedef, request):
+ yield
+ config = request.config
+ if config.option.setupshow:
+ if hasattr(request, "param"):
+ # Save the fixture parameter so ._show_fixture_action() can
+ # display it now and during the teardown (in .finish()).
+ if fixturedef.ids:
+ if callable(fixturedef.ids):
+ fixturedef.cached_param = fixturedef.ids(request.param)
+ else:
+ fixturedef.cached_param = fixturedef.ids[request.param_index]
+ else:
+ fixturedef.cached_param = request.param
+ _show_fixture_action(fixturedef, "SETUP")
+
+
+def pytest_fixture_post_finalizer(fixturedef):
+ if hasattr(fixturedef, "cached_result"):
+ config = fixturedef._fixturemanager.config
+ if config.option.setupshow:
+ _show_fixture_action(fixturedef, "TEARDOWN")
+ if hasattr(fixturedef, "cached_param"):
+ del fixturedef.cached_param
+
+
+def _show_fixture_action(fixturedef, msg):
+ config = fixturedef._fixturemanager.config
+ capman = config.pluginmanager.getplugin("capturemanager")
+ if capman:
+ capman.suspend_global_capture()
+ out, err = capman.read_global_capture()
+
+ tw = config.get_terminal_writer()
+ tw.line()
+ tw.write(" " * 2 * fixturedef.scopenum)
+ tw.write(
+ "{step} {scope} {fixture}".format(
+ step=msg.ljust(8), # align the output to TEARDOWN
+ scope=fixturedef.scope[0].upper(),
+ fixture=fixturedef.argname,
+ )
+ )
+
+ if msg == "SETUP":
+ deps = sorted(arg for arg in fixturedef.argnames if arg != "request")
+ if deps:
+ tw.write(" (fixtures used: {})".format(", ".join(deps)))
+
+ if hasattr(fixturedef, "cached_param"):
+ tw.write("[{}]".format(fixturedef.cached_param))
+
+ if capman:
+ capman.resume_global_capture()
+ sys.stdout.write(out)
+ sys.stderr.write(err)
+
+
+@pytest.hookimpl(tryfirst=True)
+def pytest_cmdline_main(config):
+ if config.option.setuponly:
+ config.option.setupshow = True
diff --git a/contrib/python/pytest/py2/_pytest/setupplan.py b/contrib/python/pytest/py2/_pytest/setupplan.py
new file mode 100644
index 00000000000..47b0fe82ef6
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/setupplan.py
@@ -0,0 +1,32 @@
+# -*- coding: utf-8 -*-
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import pytest
+
+
+def pytest_addoption(parser):
+ group = parser.getgroup("debugconfig")
+ group.addoption(
+ "--setupplan",
+ "--setup-plan",
+ action="store_true",
+ help="show what fixtures and tests would be executed but "
+ "don't execute anything.",
+ )
+
+
+@pytest.hookimpl(tryfirst=True)
+def pytest_fixture_setup(fixturedef, request):
+ # Will return a dummy fixture if the setuponly option is provided.
+ if request.config.option.setupplan:
+ fixturedef.cached_result = (None, None, None)
+ return fixturedef.cached_result
+
+
+@pytest.hookimpl(tryfirst=True)
+def pytest_cmdline_main(config):
+ if config.option.setupplan:
+ config.option.setuponly = True
+ config.option.setupshow = True
diff --git a/contrib/python/pytest/py2/_pytest/skipping.py b/contrib/python/pytest/py2/_pytest/skipping.py
new file mode 100644
index 00000000000..bc8b88e7178
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/skipping.py
@@ -0,0 +1,186 @@
+# -*- coding: utf-8 -*-
+""" support for skip/xfail functions and markers. """
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+from _pytest.config import hookimpl
+from _pytest.mark.evaluate import MarkEvaluator
+from _pytest.outcomes import fail
+from _pytest.outcomes import skip
+from _pytest.outcomes import xfail
+
+
+def pytest_addoption(parser):
+ group = parser.getgroup("general")
+ group.addoption(
+ "--runxfail",
+ action="store_true",
+ dest="runxfail",
+ default=False,
+ help="report the results of xfail tests as if they were not marked",
+ )
+
+ parser.addini(
+ "xfail_strict",
+ "default for the strict parameter of xfail "
+ "markers when not given explicitly (default: False)",
+ default=False,
+ type="bool",
+ )
+
+
+def pytest_configure(config):
+ if config.option.runxfail:
+ # yay a hack
+ import pytest
+
+ old = pytest.xfail
+ config._cleanup.append(lambda: setattr(pytest, "xfail", old))
+
+ def nop(*args, **kwargs):
+ pass
+
+ nop.Exception = xfail.Exception
+ setattr(pytest, "xfail", nop)
+
+ config.addinivalue_line(
+ "markers",
+ "skip(reason=None): skip the given test function with an optional reason. "
+ 'Example: skip(reason="no way of currently testing this") skips the '
+ "test.",
+ )
+ config.addinivalue_line(
+ "markers",
+ "skipif(condition): skip the given test function if eval(condition) "
+ "results in a True value. Evaluation happens within the "
+ "module global context. Example: skipif('sys.platform == \"win32\"') "
+ "skips the test if we are on the win32 platform. see "
+ "https://docs.pytest.org/en/latest/skipping.html",
+ )
+ config.addinivalue_line(
+ "markers",
+ "xfail(condition, reason=None, run=True, raises=None, strict=False): "
+ "mark the test function as an expected failure if eval(condition) "
+ "has a True value. Optionally specify a reason for better reporting "
+ "and run=False if you don't even want to execute the test function. "
+ "If only specific exception(s) are expected, you can list them in "
+ "raises, and if the test fails in other ways, it will be reported as "
+ "a true failure. See https://docs.pytest.org/en/latest/skipping.html",
+ )
+
+
+@hookimpl(tryfirst=True)
+def pytest_runtest_setup(item):
+ # Check if skip or skipif are specified as pytest marks
+ item._skipped_by_mark = False
+ eval_skipif = MarkEvaluator(item, "skipif")
+ if eval_skipif.istrue():
+ item._skipped_by_mark = True
+ skip(eval_skipif.getexplanation())
+
+ for skip_info in item.iter_markers(name="skip"):
+ item._skipped_by_mark = True
+ if "reason" in skip_info.kwargs:
+ skip(skip_info.kwargs["reason"])
+ elif skip_info.args:
+ skip(skip_info.args[0])
+ else:
+ skip("unconditional skip")
+
+ item._evalxfail = MarkEvaluator(item, "xfail")
+ check_xfail_no_run(item)
+
+
+@hookimpl(hookwrapper=True)
+def pytest_pyfunc_call(pyfuncitem):
+ check_xfail_no_run(pyfuncitem)
+ outcome = yield
+ passed = outcome.excinfo is None
+ if passed:
+ check_strict_xfail(pyfuncitem)
+
+
+def check_xfail_no_run(item):
+ """check xfail(run=False)"""
+ if not item.config.option.runxfail:
+ evalxfail = item._evalxfail
+ if evalxfail.istrue():
+ if not evalxfail.get("run", True):
+ xfail("[NOTRUN] " + evalxfail.getexplanation())
+
+
+def check_strict_xfail(pyfuncitem):
+ """check xfail(strict=True) for the given PASSING test"""
+ evalxfail = pyfuncitem._evalxfail
+ if evalxfail.istrue():
+ strict_default = pyfuncitem.config.getini("xfail_strict")
+ is_strict_xfail = evalxfail.get("strict", strict_default)
+ if is_strict_xfail:
+ del pyfuncitem._evalxfail
+ explanation = evalxfail.getexplanation()
+ fail("[XPASS(strict)] " + explanation, pytrace=False)
+
+
+@hookimpl(hookwrapper=True)
+def pytest_runtest_makereport(item, call):
+ outcome = yield
+ rep = outcome.get_result()
+ evalxfail = getattr(item, "_evalxfail", None)
+ # unitttest special case, see setting of _unexpectedsuccess
+ if hasattr(item, "_unexpectedsuccess") and rep.when == "call":
+ from _pytest.compat import _is_unittest_unexpected_success_a_failure
+
+ if item._unexpectedsuccess:
+ rep.longrepr = "Unexpected success: {}".format(item._unexpectedsuccess)
+ else:
+ rep.longrepr = "Unexpected success"
+ if _is_unittest_unexpected_success_a_failure():
+ rep.outcome = "failed"
+ else:
+ rep.outcome = "passed"
+ rep.wasxfail = rep.longrepr
+ elif item.config.option.runxfail:
+ pass # don't interefere
+ elif call.excinfo and call.excinfo.errisinstance(xfail.Exception):
+ rep.wasxfail = "reason: " + call.excinfo.value.msg
+ rep.outcome = "skipped"
+ elif evalxfail and not rep.skipped and evalxfail.wasvalid() and evalxfail.istrue():
+ if call.excinfo:
+ if evalxfail.invalidraise(call.excinfo.value):
+ rep.outcome = "failed"
+ else:
+ rep.outcome = "skipped"
+ rep.wasxfail = evalxfail.getexplanation()
+ elif call.when == "call":
+ strict_default = item.config.getini("xfail_strict")
+ is_strict_xfail = evalxfail.get("strict", strict_default)
+ explanation = evalxfail.getexplanation()
+ if is_strict_xfail:
+ rep.outcome = "failed"
+ rep.longrepr = "[XPASS(strict)] {}".format(explanation)
+ else:
+ rep.outcome = "passed"
+ rep.wasxfail = explanation
+ elif (
+ getattr(item, "_skipped_by_mark", False)
+ and rep.skipped
+ and type(rep.longrepr) is tuple
+ ):
+ # skipped by mark.skipif; change the location of the failure
+ # to point to the item definition, otherwise it will display
+ # the location of where the skip exception was raised within pytest
+ filename, line, reason = rep.longrepr
+ filename, line = item.location[:2]
+ rep.longrepr = filename, line, reason
+
+
+# called by terminalreporter progress reporting
+
+
+def pytest_report_teststatus(report):
+ if hasattr(report, "wasxfail"):
+ if report.skipped:
+ return "xfailed", "x", "XFAIL"
+ elif report.passed:
+ return "xpassed", "X", "XPASS"
diff --git a/contrib/python/pytest/py2/_pytest/stepwise.py b/contrib/python/pytest/py2/_pytest/stepwise.py
new file mode 100644
index 00000000000..88902595896
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/stepwise.py
@@ -0,0 +1,109 @@
+# -*- coding: utf-8 -*-
+import pytest
+
+
+def pytest_addoption(parser):
+ group = parser.getgroup("general")
+ group.addoption(
+ "--sw",
+ "--stepwise",
+ action="store_true",
+ dest="stepwise",
+ help="exit on test failure and continue from last failing test next time",
+ )
+ group.addoption(
+ "--stepwise-skip",
+ action="store_true",
+ dest="stepwise_skip",
+ help="ignore the first failing test but stop on the next failing test",
+ )
+
+
+@pytest.hookimpl
+def pytest_configure(config):
+ config.pluginmanager.register(StepwisePlugin(config), "stepwiseplugin")
+
+
+class StepwisePlugin:
+ def __init__(self, config):
+ self.config = config
+ self.active = config.getvalue("stepwise")
+ self.session = None
+ self.report_status = ""
+
+ if self.active:
+ self.lastfailed = config.cache.get("cache/stepwise", None)
+ self.skip = config.getvalue("stepwise_skip")
+
+ def pytest_sessionstart(self, session):
+ self.session = session
+
+ def pytest_collection_modifyitems(self, session, config, items):
+ if not self.active:
+ return
+ if not self.lastfailed:
+ self.report_status = "no previously failed tests, not skipping."
+ return
+
+ already_passed = []
+ found = False
+
+ # Make a list of all tests that have been run before the last failing one.
+ for item in items:
+ if item.nodeid == self.lastfailed:
+ found = True
+ break
+ else:
+ already_passed.append(item)
+
+ # If the previously failed test was not found among the test items,
+ # do not skip any tests.
+ if not found:
+ self.report_status = "previously failed test not found, not skipping."
+ already_passed = []
+ else:
+ self.report_status = "skipping {} already passed items.".format(
+ len(already_passed)
+ )
+
+ for item in already_passed:
+ items.remove(item)
+
+ config.hook.pytest_deselected(items=already_passed)
+
+ def pytest_runtest_logreport(self, report):
+ if not self.active:
+ return
+
+ if report.failed:
+ if self.skip:
+ # Remove test from the failed ones (if it exists) and unset the skip option
+ # to make sure the following tests will not be skipped.
+ if report.nodeid == self.lastfailed:
+ self.lastfailed = None
+
+ self.skip = False
+ else:
+ # Mark test as the last failing and interrupt the test session.
+ self.lastfailed = report.nodeid
+ self.session.shouldstop = (
+ "Test failed, continuing from this test next run."
+ )
+
+ else:
+ # If the test was actually run and did pass.
+ if report.when == "call":
+ # Remove test from the failed ones, if exists.
+ if report.nodeid == self.lastfailed:
+ self.lastfailed = None
+
+ def pytest_report_collectionfinish(self):
+ if self.active and self.config.getoption("verbose") >= 0 and self.report_status:
+ return "stepwise: %s" % self.report_status
+
+ def pytest_sessionfinish(self, session):
+ if self.active:
+ self.config.cache.set("cache/stepwise", self.lastfailed)
+ else:
+ # Clear the list of failing tests if the plugin is not active.
+ self.config.cache.set("cache/stepwise", [])
diff --git a/contrib/python/pytest/py2/_pytest/terminal.py b/contrib/python/pytest/py2/_pytest/terminal.py
new file mode 100644
index 00000000000..4418338c656
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/terminal.py
@@ -0,0 +1,1090 @@
+# -*- coding: utf-8 -*-
+""" terminal reporting of the full testing process.
+
+This is a good source for looking at the various reporting hooks.
+"""
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import argparse
+import collections
+import platform
+import sys
+import time
+from functools import partial
+
+import attr
+import pluggy
+import py
+import six
+from more_itertools import collapse
+
+import pytest
+from _pytest import nodes
+from _pytest.main import EXIT_INTERRUPTED
+from _pytest.main import EXIT_NOTESTSCOLLECTED
+from _pytest.main import EXIT_OK
+from _pytest.main import EXIT_TESTSFAILED
+from _pytest.main import EXIT_USAGEERROR
+
+REPORT_COLLECTING_RESOLUTION = 0.5
+
+
+class MoreQuietAction(argparse.Action):
+ """
+ a modified copy of the argparse count action which counts down and updates
+ the legacy quiet attribute at the same time
+
+ used to unify verbosity handling
+ """
+
+ def __init__(self, option_strings, dest, default=None, required=False, help=None):
+ super(MoreQuietAction, self).__init__(
+ option_strings=option_strings,
+ dest=dest,
+ nargs=0,
+ default=default,
+ required=required,
+ help=help,
+ )
+
+ def __call__(self, parser, namespace, values, option_string=None):
+ new_count = getattr(namespace, self.dest, 0) - 1
+ setattr(namespace, self.dest, new_count)
+ # todo Deprecate config.quiet
+ namespace.quiet = getattr(namespace, "quiet", 0) + 1
+
+
+def pytest_addoption(parser):
+ group = parser.getgroup("terminal reporting", "reporting", after="general")
+ group._addoption(
+ "-v",
+ "--verbose",
+ action="count",
+ default=0,
+ dest="verbose",
+ help="increase verbosity.",
+ ),
+ group._addoption(
+ "-q",
+ "--quiet",
+ action=MoreQuietAction,
+ default=0,
+ dest="verbose",
+ help="decrease verbosity.",
+ ),
+ group._addoption(
+ "--verbosity", dest="verbose", type=int, default=0, help="set verbosity"
+ )
+ group._addoption(
+ "-r",
+ action="store",
+ dest="reportchars",
+ default="",
+ metavar="chars",
+ help="show extra test summary info as specified by chars: (f)ailed, "
+ "(E)rror, (s)kipped, (x)failed, (X)passed, "
+ "(p)assed, (P)assed with output, (a)ll except passed (p/P), or (A)ll. "
+ "Warnings are displayed at all times except when "
+ "--disable-warnings is set.",
+ )
+ group._addoption(
+ "--disable-warnings",
+ "--disable-pytest-warnings",
+ default=False,
+ dest="disable_warnings",
+ action="store_true",
+ help="disable warnings summary",
+ )
+ group._addoption(
+ "-l",
+ "--showlocals",
+ action="store_true",
+ dest="showlocals",
+ default=False,
+ help="show locals in tracebacks (disabled by default).",
+ )
+ group._addoption(
+ "--tb",
+ metavar="style",
+ action="store",
+ dest="tbstyle",
+ default="auto",
+ choices=["auto", "long", "short", "no", "line", "native"],
+ help="traceback print mode (auto/long/short/line/native/no).",
+ )
+ group._addoption(
+ "--show-capture",
+ action="store",
+ dest="showcapture",
+ choices=["no", "stdout", "stderr", "log", "all"],
+ default="all",
+ help="Controls how captured stdout/stderr/log is shown on failed tests. "
+ "Default is 'all'.",
+ )
+ group._addoption(
+ "--fulltrace",
+ "--full-trace",
+ action="store_true",
+ default=False,
+ help="don't cut any tracebacks (default is to cut).",
+ )
+ group._addoption(
+ "--color",
+ metavar="color",
+ action="store",
+ dest="color",
+ default="auto",
+ choices=["yes", "no", "auto"],
+ help="color terminal output (yes/no/auto).",
+ )
+
+ parser.addini(
+ "console_output_style",
+ help='console output: "classic", or with additional progress information ("progress" (percentage) | "count").',
+ default="progress",
+ )
+
+
+def pytest_configure(config):
+ reporter = TerminalReporter(config, sys.stdout)
+ config.pluginmanager.register(reporter, "terminalreporter")
+ if config.option.debug or config.option.traceconfig:
+
+ def mywriter(tags, args):
+ msg = " ".join(map(str, args))
+ reporter.write_line("[traceconfig] " + msg)
+
+ config.trace.root.setprocessor("pytest:config", mywriter)
+
+
+def getreportopt(config):
+ reportopts = ""
+ reportchars = config.option.reportchars
+ if not config.option.disable_warnings and "w" not in reportchars:
+ reportchars += "w"
+ elif config.option.disable_warnings and "w" in reportchars:
+ reportchars = reportchars.replace("w", "")
+ aliases = {"F", "S"}
+ for char in reportchars:
+ # handle old aliases
+ if char in aliases:
+ char = char.lower()
+ if char == "a":
+ reportopts = "sxXwEf"
+ elif char == "A":
+ reportopts = "PpsxXwEf"
+ break
+ elif char not in reportopts:
+ reportopts += char
+ return reportopts
+
+
+@pytest.hookimpl(trylast=True) # after _pytest.runner
+def pytest_report_teststatus(report):
+ letter = "F"
+ if report.passed:
+ letter = "."
+ elif report.skipped:
+ letter = "s"
+
+ outcome = report.outcome
+ if report.when in ("collect", "setup", "teardown") and outcome == "failed":
+ outcome = "error"
+ letter = "E"
+
+ return outcome, letter, outcome.upper()
+
+
+@attr.s
+class WarningReport(object):
+ """
+ Simple structure to hold warnings information captured by ``pytest_warning_captured``.
+
+ :ivar str message: user friendly message about the warning
+ :ivar str|None nodeid: node id that generated the warning (see ``get_location``).
+ :ivar tuple|py.path.local fslocation:
+ file system location of the source of the warning (see ``get_location``).
+ """
+
+ message = attr.ib()
+ nodeid = attr.ib(default=None)
+ fslocation = attr.ib(default=None)
+ count_towards_summary = True
+
+ def get_location(self, config):
+ """
+ Returns the more user-friendly information about the location
+ of a warning, or None.
+ """
+ if self.nodeid:
+ return self.nodeid
+ if self.fslocation:
+ if isinstance(self.fslocation, tuple) and len(self.fslocation) >= 2:
+ filename, linenum = self.fslocation[:2]
+ relpath = py.path.local(filename).relto(config.invocation_dir)
+ if not relpath:
+ relpath = str(filename)
+ return "%s:%s" % (relpath, linenum)
+ else:
+ return str(self.fslocation)
+ return None
+
+
+class TerminalReporter(object):
+ def __init__(self, config, file=None):
+ import _pytest.config
+
+ self.config = config
+ self._numcollected = 0
+ self._session = None
+ self._showfspath = None
+
+ self.stats = {}
+ self.startdir = config.invocation_dir
+ if file is None:
+ file = sys.stdout
+ self._tw = _pytest.config.create_terminal_writer(config, file)
+ # self.writer will be deprecated in pytest-3.4
+ self.writer = self._tw
+ self._screen_width = self._tw.fullwidth
+ self.currentfspath = None
+ self.reportchars = getreportopt(config)
+ self.hasmarkup = self._tw.hasmarkup
+ self.isatty = file.isatty()
+ self._progress_nodeids_reported = set()
+ self._show_progress_info = self._determine_show_progress_info()
+ self._collect_report_last_write = None
+
+ def _determine_show_progress_info(self):
+ """Return True if we should display progress information based on the current config"""
+ # do not show progress if we are not capturing output (#3038)
+ if self.config.getoption("capture", "no") == "no":
+ return False
+ # do not show progress if we are showing fixture setup/teardown
+ if self.config.getoption("setupshow", False):
+ return False
+ cfg = self.config.getini("console_output_style")
+ if cfg in ("progress", "count"):
+ return cfg
+ return False
+
+ @property
+ def verbosity(self):
+ return self.config.option.verbose
+
+ @property
+ def showheader(self):
+ return self.verbosity >= 0
+
+ @property
+ def showfspath(self):
+ if self._showfspath is None:
+ return self.verbosity >= 0
+ return self._showfspath
+
+ @showfspath.setter
+ def showfspath(self, value):
+ self._showfspath = value
+
+ @property
+ def showlongtestinfo(self):
+ return self.verbosity > 0
+
+ def hasopt(self, char):
+ char = {"xfailed": "x", "skipped": "s"}.get(char, char)
+ return char in self.reportchars
+
+ def write_fspath_result(self, nodeid, res, **markup):
+ fspath = self.config.rootdir.join(nodeid.split("::")[0])
+ # NOTE: explicitly check for None to work around py bug, and for less
+ # overhead in general (https://github.com/pytest-dev/py/pull/207).
+ if self.currentfspath is None or fspath != self.currentfspath:
+ if self.currentfspath is not None and self._show_progress_info:
+ self._write_progress_information_filling_space()
+ self.currentfspath = fspath
+ fspath = self.startdir.bestrelpath(fspath)
+ self._tw.line()
+ self._tw.write(fspath + " ")
+ self._tw.write(res, **markup)
+
+ def write_ensure_prefix(self, prefix, extra="", **kwargs):
+ if self.currentfspath != prefix:
+ self._tw.line()
+ self.currentfspath = prefix
+ self._tw.write(prefix)
+ if extra:
+ self._tw.write(extra, **kwargs)
+ self.currentfspath = -2
+
+ def ensure_newline(self):
+ if self.currentfspath:
+ self._tw.line()
+ self.currentfspath = None
+
+ def write(self, content, **markup):
+ self._tw.write(content, **markup)
+
+ def write_line(self, line, **markup):
+ if not isinstance(line, six.text_type):
+ line = six.text_type(line, errors="replace")
+ self.ensure_newline()
+ self._tw.line(line, **markup)
+
+ def rewrite(self, line, **markup):
+ """
+ Rewinds the terminal cursor to the beginning and writes the given line.
+
+ :kwarg erase: if True, will also add spaces until the full terminal width to ensure
+ previous lines are properly erased.
+
+ The rest of the keyword arguments are markup instructions.
+ """
+ erase = markup.pop("erase", False)
+ if erase:
+ fill_count = self._tw.fullwidth - len(line) - 1
+ fill = " " * fill_count
+ else:
+ fill = ""
+ line = str(line)
+ self._tw.write("\r" + line + fill, **markup)
+
+ def write_sep(self, sep, title=None, **markup):
+ self.ensure_newline()
+ self._tw.sep(sep, title, **markup)
+
+ def section(self, title, sep="=", **kw):
+ self._tw.sep(sep, title, **kw)
+
+ def line(self, msg, **kw):
+ self._tw.line(msg, **kw)
+
+ def pytest_internalerror(self, excrepr):
+ for line in six.text_type(excrepr).split("\n"):
+ self.write_line("INTERNALERROR> " + line)
+ return 1
+
+ def pytest_warning_captured(self, warning_message, item):
+ # from _pytest.nodes import get_fslocation_from_item
+ from _pytest.warnings import warning_record_to_str
+
+ warnings = self.stats.setdefault("warnings", [])
+ fslocation = warning_message.filename, warning_message.lineno
+ message = warning_record_to_str(warning_message)
+
+ nodeid = item.nodeid if item is not None else ""
+ warning_report = WarningReport(
+ fslocation=fslocation, message=message, nodeid=nodeid
+ )
+ warnings.append(warning_report)
+
+ def pytest_plugin_registered(self, plugin):
+ if self.config.option.traceconfig:
+ msg = "PLUGIN registered: %s" % (plugin,)
+ # XXX this event may happen during setup/teardown time
+ # which unfortunately captures our output here
+ # which garbles our output if we use self.write_line
+ self.write_line(msg)
+
+ def pytest_deselected(self, items):
+ self.stats.setdefault("deselected", []).extend(items)
+
+ def pytest_runtest_logstart(self, nodeid, location):
+ # ensure that the path is printed before the
+ # 1st test of a module starts running
+ if self.showlongtestinfo:
+ line = self._locationline(nodeid, *location)
+ self.write_ensure_prefix(line, "")
+ elif self.showfspath:
+ fsid = nodeid.split("::")[0]
+ self.write_fspath_result(fsid, "")
+
+ def pytest_runtest_logreport(self, report):
+ self._tests_ran = True
+ rep = report
+ res = self.config.hook.pytest_report_teststatus(report=rep, config=self.config)
+ category, letter, word = res
+ if isinstance(word, tuple):
+ word, markup = word
+ else:
+ markup = None
+ self.stats.setdefault(category, []).append(rep)
+ if not letter and not word:
+ # probably passed setup/teardown
+ return
+ running_xdist = hasattr(rep, "node")
+ if markup is None:
+ was_xfail = hasattr(report, "wasxfail")
+ if rep.passed and not was_xfail:
+ markup = {"green": True}
+ elif rep.passed and was_xfail:
+ markup = {"yellow": True}
+ elif rep.failed:
+ markup = {"red": True}
+ elif rep.skipped:
+ markup = {"yellow": True}
+ else:
+ markup = {}
+ if self.verbosity <= 0:
+ if not running_xdist and self.showfspath:
+ self.write_fspath_result(rep.nodeid, letter, **markup)
+ else:
+ self._tw.write(letter, **markup)
+ else:
+ self._progress_nodeids_reported.add(rep.nodeid)
+ line = self._locationline(rep.nodeid, *rep.location)
+ if not running_xdist:
+ self.write_ensure_prefix(line, word, **markup)
+ if self._show_progress_info:
+ self._write_progress_information_filling_space()
+ else:
+ self.ensure_newline()
+ self._tw.write("[%s]" % rep.node.gateway.id)
+ if self._show_progress_info:
+ self._tw.write(
+ self._get_progress_information_message() + " ", cyan=True
+ )
+ else:
+ self._tw.write(" ")
+ self._tw.write(word, **markup)
+ self._tw.write(" " + line)
+ self.currentfspath = -2
+
+ def pytest_runtest_logfinish(self, nodeid):
+ if self.verbosity <= 0 and self._show_progress_info:
+ if self._show_progress_info == "count":
+ num_tests = self._session.testscollected
+ progress_length = len(" [{}/{}]".format(str(num_tests), str(num_tests)))
+ else:
+ progress_length = len(" [100%]")
+
+ self._progress_nodeids_reported.add(nodeid)
+ is_last_item = (
+ len(self._progress_nodeids_reported) == self._session.testscollected
+ )
+ if is_last_item:
+ self._write_progress_information_filling_space()
+ else:
+ w = self._width_of_current_line
+ past_edge = w + progress_length + 1 >= self._screen_width
+ if past_edge:
+ msg = self._get_progress_information_message()
+ self._tw.write(msg + "\n", cyan=True)
+
+ def _get_progress_information_message(self):
+ collected = self._session.testscollected
+ if self._show_progress_info == "count":
+ if collected:
+ progress = self._progress_nodeids_reported
+ counter_format = "{{:{}d}}".format(len(str(collected)))
+ format_string = " [{}/{{}}]".format(counter_format)
+ return format_string.format(len(progress), collected)
+ return " [ {} / {} ]".format(collected, collected)
+ else:
+ if collected:
+ progress = len(self._progress_nodeids_reported) * 100 // collected
+ return " [{:3d}%]".format(progress)
+ return " [100%]"
+
+ def _write_progress_information_filling_space(self):
+ msg = self._get_progress_information_message()
+ w = self._width_of_current_line
+ fill = self._tw.fullwidth - w - 1
+ self.write(msg.rjust(fill), cyan=True)
+
+ @property
+ def _width_of_current_line(self):
+ """Return the width of current line, using the superior implementation of py-1.6 when available"""
+ try:
+ return self._tw.width_of_current_line
+ except AttributeError:
+ # py < 1.6.0
+ return self._tw.chars_on_current_line
+
+ def pytest_collection(self):
+ if self.isatty:
+ if self.config.option.verbose >= 0:
+ self.write("collecting ... ", bold=True)
+ self._collect_report_last_write = time.time()
+ elif self.config.option.verbose >= 1:
+ self.write("collecting ... ", bold=True)
+
+ def pytest_collectreport(self, report):
+ if report.failed:
+ self.stats.setdefault("error", []).append(report)
+ elif report.skipped:
+ self.stats.setdefault("skipped", []).append(report)
+ items = [x for x in report.result if isinstance(x, pytest.Item)]
+ self._numcollected += len(items)
+ if self.isatty:
+ self.report_collect()
+
+ def report_collect(self, final=False):
+ if self.config.option.verbose < 0:
+ return
+
+ if not final:
+ # Only write "collecting" report every 0.5s.
+ t = time.time()
+ if (
+ self._collect_report_last_write is not None
+ and self._collect_report_last_write > t - REPORT_COLLECTING_RESOLUTION
+ ):
+ return
+ self._collect_report_last_write = t
+
+ errors = len(self.stats.get("error", []))
+ skipped = len(self.stats.get("skipped", []))
+ deselected = len(self.stats.get("deselected", []))
+ selected = self._numcollected - errors - skipped - deselected
+ if final:
+ line = "collected "
+ else:
+ line = "collecting "
+ line += (
+ str(self._numcollected) + " item" + ("" if self._numcollected == 1 else "s")
+ )
+ if errors:
+ line += " / %d errors" % errors
+ if deselected:
+ line += " / %d deselected" % deselected
+ if skipped:
+ line += " / %d skipped" % skipped
+ if self._numcollected > selected > 0:
+ line += " / %d selected" % selected
+ if self.isatty:
+ self.rewrite(line, bold=True, erase=True)
+ if final:
+ self.write("\n")
+ else:
+ self.write_line(line)
+
+ @pytest.hookimpl(trylast=True)
+ def pytest_sessionstart(self, session):
+ self._session = session
+ self._sessionstarttime = time.time()
+ if not self.showheader:
+ return
+ self.write_sep("=", "test session starts", bold=True)
+ verinfo = platform.python_version()
+ msg = "platform %s -- Python %s" % (sys.platform, verinfo)
+ if hasattr(sys, "pypy_version_info"):
+ verinfo = ".".join(map(str, sys.pypy_version_info[:3]))
+ msg += "[pypy-%s-%s]" % (verinfo, sys.pypy_version_info[3])
+ msg += ", pytest-%s, py-%s, pluggy-%s" % (
+ pytest.__version__,
+ py.__version__,
+ pluggy.__version__,
+ )
+ if (
+ self.verbosity > 0
+ or self.config.option.debug
+ or getattr(self.config.option, "pastebin", None)
+ ):
+ msg += " -- " + str(sys.executable)
+ self.write_line(msg)
+ lines = self.config.hook.pytest_report_header(
+ config=self.config, startdir=self.startdir
+ )
+ self._write_report_lines_from_hooks(lines)
+
+ def _write_report_lines_from_hooks(self, lines):
+ lines.reverse()
+ for line in collapse(lines):
+ self.write_line(line)
+
+ def pytest_report_header(self, config):
+ line = "rootdir: %s" % config.rootdir
+
+ if config.inifile:
+ line += ", inifile: " + config.rootdir.bestrelpath(config.inifile)
+
+ testpaths = config.getini("testpaths")
+ if testpaths and config.args == testpaths:
+ rel_paths = [config.rootdir.bestrelpath(x) for x in testpaths]
+ line += ", testpaths: {}".format(", ".join(rel_paths))
+ result = [line]
+
+ plugininfo = config.pluginmanager.list_plugin_distinfo()
+ if plugininfo:
+ result.append("plugins: %s" % ", ".join(_plugin_nameversions(plugininfo)))
+ return result
+
+ def pytest_collection_finish(self, session):
+ self.report_collect(True)
+
+ if self.config.getoption("collectonly"):
+ self._printcollecteditems(session.items)
+
+ lines = self.config.hook.pytest_report_collectionfinish(
+ config=self.config, startdir=self.startdir, items=session.items
+ )
+ self._write_report_lines_from_hooks(lines)
+
+ if self.config.getoption("collectonly"):
+ if self.stats.get("failed"):
+ self._tw.sep("!", "collection failures")
+ for rep in self.stats.get("failed"):
+ rep.toterminal(self._tw)
+
+ def _printcollecteditems(self, items):
+ # to print out items and their parent collectors
+ # we take care to leave out Instances aka ()
+ # because later versions are going to get rid of them anyway
+ if self.config.option.verbose < 0:
+ if self.config.option.verbose < -1:
+ counts = {}
+ for item in items:
+ name = item.nodeid.split("::", 1)[0]
+ counts[name] = counts.get(name, 0) + 1
+ for name, count in sorted(counts.items()):
+ self._tw.line("%s: %d" % (name, count))
+ else:
+ for item in items:
+ self._tw.line(item.nodeid)
+ return
+ stack = []
+ indent = ""
+ for item in items:
+ needed_collectors = item.listchain()[1:] # strip root node
+ while stack:
+ if stack == needed_collectors[: len(stack)]:
+ break
+ stack.pop()
+ for col in needed_collectors[len(stack) :]:
+ stack.append(col)
+ if col.name == "()": # Skip Instances.
+ continue
+ indent = (len(stack) - 1) * " "
+ self._tw.line("%s%s" % (indent, col))
+ if self.config.option.verbose >= 1:
+ if hasattr(col, "_obj") and col._obj.__doc__:
+ for line in col._obj.__doc__.strip().splitlines():
+ self._tw.line("%s%s" % (indent + " ", line.strip()))
+
+ @pytest.hookimpl(hookwrapper=True)
+ def pytest_sessionfinish(self, exitstatus):
+ outcome = yield
+ outcome.get_result()
+ self._tw.line("")
+ summary_exit_codes = (
+ EXIT_OK,
+ EXIT_TESTSFAILED,
+ EXIT_INTERRUPTED,
+ EXIT_USAGEERROR,
+ EXIT_NOTESTSCOLLECTED,
+ )
+ if exitstatus in summary_exit_codes:
+ self.config.hook.pytest_terminal_summary(
+ terminalreporter=self, exitstatus=exitstatus, config=self.config
+ )
+ if exitstatus == EXIT_INTERRUPTED:
+ self._report_keyboardinterrupt()
+ del self._keyboardinterrupt_memo
+ self.summary_stats()
+
+ @pytest.hookimpl(hookwrapper=True)
+ def pytest_terminal_summary(self):
+ self.summary_errors()
+ self.summary_failures()
+ self.summary_warnings()
+ self.summary_passes()
+ yield
+ self.short_test_summary()
+ # Display any extra warnings from teardown here (if any).
+ self.summary_warnings()
+
+ def pytest_keyboard_interrupt(self, excinfo):
+ self._keyboardinterrupt_memo = excinfo.getrepr(funcargs=True)
+
+ def pytest_unconfigure(self):
+ if hasattr(self, "_keyboardinterrupt_memo"):
+ self._report_keyboardinterrupt()
+
+ def _report_keyboardinterrupt(self):
+ excrepr = self._keyboardinterrupt_memo
+ msg = excrepr.reprcrash.message
+ self.write_sep("!", msg)
+ if "KeyboardInterrupt" in msg:
+ if self.config.option.fulltrace:
+ excrepr.toterminal(self._tw)
+ else:
+ excrepr.reprcrash.toterminal(self._tw)
+ self._tw.line(
+ "(to show a full traceback on KeyboardInterrupt use --fulltrace)",
+ yellow=True,
+ )
+
+ def _locationline(self, nodeid, fspath, lineno, domain):
+ def mkrel(nodeid):
+ line = self.config.cwd_relative_nodeid(nodeid)
+ if domain and line.endswith(domain):
+ line = line[: -len(domain)]
+ values = domain.split("[")
+ values[0] = values[0].replace(".", "::") # don't replace '.' in params
+ line += "[".join(values)
+ return line
+
+ # collect_fspath comes from testid which has a "/"-normalized path
+
+ if fspath:
+ res = mkrel(nodeid)
+ if self.verbosity >= 2 and nodeid.split("::")[0] != fspath.replace(
+ "\\", nodes.SEP
+ ):
+ res += " <- " + self.startdir.bestrelpath(fspath)
+ else:
+ res = "[location]"
+ return res + " "
+
+ def _getfailureheadline(self, rep):
+ head_line = rep.head_line
+ if head_line:
+ return head_line
+ return "test session" # XXX?
+
+ def _getcrashline(self, rep):
+ try:
+ return str(rep.longrepr.reprcrash)
+ except AttributeError:
+ try:
+ return str(rep.longrepr)[:50]
+ except AttributeError:
+ return ""
+
+ #
+ # summaries for sessionfinish
+ #
+ def getreports(self, name):
+ values = []
+ for x in self.stats.get(name, []):
+ if not hasattr(x, "_pdbshown"):
+ values.append(x)
+ return values
+
+ def summary_warnings(self):
+ if self.hasopt("w"):
+ all_warnings = self.stats.get("warnings")
+ if not all_warnings:
+ return
+
+ final = hasattr(self, "_already_displayed_warnings")
+ if final:
+ warning_reports = all_warnings[self._already_displayed_warnings :]
+ else:
+ warning_reports = all_warnings
+ self._already_displayed_warnings = len(warning_reports)
+ if not warning_reports:
+ return
+
+ reports_grouped_by_message = collections.OrderedDict()
+ for wr in warning_reports:
+ reports_grouped_by_message.setdefault(wr.message, []).append(wr)
+
+ title = "warnings summary (final)" if final else "warnings summary"
+ self.write_sep("=", title, yellow=True, bold=False)
+ for message, warning_reports in reports_grouped_by_message.items():
+ has_any_location = False
+ for w in warning_reports:
+ location = w.get_location(self.config)
+ if location:
+ self._tw.line(str(location))
+ has_any_location = True
+ if has_any_location:
+ lines = message.splitlines()
+ indented = "\n".join(" " + x for x in lines)
+ message = indented.rstrip()
+ else:
+ message = message.rstrip()
+ self._tw.line(message)
+ self._tw.line()
+ self._tw.line("-- Docs: https://docs.pytest.org/en/latest/warnings.html")
+
+ def summary_passes(self):
+ if self.config.option.tbstyle != "no":
+ if self.hasopt("P"):
+ reports = self.getreports("passed")
+ if not reports:
+ return
+ self.write_sep("=", "PASSES")
+ for rep in reports:
+ if rep.sections:
+ msg = self._getfailureheadline(rep)
+ self.write_sep("_", msg, green=True, bold=True)
+ self._outrep_summary(rep)
+
+ def print_teardown_sections(self, rep):
+ showcapture = self.config.option.showcapture
+ if showcapture == "no":
+ return
+ for secname, content in rep.sections:
+ if showcapture != "all" and showcapture not in secname:
+ continue
+ if "teardown" in secname:
+ self._tw.sep("-", secname)
+ if content[-1:] == "\n":
+ content = content[:-1]
+ self._tw.line(content)
+
+ def summary_failures(self):
+ if self.config.option.tbstyle != "no":
+ reports = self.getreports("failed")
+ if not reports:
+ return
+ self.write_sep("=", "FAILURES")
+ if self.config.option.tbstyle == "line":
+ for rep in reports:
+ line = self._getcrashline(rep)
+ self.write_line(line)
+ else:
+ teardown_sections = {}
+ for report in self.getreports(""):
+ if report.when == "teardown":
+ teardown_sections.setdefault(report.nodeid, []).append(report)
+
+ for rep in reports:
+ msg = self._getfailureheadline(rep)
+ self.write_sep("_", msg, red=True, bold=True)
+ self._outrep_summary(rep)
+ for report in teardown_sections.get(rep.nodeid, []):
+ self.print_teardown_sections(report)
+
+ def summary_errors(self):
+ if self.config.option.tbstyle != "no":
+ reports = self.getreports("error")
+ if not reports:
+ return
+ self.write_sep("=", "ERRORS")
+ for rep in self.stats["error"]:
+ msg = self._getfailureheadline(rep)
+ if rep.when == "collect":
+ msg = "ERROR collecting " + msg
+ else:
+ msg = "ERROR at %s of %s" % (rep.when, msg)
+ self.write_sep("_", msg, red=True, bold=True)
+ self._outrep_summary(rep)
+
+ def _outrep_summary(self, rep):
+ rep.toterminal(self._tw)
+ showcapture = self.config.option.showcapture
+ if showcapture == "no":
+ return
+ for secname, content in rep.sections:
+ if showcapture != "all" and showcapture not in secname:
+ continue
+ self._tw.sep("-", secname)
+ if content[-1:] == "\n":
+ content = content[:-1]
+ self._tw.line(content)
+
+ def summary_stats(self):
+ session_duration = time.time() - self._sessionstarttime
+ (line, color) = build_summary_stats_line(self.stats)
+ msg = "%s in %.2f seconds" % (line, session_duration)
+ markup = {color: True, "bold": True}
+
+ if self.verbosity >= 0:
+ self.write_sep("=", msg, **markup)
+ if self.verbosity == -1:
+ self.write_line(msg, **markup)
+
+ def short_test_summary(self):
+ if not self.reportchars:
+ return
+
+ def show_simple(stat, lines):
+ failed = self.stats.get(stat, [])
+ if not failed:
+ return
+ termwidth = self.writer.fullwidth
+ config = self.config
+ for rep in failed:
+ line = _get_line_with_reprcrash_message(config, rep, termwidth)
+ lines.append(line)
+
+ def show_xfailed(lines):
+ xfailed = self.stats.get("xfailed", [])
+ for rep in xfailed:
+ verbose_word = rep._get_verbose_word(self.config)
+ pos = _get_pos(self.config, rep)
+ lines.append("%s %s" % (verbose_word, pos))
+ reason = rep.wasxfail
+ if reason:
+ lines.append(" " + str(reason))
+
+ def show_xpassed(lines):
+ xpassed = self.stats.get("xpassed", [])
+ for rep in xpassed:
+ verbose_word = rep._get_verbose_word(self.config)
+ pos = _get_pos(self.config, rep)
+ reason = rep.wasxfail
+ lines.append("%s %s %s" % (verbose_word, pos, reason))
+
+ def show_skipped(lines):
+ skipped = self.stats.get("skipped", [])
+ fskips = _folded_skips(skipped) if skipped else []
+ if not fskips:
+ return
+ verbose_word = skipped[0]._get_verbose_word(self.config)
+ for num, fspath, lineno, reason in fskips:
+ if reason.startswith("Skipped: "):
+ reason = reason[9:]
+ if lineno is not None:
+ lines.append(
+ "%s [%d] %s:%d: %s"
+ % (verbose_word, num, fspath, lineno + 1, reason)
+ )
+ else:
+ lines.append("%s [%d] %s: %s" % (verbose_word, num, fspath, reason))
+
+ REPORTCHAR_ACTIONS = {
+ "x": show_xfailed,
+ "X": show_xpassed,
+ "f": partial(show_simple, "failed"),
+ "s": show_skipped,
+ "p": partial(show_simple, "passed"),
+ "E": partial(show_simple, "error"),
+ }
+
+ lines = []
+ for char in self.reportchars:
+ action = REPORTCHAR_ACTIONS.get(char)
+ if action: # skipping e.g. "P" (passed with output) here.
+ action(lines)
+
+ if lines:
+ self.write_sep("=", "short test summary info")
+ for line in lines:
+ self.write_line(line)
+
+
+def _get_pos(config, rep):
+ nodeid = config.cwd_relative_nodeid(rep.nodeid)
+ return nodeid
+
+
+def _get_line_with_reprcrash_message(config, rep, termwidth):
+ """Get summary line for a report, trying to add reprcrash message."""
+ from wcwidth import wcswidth
+
+ verbose_word = rep._get_verbose_word(config)
+ pos = _get_pos(config, rep)
+
+ line = "%s %s" % (verbose_word, pos)
+ len_line = wcswidth(line)
+ ellipsis, len_ellipsis = "...", 3
+ if len_line > termwidth - len_ellipsis:
+ # No space for an additional message.
+ return line
+
+ try:
+ msg = rep.longrepr.reprcrash.message
+ except AttributeError:
+ pass
+ else:
+ # Only use the first line.
+ i = msg.find("\n")
+ if i != -1:
+ msg = msg[:i]
+ len_msg = wcswidth(msg)
+
+ sep, len_sep = " - ", 3
+ max_len_msg = termwidth - len_line - len_sep
+ if max_len_msg >= len_ellipsis:
+ if len_msg > max_len_msg:
+ max_len_msg -= len_ellipsis
+ msg = msg[:max_len_msg]
+ while wcswidth(msg) > max_len_msg:
+ msg = msg[:-1]
+ if six.PY2:
+ # on python 2 systems with narrow unicode compilation, trying to
+ # get a single character out of a multi-byte unicode character such as
+ # u'😄' will result in a High Surrogate (U+D83D) character, which is
+ # rendered as u'�'; in this case we just strip that character out as it
+ # serves no purpose being rendered
+ try:
+ surrogate = six.unichr(0xD83D)
+ msg = msg.rstrip(surrogate)
+ except ValueError: # pragma: no cover
+ # Jython cannot represent this lone surrogate at all (#5256):
+ # ValueError: unichr() arg is a lone surrogate in range
+ # (0xD800, 0xDFFF) (Jython UTF-16 encoding)
+ # ignore this case as it shouldn't appear in the string anyway
+ pass
+ msg += ellipsis
+ line += sep + msg
+ return line
+
+
+def _folded_skips(skipped):
+ d = {}
+ for event in skipped:
+ key = event.longrepr
+ assert len(key) == 3, (event, key)
+ keywords = getattr(event, "keywords", {})
+ # folding reports with global pytestmark variable
+ # this is workaround, because for now we cannot identify the scope of a skip marker
+ # TODO: revisit after marks scope would be fixed
+ if (
+ event.when == "setup"
+ and "skip" in keywords
+ and "pytestmark" not in keywords
+ ):
+ key = (key[0], None, key[2])
+ d.setdefault(key, []).append(event)
+ values = []
+ for key, events in d.items():
+ values.append((len(events),) + key)
+ return values
+
+
+def build_summary_stats_line(stats):
+ known_types = (
+ "failed passed skipped deselected xfailed xpassed warnings error".split()
+ )
+ unknown_type_seen = False
+ for found_type in stats:
+ if found_type not in known_types:
+ if found_type: # setup/teardown reports have an empty key, ignore them
+ known_types.append(found_type)
+ unknown_type_seen = True
+ parts = []
+ for key in known_types:
+ reports = stats.get(key, None)
+ if reports:
+ count = sum(
+ 1 for rep in reports if getattr(rep, "count_towards_summary", True)
+ )
+ parts.append("%d %s" % (count, key))
+
+ if parts:
+ line = ", ".join(parts)
+ else:
+ line = "no tests ran"
+
+ if "failed" in stats or "error" in stats:
+ color = "red"
+ elif "warnings" in stats or unknown_type_seen:
+ color = "yellow"
+ elif "passed" in stats:
+ color = "green"
+ else:
+ color = "yellow"
+
+ return line, color
+
+
+def _plugin_nameversions(plugininfo):
+ values = []
+ for plugin, dist in plugininfo:
+ # gets us name and version!
+ name = "{dist.project_name}-{dist.version}".format(dist=dist)
+ # questionable convenience, but it keeps things short
+ if name.startswith("pytest-"):
+ name = name[7:]
+ # we decided to print python package names
+ # they can have more than one plugin
+ if name not in values:
+ values.append(name)
+ return values
diff --git a/contrib/python/pytest/py2/_pytest/tmpdir.py b/contrib/python/pytest/py2/_pytest/tmpdir.py
new file mode 100644
index 00000000000..a8a7037713c
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/tmpdir.py
@@ -0,0 +1,197 @@
+# -*- coding: utf-8 -*-
+""" support for providing temporary directories to test functions. """
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import os
+import re
+import tempfile
+import warnings
+
+import attr
+import py
+import six
+
+import pytest
+from .pathlib import ensure_reset_dir
+from .pathlib import LOCK_TIMEOUT
+from .pathlib import make_numbered_dir
+from .pathlib import make_numbered_dir_with_cleanup
+from .pathlib import Path
+from _pytest.monkeypatch import MonkeyPatch
+
+
+@attr.s
+class TempPathFactory(object):
+ """Factory for temporary directories under the common base temp directory.
+
+ The base directory can be configured using the ``--basetemp`` option."""
+
+ _given_basetemp = attr.ib(
+ # using os.path.abspath() to get absolute path instead of resolve() as it
+ # does not work the same in all platforms (see #4427)
+ # Path.absolute() exists, but it is not public (see https://bugs.python.org/issue25012)
+ converter=attr.converters.optional(
+ lambda p: Path(os.path.abspath(six.text_type(p)))
+ )
+ )
+ _trace = attr.ib()
+ _basetemp = attr.ib(default=None)
+
+ @classmethod
+ def from_config(cls, config):
+ """
+ :param config: a pytest configuration
+ """
+ return cls(
+ given_basetemp=config.option.basetemp, trace=config.trace.get("tmpdir")
+ )
+
+ def mktemp(self, basename, numbered=True):
+ """makes a temporary directory managed by the factory"""
+ if not numbered:
+ p = self.getbasetemp().joinpath(basename)
+ p.mkdir()
+ else:
+ p = make_numbered_dir(root=self.getbasetemp(), prefix=basename)
+ self._trace("mktemp", p)
+ return p
+
+ def getbasetemp(self):
+ """ return base temporary directory. """
+ if self._basetemp is not None:
+ return self._basetemp
+
+ if self._given_basetemp is not None:
+ basetemp = self._given_basetemp
+ ensure_reset_dir(basetemp)
+ basetemp = basetemp.resolve()
+ else:
+ from_env = os.environ.get("PYTEST_DEBUG_TEMPROOT")
+ temproot = Path(from_env or tempfile.gettempdir()).resolve()
+ user = get_user() or "unknown"
+ # use a sub-directory in the temproot to speed-up
+ # make_numbered_dir() call
+ rootdir = temproot.joinpath("pytest-of-{}".format(user))
+ rootdir.mkdir(exist_ok=True)
+ basetemp = make_numbered_dir_with_cleanup(
+ prefix="pytest-", root=rootdir, keep=3, lock_timeout=LOCK_TIMEOUT
+ )
+ assert basetemp is not None, basetemp
+ self._basetemp = t = basetemp
+ self._trace("new basetemp", t)
+ return t
+
+
+@attr.s
+class TempdirFactory(object):
+ """
+ backward comptibility wrapper that implements
+ :class:``py.path.local`` for :class:``TempPathFactory``
+ """
+
+ _tmppath_factory = attr.ib()
+
+ def ensuretemp(self, string, dir=1):
+ """ (deprecated) return temporary directory path with
+ the given string as the trailing part. It is usually
+ better to use the 'tmpdir' function argument which
+ provides an empty unique-per-test-invocation directory
+ and is guaranteed to be empty.
+ """
+ # py.log._apiwarn(">1.1", "use tmpdir function argument")
+ from .deprecated import PYTEST_ENSURETEMP
+
+ warnings.warn(PYTEST_ENSURETEMP, stacklevel=2)
+ return self.getbasetemp().ensure(string, dir=dir)
+
+ def mktemp(self, basename, numbered=True):
+ """Create a subdirectory of the base temporary directory and return it.
+ If ``numbered``, ensure the directory is unique by adding a number
+ prefix greater than any existing one.
+ """
+ return py.path.local(self._tmppath_factory.mktemp(basename, numbered).resolve())
+
+ def getbasetemp(self):
+ """backward compat wrapper for ``_tmppath_factory.getbasetemp``"""
+ return py.path.local(self._tmppath_factory.getbasetemp().resolve())
+
+
+def get_user():
+ """Return the current user name, or None if getuser() does not work
+ in the current environment (see #1010).
+ """
+ import getpass
+
+ try:
+ return getpass.getuser()
+ except (ImportError, KeyError):
+ return None
+
+
+def pytest_configure(config):
+ """Create a TempdirFactory and attach it to the config object.
+
+ This is to comply with existing plugins which expect the handler to be
+ available at pytest_configure time, but ideally should be moved entirely
+ to the tmpdir_factory session fixture.
+ """
+ mp = MonkeyPatch()
+ tmppath_handler = TempPathFactory.from_config(config)
+ t = TempdirFactory(tmppath_handler)
+ config._cleanup.append(mp.undo)
+ mp.setattr(config, "_tmp_path_factory", tmppath_handler, raising=False)
+ mp.setattr(config, "_tmpdirhandler", t, raising=False)
+ mp.setattr(pytest, "ensuretemp", t.ensuretemp, raising=False)
+
+
+@pytest.fixture(scope="session")
+def tmpdir_factory(request):
+ """Return a :class:`_pytest.tmpdir.TempdirFactory` instance for the test session.
+ """
+ return request.config._tmpdirhandler
+
+
+@pytest.fixture(scope="session")
+def tmp_path_factory(request):
+ """Return a :class:`_pytest.tmpdir.TempPathFactory` instance for the test session.
+ """
+ return request.config._tmp_path_factory
+
+
+def _mk_tmp(request, factory):
+ name = request.node.name
+ name = re.sub(r"[\W]", "_", name)
+ MAXVAL = 30
+ name = name[:MAXVAL]
+ return factory.mktemp(name, numbered=True)
+
+
+@pytest.fixture
+def tmpdir(tmp_path):
+ """Return a temporary directory path object
+ which is unique to each test function invocation,
+ created as a sub directory of the base temporary
+ directory. The returned object is a `py.path.local`_
+ path object.
+
+ .. _`py.path.local`: https://py.readthedocs.io/en/latest/path.html
+ """
+ return py.path.local(tmp_path)
+
+
+@pytest.fixture
+def tmp_path(request, tmp_path_factory):
+ """Return a temporary directory path object
+ which is unique to each test function invocation,
+ created as a sub directory of the base temporary
+ directory. The returned object is a :class:`pathlib.Path`
+ object.
+
+ .. note::
+
+ in python < 3.6 this is a pathlib2.Path
+ """
+
+ return _mk_tmp(request, tmp_path_factory)
diff --git a/contrib/python/pytest/py2/_pytest/unittest.py b/contrib/python/pytest/py2/_pytest/unittest.py
new file mode 100644
index 00000000000..3ff6f45d8db
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/unittest.py
@@ -0,0 +1,291 @@
+# -*- coding: utf-8 -*-
+""" discovery and running of std-library "unittest" style tests. """
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import sys
+import traceback
+
+import _pytest._code
+import pytest
+from _pytest.compat import getimfunc
+from _pytest.config import hookimpl
+from _pytest.outcomes import fail
+from _pytest.outcomes import skip
+from _pytest.outcomes import xfail
+from _pytest.python import Class
+from _pytest.python import Function
+
+
+def pytest_pycollect_makeitem(collector, name, obj):
+ # has unittest been imported and is obj a subclass of its TestCase?
+ try:
+ if not issubclass(obj, sys.modules["unittest"].TestCase):
+ return
+ except Exception:
+ return
+ # yes, so let's collect it
+ return UnitTestCase(name, parent=collector)
+
+
+class UnitTestCase(Class):
+ # marker for fixturemanger.getfixtureinfo()
+ # to declare that our children do not support funcargs
+ nofuncargs = True
+
+ def collect(self):
+ from unittest import TestLoader
+
+ cls = self.obj
+ if not getattr(cls, "__test__", True):
+ return
+
+ skipped = getattr(cls, "__unittest_skip__", False)
+ if not skipped:
+ self._inject_setup_teardown_fixtures(cls)
+ self._inject_setup_class_fixture()
+
+ self.session._fixturemanager.parsefactories(self, unittest=True)
+ loader = TestLoader()
+ foundsomething = False
+ for name in loader.getTestCaseNames(self.obj):
+ x = getattr(self.obj, name)
+ if not getattr(x, "__test__", True):
+ continue
+ funcobj = getimfunc(x)
+ yield TestCaseFunction(name, parent=self, callobj=funcobj)
+ foundsomething = True
+
+ if not foundsomething:
+ runtest = getattr(self.obj, "runTest", None)
+ if runtest is not None:
+ ut = sys.modules.get("twisted.trial.unittest", None)
+ if ut is None or runtest != ut.TestCase.runTest:
+ yield TestCaseFunction("runTest", parent=self)
+
+ def _inject_setup_teardown_fixtures(self, cls):
+ """Injects a hidden auto-use fixture to invoke setUpClass/setup_method and corresponding
+ teardown functions (#517)"""
+ class_fixture = _make_xunit_fixture(
+ cls, "setUpClass", "tearDownClass", scope="class", pass_self=False
+ )
+ if class_fixture:
+ cls.__pytest_class_setup = class_fixture
+
+ method_fixture = _make_xunit_fixture(
+ cls, "setup_method", "teardown_method", scope="function", pass_self=True
+ )
+ if method_fixture:
+ cls.__pytest_method_setup = method_fixture
+
+
+def _make_xunit_fixture(obj, setup_name, teardown_name, scope, pass_self):
+ setup = getattr(obj, setup_name, None)
+ teardown = getattr(obj, teardown_name, None)
+ if setup is None and teardown is None:
+ return None
+
+ @pytest.fixture(scope=scope, autouse=True)
+ def fixture(self, request):
+ if getattr(self, "__unittest_skip__", None):
+ reason = self.__unittest_skip_why__
+ pytest.skip(reason)
+ if setup is not None:
+ if pass_self:
+ setup(self, request.function)
+ else:
+ setup()
+ yield
+ if teardown is not None:
+ if pass_self:
+ teardown(self, request.function)
+ else:
+ teardown()
+
+ return fixture
+
+
+class TestCaseFunction(Function):
+ nofuncargs = True
+ _excinfo = None
+ _testcase = None
+
+ def setup(self):
+ self._testcase = self.parent.obj(self.name)
+ self._fix_unittest_skip_decorator()
+ self._obj = getattr(self._testcase, self.name)
+ if hasattr(self, "_request"):
+ self._request._fillfixtures()
+
+ def _fix_unittest_skip_decorator(self):
+ """
+ The @unittest.skip decorator calls functools.wraps(self._testcase)
+ The call to functools.wraps() fails unless self._testcase
+ has a __name__ attribute. This is usually automatically supplied
+ if the test is a function or method, but we need to add manually
+ here.
+
+ See issue #1169
+ """
+ if sys.version_info[0] == 2:
+ setattr(self._testcase, "__name__", self.name)
+
+ def teardown(self):
+ self._testcase = None
+ self._obj = None
+
+ def startTest(self, testcase):
+ pass
+
+ def _addexcinfo(self, rawexcinfo):
+ # unwrap potential exception info (see twisted trial support below)
+ rawexcinfo = getattr(rawexcinfo, "_rawexcinfo", rawexcinfo)
+ try:
+ excinfo = _pytest._code.ExceptionInfo(rawexcinfo)
+ # invoke the attributes to trigger storing the traceback
+ # trial causes some issue there
+ excinfo.value
+ excinfo.traceback
+ except TypeError:
+ try:
+ try:
+ values = traceback.format_exception(*rawexcinfo)
+ values.insert(
+ 0,
+ "NOTE: Incompatible Exception Representation, "
+ "displaying natively:\n\n",
+ )
+ fail("".join(values), pytrace=False)
+ except (fail.Exception, KeyboardInterrupt):
+ raise
+ except: # noqa
+ fail(
+ "ERROR: Unknown Incompatible Exception "
+ "representation:\n%r" % (rawexcinfo,),
+ pytrace=False,
+ )
+ except KeyboardInterrupt:
+ raise
+ except fail.Exception:
+ excinfo = _pytest._code.ExceptionInfo.from_current()
+ self.__dict__.setdefault("_excinfo", []).append(excinfo)
+
+ def addError(self, testcase, rawexcinfo):
+ self._addexcinfo(rawexcinfo)
+
+ def addFailure(self, testcase, rawexcinfo):
+ self._addexcinfo(rawexcinfo)
+
+ def addSkip(self, testcase, reason):
+ try:
+ skip(reason)
+ except skip.Exception:
+ self._skipped_by_mark = True
+ self._addexcinfo(sys.exc_info())
+
+ def addExpectedFailure(self, testcase, rawexcinfo, reason=""):
+ try:
+ xfail(str(reason))
+ except xfail.Exception:
+ self._addexcinfo(sys.exc_info())
+
+ def addUnexpectedSuccess(self, testcase, reason=""):
+ self._unexpectedsuccess = reason
+
+ def addSuccess(self, testcase):
+ pass
+
+ def stopTest(self, testcase):
+ pass
+
+ def _handle_skip(self):
+ # implements the skipping machinery (see #2137)
+ # analog to pythons Lib/unittest/case.py:run
+ testMethod = getattr(self._testcase, self._testcase._testMethodName)
+ if getattr(self._testcase.__class__, "__unittest_skip__", False) or getattr(
+ testMethod, "__unittest_skip__", False
+ ):
+ # If the class or method was skipped.
+ skip_why = getattr(
+ self._testcase.__class__, "__unittest_skip_why__", ""
+ ) or getattr(testMethod, "__unittest_skip_why__", "")
+ try: # PY3, unittest2 on PY2
+ self._testcase._addSkip(self, self._testcase, skip_why)
+ except TypeError: # PY2
+ if sys.version_info[0] != 2:
+ raise
+ self._testcase._addSkip(self, skip_why)
+ return True
+ return False
+
+ def runtest(self):
+ if self.config.pluginmanager.get_plugin("pdbinvoke") is None:
+ self._testcase(result=self)
+ else:
+ # disables tearDown and cleanups for post mortem debugging (see #1890)
+ if self._handle_skip():
+ return
+ self._testcase.debug()
+
+ def _prunetraceback(self, excinfo):
+ Function._prunetraceback(self, excinfo)
+ traceback = excinfo.traceback.filter(
+ lambda x: not x.frame.f_globals.get("__unittest")
+ )
+ if traceback:
+ excinfo.traceback = traceback
+
+
+@hookimpl(tryfirst=True)
+def pytest_runtest_makereport(item, call):
+ if isinstance(item, TestCaseFunction):
+ if item._excinfo:
+ call.excinfo = item._excinfo.pop(0)
+ try:
+ del call.result
+ except AttributeError:
+ pass
+
+
+# twisted trial support
+
+
+@hookimpl(hookwrapper=True)
+def pytest_runtest_protocol(item):
+ if isinstance(item, TestCaseFunction) and "twisted.trial.unittest" in sys.modules:
+ ut = sys.modules["twisted.python.failure"]
+ Failure__init__ = ut.Failure.__init__
+ check_testcase_implements_trial_reporter()
+
+ def excstore(
+ self, exc_value=None, exc_type=None, exc_tb=None, captureVars=None
+ ):
+ if exc_value is None:
+ self._rawexcinfo = sys.exc_info()
+ else:
+ if exc_type is None:
+ exc_type = type(exc_value)
+ self._rawexcinfo = (exc_type, exc_value, exc_tb)
+ try:
+ Failure__init__(
+ self, exc_value, exc_type, exc_tb, captureVars=captureVars
+ )
+ except TypeError:
+ Failure__init__(self, exc_value, exc_type, exc_tb)
+
+ ut.Failure.__init__ = excstore
+ yield
+ ut.Failure.__init__ = Failure__init__
+ else:
+ yield
+
+
+def check_testcase_implements_trial_reporter(done=[]):
+ if done:
+ return
+ from zope.interface import classImplements
+ from twisted.trial.itrial import IReporter
+
+ classImplements(TestCaseFunction, IReporter)
+ done.append(1)
diff --git a/contrib/python/pytest/py2/_pytest/warning_types.py b/contrib/python/pytest/py2/_pytest/warning_types.py
new file mode 100644
index 00000000000..861010a1275
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/warning_types.py
@@ -0,0 +1,112 @@
+# -*- coding: utf-8 -*-
+import attr
+
+
+class PytestWarning(UserWarning):
+ """
+ Bases: :class:`UserWarning`.
+
+ Base class for all warnings emitted by pytest.
+ """
+
+
+class PytestAssertRewriteWarning(PytestWarning):
+ """
+ Bases: :class:`PytestWarning`.
+
+ Warning emitted by the pytest assert rewrite module.
+ """
+
+
+class PytestCacheWarning(PytestWarning):
+ """
+ Bases: :class:`PytestWarning`.
+
+ Warning emitted by the cache plugin in various situations.
+ """
+
+
+class PytestConfigWarning(PytestWarning):
+ """
+ Bases: :class:`PytestWarning`.
+
+ Warning emitted for configuration issues.
+ """
+
+
+class PytestCollectionWarning(PytestWarning):
+ """
+ Bases: :class:`PytestWarning`.
+
+ Warning emitted when pytest is not able to collect a file or symbol in a module.
+ """
+
+
+class PytestDeprecationWarning(PytestWarning, DeprecationWarning):
+ """
+ Bases: :class:`pytest.PytestWarning`, :class:`DeprecationWarning`.
+
+ Warning class for features that will be removed in a future version.
+ """
+
+
+class PytestExperimentalApiWarning(PytestWarning, FutureWarning):
+ """
+ Bases: :class:`pytest.PytestWarning`, :class:`FutureWarning`.
+
+ Warning category used to denote experiments in pytest. Use sparingly as the API might change or even be
+ removed completely in future version
+ """
+
+ @classmethod
+ def simple(cls, apiname):
+ return cls(
+ "{apiname} is an experimental api that may change over time".format(
+ apiname=apiname
+ )
+ )
+
+
+class PytestUnhandledCoroutineWarning(PytestWarning):
+ """
+ Bases: :class:`PytestWarning`.
+
+ Warning emitted when pytest encounters a test function which is a coroutine,
+ but it was not handled by any async-aware plugin. Coroutine test functions
+ are not natively supported.
+ """
+
+
+class PytestUnknownMarkWarning(PytestWarning):
+ """
+ Bases: :class:`PytestWarning`.
+
+ Warning emitted on use of unknown markers.
+ See https://docs.pytest.org/en/latest/mark.html for details.
+ """
+
+
+class RemovedInPytest4Warning(PytestDeprecationWarning):
+ """
+ Bases: :class:`pytest.PytestDeprecationWarning`.
+
+ Warning class for features scheduled to be removed in pytest 4.0.
+ """
+
+
+@attr.s
+class UnformattedWarning(object):
+ """Used to hold warnings that need to format their message at runtime, as opposed to a direct message.
+
+ Using this class avoids to keep all the warning types and messages in this module, avoiding misuse.
+ """
+
+ category = attr.ib()
+ template = attr.ib()
+
+ def format(self, **kwargs):
+ """Returns an instance of the warning category, formatted with given kwargs"""
+ return self.category(self.template.format(**kwargs))
+
+
+PYTESTER_COPY_EXAMPLE = PytestExperimentalApiWarning.simple("testdir.copy_example")
diff --git a/contrib/python/pytest/py2/_pytest/warnings.py b/contrib/python/pytest/py2/_pytest/warnings.py
new file mode 100644
index 00000000000..a3debae462f
--- /dev/null
+++ b/contrib/python/pytest/py2/_pytest/warnings.py
@@ -0,0 +1,180 @@
+# -*- coding: utf-8 -*-
+from __future__ import absolute_import
+from __future__ import division
+from __future__ import print_function
+
+import sys
+import warnings
+from contextlib import contextmanager
+
+import pytest
+from _pytest import compat
+
+SHOW_PYTEST_WARNINGS_ARG = "-Walways::pytest.RemovedInPytest4Warning"
+
+
+def _setoption(wmod, arg):
+ """
+ Copy of the warning._setoption function but does not escape arguments.
+ """
+ parts = arg.split(":")
+ if len(parts) > 5:
+ raise wmod._OptionError("too many fields (max 5): %r" % (arg,))
+ while len(parts) < 5:
+ parts.append("")
+ action, message, category, module, lineno = [s.strip() for s in parts]
+ action = wmod._getaction(action)
+ category = wmod._getcategory(category)
+ if lineno:
+ try:
+ lineno = int(lineno)
+ if lineno < 0:
+ raise ValueError
+ except (ValueError, OverflowError):
+ raise wmod._OptionError("invalid lineno %r" % (lineno,))
+ else:
+ lineno = 0
+ wmod.filterwarnings(action, message, category, module, lineno)
+
+
+def pytest_addoption(parser):
+ group = parser.getgroup("pytest-warnings")
+ group.addoption(
+ "-W",
+ "--pythonwarnings",
+ action="append",
+ help="set which warnings to report, see -W option of python itself.",
+ )
+ parser.addini(
+ "filterwarnings",
+ type="linelist",
+ help="Each line specifies a pattern for "
+ "warnings.filterwarnings. "
+ "Processed after -W and --pythonwarnings.",
+ )
+
+
+def pytest_configure(config):
+ config.addinivalue_line(
+ "markers",
+ "filterwarnings(warning): add a warning filter to the given test. "
+ "see https://docs.pytest.org/en/latest/warnings.html#pytest-mark-filterwarnings ",
+ )
+
+
+@contextmanager
+def catch_warnings_for_item(config, ihook, when, item):
+ """
+ Context manager that catches warnings generated in the contained execution block.
+
+ ``item`` can be None if we are not in the context of an item execution.
+
+ Each warning captured triggers the ``pytest_warning_captured`` hook.
+ """
+ cmdline_filters = config.getoption("pythonwarnings") or []
+ inifilters = config.getini("filterwarnings")
+ with warnings.catch_warnings(record=True) as log:
+
+ if not sys.warnoptions:
+ # if user is not explicitly configuring warning filters, show deprecation warnings by default (#2908)
+ warnings.filterwarnings("always", category=DeprecationWarning)
+ warnings.filterwarnings("always", category=PendingDeprecationWarning)
+
+ warnings.filterwarnings("error", category=pytest.RemovedInPytest4Warning)
+
+ # filters should have this precedence: mark, cmdline options, ini
+ # filters should be applied in the inverse order of precedence
+ for arg in inifilters:
+ _setoption(warnings, arg)
+
+ for arg in cmdline_filters:
+ warnings._setoption(arg)
+
+ if item is not None:
+ for mark in item.iter_markers(name="filterwarnings"):
+ for arg in mark.args:
+ _setoption(warnings, arg)
+
+ yield
+
+ for warning_message in log:
+ ihook.pytest_warning_captured.call_historic(
+ kwargs=dict(warning_message=warning_message, when=when, item=item)
+ )
+
+
+def warning_record_to_str(warning_message):
+ """Convert a warnings.WarningMessage to a string.
+
+ This takes lot of unicode shenaningans into account for Python 2.
+ When Python 2 support is dropped this function can be greatly simplified.
+ """
+ warn_msg = warning_message.message
+ unicode_warning = False
+ if compat._PY2 and any(isinstance(m, compat.UNICODE_TYPES) for m in warn_msg.args):
+ new_args = []
+ for m in warn_msg.args:
+ new_args.append(
+ compat.ascii_escaped(m) if isinstance(m, compat.UNICODE_TYPES) else m
+ )
+ unicode_warning = list(warn_msg.args) != new_args
+ warn_msg.args = new_args
+
+ msg = warnings.formatwarning(
+ warn_msg,
+ warning_message.category,
+ warning_message.filename,
+ warning_message.lineno,
+ warning_message.line,
+ )
+ if unicode_warning:
+ warnings.warn(
+ "Warning is using unicode non convertible to ascii, "
+ "converting to a safe representation:\n {!r}".format(compat.safe_str(msg)),
+ UnicodeWarning,
+ )
+ return msg
+
+
+@pytest.hookimpl(hookwrapper=True, tryfirst=True)
+def pytest_runtest_protocol(item):
+ with catch_warnings_for_item(
+ config=item.config, ihook=item.ihook, when="runtest", item=item
+ ):
+ yield
+
+
+@pytest.hookimpl(hookwrapper=True, tryfirst=True)
+def pytest_collection(session):
+ config = session.config
+ with catch_warnings_for_item(
+ config=config, ihook=config.hook, when="collect", item=None
+ ):
+ yield
+
+
+@pytest.hookimpl(hookwrapper=True)
+def pytest_terminal_summary(terminalreporter):
+ config = terminalreporter.config
+ with catch_warnings_for_item(
+ config=config, ihook=config.hook, when="config", item=None
+ ):
+ yield
+
+
+def _issue_warning_captured(warning, hook, stacklevel):
+ """
+ This function should be used instead of calling ``warnings.warn`` directly when we are in the "configure" stage:
+ at this point the actual options might not have been set, so we manually trigger the pytest_warning_captured
+ hook so we can display this warnings in the terminal. This is a hack until we can sort out #2891.
+
+ :param warning: the warning instance.
+ :param hook: the hook caller
+ :param stacklevel: stacklevel forwarded to warnings.warn
+ """
+ with warnings.catch_warnings(record=True) as records:
+ warnings.simplefilter("always", type(warning))
+ warnings.warn(warning, stacklevel=stacklevel)
+ hook.pytest_warning_captured.call_historic(
+ kwargs=dict(warning_message=records[0], when="config", item=None)
+ )
diff --git a/contrib/python/pytest/py2/patches/01-disable-warnings.patch b/contrib/python/pytest/py2/patches/01-disable-warnings.patch
new file mode 100644
index 00000000000..b556f43bc73
--- /dev/null
+++ b/contrib/python/pytest/py2/patches/01-disable-warnings.patch
@@ -0,0 +1,12 @@
+--- contrib/python/pytest/py2/_pytest/assertion/rewrite.py (index)
++++ contrib/python/pytest/py2/_pytest/assertion/rewrite.py (working tree)
+@@ -4,6 +4,9 @@ from __future__ import absolute_import
+ from __future__ import division
+ from __future__ import print_function
+
++import warnings
++warnings.filterwarnings("ignore", category=DeprecationWarning, module="_pytest.assertion.rewrite")
++
+ import ast
+ import errno
+ import imp
diff --git a/contrib/python/pytest/py2/patches/03-limit-id.patch b/contrib/python/pytest/py2/patches/03-limit-id.patch
new file mode 100644
index 00000000000..5389c9290e5
--- /dev/null
+++ b/contrib/python/pytest/py2/patches/03-limit-id.patch
@@ -0,0 +1,36 @@
+--- contrib/python/pytest/py2/_pytest/python.py (index)
++++ contrib/python/pytest/py2/_pytest/python.py (working tree)
+@@ -1204,6 +1204,33 @@ def _idval(val, argname, idx, idfn, item, config):
+ return str(argname) + str(idx)
+
+
++def limit_idval(limit):
++ import functools
++
++ names = {}
++ limit -= 6
++ assert limit > 0
++
++ def decorator(func):
++ @functools.wraps(func)
++ def wrapper(*args, **kw):
++ idval = func(*args, **kw)
++ if len(idval) > limit:
++ prefix = idval[:limit]
++ # There might be same prefix for the different test cases - take item into account
++ name = "{}-{}".format(kw.get('item', ''), prefix)
++ idx = names.setdefault(name, -1) + 1
++ names[name] = idx
++ idval = "{}-{}".format(prefix, idx)
++ return idval
++
++ return wrapper
++
++ return decorator
++
++
++# XXX limit testnames in the name of sanity and readability
++@limit_idval(limit=500)
+ def _idvalset(idx, parameterset, argnames, idfn, ids, item, config):
+ if parameterset.id is not None:
+ return parameterset.id
diff --git a/contrib/python/pytest/py2/patches/04-fix-id-encoding.patch b/contrib/python/pytest/py2/patches/04-fix-id-encoding.patch
new file mode 100644
index 00000000000..e70af52d191
--- /dev/null
+++ b/contrib/python/pytest/py2/patches/04-fix-id-encoding.patch
@@ -0,0 +1,57 @@
+--- contrib/python/pytest/py2/_pytest/compat.py (index)
++++ contrib/python/pytest/py2/_pytest/compat.py (working tree)
+@@ -378,7 +378,10 @@ if _PY3:
+
+ def safe_str(v):
+ """returns v as string"""
+- return str(v)
++ try:
++ return str(v)
++ except UnicodeEncodeError:
++ return str(v, encoding="utf-8")
+
+
+ else:
+--- contrib/python/pytest/py2/_pytest/python.py (index)
++++ contrib/python/pytest/py2/_pytest/python.py (working tree)
+@@ -896,7 +896,7 @@ class CallSpec2(object):
+
+ @property
+ def id(self):
+- return "-".join(map(str, filter(None, self._idlist)))
++ return "-".join(map(safe_str, filter(None, self._idlist)))
+
+ def setmulti2(self, valtypes, argnames, valset, id, marks, scopenum, param_index):
+ for arg, val in zip(argnames, valset):
+@@ -1218,10 +1218,10 @@ def limit_idval(limit):
+ if len(idval) > limit:
+ prefix = idval[:limit]
+ # There might be same prefix for the different test cases - take item into account
+- name = "{}-{}".format(kw.get('item', ''), prefix)
++ name = "{}-{}".format(kw.get('item', ''), safe_str(prefix))
+ idx = names.setdefault(name, -1) + 1
+ names[name] = idx
+- idval = "{}-{}".format(prefix, idx)
++ idval = "{}-{}".format(safe_str(prefix), idx)
+ return idval
+
+ return wrapper
+--- contrib/python/pytest/py2/_pytest/runner.py (index)
++++ contrib/python/pytest/py2/_pytest/runner.py (working tree)
+@@ -16,6 +16,7 @@ from .reports import CollectErrorRepr
+ from .reports import CollectReport
+ from .reports import TestReport
+ from _pytest._code.code import ExceptionInfo
++from _pytest.compat import safe_str
+ from _pytest.outcomes import Exit
+ from _pytest.outcomes import Skipped
+ from _pytest.outcomes import TEST_OUTCOME
+@@ -241,7 +242,7 @@ class CallInfo(object):
+ value = repr(self._result)
+ status = "result"
+ return "<CallInfo when={when!r} {status}: {value}>".format(
+- when=self.when, value=value, status=status
++ when=self.when, value=safe_str(value), status=status
+ )
+
+
diff --git a/contrib/python/pytest/py2/patches/04-support-cyrillic-id.patch b/contrib/python/pytest/py2/patches/04-support-cyrillic-id.patch
new file mode 100644
index 00000000000..26242ff9704
--- /dev/null
+++ b/contrib/python/pytest/py2/patches/04-support-cyrillic-id.patch
@@ -0,0 +1,26 @@
+--- contrib/python/pytest/py2/_pytest/compat.py (index)
++++ contrib/python/pytest/py2/_pytest/compat.py (working tree)
+@@ -243,7 +243,7 @@ if _PY3:
+ if isinstance(val, bytes):
+ ret = _bytes_to_ascii(val)
+ else:
+- ret = val.encode("unicode_escape").decode("ascii")
++ ret = val
+ return _translate_non_printable(ret)
+
+
+@@ -262,11 +262,11 @@ else:
+ """
+ if isinstance(val, bytes):
+ try:
+- ret = val.decode("ascii")
++ ret = val.decode("utf-8")
+ except UnicodeDecodeError:
+- ret = val.encode("string-escape").decode("ascii")
++ ret = val.decode("utf-8", "ignore")
+ else:
+- ret = val.encode("unicode-escape").decode("ascii")
++ ret = val.encode("utf-8", "replace").decode("utf-8")
+ return _translate_non_printable(ret)
+
+
diff --git a/contrib/python/pytest/py2/patches/05-support-readline.patch b/contrib/python/pytest/py2/patches/05-support-readline.patch
new file mode 100644
index 00000000000..51c6ee2bf46
--- /dev/null
+++ b/contrib/python/pytest/py2/patches/05-support-readline.patch
@@ -0,0 +1,69 @@
+--- contrib/python/pytest/py2/_pytest/debugging.py (index)
++++ contrib/python/pytest/py2/_pytest/debugging.py (working tree)
+@@ -4,6 +4,7 @@ from __future__ import absolute_import
+ from __future__ import division
+ from __future__ import print_function
+
++import os
+ import argparse
+ import pdb
+ import sys
+@@ -14,6 +15,42 @@ from _pytest import outcomes
+ from _pytest.config.exceptions import UsageError
+
+
++def import_readline():
++ try:
++ import readline
++ except ImportError:
++ sys.path.append('/usr/lib/python2.7/lib-dynload')
++
++ try:
++ import readline
++ except ImportError as e:
++ print('can not import readline:', e)
++
++ import subprocess
++ try:
++ subprocess.check_call('stty icrnl'.split())
++ except OSError as e:
++ print('can not restore Enter, use Control+J:', e)
++
++
++def tty():
++ if os.isatty(1):
++ return
++
++ fd = os.open('/dev/tty', os.O_RDWR)
++ os.dup2(fd, 0)
++ os.dup2(fd, 1)
++ os.dup2(fd, 2)
++ os.close(fd)
++
++ old_sys_path = sys.path
++ sys.path = list(sys.path)
++ try:
++ import_readline()
++ finally:
++ sys.path = old_sys_path
++
++
+ def _validate_usepdb_cls(value):
+ """Validate syntax of --pdbcls option."""
+ try:
+@@ -249,6 +286,7 @@ class pytestPDB(object):
+ @classmethod
+ def set_trace(cls, *args, **kwargs):
+ """Invoke debugging via ``Pdb.set_trace``, dropping any IO capturing."""
++ tty()
+ frame = sys._getframe().f_back
+ _pdb = cls._init_pdb("set_trace", *args, **kwargs)
+ _pdb.set_trace(frame)
+@@ -262,6 +300,7 @@ class PdbInvoke(object):
+ out, err = capman.read_global_capture()
+ sys.stdout.write(out)
+ sys.stdout.write(err)
++ tty()
+ _enter_pdb(node, call.excinfo, report)
+
+ def pytest_internalerror(self, excrepr, excinfo):
diff --git a/contrib/python/pytest/py2/patches/06-support-ya-markers.patch b/contrib/python/pytest/py2/patches/06-support-ya-markers.patch
new file mode 100644
index 00000000000..6dae352ef8b
--- /dev/null
+++ b/contrib/python/pytest/py2/patches/06-support-ya-markers.patch
@@ -0,0 +1,14 @@
+--- contrib/python/pytest/py2/_pytest/mark/structures.py (index)
++++ contrib/python/pytest/py2/_pytest/mark/structures.py (working tree)
+@@ -316,7 +316,10 @@ class MarkGenerator(object):
+ # example lines: "skipif(condition): skip the given test if..."
+ # or "hypothesis: tests which use Hypothesis", so to get the
+ # marker name we split on both `:` and `(`.
+- marker = line.split(":")[0].split("(")[0].strip()
++ if line == "ya:external":
++ marker = line
++ else:
++ marker = line.split(":")[0].split("(")[0].strip()
+ self._markers.add(marker)
+
+ # If the name is not in the set of known marks after updating,
diff --git a/contrib/python/pytest/py2/patches/07-disable-translate-non-printable.patch b/contrib/python/pytest/py2/patches/07-disable-translate-non-printable.patch
new file mode 100644
index 00000000000..beed7a0aeb7
--- /dev/null
+++ b/contrib/python/pytest/py2/patches/07-disable-translate-non-printable.patch
@@ -0,0 +1,20 @@
+--- contrib/python/pytest/py2/_pytest/compat.py (index)
++++ contrib/python/pytest/py2/_pytest/compat.py (working tree)
+@@ -244,7 +244,7 @@ if _PY3:
+ ret = _bytes_to_ascii(val)
+ else:
+ ret = val
+- return _translate_non_printable(ret)
++ return ret
+
+
+ else:
+@@ -267,7 +267,7 @@ else:
+ ret = val.decode("utf-8", "ignore")
+ else:
+ ret = val.encode("utf-8", "replace").decode("utf-8")
+- return _translate_non_printable(ret)
++ return ret
+
+
+ class _PytestWrapper(object):
diff --git a/contrib/python/pytest/py2/patches/08-backport-pr-6607.patch b/contrib/python/pytest/py2/patches/08-backport-pr-6607.patch
new file mode 100644
index 00000000000..8d0ae7a5fbf
--- /dev/null
+++ b/contrib/python/pytest/py2/patches/08-backport-pr-6607.patch
@@ -0,0 +1,17 @@
+commit 46b46cea857997531a7b9b4de32556be50bd5aea (HEAD -> pytest-backport-pr-6607)
+author: danila-eremin
+date: 2022-01-22T16:55:07+03:00
+
+ backport py2
+
+--- contrib/python/pytest/py2/_pytest/python.py (b87553999455f0084413c5b59139aa9ccb5e3f52)
++++ contrib/python/pytest/py2/_pytest/python.py (46b46cea857997531a7b9b4de32556be50bd5aea)
+@@ -896,7 +896,7 @@ class CallSpec2(object):
+
+ @property
+ def id(self):
+- return "-".join(map(safe_str, filter(None, self._idlist)))
++ return "-".join(map(safe_str, self._idlist))
+
+ def setmulti2(self, valtypes, argnames, valset, id, marks, scopenum, param_index):
+ for arg, val in zip(argnames, valset):
diff --git a/contrib/python/pytest/py2/pytest.py b/contrib/python/pytest/py2/pytest.py
new file mode 100644
index 00000000000..ccc77b476f5
--- /dev/null
+++ b/contrib/python/pytest/py2/pytest.py
@@ -0,0 +1,107 @@
+# -*- coding: utf-8 -*-
+# PYTHON_ARGCOMPLETE_OK
+"""
+pytest: unit and functional testing with Python.
+"""
+# else we are imported
+from _pytest import __version__
+from _pytest.assertion import register_assert_rewrite
+from _pytest.config import cmdline
+from _pytest.config import hookimpl
+from _pytest.config import hookspec
+from _pytest.config import main
+from _pytest.config import UsageError
+from _pytest.debugging import pytestPDB as __pytestPDB
+from _pytest.fixtures import fillfixtures as _fillfuncargs
+from _pytest.fixtures import fixture
+from _pytest.fixtures import yield_fixture
+from _pytest.freeze_support import freeze_includes
+from _pytest.main import Session
+from _pytest.mark import MARK_GEN as mark
+from _pytest.mark import param
+from _pytest.nodes import Collector
+from _pytest.nodes import File
+from _pytest.nodes import Item
+from _pytest.outcomes import exit
+from _pytest.outcomes import fail
+from _pytest.outcomes import importorskip
+from _pytest.outcomes import skip
+from _pytest.outcomes import xfail
+from _pytest.python import Class
+from _pytest.python import Function
+from _pytest.python import Instance
+from _pytest.python import Module
+from _pytest.python import Package
+from _pytest.python_api import approx
+from _pytest.python_api import raises
+from _pytest.recwarn import deprecated_call
+from _pytest.recwarn import warns
+from _pytest.warning_types import PytestAssertRewriteWarning
+from _pytest.warning_types import PytestCacheWarning
+from _pytest.warning_types import PytestCollectionWarning
+from _pytest.warning_types import PytestConfigWarning
+from _pytest.warning_types import PytestDeprecationWarning
+from _pytest.warning_types import PytestExperimentalApiWarning
+from _pytest.warning_types import PytestUnhandledCoroutineWarning
+from _pytest.warning_types import PytestUnknownMarkWarning
+from _pytest.warning_types import PytestWarning
+from _pytest.warning_types import RemovedInPytest4Warning
+
+set_trace = __pytestPDB.set_trace
+
+__all__ = [
+ "__version__",
+ "_fillfuncargs",
+ "approx",
+ "Class",
+ "cmdline",
+ "Collector",
+ "deprecated_call",
+ "exit",
+ "fail",
+ "File",
+ "fixture",
+ "freeze_includes",
+ "Function",
+ "hookimpl",
+ "hookspec",
+ "importorskip",
+ "Instance",
+ "Item",
+ "main",
+ "mark",
+ "Module",
+ "Package",
+ "param",
+ "PytestAssertRewriteWarning",
+ "PytestCacheWarning",
+ "PytestCollectionWarning",
+ "PytestConfigWarning",
+ "PytestDeprecationWarning",
+ "PytestExperimentalApiWarning",
+ "PytestUnhandledCoroutineWarning",
+ "PytestUnknownMarkWarning",
+ "PytestWarning",
+ "raises",
+ "register_assert_rewrite",
+ "RemovedInPytest4Warning",
+ "Session",
+ "set_trace",
+ "skip",
+ "UsageError",
+ "warns",
+ "xfail",
+ "yield_fixture",
+]
+
+if __name__ == "__main__":
+ # if run as a script or by 'python -m pytest'
+ # we trigger the below "else" condition by the following import
+ import pytest
+
+ raise SystemExit(pytest.main())
+else:
+
+ from _pytest.compat import _setup_collect_fakemodule
+
+ _setup_collect_fakemodule()
diff --git a/contrib/python/pytest/py2/ya.make b/contrib/python/pytest/py2/ya.make
new file mode 100644
index 00000000000..4a4214535ca
--- /dev/null
+++ b/contrib/python/pytest/py2/ya.make
@@ -0,0 +1,100 @@
+# Generated by devtools/yamaker (pypi).
+
+PY2_LIBRARY()
+
+OWNER(dmitko g:python-contrib)
+
+VERSION(4.6.11)
+
+LICENSE(MIT)
+
+PEERDIR(
+ contrib/python/atomicwrites
+ contrib/python/attrs
+ contrib/python/funcsigs
+ contrib/python/importlib-metadata
+ contrib/python/more-itertools
+ contrib/python/packaging
+ contrib/python/pathlib2
+ contrib/python/pluggy
+ contrib/python/py
+ contrib/python/six
+ contrib/python/wcwidth
+)
+
+NO_LINT()
+
+NO_CHECK_IMPORTS(
+ __tests__.* # all test modules get imported when tests are run
+ _pytest.*
+)
+
+PY_SRCS(
+ TOP_LEVEL
+ _pytest/__init__.py
+ _pytest/_argcomplete.py
+ _pytest/_code/__init__.py
+ _pytest/_code/_py2traceback.py
+ _pytest/_code/code.py
+ _pytest/_code/source.py
+ _pytest/_io/__init__.py
+ _pytest/_io/saferepr.py
+ _pytest/_version.py
+ _pytest/assertion/__init__.py
+ _pytest/assertion/rewrite.py
+ _pytest/assertion/truncate.py
+ _pytest/assertion/util.py
+ _pytest/cacheprovider.py
+ _pytest/capture.py
+ _pytest/compat.py
+ _pytest/config/__init__.py
+ _pytest/config/argparsing.py
+ _pytest/config/exceptions.py
+ _pytest/config/findpaths.py
+ _pytest/debugging.py
+ _pytest/deprecated.py
+ _pytest/doctest.py
+ _pytest/fixtures.py
+ _pytest/freeze_support.py
+ _pytest/helpconfig.py
+ _pytest/hookspec.py
+ _pytest/junitxml.py
+ _pytest/logging.py
+ _pytest/main.py
+ _pytest/mark/__init__.py
+ _pytest/mark/evaluate.py
+ _pytest/mark/legacy.py
+ _pytest/mark/structures.py
+ _pytest/monkeypatch.py
+ _pytest/nodes.py
+ _pytest/nose.py
+ _pytest/outcomes.py
+ _pytest/pastebin.py
+ _pytest/pathlib.py
+ _pytest/pytester.py
+ _pytest/python.py
+ _pytest/python_api.py
+ _pytest/recwarn.py
+ _pytest/reports.py
+ _pytest/resultlog.py
+ _pytest/runner.py
+ _pytest/setuponly.py
+ _pytest/setupplan.py
+ _pytest/skipping.py
+ _pytest/stepwise.py
+ _pytest/terminal.py
+ _pytest/tmpdir.py
+ _pytest/unittest.py
+ _pytest/warning_types.py
+ _pytest/warnings.py
+ pytest.py
+)
+
+RESOURCE_FILES(
+ PREFIX contrib/python/pytest/py2/
+ .dist-info/METADATA
+ .dist-info/entry_points.txt
+ .dist-info/top_level.txt
+)
+
+END()